| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Hmga2
|
ENSMUSG00000056758.8 | high mobility group AT-hook 2 |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr8_84761164_84761339 | 2.99 |
Nfix |
nuclear factor I/X |
12145 |
0.11 |
| chr1_51770461_51770858 | 2.31 |
Myo1b |
myosin IB |
220 |
0.94 |
| chr13_82200174_82200343 | 2.30 |
Gm48155 |
predicted gene, 48155 |
110501 |
0.07 |
| chr7_125056317_125056468 | 2.29 |
Gm45093 |
predicted gene 45093 |
13099 |
0.23 |
| chr11_80974932_80975087 | 2.25 |
Gm11416 |
predicted gene 11416 |
71785 |
0.1 |
| chr4_108782032_108782195 | 2.07 |
Zfyve9 |
zinc finger, FYVE domain containing 9 |
1315 |
0.38 |
| chr9_80335524_80335697 | 1.82 |
Myo6 |
myosin VI |
28696 |
0.2 |
| chr2_19701468_19701642 | 1.69 |
Gm24670 |
predicted gene, 24670 |
10267 |
0.15 |
| chr1_21261382_21261702 | 1.67 |
Gsta3 |
glutathione S-transferase, alpha 3 |
8021 |
0.11 |
| chr7_118127356_118127544 | 1.66 |
Arl6ip1 |
ADP-ribosylation factor-like 6 interacting protein 1 |
1660 |
0.32 |
| chr19_12685171_12685322 | 1.61 |
Gm49772 |
predicted gene, 49772 |
3475 |
0.12 |
| chr2_177901070_177901508 | 1.61 |
Gm14327 |
predicted gene 14327 |
2996 |
0.19 |
| chr8_105104839_105104994 | 1.60 |
Gm8804 |
predicted gene 8804 |
5708 |
0.11 |
| chr4_40231621_40231774 | 1.56 |
Ddx58 |
DEAD (Asp-Glu-Ala-Asp) box polypeptide 58 |
3341 |
0.21 |
| chr4_109655723_109655874 | 1.54 |
9630013D21Rik |
RIKEN cDNA 9630013D21 gene |
1667 |
0.31 |
| chr14_88463159_88463310 | 1.51 |
Pcdh20 |
protocadherin 20 |
8112 |
0.23 |
| chr9_122848915_122849207 | 1.50 |
Gm47140 |
predicted gene, 47140 |
643 |
0.55 |
| chr11_28695418_28695578 | 1.49 |
2810471M01Rik |
RIKEN cDNA 2810471M01 gene |
13934 |
0.17 |
| chr6_24610468_24610637 | 1.46 |
Lmod2 |
leiomodin 2 (cardiac) |
12790 |
0.14 |
| chr16_24642488_24642649 | 1.46 |
Lpp |
LIM domain containing preferred translocation partner in lipoma |
79287 |
0.1 |
| chr1_21250942_21251436 | 1.44 |
Gsta3 |
glutathione S-transferase, alpha 3 |
2332 |
0.18 |
| chr4_47366562_47366857 | 1.44 |
Tgfbr1 |
transforming growth factor, beta receptor I |
13099 |
0.22 |
| chr4_88889115_88889274 | 1.43 |
Ifne |
interferon epsilon |
8993 |
0.08 |
| chr5_20858729_20858886 | 1.42 |
Phtf2 |
putative homeodomain transcription factor 2 |
3616 |
0.22 |
| chr10_24919019_24919217 | 1.41 |
Arg1 |
arginase, liver |
2711 |
0.19 |
| chr11_67359982_67360339 | 1.40 |
Myh13 |
myosin, heavy polypeptide 13, skeletal muscle |
4625 |
0.26 |
| chr10_4613331_4613709 | 1.40 |
Esr1 |
estrogen receptor 1 (alpha) |
1499 |
0.46 |
| chr10_10925442_10925593 | 1.40 |
Gm48406 |
predicted gene, 48406 |
110399 |
0.06 |
| chr10_31956696_31956848 | 1.38 |
Gm18189 |
predicted gene, 18189 |
16897 |
0.27 |
| chr5_126536904_126537081 | 1.33 |
Gm24839 |
predicted gene, 24839 |
23011 |
0.2 |
| chr7_67648192_67648343 | 1.31 |
Ttc23 |
tetratricopeptide repeat domain 23 |
807 |
0.52 |
| chr4_6843120_6843488 | 1.31 |
Tox |
thymocyte selection-associated high mobility group box |
147179 |
0.04 |
| chr1_177453047_177453198 | 1.29 |
Gm29856 |
predicted gene, 29856 |
5844 |
0.16 |
| chr1_79823871_79824030 | 1.29 |
Serpine2 |
serine (or cysteine) peptidase inhibitor, clade E, member 2 |
2628 |
0.28 |
| chr11_28684227_28684558 | 1.28 |
2810471M01Rik |
RIKEN cDNA 2810471M01 gene |
2828 |
0.27 |
| chrY_90799493_90799663 | 1.27 |
Gm47283 |
predicted gene, 47283 |
9127 |
0.18 |
| chr4_55339011_55339182 | 1.24 |
Rad23b |
RAD23 homolog B, nucleotide excision repair protein |
10947 |
0.15 |
| chr1_50806470_50806812 | 1.24 |
Gm28321 |
predicted gene 28321 |
8734 |
0.28 |
| chr4_121164131_121164282 | 1.23 |
Rlf |
rearranged L-myc fusion sequence |
24328 |
0.11 |
| chr5_105394182_105394457 | 1.22 |
Gm26519 |
predicted gene, 26519 |
6926 |
0.16 |
| chr18_36656472_36656632 | 1.21 |
Ankhd1 |
ankyrin repeat and KH domain containing 1 |
1042 |
0.31 |
| chr19_39319574_39319725 | 1.20 |
Cyp2c72-ps |
cytochrome P450, family 2, subfamily c, polypeptide 72, pseudogene |
27718 |
0.18 |
| chr2_32525017_32525309 | 1.20 |
Gm13412 |
predicted gene 13412 |
132 |
0.92 |
| chr10_22153823_22154174 | 1.20 |
Gm4895 |
predicted gene 4895 |
418 |
0.7 |
| chr19_44400352_44400581 | 1.20 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
6224 |
0.15 |
| chr19_53781327_53781513 | 1.19 |
Rbm20 |
RNA binding motif protein 20 |
11888 |
0.17 |
| chr19_40141682_40141833 | 1.17 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
45529 |
0.11 |
| chr4_48261059_48261322 | 1.16 |
Erp44 |
endoplasmic reticulum protein 44 |
16716 |
0.18 |
| chrY_90800880_90801048 | 1.16 |
Gm47283 |
predicted gene, 47283 |
10513 |
0.18 |
| chr5_87590225_87590412 | 1.15 |
Sult1e1 |
sulfotransferase family 1E, member 1 |
1276 |
0.29 |
| chr1_80244319_80244685 | 1.15 |
Gm37932 |
predicted gene, 37932 |
11695 |
0.13 |
| chr12_57540843_57541103 | 1.14 |
Foxa1 |
forkhead box A1 |
5148 |
0.17 |
| chr2_15065214_15065379 | 1.14 |
Arl5b |
ADP-ribosylation factor-like 5B |
2843 |
0.2 |
| chr3_60523656_60523949 | 1.14 |
Mbnl1 |
muscleblind like splicing factor 1 |
4326 |
0.25 |
| chr2_112285161_112285368 | 1.13 |
Slc12a6 |
solute carrier family 12, member 6 |
687 |
0.58 |
| chr3_34076650_34076843 | 1.12 |
Dnajc19 |
DnaJ heat shock protein family (Hsp40) member C19 |
3434 |
0.16 |
| chr7_67647931_67648100 | 1.12 |
Ttc23 |
tetratricopeptide repeat domain 23 |
555 |
0.67 |
| chr2_52470397_52470548 | 1.12 |
A430018G15Rik |
RIKEN cDNA A430018G15 gene |
45460 |
0.12 |
| chr8_25609907_25610083 | 1.12 |
Gm23184 |
predicted gene, 23184 |
563 |
0.58 |
| chr5_102010214_102010423 | 1.12 |
Wdfy3 |
WD repeat and FYVE domain containing 3 |
28760 |
0.16 |
| chr16_25754060_25754266 | 1.11 |
Gm27005 |
predicted gene, 27005 |
27467 |
0.19 |
| chr1_67155699_67155894 | 1.08 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
32770 |
0.18 |
| chr15_38056436_38056614 | 1.07 |
Gm22353 |
predicted gene, 22353 |
1760 |
0.31 |
| chr1_44576732_44576903 | 1.07 |
Gm37626 |
predicted gene, 37626 |
15932 |
0.19 |
| chr16_93860540_93860703 | 1.07 |
Morc3 |
microrchidia 3 |
108 |
0.95 |
| chr12_100794116_100794267 | 1.06 |
Dglucy |
D-glutamate cyclase |
8049 |
0.16 |
| chr3_129606663_129606955 | 1.05 |
Elovl6 |
ELOVL family member 6, elongation of long chain fatty acids (yeast) |
54429 |
0.09 |
| chr14_8430482_8430654 | 1.05 |
Gm8416 |
predicted gene 8416 |
21651 |
0.2 |
| chr16_32608318_32608521 | 1.05 |
Tfrc |
transferrin receptor |
501 |
0.74 |
| chr6_124883745_124883896 | 1.04 |
Cd4 |
CD4 antigen |
4379 |
0.09 |
| chr2_107628721_107628872 | 1.04 |
Gm9864 |
predicted gene 9864 |
28257 |
0.26 |
| chrY_90807930_90808086 | 1.02 |
Gm47283 |
predicted gene, 47283 |
17557 |
0.16 |
| chr11_110431257_110431440 | 1.02 |
Map2k6 |
mitogen-activated protein kinase kinase 6 |
32089 |
0.21 |
| chr2_30378803_30378994 | 1.02 |
Miga2 |
mitoguardin 2 |
663 |
0.51 |
| chr2_130911441_130911592 | 1.01 |
Atrn |
attractin |
4585 |
0.15 |
| chr13_108346244_108346395 | 1.01 |
Depdc1b |
DEP domain containing 1B |
11107 |
0.19 |
| chr7_70481551_70481951 | 1.01 |
Gm7656 |
predicted gene 7656 |
9097 |
0.15 |
| chr9_106889455_106889671 | 1.00 |
Manf |
mesencephalic astrocyte-derived neurotrophic factor |
720 |
0.47 |
| chr4_109867828_109867979 | 1.00 |
Faf1 |
Fas-associated factor 1 |
27118 |
0.21 |
| chr4_36131854_36132041 | 0.99 |
Lingo2 |
leucine rich repeat and Ig domain containing 2 |
4516 |
0.35 |
| chr9_55322341_55322520 | 0.99 |
Nrg4 |
neuregulin 4 |
2757 |
0.24 |
| chr7_97414019_97414355 | 0.98 |
Thrsp |
thyroid hormone responsive |
3332 |
0.16 |
| chr11_60199358_60199583 | 0.98 |
Mir6921 |
microRNA 6921 |
1147 |
0.3 |
| chr2_134491717_134491883 | 0.98 |
Hao1 |
hydroxyacid oxidase 1, liver |
62507 |
0.15 |
| chr11_16856758_16857153 | 0.97 |
Egfr |
epidermal growth factor receptor |
21195 |
0.18 |
| chr9_80672553_80672726 | 0.97 |
Gm39380 |
predicted gene, 39380 |
37356 |
0.19 |
| chr19_44401346_44401497 | 0.95 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
5269 |
0.16 |
| chr11_68854403_68854915 | 0.95 |
Ndel1 |
nudE neurodevelopment protein 1 like 1 |
1524 |
0.3 |
| chr15_79682408_79682594 | 0.94 |
Gm49520 |
predicted gene, 49520 |
1179 |
0.26 |
| chr7_118486990_118487215 | 0.94 |
Itpripl2 |
inositol 1,4,5-triphosphate receptor interacting protein-like 2 |
4873 |
0.17 |
| chr13_102570134_102570306 | 0.94 |
Gm29927 |
predicted gene, 29927 |
20065 |
0.22 |
| chr19_21654390_21654886 | 0.93 |
Abhd17b |
abhydrolase domain containing 17B |
1113 |
0.45 |
| chr10_80343063_80343448 | 0.93 |
Adamtsl5 |
ADAMTS-like 5 |
1983 |
0.12 |
| chr4_100107938_100108102 | 0.93 |
Gm12701 |
predicted gene 12701 |
11601 |
0.2 |
| chr6_93828173_93828340 | 0.92 |
Gm23035 |
predicted gene, 23035 |
34484 |
0.17 |
| chr19_34313239_34313423 | 0.92 |
Fas |
Fas (TNF receptor superfamily member 6) |
13256 |
0.17 |
| chr17_84742495_84742888 | 0.92 |
Lrpprc |
leucine-rich PPR-motif containing |
8571 |
0.17 |
| chr1_88107647_88108008 | 0.92 |
Ugt1a6b |
UDP glucuronosyltransferase 1 family, polypeptide A6B |
965 |
0.27 |
| chr10_24919257_24919650 | 0.92 |
Arg1 |
arginase, liver |
3046 |
0.18 |
| chr7_62923766_62924082 | 0.91 |
A26c2 |
ANKRD26-like family C, member 2 |
100251 |
0.08 |
| chr6_37542487_37542638 | 0.91 |
Gm7463 |
predicted gene 7463 |
1148 |
0.52 |
| chr11_120809505_120809952 | 0.91 |
Fasn |
fatty acid synthase |
27 |
0.95 |
| chr19_12613435_12613600 | 0.91 |
Gm4952 |
predicted gene 4952 |
13501 |
0.09 |
| chr13_114901706_114901857 | 0.91 |
Itga2 |
integrin alpha 2 |
162 |
0.96 |
| chr7_68270555_68270958 | 0.90 |
Fam169b |
family with sequence similarity 169, member B |
3083 |
0.18 |
| chr13_4270426_4270629 | 0.90 |
Akr1c12 |
aldo-keto reductase family 1, member C12 |
8906 |
0.15 |
| chr9_74993629_74993780 | 0.90 |
Fam214a |
family with sequence similarity 214, member A |
17593 |
0.17 |
| chr3_118633360_118633511 | 0.90 |
Dpyd |
dihydropyrimidine dehydrogenase |
71249 |
0.1 |
| chr10_42237331_42237482 | 0.89 |
Foxo3 |
forkhead box O3 |
20960 |
0.23 |
| chr3_141504552_141504811 | 0.89 |
Unc5c |
unc-5 netrin receptor C |
39010 |
0.18 |
| chr12_57317079_57317230 | 0.89 |
Mipol1 |
mirror-image polydactyly 1 |
11071 |
0.22 |
| chr15_36432237_36432390 | 0.89 |
Gm49224 |
predicted gene, 49224 |
4378 |
0.18 |
| chr3_136048131_136048315 | 0.89 |
Gm5281 |
predicted gene 5281 |
3465 |
0.25 |
| chr5_40811186_40811352 | 0.88 |
Gm23022 |
predicted gene, 23022 |
405340 |
0.01 |
| chr13_46051322_46051732 | 0.88 |
Gm45949 |
predicted gene, 45949 |
9070 |
0.25 |
| chr7_52056194_52056539 | 0.88 |
Gm22211 |
predicted gene, 22211 |
19213 |
0.17 |
| chr14_30530847_30531018 | 0.87 |
Dcp1a |
decapping mRNA 1A |
7225 |
0.15 |
| chr19_31885188_31885394 | 0.86 |
A1cf |
APOBEC1 complementation factor |
16510 |
0.21 |
| chr11_5917118_5917412 | 0.86 |
Gm11967 |
predicted gene 11967 |
1950 |
0.2 |
| chr3_97645418_97646002 | 0.86 |
Prkab2 |
protein kinase, AMP-activated, beta 2 non-catalytic subunit |
12483 |
0.13 |
| chr19_20472340_20472491 | 0.86 |
Aldh1a1 |
aldehyde dehydrogenase family 1, subfamily A1 |
20300 |
0.19 |
| chr19_18145861_18146289 | 0.86 |
Gm18610 |
predicted gene, 18610 |
59720 |
0.14 |
| chr7_123643560_123643752 | 0.86 |
Zkscan2 |
zinc finger with KRAB and SCAN domains 2 |
143207 |
0.04 |
| chr8_41069551_41069759 | 0.85 |
Mtus1 |
mitochondrial tumor suppressor 1 |
13121 |
0.16 |
| chr2_72206740_72207276 | 0.85 |
Rapgef4 |
Rap guanine nucleotide exchange factor (GEF) 4 |
8209 |
0.18 |
| chr2_177467353_177467504 | 0.85 |
Zfp970 |
zinc finger protein 970 |
2582 |
0.22 |
| chr9_106785056_106785244 | 0.85 |
Rad54l2 |
RAD54 like 2 (S. cerevisiae) |
4026 |
0.18 |
| chr10_40140968_40141185 | 0.84 |
Slc16a10 |
solute carrier family 16 (monocarboxylic acid transporters), member 10 |
1178 |
0.39 |
| chr19_16434927_16435222 | 0.84 |
Gna14 |
guanine nucleotide binding protein, alpha 14 |
688 |
0.67 |
| chr2_175185178_175185329 | 0.83 |
Gm14443 |
predicted gene 14443 |
9382 |
0.13 |
| chr13_63562151_63562325 | 0.83 |
Ptch1 |
patched 1 |
1577 |
0.3 |
| chr3_144714620_144714771 | 0.83 |
Sh3glb1 |
SH3-domain GRB2-like B1 (endophilin) |
5415 |
0.15 |
| chr2_175988408_175988559 | 0.83 |
Gm2026 |
predicted gene 2026 |
19541 |
0.18 |
| chr7_63897839_63898269 | 0.83 |
Gm27252 |
predicted gene 27252 |
80 |
0.96 |
| chr2_128378785_128378975 | 0.83 |
Morrbid |
myeloid RNA regulator of BCL2L11 induced cell death |
24085 |
0.18 |
| chr3_94398765_94399136 | 0.82 |
Lingo4 |
leucine rich repeat and Ig domain containing 4 |
433 |
0.59 |
| chr3_115819747_115820078 | 0.82 |
Dph5 |
diphthamide biosynthesis 5 |
67925 |
0.08 |
| chr4_76286267_76286528 | 0.82 |
Ptprd |
protein tyrosine phosphatase, receptor type, D |
38846 |
0.21 |
| chr13_41204599_41204965 | 0.82 |
Elovl2 |
elongation of very long chain fatty acids (FEN1/Elo2, SUR4/Elo3, yeast)-like 2 |
15380 |
0.12 |
| chr17_29005351_29005744 | 0.82 |
Stk38 |
serine/threonine kinase 38 |
2179 |
0.15 |
| chr9_79762117_79762289 | 0.82 |
Cox7a2 |
cytochrome c oxidase subunit 7A2 |
2325 |
0.25 |
| chrX_111626357_111626522 | 0.81 |
Gm7340 |
predicted gene 7340 |
54740 |
0.14 |
| chr4_106190662_106190826 | 0.81 |
Gm12724 |
predicted gene 12724 |
50472 |
0.1 |
| chr10_52237252_52237450 | 0.80 |
Dcbld1 |
discoidin, CUB and LCCL domain containing 1 |
3714 |
0.22 |
| chr13_119456737_119456888 | 0.80 |
4833420G17Rik |
RIKEN cDNA 4833420G17 gene |
5956 |
0.14 |
| chr10_89748469_89748656 | 0.80 |
Uhrf1bp1l |
UHRF1 (ICBP90) binding protein 1-like |
3324 |
0.24 |
| chr7_90158580_90158753 | 0.80 |
Picalm |
phosphatidylinositol binding clathrin assembly protein |
6847 |
0.12 |
| chr13_16630196_16630367 | 0.80 |
Gm7537 |
predicted gene 7537 |
9209 |
0.28 |
| chr5_90696399_90696550 | 0.80 |
Gm43090 |
predicted gene 43090 |
54051 |
0.08 |
| chr10_87912738_87912889 | 0.80 |
Igf1os |
insulin-like growth factor 1, opposite strand |
49432 |
0.11 |
| chr4_15083326_15083514 | 0.79 |
Gm11844 |
predicted gene 11844 |
60838 |
0.11 |
| chr18_12668617_12668967 | 0.79 |
Gm41668 |
predicted gene, 41668 |
20373 |
0.13 |
| chr15_56418349_56418502 | 0.79 |
Gm49213 |
predicted gene, 49213 |
3412 |
0.38 |
| chr10_89490204_89490579 | 0.79 |
Nr1h4 |
nuclear receptor subfamily 1, group H, member 4 |
16258 |
0.21 |
| chr19_12685349_12685500 | 0.79 |
Gm49772 |
predicted gene, 49772 |
3653 |
0.11 |
| chr17_13825284_13825458 | 0.78 |
Afdn |
afadin, adherens junction formation factor |
25591 |
0.15 |
| chr6_136920008_136920159 | 0.78 |
Erp27 |
endoplasmic reticulum protein 27 |
2057 |
0.21 |
| chr13_51106650_51106801 | 0.77 |
Spin1 |
spindlin 1 |
5845 |
0.25 |
| chr12_118289280_118289431 | 0.77 |
Sp4 |
trans-acting transcription factor 4 |
12013 |
0.25 |
| chr4_53137916_53138166 | 0.77 |
Abca1 |
ATP-binding cassette, sub-family A (ABC1), member 1 |
21854 |
0.2 |
| chr3_149664345_149664496 | 0.77 |
Gm31121 |
predicted gene, 31121 |
4024 |
0.37 |
| chr5_121668180_121668334 | 0.77 |
Brap |
BRCA1 associated protein |
1731 |
0.24 |
| chrX_104412829_104412980 | 0.77 |
Abcb7 |
ATP-binding cassette, sub-family B (MDR/TAP), member 7 |
942 |
0.6 |
| chr9_103217995_103218146 | 0.77 |
Trf |
transferrin |
1796 |
0.31 |
| chr5_140118940_140119385 | 0.77 |
Mad1l1 |
MAD1 mitotic arrest deficient 1-like 1 |
3696 |
0.19 |
| chr5_23562685_23562882 | 0.77 |
Srpk2 |
serine/arginine-rich protein specific kinase 2 |
13413 |
0.19 |
| chr4_120973741_120974003 | 0.77 |
Mir7015 |
microRNA 7015 |
550 |
0.63 |
| chr13_42277225_42277420 | 0.77 |
Edn1 |
endothelin 1 |
24154 |
0.2 |
| chr7_72519636_72519787 | 0.77 |
Gm37620 |
predicted gene, 37620 |
82278 |
0.09 |
| chr5_125526040_125526191 | 0.77 |
Tmem132b |
transmembrane protein 132B |
5659 |
0.17 |
| chr4_72167519_72167670 | 0.77 |
Gm11250 |
predicted gene 11250 |
1174 |
0.54 |
| chr19_58049317_58049501 | 0.76 |
Mir5623 |
microRNA 5623 |
1758 |
0.46 |
| chr8_22382757_22382908 | 0.76 |
Slc25a15 |
solute carrier family 25 (mitochondrial carrier ornithine transporter), member 15 |
15712 |
0.1 |
| chr12_71310691_71311183 | 0.76 |
Dact1 |
dishevelled-binding antagonist of beta-catenin 1 |
953 |
0.49 |
| chr3_131638032_131638214 | 0.76 |
Gm42881 |
predicted gene 42881 |
24343 |
0.22 |
| chr6_48894997_48895174 | 0.76 |
Aoc1 |
amine oxidase, copper-containing 1 |
169 |
0.89 |
| chr9_74868705_74869018 | 0.76 |
Onecut1 |
one cut domain, family member 1 |
2377 |
0.23 |
| chr9_46479855_46480133 | 0.76 |
Gm47144 |
predicted gene, 47144 |
25079 |
0.15 |
| chr6_119681279_119681450 | 0.76 |
Erc1 |
ELKS/RAB6-interacting/CAST family member 1 |
59259 |
0.13 |
| chr1_139847886_139848037 | 0.75 |
Cfhr2 |
complement factor H-related 2 |
10729 |
0.2 |
| chr6_52673820_52673989 | 0.75 |
Hibadh |
3-hydroxyisobutyrate dehydrogenase |
33515 |
0.11 |
| chr19_15007147_15007306 | 0.75 |
Gm5513 |
predicted pseudogene 5513 |
46460 |
0.21 |
| chr1_137280278_137280429 | 0.75 |
Gm37057 |
predicted gene, 37057 |
28211 |
0.18 |
| chr5_81477028_81477179 | 0.75 |
Gm43084 |
predicted gene 43084 |
58623 |
0.16 |
| chr1_66998991_66999182 | 0.75 |
Lancl1 |
LanC (bacterial lantibiotic synthetase component C)-like 1 |
21979 |
0.15 |
| chr10_93075662_93075887 | 0.75 |
Cfap54 |
cilia and flagella associated protein 54 |
5523 |
0.22 |
| chr1_162891903_162892071 | 0.75 |
Fmo2 |
flavin containing monooxygenase 2 |
5472 |
0.19 |
| chr3_97639903_97640190 | 0.74 |
Fmo5 |
flavin containing monooxygenase 5 |
11163 |
0.13 |
| chr4_120806360_120806596 | 0.74 |
Nfyc |
nuclear transcription factor-Y gamma |
9234 |
0.12 |
| chr6_8862762_8862913 | 0.74 |
Ica1 |
islet cell autoantigen 1 |
84349 |
0.1 |
| chr5_17964323_17964474 | 0.74 |
Gnat3 |
guanine nucleotide binding protein, alpha transducing 3 |
1849 |
0.49 |
| chr2_70867342_70867501 | 0.73 |
Gm13632 |
predicted gene 13632 |
10408 |
0.19 |
| chr12_83685921_83686270 | 0.73 |
Psen1 |
presenilin 1 |
2057 |
0.23 |
| chr1_67195986_67196354 | 0.73 |
Gm15668 |
predicted gene 15668 |
53030 |
0.13 |
| chr14_105266671_105266822 | 0.73 |
Ndfip2 |
Nedd4 family interacting protein 2 |
7928 |
0.15 |
| chr7_16792284_16792639 | 0.73 |
Slc1a5 |
solute carrier family 1 (neutral amino acid transporter), member 5 |
566 |
0.62 |
| chr12_52464277_52464428 | 0.72 |
Gm47431 |
predicted gene, 47431 |
16227 |
0.17 |
| chr13_38294655_38294819 | 0.72 |
Gm47978 |
predicted gene, 47978 |
24128 |
0.13 |
| chr14_55147433_55147865 | 0.72 |
Gm23596 |
predicted gene, 23596 |
13959 |
0.09 |
| chrX_109505859_109506030 | 0.72 |
Gm4784 |
predicted gene 4784 |
113779 |
0.07 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 1.5 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
| 0.3 | 1.9 | GO:0006971 | hypotonic response(GO:0006971) |
| 0.3 | 0.3 | GO:1904192 | cholangiocyte apoptotic process(GO:1902488) regulation of cholangiocyte apoptotic process(GO:1904192) negative regulation of cholangiocyte apoptotic process(GO:1904193) |
| 0.3 | 0.8 | GO:0060737 | prostate epithelial cord elongation(GO:0060523) prostate gland morphogenetic growth(GO:0060737) |
| 0.3 | 1.1 | GO:0046449 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
| 0.2 | 2.1 | GO:0052697 | xenobiotic glucuronidation(GO:0052697) |
| 0.2 | 0.6 | GO:1902065 | response to L-glutamate(GO:1902065) |
| 0.2 | 0.6 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
| 0.2 | 0.8 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
| 0.2 | 1.2 | GO:0019856 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
| 0.2 | 0.5 | GO:0032025 | response to cobalt ion(GO:0032025) |
| 0.2 | 0.5 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
| 0.2 | 0.6 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.2 | 0.5 | GO:0010963 | regulation of L-arginine import(GO:0010963) |
| 0.2 | 0.5 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
| 0.1 | 0.4 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
| 0.1 | 0.4 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.1 | 0.5 | GO:1990414 | replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
| 0.1 | 0.5 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
| 0.1 | 0.9 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
| 0.1 | 0.7 | GO:0042518 | negative regulation of tyrosine phosphorylation of Stat3 protein(GO:0042518) |
| 0.1 | 0.5 | GO:0048143 | astrocyte activation(GO:0048143) |
| 0.1 | 0.4 | GO:1904690 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.1 | 0.5 | GO:2000370 | positive regulation of clathrin-mediated endocytosis(GO:2000370) |
| 0.1 | 0.6 | GO:0071280 | cellular response to copper ion(GO:0071280) |
| 0.1 | 0.4 | GO:0031086 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.1 | 0.8 | GO:0034310 | primary alcohol catabolic process(GO:0034310) |
| 0.1 | 1.4 | GO:0009404 | toxin metabolic process(GO:0009404) |
| 0.1 | 0.4 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
| 0.1 | 0.4 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
| 0.1 | 0.2 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
| 0.1 | 0.4 | GO:0032489 | regulation of Cdc42 protein signal transduction(GO:0032489) |
| 0.1 | 0.4 | GO:0044034 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 0.1 | 0.5 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
| 0.1 | 0.4 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
| 0.1 | 0.2 | GO:0051025 | negative regulation of immunoglobulin secretion(GO:0051025) |
| 0.1 | 0.3 | GO:0042628 | mating plug formation(GO:0042628) post-mating behavior(GO:0045297) |
| 0.1 | 0.3 | GO:0042126 | nitrate metabolic process(GO:0042126) |
| 0.1 | 0.1 | GO:0071492 | cellular response to UV-A(GO:0071492) |
| 0.1 | 0.3 | GO:0032380 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.1 | 0.2 | GO:0034756 | regulation of iron ion transport(GO:0034756) |
| 0.1 | 0.3 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
| 0.1 | 0.3 | GO:0009732 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
| 0.1 | 0.3 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
| 0.1 | 0.2 | GO:2000809 | positive regulation of presynaptic membrane organization(GO:1901631) positive regulation of synaptic vesicle clustering(GO:2000809) |
| 0.1 | 0.4 | GO:1902744 | negative regulation of lamellipodium organization(GO:1902744) |
| 0.1 | 0.4 | GO:0009597 | detection of virus(GO:0009597) |
| 0.1 | 1.2 | GO:0097286 | iron ion import(GO:0097286) |
| 0.1 | 0.3 | GO:2000409 | positive regulation of T cell extravasation(GO:2000409) |
| 0.1 | 0.3 | GO:0000710 | meiotic mismatch repair(GO:0000710) |
| 0.1 | 0.4 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.1 | 0.4 | GO:0001997 | positive regulation of the force of heart contraction by epinephrine-norepinephrine(GO:0001997) positive regulation of the force of heart contraction by chemical signal(GO:0003099) |
| 0.1 | 0.3 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.1 | 0.6 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
| 0.1 | 0.3 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.1 | 0.3 | GO:0035973 | aggrephagy(GO:0035973) |
| 0.1 | 0.3 | GO:0061511 | centriole elongation(GO:0061511) |
| 0.1 | 0.2 | GO:0046098 | guanine metabolic process(GO:0046098) |
| 0.1 | 0.2 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
| 0.1 | 0.3 | GO:0048619 | embryonic hindgut morphogenesis(GO:0048619) |
| 0.1 | 0.3 | GO:0097477 | lateral motor column neuron migration(GO:0097477) |
| 0.1 | 0.3 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
| 0.1 | 0.3 | GO:1900740 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
| 0.1 | 0.5 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
| 0.1 | 0.2 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 0.1 | 0.4 | GO:0015825 | L-serine transport(GO:0015825) |
| 0.1 | 0.1 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
| 0.1 | 0.4 | GO:0045542 | positive regulation of cholesterol biosynthetic process(GO:0045542) positive regulation of cholesterol metabolic process(GO:0090205) |
| 0.1 | 0.2 | GO:0009157 | deoxyribonucleoside monophosphate biosynthetic process(GO:0009157) pyrimidine deoxyribonucleoside monophosphate biosynthetic process(GO:0009177) |
| 0.1 | 0.2 | GO:0048382 | mesendoderm development(GO:0048382) |
| 0.1 | 0.3 | GO:0044597 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.1 | 0.2 | GO:1905206 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
| 0.1 | 0.3 | GO:0002317 | plasma cell differentiation(GO:0002317) |
| 0.1 | 0.3 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 0.2 | GO:0019344 | cysteine biosynthetic process(GO:0019344) |
| 0.1 | 0.8 | GO:0045161 | neuronal ion channel clustering(GO:0045161) |
| 0.1 | 0.5 | GO:0061072 | iris morphogenesis(GO:0061072) |
| 0.1 | 1.1 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
| 0.1 | 0.1 | GO:1902988 | neurofibrillary tangle assembly(GO:1902988) regulation of neurofibrillary tangle assembly(GO:1902996) |
| 0.1 | 0.2 | GO:0046104 | thymidine metabolic process(GO:0046104) |
| 0.1 | 0.3 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
| 0.1 | 0.2 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.1 | 0.2 | GO:0051081 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
| 0.1 | 0.3 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
| 0.1 | 0.7 | GO:0042759 | long-chain fatty acid biosynthetic process(GO:0042759) |
| 0.1 | 0.2 | GO:0000189 | MAPK import into nucleus(GO:0000189) |
| 0.1 | 0.4 | GO:0051639 | actin filament network formation(GO:0051639) |
| 0.1 | 0.2 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
| 0.1 | 0.2 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.1 | 0.3 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
| 0.1 | 0.4 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
| 0.1 | 0.3 | GO:0071335 | hair follicle cell proliferation(GO:0071335) |
| 0.1 | 0.3 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
| 0.1 | 0.3 | GO:0051919 | positive regulation of fibrinolysis(GO:0051919) |
| 0.1 | 0.1 | GO:0010046 | response to mycotoxin(GO:0010046) |
| 0.1 | 0.2 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
| 0.1 | 0.3 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
| 0.1 | 0.5 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
| 0.1 | 0.2 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
| 0.1 | 0.1 | GO:1903659 | regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
| 0.1 | 0.5 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
| 0.1 | 0.5 | GO:0006707 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.1 | 0.3 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.1 | 0.2 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
| 0.1 | 0.2 | GO:0072718 | response to cisplatin(GO:0072718) |
| 0.1 | 0.1 | GO:2000611 | positive regulation of thyroid hormone generation(GO:2000611) |
| 0.1 | 0.2 | GO:0019065 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.1 | 0.1 | GO:0045869 | negative regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045869) |
| 0.1 | 0.3 | GO:0060298 | positive regulation of sarcomere organization(GO:0060298) |
| 0.1 | 0.2 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.1 | 0.4 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
| 0.1 | 0.1 | GO:0070350 | white fat cell proliferation(GO:0070343) regulation of white fat cell proliferation(GO:0070350) |
| 0.1 | 0.2 | GO:0018211 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.1 | 0.5 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.1 | 0.2 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
| 0.1 | 1.0 | GO:0007184 | SMAD protein import into nucleus(GO:0007184) |
| 0.1 | 0.2 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.1 | 0.2 | GO:1903061 | positive regulation of protein lipidation(GO:1903061) |
| 0.1 | 0.4 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
| 0.1 | 0.7 | GO:0097284 | hepatocyte apoptotic process(GO:0097284) |
| 0.1 | 0.3 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
| 0.1 | 0.2 | GO:0070842 | aggresome assembly(GO:0070842) |
| 0.1 | 0.2 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.1 | 0.2 | GO:0070947 | neutrophil mediated killing of fungus(GO:0070947) |
| 0.1 | 0.1 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
| 0.1 | 0.1 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
| 0.1 | 0.2 | GO:0030070 | insulin processing(GO:0030070) |
| 0.1 | 0.1 | GO:0045354 | interferon-alpha biosynthetic process(GO:0045349) regulation of interferon-alpha biosynthetic process(GO:0045354) |
| 0.1 | 0.4 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
| 0.1 | 0.1 | GO:1904339 | negative regulation of dopaminergic neuron differentiation(GO:1904339) |
| 0.1 | 0.2 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.1 | 0.2 | GO:0001842 | neural fold formation(GO:0001842) |
| 0.1 | 0.1 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 0.1 | 0.2 | GO:0015867 | ATP transport(GO:0015867) |
| 0.1 | 0.5 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.1 | 0.3 | GO:0006451 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.1 | 0.6 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
| 0.1 | 0.4 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
| 0.1 | 0.2 | GO:0060431 | primary lung bud formation(GO:0060431) |
| 0.1 | 0.2 | GO:0061366 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
| 0.1 | 0.2 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.1 | 0.2 | GO:0010482 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
| 0.1 | 0.1 | GO:0071724 | response to diacyl bacterial lipopeptide(GO:0071724) cellular response to diacyl bacterial lipopeptide(GO:0071726) |
| 0.1 | 0.4 | GO:0021707 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
| 0.1 | 0.4 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
| 0.1 | 0.2 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
| 0.1 | 0.2 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
| 0.1 | 0.4 | GO:0006108 | malate metabolic process(GO:0006108) |
| 0.1 | 0.5 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.0 | 0.0 | GO:0061144 | alveolar secondary septum development(GO:0061144) |
| 0.0 | 0.1 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
| 0.0 | 0.1 | GO:1900623 | regulation of monocyte aggregation(GO:1900623) positive regulation of monocyte aggregation(GO:1900625) |
| 0.0 | 0.2 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
| 0.0 | 0.3 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.0 | 0.1 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
| 0.0 | 0.4 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
| 0.0 | 0.3 | GO:0043651 | linoleic acid metabolic process(GO:0043651) |
| 0.0 | 0.3 | GO:2000508 | regulation of dendritic cell chemotaxis(GO:2000508) positive regulation of dendritic cell chemotaxis(GO:2000510) |
| 0.0 | 0.2 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
| 0.0 | 0.1 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
| 0.0 | 0.2 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
| 0.0 | 0.2 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.0 | 0.1 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
| 0.0 | 0.1 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) |
| 0.0 | 0.5 | GO:0032525 | somite rostral/caudal axis specification(GO:0032525) |
| 0.0 | 0.0 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
| 0.0 | 0.3 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
| 0.0 | 0.2 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 0.0 | 0.2 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.0 | 0.1 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
| 0.0 | 0.1 | GO:0007525 | somatic muscle development(GO:0007525) |
| 0.0 | 0.1 | GO:0044829 | positive regulation by host of viral genome replication(GO:0044829) |
| 0.0 | 0.2 | GO:0042737 | drug catabolic process(GO:0042737) |
| 0.0 | 0.2 | GO:2000481 | positive regulation of cAMP-dependent protein kinase activity(GO:2000481) |
| 0.0 | 0.1 | GO:0072679 | thymocyte migration(GO:0072679) regulation of thymocyte migration(GO:2000410) positive regulation of thymocyte migration(GO:2000412) |
| 0.0 | 0.2 | GO:0070535 | histone H2A K63-linked ubiquitination(GO:0070535) |
| 0.0 | 0.4 | GO:1901407 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
| 0.0 | 0.4 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.0 | 0.3 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
| 0.0 | 0.1 | GO:0001306 | age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
| 0.0 | 0.2 | GO:0060501 | positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
| 0.0 | 0.2 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
| 0.0 | 0.8 | GO:0071353 | cellular response to interleukin-4(GO:0071353) |
| 0.0 | 0.3 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
| 0.0 | 0.2 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
| 0.0 | 0.0 | GO:0052695 | cellular glucuronidation(GO:0052695) |
| 0.0 | 0.1 | GO:0002840 | T cell mediated immune response to tumor cell(GO:0002424) regulation of T cell mediated immune response to tumor cell(GO:0002840) |
| 0.0 | 0.2 | GO:0000960 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
| 0.0 | 0.2 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
| 0.0 | 2.7 | GO:0006892 | post-Golgi vesicle-mediated transport(GO:0006892) |
| 0.0 | 0.1 | GO:0036022 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) |
| 0.0 | 0.1 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
| 0.0 | 0.1 | GO:2000828 | regulation of parathyroid hormone secretion(GO:2000828) |
| 0.0 | 0.2 | GO:0021943 | formation of radial glial scaffolds(GO:0021943) |
| 0.0 | 0.3 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
| 0.0 | 0.1 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.0 | 0.1 | GO:0035022 | positive regulation of Rac protein signal transduction(GO:0035022) |
| 0.0 | 0.1 | GO:0097167 | circadian regulation of translation(GO:0097167) |
| 0.0 | 0.0 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
| 0.0 | 0.9 | GO:0006805 | xenobiotic metabolic process(GO:0006805) |
| 0.0 | 0.1 | GO:0031296 | B cell costimulation(GO:0031296) |
| 0.0 | 1.0 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
| 0.0 | 0.1 | GO:1904684 | negative regulation of metalloendopeptidase activity(GO:1904684) negative regulation of metallopeptidase activity(GO:1905049) |
| 0.0 | 0.4 | GO:0002755 | MyD88-dependent toll-like receptor signaling pathway(GO:0002755) |
| 0.0 | 0.1 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
| 0.0 | 0.1 | GO:2000259 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
| 0.0 | 0.1 | GO:0072361 | regulation of glycolytic process by regulation of transcription from RNA polymerase II promoter(GO:0072361) |
| 0.0 | 0.2 | GO:0031033 | myosin filament organization(GO:0031033) |
| 0.0 | 0.1 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
| 0.0 | 0.5 | GO:0035510 | DNA dealkylation(GO:0035510) |
| 0.0 | 0.2 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.0 | 0.4 | GO:0007135 | meiosis II(GO:0007135) |
| 0.0 | 0.1 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
| 0.0 | 0.1 | GO:1903894 | regulation of IRE1-mediated unfolded protein response(GO:1903894) |
| 0.0 | 0.5 | GO:0006999 | nuclear pore organization(GO:0006999) |
| 0.0 | 0.2 | GO:0061684 | chaperone-mediated autophagy(GO:0061684) |
| 0.0 | 0.1 | GO:0072282 | metanephric nephron tubule morphogenesis(GO:0072282) |
| 0.0 | 0.2 | GO:0040016 | embryonic cleavage(GO:0040016) |
| 0.0 | 0.1 | GO:0070346 | positive regulation of fat cell proliferation(GO:0070346) |
| 0.0 | 0.8 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
| 0.0 | 0.2 | GO:0032509 | endosome transport via multivesicular body sorting pathway(GO:0032509) |
| 0.0 | 0.2 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.0 | 0.1 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
| 0.0 | 0.0 | GO:0072240 | distal convoluted tubule development(GO:0072025) DCT cell differentiation(GO:0072069) metanephric distal convoluted tubule development(GO:0072221) metanephric distal tubule development(GO:0072235) metanephric DCT cell differentiation(GO:0072240) |
| 0.0 | 0.1 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
| 0.0 | 0.1 | GO:1901162 | serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
| 0.0 | 0.1 | GO:0061083 | regulation of protein refolding(GO:0061083) negative regulation of protein refolding(GO:0061084) |
| 0.0 | 0.1 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.0 | 0.1 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
| 0.0 | 0.6 | GO:0097031 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.0 | 0.1 | GO:0019054 | modulation by virus of host process(GO:0019054) |
| 0.0 | 0.1 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
| 0.0 | 0.1 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
| 0.0 | 0.1 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
| 0.0 | 0.1 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
| 0.0 | 0.3 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
| 0.0 | 0.1 | GO:0006553 | lysine metabolic process(GO:0006553) |
| 0.0 | 0.1 | GO:0002386 | immune response in mucosal-associated lymphoid tissue(GO:0002386) |
| 0.0 | 0.0 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
| 0.0 | 0.3 | GO:0017144 | drug metabolic process(GO:0017144) |
| 0.0 | 0.1 | GO:0090231 | regulation of spindle checkpoint(GO:0090231) |
| 0.0 | 0.1 | GO:0006624 | vacuolar protein processing(GO:0006624) |
| 0.0 | 0.5 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
| 0.0 | 0.1 | GO:0031627 | telomeric loop formation(GO:0031627) |
| 0.0 | 0.4 | GO:0060037 | pharyngeal system development(GO:0060037) |
| 0.0 | 0.2 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.0 | 0.1 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
| 0.0 | 0.0 | GO:0072309 | mesenchymal stem cell maintenance involved in metanephric nephron morphogenesis(GO:0072309) |
| 0.0 | 0.1 | GO:0017121 | phospholipid scrambling(GO:0017121) |
| 0.0 | 0.2 | GO:0007035 | vacuolar acidification(GO:0007035) |
| 0.0 | 0.1 | GO:0051944 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
| 0.0 | 0.1 | GO:0001712 | ectodermal cell fate commitment(GO:0001712) |
| 0.0 | 0.2 | GO:0006013 | mannose metabolic process(GO:0006013) |
| 0.0 | 0.1 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
| 0.0 | 0.1 | GO:0015677 | copper ion import(GO:0015677) |
| 0.0 | 0.4 | GO:0042659 | regulation of cell fate specification(GO:0042659) |
| 0.0 | 0.1 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
| 0.0 | 0.1 | GO:0035790 | platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
| 0.0 | 0.1 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
| 0.0 | 0.1 | GO:0060665 | regulation of branching involved in salivary gland morphogenesis by mesenchymal-epithelial signaling(GO:0060665) |
| 0.0 | 0.2 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.0 | 0.2 | GO:0006266 | DNA ligation(GO:0006266) |
| 0.0 | 0.1 | GO:2000381 | negative regulation of mesoderm development(GO:2000381) |
| 0.0 | 0.0 | GO:0070272 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
| 0.0 | 0.1 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
| 0.0 | 0.1 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.0 | 0.1 | GO:0086045 | membrane depolarization during AV node cell action potential(GO:0086045) |
| 0.0 | 0.2 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
| 0.0 | 0.4 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
| 0.0 | 0.1 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 0.0 | 0.6 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
| 0.0 | 0.1 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 0.0 | 0.3 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.0 | 0.1 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.0 | 0.2 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
| 0.0 | 0.1 | GO:0047484 | regulation of response to osmotic stress(GO:0047484) |
| 0.0 | 0.1 | GO:0033567 | DNA replication, Okazaki fragment processing(GO:0033567) DNA replication, removal of RNA primer(GO:0043137) |
| 0.0 | 0.2 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
| 0.0 | 0.0 | GO:0006067 | ethanol metabolic process(GO:0006067) ethanol oxidation(GO:0006069) |
| 0.0 | 0.1 | GO:0032596 | protein transport into membrane raft(GO:0032596) |
| 0.0 | 0.1 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
| 0.0 | 0.1 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
| 0.0 | 0.1 | GO:0070245 | positive regulation of thymocyte apoptotic process(GO:0070245) |
| 0.0 | 0.1 | GO:0001834 | trophectodermal cell proliferation(GO:0001834) |
| 0.0 | 0.1 | GO:0030035 | microspike assembly(GO:0030035) |
| 0.0 | 0.1 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
| 0.0 | 0.1 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
| 0.0 | 0.1 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
| 0.0 | 0.1 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
| 0.0 | 0.0 | GO:0072061 | central nervous system vasculogenesis(GO:0022009) inner medullary collecting duct development(GO:0072061) |
| 0.0 | 0.0 | GO:0061738 | late endosomal microautophagy(GO:0061738) |
| 0.0 | 0.1 | GO:0023021 | termination of signal transduction(GO:0023021) |
| 0.0 | 0.1 | GO:0071873 | response to norepinephrine(GO:0071873) |
| 0.0 | 0.1 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
| 0.0 | 0.1 | GO:0061428 | negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
| 0.0 | 0.1 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
| 0.0 | 0.1 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 0.0 | 0.1 | GO:0060586 | multicellular organismal iron ion homeostasis(GO:0060586) |
| 0.0 | 0.2 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
| 0.0 | 0.1 | GO:0045722 | positive regulation of gluconeogenesis(GO:0045722) |
| 0.0 | 0.1 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 0.0 | 0.0 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.0 | 0.1 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
| 0.0 | 0.1 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.0 | 0.3 | GO:0009813 | flavonoid biosynthetic process(GO:0009813) flavonoid glucuronidation(GO:0052696) |
| 0.0 | 0.3 | GO:0070584 | mitochondrion morphogenesis(GO:0070584) |
| 0.0 | 0.1 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
| 0.0 | 0.1 | GO:0001955 | blood vessel maturation(GO:0001955) |
| 0.0 | 0.0 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.0 | 0.0 | GO:1903795 | regulation of inorganic anion transmembrane transport(GO:1903795) |
| 0.0 | 0.1 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
| 0.0 | 0.1 | GO:0036507 | protein deglycosylation involved in glycoprotein catabolic process(GO:0035977) protein demannosylation(GO:0036507) protein alpha-1,2-demannosylation(GO:0036508) mannose trimming involved in glycoprotein ERAD pathway(GO:1904382) |
| 0.0 | 0.1 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
| 0.0 | 0.4 | GO:0001976 | neurological system process involved in regulation of systemic arterial blood pressure(GO:0001976) |
| 0.0 | 0.0 | GO:0071267 | amino acid salvage(GO:0043102) L-methionine biosynthetic process(GO:0071265) L-methionine salvage(GO:0071267) |
| 0.0 | 0.0 | GO:0060751 | branch elongation involved in mammary gland duct branching(GO:0060751) |
| 0.0 | 0.0 | GO:0000430 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) |
| 0.0 | 0.0 | GO:0070672 | response to interleukin-15(GO:0070672) |
| 0.0 | 0.3 | GO:0006465 | signal peptide processing(GO:0006465) |
| 0.0 | 0.3 | GO:0071364 | cellular response to epidermal growth factor stimulus(GO:0071364) |
| 0.0 | 0.1 | GO:0015074 | DNA integration(GO:0015074) |
| 0.0 | 0.1 | GO:0002115 | store-operated calcium entry(GO:0002115) |
| 0.0 | 0.0 | GO:0046208 | spermine catabolic process(GO:0046208) |
| 0.0 | 0.1 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
| 0.0 | 0.1 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.0 | 0.1 | GO:0072488 | ammonium transmembrane transport(GO:0072488) |
| 0.0 | 0.1 | GO:0034080 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.0 | 0.2 | GO:0045741 | positive regulation of epidermal growth factor-activated receptor activity(GO:0045741) |
| 0.0 | 0.1 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
| 0.0 | 0.5 | GO:0006376 | mRNA splice site selection(GO:0006376) |
| 0.0 | 0.1 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
| 0.0 | 0.2 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
| 0.0 | 0.3 | GO:0061003 | positive regulation of dendritic spine morphogenesis(GO:0061003) |
| 0.0 | 0.1 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.0 | 0.1 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
| 0.0 | 0.1 | GO:0010966 | regulation of phosphate transport(GO:0010966) |
| 0.0 | 0.4 | GO:0006879 | cellular iron ion homeostasis(GO:0006879) |
| 0.0 | 0.1 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
| 0.0 | 0.1 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.0 | 0.1 | GO:0090527 | actin filament reorganization(GO:0090527) |
| 0.0 | 0.1 | GO:0098795 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
| 0.0 | 0.0 | GO:0050427 | 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
| 0.0 | 0.1 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
| 0.0 | 0.1 | GO:0015888 | thiamine transport(GO:0015888) |
| 0.0 | 0.1 | GO:0050883 | musculoskeletal movement, spinal reflex action(GO:0050883) |
| 0.0 | 0.1 | GO:0009650 | UV protection(GO:0009650) |
| 0.0 | 0.1 | GO:0008063 | Toll signaling pathway(GO:0008063) |
| 0.0 | 0.1 | GO:0010766 | negative regulation of sodium ion transport(GO:0010766) |
| 0.0 | 0.1 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.0 | 0.0 | GO:2000468 | regulation of peroxidase activity(GO:2000468) |
| 0.0 | 0.0 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) |
| 0.0 | 0.0 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
| 0.0 | 0.1 | GO:0046959 | habituation(GO:0046959) |
| 0.0 | 0.0 | GO:0002018 | renin-angiotensin regulation of aldosterone production(GO:0002018) |
| 0.0 | 0.1 | GO:0002553 | histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 0.0 | 0.1 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
| 0.0 | 0.4 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
| 0.0 | 0.0 | GO:0051409 | response to nitrosative stress(GO:0051409) |
| 0.0 | 0.1 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.0 | 0.1 | GO:1900086 | regulation of peptidyl-tyrosine autophosphorylation(GO:1900084) positive regulation of peptidyl-tyrosine autophosphorylation(GO:1900086) |
| 0.0 | 0.1 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.0 | 0.1 | GO:0035509 | negative regulation of myosin-light-chain-phosphatase activity(GO:0035509) |
| 0.0 | 0.1 | GO:0019478 | D-amino acid catabolic process(GO:0019478) |
| 0.0 | 0.1 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
| 0.0 | 0.2 | GO:0006335 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.0 | 0.1 | GO:0061525 | hindgut development(GO:0061525) |
| 0.0 | 0.2 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
| 0.0 | 0.0 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
| 0.0 | 0.1 | GO:1901660 | calcium ion export(GO:1901660) |
| 0.0 | 0.2 | GO:0003334 | keratinocyte development(GO:0003334) |
| 0.0 | 0.1 | GO:0002043 | blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:0002043) |
| 0.0 | 0.1 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 0.0 | 0.1 | GO:0046952 | ketone body catabolic process(GO:0046952) |
| 0.0 | 0.1 | GO:0071420 | cellular response to histamine(GO:0071420) |
| 0.0 | 0.2 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
| 0.0 | 0.1 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
| 0.0 | 0.1 | GO:0090520 | sphingolipid mediated signaling pathway(GO:0090520) |
| 0.0 | 0.1 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
| 0.0 | 0.2 | GO:0045948 | positive regulation of translational initiation(GO:0045948) |
| 0.0 | 0.1 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.0 | 0.1 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
| 0.0 | 0.1 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
| 0.0 | 0.0 | GO:0002074 | extraocular skeletal muscle development(GO:0002074) |
| 0.0 | 0.2 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
| 0.0 | 0.2 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
| 0.0 | 0.1 | GO:0060546 | negative regulation of necroptotic process(GO:0060546) |
| 0.0 | 0.0 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
| 0.0 | 0.0 | GO:0035907 | dorsal aorta development(GO:0035907) dorsal aorta morphogenesis(GO:0035912) |
| 0.0 | 0.1 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.0 | 0.1 | GO:0000467 | exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) |
| 0.0 | 0.0 | GO:2000384 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
| 0.0 | 0.0 | GO:1901668 | regulation of superoxide dismutase activity(GO:1901668) |
| 0.0 | 0.1 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.0 | 0.2 | GO:0010225 | response to UV-C(GO:0010225) |
| 0.0 | 0.2 | GO:0051084 | 'de novo' protein folding(GO:0006458) 'de novo' posttranslational protein folding(GO:0051084) |
| 0.0 | 0.2 | GO:0045056 | transcytosis(GO:0045056) |
| 0.0 | 0.1 | GO:0038171 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
| 0.0 | 0.1 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
| 0.0 | 0.0 | GO:0030421 | defecation(GO:0030421) |
| 0.0 | 0.1 | GO:0035999 | tetrahydrofolate interconversion(GO:0035999) |
| 0.0 | 0.0 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
| 0.0 | 0.1 | GO:0019673 | GDP-mannose metabolic process(GO:0019673) |
| 0.0 | 0.1 | GO:0055015 | ventricular cardiac muscle cell development(GO:0055015) |
| 0.0 | 0.1 | GO:0044314 | protein K27-linked ubiquitination(GO:0044314) |
| 0.0 | 0.0 | GO:0048680 | positive regulation of axon regeneration(GO:0048680) |
| 0.0 | 0.1 | GO:0010288 | response to lead ion(GO:0010288) |
| 0.0 | 0.0 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
| 0.0 | 0.1 | GO:2000224 | regulation of testosterone biosynthetic process(GO:2000224) |
| 0.0 | 0.0 | GO:0060676 | ureteric bud formation(GO:0060676) |
| 0.0 | 0.0 | GO:0002215 | defense response to nematode(GO:0002215) |
| 0.0 | 0.0 | GO:0006222 | UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
| 0.0 | 0.1 | GO:0061418 | regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061418) |
| 0.0 | 0.1 | GO:0048148 | behavioral response to cocaine(GO:0048148) |
| 0.0 | 0.1 | GO:0071073 | positive regulation of phospholipid biosynthetic process(GO:0071073) |
| 0.0 | 0.1 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
| 0.0 | 0.1 | GO:0035090 | maintenance of apical/basal cell polarity(GO:0035090) |
| 0.0 | 0.1 | GO:0015803 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
| 0.0 | 0.1 | GO:0030836 | positive regulation of actin filament depolymerization(GO:0030836) |
| 0.0 | 0.0 | GO:0008090 | retrograde axonal transport(GO:0008090) |
| 0.0 | 0.0 | GO:0002826 | negative regulation of T-helper 1 type immune response(GO:0002826) |
| 0.0 | 0.9 | GO:0010923 | negative regulation of phosphatase activity(GO:0010923) |
| 0.0 | 0.1 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
| 0.0 | 0.1 | GO:0042048 | olfactory behavior(GO:0042048) |
| 0.0 | 0.0 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
| 0.0 | 0.0 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
| 0.0 | 0.1 | GO:0048133 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.0 | 0.1 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) |
| 0.0 | 0.0 | GO:0021564 | vagus nerve development(GO:0021564) |
| 0.0 | 0.1 | GO:0060766 | negative regulation of androgen receptor signaling pathway(GO:0060766) |
| 0.0 | 0.2 | GO:0030325 | adrenal gland development(GO:0030325) |
| 0.0 | 0.0 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
| 0.0 | 0.1 | GO:0003338 | metanephros morphogenesis(GO:0003338) |
| 0.0 | 0.1 | GO:0055089 | fatty acid homeostasis(GO:0055089) |
| 0.0 | 0.0 | GO:0071503 | response to heparin(GO:0071503) cellular response to heparin(GO:0071504) |
| 0.0 | 0.0 | GO:0043504 | mitochondrial DNA repair(GO:0043504) |
| 0.0 | 0.4 | GO:1904030 | negative regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045736) negative regulation of cyclin-dependent protein kinase activity(GO:1904030) |
| 0.0 | 0.5 | GO:0033141 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
| 0.0 | 0.2 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.0 | 0.0 | GO:0071502 | cellular response to temperature stimulus(GO:0071502) |
| 0.0 | 0.0 | GO:0032607 | interferon-alpha production(GO:0032607) |
| 0.0 | 0.1 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
| 0.0 | 0.4 | GO:0045071 | negative regulation of viral genome replication(GO:0045071) |
| 0.0 | 0.0 | GO:0071455 | cellular response to increased oxygen levels(GO:0036295) cellular response to hyperoxia(GO:0071455) |
| 0.0 | 0.0 | GO:0060137 | maternal process involved in parturition(GO:0060137) |
| 0.0 | 0.1 | GO:0045793 | positive regulation of cell size(GO:0045793) |
| 0.0 | 0.1 | GO:0032060 | bleb assembly(GO:0032060) |
| 0.0 | 0.1 | GO:0060074 | synapse maturation(GO:0060074) |
| 0.0 | 0.0 | GO:0070375 | ERK5 cascade(GO:0070375) |
| 0.0 | 0.0 | GO:0042376 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
| 0.0 | 0.1 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
| 0.0 | 0.0 | GO:0070989 | oxidative demethylation(GO:0070989) |
| 0.0 | 0.0 | GO:0002554 | serotonin secretion by platelet(GO:0002554) |
| 0.0 | 0.1 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
| 0.0 | 0.0 | GO:0090315 | negative regulation of protein targeting to membrane(GO:0090315) |
| 0.0 | 0.0 | GO:0090091 | positive regulation of extracellular matrix disassembly(GO:0090091) |
| 0.0 | 0.0 | GO:0045607 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.0 | 0.1 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
| 0.0 | 0.0 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.0 | 0.1 | GO:0060346 | bone trabecula formation(GO:0060346) |
| 0.0 | 0.1 | GO:0043496 | regulation of protein homodimerization activity(GO:0043496) |
| 0.0 | 0.0 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
| 0.0 | 0.1 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
| 0.0 | 0.0 | GO:0002326 | B cell lineage commitment(GO:0002326) |
| 0.0 | 0.1 | GO:0007194 | negative regulation of adenylate cyclase activity(GO:0007194) |
| 0.0 | 0.1 | GO:0030049 | muscle filament sliding(GO:0030049) |
| 0.0 | 0.0 | GO:2000973 | regulation of pro-B cell differentiation(GO:2000973) |
| 0.0 | 0.1 | GO:0006670 | sphingosine metabolic process(GO:0006670) |
| 0.0 | 0.1 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
| 0.0 | 0.0 | GO:0019511 | peptidyl-proline hydroxylation(GO:0019511) |
| 0.0 | 0.0 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
| 0.0 | 0.1 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.0 | 0.3 | GO:0000002 | mitochondrial genome maintenance(GO:0000002) |
| 0.0 | 0.0 | GO:0010917 | negative regulation of mitochondrial membrane potential(GO:0010917) |
| 0.0 | 0.1 | GO:0097211 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.0 | 0.1 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
| 0.0 | 0.3 | GO:0034605 | cellular response to heat(GO:0034605) |
| 0.0 | 0.2 | GO:0072661 | protein targeting to plasma membrane(GO:0072661) |
| 0.0 | 0.0 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
| 0.0 | 0.0 | GO:1904238 | mesangial cell differentiation(GO:0072007) glomerular mesangial cell differentiation(GO:0072008) kidney interstitial fibroblast differentiation(GO:0072071) renal interstitial fibroblast development(GO:0072141) mesangial cell development(GO:0072143) glomerular mesangial cell development(GO:0072144) pericyte cell differentiation(GO:1904238) |
| 0.0 | 0.1 | GO:0043306 | positive regulation of mast cell activation involved in immune response(GO:0033008) positive regulation of mast cell degranulation(GO:0043306) |
| 0.0 | 0.3 | GO:0048536 | spleen development(GO:0048536) |
| 0.0 | 0.0 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
| 0.0 | 0.0 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
| 0.0 | 0.2 | GO:0033962 | cytoplasmic mRNA processing body assembly(GO:0033962) |
| 0.0 | 0.0 | GO:0031443 | fast-twitch skeletal muscle fiber contraction(GO:0031443) |
| 0.0 | 0.1 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.0 | 0.0 | GO:0007567 | parturition(GO:0007567) |
| 0.0 | 0.2 | GO:0060216 | definitive hemopoiesis(GO:0060216) |
| 0.0 | 0.2 | GO:0015693 | magnesium ion transport(GO:0015693) |
| 0.0 | 0.0 | GO:0033084 | regulation of immature T cell proliferation in thymus(GO:0033084) |
| 0.0 | 0.0 | GO:0045897 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
| 0.0 | 0.1 | GO:0006103 | 2-oxoglutarate metabolic process(GO:0006103) |
| 0.0 | 0.1 | GO:0045217 | cell-cell junction maintenance(GO:0045217) |
| 0.0 | 0.1 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.0 | 0.0 | GO:0045113 | regulation of integrin biosynthetic process(GO:0045113) |
| 0.0 | 0.0 | GO:1902261 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.0 | 0.3 | GO:0048240 | sperm capacitation(GO:0048240) |
| 0.0 | 0.1 | GO:0045742 | positive regulation of epidermal growth factor receptor signaling pathway(GO:0045742) positive regulation of ERBB signaling pathway(GO:1901186) |
| 0.0 | 0.0 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
| 0.0 | 0.2 | GO:0046457 | prostaglandin biosynthetic process(GO:0001516) prostanoid biosynthetic process(GO:0046457) |
| 0.0 | 0.1 | GO:0042219 | cellular modified amino acid catabolic process(GO:0042219) |
| 0.0 | 0.0 | GO:0015744 | succinate transport(GO:0015744) |
| 0.0 | 0.1 | GO:0007512 | adult heart development(GO:0007512) |
| 0.0 | 0.1 | GO:0045986 | negative regulation of smooth muscle contraction(GO:0045986) |
| 0.0 | 0.0 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.0 | 0.0 | GO:0097048 | dendritic cell apoptotic process(GO:0097048) regulation of dendritic cell apoptotic process(GO:2000668) |
| 0.0 | 0.1 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
| 0.0 | 0.1 | GO:0046146 | tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.0 | 0.1 | GO:0015871 | choline transport(GO:0015871) |
| 0.0 | 0.1 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
| 0.0 | 0.0 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
| 0.0 | 0.1 | GO:0070932 | histone H3 deacetylation(GO:0070932) |
| 0.0 | 0.1 | GO:0032148 | activation of protein kinase B activity(GO:0032148) |
| 0.0 | 0.0 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
| 0.0 | 0.1 | GO:0007202 | activation of phospholipase C activity(GO:0007202) |
| 0.0 | 0.1 | GO:0006449 | regulation of translational termination(GO:0006449) |
| 0.0 | 0.2 | GO:0009225 | nucleotide-sugar metabolic process(GO:0009225) |
| 0.0 | 0.1 | GO:2000780 | negative regulation of double-strand break repair(GO:2000780) |
| 0.0 | 0.1 | GO:0007638 | mechanosensory behavior(GO:0007638) |
| 0.0 | 0.0 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
| 0.0 | 0.1 | GO:0035020 | regulation of Rac protein signal transduction(GO:0035020) |
| 0.0 | 0.0 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.0 | 0.0 | GO:0015691 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.0 | 0.0 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
| 0.0 | 0.0 | GO:1901679 | pyrimidine-containing compound transmembrane transport(GO:0072531) nucleotide transmembrane transport(GO:1901679) |
| 0.0 | 0.0 | GO:2000399 | negative regulation of thymocyte aggregation(GO:2000399) |
| 0.0 | 0.0 | GO:0055118 | negative regulation of cardiac muscle contraction(GO:0055118) |
| 0.0 | 0.1 | GO:0046132 | pyrimidine ribonucleotide biosynthetic process(GO:0009220) pyrimidine ribonucleoside biosynthetic process(GO:0046132) |
| 0.0 | 0.0 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
| 0.0 | 0.1 | GO:0006528 | asparagine metabolic process(GO:0006528) |
| 0.0 | 0.0 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
| 0.0 | 0.0 | GO:0046931 | pore complex assembly(GO:0046931) |
| 0.0 | 0.0 | GO:0060754 | positive regulation of mast cell chemotaxis(GO:0060754) |
| 0.0 | 0.0 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
| 0.0 | 0.0 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
| 0.0 | 0.0 | GO:0035087 | siRNA loading onto RISC involved in RNA interference(GO:0035087) |
| 0.0 | 0.1 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.0 | 0.0 | GO:0061355 | Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) |
| 0.0 | 0.1 | GO:0009109 | coenzyme catabolic process(GO:0009109) |
| 0.0 | 0.1 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
| 0.0 | 0.1 | GO:0035095 | behavioral response to nicotine(GO:0035095) |
| 0.0 | 0.3 | GO:0006688 | glycosphingolipid biosynthetic process(GO:0006688) |
| 0.0 | 0.0 | GO:0032714 | negative regulation of interleukin-13 production(GO:0032696) negative regulation of interleukin-5 production(GO:0032714) |
| 0.0 | 0.0 | GO:0015747 | urate transport(GO:0015747) |
| 0.0 | 0.0 | GO:0097242 | beta-amyloid clearance(GO:0097242) |
| 0.0 | 0.1 | GO:0032308 | regulation of prostaglandin secretion(GO:0032306) positive regulation of prostaglandin secretion(GO:0032308) |
| 0.0 | 0.1 | GO:0009438 | methylglyoxal metabolic process(GO:0009438) |
| 0.0 | 0.0 | GO:2000172 | regulation of branching morphogenesis of a nerve(GO:2000172) |
| 0.0 | 0.0 | GO:0045048 | protein insertion into ER membrane(GO:0045048) tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
| 0.0 | 0.0 | GO:0033087 | negative regulation of immature T cell proliferation(GO:0033087) |
| 0.0 | 0.0 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
| 0.0 | 0.0 | GO:0032898 | neurotrophin production(GO:0032898) |
| 0.0 | 0.0 | GO:0045794 | negative regulation of cell volume(GO:0045794) |
| 0.0 | 0.1 | GO:0007100 | mitotic centrosome separation(GO:0007100) |
| 0.0 | 0.0 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
| 0.0 | 0.1 | GO:0002087 | regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
| 0.0 | 0.0 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
| 0.0 | 0.0 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
| 0.0 | 0.0 | GO:0046469 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
| 0.0 | 0.0 | GO:0050955 | thermoception(GO:0050955) |
| 0.0 | 0.0 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
| 0.0 | 0.1 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
| 0.0 | 0.0 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
| 0.0 | 0.0 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
| 0.0 | 0.3 | GO:0045839 | negative regulation of mitotic nuclear division(GO:0045839) |
| 0.0 | 0.0 | GO:0033227 | dsRNA transport(GO:0033227) |
| 0.0 | 0.1 | GO:0006691 | leukotriene metabolic process(GO:0006691) |
| 0.0 | 0.0 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 0.0 | 0.0 | GO:0046015 | regulation of transcription by glucose(GO:0046015) |
| 0.0 | 0.1 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.0 | 0.1 | GO:0003356 | regulation of cilium beat frequency(GO:0003356) |
| 0.0 | 0.0 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.0 | 0.1 | GO:0042026 | protein refolding(GO:0042026) |
| 0.0 | 0.0 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
| 0.0 | 0.0 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 0.0 | 0.0 | GO:0046684 | response to pyrethroid(GO:0046684) |
| 0.0 | 0.1 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
| 0.0 | 0.0 | GO:0021603 | cranial nerve formation(GO:0021603) |
| 0.0 | 0.0 | GO:0034982 | mitochondrial protein processing(GO:0034982) |
| 0.0 | 0.0 | GO:0033686 | positive regulation of luteinizing hormone secretion(GO:0033686) |
| 0.0 | 0.0 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.0 | 0.1 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
| 0.0 | 0.0 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.0 | 0.1 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.0 | 0.0 | GO:0044340 | canonical Wnt signaling pathway involved in regulation of cell proliferation(GO:0044340) |
| 0.0 | 0.0 | GO:1903977 | positive regulation of glial cell migration(GO:1903977) |
| 0.0 | 0.4 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
| 0.0 | 0.0 | GO:0002091 | negative regulation of receptor internalization(GO:0002091) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 0.9 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
| 0.2 | 0.6 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.2 | 0.9 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.2 | 0.6 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
| 0.2 | 0.6 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
| 0.1 | 0.6 | GO:0044316 | cone cell pedicle(GO:0044316) |
| 0.1 | 2.4 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.1 | 0.3 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
| 0.1 | 0.3 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
| 0.1 | 0.3 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
| 0.1 | 0.8 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.1 | 0.5 | GO:0005579 | membrane attack complex(GO:0005579) |
| 0.1 | 0.4 | GO:0098536 | deuterosome(GO:0098536) |
| 0.1 | 0.3 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
| 0.1 | 0.3 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.1 | 1.0 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.1 | 0.3 | GO:0048179 | activin receptor complex(GO:0048179) |
| 0.1 | 0.5 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
| 0.1 | 0.2 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
| 0.1 | 0.3 | GO:0070545 | PeBoW complex(GO:0070545) |
| 0.1 | 0.5 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 0.1 | 0.2 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
| 0.1 | 0.3 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.1 | 0.5 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.1 | 0.2 | GO:0071942 | XPC complex(GO:0071942) |
| 0.1 | 0.3 | GO:0030478 | actin cap(GO:0030478) |
| 0.1 | 0.2 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.1 | 0.3 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 0.1 | 0.2 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.1 | 0.2 | GO:0045293 | mRNA editing complex(GO:0045293) |
| 0.1 | 0.2 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
| 0.1 | 0.2 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.1 | 0.2 | GO:0097441 | basilar dendrite(GO:0097441) |
| 0.1 | 0.7 | GO:0005916 | fascia adherens(GO:0005916) |
| 0.1 | 0.3 | GO:0070688 | MLL5-L complex(GO:0070688) |
| 0.1 | 0.5 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
| 0.1 | 0.2 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
| 0.1 | 0.7 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
| 0.1 | 0.3 | GO:0042824 | MHC class I peptide loading complex(GO:0042824) |
| 0.1 | 0.2 | GO:1990812 | growth cone filopodium(GO:1990812) |
| 0.1 | 0.4 | GO:0032300 | mismatch repair complex(GO:0032300) |
| 0.0 | 0.2 | GO:0005775 | vacuolar lumen(GO:0005775) |
| 0.0 | 0.1 | GO:0032437 | cuticular plate(GO:0032437) |
| 0.0 | 0.6 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
| 0.0 | 0.6 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
| 0.0 | 0.1 | GO:0032127 | dense core granule membrane(GO:0032127) |
| 0.0 | 0.2 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
| 0.0 | 0.2 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.0 | 0.2 | GO:0036449 | microtubule minus-end(GO:0036449) |
| 0.0 | 0.4 | GO:0097208 | alveolar lamellar body(GO:0097208) |
| 0.0 | 0.2 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
| 0.0 | 0.0 | GO:0000938 | GARP complex(GO:0000938) |
| 0.0 | 0.3 | GO:0031010 | ISWI-type complex(GO:0031010) |
| 0.0 | 0.6 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.0 | 0.3 | GO:1904115 | axon cytoplasm(GO:1904115) |
| 0.0 | 0.4 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.0 | 0.6 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
| 0.0 | 0.3 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.0 | 0.2 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.0 | 0.1 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
| 0.0 | 0.1 | GO:0008091 | spectrin(GO:0008091) |
| 0.0 | 0.1 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
| 0.0 | 0.1 | GO:0097524 | sperm plasma membrane(GO:0097524) |
| 0.0 | 1.6 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.0 | 0.2 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
| 0.0 | 0.1 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
| 0.0 | 0.3 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.0 | 0.1 | GO:0031417 | NatC complex(GO:0031417) |
| 0.0 | 1.6 | GO:0031903 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
| 0.0 | 0.5 | GO:0002102 | podosome(GO:0002102) |
| 0.0 | 0.4 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.0 | 0.1 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.0 | 0.1 | GO:0030870 | Mre11 complex(GO:0030870) |
| 0.0 | 0.1 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
| 0.0 | 0.1 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
| 0.0 | 0.3 | GO:0042405 | nuclear inclusion body(GO:0042405) |
| 0.0 | 0.2 | GO:0089701 | U2AF(GO:0089701) |
| 0.0 | 0.2 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
| 0.0 | 0.1 | GO:0030127 | COPII vesicle coat(GO:0030127) |
| 0.0 | 0.1 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
| 0.0 | 0.2 | GO:0031415 | NatA complex(GO:0031415) |
| 0.0 | 0.1 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.0 | 2.0 | GO:0016605 | PML body(GO:0016605) |
| 0.0 | 0.4 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 0.0 | 0.6 | GO:0034451 | centriolar satellite(GO:0034451) |
| 0.0 | 0.1 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
| 0.0 | 0.1 | GO:0097513 | myosin II filament(GO:0097513) |
| 0.0 | 0.1 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.0 | 0.2 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.0 | 0.1 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
| 0.0 | 0.1 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.0 | 0.9 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
| 0.0 | 0.4 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.0 | 0.6 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
| 0.0 | 0.8 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.0 | 0.2 | GO:0097539 | ciliary transition fiber(GO:0097539) |
| 0.0 | 0.1 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
| 0.0 | 0.9 | GO:0030964 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
| 0.0 | 0.1 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
| 0.0 | 0.1 | GO:0097422 | tubular endosome(GO:0097422) |
| 0.0 | 0.1 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
| 0.0 | 0.1 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
| 0.0 | 0.1 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.0 | 0.3 | GO:0043034 | costamere(GO:0043034) |
| 0.0 | 0.1 | GO:0071986 | Ragulator complex(GO:0071986) |
| 0.0 | 0.1 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
| 0.0 | 0.0 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
| 0.0 | 0.9 | GO:0097517 | stress fiber(GO:0001725) contractile actin filament bundle(GO:0097517) |
| 0.0 | 0.1 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
| 0.0 | 0.1 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 0.0 | 0.2 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
| 0.0 | 0.1 | GO:0001651 | dense fibrillar component(GO:0001651) |
| 0.0 | 0.1 | GO:1990423 | RZZ complex(GO:1990423) |
| 0.0 | 0.4 | GO:0005746 | mitochondrial respiratory chain(GO:0005746) |
| 0.0 | 0.1 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
| 0.0 | 0.1 | GO:0042583 | chromaffin granule(GO:0042583) |
| 0.0 | 0.2 | GO:0000242 | pericentriolar material(GO:0000242) |
| 0.0 | 0.2 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
| 0.0 | 0.0 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
| 0.0 | 0.1 | GO:0000798 | nuclear cohesin complex(GO:0000798) |
| 0.0 | 0.1 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.0 | 0.1 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
| 0.0 | 0.2 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
| 0.0 | 0.1 | GO:0070578 | RISC-loading complex(GO:0070578) |
| 0.0 | 0.1 | GO:0000814 | ESCRT II complex(GO:0000814) |
| 0.0 | 0.3 | GO:0060293 | P granule(GO:0043186) pole plasm(GO:0045495) germ plasm(GO:0060293) |
| 0.0 | 0.0 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
| 0.0 | 0.1 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.0 | 0.1 | GO:0030285 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
| 0.0 | 0.1 | GO:0001940 | male pronucleus(GO:0001940) |
| 0.0 | 0.1 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.0 | 0.1 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.0 | 0.1 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.0 | 0.1 | GO:1990130 | Iml1 complex(GO:1990130) |
| 0.0 | 0.2 | GO:0032982 | myosin filament(GO:0032982) |
| 0.0 | 0.1 | GO:0044308 | axonal spine(GO:0044308) |
| 0.0 | 0.0 | GO:0072487 | MSL complex(GO:0072487) |
| 0.0 | 0.1 | GO:1990745 | EARP complex(GO:1990745) |
| 0.0 | 0.0 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.0 | 0.0 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
| 0.0 | 0.1 | GO:0045180 | basal cortex(GO:0045180) |
| 0.0 | 0.1 | GO:0000780 | condensed nuclear chromosome, centromeric region(GO:0000780) |
| 0.0 | 0.3 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.0 | 0.4 | GO:0005776 | autophagosome(GO:0005776) |
| 0.0 | 0.2 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.0 | 0.1 | GO:0031512 | motile primary cilium(GO:0031512) |
| 0.0 | 0.0 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
| 0.0 | 0.2 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
| 0.0 | 0.1 | GO:0070938 | contractile ring(GO:0070938) |
| 0.0 | 0.1 | GO:0071203 | WASH complex(GO:0071203) |
| 0.0 | 0.3 | GO:0044665 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
| 0.0 | 0.1 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
| 0.0 | 0.0 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.0 | 0.0 | GO:0046691 | intracellular canaliculus(GO:0046691) |
| 0.0 | 0.1 | GO:0010369 | chromocenter(GO:0010369) |
| 0.0 | 0.0 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.0 | 0.6 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.0 | 0.2 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
| 0.0 | 0.0 | GO:0045098 | type III intermediate filament(GO:0045098) |
| 0.0 | 0.3 | GO:0036379 | myofilament(GO:0036379) |
| 0.0 | 0.0 | GO:0001652 | granular component(GO:0001652) |
| 0.0 | 0.1 | GO:0071014 | post-mRNA release spliceosomal complex(GO:0071014) |
| 0.0 | 0.4 | GO:0016592 | mediator complex(GO:0016592) |
| 0.0 | 0.0 | GO:0046930 | pore complex(GO:0046930) |
| 0.0 | 1.4 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
| 0.0 | 0.0 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.0 | 0.2 | GO:0032809 | neuronal cell body membrane(GO:0032809) |
| 0.0 | 0.2 | GO:0005719 | nuclear euchromatin(GO:0005719) |
| 0.0 | 0.1 | GO:0000777 | condensed chromosome kinetochore(GO:0000777) |
| 0.0 | 0.0 | GO:0044292 | dendrite terminus(GO:0044292) |
| 0.0 | 0.6 | GO:0005814 | centriole(GO:0005814) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 1.2 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
| 0.2 | 0.7 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
| 0.2 | 0.9 | GO:0038064 | collagen receptor activity(GO:0038064) |
| 0.2 | 2.2 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
| 0.2 | 0.4 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
| 0.2 | 0.6 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.2 | 0.7 | GO:0034056 | estrogen response element binding(GO:0034056) |
| 0.2 | 0.5 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
| 0.2 | 0.8 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
| 0.2 | 0.6 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
| 0.2 | 0.5 | GO:0038181 | bile acid receptor activity(GO:0038181) |
| 0.2 | 0.6 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
| 0.2 | 1.4 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.2 | 0.9 | GO:0034875 | oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
| 0.1 | 0.6 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
| 0.1 | 0.7 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
| 0.1 | 0.5 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
| 0.1 | 0.4 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
| 0.1 | 0.7 | GO:0022820 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.1 | 0.5 | GO:0000403 | Y-form DNA binding(GO:0000403) |
| 0.1 | 0.4 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
| 0.1 | 0.2 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
| 0.1 | 0.4 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
| 0.1 | 0.7 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.1 | 0.3 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
| 0.1 | 0.3 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.1 | 0.3 | GO:0055100 | adiponectin binding(GO:0055100) |
| 0.1 | 1.1 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
| 0.1 | 0.3 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
| 0.1 | 0.3 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
| 0.1 | 0.3 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
| 0.1 | 0.4 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
| 0.1 | 0.7 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
| 0.1 | 0.5 | GO:0004556 | alpha-amylase activity(GO:0004556) |
| 0.1 | 0.3 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
| 0.1 | 0.3 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.1 | 0.3 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.1 | 0.8 | GO:0002162 | dystroglycan binding(GO:0002162) |
| 0.1 | 0.5 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.1 | 0.4 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
| 0.1 | 0.2 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
| 0.1 | 0.5 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
| 0.1 | 0.2 | GO:0004793 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
| 0.1 | 0.2 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
| 0.1 | 0.3 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
| 0.1 | 0.1 | GO:0000009 | alpha-1,6-mannosyltransferase activity(GO:0000009) |
| 0.1 | 0.2 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
| 0.1 | 0.4 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
| 0.1 | 0.3 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
| 0.1 | 0.2 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
| 0.1 | 0.1 | GO:0042281 | dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase activity(GO:0042281) |
| 0.1 | 0.1 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
| 0.1 | 0.3 | GO:0032557 | pyrimidine ribonucleotide binding(GO:0032557) |
| 0.1 | 0.2 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
| 0.1 | 0.5 | GO:0008494 | translation activator activity(GO:0008494) |
| 0.1 | 0.1 | GO:0070644 | vitamin D response element binding(GO:0070644) |
| 0.1 | 1.0 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
| 0.1 | 0.2 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.1 | 0.3 | GO:0035671 | enone reductase activity(GO:0035671) |
| 0.1 | 0.4 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
| 0.1 | 0.2 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
| 0.1 | 0.6 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.1 | 0.2 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
| 0.1 | 0.2 | GO:0004083 | bisphosphoglycerate 2-phosphatase activity(GO:0004083) |
| 0.1 | 0.2 | GO:0030620 | U2 snRNA binding(GO:0030620) |
| 0.1 | 0.2 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
| 0.1 | 0.2 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 0.1 | 0.2 | GO:0051718 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
| 0.1 | 0.3 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
| 0.1 | 0.1 | GO:0032564 | dATP binding(GO:0032564) |
| 0.1 | 0.3 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
| 0.1 | 0.2 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.1 | 0.2 | GO:0005042 | netrin receptor activity(GO:0005042) |
| 0.1 | 0.2 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
| 0.1 | 0.2 | GO:0098821 | BMP receptor activity(GO:0098821) |
| 0.1 | 0.2 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.1 | 0.2 | GO:0004096 | catalase activity(GO:0004096) |
| 0.1 | 0.2 | GO:0030350 | iron-responsive element binding(GO:0030350) |
| 0.1 | 0.2 | GO:0016015 | morphogen activity(GO:0016015) |
| 0.1 | 0.3 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.1 | 0.3 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.1 | 0.2 | GO:0051425 | PTB domain binding(GO:0051425) |
| 0.0 | 0.6 | GO:0070402 | NADPH binding(GO:0070402) |
| 0.0 | 0.7 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.0 | 0.1 | GO:0004771 | sterol esterase activity(GO:0004771) |
| 0.0 | 0.4 | GO:0043995 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
| 0.0 | 0.1 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.0 | 0.1 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
| 0.0 | 0.2 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 0.0 | 0.3 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.0 | 0.4 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
| 0.0 | 0.2 | GO:0002046 | opsin binding(GO:0002046) |
| 0.0 | 0.2 | GO:0071614 | linoleic acid epoxygenase activity(GO:0071614) |
| 0.0 | 0.1 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
| 0.0 | 0.2 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
| 0.0 | 0.3 | GO:0004385 | guanylate kinase activity(GO:0004385) |
| 0.0 | 0.0 | GO:0019187 | beta-1,4-mannosyltransferase activity(GO:0019187) |
| 0.0 | 0.4 | GO:0017166 | vinculin binding(GO:0017166) |
| 0.0 | 0.1 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
| 0.0 | 0.1 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
| 0.0 | 0.6 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
| 0.0 | 0.2 | GO:0004340 | glucokinase activity(GO:0004340) hexokinase activity(GO:0004396) |
| 0.0 | 0.2 | GO:0052851 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
| 0.0 | 0.2 | GO:0086007 | voltage-gated calcium channel activity involved in cardiac muscle cell action potential(GO:0086007) |
| 0.0 | 0.1 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
| 0.0 | 0.3 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.0 | 0.1 | GO:0050692 | DBD domain binding(GO:0050692) |
| 0.0 | 0.4 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
| 0.0 | 0.2 | GO:0043559 | insulin binding(GO:0043559) |
| 0.0 | 0.1 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.0 | 0.2 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.0 | 0.2 | GO:0042731 | PH domain binding(GO:0042731) |
| 0.0 | 0.6 | GO:0071949 | FAD binding(GO:0071949) |
| 0.0 | 0.1 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
| 0.0 | 0.5 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.0 | 0.1 | GO:0004376 | glycolipid mannosyltransferase activity(GO:0004376) |
| 0.0 | 0.1 | GO:0005347 | ATP transmembrane transporter activity(GO:0005347) |
| 0.0 | 0.2 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.0 | 0.1 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
| 0.0 | 0.0 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
| 0.0 | 0.1 | GO:0008934 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
| 0.0 | 0.3 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.0 | 0.1 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
| 0.0 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.0 | 0.1 | GO:0031852 | mu-type opioid receptor binding(GO:0031852) |
| 0.0 | 0.7 | GO:0044769 | ATPase activity, coupled to transmembrane movement of ions, rotational mechanism(GO:0044769) |
| 0.0 | 1.1 | GO:0052771 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
| 0.0 | 0.1 | GO:0097016 | L27 domain binding(GO:0097016) |
| 0.0 | 0.1 | GO:0004370 | glycerol kinase activity(GO:0004370) |
| 0.0 | 0.0 | GO:0004676 | 3-phosphoinositide-dependent protein kinase activity(GO:0004676) |
| 0.0 | 0.1 | GO:0034929 | mono-butyltin dioxygenase activity(GO:0018586) tri-n-butyltin dioxygenase activity(GO:0018588) di-n-butyltin dioxygenase activity(GO:0018589) methylsilanetriol hydroxylase activity(GO:0018590) methyl tertiary butyl ether 3-monooxygenase activity(GO:0018591) 4-nitrocatechol 4-monooxygenase activity(GO:0018592) 4-chlorophenoxyacetate monooxygenase activity(GO:0018593) tert-butanol 2-monooxygenase activity(GO:0018594) alpha-pinene monooxygenase activity(GO:0018595) dimethylsilanediol hydroxylase activity(GO:0018596) ammonia monooxygenase activity(GO:0018597) hydroxymethylsilanetriol oxidase activity(GO:0018598) 2-hydroxyisobutyrate 3-monooxygenase activity(GO:0018599) alpha-pinene dehydrogenase activity(GO:0018600) bisphenol A hydroxylase B activity(GO:0034559) 2,2-bis(4-hydroxyphenyl)-1-propanol hydroxylase activity(GO:0034562) 9-fluorenone-3,4-dioxygenase activity(GO:0034786) anthracene 9,10-dioxygenase activity(GO:0034816) 2-(methylthio)benzothiazole monooxygenase activity(GO:0034857) 2-hydroxybenzothiazole monooxygenase activity(GO:0034858) benzothiazole monooxygenase activity(GO:0034859) 2,6-dihydroxybenzothiazole monooxygenase activity(GO:0034862) pinacolone 5-monooxygenase activity(GO:0034870) thioacetamide S-oxygenase activity(GO:0034873) thioacetamide S-oxide S-oxygenase activity(GO:0034874) endosulfan monooxygenase I activity(GO:0034888) N-nitrodimethylamine hydroxylase activity(GO:0034893) 4-(1-ethyl-1,4-dimethyl-pentyl)phenol monoxygenase activity(GO:0034897) endosulfan ether monooxygenase activity(GO:0034903) pyrene 4,5-monooxygenase activity(GO:0034925) pyrene 1,2-monooxygenase activity(GO:0034927) 1-hydroxypyrene 6,7-monooxygenase activity(GO:0034928) 1-hydroxypyrene 7,8-monooxygenase activity(GO:0034929) phenylboronic acid monooxygenase activity(GO:0034950) spheroidene monooxygenase activity(GO:0043823) |
| 0.0 | 1.3 | GO:0031593 | polyubiquitin binding(GO:0031593) |
| 0.0 | 0.2 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
| 0.0 | 0.1 | GO:0019808 | polyamine binding(GO:0019808) |
| 0.0 | 0.8 | GO:0030552 | cAMP binding(GO:0030552) |
| 0.0 | 1.0 | GO:0042169 | SH2 domain binding(GO:0042169) |
| 0.0 | 0.7 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
| 0.0 | 0.1 | GO:0016151 | nickel cation binding(GO:0016151) |
| 0.0 | 0.1 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) |
| 0.0 | 0.2 | GO:0035197 | siRNA binding(GO:0035197) |
| 0.0 | 0.2 | GO:0000146 | microfilament motor activity(GO:0000146) |
| 0.0 | 0.1 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.0 | 0.1 | GO:0089720 | caspase binding(GO:0089720) |
| 0.0 | 0.1 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 0.0 | 0.4 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.0 | 0.1 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
| 0.0 | 0.9 | GO:0004033 | aldo-keto reductase (NADP) activity(GO:0004033) |
| 0.0 | 0.2 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
| 0.0 | 2.6 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
| 0.0 | 0.3 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
| 0.0 | 0.1 | GO:0016018 | cyclosporin A binding(GO:0016018) |
| 0.0 | 0.1 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.0 | 0.6 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.0 | 0.2 | GO:0010861 | thyroid hormone receptor activator activity(GO:0010861) |
| 0.0 | 0.2 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
| 0.0 | 0.1 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.0 | 0.3 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.0 | 0.1 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
| 0.0 | 0.1 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.0 | 0.1 | GO:0070538 | oleic acid binding(GO:0070538) |
| 0.0 | 0.1 | GO:0001642 | group III metabotropic glutamate receptor activity(GO:0001642) |
| 0.0 | 0.2 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.0 | 0.1 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
| 0.0 | 0.1 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.0 | 0.1 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
| 0.0 | 0.2 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.0 | 0.1 | GO:0043495 | protein anchor(GO:0043495) |
| 0.0 | 0.2 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
| 0.0 | 0.1 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.0 | 0.2 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
| 0.0 | 0.1 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
| 0.0 | 0.5 | GO:0008137 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.0 | 0.2 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.0 | 0.2 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.0 | 0.2 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 0.0 | 0.1 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
| 0.0 | 0.1 | GO:0030371 | translation repressor activity(GO:0030371) |
| 0.0 | 0.0 | GO:0004104 | cholinesterase activity(GO:0004104) |
| 0.0 | 0.2 | GO:0035174 | histone serine kinase activity(GO:0035174) |
| 0.0 | 0.2 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
| 0.0 | 0.2 | GO:0015645 | fatty acid ligase activity(GO:0015645) |
| 0.0 | 0.2 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
| 0.0 | 0.2 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.0 | 0.2 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.0 | 0.0 | GO:0015216 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) |
| 0.0 | 0.5 | GO:0004364 | glutathione transferase activity(GO:0004364) |
| 0.0 | 0.3 | GO:0005523 | tropomyosin binding(GO:0005523) |
| 0.0 | 0.1 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
| 0.0 | 0.4 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
| 0.0 | 0.2 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.0 | 0.2 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
| 0.0 | 0.1 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
| 0.0 | 0.1 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.0 | 0.1 | GO:0004448 | isocitrate dehydrogenase activity(GO:0004448) |
| 0.0 | 0.4 | GO:0016864 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
| 0.0 | 0.1 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
| 0.0 | 0.2 | GO:0008097 | 5S rRNA binding(GO:0008097) |
| 0.0 | 0.1 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.0 | 0.0 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
| 0.0 | 0.3 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
| 0.0 | 0.1 | GO:0043426 | MRF binding(GO:0043426) |
| 0.0 | 0.1 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 0.0 | 0.1 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
| 0.0 | 0.1 | GO:0098748 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
| 0.0 | 0.0 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
| 0.0 | 0.2 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.0 | 0.1 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
| 0.0 | 0.2 | GO:0034185 | apolipoprotein binding(GO:0034185) |
| 0.0 | 0.0 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
| 0.0 | 0.1 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.0 | 0.1 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
| 0.0 | 0.1 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
| 0.0 | 0.1 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
| 0.0 | 0.1 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.0 | 0.1 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.0 | 0.2 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.0 | 0.1 | GO:0042285 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
| 0.0 | 0.4 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
| 0.0 | 0.1 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
| 0.0 | 0.0 | GO:0050816 | phosphothreonine binding(GO:0050816) |
| 0.0 | 0.6 | GO:0004864 | protein phosphatase inhibitor activity(GO:0004864) |
| 0.0 | 0.1 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.0 | 0.1 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
| 0.0 | 0.1 | GO:0045294 | alpha-catenin binding(GO:0045294) |
| 0.0 | 0.1 | GO:0050897 | cobalt ion binding(GO:0050897) |
| 0.0 | 0.3 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
| 0.0 | 0.1 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.0 | 0.1 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.0 | 0.7 | GO:0051723 | protein methylesterase activity(GO:0051723) |
| 0.0 | 0.1 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.0 | 0.1 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
| 0.0 | 0.1 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
| 0.0 | 0.2 | GO:0048156 | tau protein binding(GO:0048156) |
| 0.0 | 0.1 | GO:0016681 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
| 0.0 | 0.0 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
| 0.0 | 0.4 | GO:0008536 | Ran GTPase binding(GO:0008536) |
| 0.0 | 0.1 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
| 0.0 | 0.1 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
| 0.0 | 0.0 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
| 0.0 | 0.1 | GO:0070728 | leucine binding(GO:0070728) |
| 0.0 | 0.1 | GO:0004487 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
| 0.0 | 0.1 | GO:0016724 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
| 0.0 | 0.1 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
| 0.0 | 0.1 | GO:0017070 | U6 snRNA binding(GO:0017070) |
| 0.0 | 0.1 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
| 0.0 | 0.5 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
| 0.0 | 0.0 | GO:0051880 | G-quadruplex DNA binding(GO:0051880) |
| 0.0 | 0.1 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
| 0.0 | 0.0 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
| 0.0 | 0.3 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
| 0.0 | 0.4 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
| 0.0 | 0.0 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
| 0.0 | 0.3 | GO:0008200 | ion channel inhibitor activity(GO:0008200) |
| 0.0 | 0.2 | GO:0005522 | profilin binding(GO:0005522) |
| 0.0 | 0.1 | GO:0008320 | protein transmembrane transporter activity(GO:0008320) |
| 0.0 | 0.1 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.0 | 0.1 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
| 0.0 | 0.3 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.0 | 0.1 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
| 0.0 | 0.1 | GO:0003988 | acetyl-CoA C-acyltransferase activity(GO:0003988) |
| 0.0 | 0.2 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
| 0.0 | 0.1 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.0 | 0.0 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
| 0.0 | 0.1 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.0 | 0.1 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
| 0.0 | 0.4 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
| 0.0 | 0.7 | GO:0035064 | methylated histone binding(GO:0035064) |
| 0.0 | 0.3 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.0 | 0.3 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
| 0.0 | 0.3 | GO:0046875 | ephrin receptor binding(GO:0046875) |
| 0.0 | 0.1 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
| 0.0 | 0.1 | GO:0043140 | ATP-dependent 3'-5' DNA helicase activity(GO:0043140) |
| 0.0 | 0.1 | GO:0097001 | ceramide binding(GO:0097001) |
| 0.0 | 0.1 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.0 | 0.0 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
| 0.0 | 0.2 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.0 | 0.1 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
| 0.0 | 0.6 | GO:0003725 | double-stranded RNA binding(GO:0003725) |
| 0.0 | 0.3 | GO:0019888 | protein phosphatase regulator activity(GO:0019888) |
| 0.0 | 0.0 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
| 0.0 | 0.2 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
| 0.0 | 1.1 | GO:0004725 | protein tyrosine phosphatase activity(GO:0004725) |
| 0.0 | 0.1 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.0 | 0.1 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
| 0.0 | 0.0 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
| 0.0 | 0.0 | GO:0015141 | succinate transmembrane transporter activity(GO:0015141) |
| 0.0 | 0.1 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.0 | 0.1 | GO:0008474 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.0 | 0.0 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
| 0.0 | 0.1 | GO:0004779 | sulfate adenylyltransferase activity(GO:0004779) |
| 0.0 | 0.1 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
| 0.0 | 0.2 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.0 | 0.1 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
| 0.0 | 0.0 | GO:0034452 | dynactin binding(GO:0034452) |
| 0.0 | 0.3 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.0 | 0.1 | GO:0005499 | vitamin D binding(GO:0005499) |
| 0.0 | 0.1 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
| 0.0 | 0.0 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.0 | 0.0 | GO:0019959 | interleukin-8 binding(GO:0019959) |
| 0.0 | 0.1 | GO:0008198 | ferrous iron binding(GO:0008198) |
| 0.0 | 0.0 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
| 0.0 | 0.1 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) acidic amino acid transmembrane transporter activity(GO:0015172) |
| 0.0 | 0.0 | GO:0016882 | cyclo-ligase activity(GO:0016882) |
| 0.0 | 0.0 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
| 0.0 | 0.0 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
| 0.0 | 0.0 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.0 | 0.0 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
| 0.0 | 0.0 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
| 0.0 | 0.0 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
| 0.0 | 0.2 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
| 0.0 | 0.2 | GO:0030506 | ankyrin binding(GO:0030506) |
| 0.0 | 0.2 | GO:0042162 | telomeric DNA binding(GO:0042162) |
| 0.0 | 0.1 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
| 0.0 | 0.0 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
| 0.0 | 0.1 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
| 0.0 | 0.2 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
| 0.0 | 0.0 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
| 0.0 | 0.1 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
| 0.0 | 0.1 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
| 0.0 | 0.1 | GO:0004120 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) photoreceptor cyclic-nucleotide phosphodiesterase activity(GO:0004120) 7,8-dihydro-D-neopterin 2',3'-cyclic phosphate phosphodiesterase activity(GO:0044688) inositol phosphosphingolipid phospholipase activity(GO:0052712) inositol phosphorylceramide phospholipase activity(GO:0052713) mannosyl-inositol phosphorylceramide phospholipase activity(GO:0052714) mannosyl-diinositol phosphorylceramide phospholipase activity(GO:0052715) |
| 0.0 | 0.1 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
| 0.0 | 0.0 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
| 0.0 | 0.0 | GO:0004936 | alpha-adrenergic receptor activity(GO:0004936) |
| 0.0 | 0.1 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.2 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
| 0.1 | 1.7 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
| 0.1 | 1.0 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.1 | 0.4 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
| 0.0 | 1.4 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
| 0.0 | 0.4 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.0 | 0.2 | PID S1P S1P4 PATHWAY | S1P4 pathway |
| 0.0 | 0.1 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
| 0.0 | 0.1 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
| 0.0 | 1.7 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.0 | 0.4 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.0 | 0.7 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
| 0.0 | 0.5 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.0 | 0.3 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
| 0.0 | 0.8 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
| 0.0 | 0.2 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.0 | 0.6 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
| 0.0 | 1.1 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
| 0.0 | 0.9 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
| 0.0 | 0.6 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.0 | 0.0 | PID ERBB1 RECEPTOR PROXIMAL PATHWAY | EGF receptor (ErbB1) signaling pathway |
| 0.0 | 0.0 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.0 | 0.4 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
| 0.0 | 0.4 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.0 | 0.4 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
| 0.0 | 0.4 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.0 | 0.5 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.0 | 0.6 | PID BARD1 PATHWAY | BARD1 signaling events |
| 0.0 | 0.6 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 0.0 | 0.0 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.0 | 0.8 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.0 | 0.2 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.0 | 0.4 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
| 0.0 | 0.7 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.0 | 0.2 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.0 | 0.1 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
| 0.0 | 0.0 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
| 0.0 | 0.4 | PID INSULIN PATHWAY | Insulin Pathway |
| 0.0 | 0.0 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
| 0.0 | 0.1 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.0 | 0.4 | PID P53 REGULATION PATHWAY | p53 pathway |
| 0.0 | 0.1 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
| 0.0 | 0.1 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.0 | 0.4 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
| 0.0 | 0.1 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
| 0.0 | 0.2 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.0 | 0.3 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.0 | 0.0 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.0 | 0.0 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
| 0.0 | 0.1 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
| 0.0 | 0.3 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.0 | 0.3 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
| 0.0 | 0.1 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.0 | 0.2 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
| 0.0 | 0.2 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 0.2 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
| 0.1 | 0.6 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
| 0.1 | 1.3 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.1 | 0.8 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
| 0.1 | 1.6 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
| 0.1 | 1.1 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
| 0.1 | 1.0 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.1 | 2.0 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
| 0.1 | 0.1 | REACTOME CLASS I MHC MEDIATED ANTIGEN PROCESSING PRESENTATION | Genes involved in Class I MHC mediated antigen processing & presentation |
| 0.0 | 0.7 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
| 0.0 | 0.3 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.0 | 0.4 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
| 0.0 | 0.5 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
| 0.0 | 0.5 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.0 | 0.1 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
| 0.0 | 0.4 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
| 0.0 | 0.4 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.0 | 0.5 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.0 | 0.1 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
| 0.0 | 0.6 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS | Genes involved in Synthesis of bile acids and bile salts |
| 0.0 | 0.7 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
| 0.0 | 0.4 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
| 0.0 | 0.6 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
| 0.0 | 0.2 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
| 0.0 | 0.4 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.0 | 0.4 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
| 0.0 | 0.2 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
| 0.0 | 0.3 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.0 | 0.1 | REACTOME SIGNALLING BY NGF | Genes involved in Signalling by NGF |
| 0.0 | 0.1 | REACTOME ERK MAPK TARGETS | Genes involved in ERK/MAPK targets |
| 0.0 | 0.5 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.0 | 0.1 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
| 0.0 | 0.4 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.0 | 0.7 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
| 0.0 | 0.1 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
| 0.0 | 0.0 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
| 0.0 | 0.1 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
| 0.0 | 0.3 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
| 0.0 | 0.9 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.0 | 0.4 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.0 | 0.4 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
| 0.0 | 0.3 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.0 | 0.5 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.0 | 0.9 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
| 0.0 | 0.1 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
| 0.0 | 0.8 | REACTOME BIOLOGICAL OXIDATIONS | Genes involved in Biological oxidations |
| 0.0 | 0.5 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.0 | 0.3 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 0.0 | 0.3 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
| 0.0 | 0.2 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
| 0.0 | 0.2 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
| 0.0 | 0.2 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
| 0.0 | 0.2 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.0 | 0.2 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
| 0.0 | 0.4 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
| 0.0 | 0.2 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 0.0 | 0.0 | REACTOME POST NMDA RECEPTOR ACTIVATION EVENTS | Genes involved in Post NMDA receptor activation events |
| 0.0 | 0.4 | REACTOME MUSCLE CONTRACTION | Genes involved in Muscle contraction |
| 0.0 | 0.1 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
| 0.0 | 0.5 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
| 0.0 | 0.5 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
| 0.0 | 0.2 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
| 0.0 | 0.3 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.0 | 0.2 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
| 0.0 | 0.1 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
| 0.0 | 0.3 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.0 | 0.1 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
| 0.0 | 0.1 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
| 0.0 | 0.3 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.0 | 0.2 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
| 0.0 | 0.7 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.0 | 0.0 | REACTOME PROCESSIVE SYNTHESIS ON THE LAGGING STRAND | Genes involved in Processive synthesis on the lagging strand |
| 0.0 | 0.4 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
| 0.0 | 0.3 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
| 0.0 | 0.6 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
| 0.0 | 0.1 | REACTOME RESOLUTION OF AP SITES VIA THE MULTIPLE NUCLEOTIDE PATCH REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the multiple-nucleotide patch replacement pathway |
| 0.0 | 0.5 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
| 0.0 | 0.7 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.0 | 0.1 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.0 | 0.6 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
| 0.0 | 0.1 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
| 0.0 | 0.2 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 0.0 | 0.3 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.0 | 0.1 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
| 0.0 | 0.7 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
| 0.0 | 0.1 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.0 | 0.3 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
| 0.0 | 0.6 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
| 0.0 | 0.1 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
| 0.0 | 0.0 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
| 0.0 | 1.8 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
| 0.0 | 0.0 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
| 0.0 | 0.1 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |