| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Hmga1
|
ENSMUSG00000046711.9 | high mobility group AT-hook 1 |
| CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|---|---|
| chr17_27555997_27556169 | Hmga1 | 414 | 0.416063 | -0.80 | 5.7e-02 | Click! |
| chr17_27556540_27556709 | Hmga1 | 8 | 0.578558 | -0.60 | 2.1e-01 | Click! |
| chr17_27557519_27557704 | Hmga1 | 916 | 0.277409 | -0.58 | 2.3e-01 | Click! |
| chr17_27557805_27557956 | Hmga1 | 1185 | 0.218069 | -0.48 | 3.3e-01 | Click! |
| chr17_27556354_27556505 | Hmga1 | 68 | 0.509672 | -0.36 | 4.8e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr1_50806813_50807031 | 3.01 |
Gm28321 |
predicted gene 28321 |
8453 |
0.28 |
| chr6_149225033_149225369 | 2.69 |
1700003I16Rik |
RIKEN cDNA 1700003I16 gene |
10016 |
0.16 |
| chr1_21250942_21251436 | 2.43 |
Gsta3 |
glutathione S-transferase, alpha 3 |
2332 |
0.18 |
| chr4_76962419_76962593 | 2.17 |
Gm23159 |
predicted gene, 23159 |
4008 |
0.29 |
| chr14_103463834_103464050 | 2.09 |
Gm34907 |
predicted gene, 34907 |
23 |
0.98 |
| chr11_5905326_5905477 | 2.00 |
Gck |
glucokinase |
3314 |
0.14 |
| chr9_44083899_44084207 | 1.99 |
Usp2 |
ubiquitin specific peptidase 2 |
886 |
0.32 |
| chr4_47366562_47366857 | 1.99 |
Tgfbr1 |
transforming growth factor, beta receptor I |
13099 |
0.22 |
| chr11_32266960_32267196 | 1.97 |
Nprl3 |
nitrogen permease regulator-like 3 |
469 |
0.68 |
| chr3_118660717_118660868 | 1.94 |
Dpyd |
dihydropyrimidine dehydrogenase |
98606 |
0.07 |
| chr4_76963069_76963220 | 1.89 |
Gm23159 |
predicted gene, 23159 |
4646 |
0.28 |
| chr9_122848915_122849207 | 1.84 |
Gm47140 |
predicted gene, 47140 |
643 |
0.55 |
| chr11_28695418_28695578 | 1.83 |
2810471M01Rik |
RIKEN cDNA 2810471M01 gene |
13934 |
0.17 |
| chr17_46439501_46439689 | 1.79 |
Gm5093 |
predicted gene 5093 |
502 |
0.57 |
| chr13_4270711_4270899 | 1.68 |
Akr1c12 |
aldo-keto reductase family 1, member C12 |
8628 |
0.15 |
| chr11_67229794_67229959 | 1.65 |
Myhas |
myosin heavy chain gene antisense RNA |
1134 |
0.4 |
| chr9_74882325_74882476 | 1.63 |
Onecut1 |
one cut domain, family member 1 |
15916 |
0.15 |
| chr11_16768516_16768667 | 1.60 |
Egfr |
epidermal growth factor receptor |
16361 |
0.19 |
| chr11_38774641_38774792 | 1.59 |
Gm23520 |
predicted gene, 23520 |
23561 |
0.29 |
| chr1_21264707_21265188 | 1.58 |
Gm28836 |
predicted gene 28836 |
6646 |
0.11 |
| chr6_50587768_50588064 | 1.57 |
4921507P07Rik |
RIKEN cDNA 4921507P07 gene |
8716 |
0.09 |
| chr1_162891903_162892071 | 1.54 |
Fmo2 |
flavin containing monooxygenase 2 |
5472 |
0.19 |
| chr9_106245058_106245282 | 1.51 |
Alas1 |
aminolevulinic acid synthase 1 |
1536 |
0.23 |
| chr3_97637473_97637939 | 1.50 |
Fmo5 |
flavin containing monooxygenase 5 |
8823 |
0.13 |
| chr3_144109828_144110050 | 1.47 |
Gm34078 |
predicted gene, 34078 |
25815 |
0.2 |
| chr19_40146515_40146666 | 1.46 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
40696 |
0.11 |
| chr13_107645708_107645859 | 1.46 |
Gm32090 |
predicted gene, 32090 |
32934 |
0.17 |
| chr3_89149636_89149787 | 1.45 |
Hcn3 |
hyperpolarization-activated, cyclic nucleotide-gated K+ 3 |
1503 |
0.17 |
| chr14_37885502_37885724 | 1.45 |
Gm5204 |
predicted gene 5204 |
27085 |
0.25 |
| chr19_40153747_40153898 | 1.45 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
33464 |
0.13 |
| chr3_18463182_18463725 | 1.44 |
Gm30667 |
predicted gene, 30667 |
2199 |
0.33 |
| chr11_16828832_16828991 | 1.44 |
Egfros |
epidermal growth factor receptor, opposite strand |
1791 |
0.4 |
| chr6_37542487_37542638 | 1.44 |
Gm7463 |
predicted gene 7463 |
1148 |
0.52 |
| chr19_12613616_12613767 | 1.44 |
Gm4952 |
predicted gene 4952 |
13675 |
0.09 |
| chr3_18133555_18133706 | 1.44 |
Gm23686 |
predicted gene, 23686 |
43995 |
0.14 |
| chr11_7816093_7816451 | 1.42 |
Gm27393 |
predicted gene, 27393 |
70233 |
0.13 |
| chr1_67138759_67139000 | 1.41 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
15853 |
0.23 |
| chr9_122056238_122056617 | 1.41 |
Gm39465 |
predicted gene, 39465 |
4964 |
0.13 |
| chr18_33352007_33352191 | 1.39 |
Gm5503 |
predicted gene 5503 |
32856 |
0.21 |
| chr16_25221904_25222082 | 1.38 |
Tprg |
transformation related protein 63 regulated |
64824 |
0.14 |
| chr6_21822757_21822949 | 1.38 |
Tspan12 |
tetraspanin 12 |
28975 |
0.16 |
| chr9_55541381_55541949 | 1.36 |
Isl2 |
insulin related protein 2 (islet 2) |
458 |
0.61 |
| chr19_40090765_40090926 | 1.33 |
Cyp2c50 |
cytochrome P450, family 2, subfamily c, polypeptide 50 |
1110 |
0.51 |
| chr4_35533897_35534048 | 1.33 |
Gm12365 |
predicted gene 12365 |
97758 |
0.08 |
| chr2_130819555_130819828 | 1.32 |
4930402H24Rik |
RIKEN cDNA 4930402H24 gene |
5399 |
0.18 |
| chr4_25454527_25454678 | 1.32 |
Gm11894 |
predicted gene 11894 |
35253 |
0.15 |
| chr10_87051307_87051578 | 1.31 |
1700113H08Rik |
RIKEN cDNA 1700113H08 gene |
6603 |
0.2 |
| chr1_67233878_67234117 | 1.31 |
Gm15668 |
predicted gene 15668 |
15203 |
0.21 |
| chr7_97415349_97415810 | 1.31 |
Thrsp |
thyroid hormone responsive |
1940 |
0.23 |
| chr1_50806470_50806812 | 1.30 |
Gm28321 |
predicted gene 28321 |
8734 |
0.28 |
| chr3_117078471_117078622 | 1.30 |
1700061I17Rik |
RIKEN cDNA 1700061I17 gene |
781 |
0.64 |
| chr1_80427820_80427971 | 1.29 |
1700016L21Rik |
RIKEN cDNA 1700016L21 gene |
18037 |
0.15 |
| chr1_21260733_21261242 | 1.29 |
Gsta3 |
glutathione S-transferase, alpha 3 |
7466 |
0.11 |
| chr11_16823947_16824154 | 1.29 |
Egfros |
epidermal growth factor receptor, opposite strand |
6652 |
0.23 |
| chr9_74884431_74884582 | 1.28 |
Onecut1 |
one cut domain, family member 1 |
18022 |
0.15 |
| chr1_67208435_67208586 | 1.27 |
Gm15668 |
predicted gene 15668 |
40690 |
0.16 |
| chr19_12720308_12720459 | 1.27 |
Gm15962 |
predicted gene 15962 |
820 |
0.46 |
| chr13_31808871_31809301 | 1.27 |
Foxc1 |
forkhead box C1 |
2453 |
0.26 |
| chr2_67898259_67898744 | 1.27 |
Gm37964 |
predicted gene, 37964 |
95 |
0.98 |
| chr12_104343910_104344587 | 1.27 |
Serpina3k |
serine (or cysteine) peptidase inhibitor, clade A, member 3K |
5762 |
0.12 |
| chr5_130227356_130227532 | 1.26 |
Gm42467 |
predicted gene 42467 |
1228 |
0.28 |
| chrX_68717266_68717440 | 1.25 |
Fmr1 |
fragile X mental retardation 1 |
5502 |
0.2 |
| chr8_76147308_76147459 | 1.24 |
Gm45742 |
predicted gene 45742 |
30356 |
0.21 |
| chr11_28696545_28697113 | 1.24 |
2810471M01Rik |
RIKEN cDNA 2810471M01 gene |
15265 |
0.17 |
| chr1_41559831_41559986 | 1.22 |
Gm28634 |
predicted gene 28634 |
30365 |
0.26 |
| chrX_15254619_15254770 | 1.22 |
Gm14519 |
predicted gene 14519 |
110485 |
0.07 |
| chr8_109571236_109571470 | 1.22 |
Txnl4b |
thioredoxin-like 4B |
2465 |
0.2 |
| chr15_56418349_56418502 | 1.22 |
Gm49213 |
predicted gene, 49213 |
3412 |
0.38 |
| chr13_48533860_48534011 | 1.21 |
Mirlet7d |
microRNA let7d |
2179 |
0.14 |
| chr10_110717608_110717759 | 1.21 |
E2f7 |
E2F transcription factor 7 |
27756 |
0.19 |
| chr11_16854254_16854692 | 1.21 |
Egfr |
epidermal growth factor receptor |
23677 |
0.17 |
| chr9_9180190_9180363 | 1.19 |
Gm16833 |
predicted gene, 16833 |
56012 |
0.14 |
| chr19_40185193_40185344 | 1.17 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
2018 |
0.27 |
| chr9_74894074_74894225 | 1.17 |
Onecut1 |
one cut domain, family member 1 |
27665 |
0.13 |
| chr1_127735231_127735422 | 1.17 |
Acmsd |
amino carboxymuconate semialdehyde decarboxylase |
5913 |
0.2 |
| chr11_50312282_50312433 | 1.17 |
Canx |
calnexin |
11367 |
0.12 |
| chr17_32935826_32936018 | 1.17 |
Cyp4f13 |
cytochrome P450, family 4, subfamily f, polypeptide 13 |
4914 |
0.11 |
| chr2_117026913_117027140 | 1.16 |
Gm13981 |
predicted gene 13981 |
28540 |
0.17 |
| chr10_23781900_23782191 | 1.16 |
Snora33 |
small nucleolar RNA, H/ACA box 33 |
3430 |
0.14 |
| chr9_74893395_74893777 | 1.16 |
Onecut1 |
one cut domain, family member 1 |
27102 |
0.13 |
| chr4_102512520_102512765 | 1.16 |
Pde4b |
phosphodiesterase 4B, cAMP specific |
42245 |
0.21 |
| chr12_57537784_57538085 | 1.15 |
Foxa1 |
forkhead box A1 |
8187 |
0.15 |
| chr7_114418385_114418663 | 1.15 |
Pde3b |
phosphodiesterase 3B, cGMP-inhibited |
3243 |
0.26 |
| chr5_86919547_86919811 | 1.14 |
Gm25211 |
predicted gene, 25211 |
3357 |
0.13 |
| chr1_107939441_107939624 | 1.14 |
D830032E09Rik |
RIKEN cDNA D830032E09 gene |
2823 |
0.25 |
| chr15_22127008_22127164 | 1.14 |
Gm27525 |
predicted gene, 27525 |
146984 |
0.05 |
| chr2_39216382_39216533 | 1.14 |
Gm13511 |
predicted gene 13511 |
837 |
0.49 |
| chr19_37077879_37078030 | 1.14 |
Gm22714 |
predicted gene, 22714 |
71208 |
0.08 |
| chr5_92715143_92715334 | 1.13 |
Gm20500 |
predicted gene 20500 |
20967 |
0.16 |
| chr13_102570134_102570306 | 1.13 |
Gm29927 |
predicted gene, 29927 |
20065 |
0.22 |
| chrX_140591571_140591781 | 1.13 |
AL683809.1 |
TSC22 domain family, member 3 (Tsc22d3), pseuodgene |
8077 |
0.17 |
| chr4_121164131_121164282 | 1.12 |
Rlf |
rearranged L-myc fusion sequence |
24328 |
0.11 |
| chr1_67217690_67217947 | 1.12 |
Gm15668 |
predicted gene 15668 |
31382 |
0.18 |
| chr12_104346326_104346873 | 1.12 |
Serpina3k |
serine (or cysteine) peptidase inhibitor, clade A, member 3K |
8113 |
0.12 |
| chr3_18164477_18164836 | 1.12 |
Gm23686 |
predicted gene, 23686 |
12969 |
0.23 |
| chr19_40160205_40160356 | 1.11 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
27006 |
0.14 |
| chr11_16836119_16836554 | 1.11 |
Egfros |
epidermal growth factor receptor, opposite strand |
5634 |
0.23 |
| chr9_24502048_24502199 | 1.11 |
Dpy19l1 |
dpy-19-like 1 (C. elegans) |
1017 |
0.45 |
| chr3_129578610_129578761 | 1.11 |
Elovl6 |
ELOVL family member 6, elongation of long chain fatty acids (yeast) |
26305 |
0.15 |
| chr19_40181161_40181312 | 1.10 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
6050 |
0.17 |
| chr13_28877494_28877645 | 1.10 |
2610307P16Rik |
RIKEN cDNA 2610307P16 gene |
5887 |
0.2 |
| chr2_17297221_17297404 | 1.09 |
Nebl |
nebulette |
63774 |
0.13 |
| chr5_51162183_51162334 | 1.09 |
Gm44377 |
predicted gene, 44377 |
61416 |
0.14 |
| chr8_40271825_40271984 | 1.09 |
Fgf20 |
fibroblast growth factor 20 |
15049 |
0.2 |
| chr4_41331357_41331705 | 1.08 |
Gm26084 |
predicted gene, 26084 |
14420 |
0.1 |
| chr9_122148667_122148818 | 1.08 |
Gm47121 |
predicted gene, 47121 |
6293 |
0.13 |
| chr5_24800499_24800655 | 1.08 |
Rheb |
Ras homolog enriched in brain |
13382 |
0.15 |
| chr15_42296635_42296795 | 1.08 |
Gm49452 |
predicted gene, 49452 |
23631 |
0.17 |
| chr10_69226215_69226525 | 1.08 |
Rhobtb1 |
Rho-related BTB domain containing 1 |
6985 |
0.2 |
| chr13_9762543_9762762 | 1.07 |
Zmynd11 |
zinc finger, MYND domain containing 11 |
1698 |
0.3 |
| chr7_121802332_121802546 | 1.07 |
Gm44740 |
predicted gene 44740 |
36626 |
0.13 |
| chr7_19017968_19018166 | 1.07 |
Foxa3 |
forkhead box A3 |
5471 |
0.08 |
| chr9_74881023_74881569 | 1.07 |
Onecut1 |
one cut domain, family member 1 |
14812 |
0.15 |
| chr4_8244613_8244770 | 1.06 |
Car8 |
carbonic anhydrase 8 |
5650 |
0.24 |
| chr5_8686364_8686515 | 1.06 |
Gm42684 |
predicted gene 42684 |
16919 |
0.16 |
| chr6_35516304_35516455 | 1.06 |
Gm23053 |
predicted gene, 23053 |
8259 |
0.23 |
| chr1_97770980_97771325 | 1.06 |
Ppip5k2 |
diphosphoinositol pentakisphosphate kinase 2 |
741 |
0.49 |
| chr9_55277952_55278103 | 1.06 |
Nrg4 |
neuregulin 4 |
5545 |
0.2 |
| chr19_37501929_37502080 | 1.06 |
Exoc6 |
exocyst complex component 6 |
18875 |
0.14 |
| chr18_61565305_61565485 | 1.05 |
Csnk1a1 |
casein kinase 1, alpha 1 |
9706 |
0.15 |
| chr2_32174827_32174978 | 1.05 |
Gm27805 |
predicted gene, 27805 |
1731 |
0.23 |
| chr15_3533289_3533452 | 1.04 |
Ghr |
growth hormone receptor |
48472 |
0.16 |
| chr15_35886635_35886786 | 1.04 |
Vps13b |
vacuolar protein sorting 13B |
14988 |
0.16 |
| chr9_122849425_122849576 | 1.04 |
Gm47140 |
predicted gene, 47140 |
1082 |
0.34 |
| chr6_15930296_15930597 | 1.04 |
Gm43990 |
predicted gene, 43990 |
94357 |
0.08 |
| chr10_111708723_111708874 | 1.03 |
Gm30624 |
predicted gene, 30624 |
16386 |
0.16 |
| chr3_112820887_112821047 | 1.03 |
Gm43587 |
predicted gene 43587 |
53955 |
0.17 |
| chr6_116047171_116047385 | 1.03 |
Tmcc1 |
transmembrane and coiled coil domains 1 |
9677 |
0.17 |
| chr3_119165577_119165728 | 1.03 |
Gm43410 |
predicted gene 43410 |
297408 |
0.01 |
| chr14_48664466_48664692 | 1.02 |
Otx2 |
orthodenticle homeobox 2 |
527 |
0.59 |
| chr14_66097069_66097220 | 1.02 |
Ephx2 |
epoxide hydrolase 2, cytoplasmic |
13516 |
0.15 |
| chr19_21654390_21654886 | 1.02 |
Abhd17b |
abhydrolase domain containing 17B |
1113 |
0.45 |
| chr4_96663128_96663305 | 1.02 |
Cyp2j5 |
cytochrome P450, family 2, subfamily j, polypeptide 5 |
938 |
0.67 |
| chr19_12793824_12793975 | 1.02 |
Zfp91 |
zinc finger protein 91 |
2227 |
0.17 |
| chr9_106238560_106238771 | 1.01 |
Alas1 |
aminolevulinic acid synthase 1 |
65 |
0.95 |
| chr16_93354614_93354802 | 1.01 |
1810053B23Rik |
RIKEN cDNA 1810053B23 gene |
606 |
0.72 |
| chr2_60124236_60125022 | 1.01 |
Gm13620 |
predicted gene 13620 |
467 |
0.65 |
| chr1_67153777_67153928 | 1.01 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
30826 |
0.19 |
| chr13_109635481_109635828 | 1.01 |
Pde4d |
phosphodiesterase 4D, cAMP specific |
2874 |
0.42 |
| chr1_128080862_128081018 | 1.00 |
Gm37625 |
predicted gene, 37625 |
8391 |
0.12 |
| chr17_64524994_64525269 | 1.00 |
AU016765 |
expressed sequence AU016765 |
30372 |
0.2 |
| chr4_25281013_25281629 | 1.00 |
Ufl1 |
UFM1 specific ligase 1 |
427 |
0.85 |
| chr17_15341059_15341210 | 0.99 |
Gm7423 |
predicted gene 7423 |
19252 |
0.14 |
| chr15_3720483_3720634 | 0.99 |
Gm4823 |
predicted gene 4823 |
26317 |
0.23 |
| chr3_51246100_51246251 | 0.99 |
Noct |
nocturnin |
2767 |
0.18 |
| chr7_115859114_115859300 | 0.99 |
Sox6 |
SRY (sex determining region Y)-box 6 |
645 |
0.82 |
| chrX_85734642_85734808 | 0.99 |
Gk |
glycerol kinase |
2885 |
0.21 |
| chr4_99037726_99038187 | 0.99 |
Angptl3 |
angiopoietin-like 3 |
4753 |
0.21 |
| chr4_39672261_39672517 | 0.99 |
Gm12385 |
predicted gene 12385 |
95229 |
0.08 |
| chr14_21033937_21034339 | 0.98 |
Vcl |
vinculin |
12135 |
0.18 |
| chr5_38117047_38117323 | 0.98 |
Stx18 |
syntaxin 18 |
3724 |
0.2 |
| chr8_5030377_5030626 | 0.98 |
n-R5s93 |
nuclear encoded rRNA 5S 93 |
38876 |
0.14 |
| chr1_127899100_127899290 | 0.98 |
Rab3gap1 |
RAB3 GTPase activating protein subunit 1 |
1718 |
0.35 |
| chr11_16815536_16815687 | 0.98 |
Egfros |
epidermal growth factor receptor, opposite strand |
15091 |
0.21 |
| chr9_108307554_108308248 | 0.98 |
Rhoa |
ras homolog family member A |
1072 |
0.25 |
| chr1_159269464_159269648 | 0.97 |
Cop1 |
COP1, E3 ubiquitin ligase |
2822 |
0.24 |
| chr1_21267241_21267394 | 0.97 |
Gm28836 |
predicted gene 28836 |
4276 |
0.12 |
| chr12_83685684_83685835 | 0.97 |
Psen1 |
presenilin 1 |
2393 |
0.21 |
| chr12_71805815_71805966 | 0.97 |
Daam1 |
dishevelled associated activator of morphogenesis 1 |
25188 |
0.16 |
| chr8_40270513_40270891 | 0.97 |
Fgf20 |
fibroblast growth factor 20 |
16251 |
0.2 |
| chr9_55193651_55193802 | 0.97 |
Ube2q2 |
ubiquitin-conjugating enzyme E2Q family member 2 |
1119 |
0.48 |
| chr13_107645955_107646106 | 0.97 |
Gm32090 |
predicted gene, 32090 |
33181 |
0.17 |
| chr8_80483289_80483449 | 0.97 |
Gypa |
glycophorin A |
10412 |
0.24 |
| chr13_16575026_16575177 | 0.97 |
Gm48497 |
predicted gene, 48497 |
41280 |
0.17 |
| chr2_58773911_58774203 | 0.96 |
Upp2 |
uridine phosphorylase 2 |
8732 |
0.21 |
| chr3_97988109_97988290 | 0.96 |
Notch2 |
notch 2 |
25328 |
0.15 |
| chr3_60576733_60576906 | 0.96 |
Mbnl1 |
muscleblind like splicing factor 1 |
18822 |
0.19 |
| chr16_10675930_10676129 | 0.96 |
Gm15558 |
predicted gene 15558 |
7510 |
0.18 |
| chr12_104347486_104347696 | 0.96 |
Serpina3k |
serine (or cysteine) peptidase inhibitor, clade A, member 3K |
9105 |
0.12 |
| chr1_134133418_134133585 | 0.96 |
Chit1 |
chitinase 1 (chitotriosidase) |
5145 |
0.15 |
| chr5_53999786_53999937 | 0.95 |
Stim2 |
stromal interaction molecule 2 |
1296 |
0.54 |
| chr8_9501766_9501947 | 0.95 |
4930435N07Rik |
RIKEN cDNA 4930435N07 gene |
42764 |
0.13 |
| chr15_7135727_7135925 | 0.95 |
Lifr |
LIF receptor alpha |
4716 |
0.31 |
| chr15_54578033_54578470 | 0.95 |
Mal2 |
mal, T cell differentiation protein 2 |
7059 |
0.27 |
| chr1_5257936_5258087 | 0.95 |
Gm7182 |
predicted gene 7182 |
19326 |
0.22 |
| chr15_62705006_62705181 | 0.95 |
Gm24810 |
predicted gene, 24810 |
52089 |
0.16 |
| chr10_95153094_95153246 | 0.95 |
Gm48874 |
predicted gene, 48874 |
7191 |
0.16 |
| chr12_104088559_104088873 | 0.95 |
Serpina4-ps1 |
serine (or cysteine) peptidase inhibitor, clade A, member 4, pseudogene 1 |
8067 |
0.1 |
| chr5_87499011_87499178 | 0.94 |
Ugt2a1 |
UDP glucuronosyltransferase 2 family, polypeptide A1 |
8223 |
0.12 |
| chr7_114788616_114788767 | 0.94 |
Insc |
INSC spindle orientation adaptor protein |
3362 |
0.24 |
| chr2_64095519_64096038 | 0.94 |
Fign |
fidgetin |
2210 |
0.48 |
| chr9_74702140_74702734 | 0.94 |
Gm27233 |
predicted gene 27233 |
6825 |
0.25 |
| chr16_43169836_43170008 | 0.94 |
Gm15712 |
predicted gene 15712 |
14651 |
0.21 |
| chr8_34927398_34927800 | 0.94 |
Tnks |
tankyrase, TRF1-interacting ankyrin-related ADP-ribose polymerase |
8831 |
0.2 |
| chr13_45851533_45851684 | 0.94 |
Atxn1 |
ataxin 1 |
20680 |
0.23 |
| chr11_111996861_111997073 | 0.94 |
Gm11679 |
predicted gene 11679 |
46611 |
0.19 |
| chr4_16049899_16050092 | 0.94 |
Osgin2 |
oxidative stress induced growth inhibitor family member 2 |
36107 |
0.12 |
| chr12_104346091_104346278 | 0.94 |
Serpina3k |
serine (or cysteine) peptidase inhibitor, clade A, member 3K |
7698 |
0.12 |
| chr19_37078496_37078665 | 0.94 |
Gm22714 |
predicted gene, 22714 |
70582 |
0.09 |
| chr15_55046384_55046549 | 0.93 |
Taf2 |
TATA-box binding protein associated factor 2 |
300 |
0.88 |
| chr14_34328017_34328168 | 0.93 |
Glud1 |
glutamate dehydrogenase 1 |
570 |
0.61 |
| chr4_135255267_135255418 | 0.93 |
Clic4 |
chloride intracellular channel 4 (mitochondrial) |
17472 |
0.14 |
| chr13_46677823_46678234 | 0.93 |
Nup153 |
nucleoporin 153 |
3924 |
0.19 |
| chr4_109805630_109805981 | 0.93 |
Faf1 |
Fas-associated factor 1 |
34980 |
0.17 |
| chr18_36656472_36656632 | 0.93 |
Ankhd1 |
ankyrin repeat and KH domain containing 1 |
1042 |
0.31 |
| chr2_158341832_158341983 | 0.92 |
Gm24411 |
predicted gene, 24411 |
14647 |
0.08 |
| chr1_67213641_67214357 | 0.92 |
Gm15668 |
predicted gene 15668 |
35201 |
0.17 |
| chr1_131921949_131922126 | 0.92 |
Nucks1 |
nuclear casein kinase and cyclin-dependent kinase substrate 1 |
7126 |
0.11 |
| chr6_128662037_128662201 | 0.92 |
Clec2h |
C-type lectin domain family 2, member h |
266 |
0.49 |
| chr17_28447526_28448288 | 0.92 |
Gm22146 |
predicted gene, 22146 |
1407 |
0.25 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.9 | 5.6 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
| 1.1 | 6.4 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
| 0.8 | 2.5 | GO:0006068 | ethanol catabolic process(GO:0006068) |
| 0.8 | 2.4 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
| 0.7 | 2.7 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.6 | 1.2 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
| 0.6 | 1.7 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
| 0.5 | 6.0 | GO:0009404 | toxin metabolic process(GO:0009404) |
| 0.5 | 1.6 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.5 | 1.6 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.5 | 2.6 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
| 0.5 | 2.0 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
| 0.5 | 2.0 | GO:0072338 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
| 0.5 | 1.0 | GO:2000809 | positive regulation of synaptic vesicle clustering(GO:2000809) |
| 0.5 | 1.4 | GO:0034310 | primary alcohol catabolic process(GO:0034310) |
| 0.4 | 1.7 | GO:0044598 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.4 | 1.2 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
| 0.4 | 2.8 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
| 0.4 | 1.2 | GO:0009730 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
| 0.4 | 1.1 | GO:0036493 | positive regulation of translation in response to endoplasmic reticulum stress(GO:0036493) |
| 0.4 | 0.4 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
| 0.4 | 1.1 | GO:0060523 | prostate epithelial cord elongation(GO:0060523) |
| 0.4 | 1.5 | GO:0018243 | protein O-linked glycosylation via threonine(GO:0018243) |
| 0.4 | 1.1 | GO:1990168 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
| 0.4 | 1.1 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
| 0.3 | 3.1 | GO:0043651 | linoleic acid metabolic process(GO:0043651) |
| 0.3 | 1.4 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
| 0.3 | 1.0 | GO:1902065 | response to L-glutamate(GO:1902065) |
| 0.3 | 2.0 | GO:0071763 | nuclear membrane organization(GO:0071763) |
| 0.3 | 1.7 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.3 | 0.7 | GO:0070672 | response to interleukin-15(GO:0070672) |
| 0.3 | 1.0 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 0.3 | 1.6 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
| 0.3 | 1.0 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
| 0.3 | 0.9 | GO:2000370 | positive regulation of clathrin-mediated endocytosis(GO:2000370) |
| 0.3 | 1.2 | GO:0015819 | lysine transport(GO:0015819) |
| 0.3 | 1.5 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
| 0.3 | 0.9 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
| 0.3 | 0.9 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
| 0.3 | 2.0 | GO:0070857 | regulation of bile acid biosynthetic process(GO:0070857) |
| 0.3 | 1.1 | GO:0097460 | ferrous iron import into cell(GO:0097460) |
| 0.3 | 0.6 | GO:0070103 | regulation of interleukin-6-mediated signaling pathway(GO:0070103) |
| 0.3 | 1.3 | GO:0032237 | activation of store-operated calcium channel activity(GO:0032237) |
| 0.3 | 1.5 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
| 0.3 | 0.5 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
| 0.3 | 0.8 | GO:0021553 | olfactory nerve development(GO:0021553) |
| 0.2 | 0.5 | GO:1900045 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.2 | 0.5 | GO:1904339 | negative regulation of dopaminergic neuron differentiation(GO:1904339) |
| 0.2 | 0.5 | GO:0038161 | prolactin signaling pathway(GO:0038161) |
| 0.2 | 2.5 | GO:0006699 | bile acid biosynthetic process(GO:0006699) |
| 0.2 | 0.5 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
| 0.2 | 1.4 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
| 0.2 | 2.1 | GO:0055091 | phospholipid homeostasis(GO:0055091) |
| 0.2 | 0.7 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
| 0.2 | 0.7 | GO:0070346 | positive regulation of fat cell proliferation(GO:0070346) |
| 0.2 | 0.7 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
| 0.2 | 5.7 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
| 0.2 | 0.2 | GO:0071455 | cellular response to increased oxygen levels(GO:0036295) cellular response to hyperoxia(GO:0071455) |
| 0.2 | 0.2 | GO:0072361 | regulation of glycolytic process by regulation of transcription from RNA polymerase II promoter(GO:0072361) |
| 0.2 | 0.2 | GO:0000430 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) |
| 0.2 | 0.9 | GO:0044034 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 0.2 | 0.9 | GO:0060665 | regulation of branching involved in salivary gland morphogenesis by mesenchymal-epithelial signaling(GO:0060665) |
| 0.2 | 1.3 | GO:2000543 | positive regulation of gastrulation(GO:2000543) |
| 0.2 | 0.7 | GO:0006553 | lysine metabolic process(GO:0006553) |
| 0.2 | 1.3 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.2 | 0.9 | GO:0000957 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
| 0.2 | 0.4 | GO:1903371 | regulation of endoplasmic reticulum tubular network organization(GO:1903371) |
| 0.2 | 1.1 | GO:0042518 | negative regulation of tyrosine phosphorylation of Stat3 protein(GO:0042518) |
| 0.2 | 0.6 | GO:0001998 | angiotensin mediated vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001998) |
| 0.2 | 1.9 | GO:0052697 | xenobiotic glucuronidation(GO:0052697) |
| 0.2 | 0.6 | GO:0060748 | tertiary branching involved in mammary gland duct morphogenesis(GO:0060748) |
| 0.2 | 0.8 | GO:0018211 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.2 | 1.0 | GO:0021960 | anterior commissure morphogenesis(GO:0021960) |
| 0.2 | 0.2 | GO:0006067 | ethanol metabolic process(GO:0006067) ethanol oxidation(GO:0006069) |
| 0.2 | 1.1 | GO:0006559 | L-phenylalanine metabolic process(GO:0006558) L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
| 0.2 | 0.9 | GO:0090110 | cargo loading into COPII-coated vesicle(GO:0090110) |
| 0.2 | 0.5 | GO:0045917 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
| 0.2 | 0.5 | GO:0008050 | female courtship behavior(GO:0008050) |
| 0.2 | 0.3 | GO:0035973 | aggrephagy(GO:0035973) |
| 0.2 | 1.0 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.2 | 0.3 | GO:0032741 | positive regulation of interleukin-18 production(GO:0032741) |
| 0.2 | 0.5 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
| 0.2 | 0.5 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
| 0.2 | 0.5 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
| 0.2 | 0.6 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
| 0.2 | 0.5 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
| 0.2 | 0.3 | GO:0003330 | regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
| 0.2 | 0.5 | GO:0060164 | regulation of timing of neuron differentiation(GO:0060164) |
| 0.2 | 0.6 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
| 0.2 | 0.5 | GO:1901162 | serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
| 0.2 | 0.6 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
| 0.2 | 0.9 | GO:0015074 | DNA integration(GO:0015074) |
| 0.2 | 0.8 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
| 0.2 | 0.3 | GO:2000302 | positive regulation of synaptic vesicle exocytosis(GO:2000302) |
| 0.2 | 0.5 | GO:0021699 | cerebellar cortex maturation(GO:0021699) |
| 0.2 | 0.8 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
| 0.2 | 0.6 | GO:0035627 | ceramide transport(GO:0035627) |
| 0.2 | 0.3 | GO:0042118 | endothelial cell activation(GO:0042118) |
| 0.2 | 0.3 | GO:0061010 | gall bladder development(GO:0061010) |
| 0.1 | 0.6 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
| 0.1 | 0.4 | GO:0019086 | late viral transcription(GO:0019086) |
| 0.1 | 0.3 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
| 0.1 | 0.6 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
| 0.1 | 0.9 | GO:0006048 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
| 0.1 | 0.3 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 0.1 | 0.6 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
| 0.1 | 0.3 | GO:0042091 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
| 0.1 | 0.4 | GO:0031086 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.1 | 0.3 | GO:0010159 | specification of organ position(GO:0010159) |
| 0.1 | 0.4 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
| 0.1 | 1.0 | GO:0070874 | negative regulation of glycogen metabolic process(GO:0070874) |
| 0.1 | 0.4 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
| 0.1 | 0.1 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
| 0.1 | 0.3 | GO:0010963 | regulation of L-arginine import(GO:0010963) |
| 0.1 | 1.2 | GO:0051657 | maintenance of organelle location(GO:0051657) |
| 0.1 | 0.4 | GO:0045738 | negative regulation of DNA repair(GO:0045738) negative regulation of double-strand break repair(GO:2000780) |
| 0.1 | 0.5 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
| 0.1 | 1.5 | GO:0048742 | regulation of skeletal muscle fiber development(GO:0048742) |
| 0.1 | 0.1 | GO:1902947 | regulation of tau-protein kinase activity(GO:1902947) neurofibrillary tangle assembly(GO:1902988) regulation of neurofibrillary tangle assembly(GO:1902996) |
| 0.1 | 1.0 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.1 | 0.5 | GO:0048478 | replication fork protection(GO:0048478) |
| 0.1 | 0.5 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
| 0.1 | 0.5 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
| 0.1 | 0.5 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.1 | 0.1 | GO:0032349 | positive regulation of aldosterone metabolic process(GO:0032346) positive regulation of aldosterone biosynthetic process(GO:0032349) |
| 0.1 | 0.4 | GO:0034197 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
| 0.1 | 0.3 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
| 0.1 | 0.3 | GO:0032727 | positive regulation of interferon-alpha production(GO:0032727) |
| 0.1 | 0.1 | GO:0045608 | negative regulation of auditory receptor cell differentiation(GO:0045608) |
| 0.1 | 2.1 | GO:0006376 | mRNA splice site selection(GO:0006376) |
| 0.1 | 0.8 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
| 0.1 | 0.9 | GO:0006568 | tryptophan metabolic process(GO:0006568) indolalkylamine metabolic process(GO:0006586) |
| 0.1 | 0.4 | GO:0060468 | prevention of polyspermy(GO:0060468) |
| 0.1 | 0.4 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.1 | 0.2 | GO:0034756 | regulation of iron ion transport(GO:0034756) |
| 0.1 | 0.4 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
| 0.1 | 0.4 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.1 | 0.6 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.1 | 0.5 | GO:0061641 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.1 | 0.2 | GO:0048369 | lateral mesoderm morphogenesis(GO:0048369) lateral mesoderm formation(GO:0048370) lateral mesodermal cell differentiation(GO:0048371) |
| 0.1 | 0.6 | GO:0060017 | parathyroid gland development(GO:0060017) |
| 0.1 | 0.1 | GO:0032058 | positive regulation of translational initiation in response to stress(GO:0032058) |
| 0.1 | 1.7 | GO:0017144 | drug metabolic process(GO:0017144) |
| 0.1 | 0.4 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
| 0.1 | 0.6 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 0.1 | 0.4 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) |
| 0.1 | 1.4 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
| 0.1 | 0.4 | GO:0048143 | astrocyte activation(GO:0048143) |
| 0.1 | 0.4 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
| 0.1 | 0.6 | GO:2000794 | positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) regulation of epithelial cell proliferation involved in lung morphogenesis(GO:2000794) |
| 0.1 | 0.4 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
| 0.1 | 0.5 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
| 0.1 | 0.6 | GO:0015867 | ATP transport(GO:0015867) |
| 0.1 | 0.4 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
| 0.1 | 0.1 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
| 0.1 | 0.2 | GO:0042374 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
| 0.1 | 0.3 | GO:0032439 | endosome localization(GO:0032439) |
| 0.1 | 0.2 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
| 0.1 | 0.3 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
| 0.1 | 0.7 | GO:0006678 | glucosylceramide metabolic process(GO:0006678) |
| 0.1 | 0.5 | GO:0036490 | regulation of translation in response to endoplasmic reticulum stress(GO:0036490) regulation of translation initiation in response to endoplasmic reticulum stress(GO:0036491) eiF2alpha phosphorylation in response to endoplasmic reticulum stress(GO:0036492) |
| 0.1 | 0.1 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
| 0.1 | 0.7 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.1 | 0.2 | GO:0035459 | cargo loading into vesicle(GO:0035459) |
| 0.1 | 0.3 | GO:1902953 | positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
| 0.1 | 0.5 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.1 | 0.3 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
| 0.1 | 0.2 | GO:0034436 | glycoprotein transport(GO:0034436) |
| 0.1 | 0.3 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
| 0.1 | 0.3 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
| 0.1 | 0.4 | GO:0097278 | complement-dependent cytotoxicity(GO:0097278) |
| 0.1 | 3.0 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
| 0.1 | 0.8 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.1 | 0.6 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.1 | 1.2 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.1 | 2.7 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
| 0.1 | 0.1 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
| 0.1 | 0.8 | GO:0032959 | inositol trisphosphate biosynthetic process(GO:0032959) |
| 0.1 | 0.2 | GO:0051025 | negative regulation of immunoglobulin secretion(GO:0051025) |
| 0.1 | 0.7 | GO:0033625 | positive regulation of integrin activation(GO:0033625) |
| 0.1 | 1.5 | GO:0048643 | positive regulation of skeletal muscle tissue development(GO:0048643) |
| 0.1 | 0.3 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
| 0.1 | 0.7 | GO:0060628 | regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
| 0.1 | 0.3 | GO:0045764 | positive regulation of cellular amino acid metabolic process(GO:0045764) |
| 0.1 | 0.2 | GO:0048696 | regulation of collateral sprouting in absence of injury(GO:0048696) |
| 0.1 | 0.3 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
| 0.1 | 0.6 | GO:0001547 | antral ovarian follicle growth(GO:0001547) |
| 0.1 | 0.3 | GO:0048239 | negative regulation of DNA recombination at telomere(GO:0048239) regulation of DNA recombination at telomere(GO:0072695) |
| 0.1 | 0.8 | GO:0006013 | mannose metabolic process(GO:0006013) |
| 0.1 | 0.3 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
| 0.1 | 0.3 | GO:0060956 | endocardial cell differentiation(GO:0060956) |
| 0.1 | 0.2 | GO:0006059 | hexitol metabolic process(GO:0006059) |
| 0.1 | 0.2 | GO:0071799 | response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
| 0.1 | 1.9 | GO:0006783 | heme biosynthetic process(GO:0006783) |
| 0.1 | 0.6 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
| 0.1 | 0.6 | GO:0055089 | fatty acid homeostasis(GO:0055089) |
| 0.1 | 0.3 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
| 0.1 | 0.9 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
| 0.1 | 0.5 | GO:0045541 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
| 0.1 | 0.3 | GO:0031585 | regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031585) |
| 0.1 | 0.2 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
| 0.1 | 0.5 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
| 0.1 | 0.3 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.1 | 0.7 | GO:0000963 | mitochondrial RNA processing(GO:0000963) |
| 0.1 | 0.4 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
| 0.1 | 0.2 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
| 0.1 | 0.6 | GO:0043249 | erythrocyte maturation(GO:0043249) |
| 0.1 | 0.2 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
| 0.1 | 0.3 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.1 | 0.2 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
| 0.1 | 3.3 | GO:0048536 | spleen development(GO:0048536) |
| 0.1 | 0.2 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
| 0.1 | 0.2 | GO:0035799 | ureter maturation(GO:0035799) |
| 0.1 | 0.7 | GO:0006273 | lagging strand elongation(GO:0006273) |
| 0.1 | 0.2 | GO:0060509 | Type I pneumocyte differentiation(GO:0060509) |
| 0.1 | 0.8 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
| 0.1 | 0.3 | GO:0014744 | positive regulation of muscle adaptation(GO:0014744) |
| 0.1 | 0.5 | GO:0045176 | apical protein localization(GO:0045176) |
| 0.1 | 0.1 | GO:0060916 | mesenchymal cell proliferation involved in lung development(GO:0060916) |
| 0.1 | 0.1 | GO:0033683 | nucleotide-excision repair, DNA incision(GO:0033683) |
| 0.1 | 0.3 | GO:1900222 | negative regulation of beta-amyloid clearance(GO:1900222) |
| 0.1 | 1.7 | GO:0006883 | cellular sodium ion homeostasis(GO:0006883) |
| 0.1 | 0.4 | GO:0032532 | regulation of microvillus length(GO:0032532) |
| 0.1 | 0.3 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
| 0.1 | 0.3 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.1 | 1.0 | GO:0019184 | nonribosomal peptide biosynthetic process(GO:0019184) |
| 0.1 | 1.0 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
| 0.1 | 0.3 | GO:0002905 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
| 0.1 | 0.3 | GO:0071926 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
| 0.1 | 0.4 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
| 0.1 | 0.3 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
| 0.1 | 0.3 | GO:1902219 | intrinsic apoptotic signaling pathway in response to osmotic stress(GO:0008627) regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902218) negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
| 0.1 | 1.0 | GO:0048026 | positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
| 0.1 | 0.1 | GO:1903061 | positive regulation of protein lipidation(GO:1903061) |
| 0.1 | 0.3 | GO:0045113 | regulation of integrin biosynthetic process(GO:0045113) |
| 0.1 | 0.5 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
| 0.1 | 0.3 | GO:0097070 | ductus arteriosus closure(GO:0097070) |
| 0.1 | 0.1 | GO:2000111 | positive regulation of macrophage apoptotic process(GO:2000111) |
| 0.1 | 0.3 | GO:0090188 | negative regulation of pancreatic juice secretion(GO:0090188) |
| 0.1 | 0.2 | GO:0000255 | allantoin metabolic process(GO:0000255) |
| 0.1 | 0.3 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
| 0.1 | 0.2 | GO:2000224 | regulation of testosterone biosynthetic process(GO:2000224) |
| 0.1 | 0.4 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.1 | 0.2 | GO:0030397 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
| 0.1 | 0.2 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
| 0.1 | 0.6 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
| 0.1 | 0.1 | GO:0051771 | negative regulation of nitric-oxide synthase biosynthetic process(GO:0051771) |
| 0.1 | 0.2 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
| 0.1 | 0.5 | GO:0045714 | regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045714) |
| 0.1 | 0.6 | GO:0002072 | optic cup morphogenesis involved in camera-type eye development(GO:0002072) |
| 0.1 | 0.2 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
| 0.1 | 0.3 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
| 0.1 | 0.2 | GO:0021873 | forebrain neuroblast division(GO:0021873) |
| 0.1 | 0.3 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
| 0.1 | 0.8 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.1 | 0.2 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
| 0.1 | 0.2 | GO:2000834 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
| 0.1 | 0.1 | GO:2000618 | regulation of histone H4-K16 acetylation(GO:2000618) |
| 0.1 | 0.3 | GO:0042795 | snRNA transcription from RNA polymerase II promoter(GO:0042795) |
| 0.1 | 0.6 | GO:0042026 | protein refolding(GO:0042026) |
| 0.1 | 0.2 | GO:0042525 | tyrosine phosphorylation of Stat6 protein(GO:0042505) regulation of tyrosine phosphorylation of Stat6 protein(GO:0042525) |
| 0.1 | 1.0 | GO:0045056 | transcytosis(GO:0045056) |
| 0.1 | 0.8 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.1 | 1.0 | GO:0045116 | protein neddylation(GO:0045116) |
| 0.1 | 0.3 | GO:0060696 | regulation of phospholipid catabolic process(GO:0060696) |
| 0.1 | 0.1 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
| 0.1 | 0.3 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 0.1 | 0.3 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
| 0.1 | 0.5 | GO:1901970 | positive regulation of mitotic sister chromatid separation(GO:1901970) |
| 0.1 | 0.7 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
| 0.1 | 1.5 | GO:0035909 | aorta morphogenesis(GO:0035909) |
| 0.1 | 0.1 | GO:0072093 | metanephric renal vesicle formation(GO:0072093) |
| 0.1 | 0.6 | GO:0009435 | NAD biosynthetic process(GO:0009435) |
| 0.1 | 0.5 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
| 0.1 | 0.4 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
| 0.1 | 0.1 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
| 0.1 | 0.2 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.1 | 0.3 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.1 | 0.3 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
| 0.1 | 0.2 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.1 | 0.1 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 0.1 | 0.9 | GO:0051923 | sulfation(GO:0051923) |
| 0.1 | 0.4 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
| 0.1 | 0.7 | GO:0045793 | positive regulation of cell size(GO:0045793) |
| 0.1 | 0.1 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
| 0.1 | 0.4 | GO:0051639 | actin filament network formation(GO:0051639) |
| 0.1 | 0.3 | GO:0014022 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
| 0.1 | 0.2 | GO:0030202 | heparin metabolic process(GO:0030202) |
| 0.1 | 0.2 | GO:0046469 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
| 0.1 | 0.1 | GO:0014042 | positive regulation of neuron maturation(GO:0014042) |
| 0.1 | 0.1 | GO:1903298 | regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903297) negative regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903298) |
| 0.1 | 0.3 | GO:2001225 | regulation of chloride transport(GO:2001225) |
| 0.1 | 0.3 | GO:0035360 | positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
| 0.1 | 0.2 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
| 0.1 | 0.1 | GO:0046098 | guanine metabolic process(GO:0046098) |
| 0.1 | 0.5 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
| 0.1 | 0.5 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
| 0.1 | 0.2 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
| 0.1 | 0.1 | GO:2001012 | mesenchymal cell differentiation involved in kidney development(GO:0072161) mesenchymal cell differentiation involved in renal system development(GO:2001012) |
| 0.1 | 0.2 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
| 0.1 | 0.3 | GO:1904970 | brush border assembly(GO:1904970) |
| 0.1 | 0.1 | GO:0014016 | neuroblast differentiation(GO:0014016) |
| 0.1 | 0.1 | GO:0071839 | apoptotic process in bone marrow(GO:0071839) |
| 0.1 | 0.3 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
| 0.1 | 0.3 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
| 0.1 | 0.1 | GO:0051088 | PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
| 0.1 | 1.2 | GO:0009303 | rRNA transcription(GO:0009303) |
| 0.1 | 0.5 | GO:0032825 | positive regulation of natural killer cell differentiation(GO:0032825) |
| 0.1 | 0.2 | GO:0042403 | thyroid hormone metabolic process(GO:0042403) |
| 0.1 | 0.2 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.1 | 0.2 | GO:1990928 | response to amino acid starvation(GO:1990928) |
| 0.1 | 0.3 | GO:0098787 | mRNA cleavage involved in mRNA processing(GO:0098787) pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.1 | 0.1 | GO:2000646 | positive regulation of receptor catabolic process(GO:2000646) |
| 0.1 | 0.2 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
| 0.1 | 0.5 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.1 | 0.4 | GO:0016093 | polyprenol metabolic process(GO:0016093) |
| 0.1 | 0.1 | GO:1903333 | negative regulation of protein folding(GO:1903333) |
| 0.1 | 0.1 | GO:1904058 | positive regulation of sensory perception of pain(GO:1904058) |
| 0.1 | 0.1 | GO:0044004 | killing by symbiont of host cells(GO:0001907) disruption by symbiont of host cell(GO:0044004) |
| 0.1 | 0.2 | GO:0048597 | post-embryonic camera-type eye morphogenesis(GO:0048597) |
| 0.1 | 0.6 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
| 0.1 | 0.2 | GO:0006573 | valine metabolic process(GO:0006573) |
| 0.1 | 0.4 | GO:0006590 | thyroid hormone generation(GO:0006590) |
| 0.1 | 0.1 | GO:0070189 | kynurenine metabolic process(GO:0070189) |
| 0.1 | 0.5 | GO:1904322 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
| 0.1 | 0.2 | GO:1903301 | positive regulation of glucokinase activity(GO:0033133) positive regulation of hexokinase activity(GO:1903301) |
| 0.1 | 0.8 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
| 0.1 | 0.1 | GO:0035513 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
| 0.1 | 1.0 | GO:0030488 | tRNA methylation(GO:0030488) |
| 0.1 | 0.2 | GO:0035864 | response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
| 0.1 | 0.2 | GO:1902473 | regulation of protein localization to synapse(GO:1902473) |
| 0.1 | 0.2 | GO:0071034 | CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
| 0.1 | 0.2 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.1 | 0.2 | GO:0071498 | cellular response to fluid shear stress(GO:0071498) |
| 0.1 | 0.2 | GO:0002155 | regulation of thyroid hormone mediated signaling pathway(GO:0002155) |
| 0.1 | 0.5 | GO:0071379 | cellular response to prostaglandin stimulus(GO:0071379) |
| 0.1 | 0.4 | GO:0042759 | long-chain fatty acid biosynthetic process(GO:0042759) |
| 0.1 | 0.1 | GO:0006551 | leucine metabolic process(GO:0006551) |
| 0.1 | 0.3 | GO:0030948 | negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
| 0.1 | 0.1 | GO:0060839 | endothelial cell fate commitment(GO:0060839) |
| 0.1 | 0.1 | GO:0002074 | extraocular skeletal muscle development(GO:0002074) |
| 0.1 | 0.4 | GO:0060020 | Bergmann glial cell differentiation(GO:0060020) |
| 0.1 | 0.4 | GO:1904153 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
| 0.1 | 0.4 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
| 0.1 | 0.5 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
| 0.1 | 0.1 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
| 0.1 | 0.2 | GO:0060449 | bud elongation involved in lung branching(GO:0060449) |
| 0.1 | 0.2 | GO:0021603 | cranial nerve formation(GO:0021603) |
| 0.1 | 0.2 | GO:0001839 | neural plate morphogenesis(GO:0001839) |
| 0.1 | 0.2 | GO:1902075 | cellular response to salt(GO:1902075) |
| 0.1 | 0.1 | GO:0060128 | corticotropin hormone secreting cell differentiation(GO:0060128) thyroid-stimulating hormone-secreting cell differentiation(GO:0060129) |
| 0.1 | 0.1 | GO:0018343 | protein farnesylation(GO:0018343) |
| 0.1 | 0.2 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
| 0.1 | 0.1 | GO:0072102 | glomerulus morphogenesis(GO:0072102) |
| 0.1 | 0.2 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
| 0.1 | 0.6 | GO:0042407 | cristae formation(GO:0042407) |
| 0.1 | 0.4 | GO:0070849 | response to epidermal growth factor(GO:0070849) |
| 0.1 | 0.9 | GO:0000266 | mitochondrial fission(GO:0000266) |
| 0.1 | 0.2 | GO:1900060 | negative regulation of ceramide biosynthetic process(GO:1900060) |
| 0.1 | 0.2 | GO:2000481 | positive regulation of cAMP-dependent protein kinase activity(GO:2000481) |
| 0.1 | 0.5 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.1 | 0.3 | GO:0010882 | regulation of cardiac muscle contraction by calcium ion signaling(GO:0010882) |
| 0.1 | 0.2 | GO:0048677 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
| 0.1 | 0.3 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
| 0.1 | 0.2 | GO:0032202 | telomere assembly(GO:0032202) |
| 0.1 | 0.2 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
| 0.1 | 0.6 | GO:0055070 | copper ion homeostasis(GO:0055070) |
| 0.1 | 0.4 | GO:0097340 | inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
| 0.1 | 0.2 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.1 | 0.1 | GO:0051106 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
| 0.1 | 0.1 | GO:0070827 | chromatin maintenance(GO:0070827) |
| 0.1 | 0.2 | GO:2000643 | positive regulation of early endosome to late endosome transport(GO:2000643) |
| 0.1 | 0.3 | GO:0042447 | hormone catabolic process(GO:0042447) |
| 0.1 | 0.6 | GO:0015732 | prostaglandin transport(GO:0015732) |
| 0.1 | 1.0 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.1 | 0.1 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
| 0.1 | 0.1 | GO:0014891 | skeletal muscle atrophy(GO:0014732) striated muscle atrophy(GO:0014891) |
| 0.1 | 0.4 | GO:0055064 | chloride ion homeostasis(GO:0055064) |
| 0.1 | 0.2 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
| 0.1 | 0.3 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
| 0.1 | 0.4 | GO:0002087 | regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
| 0.1 | 0.2 | GO:0019478 | D-amino acid catabolic process(GO:0019478) |
| 0.1 | 0.2 | GO:0051103 | DNA ligation involved in DNA repair(GO:0051103) |
| 0.1 | 0.1 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) |
| 0.1 | 0.5 | GO:0061088 | sequestering of zinc ion(GO:0032119) regulation of sequestering of zinc ion(GO:0061088) |
| 0.1 | 0.2 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
| 0.1 | 0.2 | GO:0061051 | positive regulation of cell growth involved in cardiac muscle cell development(GO:0061051) |
| 0.1 | 0.1 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
| 0.1 | 0.4 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
| 0.1 | 0.2 | GO:2000980 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.1 | 0.2 | GO:1901096 | regulation of autophagosome maturation(GO:1901096) |
| 0.1 | 0.1 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
| 0.0 | 0.2 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 0.0 | 0.4 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.0 | 0.0 | GO:0030035 | microspike assembly(GO:0030035) |
| 0.0 | 0.0 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
| 0.0 | 0.1 | GO:1904293 | negative regulation of ERAD pathway(GO:1904293) |
| 0.0 | 0.2 | GO:0010519 | negative regulation of phospholipase activity(GO:0010519) |
| 0.0 | 0.1 | GO:0010040 | response to iron(II) ion(GO:0010040) |
| 0.0 | 0.1 | GO:0010998 | regulation of translational initiation by eIF2 alpha phosphorylation(GO:0010998) |
| 0.0 | 0.1 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
| 0.0 | 0.2 | GO:2000510 | positive regulation of dendritic cell chemotaxis(GO:2000510) |
| 0.0 | 0.2 | GO:1903069 | regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903069) |
| 0.0 | 0.0 | GO:0006266 | DNA ligation(GO:0006266) |
| 0.0 | 0.1 | GO:0035826 | rubidium ion transport(GO:0035826) |
| 0.0 | 0.1 | GO:0071830 | chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
| 0.0 | 0.0 | GO:0003347 | epicardial cell to mesenchymal cell transition(GO:0003347) |
| 0.0 | 0.1 | GO:0006296 | nucleotide-excision repair, DNA incision, 5'-to lesion(GO:0006296) |
| 0.0 | 0.1 | GO:0002069 | columnar/cuboidal epithelial cell maturation(GO:0002069) |
| 0.0 | 0.3 | GO:0051085 | chaperone mediated protein folding requiring cofactor(GO:0051085) |
| 0.0 | 0.2 | GO:0006621 | protein retention in ER lumen(GO:0006621) maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
| 0.0 | 0.3 | GO:0009191 | ribonucleoside diphosphate catabolic process(GO:0009191) |
| 0.0 | 0.1 | GO:2000143 | negative regulation of transcription initiation from RNA polymerase II promoter(GO:0060633) negative regulation of DNA-templated transcription, initiation(GO:2000143) |
| 0.0 | 0.1 | GO:0090148 | membrane fission(GO:0090148) |
| 0.0 | 0.1 | GO:0035087 | siRNA loading onto RISC involved in RNA interference(GO:0035087) |
| 0.0 | 0.0 | GO:2000407 | regulation of T cell extravasation(GO:2000407) |
| 0.0 | 0.1 | GO:0031443 | fast-twitch skeletal muscle fiber contraction(GO:0031443) |
| 0.0 | 0.1 | GO:0060355 | positive regulation of cell adhesion molecule production(GO:0060355) |
| 0.0 | 0.2 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.0 | 0.4 | GO:0006152 | purine nucleoside catabolic process(GO:0006152) purine ribonucleoside catabolic process(GO:0046130) |
| 0.0 | 0.2 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.0 | 0.3 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.0 | 0.2 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
| 0.0 | 0.1 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
| 0.0 | 0.9 | GO:0045070 | positive regulation of viral genome replication(GO:0045070) |
| 0.0 | 0.6 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
| 0.0 | 0.4 | GO:0000479 | endonucleolytic cleavage of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000479) |
| 0.0 | 0.1 | GO:0002215 | defense response to nematode(GO:0002215) |
| 0.0 | 0.0 | GO:0008105 | asymmetric protein localization(GO:0008105) |
| 0.0 | 0.2 | GO:0060242 | contact inhibition(GO:0060242) |
| 0.0 | 0.2 | GO:0044821 | meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
| 0.0 | 0.1 | GO:1903207 | neuron death in response to hydrogen peroxide(GO:0036476) regulation of hydrogen peroxide-induced neuron death(GO:1903207) negative regulation of hydrogen peroxide-induced neuron death(GO:1903208) |
| 0.0 | 0.1 | GO:0061511 | centriole elongation(GO:0061511) |
| 0.0 | 0.2 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
| 0.0 | 0.3 | GO:0032060 | bleb assembly(GO:0032060) |
| 0.0 | 0.1 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
| 0.0 | 0.2 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
| 0.0 | 0.1 | GO:0040009 | regulation of growth rate(GO:0040009) |
| 0.0 | 0.0 | GO:2000586 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
| 0.0 | 0.6 | GO:0032011 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
| 0.0 | 0.1 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
| 0.0 | 0.2 | GO:2000074 | regulation of type B pancreatic cell development(GO:2000074) |
| 0.0 | 0.6 | GO:0008053 | mitochondrial fusion(GO:0008053) |
| 0.0 | 0.3 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
| 0.0 | 0.1 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
| 0.0 | 0.0 | GO:1900086 | positive regulation of peptidyl-tyrosine autophosphorylation(GO:1900086) |
| 0.0 | 0.3 | GO:1900107 | regulation of nodal signaling pathway(GO:1900107) |
| 0.0 | 0.0 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
| 0.0 | 0.1 | GO:0009068 | aspartate family amino acid catabolic process(GO:0009068) |
| 0.0 | 0.1 | GO:1990034 | calcium ion export from cell(GO:1990034) |
| 0.0 | 0.1 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.0 | 0.0 | GO:1903984 | positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
| 0.0 | 0.1 | GO:0046836 | glycolipid transport(GO:0046836) |
| 0.0 | 0.5 | GO:0010165 | response to X-ray(GO:0010165) |
| 0.0 | 0.0 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
| 0.0 | 0.2 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.0 | 0.5 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
| 0.0 | 0.1 | GO:1902993 | positive regulation of beta-amyloid formation(GO:1902004) positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
| 0.0 | 0.1 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.0 | 0.3 | GO:0000059 | protein import into nucleus, docking(GO:0000059) |
| 0.0 | 0.1 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
| 0.0 | 0.5 | GO:0045742 | positive regulation of epidermal growth factor receptor signaling pathway(GO:0045742) positive regulation of ERBB signaling pathway(GO:1901186) |
| 0.0 | 0.1 | GO:1905049 | negative regulation of metalloendopeptidase activity(GO:1904684) negative regulation of metallopeptidase activity(GO:1905049) |
| 0.0 | 0.1 | GO:1904742 | regulation of telomeric DNA binding(GO:1904742) |
| 0.0 | 0.1 | GO:0006562 | proline catabolic process(GO:0006562) |
| 0.0 | 0.1 | GO:1902109 | negative regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902109) |
| 0.0 | 0.1 | GO:0060339 | negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
| 0.0 | 0.1 | GO:0097167 | circadian regulation of translation(GO:0097167) |
| 0.0 | 0.4 | GO:0006465 | signal peptide processing(GO:0006465) |
| 0.0 | 0.2 | GO:0019740 | nitrogen utilization(GO:0019740) |
| 0.0 | 0.4 | GO:0097352 | autophagosome maturation(GO:0097352) |
| 0.0 | 0.2 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
| 0.0 | 0.2 | GO:0032790 | ribosome disassembly(GO:0032790) |
| 0.0 | 0.2 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.0 | 0.1 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
| 0.0 | 0.3 | GO:0031440 | regulation of mRNA 3'-end processing(GO:0031440) |
| 0.0 | 0.0 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
| 0.0 | 0.1 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
| 0.0 | 0.1 | GO:0036498 | IRE1-mediated unfolded protein response(GO:0036498) regulation of IRE1-mediated unfolded protein response(GO:1903894) |
| 0.0 | 0.2 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 0.0 | 0.0 | GO:0097476 | motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) |
| 0.0 | 0.1 | GO:0070368 | positive regulation of hepatocyte differentiation(GO:0070368) |
| 0.0 | 0.3 | GO:0006388 | RNA splicing, via endonucleolytic cleavage and ligation(GO:0000394) tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.0 | 0.2 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.0 | 0.2 | GO:0033630 | positive regulation of cell adhesion mediated by integrin(GO:0033630) |
| 0.0 | 0.0 | GO:1901674 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
| 0.0 | 0.1 | GO:0046959 | habituation(GO:0046959) |
| 0.0 | 0.1 | GO:0033686 | positive regulation of luteinizing hormone secretion(GO:0033686) |
| 0.0 | 0.3 | GO:0030836 | positive regulation of actin filament depolymerization(GO:0030836) |
| 0.0 | 0.1 | GO:0047484 | regulation of response to osmotic stress(GO:0047484) |
| 0.0 | 0.1 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.0 | 0.1 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
| 0.0 | 0.1 | GO:0090091 | positive regulation of extracellular matrix disassembly(GO:0090091) |
| 0.0 | 0.1 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.0 | 0.1 | GO:0043247 | telomere maintenance in response to DNA damage(GO:0043247) |
| 0.0 | 0.1 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
| 0.0 | 0.1 | GO:0042167 | heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
| 0.0 | 0.2 | GO:0035509 | negative regulation of myosin-light-chain-phosphatase activity(GO:0035509) |
| 0.0 | 0.1 | GO:0071281 | cellular response to iron ion(GO:0071281) |
| 0.0 | 0.0 | GO:2000807 | regulation of synaptic vesicle clustering(GO:2000807) |
| 0.0 | 0.2 | GO:0060177 | regulation of angiotensin levels in blood(GO:0002002) regulation of angiotensin metabolic process(GO:0060177) |
| 0.0 | 0.0 | GO:0006591 | ornithine metabolic process(GO:0006591) |
| 0.0 | 0.3 | GO:0006098 | pentose-phosphate shunt(GO:0006098) |
| 0.0 | 0.1 | GO:0031999 | negative regulation of fatty acid beta-oxidation(GO:0031999) |
| 0.0 | 0.6 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
| 0.0 | 0.1 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) |
| 0.0 | 0.3 | GO:0006108 | malate metabolic process(GO:0006108) |
| 0.0 | 0.1 | GO:0033091 | positive regulation of immature T cell proliferation(GO:0033091) |
| 0.0 | 0.3 | GO:0045945 | positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
| 0.0 | 0.0 | GO:0071436 | sodium ion export from cell(GO:0036376) sodium ion export(GO:0071436) |
| 0.0 | 0.0 | GO:2000508 | regulation of dendritic cell chemotaxis(GO:2000508) |
| 0.0 | 0.1 | GO:0039692 | single stranded viral RNA replication via double stranded DNA intermediate(GO:0039692) negative regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045869) |
| 0.0 | 0.2 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 0.0 | 0.1 | GO:0061101 | neuroendocrine cell differentiation(GO:0061101) |
| 0.0 | 0.1 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
| 0.0 | 1.3 | GO:1904893 | negative regulation of JAK-STAT cascade(GO:0046426) negative regulation of STAT cascade(GO:1904893) |
| 0.0 | 0.1 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
| 0.0 | 1.6 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
| 0.0 | 0.4 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.0 | 0.2 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.0 | 0.6 | GO:0060074 | synapse maturation(GO:0060074) |
| 0.0 | 0.3 | GO:0006968 | cellular defense response(GO:0006968) |
| 0.0 | 0.0 | GO:0032512 | regulation of protein phosphatase type 2B activity(GO:0032512) negative regulation of protein phosphatase type 2B activity(GO:0032513) |
| 0.0 | 0.3 | GO:0010544 | negative regulation of platelet activation(GO:0010544) |
| 0.0 | 0.1 | GO:0035871 | protein K11-linked deubiquitination(GO:0035871) |
| 0.0 | 0.2 | GO:0071918 | urea transmembrane transport(GO:0071918) |
| 0.0 | 0.2 | GO:0060484 | lung-associated mesenchyme development(GO:0060484) |
| 0.0 | 0.1 | GO:0072178 | nephric duct development(GO:0072176) nephric duct morphogenesis(GO:0072178) |
| 0.0 | 0.1 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
| 0.0 | 0.1 | GO:0030421 | defecation(GO:0030421) |
| 0.0 | 0.1 | GO:0032786 | positive regulation of DNA-templated transcription, elongation(GO:0032786) |
| 0.0 | 0.2 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.0 | 0.3 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
| 0.0 | 0.1 | GO:0072076 | nephrogenic mesenchyme development(GO:0072076) |
| 0.0 | 0.1 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
| 0.0 | 0.3 | GO:0031269 | pseudopodium assembly(GO:0031269) |
| 0.0 | 0.0 | GO:0033629 | negative regulation of cell adhesion mediated by integrin(GO:0033629) |
| 0.0 | 0.1 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.0 | 0.0 | GO:2000338 | chemokine (C-X-C motif) ligand 1 production(GO:0072566) regulation of chemokine (C-X-C motif) ligand 1 production(GO:2000338) |
| 0.0 | 0.4 | GO:0031116 | positive regulation of microtubule polymerization(GO:0031116) |
| 0.0 | 0.0 | GO:0060375 | regulation of mast cell differentiation(GO:0060375) |
| 0.0 | 0.1 | GO:0042996 | regulation of Golgi to plasma membrane protein transport(GO:0042996) |
| 0.0 | 0.2 | GO:0005513 | detection of calcium ion(GO:0005513) |
| 0.0 | 0.1 | GO:0007529 | establishment of synaptic specificity at neuromuscular junction(GO:0007529) |
| 0.0 | 0.5 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
| 0.0 | 0.2 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 0.0 | 0.2 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
| 0.0 | 0.1 | GO:2000598 | regulation of cyclin catabolic process(GO:2000598) negative regulation of cyclin catabolic process(GO:2000599) |
| 0.0 | 0.1 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
| 0.0 | 0.1 | GO:0021523 | somatic motor neuron differentiation(GO:0021523) |
| 0.0 | 0.1 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
| 0.0 | 0.1 | GO:0036462 | TRAIL-activated apoptotic signaling pathway(GO:0036462) |
| 0.0 | 0.1 | GO:0033084 | regulation of immature T cell proliferation in thymus(GO:0033084) |
| 0.0 | 0.0 | GO:0071394 | cellular response to testosterone stimulus(GO:0071394) |
| 0.0 | 0.1 | GO:0045200 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
| 0.0 | 0.1 | GO:0070922 | small RNA loading onto RISC(GO:0070922) |
| 0.0 | 0.1 | GO:1903977 | positive regulation of glial cell migration(GO:1903977) |
| 0.0 | 0.1 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
| 0.0 | 0.2 | GO:0006103 | 2-oxoglutarate metabolic process(GO:0006103) |
| 0.0 | 0.1 | GO:0007258 | JUN phosphorylation(GO:0007258) |
| 0.0 | 0.1 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.0 | 0.0 | GO:0002725 | negative regulation of T cell cytokine production(GO:0002725) |
| 0.0 | 0.2 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.0 | 0.1 | GO:0005984 | disaccharide metabolic process(GO:0005984) |
| 0.0 | 0.1 | GO:0070986 | left/right axis specification(GO:0070986) |
| 0.0 | 0.1 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
| 0.0 | 0.1 | GO:0015868 | purine ribonucleotide transport(GO:0015868) |
| 0.0 | 0.1 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 0.0 | 0.1 | GO:0006924 | activation-induced cell death of T cells(GO:0006924) |
| 0.0 | 1.3 | GO:0045454 | cell redox homeostasis(GO:0045454) |
| 0.0 | 0.1 | GO:0007000 | nucleolus organization(GO:0007000) |
| 0.0 | 0.1 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.0 | 0.1 | GO:0090160 | Golgi to lysosome transport(GO:0090160) |
| 0.0 | 0.4 | GO:0032801 | receptor catabolic process(GO:0032801) |
| 0.0 | 0.2 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
| 0.0 | 0.0 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
| 0.0 | 0.2 | GO:0003338 | metanephros morphogenesis(GO:0003338) |
| 0.0 | 0.1 | GO:0036089 | cleavage furrow formation(GO:0036089) |
| 0.0 | 0.2 | GO:0002176 | male germ cell proliferation(GO:0002176) |
| 0.0 | 0.1 | GO:0007638 | mechanosensory behavior(GO:0007638) |
| 0.0 | 0.1 | GO:1900227 | positive regulation of NLRP3 inflammasome complex assembly(GO:1900227) |
| 0.0 | 0.1 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
| 0.0 | 0.1 | GO:0000492 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
| 0.0 | 0.1 | GO:1902837 | amino acid import into cell(GO:1902837) |
| 0.0 | 0.1 | GO:1903972 | regulation of macrophage colony-stimulating factor signaling pathway(GO:1902226) regulation of response to macrophage colony-stimulating factor(GO:1903969) regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903972) |
| 0.0 | 0.1 | GO:0032367 | intracellular cholesterol transport(GO:0032367) |
| 0.0 | 0.1 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
| 0.0 | 0.1 | GO:0009597 | detection of virus(GO:0009597) |
| 0.0 | 0.2 | GO:0030157 | pancreatic juice secretion(GO:0030157) |
| 0.0 | 0.1 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
| 0.0 | 0.1 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
| 0.0 | 0.5 | GO:0008089 | anterograde axonal transport(GO:0008089) |
| 0.0 | 0.3 | GO:0006198 | cAMP catabolic process(GO:0006198) |
| 0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.1 | GO:0046477 | glycosylceramide catabolic process(GO:0046477) |
| 0.0 | 0.1 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
| 0.0 | 0.1 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
| 0.0 | 0.1 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
| 0.0 | 0.1 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.0 | 0.3 | GO:0051383 | kinetochore organization(GO:0051383) |
| 0.0 | 0.1 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
| 0.0 | 0.2 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
| 0.0 | 0.1 | GO:0009249 | protein lipoylation(GO:0009249) |
| 0.0 | 0.0 | GO:0010958 | regulation of amino acid import(GO:0010958) |
| 0.0 | 0.1 | GO:0017121 | phospholipid scrambling(GO:0017121) |
| 0.0 | 0.1 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
| 0.0 | 0.6 | GO:0032467 | positive regulation of cytokinesis(GO:0032467) |
| 0.0 | 0.1 | GO:0045084 | positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
| 0.0 | 0.8 | GO:0033141 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
| 0.0 | 0.1 | GO:0070633 | transepithelial transport(GO:0070633) |
| 0.0 | 0.1 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
| 0.0 | 0.0 | GO:0044531 | modulation of programmed cell death in other organism(GO:0044531) modulation of apoptotic process in other organism(GO:0044532) modulation by symbiont of host programmed cell death(GO:0052040) modulation by symbiont of host apoptotic process(GO:0052150) modulation of programmed cell death in other organism involved in symbiotic interaction(GO:0052248) modulation by organism of apoptotic process in other organism involved in symbiotic interaction(GO:0052433) |
| 0.0 | 0.2 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
| 0.0 | 0.2 | GO:0006828 | manganese ion transport(GO:0006828) |
| 0.0 | 0.2 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
| 0.0 | 0.1 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
| 0.0 | 0.1 | GO:0045046 | peroxisomal membrane transport(GO:0015919) protein import into peroxisome membrane(GO:0045046) |
| 0.0 | 0.0 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
| 0.0 | 0.1 | GO:0032474 | otolith morphogenesis(GO:0032474) |
| 0.0 | 0.1 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.0 | 0.0 | GO:2000347 | positive regulation of hepatocyte proliferation(GO:2000347) |
| 0.0 | 0.2 | GO:0006335 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.0 | 0.1 | GO:0071670 | smooth muscle cell chemotaxis(GO:0071670) |
| 0.0 | 0.0 | GO:0060546 | negative regulation of necroptotic process(GO:0060546) |
| 0.0 | 0.1 | GO:0061724 | lipophagy(GO:0061724) |
| 0.0 | 0.1 | GO:0045213 | neurotransmitter receptor metabolic process(GO:0045213) |
| 0.0 | 0.0 | GO:0015747 | urate transport(GO:0015747) |
| 0.0 | 0.0 | GO:0003348 | cardiac endothelial cell differentiation(GO:0003348) |
| 0.0 | 0.1 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
| 0.0 | 0.1 | GO:2000341 | regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000341) |
| 0.0 | 0.2 | GO:0006337 | nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
| 0.0 | 0.1 | GO:0071223 | response to lipoteichoic acid(GO:0070391) cellular response to lipoteichoic acid(GO:0071223) |
| 0.0 | 0.1 | GO:0009650 | UV protection(GO:0009650) |
| 0.0 | 0.1 | GO:0097152 | mesenchymal cell apoptotic process(GO:0097152) |
| 0.0 | 0.2 | GO:0006691 | leukotriene metabolic process(GO:0006691) |
| 0.0 | 0.5 | GO:0048240 | sperm capacitation(GO:0048240) |
| 0.0 | 0.1 | GO:0018230 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.0 | 0.1 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
| 0.0 | 0.2 | GO:0035095 | behavioral response to nicotine(GO:0035095) |
| 0.0 | 0.1 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
| 0.0 | 0.0 | GO:0060399 | regulation of growth hormone receptor signaling pathway(GO:0060398) positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
| 0.0 | 0.2 | GO:2000757 | negative regulation of peptidyl-lysine acetylation(GO:2000757) |
| 0.0 | 0.1 | GO:0090166 | Golgi disassembly(GO:0090166) |
| 0.0 | 0.2 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.0 | 0.0 | GO:0070487 | monocyte aggregation(GO:0070487) |
| 0.0 | 0.1 | GO:0033572 | transferrin transport(GO:0033572) |
| 0.0 | 0.1 | GO:0071692 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
| 0.0 | 0.0 | GO:0023035 | CD40 signaling pathway(GO:0023035) |
| 0.0 | 0.0 | GO:0015705 | iodide transport(GO:0015705) |
| 0.0 | 0.5 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
| 0.0 | 0.0 | GO:0010520 | regulation of reciprocal meiotic recombination(GO:0010520) |
| 0.0 | 0.2 | GO:1900151 | regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
| 0.0 | 0.1 | GO:0019511 | peptidyl-proline hydroxylation(GO:0019511) |
| 0.0 | 0.1 | GO:0042448 | progesterone metabolic process(GO:0042448) |
| 0.0 | 0.4 | GO:2000142 | regulation of DNA-templated transcription, initiation(GO:2000142) |
| 0.0 | 0.0 | GO:0035633 | maintenance of blood-brain barrier(GO:0035633) |
| 0.0 | 0.0 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.0 | 0.1 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) |
| 0.0 | 0.1 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
| 0.0 | 0.2 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
| 0.0 | 0.1 | GO:1902571 | regulation of serine-type endopeptidase activity(GO:1900003) negative regulation of serine-type endopeptidase activity(GO:1900004) regulation of serine-type peptidase activity(GO:1902571) negative regulation of serine-type peptidase activity(GO:1902572) |
| 0.0 | 0.2 | GO:0097150 | neuronal stem cell population maintenance(GO:0097150) |
| 0.0 | 0.4 | GO:0043666 | regulation of phosphoprotein phosphatase activity(GO:0043666) |
| 0.0 | 0.0 | GO:0055059 | asymmetric neuroblast division(GO:0055059) |
| 0.0 | 0.1 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.0 | 0.0 | GO:0035581 | sequestering of extracellular ligand from receptor(GO:0035581) extracellular regulation of signal transduction(GO:1900115) extracellular negative regulation of signal transduction(GO:1900116) |
| 0.0 | 0.3 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
| 0.0 | 0.0 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
| 0.0 | 0.1 | GO:0033860 | regulation of NAD(P)H oxidase activity(GO:0033860) |
| 0.0 | 0.1 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
| 0.0 | 0.1 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
| 0.0 | 0.0 | GO:0061626 | pharyngeal arch artery morphogenesis(GO:0061626) |
| 0.0 | 0.1 | GO:1901475 | pyruvate transmembrane transport(GO:1901475) |
| 0.0 | 0.4 | GO:0019369 | arachidonic acid metabolic process(GO:0019369) |
| 0.0 | 0.0 | GO:0030241 | skeletal muscle myosin thick filament assembly(GO:0030241) striated muscle myosin thick filament assembly(GO:0071688) |
| 0.0 | 0.1 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.0 | 0.1 | GO:0032288 | myelin assembly(GO:0032288) |
| 0.0 | 0.0 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
| 0.0 | 0.1 | GO:0045006 | DNA deamination(GO:0045006) polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
| 0.0 | 0.0 | GO:0048703 | embryonic viscerocranium morphogenesis(GO:0048703) |
| 0.0 | 0.1 | GO:0033014 | porphyrin-containing compound biosynthetic process(GO:0006779) tetrapyrrole biosynthetic process(GO:0033014) |
| 0.0 | 0.2 | GO:0070884 | regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
| 0.0 | 0.0 | GO:0045901 | positive regulation of translational elongation(GO:0045901) |
| 0.0 | 0.0 | GO:0001996 | positive regulation of heart rate by epinephrine-norepinephrine(GO:0001996) |
| 0.0 | 0.1 | GO:0060352 | cell adhesion molecule production(GO:0060352) |
| 0.0 | 0.4 | GO:2001014 | regulation of skeletal muscle cell differentiation(GO:2001014) |
| 0.0 | 0.1 | GO:0002070 | epithelial cell maturation(GO:0002070) |
| 0.0 | 0.1 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
| 0.0 | 0.1 | GO:0006768 | biotin metabolic process(GO:0006768) |
| 0.0 | 0.0 | GO:1901492 | positive regulation of lymphangiogenesis(GO:1901492) |
| 0.0 | 0.1 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.0 | 0.1 | GO:0033120 | positive regulation of RNA splicing(GO:0033120) |
| 0.0 | 0.1 | GO:0002175 | protein localization to paranode region of axon(GO:0002175) |
| 0.0 | 0.5 | GO:0006367 | transcription initiation from RNA polymerase II promoter(GO:0006367) |
| 0.0 | 0.0 | GO:0072553 | terminal button organization(GO:0072553) |
| 0.0 | 0.0 | GO:0045112 | integrin biosynthetic process(GO:0045112) |
| 0.0 | 0.1 | GO:0003084 | positive regulation of systemic arterial blood pressure(GO:0003084) |
| 0.0 | 0.0 | GO:0051138 | regulation of NK T cell differentiation(GO:0051136) positive regulation of NK T cell differentiation(GO:0051138) |
| 0.0 | 0.1 | GO:0033132 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.0 | 0.3 | GO:0070670 | response to interleukin-4(GO:0070670) |
| 0.0 | 0.1 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
| 0.0 | 0.2 | GO:0021871 | forebrain regionalization(GO:0021871) |
| 0.0 | 0.5 | GO:0006334 | nucleosome assembly(GO:0006334) |
| 0.0 | 0.0 | GO:0015865 | purine nucleotide transport(GO:0015865) |
| 0.0 | 0.0 | GO:0009946 | proximal/distal axis specification(GO:0009946) |
| 0.0 | 0.3 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
| 0.0 | 0.0 | GO:0051084 | 'de novo' protein folding(GO:0006458) 'de novo' posttranslational protein folding(GO:0051084) |
| 0.0 | 0.3 | GO:0006308 | DNA catabolic process(GO:0006308) |
| 0.0 | 0.0 | GO:0000022 | mitotic spindle elongation(GO:0000022) mitotic spindle midzone assembly(GO:0051256) |
| 0.0 | 0.2 | GO:0042711 | maternal behavior(GO:0042711) |
| 0.0 | 0.1 | GO:0046485 | ether lipid metabolic process(GO:0046485) |
| 0.0 | 0.1 | GO:0042789 | mRNA transcription from RNA polymerase II promoter(GO:0042789) |
| 0.0 | 0.1 | GO:0009109 | coenzyme catabolic process(GO:0009109) |
| 0.0 | 0.0 | GO:0060346 | bone trabecula formation(GO:0060346) |
| 0.0 | 0.1 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
| 0.0 | 0.1 | GO:0010666 | positive regulation of striated muscle cell apoptotic process(GO:0010663) positive regulation of cardiac muscle cell apoptotic process(GO:0010666) |
| 0.0 | 0.1 | GO:0000270 | peptidoglycan metabolic process(GO:0000270) peptidoglycan catabolic process(GO:0009253) |
| 0.0 | 0.1 | GO:0006451 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.0 | 0.1 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
| 0.0 | 0.1 | GO:0016115 | terpenoid catabolic process(GO:0016115) |
| 0.0 | 0.1 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
| 0.0 | 0.1 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
| 0.0 | 0.1 | GO:0032667 | interleukin-23 production(GO:0032627) regulation of interleukin-23 production(GO:0032667) |
| 0.0 | 0.1 | GO:0060287 | epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
| 0.0 | 0.0 | GO:0060766 | negative regulation of androgen receptor signaling pathway(GO:0060766) |
| 0.0 | 0.1 | GO:0045048 | protein insertion into ER membrane(GO:0045048) tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
| 0.0 | 0.1 | GO:0042590 | antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
| 0.0 | 0.1 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
| 0.0 | 0.1 | GO:0015871 | choline transport(GO:0015871) |
| 0.0 | 0.0 | GO:0051231 | spindle elongation(GO:0051231) |
| 0.0 | 0.1 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
| 0.0 | 0.0 | GO:0001757 | somite specification(GO:0001757) |
| 0.0 | 0.3 | GO:0030520 | intracellular estrogen receptor signaling pathway(GO:0030520) |
| 0.0 | 0.3 | GO:0000381 | regulation of alternative mRNA splicing, via spliceosome(GO:0000381) |
| 0.0 | 0.1 | GO:1902254 | negative regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902254) |
| 0.0 | 0.0 | GO:0060596 | mammary placode formation(GO:0060596) |
| 0.0 | 0.0 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
| 0.0 | 0.1 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
| 0.0 | 0.2 | GO:0048538 | thymus development(GO:0048538) |
| 0.0 | 0.0 | GO:0006015 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.0 | 0.1 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
| 0.0 | 0.1 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
| 0.0 | 0.1 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
| 0.0 | 0.0 | GO:1901857 | positive regulation of cellular respiration(GO:1901857) |
| 0.0 | 0.1 | GO:0016479 | negative regulation of transcription from RNA polymerase I promoter(GO:0016479) |
| 0.0 | 0.0 | GO:2000381 | negative regulation of mesoderm development(GO:2000381) |
| 0.0 | 0.0 | GO:0090135 | actin filament branching(GO:0090135) |
| 0.0 | 0.0 | GO:0042940 | D-amino acid transport(GO:0042940) |
| 0.0 | 0.0 | GO:0038003 | opioid receptor signaling pathway(GO:0038003) |
| 0.0 | 0.1 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
| 0.0 | 0.1 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
| 0.0 | 0.0 | GO:0033173 | calcineurin-NFAT signaling cascade(GO:0033173) |
| 0.0 | 0.1 | GO:0021756 | striatum development(GO:0021756) |
| 0.0 | 0.1 | GO:0043206 | extracellular fibril organization(GO:0043206) |
| 0.0 | 0.0 | GO:0015670 | carbon dioxide transport(GO:0015670) |
| 0.0 | 0.0 | GO:0035106 | operant conditioning(GO:0035106) |
| 0.0 | 0.1 | GO:0016266 | O-glycan processing(GO:0016266) |
| 0.0 | 0.0 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
| 0.0 | 0.0 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
| 0.0 | 0.2 | GO:0045026 | plasma membrane fusion(GO:0045026) |
| 0.0 | 0.1 | GO:0007096 | regulation of exit from mitosis(GO:0007096) |
| 0.0 | 0.1 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
| 0.0 | 0.1 | GO:0043174 | nucleoside salvage(GO:0043174) |
| 0.0 | 0.1 | GO:0035188 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
| 0.0 | 0.0 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
| 0.0 | 0.0 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
| 0.0 | 0.1 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
| 0.0 | 0.2 | GO:0015693 | magnesium ion transport(GO:0015693) |
| 0.0 | 0.1 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
| 0.0 | 0.0 | GO:0061370 | testosterone biosynthetic process(GO:0061370) |
| 0.0 | 0.2 | GO:0061462 | protein localization to lysosome(GO:0061462) |
| 0.0 | 0.0 | GO:0007501 | mesodermal cell fate specification(GO:0007501) |
| 0.0 | 0.3 | GO:0016578 | histone deubiquitination(GO:0016578) |
| 0.0 | 0.0 | GO:1903238 | positive regulation of leukocyte tethering or rolling(GO:1903238) |
| 0.0 | 0.1 | GO:0015813 | L-glutamate transport(GO:0015813) |
| 0.0 | 0.3 | GO:0006400 | tRNA modification(GO:0006400) |
| 0.0 | 0.1 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
| 0.0 | 0.2 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
| 0.0 | 0.3 | GO:0061077 | chaperone-mediated protein folding(GO:0061077) |
| 0.0 | 0.0 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
| 0.0 | 0.0 | GO:0001539 | cilium or flagellum-dependent cell motility(GO:0001539) cilium-dependent cell motility(GO:0060285) |
| 0.0 | 0.2 | GO:0051180 | vitamin transport(GO:0051180) |
| 0.0 | 0.1 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
| 0.0 | 0.0 | GO:0010832 | negative regulation of myotube differentiation(GO:0010832) |
| 0.0 | 0.1 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.0 | 0.0 | GO:0060746 | parental behavior(GO:0060746) |
| 0.0 | 0.1 | GO:0035457 | cellular response to interferon-alpha(GO:0035457) |
| 0.0 | 0.1 | GO:0032224 | positive regulation of synaptic transmission, cholinergic(GO:0032224) |
| 0.0 | 0.0 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
| 0.0 | 0.0 | GO:1902308 | regulation of peptidyl-serine dephosphorylation(GO:1902308) |
| 0.0 | 0.3 | GO:0006270 | DNA replication initiation(GO:0006270) |
| 0.0 | 0.2 | GO:0050684 | regulation of mRNA processing(GO:0050684) |
| 0.0 | 0.0 | GO:0019896 | axonal transport of mitochondrion(GO:0019896) |
| 0.0 | 0.0 | GO:1902177 | positive regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902177) |
| 0.0 | 0.0 | GO:0060406 | positive regulation of penile erection(GO:0060406) |
| 0.0 | 0.1 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.0 | 0.0 | GO:0046952 | ketone body catabolic process(GO:0046952) |
| 0.0 | 0.4 | GO:0006687 | glycosphingolipid metabolic process(GO:0006687) |
| 0.0 | 0.0 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
| 0.0 | 0.0 | GO:0009128 | purine nucleoside monophosphate catabolic process(GO:0009128) |
| 0.0 | 0.1 | GO:0046037 | GMP metabolic process(GO:0046037) |
| 0.0 | 0.1 | GO:0006901 | vesicle coating(GO:0006901) |
| 0.0 | 0.0 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
| 0.0 | 0.0 | GO:0021542 | dentate gyrus development(GO:0021542) |
| 0.0 | 0.1 | GO:0006353 | DNA-templated transcription, termination(GO:0006353) |
| 0.0 | 0.0 | GO:2000535 | entry of bacterium into host cell(GO:0035635) regulation of entry of bacterium into host cell(GO:2000535) |
| 0.0 | 0.1 | GO:0031937 | positive regulation of chromatin silencing(GO:0031937) |
| 0.0 | 0.0 | GO:0035279 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
| 0.0 | 0.2 | GO:0018345 | protein palmitoylation(GO:0018345) |
| 0.0 | 0.0 | GO:0050427 | 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
| 0.0 | 0.1 | GO:0021801 | cerebral cortex radial glia guided migration(GO:0021801) telencephalon glial cell migration(GO:0022030) |
| 0.0 | 0.0 | GO:1902414 | protein localization to cell junction(GO:1902414) |
| 0.0 | 0.1 | GO:0033127 | regulation of histone phosphorylation(GO:0033127) positive regulation of histone phosphorylation(GO:0033129) |
| 0.0 | 0.1 | GO:0015824 | proline transport(GO:0015824) |
| 0.0 | 0.0 | GO:0015842 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.0 | 0.1 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.0 | 0.0 | GO:0099515 | actin filament-based transport(GO:0099515) |
| 0.0 | 0.2 | GO:0060046 | regulation of acrosome reaction(GO:0060046) |
| 0.0 | 0.0 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
| 0.0 | 0.0 | GO:0007191 | adenylate cyclase-activating dopamine receptor signaling pathway(GO:0007191) |
| 0.0 | 0.1 | GO:0032099 | negative regulation of appetite(GO:0032099) |
| 0.0 | 0.2 | GO:0007274 | neuromuscular synaptic transmission(GO:0007274) |
| 0.0 | 0.0 | GO:0006570 | tyrosine metabolic process(GO:0006570) |
| 0.0 | 0.0 | GO:0090191 | negative regulation of branching involved in ureteric bud morphogenesis(GO:0090191) |
| 0.0 | 0.0 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
| 0.0 | 0.0 | GO:1903358 | constitutive secretory pathway(GO:0045054) regulation of Golgi organization(GO:1903358) |
| 0.0 | 0.0 | GO:0042402 | cellular biogenic amine catabolic process(GO:0042402) |
| 0.0 | 0.1 | GO:0019886 | antigen processing and presentation of exogenous peptide antigen via MHC class II(GO:0019886) |
| 0.0 | 0.0 | GO:0006624 | vacuolar protein processing(GO:0006624) |
| 0.0 | 0.2 | GO:0006414 | translational elongation(GO:0006414) |
| 0.0 | 0.1 | GO:0010640 | regulation of platelet-derived growth factor receptor signaling pathway(GO:0010640) |
| 0.0 | 0.0 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.0 | 0.1 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.0 | 0.0 | GO:0010288 | response to lead ion(GO:0010288) |
| 0.0 | 0.0 | GO:0015860 | purine nucleoside transmembrane transport(GO:0015860) purine-containing compound transmembrane transport(GO:0072530) nucleoside transmembrane transport(GO:1901642) |
| 0.0 | 0.0 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
| 0.0 | 0.0 | GO:0045345 | MHC class I biosynthetic process(GO:0045341) regulation of MHC class I biosynthetic process(GO:0045343) positive regulation of MHC class I biosynthetic process(GO:0045345) |
| 0.0 | 0.0 | GO:0031282 | regulation of guanylate cyclase activity(GO:0031282) |
| 0.0 | 0.0 | GO:0040031 | snRNA modification(GO:0040031) |
| 0.0 | 0.0 | GO:0002727 | natural killer cell cytokine production(GO:0002370) regulation of natural killer cell cytokine production(GO:0002727) |
| 0.0 | 0.1 | GO:0043116 | negative regulation of vascular permeability(GO:0043116) |
| 0.0 | 0.1 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
| 0.0 | 0.0 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 0.0 | 0.1 | GO:0008343 | adult feeding behavior(GO:0008343) |
| 0.0 | 0.2 | GO:0032465 | regulation of cytokinesis(GO:0032465) |
| 0.0 | 0.0 | GO:0006528 | asparagine metabolic process(GO:0006528) |
| 0.0 | 0.0 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
| 0.0 | 0.0 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
| 0.0 | 0.1 | GO:0001878 | response to yeast(GO:0001878) |
| 0.0 | 0.0 | GO:0070272 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
| 0.0 | 0.1 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
| 0.0 | 0.0 | GO:0035090 | maintenance of cell polarity(GO:0030011) maintenance of apical/basal cell polarity(GO:0035090) |
| 0.0 | 0.0 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
| 0.0 | 0.0 | GO:0007220 | Notch receptor processing(GO:0007220) |
| 0.0 | 0.0 | GO:0010613 | positive regulation of cardiac muscle hypertrophy(GO:0010613) positive regulation of muscle hypertrophy(GO:0014742) |
| 0.0 | 0.0 | GO:1900102 | negative regulation of endoplasmic reticulum unfolded protein response(GO:1900102) |
| 0.0 | 0.0 | GO:1903677 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.0 | 0.0 | GO:0048050 | post-embryonic eye morphogenesis(GO:0048050) |
| 0.0 | 0.1 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.0 | 0.0 | GO:0060298 | positive regulation of sarcomere organization(GO:0060298) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.8 | 5.4 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
| 0.4 | 1.8 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.4 | 2.0 | GO:0045098 | type III intermediate filament(GO:0045098) |
| 0.4 | 1.5 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
| 0.3 | 1.3 | GO:1990130 | Iml1 complex(GO:1990130) |
| 0.3 | 1.7 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.3 | 1.1 | GO:0044316 | cone cell pedicle(GO:0044316) |
| 0.3 | 1.3 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.3 | 0.8 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
| 0.2 | 0.9 | GO:0045293 | mRNA editing complex(GO:0045293) |
| 0.2 | 1.1 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 0.2 | 0.6 | GO:0097441 | basilar dendrite(GO:0097441) |
| 0.2 | 0.7 | GO:0070545 | PeBoW complex(GO:0070545) |
| 0.2 | 1.8 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.2 | 0.5 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
| 0.2 | 0.8 | GO:0005579 | membrane attack complex(GO:0005579) |
| 0.1 | 0.7 | GO:0045180 | basal cortex(GO:0045180) |
| 0.1 | 0.7 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
| 0.1 | 0.4 | GO:0033647 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
| 0.1 | 2.2 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
| 0.1 | 0.5 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.1 | 0.1 | GO:0000125 | PCAF complex(GO:0000125) |
| 0.1 | 0.5 | GO:0030127 | COPII vesicle coat(GO:0030127) |
| 0.1 | 1.2 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.1 | 0.6 | GO:0071458 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) |
| 0.1 | 0.3 | GO:0071256 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
| 0.1 | 0.3 | GO:0005608 | laminin-3 complex(GO:0005608) |
| 0.1 | 0.8 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
| 0.1 | 0.3 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.1 | 1.3 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.1 | 0.3 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
| 0.1 | 0.4 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.1 | 0.6 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
| 0.1 | 0.1 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
| 0.1 | 0.3 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.1 | 0.3 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
| 0.1 | 0.3 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
| 0.1 | 0.2 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
| 0.1 | 0.3 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
| 0.1 | 0.6 | GO:0002177 | manchette(GO:0002177) |
| 0.1 | 0.4 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
| 0.1 | 4.2 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.1 | 0.4 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
| 0.1 | 1.1 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.1 | 1.5 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.1 | 0.4 | GO:0097524 | sperm plasma membrane(GO:0097524) |
| 0.1 | 0.3 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
| 0.1 | 1.3 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
| 0.1 | 0.4 | GO:0016342 | catenin complex(GO:0016342) |
| 0.1 | 1.5 | GO:0043034 | costamere(GO:0043034) |
| 0.1 | 0.3 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
| 0.1 | 0.3 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.1 | 0.7 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
| 0.1 | 0.2 | GO:0005745 | m-AAA complex(GO:0005745) |
| 0.1 | 0.7 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.1 | 0.2 | GO:0097413 | Lewy body(GO:0097413) |
| 0.1 | 0.2 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
| 0.1 | 0.2 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
| 0.1 | 0.2 | GO:0048179 | activin receptor complex(GO:0048179) |
| 0.1 | 0.6 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.1 | 0.4 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.1 | 1.0 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
| 0.1 | 0.6 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
| 0.1 | 0.3 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| 0.1 | 0.5 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.1 | 0.8 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.1 | 3.0 | GO:0005747 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
| 0.1 | 0.2 | GO:0016442 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
| 0.1 | 0.2 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
| 0.1 | 0.4 | GO:0042824 | MHC class I peptide loading complex(GO:0042824) |
| 0.1 | 0.5 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.1 | 0.3 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
| 0.1 | 1.4 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.1 | 0.2 | GO:0005879 | axonemal microtubule(GO:0005879) |
| 0.1 | 0.6 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.1 | 0.4 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
| 0.1 | 0.4 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
| 0.1 | 0.4 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.1 | 0.9 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) |
| 0.1 | 0.6 | GO:0034719 | SMN-Sm protein complex(GO:0034719) |
| 0.1 | 0.2 | GO:0055087 | Ski complex(GO:0055087) |
| 0.1 | 2.1 | GO:0032838 | cell projection cytoplasm(GO:0032838) |
| 0.1 | 0.2 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
| 0.1 | 0.1 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
| 0.1 | 0.2 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
| 0.1 | 0.5 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.1 | 0.2 | GO:0035838 | growing cell tip(GO:0035838) |
| 0.1 | 0.2 | GO:0070765 | gamma-secretase complex(GO:0070765) |
| 0.1 | 0.3 | GO:0030891 | VCB complex(GO:0030891) |
| 0.1 | 0.4 | GO:0097342 | ripoptosome(GO:0097342) |
| 0.1 | 0.2 | GO:0032585 | multivesicular body membrane(GO:0032585) |
| 0.1 | 0.2 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.1 | 0.2 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
| 0.1 | 0.8 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.1 | 0.5 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
| 0.1 | 1.0 | GO:0005685 | U1 snRNP(GO:0005685) |
| 0.1 | 0.1 | GO:0030128 | clathrin coat of endocytic vesicle(GO:0030128) |
| 0.1 | 0.4 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.1 | 0.1 | GO:0098827 | endoplasmic reticulum subcompartment(GO:0098827) |
| 0.1 | 0.4 | GO:0070578 | RISC-loading complex(GO:0070578) |
| 0.1 | 0.1 | GO:0005712 | chiasma(GO:0005712) |
| 0.1 | 0.8 | GO:0005746 | mitochondrial respiratory chain(GO:0005746) |
| 0.1 | 0.3 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
| 0.1 | 0.1 | GO:0016939 | kinesin II complex(GO:0016939) |
| 0.1 | 0.2 | GO:0031258 | lamellipodium membrane(GO:0031258) |
| 0.1 | 0.5 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
| 0.1 | 0.5 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
| 0.1 | 0.2 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
| 0.1 | 1.7 | GO:0031672 | A band(GO:0031672) |
| 0.1 | 0.4 | GO:0070187 | telosome(GO:0070187) |
| 0.1 | 0.2 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.1 | 0.2 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.1 | 0.4 | GO:0016600 | flotillin complex(GO:0016600) |
| 0.1 | 0.4 | GO:0001650 | fibrillar center(GO:0001650) |
| 0.1 | 1.0 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.1 | 0.4 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 0.1 | 0.2 | GO:0043202 | lysosomal lumen(GO:0043202) |
| 0.1 | 0.2 | GO:0045261 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
| 0.1 | 0.2 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
| 0.1 | 0.5 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.1 | 0.8 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
| 0.0 | 0.4 | GO:0031211 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
| 0.0 | 0.1 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
| 0.0 | 0.1 | GO:0036449 | microtubule minus-end(GO:0036449) |
| 0.0 | 1.6 | GO:0031903 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
| 0.0 | 0.3 | GO:0000306 | extrinsic component of vacuolar membrane(GO:0000306) |
| 0.0 | 1.9 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
| 0.0 | 0.7 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.0 | 0.2 | GO:0005638 | lamin filament(GO:0005638) |
| 0.0 | 0.5 | GO:0001527 | microfibril(GO:0001527) |
| 0.0 | 0.2 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
| 0.0 | 0.1 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
| 0.0 | 0.1 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.0 | 0.3 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 0.0 | 0.1 | GO:0005606 | laminin-1 complex(GO:0005606) |
| 0.0 | 0.4 | GO:0005682 | U5 snRNP(GO:0005682) |
| 0.0 | 0.1 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.0 | 0.6 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.0 | 0.5 | GO:0010369 | chromocenter(GO:0010369) |
| 0.0 | 0.1 | GO:0097433 | dense body(GO:0097433) |
| 0.0 | 0.1 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.0 | 0.3 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
| 0.0 | 0.1 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.0 | 0.5 | GO:0032426 | stereocilium tip(GO:0032426) |
| 0.0 | 0.0 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
| 0.0 | 0.4 | GO:0000346 | transcription export complex(GO:0000346) |
| 0.0 | 0.2 | GO:0031094 | platelet dense tubular network(GO:0031094) |
| 0.0 | 0.2 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
| 0.0 | 0.1 | GO:0043256 | laminin-5 complex(GO:0005610) laminin complex(GO:0043256) |
| 0.0 | 0.2 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
| 0.0 | 0.2 | GO:0032389 | MutLalpha complex(GO:0032389) |
| 0.0 | 0.2 | GO:0098536 | deuterosome(GO:0098536) |
| 0.0 | 0.2 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 0.0 | 0.3 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.0 | 0.4 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
| 0.0 | 0.1 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.0 | 0.6 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.0 | 0.1 | GO:0071942 | XPC complex(GO:0071942) |
| 0.0 | 0.2 | GO:0034704 | calcium channel complex(GO:0034704) |
| 0.0 | 0.2 | GO:0000796 | condensin complex(GO:0000796) |
| 0.0 | 0.9 | GO:0031201 | SNARE complex(GO:0031201) |
| 0.0 | 1.1 | GO:0030532 | small nuclear ribonucleoprotein complex(GO:0030532) |
| 0.0 | 0.9 | GO:0005637 | nuclear inner membrane(GO:0005637) |
| 0.0 | 0.2 | GO:0000791 | euchromatin(GO:0000791) |
| 0.0 | 0.7 | GO:0005719 | nuclear euchromatin(GO:0005719) |
| 0.0 | 0.4 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 0.0 | 0.2 | GO:0032009 | early phagosome(GO:0032009) |
| 0.0 | 0.0 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
| 0.0 | 0.4 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.0 | 0.1 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.0 | 0.1 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.0 | 0.4 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
| 0.0 | 0.1 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
| 0.0 | 0.3 | GO:0031528 | microvillus membrane(GO:0031528) |
| 0.0 | 0.1 | GO:0030478 | actin cap(GO:0030478) |
| 0.0 | 0.4 | GO:0098533 | ATPase dependent transmembrane transport complex(GO:0098533) |
| 0.0 | 0.1 | GO:0044308 | axonal spine(GO:0044308) |
| 0.0 | 0.2 | GO:0070688 | MLL5-L complex(GO:0070688) |
| 0.0 | 0.1 | GO:0005828 | kinetochore microtubule(GO:0005828) |
| 0.0 | 0.2 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.0 | 0.1 | GO:0070069 | cytochrome complex(GO:0070069) |
| 0.0 | 0.7 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.0 | 0.3 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.0 | 0.1 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
| 0.0 | 0.1 | GO:0042575 | DNA polymerase complex(GO:0042575) |
| 0.0 | 0.5 | GO:0030665 | clathrin-coated vesicle membrane(GO:0030665) |
| 0.0 | 0.4 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.0 | 0.1 | GO:1990357 | terminal web(GO:1990357) |
| 0.0 | 0.4 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
| 0.0 | 0.7 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.0 | 0.3 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
| 0.0 | 0.8 | GO:0005801 | cis-Golgi network(GO:0005801) |
| 0.0 | 0.3 | GO:0036156 | inner dynein arm(GO:0036156) |
| 0.0 | 0.3 | GO:0005583 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.0 | 0.2 | GO:0071986 | Ragulator complex(GO:0071986) |
| 0.0 | 0.3 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
| 0.0 | 0.1 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
| 0.0 | 0.2 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.0 | 0.2 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
| 0.0 | 0.2 | GO:0031512 | motile primary cilium(GO:0031512) |
| 0.0 | 0.2 | GO:0033263 | CORVET complex(GO:0033263) |
| 0.0 | 0.1 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.0 | 0.2 | GO:0098563 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
| 0.0 | 0.1 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
| 0.0 | 0.1 | GO:0072534 | perineuronal net(GO:0072534) |
| 0.0 | 0.1 | GO:0070939 | Dsl1p complex(GO:0070939) |
| 0.0 | 0.1 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.0 | 0.1 | GO:0031415 | NatA complex(GO:0031415) |
| 0.0 | 0.1 | GO:0045239 | tricarboxylic acid cycle enzyme complex(GO:0045239) |
| 0.0 | 0.1 | GO:0097422 | tubular endosome(GO:0097422) |
| 0.0 | 0.3 | GO:0043196 | varicosity(GO:0043196) |
| 0.0 | 0.8 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.0 | 0.1 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.0 | 0.2 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.0 | 0.1 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
| 0.0 | 0.1 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.0 | 0.4 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
| 0.0 | 1.4 | GO:0016363 | nuclear matrix(GO:0016363) |
| 0.0 | 0.1 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
| 0.0 | 0.2 | GO:0042613 | MHC class II protein complex(GO:0042613) |
| 0.0 | 0.2 | GO:0031305 | intrinsic component of mitochondrial inner membrane(GO:0031304) integral component of mitochondrial inner membrane(GO:0031305) |
| 0.0 | 1.1 | GO:0016605 | PML body(GO:0016605) |
| 0.0 | 0.1 | GO:0072487 | MSL complex(GO:0072487) |
| 0.0 | 0.1 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
| 0.0 | 0.0 | GO:0071203 | WASH complex(GO:0071203) |
| 0.0 | 0.1 | GO:0098644 | complex of collagen trimers(GO:0098644) |
| 0.0 | 0.0 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 0.0 | 0.1 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 0.0 | 0.1 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.0 | 0.4 | GO:0000777 | condensed chromosome kinetochore(GO:0000777) |
| 0.0 | 1.2 | GO:0005770 | late endosome(GO:0005770) |
| 0.0 | 0.5 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.0 | 0.1 | GO:0034448 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.0 | 0.0 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.0 | 0.1 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
| 0.0 | 0.1 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.0 | 2.2 | GO:0005769 | early endosome(GO:0005769) |
| 0.0 | 2.4 | GO:0005759 | mitochondrial matrix(GO:0005759) |
| 0.0 | 0.2 | GO:0031010 | ISWI-type complex(GO:0031010) |
| 0.0 | 0.3 | GO:0016235 | aggresome(GO:0016235) |
| 0.0 | 21.1 | GO:0005783 | endoplasmic reticulum(GO:0005783) |
| 0.0 | 0.6 | GO:0005811 | lipid particle(GO:0005811) |
| 0.0 | 0.1 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.0 | 0.1 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.0 | 0.1 | GO:0034464 | BBSome(GO:0034464) |
| 0.0 | 0.4 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.0 | 0.4 | GO:0042734 | presynaptic membrane(GO:0042734) |
| 0.0 | 0.2 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
| 0.0 | 0.1 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.0 | 0.3 | GO:0005865 | striated muscle thin filament(GO:0005865) |
| 0.0 | 0.1 | GO:0001652 | granular component(GO:0001652) |
| 0.0 | 0.1 | GO:1990716 | axonemal central apparatus(GO:1990716) |
| 0.0 | 0.1 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.0 | 0.2 | GO:0044665 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
| 0.0 | 0.0 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.0 | 1.0 | GO:0005604 | basement membrane(GO:0005604) |
| 0.0 | 0.3 | GO:0045335 | phagocytic vesicle(GO:0045335) |
| 0.0 | 0.1 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
| 0.0 | 0.9 | GO:0000922 | spindle pole(GO:0000922) |
| 0.0 | 0.0 | GO:0042585 | germinal vesicle(GO:0042585) |
| 0.0 | 0.0 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 0.0 | 0.1 | GO:0005796 | Golgi lumen(GO:0005796) |
| 0.0 | 1.1 | GO:0031514 | motile cilium(GO:0031514) |
| 0.0 | 0.1 | GO:0048500 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
| 0.0 | 0.0 | GO:0097208 | alveolar lamellar body(GO:0097208) |
| 0.0 | 0.1 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.0 | 1.2 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
| 0.0 | 0.4 | GO:0045171 | intercellular bridge(GO:0045171) |
| 0.0 | 0.1 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
| 0.0 | 0.2 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
| 0.0 | 0.0 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
| 0.0 | 0.3 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.0 | 0.0 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.0 | 0.0 | GO:0019908 | nuclear cyclin-dependent protein kinase holoenzyme complex(GO:0019908) |
| 0.0 | 0.1 | GO:0098800 | inner mitochondrial membrane protein complex(GO:0098800) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.9 | 5.6 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
| 1.6 | 4.7 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
| 0.8 | 1.5 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
| 0.7 | 6.0 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.7 | 2.7 | GO:0071614 | linoleic acid epoxygenase activity(GO:0071614) |
| 0.6 | 1.8 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
| 0.5 | 1.4 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.4 | 0.4 | GO:0003896 | DNA primase activity(GO:0003896) |
| 0.4 | 1.2 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
| 0.4 | 1.2 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.4 | 1.2 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 0.4 | 1.5 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
| 0.4 | 1.1 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
| 0.4 | 1.1 | GO:0038181 | bile acid receptor activity(GO:0038181) |
| 0.4 | 1.1 | GO:0070538 | oleic acid binding(GO:0070538) |
| 0.3 | 0.3 | GO:0000009 | alpha-1,6-mannosyltransferase activity(GO:0000009) |
| 0.3 | 1.3 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
| 0.3 | 1.0 | GO:0004771 | sterol esterase activity(GO:0004771) |
| 0.3 | 0.9 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
| 0.3 | 1.5 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
| 0.3 | 0.9 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
| 0.3 | 0.8 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
| 0.3 | 0.3 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
| 0.3 | 1.6 | GO:0016151 | nickel cation binding(GO:0016151) |
| 0.3 | 0.8 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
| 0.3 | 1.3 | GO:0070728 | leucine binding(GO:0070728) |
| 0.3 | 2.3 | GO:0016215 | acyl-CoA desaturase activity(GO:0016215) |
| 0.2 | 1.2 | GO:0015181 | arginine transmembrane transporter activity(GO:0015181) L-lysine transmembrane transporter activity(GO:0015189) |
| 0.2 | 0.7 | GO:0030284 | estrogen receptor activity(GO:0030284) |
| 0.2 | 1.2 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
| 0.2 | 0.9 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
| 0.2 | 0.7 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.2 | 0.9 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
| 0.2 | 1.1 | GO:1990239 | steroid hormone binding(GO:1990239) |
| 0.2 | 0.2 | GO:0050051 | leukotriene-B4 20-monooxygenase activity(GO:0050051) |
| 0.2 | 0.7 | GO:0005347 | ATP transmembrane transporter activity(GO:0005347) |
| 0.2 | 0.7 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
| 0.2 | 2.4 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.2 | 0.6 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.2 | 0.2 | GO:0070644 | vitamin D response element binding(GO:0070644) |
| 0.2 | 1.2 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
| 0.2 | 1.8 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.2 | 1.2 | GO:0033695 | oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
| 0.2 | 0.6 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
| 0.2 | 0.8 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.2 | 0.4 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
| 0.2 | 0.6 | GO:2001070 | starch binding(GO:2001070) |
| 0.2 | 0.7 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
| 0.2 | 0.5 | GO:0055100 | adiponectin binding(GO:0055100) |
| 0.2 | 0.4 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
| 0.2 | 0.7 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
| 0.2 | 0.7 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
| 0.2 | 1.5 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
| 0.2 | 0.5 | GO:0016842 | amidine-lyase activity(GO:0016842) |
| 0.2 | 0.5 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.2 | 1.0 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.2 | 0.2 | GO:0030792 | methylarsonite methyltransferase activity(GO:0030792) |
| 0.2 | 0.3 | GO:0030620 | U2 snRNA binding(GO:0030620) |
| 0.2 | 2.1 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.2 | 1.1 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.2 | 0.5 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
| 0.2 | 0.5 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.2 | 1.7 | GO:0034071 | cobinamide kinase activity(GO:0008819) phytol kinase activity(GO:0010276) phenol kinase activity(GO:0018720) cyclin-dependent protein kinase activating kinase regulator activity(GO:0019914) inositol tetrakisphosphate 2-kinase activity(GO:0032942) heptose 7-phosphate kinase activity(GO:0033785) aminoglycoside phosphotransferase activity(GO:0034071) eukaryotic elongation factor-2 kinase regulator activity(GO:0042556) eukaryotic elongation factor-2 kinase activator activity(GO:0042557) LPPG:FO 2-phospho-L-lactate transferase activity(GO:0043743) cytidine kinase activity(GO:0043771) glycerate 2-kinase activity(GO:0043798) (S)-lactate 2-kinase activity(GO:0043841) phosphoserine:homoserine phosphotransferase activity(GO:0043899) L-seryl-tRNA(Sec) kinase activity(GO:0043915) phosphocholine transferase activity(GO:0044605) GTP-dependent polynucleotide kinase activity(GO:0051735) farnesol kinase activity(GO:0052668) CTP:2-trans,-6-trans-farnesol kinase activity(GO:0052669) geraniol kinase activity(GO:0052670) geranylgeraniol kinase activity(GO:0052671) CTP:geranylgeraniol kinase activity(GO:0052672) prenol kinase activity(GO:0052673) 1-phosphatidylinositol-5-kinase activity(GO:0052810) 1-phosphatidylinositol-3-phosphate 4-kinase activity(GO:0052811) phosphatidylinositol-3,4-bisphosphate 5-kinase activity(GO:0052812) inositol-3,4,6-trisphosphate 1-kinase activity(GO:0052835) inositol 5-diphosphate pentakisphosphate 5-kinase activity(GO:0052836) inositol diphosphate tetrakisphosphate kinase activity(GO:0052839) |
| 0.2 | 0.5 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
| 0.2 | 1.1 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
| 0.2 | 1.4 | GO:0002162 | dystroglycan binding(GO:0002162) |
| 0.2 | 3.7 | GO:0030552 | cAMP binding(GO:0030552) |
| 0.2 | 0.6 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
| 0.2 | 0.6 | GO:0052834 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
| 0.2 | 0.5 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
| 0.1 | 0.4 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) |
| 0.1 | 0.6 | GO:0043559 | insulin binding(GO:0043559) |
| 0.1 | 0.6 | GO:0097001 | ceramide binding(GO:0097001) |
| 0.1 | 0.4 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
| 0.1 | 0.7 | GO:0052724 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
| 0.1 | 0.4 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
| 0.1 | 3.2 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
| 0.1 | 2.9 | GO:0003785 | actin monomer binding(GO:0003785) |
| 0.1 | 2.1 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
| 0.1 | 0.8 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
| 0.1 | 0.4 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
| 0.1 | 1.8 | GO:0070402 | NADPH binding(GO:0070402) |
| 0.1 | 1.6 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
| 0.1 | 0.7 | GO:0035671 | enone reductase activity(GO:0035671) |
| 0.1 | 0.4 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
| 0.1 | 2.8 | GO:0008137 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.1 | 0.4 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.1 | 2.6 | GO:0016864 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
| 0.1 | 0.5 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
| 0.1 | 0.5 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.1 | 0.9 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
| 0.1 | 1.2 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
| 0.1 | 1.2 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
| 0.1 | 0.4 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
| 0.1 | 0.5 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
| 0.1 | 0.5 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.1 | 0.5 | GO:0032564 | dATP binding(GO:0032564) |
| 0.1 | 3.7 | GO:0052768 | prenylcysteine methylesterase activity(GO:0010296) 1-oxa-2-oxocycloheptane lactonase activity(GO:0018731) sulfolactone hydrolase activity(GO:0018732) butyrolactone hydrolase activity(GO:0018734) endosulfan lactone lactonase activity(GO:0034892) L-ascorbate 6-phosphate lactonase activity(GO:0035460) Ser-tRNA(Thr) hydrolase activity(GO:0043905) Ala-tRNA(Pro) hydrolase activity(GO:0043906) Cys-tRNA(Pro) hydrolase activity(GO:0043907) Ser(Gly)-tRNA(Ala) hydrolase activity(GO:0043908) all-trans-retinyl-palmitate hydrolase, all-trans-retinol forming activity(GO:0047376) mannosyl-oligosaccharide 1,6-alpha-mannosidase activity(GO:0052767) mannosyl-oligosaccharide 1,3-alpha-mannosidase activity(GO:0052768) methyl indole-3-acetate esterase activity(GO:0080030) methyl salicylate esterase activity(GO:0080031) methyl jasmonate esterase activity(GO:0080032) |
| 0.1 | 1.4 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
| 0.1 | 0.1 | GO:0008579 | JUN kinase phosphatase activity(GO:0008579) |
| 0.1 | 0.3 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
| 0.1 | 3.0 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
| 0.1 | 0.3 | GO:0016532 | superoxide dismutase copper chaperone activity(GO:0016532) |
| 0.1 | 0.4 | GO:0098748 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
| 0.1 | 4.0 | GO:0008392 | arachidonic acid epoxygenase activity(GO:0008392) |
| 0.1 | 0.6 | GO:0043426 | MRF binding(GO:0043426) |
| 0.1 | 0.5 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.1 | 0.5 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
| 0.1 | 0.5 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.1 | 0.7 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.1 | 0.4 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.1 | 0.6 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
| 0.1 | 0.7 | GO:0043140 | ATP-dependent 3'-5' DNA helicase activity(GO:0043140) |
| 0.1 | 0.4 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
| 0.1 | 0.5 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.1 | 0.3 | GO:0098821 | BMP receptor activity(GO:0098821) |
| 0.1 | 0.1 | GO:0030619 | U1 snRNA binding(GO:0030619) |
| 0.1 | 0.2 | GO:0042281 | dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase activity(GO:0042281) |
| 0.1 | 0.4 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
| 0.1 | 1.4 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
| 0.1 | 0.6 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
| 0.1 | 0.3 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
| 0.1 | 0.3 | GO:0050816 | phosphothreonine binding(GO:0050816) |
| 0.1 | 0.2 | GO:0017153 | sodium:dicarboxylate symporter activity(GO:0017153) |
| 0.1 | 0.3 | GO:0004096 | catalase activity(GO:0004096) |
| 0.1 | 0.8 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.1 | 0.5 | GO:0035197 | siRNA binding(GO:0035197) |
| 0.1 | 0.1 | GO:0008905 | mannose-phosphate guanylyltransferase activity(GO:0008905) |
| 0.1 | 1.5 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
| 0.1 | 0.8 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
| 0.1 | 0.5 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.1 | 0.3 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
| 0.1 | 0.5 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.1 | 0.5 | GO:0016443 | bidentate ribonuclease III activity(GO:0016443) |
| 0.1 | 0.1 | GO:0051723 | protein methylesterase activity(GO:0051723) |
| 0.1 | 0.9 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.1 | 0.9 | GO:0001223 | transcription coactivator binding(GO:0001223) |
| 0.1 | 2.4 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
| 0.1 | 0.2 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
| 0.1 | 0.5 | GO:0003909 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
| 0.1 | 0.1 | GO:0043398 | HLH domain binding(GO:0043398) |
| 0.1 | 0.1 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
| 0.1 | 0.2 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
| 0.1 | 0.9 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
| 0.1 | 0.3 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
| 0.1 | 0.3 | GO:0070546 | L-phenylalanine aminotransferase activity(GO:0070546) |
| 0.1 | 0.2 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
| 0.1 | 0.2 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
| 0.1 | 0.2 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.1 | 0.1 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
| 0.1 | 1.2 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.1 | 1.6 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 0.1 | 0.2 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
| 0.1 | 0.2 | GO:0048030 | disaccharide binding(GO:0048030) |
| 0.1 | 0.5 | GO:0098505 | G-rich strand telomeric DNA binding(GO:0098505) |
| 0.1 | 1.0 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
| 0.1 | 0.4 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
| 0.1 | 1.0 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
| 0.1 | 0.4 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.1 | 0.4 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.1 | 0.7 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
| 0.1 | 0.6 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
| 0.1 | 0.4 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.1 | 0.2 | GO:0050692 | DBD domain binding(GO:0050692) |
| 0.1 | 0.1 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
| 0.1 | 0.3 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
| 0.1 | 0.9 | GO:0050661 | NADP binding(GO:0050661) |
| 0.1 | 0.1 | GO:0004470 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) |
| 0.1 | 0.2 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
| 0.1 | 0.2 | GO:0005119 | smoothened binding(GO:0005119) |
| 0.1 | 0.1 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
| 0.1 | 0.1 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
| 0.1 | 0.1 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
| 0.1 | 2.1 | GO:0004364 | glutathione transferase activity(GO:0004364) |
| 0.1 | 0.4 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
| 0.1 | 0.2 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
| 0.1 | 0.6 | GO:0045294 | alpha-catenin binding(GO:0045294) |
| 0.1 | 0.3 | GO:0070878 | primary miRNA binding(GO:0070878) |
| 0.1 | 0.3 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
| 0.1 | 0.2 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
| 0.1 | 0.6 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.1 | 0.3 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
| 0.1 | 0.3 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
| 0.1 | 0.4 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) |
| 0.1 | 0.2 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
| 0.1 | 0.2 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
| 0.1 | 0.2 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
| 0.1 | 0.3 | GO:0034416 | bisphosphoglycerate phosphatase activity(GO:0034416) |
| 0.1 | 0.2 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.1 | 0.8 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
| 0.1 | 0.1 | GO:0061505 | DNA topoisomerase activity(GO:0003916) DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
| 0.1 | 0.7 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
| 0.1 | 0.2 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.1 | 0.1 | GO:0036137 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
| 0.1 | 0.2 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.1 | 0.4 | GO:0046790 | virion binding(GO:0046790) |
| 0.1 | 0.8 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
| 0.1 | 0.2 | GO:1990459 | transferrin receptor binding(GO:1990459) |
| 0.1 | 0.2 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
| 0.1 | 0.2 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.1 | 1.1 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
| 0.1 | 0.7 | GO:0016646 | oxidoreductase activity, acting on the CH-NH group of donors, NAD or NADP as acceptor(GO:0016646) |
| 0.1 | 0.5 | GO:0016004 | phospholipase activator activity(GO:0016004) |
| 0.1 | 1.2 | GO:0016676 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors(GO:0016675) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.1 | 0.2 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 0.1 | 0.2 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
| 0.1 | 0.6 | GO:0008301 | DNA binding, bending(GO:0008301) |
| 0.1 | 0.2 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
| 0.1 | 0.1 | GO:0033142 | progesterone receptor binding(GO:0033142) |
| 0.1 | 0.7 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.1 | 0.2 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 0.1 | 0.4 | GO:0048185 | activin binding(GO:0048185) |
| 0.1 | 0.1 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
| 0.1 | 0.9 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
| 0.1 | 0.7 | GO:0043422 | protein kinase B binding(GO:0043422) |
| 0.1 | 0.6 | GO:0055106 | ubiquitin-protein transferase regulator activity(GO:0055106) |
| 0.1 | 0.2 | GO:0008430 | selenium binding(GO:0008430) |
| 0.1 | 0.2 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
| 0.1 | 0.2 | GO:0035877 | death effector domain binding(GO:0035877) |
| 0.1 | 0.2 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
| 0.1 | 0.3 | GO:0004556 | alpha-amylase activity(GO:0004556) |
| 0.1 | 0.3 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 0.1 | 0.2 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.1 | 0.4 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
| 0.1 | 0.3 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.0 | 0.2 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
| 0.0 | 0.0 | GO:0070699 | type II activin receptor binding(GO:0070699) |
| 0.0 | 0.1 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
| 0.0 | 1.0 | GO:0015924 | mannosyl-oligosaccharide mannosidase activity(GO:0015924) |
| 0.0 | 0.1 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
| 0.0 | 0.4 | GO:0004955 | prostaglandin receptor activity(GO:0004955) |
| 0.0 | 1.5 | GO:0052771 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
| 0.0 | 0.1 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.0 | 0.1 | GO:0045503 | dynein light chain binding(GO:0045503) |
| 0.0 | 0.9 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
| 0.0 | 0.5 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.0 | 0.1 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
| 0.0 | 0.2 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
| 0.0 | 0.2 | GO:0042015 | interleukin-20 binding(GO:0042015) |
| 0.0 | 0.1 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
| 0.0 | 0.1 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
| 0.0 | 0.5 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.0 | 0.8 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
| 0.0 | 0.1 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
| 0.0 | 0.1 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
| 0.0 | 0.2 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
| 0.0 | 0.4 | GO:0030553 | cGMP binding(GO:0030553) |
| 0.0 | 0.5 | GO:0005523 | tropomyosin binding(GO:0005523) |
| 0.0 | 0.2 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
| 0.0 | 0.1 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
| 0.0 | 0.1 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
| 0.0 | 0.1 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
| 0.0 | 0.2 | GO:0015265 | urea channel activity(GO:0015265) |
| 0.0 | 0.2 | GO:0010861 | thyroid hormone receptor activator activity(GO:0010861) |
| 0.0 | 1.7 | GO:0017046 | peptide hormone binding(GO:0017046) |
| 0.0 | 0.2 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.0 | 0.2 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
| 0.0 | 0.6 | GO:0004120 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) photoreceptor cyclic-nucleotide phosphodiesterase activity(GO:0004120) 7,8-dihydro-D-neopterin 2',3'-cyclic phosphate phosphodiesterase activity(GO:0044688) inositol phosphosphingolipid phospholipase activity(GO:0052712) inositol phosphorylceramide phospholipase activity(GO:0052713) mannosyl-inositol phosphorylceramide phospholipase activity(GO:0052714) mannosyl-diinositol phosphorylceramide phospholipase activity(GO:0052715) |
| 0.0 | 0.1 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.0 | 0.1 | GO:0015923 | mannosidase activity(GO:0015923) |
| 0.0 | 0.2 | GO:0005113 | patched binding(GO:0005113) |
| 0.0 | 0.1 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
| 0.0 | 0.7 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.0 | 0.1 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 0.0 | 1.5 | GO:0005546 | phosphatidylinositol-4,5-bisphosphate binding(GO:0005546) |
| 0.0 | 0.2 | GO:0035251 | UDP-glucosyltransferase activity(GO:0035251) |
| 0.0 | 0.2 | GO:0001515 | opioid peptide activity(GO:0001515) |
| 0.0 | 0.2 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.0 | 0.2 | GO:0048019 | receptor antagonist activity(GO:0048019) |
| 0.0 | 0.1 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
| 0.0 | 1.2 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
| 0.0 | 0.3 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 0.0 | 0.1 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
| 0.0 | 0.2 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
| 0.0 | 0.2 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
| 0.0 | 0.0 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.0 | 0.1 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 0.0 | 0.1 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
| 0.0 | 0.1 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
| 0.0 | 0.2 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.0 | 0.2 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.0 | 0.1 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
| 0.0 | 0.0 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
| 0.0 | 0.2 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
| 0.0 | 0.3 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.0 | 0.1 | GO:0071553 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
| 0.0 | 0.1 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 0.0 | 0.1 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
| 0.0 | 2.9 | GO:0101005 | thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) ubiquitinyl hydrolase activity(GO:0101005) |
| 0.0 | 0.6 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
| 0.0 | 0.4 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
| 0.0 | 0.1 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
| 0.0 | 0.1 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
| 0.0 | 0.5 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 0.0 | 1.3 | GO:0043022 | ribosome binding(GO:0043022) |
| 0.0 | 0.2 | GO:0008251 | tRNA-specific adenosine deaminase activity(GO:0008251) |
| 0.0 | 0.1 | GO:0036310 | annealing helicase activity(GO:0036310) |
| 0.0 | 0.4 | GO:0005522 | profilin binding(GO:0005522) |
| 0.0 | 0.3 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.0 | 0.1 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 0.0 | 0.4 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
| 0.0 | 2.0 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
| 0.0 | 0.6 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.0 | 0.1 | GO:0004802 | transketolase activity(GO:0004802) |
| 0.0 | 0.2 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.0 | 0.1 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
| 0.0 | 0.0 | GO:0015141 | succinate transmembrane transporter activity(GO:0015141) |
| 0.0 | 0.6 | GO:0045296 | cadherin binding(GO:0045296) |
| 0.0 | 0.2 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 0.0 | 0.1 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
| 0.0 | 0.4 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.0 | 0.3 | GO:0042043 | neurexin family protein binding(GO:0042043) |
| 0.0 | 0.7 | GO:0050681 | androgen receptor binding(GO:0050681) |
| 0.0 | 0.3 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
| 0.0 | 0.3 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.0 | 0.5 | GO:0042166 | acetylcholine binding(GO:0042166) |
| 0.0 | 0.0 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
| 0.0 | 0.1 | GO:0031686 | A1 adenosine receptor binding(GO:0031686) |
| 0.0 | 0.2 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
| 0.0 | 3.1 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
| 0.0 | 1.1 | GO:0016763 | transferase activity, transferring pentosyl groups(GO:0016763) |
| 0.0 | 0.1 | GO:0000403 | Y-form DNA binding(GO:0000403) |
| 0.0 | 0.8 | GO:0016312 | inositol bisphosphate phosphatase activity(GO:0016312) |
| 0.0 | 0.2 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.0 | 0.1 | GO:0001642 | group III metabotropic glutamate receptor activity(GO:0001642) |
| 0.0 | 0.0 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
| 0.0 | 0.1 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
| 0.0 | 0.1 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
| 0.0 | 0.6 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.0 | 0.3 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
| 0.0 | 0.1 | GO:0019992 | diacylglycerol binding(GO:0019992) |
| 0.0 | 0.1 | GO:0050815 | phosphoserine binding(GO:0050815) |
| 0.0 | 0.1 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
| 0.0 | 0.1 | GO:0035325 | Toll-like receptor binding(GO:0035325) |
| 0.0 | 0.4 | GO:0042056 | chemoattractant activity(GO:0042056) |
| 0.0 | 0.3 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
| 0.0 | 0.1 | GO:0071723 | lipopeptide binding(GO:0071723) |
| 0.0 | 0.1 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.0 | 2.9 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.0 | 0.1 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
| 0.0 | 0.1 | GO:0001640 | adenylate cyclase inhibiting G-protein coupled glutamate receptor activity(GO:0001640) |
| 0.0 | 0.1 | GO:0004370 | glycerol kinase activity(GO:0004370) |
| 0.0 | 0.7 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
| 0.0 | 2.3 | GO:0008175 | tRNA methyltransferase activity(GO:0008175) |
| 0.0 | 0.1 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
| 0.0 | 0.1 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
| 0.0 | 0.4 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.0 | 0.2 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
| 0.0 | 0.1 | GO:0019862 | IgA binding(GO:0019862) |
| 0.0 | 0.7 | GO:0004693 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
| 0.0 | 0.1 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
| 0.0 | 0.1 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 0.0 | 0.1 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
| 0.0 | 0.8 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
| 0.0 | 0.6 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.0 | 0.1 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
| 0.0 | 0.2 | GO:0016668 | oxidoreductase activity, acting on a sulfur group of donors, NAD(P) as acceptor(GO:0016668) |
| 0.0 | 0.1 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
| 0.0 | 0.1 | GO:0097016 | L27 domain binding(GO:0097016) |
| 0.0 | 1.1 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
| 0.0 | 0.6 | GO:0030507 | spectrin binding(GO:0030507) |
| 0.0 | 0.6 | GO:0008170 | N-methyltransferase activity(GO:0008170) |
| 0.0 | 0.1 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
| 0.0 | 0.1 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
| 0.0 | 0.1 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
| 0.0 | 0.1 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
| 0.0 | 0.2 | GO:0008474 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.0 | 0.1 | GO:0051434 | BH3 domain binding(GO:0051434) |
| 0.0 | 0.2 | GO:0008432 | JUN kinase binding(GO:0008432) |
| 0.0 | 0.3 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.0 | 0.0 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
| 0.0 | 0.2 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
| 0.0 | 0.1 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.0 | 0.1 | GO:0039706 | co-receptor binding(GO:0039706) |
| 0.0 | 0.1 | GO:0005042 | netrin receptor activity(GO:0005042) |
| 0.0 | 0.0 | GO:0051870 | methotrexate binding(GO:0051870) |
| 0.0 | 0.6 | GO:0005484 | SNAP receptor activity(GO:0005484) |
| 0.0 | 0.1 | GO:0035198 | miRNA binding(GO:0035198) |
| 0.0 | 0.7 | GO:0004864 | protein phosphatase inhibitor activity(GO:0004864) |
| 0.0 | 0.1 | GO:0070403 | NAD+ binding(GO:0070403) |
| 0.0 | 0.2 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
| 0.0 | 0.2 | GO:0008327 | methyl-CpG binding(GO:0008327) |
| 0.0 | 0.1 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.0 | 1.5 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
| 0.0 | 0.1 | GO:0000339 | RNA cap binding(GO:0000339) |
| 0.0 | 0.2 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
| 0.0 | 0.0 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
| 0.0 | 0.0 | GO:0008187 | poly-pyrimidine tract binding(GO:0008187) |
| 0.0 | 0.5 | GO:0031491 | nucleosome binding(GO:0031491) |
| 0.0 | 0.1 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
| 0.0 | 0.4 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.0 | 0.6 | GO:0004033 | aldo-keto reductase (NADP) activity(GO:0004033) |
| 0.0 | 0.1 | GO:0030621 | U4 snRNA binding(GO:0030621) |
| 0.0 | 0.2 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
| 0.0 | 1.1 | GO:0005518 | collagen binding(GO:0005518) |
| 0.0 | 0.1 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.0 | 0.1 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.0 | 0.9 | GO:0048306 | calcium-dependent protein binding(GO:0048306) |
| 0.0 | 0.3 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.0 | 0.2 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
| 0.0 | 0.1 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
| 0.0 | 0.1 | GO:0015172 | L-glutamate transmembrane transporter activity(GO:0005313) acidic amino acid transmembrane transporter activity(GO:0015172) |
| 0.0 | 0.2 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.0 | 0.1 | GO:0030350 | iron-responsive element binding(GO:0030350) |
| 0.0 | 0.1 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
| 0.0 | 0.3 | GO:1990939 | ATP-dependent microtubule motor activity(GO:1990939) |
| 0.0 | 0.1 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
| 0.0 | 0.4 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.0 | 0.1 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
| 0.0 | 0.0 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
| 0.0 | 0.5 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
| 0.0 | 0.3 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.0 | 0.2 | GO:0015194 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
| 0.0 | 0.2 | GO:0035254 | glutamate receptor binding(GO:0035254) |
| 0.0 | 0.1 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
| 0.0 | 0.3 | GO:0000049 | tRNA binding(GO:0000049) |
| 0.0 | 0.0 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
| 0.0 | 0.1 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
| 0.0 | 0.6 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.0 | 0.1 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
| 0.0 | 0.0 | GO:0002060 | purine nucleobase binding(GO:0002060) |
| 0.0 | 0.2 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
| 0.0 | 0.1 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 0.0 | 0.0 | GO:0019187 | beta-1,4-mannosyltransferase activity(GO:0019187) |
| 0.0 | 0.1 | GO:0004977 | melanocortin receptor activity(GO:0004977) |
| 0.0 | 0.1 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 0.0 | 0.1 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
| 0.0 | 0.5 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.0 | 0.3 | GO:0001158 | enhancer sequence-specific DNA binding(GO:0001158) |
| 0.0 | 0.0 | GO:0043891 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
| 0.0 | 0.2 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
| 0.0 | 0.0 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
| 0.0 | 0.1 | GO:0008020 | G-protein coupled photoreceptor activity(GO:0008020) |
| 0.0 | 0.0 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
| 0.0 | 0.5 | GO:0048487 | beta-tubulin binding(GO:0048487) |
| 0.0 | 0.1 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.0 | 0.2 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
| 0.0 | 0.1 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
| 0.0 | 0.0 | GO:0032138 | single base insertion or deletion binding(GO:0032138) |
| 0.0 | 0.0 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
| 0.0 | 0.0 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
| 0.0 | 0.0 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
| 0.0 | 0.1 | GO:0004448 | isocitrate dehydrogenase activity(GO:0004448) |
| 0.0 | 0.1 | GO:0016595 | glutamate binding(GO:0016595) |
| 0.0 | 0.1 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 0.0 | 0.2 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
| 0.0 | 0.0 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
| 0.0 | 0.0 | GO:0061731 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.0 | 0.1 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
| 0.0 | 0.1 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
| 0.0 | 0.1 | GO:0001221 | transcription cofactor binding(GO:0001221) |
| 0.0 | 0.0 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
| 0.0 | 0.1 | GO:0102337 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.0 | 0.0 | GO:0004385 | guanylate kinase activity(GO:0004385) |
| 0.0 | 0.0 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
| 0.0 | 0.1 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.0 | 0.4 | GO:0003684 | damaged DNA binding(GO:0003684) |
| 0.0 | 0.1 | GO:0005227 | calcium activated cation channel activity(GO:0005227) |
| 0.0 | 0.1 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.0 | 0.0 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
| 0.0 | 0.0 | GO:0016160 | amylase activity(GO:0016160) |
| 0.0 | 0.4 | GO:0061733 | peptide-lysine-N-acetyltransferase activity(GO:0061733) |
| 0.0 | 0.0 | GO:1902936 | phosphatidylinositol bisphosphate binding(GO:1902936) |
| 0.0 | 0.0 | GO:0004779 | sulfate adenylyltransferase activity(GO:0004779) |
| 0.0 | 0.3 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.0 | 0.0 | GO:0034618 | arginine binding(GO:0034618) |
| 0.0 | 0.2 | GO:0045502 | dynein binding(GO:0045502) |
| 0.0 | 0.4 | GO:0035064 | methylated histone binding(GO:0035064) |
| 0.0 | 0.2 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
| 0.0 | 0.1 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
| 0.0 | 0.2 | GO:0005246 | calcium channel regulator activity(GO:0005246) |
| 0.0 | 0.0 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
| 0.0 | 0.3 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
| 0.0 | 0.0 | GO:0046923 | ER retention sequence binding(GO:0046923) |
| 0.0 | 0.1 | GO:0070990 | snRNP binding(GO:0070990) |
| 0.0 | 0.1 | GO:0004576 | oligosaccharyl transferase activity(GO:0004576) |
| 0.0 | 0.0 | GO:0031720 | haptoglobin binding(GO:0031720) |
| 0.0 | 0.0 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
| 0.0 | 0.1 | GO:0036002 | pre-mRNA binding(GO:0036002) |
| 0.0 | 0.1 | GO:0034573 | protein-N-terminal asparagine amidohydrolase activity(GO:0008418) UDP-3-O-[3-hydroxymyristoyl] N-acetylglucosamine deacetylase activity(GO:0008759) iprodione amidohydrolase activity(GO:0018748) (3,5-dichlorophenylurea)acetate amidohydrolase activity(GO:0018749) 4'-(2-hydroxyisopropyl)phenylurea amidohydrolase activity(GO:0034571) didemethylisoproturon amidohydrolase activity(GO:0034573) N-isopropylacetanilide amidohydrolase activity(GO:0034576) N-cyclohexylformamide amidohydrolase activity(GO:0034781) isonicotinic acid hydrazide hydrolase activity(GO:0034876) cis-aconitamide amidase activity(GO:0034882) gamma-N-formylaminovinylacetate hydrolase activity(GO:0034885) N2-acetyl-L-lysine deacetylase activity(GO:0043747) O-succinylbenzoate synthase activity(GO:0043748) indoleacetamide hydrolase activity(GO:0043864) N-acetylcitrulline deacetylase activity(GO:0043909) N-acetylgalactosamine-6-phosphate deacetylase activity(GO:0047419) diacetylchitobiose deacetylase activity(GO:0052773) chitooligosaccharide deacetylase activity(GO:0052790) |
| 0.0 | 0.0 | GO:0034235 | GPI anchor binding(GO:0034235) |
| 0.0 | 0.0 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
| 0.0 | 0.5 | GO:0004714 | transmembrane receptor protein tyrosine kinase activity(GO:0004714) |
| 0.0 | 0.1 | GO:0015288 | porin activity(GO:0015288) |
| 0.0 | 0.1 | GO:0070891 | lipoteichoic acid binding(GO:0070891) |
| 0.0 | 0.0 | GO:0003954 | NADH dehydrogenase activity(GO:0003954) |
| 0.0 | 0.0 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.0 | 0.0 | GO:0003696 | satellite DNA binding(GO:0003696) |
| 0.0 | 0.2 | GO:0031489 | myosin V binding(GO:0031489) |
| 0.0 | 0.1 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
| 0.0 | 0.0 | GO:0008443 | phosphofructokinase activity(GO:0008443) |
| 0.0 | 0.0 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
| 0.0 | 0.0 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
| 0.0 | 0.0 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.0 | 0.0 | GO:0098988 | G-protein coupled glutamate receptor activity(GO:0098988) |
| 0.0 | 0.1 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
| 0.0 | 0.2 | GO:0008375 | acetylglucosaminyltransferase activity(GO:0008375) |
| 0.0 | 0.2 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
| 0.0 | 0.0 | GO:0005499 | vitamin D binding(GO:0005499) |
| 0.0 | 0.0 | GO:0008745 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) peptidoglycan receptor activity(GO:0016019) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 8.0 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.1 | 1.5 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.1 | 2.6 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.1 | 2.8 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
| 0.1 | 2.3 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.1 | 4.1 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
| 0.1 | 0.7 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.1 | 1.6 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.1 | 1.2 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.1 | 3.1 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.1 | 2.6 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 0.1 | 1.1 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.1 | 2.3 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.1 | 0.8 | PID ERBB1 RECEPTOR PROXIMAL PATHWAY | EGF receptor (ErbB1) signaling pathway |
| 0.1 | 0.8 | ST G ALPHA I PATHWAY | G alpha i Pathway |
| 0.1 | 0.7 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 0.1 | 1.1 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.1 | 0.6 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| 0.1 | 0.2 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
| 0.1 | 0.8 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
| 0.1 | 1.0 | PID ALK1 PATHWAY | ALK1 signaling events |
| 0.1 | 0.4 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
| 0.0 | 0.1 | PID CD40 PATHWAY | CD40/CD40L signaling |
| 0.0 | 1.9 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.0 | 0.6 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.0 | 0.2 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
| 0.0 | 0.5 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.0 | 0.4 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
| 0.0 | 0.8 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
| 0.0 | 0.5 | NABA COLLAGENS | Genes encoding collagen proteins |
| 0.0 | 0.9 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
| 0.0 | 0.1 | PID INTEGRIN1 PATHWAY | Beta1 integrin cell surface interactions |
| 0.0 | 1.1 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.0 | 0.4 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.0 | 0.1 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.0 | 0.7 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
| 0.0 | 0.1 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
| 0.0 | 0.1 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.0 | 0.7 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
| 0.0 | 0.3 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
| 0.0 | 0.0 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
| 0.0 | 0.4 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
| 0.0 | 0.8 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 0.0 | 0.1 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
| 0.0 | 0.4 | PID ARF6 PATHWAY | Arf6 signaling events |
| 0.0 | 0.6 | PID SHP2 PATHWAY | SHP2 signaling |
| 0.0 | 0.2 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.0 | 0.1 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.0 | 0.4 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
| 0.0 | 0.2 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.0 | 0.0 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
| 0.0 | 0.1 | PID ERBB4 PATHWAY | ErbB4 signaling events |
| 0.0 | 0.3 | PID BARD1 PATHWAY | BARD1 signaling events |
| 0.0 | 0.2 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
| 0.0 | 0.2 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
| 0.0 | 0.1 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.0 | 0.3 | PID BMP PATHWAY | BMP receptor signaling |
| 0.0 | 0.5 | PID MTOR 4PATHWAY | mTOR signaling pathway |
| 0.0 | 0.4 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
| 0.0 | 0.1 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
| 0.0 | 0.2 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.0 | 0.8 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
| 0.0 | 0.2 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.0 | 0.2 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.0 | 0.6 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
| 0.0 | 0.1 | PID ATR PATHWAY | ATR signaling pathway |
| 0.0 | 0.0 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.0 | 0.0 | PID S1P S1P4 PATHWAY | S1P4 pathway |
| 0.0 | 0.3 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
| 0.0 | 0.1 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
| 0.0 | 0.3 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
| 0.0 | 0.0 | PID IL3 PATHWAY | IL3-mediated signaling events |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 7.4 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.2 | 5.5 | REACTOME BILE ACID AND BILE SALT METABOLISM | Genes involved in Bile acid and bile salt metabolism |
| 0.2 | 1.4 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.2 | 0.2 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 0.2 | 0.2 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
| 0.2 | 0.3 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
| 0.2 | 2.3 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
| 0.2 | 2.3 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
| 0.2 | 1.6 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
| 0.1 | 2.1 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.1 | 4.3 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 0.1 | 0.1 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.1 | 2.1 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.1 | 0.1 | REACTOME SIGNALING BY TGF BETA RECEPTOR COMPLEX | Genes involved in Signaling by TGF-beta Receptor Complex |
| 0.1 | 2.3 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
| 0.1 | 0.5 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
| 0.1 | 3.6 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
| 0.1 | 0.8 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
| 0.1 | 2.1 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
| 0.1 | 1.2 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.1 | 1.0 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.1 | 1.3 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
| 0.1 | 2.4 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
| 0.1 | 0.4 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.1 | 0.3 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
| 0.1 | 1.5 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
| 0.1 | 1.2 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
| 0.1 | 0.3 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.1 | 1.5 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
| 0.1 | 1.0 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.1 | 1.8 | REACTOME PHASE II CONJUGATION | Genes involved in Phase II conjugation |
| 0.1 | 1.9 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
| 0.1 | 1.0 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
| 0.1 | 0.7 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.1 | 0.3 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
| 0.1 | 1.2 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.1 | 1.6 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
| 0.1 | 0.8 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
| 0.1 | 0.4 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.1 | 1.5 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.1 | 4.5 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
| 0.1 | 0.8 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
| 0.1 | 0.2 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
| 0.1 | 0.5 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
| 0.1 | 0.2 | REACTOME TGF BETA RECEPTOR SIGNALING ACTIVATES SMADS | Genes involved in TGF-beta receptor signaling activates SMADs |
| 0.1 | 0.5 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.1 | 0.7 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
| 0.1 | 2.0 | REACTOME MRNA 3 END PROCESSING | Genes involved in mRNA 3'-end processing |
| 0.1 | 0.1 | REACTOME GAP JUNCTION TRAFFICKING | Genes involved in Gap junction trafficking |
| 0.1 | 0.6 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.1 | 1.0 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.1 | 0.9 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.1 | 1.0 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
| 0.1 | 1.9 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.1 | 0.3 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
| 0.1 | 0.6 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
| 0.1 | 0.5 | REACTOME PKB MEDIATED EVENTS | Genes involved in PKB-mediated events |
| 0.1 | 0.1 | REACTOME SIGNALING BY NOTCH3 | Genes involved in Signaling by NOTCH3 |
| 0.1 | 0.6 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.0 | 0.7 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
| 0.0 | 0.5 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
| 0.0 | 0.0 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.0 | 0.7 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
| 0.0 | 1.0 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.0 | 0.2 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
| 0.0 | 0.3 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.0 | 0.5 | REACTOME SIGNALING BY NOTCH2 | Genes involved in Signaling by NOTCH2 |
| 0.0 | 1.7 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
| 0.0 | 1.3 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
| 0.0 | 0.9 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.0 | 0.6 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.0 | 0.8 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.0 | 0.3 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
| 0.0 | 0.5 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
| 0.0 | 5.8 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
| 0.0 | 0.2 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
| 0.0 | 0.3 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.0 | 0.2 | REACTOME ACTIVATION OF ATR IN RESPONSE TO REPLICATION STRESS | Genes involved in Activation of ATR in response to replication stress |
| 0.0 | 0.2 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
| 0.0 | 1.0 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
| 0.0 | 0.5 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.0 | 0.7 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.0 | 0.2 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
| 0.0 | 0.3 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
| 0.0 | 0.9 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
| 0.0 | 0.0 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
| 0.0 | 0.4 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
| 0.0 | 0.7 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
| 0.0 | 0.4 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
| 0.0 | 1.2 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.0 | 0.0 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
| 0.0 | 0.7 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
| 0.0 | 0.1 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
| 0.0 | 0.5 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
| 0.0 | 0.9 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
| 0.0 | 0.3 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.0 | 0.0 | REACTOME NEF MEDIATES DOWN MODULATION OF CELL SURFACE RECEPTORS BY RECRUITING THEM TO CLATHRIN ADAPTERS | Genes involved in Nef-mediates down modulation of cell surface receptors by recruiting them to clathrin adapters |
| 0.0 | 0.2 | REACTOME REGULATION OF WATER BALANCE BY RENAL AQUAPORINS | Genes involved in Regulation of Water Balance by Renal Aquaporins |
| 0.0 | 0.2 | REACTOME CLASS I MHC MEDIATED ANTIGEN PROCESSING PRESENTATION | Genes involved in Class I MHC mediated antigen processing & presentation |
| 0.0 | 0.1 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
| 0.0 | 1.1 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
| 0.0 | 0.3 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.0 | 0.0 | REACTOME SIGNALING BY NOTCH4 | Genes involved in Signaling by NOTCH4 |
| 0.0 | 0.3 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.0 | 0.2 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
| 0.0 | 0.0 | REACTOME ADP SIGNALLING THROUGH P2RY1 | Genes involved in ADP signalling through P2Y purinoceptor 1 |
| 0.0 | 0.6 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
| 0.0 | 0.1 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.0 | 0.2 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
| 0.0 | 0.1 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 0.0 | 0.1 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.0 | 0.3 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
| 0.0 | 0.3 | REACTOME M G1 TRANSITION | Genes involved in M/G1 Transition |
| 0.0 | 0.8 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.0 | 0.1 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
| 0.0 | 0.3 | REACTOME EARLY PHASE OF HIV LIFE CYCLE | Genes involved in Early Phase of HIV Life Cycle |
| 0.0 | 0.2 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.0 | 0.1 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
| 0.0 | 0.7 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
| 0.0 | 0.2 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.0 | 0.0 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
| 0.0 | 0.5 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.0 | 0.4 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.0 | 0.3 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
| 0.0 | 0.0 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
| 0.0 | 0.0 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
| 0.0 | 0.1 | REACTOME ARMS MEDIATED ACTIVATION | Genes involved in ARMS-mediated activation |
| 0.0 | 0.1 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
| 0.0 | 0.1 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.0 | 0.2 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
| 0.0 | 0.1 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
| 0.0 | 0.0 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
| 0.0 | 0.1 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.0 | 0.1 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
| 0.0 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
| 0.0 | 0.5 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
| 0.0 | 0.4 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
| 0.0 | 0.6 | REACTOME MRNA PROCESSING | Genes involved in mRNA Processing |
| 0.0 | 0.0 | REACTOME POST NMDA RECEPTOR ACTIVATION EVENTS | Genes involved in Post NMDA receptor activation events |
| 0.0 | 0.0 | REACTOME NUCLEAR EVENTS KINASE AND TRANSCRIPTION FACTOR ACTIVATION | Genes involved in Nuclear Events (kinase and transcription factor activation) |
| 0.0 | 0.3 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
| 0.0 | 0.2 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
| 0.0 | 1.2 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
| 0.0 | 0.2 | REACTOME ASPARAGINE N LINKED GLYCOSYLATION | Genes involved in Asparagine N-linked glycosylation |
| 0.0 | 0.0 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
| 0.0 | 0.2 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |