Gene Symbol | Gene ID | Gene Info |
---|---|---|
Hnf1a
|
ENSMUSG00000029556.6 | Hnf1a |
Gene | Promoter | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Hnf1a | chr5_114971025_114971183 | 10 | 0.928012 | 0.97 | 1.3e-03 | Click! |
Hnf1a | chr5_114970275_114970719 | 347 | 0.558181 | -0.71 | 1.2e-01 | Click! |
Hnf1a | chr5_114971326_114971494 | 316 | 0.726713 | -0.70 | 1.2e-01 | Click! |
Hnf1a | chr5_114972259_114972410 | 1240 | 0.232675 | -0.51 | 3.0e-01 | Click! |
Hnf1a | chr5_114970762_114970954 | 14 | 0.919046 | 0.41 | 4.2e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr12_25132144_25132315 | 5.50 |
Gm17746 |
predicted gene, 17746 |
3055 |
0.22 |
chr3_153840565_153840726 | 3.26 |
Asb17 |
ankyrin repeat and SOCS box-containing 17 |
3564 |
0.13 |
chr10_33814374_33814533 | 3.09 |
Gm10327 |
predicted pseudogene 10327 |
4955 |
0.17 |
chr11_7197480_7197826 | 3.06 |
Igfbp1 |
insulin-like growth factor binding protein 1 |
129 |
0.96 |
chr8_108101452_108101603 | 2.90 |
Zfhx3 |
zinc finger homeobox 3 |
106968 |
0.07 |
chr11_85618066_85618217 | 2.82 |
Bcas3 |
breast carcinoma amplified sequence 3 |
22563 |
0.21 |
chr6_72961723_72961891 | 2.81 |
Tmsb10 |
thymosin, beta 10 |
3059 |
0.2 |
chr8_48730833_48730999 | 2.79 |
Tenm3 |
teneurin transmembrane protein 3 |
56226 |
0.15 |
chr5_114969673_114969978 | 2.68 |
Hnf1aos1 |
HNF1 homeobox A, opposite strand 1 |
72 |
0.89 |
chr6_99145207_99145385 | 2.61 |
Foxp1 |
forkhead box P1 |
17722 |
0.26 |
chr8_126838292_126838477 | 2.48 |
A630001O12Rik |
RIKEN cDNA A630001O12 gene |
849 |
0.65 |
chr5_147017691_147017860 | 2.36 |
Lnx2 |
ligand of numb-protein X 2 |
1260 |
0.45 |
chr3_19962880_19963390 | 2.35 |
Cp |
ceruloplasmin |
5851 |
0.19 |
chr12_108887070_108887221 | 2.33 |
Wars |
tryptophanyl-tRNA synthetase |
1272 |
0.3 |
chr4_107899351_107899556 | 2.20 |
Czib |
CXXC motif containing zinc binding protein |
6083 |
0.13 |
chr5_106416670_106416832 | 2.19 |
Barhl2 |
BarH like homeobox 2 |
41415 |
0.1 |
chr17_73142498_73142677 | 2.19 |
Lclat1 |
lysocardiolipin acyltransferase 1 |
16160 |
0.2 |
chr4_55014920_55015072 | 2.13 |
Zfp462 |
zinc finger protein 462 |
3516 |
0.32 |
chr10_81300375_81300537 | 2.13 |
Gm16315 |
predicted gene 16315 |
2461 |
0.1 |
chr4_140636403_140636579 | 2.11 |
Arhgef10l |
Rho guanine nucleotide exchange factor (GEF) 10-like |
12259 |
0.16 |
chr15_3500167_3500349 | 2.10 |
Ghr |
growth hormone receptor |
28614 |
0.23 |
chr9_91193419_91193605 | 2.10 |
Gm29602 |
predicted gene 29602 |
22503 |
0.17 |
chr14_40830166_40830336 | 2.09 |
Sh2d4b |
SH2 domain containing 4B |
23054 |
0.21 |
chr10_7140427_7140586 | 2.07 |
Cnksr3 |
Cnksr family member 3 |
5000 |
0.3 |
chr13_103862111_103862291 | 2.03 |
Erbin |
Erbb2 interacting protein |
27091 |
0.21 |
chr8_3211855_3212035 | 2.02 |
Insr |
insulin receptor |
19228 |
0.18 |
chr5_90518764_90518951 | 2.01 |
Afm |
afamin |
75 |
0.95 |
chr5_130768145_130768304 | 2.01 |
Gm23761 |
predicted gene, 23761 |
14477 |
0.25 |
chr10_110707462_110707627 | 1.94 |
E2f7 |
E2F transcription factor 7 |
37895 |
0.16 |
chrX_164035471_164035631 | 1.90 |
Car5b |
carbonic anhydrase 5b, mitochondrial |
7554 |
0.2 |
chr6_134664500_134664832 | 1.88 |
Borcs5 |
BLOC-1 related complex subunit 5 |
23411 |
0.12 |
chr14_7826170_7826331 | 1.87 |
Flnb |
filamin, beta |
8293 |
0.16 |
chr8_117317565_117317727 | 1.86 |
Cmip |
c-Maf inducing protein |
31524 |
0.2 |
chr7_70542295_70542626 | 1.85 |
Gm35842 |
predicted gene, 35842 |
6409 |
0.14 |
chr12_21167471_21167660 | 1.85 |
Asap2 |
ArfGAP with SH3 domain, ankyrin repeat and PH domain 2 |
55611 |
0.1 |
chr16_72646493_72646678 | 1.84 |
Robo1 |
roundabout guidance receptor 1 |
16564 |
0.31 |
chr16_32427729_32427880 | 1.83 |
Pcyt1a |
phosphate cytidylyltransferase 1, choline, alpha isoform |
3117 |
0.15 |
chr12_75706681_75706992 | 1.82 |
Sgpp1 |
sphingosine-1-phosphate phosphatase 1 |
28860 |
0.17 |
chr10_117358959_117359253 | 1.82 |
Cpsf6 |
cleavage and polyadenylation specific factor 6 |
1838 |
0.28 |
chr14_27182121_27182328 | 1.81 |
Gm7591 |
predicted gene 7591 |
28173 |
0.17 |
chr4_137480790_137480961 | 1.79 |
Hspg2 |
perlecan (heparan sulfate proteoglycan 2) |
12072 |
0.13 |
chr16_23033709_23034045 | 1.78 |
Gm8128 |
predicted gene 8128 |
155 |
0.89 |
chr5_119228207_119228359 | 1.77 |
Gm7538 |
predicted gene 7538 |
28265 |
0.21 |
chr13_28662344_28662520 | 1.76 |
Mir6368 |
microRNA 6368 |
48441 |
0.17 |
chr7_98178942_98179132 | 1.75 |
Capn5 |
calpain 5 |
763 |
0.53 |
chr13_24950116_24950267 | 1.75 |
Gpld1 |
glycosylphosphatidylinositol specific phospholipase D1 |
5663 |
0.14 |
chr18_70644430_70644600 | 1.75 |
Gm8934 |
predicted gene 8934 |
3522 |
0.25 |
chr18_40161185_40161496 | 1.74 |
Gm50396 |
predicted gene, 50396 |
20245 |
0.2 |
chr11_31001740_31002153 | 1.73 |
Gm12102 |
predicted gene 12102 |
1952 |
0.3 |
chr17_4196946_4197109 | 1.71 |
4930548J01Rik |
RIKEN cDNA 4930548J01 gene |
74914 |
0.12 |
chr19_37867569_37867909 | 1.71 |
Gm4757 |
predicted gene 4757 |
2531 |
0.31 |
chr13_47229291_47229458 | 1.70 |
Rnf144b |
ring finger protein 144B |
35549 |
0.15 |
chr3_97756796_97756965 | 1.69 |
Pde4dip |
phosphodiesterase 4D interacting protein (myomegalin) |
11051 |
0.18 |
chr9_101036260_101036546 | 1.69 |
Pccb |
propionyl Coenzyme A carboxylase, beta polypeptide |
1505 |
0.33 |
chr1_193205560_193205724 | 1.68 |
Lamb3 |
laminin, beta 3 |
2057 |
0.17 |
chr6_71626713_71626931 | 1.67 |
Kdm3a |
lysine (K)-specific demethylase 3A |
5148 |
0.15 |
chr2_50967335_50967505 | 1.66 |
Gm13498 |
predicted gene 13498 |
57736 |
0.16 |
chr14_47016165_47016374 | 1.64 |
Samd4 |
sterile alpha motif domain containing 4 |
14904 |
0.15 |
chr2_59042197_59042352 | 1.64 |
Gm13557 |
predicted gene 13557 |
82567 |
0.09 |
chr12_21200768_21200935 | 1.64 |
AC156032.1 |
|
46472 |
0.11 |
chr6_39191456_39191621 | 1.63 |
Kdm7a |
lysine (K)-specific demethylase 7A |
15251 |
0.14 |
chr9_37082260_37082465 | 1.62 |
Pknox2 |
Pbx/knotted 1 homeobox 2 |
917 |
0.53 |
chr1_136229022_136229181 | 1.62 |
Inava |
innate immunity activator |
918 |
0.4 |
chr10_122343453_122343625 | 1.61 |
Gm36041 |
predicted gene, 36041 |
43353 |
0.16 |
chr13_81323663_81323834 | 1.61 |
Adgrv1 |
adhesion G protein-coupled receptor V1 |
19088 |
0.24 |
chr10_127763888_127764284 | 1.61 |
Rdh16f1 |
RDH16 family member 1 |
4299 |
0.09 |
chr3_145634494_145634653 | 1.60 |
Ccn1 |
cellular communication network factor 1 |
15408 |
0.17 |
chr12_109501140_109501291 | 1.60 |
Gm34081 |
predicted gene, 34081 |
15525 |
0.06 |
chr2_114776001_114776450 | 1.60 |
Gm13975 |
predicted gene 13975 |
68113 |
0.11 |
chr15_98918937_98919102 | 1.59 |
Lmbr1l |
limb region 1 like |
788 |
0.37 |
chr8_108768182_108768345 | 1.58 |
Gm38042 |
predicted gene, 38042 |
30670 |
0.19 |
chr15_82013637_82013909 | 1.58 |
Xrcc6 |
X-ray repair complementing defective repair in Chinese hamster cells 6 |
1746 |
0.16 |
chr5_146974799_146974984 | 1.58 |
Mtif3 |
mitochondrial translational initiation factor 3 |
11091 |
0.17 |
chr10_87915872_87916048 | 1.57 |
Tyms-ps |
thymidylate synthase, pseudogene |
50887 |
0.11 |
chr13_37856664_37856837 | 1.57 |
Rreb1 |
ras responsive element binding protein 1 |
1184 |
0.52 |
chr2_35100620_35100804 | 1.57 |
AI182371 |
expressed sequence AI182371 |
23 |
0.97 |
chr1_62423315_62423491 | 1.56 |
Pard3bos3 |
par-3 family cell polarity regulator beta, opposite strand 3 |
75858 |
0.1 |
chr8_84770719_84770889 | 1.56 |
Nfix |
nuclear factor I/X |
2592 |
0.16 |
chr13_18868301_18868479 | 1.56 |
Vps41 |
VPS41 HOPS complex subunit |
23527 |
0.19 |
chr6_108115041_108115202 | 1.55 |
Sumf1 |
sulfatase modifying factor 1 |
11942 |
0.21 |
chr18_39044768_39045071 | 1.54 |
Gm15334 |
predicted gene 15334 |
50727 |
0.13 |
chr9_52034520_52034671 | 1.53 |
Rdx |
radixin |
12578 |
0.18 |
chr15_34513935_34514163 | 1.53 |
Pop1 |
processing of precursor 1, ribonuclease P/MRP family, (S. cerevisiae) |
121 |
0.94 |
chr11_101367394_101367568 | 1.53 |
G6pc |
glucose-6-phosphatase, catalytic |
80 |
0.87 |
chr10_68351966_68352135 | 1.51 |
4930545H06Rik |
RIKEN cDNA 4930545H06 gene |
30908 |
0.18 |
chr8_126737026_126737184 | 1.51 |
Gm45805 |
predicted gene 45805 |
21229 |
0.23 |
chr5_89218414_89218582 | 1.51 |
Slc4a4 |
solute carrier family 4 (anion exchanger), member 4 |
190406 |
0.03 |
chr14_57729975_57730145 | 1.51 |
Lats2 |
large tumor suppressor 2 |
4240 |
0.15 |
chr19_23065038_23065467 | 1.50 |
Gm50136 |
predicted gene, 50136 |
3779 |
0.23 |
chr10_79855965_79856127 | 1.50 |
Ptbp1 |
polypyrimidine tract binding protein 1 |
1008 |
0.2 |
chr11_3458441_3458592 | 1.49 |
8430429K09Rik |
RIKEN cDNA 8430429K09 gene |
6036 |
0.1 |
chr14_122990850_122991017 | 1.48 |
Tmtc4 |
transmembrane and tetratricopeptide repeat containing 4 |
6898 |
0.22 |
chr1_82827947_82828255 | 1.47 |
Gm17764 |
predicted gene, 17764 |
5240 |
0.1 |
chr12_99418906_99419292 | 1.47 |
Foxn3 |
forkhead box N3 |
6494 |
0.18 |
chr7_28931496_28931685 | 1.46 |
Gm44699 |
predicted gene 44699 |
11938 |
0.1 |
chr5_51511759_51511910 | 1.45 |
Gm43605 |
predicted gene 43605 |
2459 |
0.24 |
chr10_99555138_99555310 | 1.45 |
Gm48085 |
predicted gene, 48085 |
17155 |
0.18 |
chr5_138089164_138089333 | 1.44 |
Zkscan1 |
zinc finger with KRAB and SCAN domains 1 |
3392 |
0.11 |
chr19_10168393_10168709 | 1.44 |
Gm50359 |
predicted gene, 50359 |
7610 |
0.11 |
chr15_38640893_38641050 | 1.43 |
1100001I12Rik |
RIKEN cDNA 1100001I12 gene |
18868 |
0.14 |
chr13_52055792_52055981 | 1.43 |
Gm37872 |
predicted gene, 37872 |
33959 |
0.15 |
chr11_97920651_97920808 | 1.43 |
Gm22461 |
predicted gene, 22461 |
21011 |
0.1 |
chr10_71281485_71281659 | 1.42 |
Ube2d1 |
ubiquitin-conjugating enzyme E2D 1 |
3646 |
0.15 |
chr16_86816748_86816918 | 1.41 |
Gm32624 |
predicted gene, 32624 |
33 |
0.98 |
chr13_24558011_24558213 | 1.41 |
Ripor2 |
RHO family interacting cell polarization regulator 2 |
24077 |
0.17 |
chr2_163555484_163555653 | 1.41 |
Hnf4a |
hepatic nuclear factor 4, alpha |
5485 |
0.14 |
chr16_45985248_45985447 | 1.40 |
Plcxd2 |
phosphatidylinositol-specific phospholipase C, X domain containing 2 |
24871 |
0.13 |
chr15_82643084_82643235 | 1.40 |
AC118710.1 |
cytochrome P450, family 2, subfamily d, polypeptide 13, pseudogene |
1113 |
0.22 |
chr5_90460669_90461033 | 1.39 |
Alb |
albumin |
46 |
0.97 |
chr14_78850607_78850779 | 1.39 |
Vwa8 |
von Willebrand factor A domain containing 8 |
1439 |
0.39 |
chr8_46607117_46607283 | 1.38 |
Gm45607 |
predicted gene 45607 |
2451 |
0.22 |
chr11_95301948_95302115 | 1.38 |
Kat7 |
K(lysine) acetyltransferase 7 |
7482 |
0.13 |
chr1_170515621_170515785 | 1.36 |
Nos1ap |
nitric oxide synthase 1 (neuronal) adaptor protein |
41407 |
0.16 |
chr1_88195805_88195977 | 1.36 |
Gm15376 |
predicted gene 15376 |
3990 |
0.08 |
chr4_115600689_115600996 | 1.36 |
Cyp4a32 |
cytochrome P450, family 4, subfamily a, polypeptide 32 |
127 |
0.94 |
chr7_16604272_16604437 | 1.35 |
Gm29443 |
predicted gene 29443 |
9470 |
0.09 |
chr10_68529444_68529608 | 1.35 |
Gm32872 |
predicted gene, 32872 |
568 |
0.79 |
chr7_65958246_65958406 | 1.35 |
Pcsk6 |
proprotein convertase subtilisin/kexin type 6 |
5314 |
0.23 |
chr6_38919287_38919548 | 1.35 |
Tbxas1 |
thromboxane A synthase 1, platelet |
393 |
0.87 |
chr2_147968721_147968877 | 1.34 |
9030622O22Rik |
RIKEN cDNA 9030622O22 gene |
7386 |
0.24 |
chr13_98684591_98684906 | 1.34 |
Tmem171 |
transmembrane protein 171 |
10020 |
0.14 |
chr17_32601903_32602088 | 1.34 |
Gm50038 |
predicted gene, 50038 |
479 |
0.69 |
chr7_19007102_19007261 | 1.34 |
Irf2bp1 |
interferon regulatory factor 2 binding protein 1 |
3137 |
0.1 |
chr13_48911167_48911373 | 1.33 |
Phf2 |
PHD finger protein 2 |
40151 |
0.14 |
chr19_36696562_36696736 | 1.33 |
Hectd2os |
Hectd2, opposite strand |
7170 |
0.23 |
chr6_146125646_146125809 | 1.32 |
Itpr2 |
inositol 1,4,5-triphosphate receptor 2 |
21481 |
0.23 |
chr13_29127516_29127681 | 1.32 |
Gm11363 |
predicted gene 11363 |
3160 |
0.35 |
chr16_52701782_52701933 | 1.31 |
4930404A05Rik |
RIKEN cDNA 4930404A05 gene |
113887 |
0.06 |
chr10_61928880_61929308 | 1.31 |
Gm5750 |
predicted gene 5750 |
30530 |
0.16 |
chr10_21665548_21665708 | 1.30 |
Gm5420 |
predicted gene 5420 |
20783 |
0.2 |
chr10_110258114_110258282 | 1.29 |
Gm47340 |
predicted gene, 47340 |
118029 |
0.06 |
chr1_59212212_59212392 | 1.28 |
Als2 |
alsin Rho guanine nucleotide exchange factor |
6824 |
0.17 |
chr1_71731714_71731890 | 1.28 |
Gm5256 |
predicted gene 5256 |
16878 |
0.18 |
chr13_36367851_36368002 | 1.28 |
Fars2 |
phenylalanine-tRNA synthetase 2 (mitochondrial) |
21232 |
0.22 |
chr8_115980743_115980903 | 1.28 |
Gm45733 |
predicted gene 45733 |
8752 |
0.32 |
chr7_73882661_73882812 | 1.28 |
Mir7234 |
microRNA 7234 |
63146 |
0.07 |
chr19_55700999_55701186 | 1.27 |
Tcf7l2 |
transcription factor 7 like 2, T cell specific, HMG box |
40728 |
0.21 |
chr1_168305612_168305798 | 1.27 |
Gm37524 |
predicted gene, 37524 |
31966 |
0.2 |
chr14_37885236_37885394 | 1.27 |
Gm5204 |
predicted gene 5204 |
27383 |
0.25 |
chr13_52832544_52832767 | 1.26 |
BB123696 |
expressed sequence BB123696 |
75450 |
0.1 |
chr13_90463528_90463692 | 1.26 |
Gm47520 |
predicted gene, 47520 |
45510 |
0.16 |
chr14_73106958_73107303 | 1.25 |
Rcbtb2 |
regulator of chromosome condensation (RCC1) and BTB (POZ) domain containing protein 2 |
15907 |
0.2 |
chr12_114053283_114053753 | 1.24 |
Ighv3-2 |
immunoglobulin heavy variable 3-2 |
19285 |
0.13 |
chr11_89996982_89997171 | 1.24 |
Pctp |
phosphatidylcholine transfer protein |
5818 |
0.26 |
chr19_14598035_14598211 | 1.24 |
Tle4 |
transducin-like enhancer of split 4 |
72 |
0.98 |
chr16_20102189_20102498 | 1.24 |
Klhl24 |
kelch-like 24 |
4751 |
0.22 |
chr18_74384707_74384870 | 1.23 |
Gm8986 |
predicted gene 8986 |
15820 |
0.16 |
chr10_111756586_111756764 | 1.23 |
Gm46193 |
predicted gene, 46193 |
11103 |
0.15 |
chr16_9824617_9824775 | 1.23 |
Grin2a |
glutamate receptor, ionotropic, NMDA2A (epsilon 1) |
27363 |
0.25 |
chr11_53874807_53875189 | 1.23 |
Slc22a5 |
solute carrier family 22 (organic cation transporter), member 5 |
3321 |
0.15 |
chr13_47019948_47020111 | 1.23 |
Gm18807 |
predicted gene, 18807 |
4317 |
0.11 |
chr4_100123502_100123952 | 1.22 |
Gm12701 |
predicted gene 12701 |
4106 |
0.26 |
chr8_90391468_90391650 | 1.22 |
Tox3 |
TOX high mobility group box family member 3 |
43216 |
0.2 |
chr10_42342198_42342349 | 1.22 |
Gm15197 |
predicted gene 15197 |
11010 |
0.23 |
chr3_65527351_65527507 | 1.22 |
4931440P22Rik |
RIKEN cDNA 4931440P22 gene |
755 |
0.39 |
chr10_71337816_71337971 | 1.22 |
Cisd1 |
CDGSH iron sulfur domain 1 |
7061 |
0.13 |
chr7_100937600_100937760 | 1.21 |
Arhgef17 |
Rho guanine nucleotide exchange factor (GEF) 17 |
5573 |
0.15 |
chr1_18961462_18961613 | 1.21 |
Gm24075 |
predicted gene, 24075 |
8296 |
0.26 |
chr8_117347724_117347903 | 1.21 |
Cmip |
c-Maf inducing protein |
1357 |
0.53 |
chr14_46606657_46607000 | 1.21 |
Gm18761 |
predicted gene, 18761 |
724 |
0.53 |
chr13_60578609_60578764 | 1.20 |
Dapk1 |
death associated protein kinase 1 |
23261 |
0.15 |
chr18_60386081_60386247 | 1.20 |
Iigp1 |
interferon inducible GTPase 1 |
3481 |
0.19 |
chr1_10040146_10040336 | 1.20 |
Cspp1 |
centrosome and spindle pole associated protein 1 |
86 |
0.94 |
chr2_122148135_122148291 | 1.20 |
B2m |
beta-2 microglobulin |
527 |
0.67 |
chr15_3464796_3465100 | 1.19 |
Ghr |
growth hormone receptor |
6696 |
0.3 |
chr12_71355273_71355435 | 1.18 |
Gm40438 |
predicted gene, 40438 |
87 |
0.96 |
chr6_72743864_72744051 | 1.18 |
Gm37736 |
predicted gene, 37736 |
7957 |
0.16 |
chr2_6611640_6611812 | 1.18 |
Celf2 |
CUGBP, Elav-like family member 2 |
4454 |
0.32 |
chr8_46529669_46529830 | 1.18 |
Acsl1 |
acyl-CoA synthetase long-chain family member 1 |
1315 |
0.39 |
chr10_36074127_36074466 | 1.18 |
Gm47048 |
predicted gene, 47048 |
21580 |
0.28 |
chr1_179836199_179836367 | 1.18 |
Ahctf1 |
AT hook containing transcription factor 1 |
32603 |
0.16 |
chr8_70170779_70170941 | 1.18 |
Tmem161a |
transmembrane protein 161A |
1496 |
0.22 |
chr19_23354212_23354391 | 1.17 |
Gm24263 |
predicted gene, 24263 |
57972 |
0.1 |
chr11_89000375_89000535 | 1.16 |
Trim25 |
tripartite motif-containing 25 |
1079 |
0.36 |
chr5_111424270_111424438 | 1.16 |
Gm43119 |
predicted gene 43119 |
765 |
0.62 |
chr8_72376397_72376563 | 1.16 |
Eps15l1 |
epidermal growth factor receptor pathway substrate 15-like 1 |
2166 |
0.21 |
chr13_55153076_55153240 | 1.16 |
Fgfr4 |
fibroblast growth factor receptor 4 |
518 |
0.69 |
chr11_70713419_70713657 | 1.15 |
Mir6925 |
microRNA 6925 |
7548 |
0.08 |
chr17_12378453_12378627 | 1.14 |
Plg |
plasminogen |
68 |
0.97 |
chr16_23317475_23317652 | 1.14 |
St6gal1 |
beta galactoside alpha 2,6 sialyltransferase 1 |
27093 |
0.15 |
chr11_43950413_43950575 | 1.14 |
Gm12153 |
predicted gene 12153 |
8595 |
0.26 |
chr8_126734848_126735025 | 1.14 |
Gm45805 |
predicted gene 45805 |
23398 |
0.22 |
chr8_45267739_45267904 | 1.13 |
F11 |
coagulation factor XI |
5790 |
0.18 |
chr9_42507207_42507377 | 1.13 |
Tbcel |
tubulin folding cofactor E-like |
517 |
0.81 |
chrX_11644615_11644774 | 1.13 |
Gm14513 |
predicted gene 14513 |
39430 |
0.17 |
chr1_191154426_191154595 | 1.12 |
Fam71a |
family with sequence similarity 71, member A |
10307 |
0.13 |
chr7_65803728_65803914 | 1.12 |
1810008I18Rik |
RIKEN cDNA 1810008I18 gene |
210 |
0.94 |
chr15_39813920_39814243 | 1.12 |
Gm16291 |
predicted gene 16291 |
17036 |
0.19 |
chrX_38466191_38466467 | 1.12 |
Lamp2 |
lysosomal-associated membrane protein 2 |
9875 |
0.17 |
chr18_38193225_38193388 | 1.12 |
Pcdh1 |
protocadherin 1 |
9857 |
0.14 |
chr19_39464056_39464240 | 1.12 |
Cyp2c38 |
cytochrome P450, family 2, subfamily c, polypeptide 38 |
1073 |
0.61 |
chr8_33987157_33987321 | 1.12 |
Gm45817 |
predicted gene 45817 |
39 |
0.96 |
chr5_89578630_89578799 | 1.12 |
Npffr2 |
neuropeptide FF receptor 2 |
51285 |
0.14 |
chr10_12278450_12278601 | 1.12 |
Gm48723 |
predicted gene, 48723 |
46136 |
0.14 |
chr18_42961401_42961716 | 1.11 |
Ppp2r2b |
protein phosphatase 2, regulatory subunit B, beta |
23326 |
0.19 |
chr14_34275354_34275514 | 1.11 |
Shld2 |
shieldin complex subunit 2 |
1175 |
0.29 |
chr12_79525903_79526237 | 1.11 |
Rad51b |
RAD51 paralog B |
198717 |
0.02 |
chr2_90489142_90489594 | 1.11 |
4933423P22Rik |
RIKEN cDNA 4933423P22 gene |
10118 |
0.18 |
chr2_3641471_3641630 | 1.11 |
Fam107b |
family with sequence similarity 107, member B |
27792 |
0.14 |
chr3_121903353_121903632 | 1.11 |
Gm42593 |
predicted gene 42593 |
40650 |
0.12 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.8 | 2.4 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
0.4 | 1.7 | GO:0051919 | positive regulation of fibrinolysis(GO:0051919) |
0.4 | 0.7 | GO:0010908 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
0.3 | 1.4 | GO:0044004 | killing by symbiont of host cells(GO:0001907) disruption by symbiont of host cell(GO:0044004) |
0.3 | 1.0 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
0.3 | 0.9 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
0.3 | 0.9 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
0.3 | 0.9 | GO:0045196 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
0.3 | 1.4 | GO:0015760 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
0.3 | 0.8 | GO:0061144 | alveolar secondary septum development(GO:0061144) |
0.3 | 1.0 | GO:0010887 | negative regulation of cholesterol storage(GO:0010887) |
0.3 | 0.8 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
0.3 | 1.5 | GO:0016078 | tRNA catabolic process(GO:0016078) |
0.2 | 1.0 | GO:0009750 | response to fructose(GO:0009750) |
0.2 | 0.7 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
0.2 | 0.9 | GO:0006681 | galactosylceramide metabolic process(GO:0006681) |
0.2 | 0.9 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
0.2 | 0.6 | GO:0006210 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
0.2 | 1.0 | GO:1903689 | regulation of wound healing, spreading of epidermal cells(GO:1903689) |
0.2 | 0.8 | GO:0034756 | regulation of iron ion transport(GO:0034756) |
0.2 | 0.6 | GO:0021827 | cerebral cortex tangential migration using cell-cell interactions(GO:0021823) postnatal olfactory bulb interneuron migration(GO:0021827) |
0.2 | 0.6 | GO:0034441 | plasma lipoprotein particle oxidation(GO:0034441) |
0.2 | 0.7 | GO:0035564 | regulation of kidney size(GO:0035564) |
0.2 | 4.1 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
0.2 | 0.7 | GO:0003166 | bundle of His development(GO:0003166) |
0.2 | 0.7 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
0.2 | 0.5 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
0.2 | 0.5 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.2 | 0.5 | GO:1901844 | regulation of cell communication by electrical coupling involved in cardiac conduction(GO:1901844) |
0.2 | 0.7 | GO:0006549 | isoleucine metabolic process(GO:0006549) |
0.2 | 1.5 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
0.2 | 0.5 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
0.2 | 0.3 | GO:2000173 | negative regulation of branching morphogenesis of a nerve(GO:2000173) |
0.1 | 0.7 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
0.1 | 0.9 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
0.1 | 0.9 | GO:0034374 | low-density lipoprotein particle remodeling(GO:0034374) |
0.1 | 0.1 | GO:2000468 | regulation of peroxidase activity(GO:2000468) |
0.1 | 0.4 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) |
0.1 | 0.7 | GO:0061684 | chaperone-mediated autophagy(GO:0061684) |
0.1 | 0.6 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
0.1 | 0.3 | GO:0006068 | ethanol catabolic process(GO:0006068) |
0.1 | 0.6 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
0.1 | 0.4 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
0.1 | 3.1 | GO:0051180 | vitamin transport(GO:0051180) |
0.1 | 0.4 | GO:0006768 | biotin metabolic process(GO:0006768) |
0.1 | 0.6 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
0.1 | 0.2 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
0.1 | 0.1 | GO:0060061 | Spemann organizer formation(GO:0060061) |
0.1 | 0.4 | GO:0097195 | pilomotor reflex(GO:0097195) |
0.1 | 1.7 | GO:0051923 | sulfation(GO:0051923) |
0.1 | 0.3 | GO:0035483 | gastric emptying(GO:0035483) |
0.1 | 0.3 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
0.1 | 0.4 | GO:0010835 | regulation of protein ADP-ribosylation(GO:0010835) |
0.1 | 0.5 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.1 | 0.3 | GO:0038161 | prolactin signaling pathway(GO:0038161) |
0.1 | 0.3 | GO:0032430 | positive regulation of phospholipase A2 activity(GO:0032430) |
0.1 | 0.3 | GO:0048696 | regulation of collateral sprouting in absence of injury(GO:0048696) |
0.1 | 0.4 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
0.1 | 0.9 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
0.1 | 1.3 | GO:0032308 | positive regulation of prostaglandin secretion(GO:0032308) |
0.1 | 0.2 | GO:0060468 | prevention of polyspermy(GO:0060468) |
0.1 | 0.7 | GO:0097264 | self proteolysis(GO:0097264) |
0.1 | 0.4 | GO:0034638 | phosphatidylcholine catabolic process(GO:0034638) |
0.1 | 0.8 | GO:0035814 | negative regulation of renal sodium excretion(GO:0035814) |
0.1 | 0.3 | GO:0033058 | directional locomotion(GO:0033058) |
0.1 | 0.6 | GO:0044539 | long-chain fatty acid import(GO:0044539) |
0.1 | 0.3 | GO:0009436 | glyoxylate catabolic process(GO:0009436) |
0.1 | 0.3 | GO:2001170 | negative regulation of ATP biosynthetic process(GO:2001170) |
0.1 | 0.2 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
0.1 | 0.7 | GO:0060613 | fat pad development(GO:0060613) |
0.1 | 0.3 | GO:0010986 | positive regulation of lipoprotein particle clearance(GO:0010986) |
0.1 | 0.3 | GO:0007525 | somatic muscle development(GO:0007525) |
0.1 | 0.6 | GO:0051549 | regulation of keratinocyte migration(GO:0051547) positive regulation of keratinocyte migration(GO:0051549) |
0.1 | 0.5 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.1 | 0.6 | GO:0002553 | histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
0.1 | 0.4 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
0.1 | 0.5 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
0.1 | 0.3 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.1 | 0.3 | GO:0090230 | regulation of centromere complex assembly(GO:0090230) |
0.1 | 0.3 | GO:0007354 | zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
0.1 | 0.3 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
0.1 | 0.3 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
0.1 | 0.2 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
0.1 | 0.4 | GO:0019087 | transformation of host cell by virus(GO:0019087) |
0.1 | 0.3 | GO:0003383 | apical constriction(GO:0003383) |
0.1 | 0.2 | GO:0071799 | response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
0.1 | 0.1 | GO:0033184 | positive regulation of histone ubiquitination(GO:0033184) |
0.1 | 0.2 | GO:0060051 | negative regulation of protein glycosylation(GO:0060051) |
0.1 | 0.2 | GO:0032696 | negative regulation of interleukin-13 production(GO:0032696) |
0.1 | 0.4 | GO:0046836 | glycolipid transport(GO:0046836) |
0.1 | 0.3 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
0.1 | 0.9 | GO:1903392 | negative regulation of adherens junction organization(GO:1903392) |
0.1 | 0.2 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.1 | 0.2 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
0.1 | 0.2 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
0.1 | 0.2 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
0.1 | 0.4 | GO:0070327 | thyroid hormone transport(GO:0070327) |
0.1 | 1.1 | GO:2000651 | positive regulation of sodium ion transmembrane transporter activity(GO:2000651) |
0.1 | 0.5 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
0.1 | 0.2 | GO:1901503 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) cellular lipid biosynthetic process(GO:0097384) ether biosynthetic process(GO:1901503) |
0.1 | 0.3 | GO:0035992 | tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
0.1 | 0.3 | GO:0071877 | regulation of adrenergic receptor signaling pathway(GO:0071877) |
0.1 | 0.2 | GO:0006083 | acetate metabolic process(GO:0006083) |
0.1 | 0.4 | GO:0044598 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.1 | 0.2 | GO:1902744 | negative regulation of lamellipodium organization(GO:1902744) |
0.1 | 0.2 | GO:2000169 | regulation of peptidyl-cysteine S-nitrosylation(GO:2000169) |
0.1 | 0.1 | GO:1903596 | regulation of gap junction assembly(GO:1903596) positive regulation of gap junction assembly(GO:1903598) |
0.1 | 0.2 | GO:0001951 | intestinal D-glucose absorption(GO:0001951) |
0.1 | 0.3 | GO:0046499 | S-adenosylmethioninamine metabolic process(GO:0046499) |
0.1 | 0.6 | GO:0007614 | short-term memory(GO:0007614) |
0.1 | 0.2 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
0.1 | 0.5 | GO:0042448 | progesterone metabolic process(GO:0042448) |
0.1 | 0.3 | GO:0032763 | regulation of mast cell cytokine production(GO:0032763) |
0.1 | 0.1 | GO:2000110 | negative regulation of macrophage apoptotic process(GO:2000110) |
0.1 | 0.3 | GO:0002913 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
0.1 | 0.3 | GO:0050847 | progesterone receptor signaling pathway(GO:0050847) |
0.1 | 0.3 | GO:0043622 | cortical microtubule organization(GO:0043622) |
0.1 | 0.3 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.1 | 0.4 | GO:0015868 | purine ribonucleotide transport(GO:0015868) |
0.1 | 0.3 | GO:0034091 | regulation of maintenance of sister chromatid cohesion(GO:0034091) regulation of maintenance of mitotic sister chromatid cohesion(GO:0034182) |
0.1 | 0.2 | GO:0052422 | modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
0.1 | 0.4 | GO:0036462 | TRAIL-activated apoptotic signaling pathway(GO:0036462) |
0.1 | 0.3 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
0.1 | 0.5 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.1 | 0.2 | GO:0006553 | lysine metabolic process(GO:0006553) |
0.1 | 0.3 | GO:0036072 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
0.1 | 0.2 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
0.1 | 0.1 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
0.1 | 0.1 | GO:0075509 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
0.1 | 0.4 | GO:0099515 | actin filament-based transport(GO:0099515) |
0.1 | 0.2 | GO:1901509 | regulation of endothelial tube morphogenesis(GO:1901509) |
0.1 | 0.2 | GO:2000850 | negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
0.1 | 0.8 | GO:1904355 | positive regulation of telomere capping(GO:1904355) |
0.1 | 0.1 | GO:0006067 | ethanol metabolic process(GO:0006067) ethanol oxidation(GO:0006069) |
0.1 | 0.1 | GO:0070368 | positive regulation of hepatocyte differentiation(GO:0070368) |
0.1 | 0.3 | GO:1902774 | late endosome to lysosome transport(GO:1902774) |
0.1 | 0.2 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
0.1 | 0.2 | GO:0086023 | adrenergic receptor signaling pathway involved in heart process(GO:0086023) |
0.1 | 0.4 | GO:0032790 | ribosome disassembly(GO:0032790) |
0.1 | 0.2 | GO:0006106 | fumarate metabolic process(GO:0006106) |
0.1 | 0.2 | GO:0046101 | hypoxanthine metabolic process(GO:0046100) hypoxanthine biosynthetic process(GO:0046101) |
0.1 | 0.2 | GO:0009177 | deoxyribonucleoside monophosphate biosynthetic process(GO:0009157) pyrimidine deoxyribonucleoside monophosphate biosynthetic process(GO:0009177) |
0.1 | 0.1 | GO:0010912 | regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) |
0.1 | 0.1 | GO:0060397 | JAK-STAT cascade involved in growth hormone signaling pathway(GO:0060397) |
0.1 | 0.1 | GO:0034241 | positive regulation of macrophage fusion(GO:0034241) |
0.1 | 0.1 | GO:1990791 | dorsal root ganglion development(GO:1990791) |
0.1 | 0.3 | GO:0042905 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
0.1 | 0.2 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
0.1 | 0.2 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
0.1 | 0.1 | GO:0021861 | forebrain radial glial cell differentiation(GO:0021861) |
0.1 | 0.2 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.1 | 0.2 | GO:0071205 | protein localization to juxtaparanode region of axon(GO:0071205) |
0.1 | 0.2 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
0.1 | 0.2 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
0.1 | 0.2 | GO:0042891 | antibiotic transport(GO:0042891) |
0.1 | 0.2 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
0.1 | 0.1 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
0.1 | 0.2 | GO:0000492 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
0.1 | 0.1 | GO:0060066 | oviduct development(GO:0060066) |
0.1 | 0.1 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
0.0 | 0.4 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
0.0 | 0.1 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
0.0 | 0.1 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
0.0 | 0.5 | GO:0006656 | phosphatidylcholine biosynthetic process(GO:0006656) |
0.0 | 0.1 | GO:0015772 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.0 | 0.0 | GO:0060594 | mammary gland specification(GO:0060594) |
0.0 | 0.1 | GO:0051572 | negative regulation of histone H3-K4 methylation(GO:0051572) |
0.0 | 0.1 | GO:0071670 | smooth muscle cell chemotaxis(GO:0071670) |
0.0 | 0.8 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
0.0 | 0.3 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.0 | 1.5 | GO:0006953 | acute-phase response(GO:0006953) |
0.0 | 0.3 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
0.0 | 0.3 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) |
0.0 | 0.2 | GO:1904526 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
0.0 | 0.4 | GO:0048194 | Golgi vesicle budding(GO:0048194) |
0.0 | 0.2 | GO:0017014 | protein nitrosylation(GO:0017014) |
0.0 | 0.1 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
0.0 | 0.3 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
0.0 | 0.1 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
0.0 | 0.1 | GO:0045896 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
0.0 | 0.2 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
0.0 | 0.1 | GO:2000670 | positive regulation of dendritic cell apoptotic process(GO:2000670) |
0.0 | 0.3 | GO:0021707 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
0.0 | 0.2 | GO:0046110 | xanthine catabolic process(GO:0009115) xanthine metabolic process(GO:0046110) |
0.0 | 0.3 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
0.0 | 0.1 | GO:0006059 | hexitol metabolic process(GO:0006059) |
0.0 | 0.2 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
0.0 | 0.8 | GO:0015701 | bicarbonate transport(GO:0015701) |
0.0 | 0.0 | GO:0033239 | negative regulation of cellular amine metabolic process(GO:0033239) |
0.0 | 0.1 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.0 | 0.2 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
0.0 | 0.1 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
0.0 | 0.1 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
0.0 | 0.3 | GO:0006670 | sphingosine metabolic process(GO:0006670) |
0.0 | 0.2 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.0 | 0.0 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
0.0 | 0.1 | GO:0072179 | nephric duct formation(GO:0072179) |
0.0 | 0.3 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
0.0 | 0.1 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
0.0 | 0.2 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
0.0 | 0.2 | GO:0018317 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
0.0 | 0.6 | GO:0006883 | cellular sodium ion homeostasis(GO:0006883) |
0.0 | 0.1 | GO:0034287 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
0.0 | 0.0 | GO:0060019 | radial glial cell differentiation(GO:0060019) |
0.0 | 0.2 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
0.0 | 0.3 | GO:0021860 | pyramidal neuron development(GO:0021860) |
0.0 | 0.1 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
0.0 | 0.2 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
0.0 | 0.2 | GO:0018101 | protein citrullination(GO:0018101) |
0.0 | 0.1 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
0.0 | 0.5 | GO:0046688 | response to copper ion(GO:0046688) |
0.0 | 0.3 | GO:0071361 | cellular response to ethanol(GO:0071361) |
0.0 | 0.1 | GO:0032439 | endosome localization(GO:0032439) |
0.0 | 0.1 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
0.0 | 0.1 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
0.0 | 0.0 | GO:0002034 | angiotensin mediated vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001998) regulation of blood vessel size by renin-angiotensin(GO:0002034) renal control of peripheral vascular resistance involved in regulation of systemic arterial blood pressure(GO:0003072) |
0.0 | 0.1 | GO:0051890 | regulation of cardioblast differentiation(GO:0051890) |
0.0 | 0.2 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
0.0 | 0.2 | GO:0006561 | proline biosynthetic process(GO:0006561) |
0.0 | 0.1 | GO:0010459 | negative regulation of heart rate(GO:0010459) |
0.0 | 0.1 | GO:0002894 | type IIa hypersensitivity(GO:0001794) regulation of type IIa hypersensitivity(GO:0001796) positive regulation of type IIa hypersensitivity(GO:0001798) type II hypersensitivity(GO:0002445) regulation of type II hypersensitivity(GO:0002892) positive regulation of type II hypersensitivity(GO:0002894) |
0.0 | 0.3 | GO:0042730 | fibrinolysis(GO:0042730) |
0.0 | 0.2 | GO:2001214 | positive regulation of vasculogenesis(GO:2001214) |
0.0 | 0.2 | GO:0043320 | natural killer cell degranulation(GO:0043320) |
0.0 | 0.2 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.0 | 0.4 | GO:2000310 | regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
0.0 | 0.1 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
0.0 | 0.1 | GO:0060591 | chondroblast differentiation(GO:0060591) |
0.0 | 0.1 | GO:0090240 | positive regulation of histone H4 acetylation(GO:0090240) |
0.0 | 0.2 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
0.0 | 0.0 | GO:0034196 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
0.0 | 0.1 | GO:0030241 | skeletal muscle myosin thick filament assembly(GO:0030241) striated muscle myosin thick filament assembly(GO:0071688) |
0.0 | 0.1 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
0.0 | 0.1 | GO:2000978 | negative regulation of forebrain neuron differentiation(GO:2000978) |
0.0 | 0.1 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
0.0 | 0.1 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
0.0 | 0.0 | GO:1900020 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
0.0 | 0.8 | GO:0032467 | positive regulation of cytokinesis(GO:0032467) |
0.0 | 0.1 | GO:0071494 | cellular response to UV-C(GO:0071494) |
0.0 | 0.2 | GO:0060242 | contact inhibition(GO:0060242) |
0.0 | 0.1 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
0.0 | 0.1 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
0.0 | 0.1 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
0.0 | 0.2 | GO:0060710 | chorio-allantoic fusion(GO:0060710) |
0.0 | 0.1 | GO:0002309 | T cell proliferation involved in immune response(GO:0002309) |
0.0 | 0.1 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
0.0 | 0.2 | GO:0051639 | actin filament network formation(GO:0051639) |
0.0 | 0.2 | GO:0042178 | xenobiotic catabolic process(GO:0042178) |
0.0 | 0.6 | GO:0002089 | lens morphogenesis in camera-type eye(GO:0002089) |
0.0 | 0.1 | GO:0008078 | mesodermal cell migration(GO:0008078) |
0.0 | 2.4 | GO:0035023 | regulation of Rho protein signal transduction(GO:0035023) |
0.0 | 0.1 | GO:0003096 | renal sodium ion transport(GO:0003096) renal sodium ion absorption(GO:0070294) |
0.0 | 0.1 | GO:0070649 | formin-nucleated actin cable assembly(GO:0070649) |
0.0 | 0.2 | GO:0060628 | regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
0.0 | 0.1 | GO:1990034 | calcium ion export from cell(GO:1990034) |
0.0 | 0.1 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
0.0 | 0.1 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
0.0 | 0.1 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
0.0 | 0.1 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
0.0 | 0.4 | GO:0006706 | steroid catabolic process(GO:0006706) |
0.0 | 0.1 | GO:0051409 | response to nitrosative stress(GO:0051409) |
0.0 | 0.2 | GO:0006264 | mitochondrial DNA replication(GO:0006264) |
0.0 | 0.1 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
0.0 | 0.5 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
0.0 | 0.2 | GO:0072673 | lamellipodium morphogenesis(GO:0072673) |
0.0 | 0.1 | GO:1900107 | regulation of nodal signaling pathway(GO:1900107) |
0.0 | 0.1 | GO:0016264 | gap junction assembly(GO:0016264) |
0.0 | 0.3 | GO:0034063 | stress granule assembly(GO:0034063) |
0.0 | 0.3 | GO:0045725 | positive regulation of glycogen biosynthetic process(GO:0045725) |
0.0 | 0.1 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
0.0 | 0.1 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
0.0 | 0.4 | GO:0048026 | positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
0.0 | 0.1 | GO:0046013 | regulation of T cell homeostatic proliferation(GO:0046013) |
0.0 | 0.1 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.0 | 0.2 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
0.0 | 0.2 | GO:0061154 | endothelial tube morphogenesis(GO:0061154) |
0.0 | 0.1 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
0.0 | 0.1 | GO:0060339 | negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
0.0 | 0.2 | GO:0002591 | positive regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002591) |
0.0 | 0.1 | GO:0048207 | vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
0.0 | 0.3 | GO:0008210 | estrogen metabolic process(GO:0008210) |
0.0 | 0.1 | GO:0071442 | positive regulation of histone H3-K14 acetylation(GO:0071442) |
0.0 | 0.1 | GO:0006393 | termination of mitochondrial transcription(GO:0006393) |
0.0 | 0.5 | GO:0017144 | drug metabolic process(GO:0017144) |
0.0 | 0.1 | GO:1901662 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
0.0 | 0.1 | GO:0061000 | negative regulation of dendritic spine development(GO:0061000) |
0.0 | 0.1 | GO:0033087 | negative regulation of immature T cell proliferation(GO:0033087) |
0.0 | 0.1 | GO:0060510 | Type II pneumocyte differentiation(GO:0060510) |
0.0 | 0.1 | GO:0007208 | phospholipase C-activating serotonin receptor signaling pathway(GO:0007208) |
0.0 | 0.0 | GO:0002018 | renin-angiotensin regulation of aldosterone production(GO:0002018) |
0.0 | 0.0 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
0.0 | 0.5 | GO:0061436 | establishment of skin barrier(GO:0061436) |
0.0 | 0.0 | GO:0007144 | female meiosis I(GO:0007144) |
0.0 | 0.0 | GO:0072531 | pyrimidine-containing compound transmembrane transport(GO:0072531) |
0.0 | 0.1 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.0 | 0.1 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
0.0 | 0.1 | GO:0002870 | lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
0.0 | 0.0 | GO:0002554 | serotonin secretion by platelet(GO:0002554) |
0.0 | 0.1 | GO:0019249 | lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
0.0 | 0.1 | GO:0014012 | peripheral nervous system axon regeneration(GO:0014012) |
0.0 | 0.1 | GO:0071926 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
0.0 | 0.1 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
0.0 | 0.2 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
0.0 | 1.2 | GO:0031338 | regulation of vesicle fusion(GO:0031338) |
0.0 | 0.1 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
0.0 | 0.1 | GO:0060368 | regulation of Fc receptor mediated stimulatory signaling pathway(GO:0060368) |
0.0 | 0.0 | GO:2000698 | positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) |
0.0 | 0.1 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
0.0 | 0.1 | GO:0001712 | ectodermal cell fate commitment(GO:0001712) |
0.0 | 0.1 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
0.0 | 0.1 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
0.0 | 0.1 | GO:0035166 | post-embryonic hemopoiesis(GO:0035166) |
0.0 | 0.1 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
0.0 | 0.3 | GO:0035518 | histone H2A monoubiquitination(GO:0035518) |
0.0 | 0.2 | GO:0051026 | chiasma assembly(GO:0051026) |
0.0 | 0.8 | GO:0050829 | defense response to Gram-negative bacterium(GO:0050829) |
0.0 | 0.2 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
0.0 | 0.0 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
0.0 | 0.4 | GO:0032958 | inositol phosphate biosynthetic process(GO:0032958) |
0.0 | 0.2 | GO:0045651 | positive regulation of macrophage differentiation(GO:0045651) |
0.0 | 0.0 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
0.0 | 0.0 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
0.0 | 0.0 | GO:0002730 | regulation of dendritic cell cytokine production(GO:0002730) |
0.0 | 0.1 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
0.0 | 0.1 | GO:0014745 | negative regulation of muscle adaptation(GO:0014745) |
0.0 | 0.1 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
0.0 | 0.0 | GO:2000564 | regulation of CD8-positive, alpha-beta T cell proliferation(GO:2000564) |
0.0 | 0.1 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.0 | 0.4 | GO:1900449 | regulation of glutamate receptor signaling pathway(GO:1900449) |
0.0 | 0.1 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
0.0 | 0.0 | GO:0035771 | interleukin-4-mediated signaling pathway(GO:0035771) |
0.0 | 0.0 | GO:0003149 | membranous septum morphogenesis(GO:0003149) |
0.0 | 0.1 | GO:0030916 | otic vesicle formation(GO:0030916) |
0.0 | 0.1 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
0.0 | 0.3 | GO:0006376 | mRNA splice site selection(GO:0006376) |
0.0 | 0.1 | GO:0006203 | dGTP catabolic process(GO:0006203) |
0.0 | 0.8 | GO:0006418 | tRNA aminoacylation for protein translation(GO:0006418) |
0.0 | 0.1 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
0.0 | 0.1 | GO:0090148 | membrane fission(GO:0090148) |
0.0 | 0.1 | GO:0009106 | lipoate metabolic process(GO:0009106) |
0.0 | 0.2 | GO:0045943 | positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
0.0 | 0.1 | GO:0008300 | isoprenoid catabolic process(GO:0008300) |
0.0 | 0.0 | GO:0001555 | oocyte growth(GO:0001555) |
0.0 | 0.1 | GO:0042256 | mature ribosome assembly(GO:0042256) |
0.0 | 0.1 | GO:0070995 | NADPH oxidation(GO:0070995) |
0.0 | 0.4 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
0.0 | 0.0 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
0.0 | 0.1 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.0 | 0.2 | GO:0046697 | decidualization(GO:0046697) |
0.0 | 0.0 | GO:0033686 | positive regulation of luteinizing hormone secretion(GO:0033686) |
0.0 | 0.0 | GO:2000384 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
0.0 | 0.1 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
0.0 | 0.1 | GO:0051031 | tRNA transport(GO:0051031) |
0.0 | 0.2 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
0.0 | 0.0 | GO:2000525 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
0.0 | 0.0 | GO:0060335 | positive regulation of response to interferon-gamma(GO:0060332) positive regulation of interferon-gamma-mediated signaling pathway(GO:0060335) |
0.0 | 0.1 | GO:0022030 | cerebral cortex radial glia guided migration(GO:0021801) telencephalon glial cell migration(GO:0022030) |
0.0 | 0.1 | GO:0003223 | ventricular compact myocardium morphogenesis(GO:0003223) |
0.0 | 0.1 | GO:0042270 | protection from natural killer cell mediated cytotoxicity(GO:0042270) |
0.0 | 0.3 | GO:0016180 | snRNA processing(GO:0016180) |
0.0 | 0.1 | GO:0071868 | cellular response to monoamine stimulus(GO:0071868) |
0.0 | 0.1 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
0.0 | 0.1 | GO:1901300 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
0.0 | 0.1 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
0.0 | 0.1 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
0.0 | 0.1 | GO:0008063 | Toll signaling pathway(GO:0008063) |
0.0 | 0.0 | GO:0090239 | regulation of histone H4 acetylation(GO:0090239) |
0.0 | 0.6 | GO:0006958 | complement activation, classical pathway(GO:0006958) |
0.0 | 0.0 | GO:0097343 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
0.0 | 0.0 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
0.0 | 0.1 | GO:0035428 | hexose transmembrane transport(GO:0035428) |
0.0 | 0.4 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
0.0 | 0.1 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
0.0 | 0.6 | GO:0006378 | mRNA polyadenylation(GO:0006378) RNA polyadenylation(GO:0043631) |
0.0 | 0.0 | GO:1902202 | regulation of hepatocyte growth factor receptor signaling pathway(GO:1902202) |
0.0 | 0.0 | GO:0009698 | phenylpropanoid metabolic process(GO:0009698) phenylpropanoid catabolic process(GO:0046271) |
0.0 | 0.0 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
0.0 | 0.0 | GO:0010749 | regulation of nitric oxide mediated signal transduction(GO:0010749) |
0.0 | 0.1 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
0.0 | 0.0 | GO:1903797 | positive regulation of inorganic anion transmembrane transport(GO:1903797) |
0.0 | 0.1 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
0.0 | 0.1 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
0.0 | 0.0 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
0.0 | 0.3 | GO:0048488 | synaptic vesicle endocytosis(GO:0048488) |
0.0 | 0.1 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
0.0 | 0.3 | GO:0010107 | potassium ion import(GO:0010107) |
0.0 | 0.1 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
0.0 | 0.1 | GO:0071420 | cellular response to histamine(GO:0071420) |
0.0 | 0.1 | GO:1904668 | positive regulation of ubiquitin protein ligase activity(GO:1904668) |
0.0 | 0.2 | GO:0010971 | positive regulation of G2/M transition of mitotic cell cycle(GO:0010971) |
0.0 | 0.0 | GO:0002678 | positive regulation of chronic inflammatory response(GO:0002678) |
0.0 | 0.0 | GO:0036514 | dopaminergic neuron axon guidance(GO:0036514) planar cell polarity pathway involved in axon guidance(GO:1904938) |
0.0 | 0.1 | GO:0048625 | myoblast fate commitment(GO:0048625) |
0.0 | 0.1 | GO:0036089 | cleavage furrow formation(GO:0036089) |
0.0 | 0.1 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
0.0 | 0.1 | GO:0018230 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
0.0 | 0.1 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
0.0 | 0.1 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
0.0 | 0.1 | GO:0043615 | astrocyte cell migration(GO:0043615) |
0.0 | 0.1 | GO:0048012 | hepatocyte growth factor receptor signaling pathway(GO:0048012) |
0.0 | 0.1 | GO:0071971 | extracellular exosome assembly(GO:0071971) regulation of extracellular exosome assembly(GO:1903551) |
0.0 | 0.1 | GO:0051181 | cofactor transport(GO:0051181) |
0.0 | 0.1 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
0.0 | 0.1 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
0.0 | 0.2 | GO:0007413 | axonal fasciculation(GO:0007413) |
0.0 | 0.1 | GO:0090166 | Golgi disassembly(GO:0090166) |
0.0 | 0.1 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.0 | 0.2 | GO:0033120 | positive regulation of RNA splicing(GO:0033120) |
0.0 | 0.1 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
0.0 | 0.0 | GO:0006600 | creatine metabolic process(GO:0006600) |
0.0 | 0.1 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
0.0 | 0.0 | GO:0050427 | 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
0.0 | 0.0 | GO:0002727 | natural killer cell cytokine production(GO:0002370) regulation of natural killer cell cytokine production(GO:0002727) |
0.0 | 0.1 | GO:2000343 | positive regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000343) |
0.0 | 0.0 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.0 | 0.2 | GO:0006198 | cAMP catabolic process(GO:0006198) |
0.0 | 0.1 | GO:0015879 | carnitine transport(GO:0015879) |
0.0 | 0.1 | GO:0032825 | positive regulation of natural killer cell differentiation(GO:0032825) |
0.0 | 0.0 | GO:0034454 | microtubule anchoring at centrosome(GO:0034454) |
0.0 | 0.0 | GO:0019464 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.0 | 0.0 | GO:0061046 | regulation of branching involved in lung morphogenesis(GO:0061046) |
0.0 | 0.0 | GO:0002901 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
0.0 | 0.1 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
0.0 | 0.0 | GO:0002434 | immune complex clearance(GO:0002434) |
0.0 | 0.0 | GO:0015817 | histidine transport(GO:0015817) |
0.0 | 0.1 | GO:0030259 | lipid glycosylation(GO:0030259) |
0.0 | 0.1 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
0.0 | 0.0 | GO:0098787 | mRNA cleavage involved in mRNA processing(GO:0098787) |
0.0 | 0.1 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.0 | 0.0 | GO:1900864 | mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
0.0 | 0.0 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
0.0 | 0.0 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
0.0 | 0.0 | GO:0035902 | response to immobilization stress(GO:0035902) |
0.0 | 0.0 | GO:0048295 | positive regulation of isotype switching to IgE isotypes(GO:0048295) |
0.0 | 0.0 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
0.0 | 0.1 | GO:1902093 | positive regulation of sperm motility(GO:1902093) |
0.0 | 0.1 | GO:0019321 | pentose metabolic process(GO:0019321) |
0.0 | 0.1 | GO:0045835 | negative regulation of meiotic nuclear division(GO:0045835) |
0.0 | 0.1 | GO:0009597 | detection of virus(GO:0009597) |
0.0 | 0.4 | GO:0009994 | oocyte differentiation(GO:0009994) |
0.0 | 0.2 | GO:0006336 | DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
0.0 | 0.3 | GO:0000460 | maturation of 5.8S rRNA(GO:0000460) |
0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.3 | GO:0006298 | mismatch repair(GO:0006298) |
0.0 | 0.1 | GO:0070862 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
0.0 | 0.0 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
0.0 | 0.2 | GO:2000171 | negative regulation of dendrite development(GO:2000171) |
0.0 | 0.0 | GO:0072318 | clathrin coat disassembly(GO:0072318) |
0.0 | 0.0 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
0.0 | 0.0 | GO:0015744 | succinate transport(GO:0015744) |
0.0 | 0.2 | GO:0036075 | endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
0.0 | 0.0 | GO:0046654 | tetrahydrofolate biosynthetic process(GO:0046654) |
0.0 | 0.0 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
0.0 | 0.1 | GO:0003056 | regulation of vascular smooth muscle contraction(GO:0003056) |
0.0 | 0.0 | GO:0036289 | peptidyl-serine autophosphorylation(GO:0036289) |
0.0 | 0.1 | GO:0006273 | lagging strand elongation(GO:0006273) |
0.0 | 0.0 | GO:0002432 | granuloma formation(GO:0002432) |
0.0 | 0.0 | GO:0048341 | paraxial mesoderm formation(GO:0048341) |
0.0 | 0.0 | GO:2000020 | positive regulation of male gonad development(GO:2000020) |
0.0 | 0.0 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
0.0 | 0.1 | GO:1900048 | positive regulation of blood coagulation(GO:0030194) positive regulation of hemostasis(GO:1900048) |
0.0 | 0.0 | GO:1902109 | negative regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902109) |
0.0 | 0.0 | GO:0036394 | amylase secretion(GO:0036394) |
0.0 | 0.0 | GO:0030222 | eosinophil differentiation(GO:0030222) |
0.0 | 0.0 | GO:0044849 | estrous cycle(GO:0044849) |
0.0 | 0.0 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
0.0 | 0.1 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
0.0 | 0.0 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
0.0 | 0.0 | GO:0000087 | mitotic M phase(GO:0000087) |
0.0 | 0.0 | GO:0060437 | lung growth(GO:0060437) |
0.0 | 0.3 | GO:0043277 | apoptotic cell clearance(GO:0043277) |
0.0 | 0.1 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
0.0 | 0.0 | GO:0007199 | G-protein coupled receptor signaling pathway coupled to cGMP nucleotide second messenger(GO:0007199) |
0.0 | 0.0 | GO:0007343 | egg activation(GO:0007343) |
0.0 | 0.1 | GO:0001675 | acrosome assembly(GO:0001675) |
0.0 | 0.0 | GO:0001866 | NK T cell proliferation(GO:0001866) |
0.0 | 0.0 | GO:1902023 | L-arginine import(GO:0043091) arginine import(GO:0090467) L-arginine transport(GO:1902023) |
0.0 | 0.0 | GO:1903236 | regulation of leukocyte tethering or rolling(GO:1903236) |
0.0 | 0.1 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
0.0 | 0.1 | GO:0042795 | snRNA transcription from RNA polymerase II promoter(GO:0042795) |
0.0 | 0.2 | GO:0042036 | negative regulation of cytokine biosynthetic process(GO:0042036) |
0.0 | 0.1 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
0.0 | 0.1 | GO:0051697 | protein delipidation(GO:0051697) |
0.0 | 0.1 | GO:0097120 | receptor localization to synapse(GO:0097120) |
0.0 | 0.0 | GO:2000870 | regulation of progesterone secretion(GO:2000870) |
0.0 | 0.1 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
0.0 | 0.0 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
0.0 | 0.0 | GO:0006244 | pyrimidine nucleotide catabolic process(GO:0006244) |
0.0 | 0.1 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
0.0 | 0.0 | GO:0060839 | endothelial cell fate commitment(GO:0060839) |
0.0 | 0.0 | GO:0060005 | vestibular reflex(GO:0060005) |
0.0 | 0.0 | GO:0006787 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) |
0.0 | 0.0 | GO:0001302 | replicative cell aging(GO:0001302) |
0.0 | 0.1 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.0 | 0.9 | GO:0051056 | regulation of small GTPase mediated signal transduction(GO:0051056) |
0.0 | 0.1 | GO:0046060 | dATP metabolic process(GO:0046060) |
0.0 | 0.1 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
0.0 | 0.2 | GO:0006099 | tricarboxylic acid cycle(GO:0006099) |
0.0 | 0.0 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
0.0 | 0.1 | GO:0042573 | retinoic acid metabolic process(GO:0042573) |
0.0 | 0.0 | GO:0016056 | rhodopsin mediated signaling pathway(GO:0016056) |
0.0 | 0.0 | GO:0018243 | protein O-linked glycosylation via threonine(GO:0018243) |
0.0 | 0.1 | GO:0006527 | arginine catabolic process(GO:0006527) |
0.0 | 0.0 | GO:0046070 | dGTP metabolic process(GO:0046070) |
0.0 | 0.1 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
0.0 | 0.3 | GO:0043392 | negative regulation of DNA binding(GO:0043392) |
0.0 | 0.0 | GO:0045654 | positive regulation of megakaryocyte differentiation(GO:0045654) |
0.0 | 0.1 | GO:0010640 | regulation of platelet-derived growth factor receptor signaling pathway(GO:0010640) |
0.0 | 0.0 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.0 | 0.1 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.0 | 0.1 | GO:0071850 | mitotic cell cycle arrest(GO:0071850) |
0.0 | 0.0 | GO:0032429 | regulation of phospholipase A2 activity(GO:0032429) |
0.0 | 0.0 | GO:0010885 | regulation of cholesterol storage(GO:0010885) |
0.0 | 0.1 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
0.0 | 0.0 | GO:0045617 | negative regulation of keratinocyte differentiation(GO:0045617) |
0.0 | 0.0 | GO:0035582 | sequestering of BMP in extracellular matrix(GO:0035582) |
0.0 | 0.0 | GO:0015838 | amino-acid betaine transport(GO:0015838) |
0.0 | 0.1 | GO:0015012 | heparan sulfate proteoglycan biosynthetic process(GO:0015012) |
0.0 | 0.1 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
0.0 | 0.1 | GO:0008340 | determination of adult lifespan(GO:0008340) |
0.0 | 0.0 | GO:0061054 | dermatome development(GO:0061054) regulation of dermatome development(GO:0061183) |
0.0 | 0.1 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
0.0 | 0.1 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
0.0 | 0.0 | GO:0002317 | plasma cell differentiation(GO:0002317) |
0.0 | 0.0 | GO:2000643 | positive regulation of early endosome to late endosome transport(GO:2000643) |
0.0 | 0.1 | GO:0000103 | sulfate assimilation(GO:0000103) |
0.0 | 0.1 | GO:0097341 | inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
0.0 | 0.4 | GO:0045761 | regulation of adenylate cyclase activity(GO:0045761) |
0.0 | 0.0 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
0.0 | 0.2 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
0.0 | 0.1 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
0.0 | 0.0 | GO:0045945 | positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
0.0 | 0.1 | GO:1902230 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902230) |
0.0 | 0.0 | GO:0060592 | mammary gland formation(GO:0060592) |
0.0 | 0.1 | GO:0015693 | magnesium ion transport(GO:0015693) |
0.0 | 0.0 | GO:0006662 | glycerol ether metabolic process(GO:0006662) |
0.0 | 0.0 | GO:2000015 | regulation of determination of dorsal identity(GO:2000015) |
0.0 | 0.0 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.0 | 0.1 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
0.0 | 0.0 | GO:0001757 | somite specification(GO:0001757) |
0.0 | 0.0 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
0.0 | 0.0 | GO:0090214 | spongiotrophoblast layer developmental growth(GO:0090214) |
0.0 | 0.1 | GO:0045117 | azole transport(GO:0045117) |
0.0 | 0.0 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
0.0 | 0.0 | GO:0070633 | transepithelial transport(GO:0070633) |
0.0 | 0.0 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
0.0 | 0.0 | GO:0043031 | negative regulation of macrophage activation(GO:0043031) |
0.0 | 0.0 | GO:0010637 | negative regulation of mitochondrial fusion(GO:0010637) |
0.0 | 0.1 | GO:0034033 | coenzyme A biosynthetic process(GO:0015937) nucleoside bisphosphate biosynthetic process(GO:0033866) ribonucleoside bisphosphate biosynthetic process(GO:0034030) purine nucleoside bisphosphate biosynthetic process(GO:0034033) |
0.0 | 0.0 | GO:0050955 | thermoception(GO:0050955) |
0.0 | 0.1 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
0.0 | 0.1 | GO:0043518 | negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
0.0 | 0.0 | GO:2000195 | negative regulation of female gonad development(GO:2000195) |
0.0 | 0.0 | GO:0002431 | Fc receptor mediated stimulatory signaling pathway(GO:0002431) |
0.0 | 0.0 | GO:0061370 | testosterone biosynthetic process(GO:0061370) |
0.0 | 0.0 | GO:0010519 | negative regulation of phospholipase activity(GO:0010519) |
0.0 | 0.0 | GO:0051596 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
0.0 | 0.1 | GO:0097034 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
0.0 | 0.0 | GO:0039689 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
0.0 | 0.1 | GO:0006309 | apoptotic DNA fragmentation(GO:0006309) |
0.0 | 0.0 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
0.0 | 0.1 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
0.0 | 0.1 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
0.0 | 0.1 | GO:0010225 | response to UV-C(GO:0010225) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 1.5 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
0.3 | 1.9 | GO:0005577 | fibrinogen complex(GO:0005577) |
0.2 | 0.7 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.2 | 0.7 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
0.2 | 0.8 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
0.2 | 1.2 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
0.2 | 0.6 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
0.2 | 0.5 | GO:0031417 | NatC complex(GO:0031417) |
0.2 | 0.5 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
0.2 | 0.9 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
0.2 | 0.9 | GO:0031983 | vesicle lumen(GO:0031983) |
0.1 | 0.6 | GO:1990696 | USH2 complex(GO:1990696) |
0.1 | 0.4 | GO:0045293 | mRNA editing complex(GO:0045293) |
0.1 | 0.7 | GO:0043219 | lateral loop(GO:0043219) |
0.1 | 0.5 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
0.1 | 0.3 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
0.1 | 0.2 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
0.1 | 0.2 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
0.1 | 1.2 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.1 | 0.2 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.1 | 0.9 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.1 | 0.4 | GO:0002177 | manchette(GO:0002177) |
0.1 | 1.1 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
0.1 | 0.5 | GO:0042587 | glycogen granule(GO:0042587) |
0.1 | 0.3 | GO:0097255 | R2TP complex(GO:0097255) |
0.1 | 0.2 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
0.1 | 0.3 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.1 | 0.2 | GO:0031084 | BLOC-2 complex(GO:0031084) |
0.1 | 0.3 | GO:0045180 | basal cortex(GO:0045180) |
0.1 | 0.3 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.1 | 0.2 | GO:0070876 | SOSS complex(GO:0070876) |
0.1 | 0.2 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
0.1 | 0.3 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.1 | 5.5 | GO:0072562 | blood microparticle(GO:0072562) |
0.1 | 0.4 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.1 | 0.9 | GO:0090665 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
0.0 | 0.9 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
0.0 | 0.3 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
0.0 | 0.1 | GO:0032127 | dense core granule membrane(GO:0032127) |
0.0 | 0.2 | GO:0036454 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
0.0 | 0.2 | GO:0098536 | deuterosome(GO:0098536) |
0.0 | 0.2 | GO:0070820 | tertiary granule(GO:0070820) |
0.0 | 1.1 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.0 | 0.8 | GO:0030673 | axolemma(GO:0030673) |
0.0 | 0.2 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
0.0 | 0.3 | GO:0033263 | CORVET complex(GO:0033263) |
0.0 | 0.7 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
0.0 | 0.1 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.0 | 0.4 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.0 | 0.1 | GO:0035061 | interchromatin granule(GO:0035061) |
0.0 | 0.1 | GO:0035189 | Rb-E2F complex(GO:0035189) |
0.0 | 0.2 | GO:0045239 | tricarboxylic acid cycle enzyme complex(GO:0045239) |
0.0 | 0.3 | GO:0032591 | dendritic spine membrane(GO:0032591) |
0.0 | 0.2 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.0 | 0.1 | GO:0036449 | microtubule minus-end(GO:0036449) |
0.0 | 0.1 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.0 | 0.1 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
0.0 | 0.1 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.0 | 0.3 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.0 | 0.2 | GO:0020005 | symbiont-containing vacuole membrane(GO:0020005) |
0.0 | 0.6 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.0 | 0.1 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.0 | 0.1 | GO:0072487 | MSL complex(GO:0072487) |
0.0 | 0.5 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.0 | 0.0 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
0.0 | 0.4 | GO:0000242 | pericentriolar material(GO:0000242) |
0.0 | 0.3 | GO:0046581 | intercellular canaliculus(GO:0046581) |
0.0 | 0.6 | GO:0005922 | connexon complex(GO:0005922) |
0.0 | 0.4 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.0 | 0.1 | GO:0031094 | platelet dense tubular network(GO:0031094) |
0.0 | 0.1 | GO:0089701 | U2AF(GO:0089701) |
0.0 | 0.3 | GO:0032039 | integrator complex(GO:0032039) |
0.0 | 0.1 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
0.0 | 0.2 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
0.0 | 0.4 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
0.0 | 0.1 | GO:0000811 | GINS complex(GO:0000811) |
0.0 | 0.1 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
0.0 | 0.2 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.0 | 0.3 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.0 | 0.2 | GO:0051286 | cell tip(GO:0051286) |
0.0 | 0.2 | GO:0045179 | apical cortex(GO:0045179) |
0.0 | 0.2 | GO:0016272 | prefoldin complex(GO:0016272) |
0.0 | 0.3 | GO:0045495 | P granule(GO:0043186) pole plasm(GO:0045495) germ plasm(GO:0060293) |
0.0 | 0.2 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.0 | 1.3 | GO:0044439 | microbody part(GO:0044438) peroxisomal part(GO:0044439) |
0.0 | 0.1 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
0.0 | 0.0 | GO:1990357 | terminal web(GO:1990357) |
0.0 | 1.7 | GO:0000922 | spindle pole(GO:0000922) |
0.0 | 0.3 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.0 | 0.1 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.0 | 0.1 | GO:0020016 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
0.0 | 0.1 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
0.0 | 0.1 | GO:0061574 | ASAP complex(GO:0061574) |
0.0 | 0.3 | GO:0046540 | U4/U6 x U5 tri-snRNP complex(GO:0046540) |
0.0 | 0.1 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.0 | 0.0 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
0.0 | 0.7 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
0.0 | 0.3 | GO:0002080 | acrosomal membrane(GO:0002080) |
0.0 | 0.1 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.0 | 0.5 | GO:0031941 | filamentous actin(GO:0031941) |
0.0 | 0.4 | GO:0000777 | condensed chromosome kinetochore(GO:0000777) |
0.0 | 0.1 | GO:0044327 | dendritic spine head(GO:0044327) |
0.0 | 0.3 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.0 | 0.1 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
0.0 | 0.1 | GO:0033655 | host cell cytoplasm(GO:0030430) host cell cytoplasm part(GO:0033655) |
0.0 | 0.2 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
0.0 | 0.1 | GO:0030127 | COPII vesicle coat(GO:0030127) |
0.0 | 0.0 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.0 | 0.1 | GO:1990130 | Iml1 complex(GO:1990130) |
0.0 | 0.1 | GO:0071203 | WASH complex(GO:0071203) |
0.0 | 0.1 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
0.0 | 0.0 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.0 | 0.1 | GO:0000938 | GARP complex(GO:0000938) |
0.0 | 0.1 | GO:0044666 | MLL3/4 complex(GO:0044666) |
0.0 | 0.3 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
0.0 | 0.1 | GO:0005767 | secondary lysosome(GO:0005767) |
0.0 | 0.0 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
0.0 | 0.0 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.0 | 0.1 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
0.0 | 0.0 | GO:0097443 | sorting endosome(GO:0097443) |
0.0 | 0.1 | GO:0001674 | female germ cell nucleus(GO:0001674) |
0.0 | 0.0 | GO:0000802 | transverse filament(GO:0000802) |
0.0 | 0.1 | GO:1990777 | plasma lipoprotein particle(GO:0034358) lipoprotein particle(GO:1990777) |
0.0 | 0.1 | GO:0071986 | Ragulator complex(GO:0071986) |
0.0 | 0.1 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
0.0 | 0.0 | GO:0005683 | U7 snRNP(GO:0005683) |
0.0 | 0.1 | GO:0031931 | TORC1 complex(GO:0031931) |
0.0 | 0.0 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
0.0 | 0.0 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.0 | 0.1 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
0.0 | 0.1 | GO:0070938 | contractile ring(GO:0070938) |
0.0 | 0.1 | GO:0005686 | U2 snRNP(GO:0005686) |
0.0 | 0.3 | GO:0030686 | 90S preribosome(GO:0030686) |
0.0 | 0.1 | GO:0097539 | ciliary transition fiber(GO:0097539) |
0.0 | 0.1 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.0 | 0.0 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.0 | 0.3 | GO:0001772 | immunological synapse(GO:0001772) |
0.0 | 0.1 | GO:0035859 | Seh1-associated complex(GO:0035859) GATOR2 complex(GO:0061700) |
0.0 | 0.1 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
0.0 | 0.0 | GO:0071953 | elastic fiber(GO:0071953) |
0.0 | 0.1 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
0.0 | 0.1 | GO:0001651 | dense fibrillar component(GO:0001651) |
0.0 | 0.1 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
0.0 | 1.1 | GO:0031227 | intrinsic component of endoplasmic reticulum membrane(GO:0031227) |
0.0 | 0.1 | GO:0070531 | BRCA1-A complex(GO:0070531) |
0.0 | 0.0 | GO:0046691 | intracellular canaliculus(GO:0046691) |
0.0 | 0.1 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
0.0 | 0.0 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
0.0 | 0.2 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.0 | 0.1 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 4.4 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
0.5 | 1.5 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
0.5 | 1.4 | GO:0050309 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
0.3 | 0.8 | GO:1990460 | leptin receptor binding(GO:1990460) |
0.3 | 1.3 | GO:0050051 | leukotriene-B4 20-monooxygenase activity(GO:0050051) |
0.3 | 1.0 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
0.2 | 0.8 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
0.2 | 1.1 | GO:0005499 | vitamin D binding(GO:0005499) |
0.2 | 0.6 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.2 | 0.9 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.2 | 0.5 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
0.2 | 0.9 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.2 | 0.8 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
0.1 | 0.5 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
0.1 | 0.9 | GO:0001849 | complement component C1q binding(GO:0001849) |
0.1 | 0.6 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
0.1 | 0.4 | GO:0035877 | death effector domain binding(GO:0035877) |
0.1 | 1.7 | GO:0034185 | apolipoprotein binding(GO:0034185) |
0.1 | 0.5 | GO:0047105 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
0.1 | 0.7 | GO:0002054 | nucleobase binding(GO:0002054) |
0.1 | 0.7 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
0.1 | 0.3 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
0.1 | 0.4 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
0.1 | 0.8 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.1 | 0.2 | GO:0042895 | antibiotic transporter activity(GO:0042895) |
0.1 | 0.4 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
0.1 | 0.3 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
0.1 | 0.3 | GO:0051718 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
0.1 | 0.2 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
0.1 | 0.3 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.1 | 0.3 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.1 | 0.5 | GO:0016724 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.1 | 0.5 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) |
0.1 | 0.3 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
0.1 | 1.2 | GO:0016646 | oxidoreductase activity, acting on the CH-NH group of donors, NAD or NADP as acceptor(GO:0016646) |
0.1 | 0.2 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
0.1 | 0.2 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.1 | 0.2 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
0.1 | 0.4 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
0.1 | 0.2 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.1 | 0.5 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
0.1 | 0.3 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
0.1 | 0.2 | GO:0097016 | L27 domain binding(GO:0097016) |
0.1 | 0.9 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.1 | 0.3 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
0.1 | 1.4 | GO:0019825 | oxygen binding(GO:0019825) |
0.1 | 0.2 | GO:0070905 | serine binding(GO:0070905) |
0.1 | 0.8 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
0.1 | 1.0 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
0.1 | 0.2 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.1 | 0.2 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
0.1 | 0.2 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
0.1 | 0.6 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
0.1 | 0.1 | GO:0003896 | DNA primase activity(GO:0003896) |
0.1 | 0.2 | GO:0052833 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
0.1 | 0.2 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
0.1 | 0.1 | GO:0015106 | bicarbonate transmembrane transporter activity(GO:0015106) |
0.1 | 0.2 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
0.1 | 0.2 | GO:0016215 | acyl-CoA desaturase activity(GO:0016215) |
0.1 | 0.6 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
0.1 | 0.2 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
0.1 | 0.2 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.1 | 0.2 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.1 | 0.3 | GO:0004630 | phospholipase D activity(GO:0004630) |
0.1 | 0.3 | GO:0034875 | oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
0.1 | 1.0 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.1 | 0.2 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.1 | 0.1 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
0.1 | 0.2 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
0.1 | 0.3 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.0 | 0.1 | GO:0071553 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
0.0 | 0.8 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.0 | 2.1 | GO:0050694 | galactose 3-O-sulfotransferase activity(GO:0050694) |
0.0 | 0.6 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
0.0 | 0.1 | GO:0015157 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
0.0 | 0.1 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
0.0 | 0.4 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
0.0 | 0.6 | GO:0004707 | MAP kinase activity(GO:0004707) |
0.0 | 0.2 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
0.0 | 0.8 | GO:0016780 | phosphotransferase activity, for other substituted phosphate groups(GO:0016780) |
0.0 | 0.1 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
0.0 | 0.4 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
0.0 | 0.0 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.0 | 0.3 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
0.0 | 0.2 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.0 | 0.1 | GO:1990715 | mRNA CDS binding(GO:1990715) |
0.0 | 3.1 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
0.0 | 0.2 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
0.0 | 0.1 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.0 | 0.2 | GO:0004854 | xanthine dehydrogenase activity(GO:0004854) oxidoreductase activity, acting on CH or CH2 groups, NAD or NADP as acceptor(GO:0016726) |
0.0 | 0.7 | GO:0008327 | methyl-CpG binding(GO:0008327) |
0.0 | 0.5 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.0 | 0.2 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
0.0 | 0.8 | GO:0003785 | actin monomer binding(GO:0003785) |
0.0 | 0.2 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
0.0 | 0.1 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.0 | 0.4 | GO:0030983 | mismatched DNA binding(GO:0030983) |
0.0 | 0.1 | GO:0030350 | iron-responsive element binding(GO:0030350) |
0.0 | 0.2 | GO:0050693 | LBD domain binding(GO:0050693) |
0.0 | 0.9 | GO:0015301 | anion:anion antiporter activity(GO:0015301) |
0.0 | 0.1 | GO:0070538 | oleic acid binding(GO:0070538) |
0.0 | 0.1 | GO:0019862 | IgA binding(GO:0019862) |
0.0 | 0.2 | GO:0017040 | ceramidase activity(GO:0017040) |
0.0 | 0.5 | GO:0005243 | gap junction channel activity(GO:0005243) |
0.0 | 0.1 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.0 | 0.7 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
0.0 | 0.6 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
0.0 | 0.2 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.0 | 0.1 | GO:0071253 | connexin binding(GO:0071253) |
0.0 | 0.3 | GO:0050649 | testosterone 6-beta-hydroxylase activity(GO:0050649) |
0.0 | 1.5 | GO:0017046 | peptide hormone binding(GO:0017046) |
0.0 | 0.2 | GO:0043426 | MRF binding(GO:0043426) |
0.0 | 0.3 | GO:0052688 | 3-oxo-2-(2'-pentenyl)cyclopentane-1-octanoic acid CoA ligase activity(GO:0010435) 3-isopropenyl-6-oxoheptanoyl-CoA synthetase activity(GO:0018854) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA synthetase activity(GO:0018855) benzoyl acetate-CoA ligase activity(GO:0018856) 2,4-dichlorobenzoate-CoA ligase activity(GO:0018857) pivalate-CoA ligase activity(GO:0034783) cyclopropanecarboxylate-CoA ligase activity(GO:0034793) adipate-CoA ligase activity(GO:0034796) citronellyl-CoA ligase activity(GO:0034823) mentha-1,3-dione-CoA ligase activity(GO:0034841) thiophene-2-carboxylate-CoA ligase activity(GO:0034842) 2,4,4-trimethylpentanoate-CoA ligase activity(GO:0034865) cis-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034942) trans-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034943) branched-chain acyl-CoA synthetase (ADP-forming) activity(GO:0043759) aryl-CoA synthetase (ADP-forming) activity(GO:0043762) 3-hydroxypropionyl-CoA synthetase activity(GO:0043955) perillic acid:CoA ligase (ADP-forming) activity(GO:0052685) perillic acid:CoA ligase (AMP-forming) activity(GO:0052686) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (ADP-forming) activity(GO:0052687) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (AMP-forming) activity(GO:0052688) pristanate-CoA ligase activity(GO:0070251) malonyl-CoA synthetase activity(GO:0090409) |
0.0 | 0.1 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
0.0 | 0.1 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
0.0 | 0.1 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
0.0 | 0.2 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
0.0 | 0.1 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.0 | 0.1 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
0.0 | 0.1 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
0.0 | 0.1 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.0 | 0.3 | GO:0048406 | nerve growth factor binding(GO:0048406) |
0.0 | 3.3 | GO:0001948 | glycoprotein binding(GO:0001948) |
0.0 | 0.1 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
0.0 | 1.0 | GO:0048365 | Rac GTPase binding(GO:0048365) |
0.0 | 0.1 | GO:0019767 | IgE receptor activity(GO:0019767) |
0.0 | 0.1 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
0.0 | 0.9 | GO:0001221 | transcription cofactor binding(GO:0001221) |
0.0 | 0.1 | GO:0042609 | CD4 receptor binding(GO:0042609) |
0.0 | 0.2 | GO:0016892 | endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
0.0 | 0.1 | GO:0050692 | DBD domain binding(GO:0050692) |
0.0 | 0.5 | GO:0008143 | poly(A) binding(GO:0008143) |
0.0 | 0.1 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
0.0 | 1.1 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
0.0 | 0.4 | GO:0004029 | aldehyde dehydrogenase (NAD) activity(GO:0004029) |
0.0 | 0.1 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
0.0 | 0.1 | GO:0019808 | polyamine binding(GO:0019808) |
0.0 | 0.1 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.0 | 0.1 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
0.0 | 0.1 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
0.0 | 0.4 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
0.0 | 0.4 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
0.0 | 0.1 | GO:0019763 | immunoglobulin receptor activity(GO:0019763) |
0.0 | 0.1 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.0 | 0.1 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
0.0 | 0.1 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
0.0 | 0.3 | GO:0008432 | JUN kinase binding(GO:0008432) |
0.0 | 0.1 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.0 | 0.3 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
0.0 | 0.2 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
0.0 | 0.1 | GO:0016015 | morphogen activity(GO:0016015) |
0.0 | 0.1 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.0 | 0.1 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.0 | 0.4 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
0.0 | 0.5 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
0.0 | 0.2 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
0.0 | 0.1 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.0 | 0.1 | GO:0019976 | interleukin-2 binding(GO:0019976) |
0.0 | 2.2 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
0.0 | 0.0 | GO:0001884 | pyrimidine nucleoside binding(GO:0001884) |
0.0 | 0.1 | GO:0032557 | pyrimidine ribonucleotide binding(GO:0032557) |
0.0 | 0.5 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
0.0 | 0.1 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.0 | 0.2 | GO:0031628 | opioid receptor binding(GO:0031628) |
0.0 | 0.1 | GO:0031748 | D1 dopamine receptor binding(GO:0031748) |
0.0 | 0.1 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
0.0 | 0.2 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
0.0 | 0.1 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
0.0 | 0.1 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.0 | 0.2 | GO:0008494 | translation activator activity(GO:0008494) |
0.0 | 0.5 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
0.0 | 0.2 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
0.0 | 0.2 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
0.0 | 0.4 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
0.0 | 1.1 | GO:0016860 | intramolecular oxidoreductase activity(GO:0016860) |
0.0 | 0.0 | GO:0015182 | L-asparagine transmembrane transporter activity(GO:0015182) L-glutamine transmembrane transporter activity(GO:0015186) |
0.0 | 0.1 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
0.0 | 0.1 | GO:0015216 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) |
0.0 | 0.2 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
0.0 | 0.3 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
0.0 | 0.5 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
0.0 | 0.2 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.0 | 0.2 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
0.0 | 0.1 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
0.0 | 0.1 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
0.0 | 0.1 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
0.0 | 0.1 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
0.0 | 0.1 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) |
0.0 | 0.1 | GO:0036122 | BMP binding(GO:0036122) |
0.0 | 0.1 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
0.0 | 0.1 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
0.0 | 0.1 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.0 | 0.2 | GO:0001848 | complement binding(GO:0001848) |
0.0 | 0.1 | GO:0045340 | mercury ion binding(GO:0045340) |
0.0 | 0.1 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
0.0 | 0.1 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.0 | 0.1 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
0.0 | 0.2 | GO:0044213 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) intronic transcription regulatory region DNA binding(GO:0044213) |
0.0 | 0.1 | GO:0004457 | lactate dehydrogenase activity(GO:0004457) |
0.0 | 0.5 | GO:0004115 | 3',5'-cyclic-AMP phosphodiesterase activity(GO:0004115) |
0.0 | 0.8 | GO:0004812 | aminoacyl-tRNA ligase activity(GO:0004812) |
0.0 | 1.2 | GO:0019842 | vitamin binding(GO:0019842) |
0.0 | 0.2 | GO:0070402 | NADPH binding(GO:0070402) |
0.0 | 0.2 | GO:0009881 | photoreceptor activity(GO:0009881) |
0.0 | 0.1 | GO:0010861 | thyroid hormone receptor activator activity(GO:0010861) |
0.0 | 1.5 | GO:0030674 | protein binding, bridging(GO:0030674) |
0.0 | 0.2 | GO:0017166 | vinculin binding(GO:0017166) |
0.0 | 0.2 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.0 | 0.2 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.0 | 0.1 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
0.0 | 0.1 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
0.0 | 0.5 | GO:0016790 | thiolester hydrolase activity(GO:0016790) |
0.0 | 0.3 | GO:0048038 | quinone binding(GO:0048038) |
0.0 | 0.1 | GO:0015226 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
0.0 | 1.8 | GO:0030165 | PDZ domain binding(GO:0030165) |
0.0 | 0.1 | GO:0030957 | Tat protein binding(GO:0030957) |
0.0 | 0.1 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
0.0 | 0.1 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.0 | 0.0 | GO:0047751 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) cholestenone 5-alpha-reductase activity(GO:0047751) |
0.0 | 0.1 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
0.0 | 0.1 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
0.0 | 0.1 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.0 | 0.6 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
0.0 | 0.1 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.0 | 0.2 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
0.0 | 0.1 | GO:0016653 | oxidoreductase activity, acting on NAD(P)H, heme protein as acceptor(GO:0016653) |
0.0 | 0.0 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
0.0 | 0.1 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
0.0 | 0.4 | GO:0030515 | snoRNA binding(GO:0030515) |
0.0 | 0.1 | GO:0005345 | purine nucleobase transmembrane transporter activity(GO:0005345) pyrimidine nucleobase transmembrane transporter activity(GO:0005350) nucleobase transmembrane transporter activity(GO:0015205) |
0.0 | 0.2 | GO:0008413 | 8-oxo-7,8-dihydroguanosine triphosphate pyrophosphatase activity(GO:0008413) |
0.0 | 0.1 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.0 | 3.1 | GO:0005096 | GTPase activator activity(GO:0005096) |
0.0 | 0.3 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
0.0 | 0.0 | GO:0003985 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
0.0 | 0.1 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
0.0 | 0.3 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
0.0 | 0.5 | GO:0043531 | ADP binding(GO:0043531) |
0.0 | 0.1 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
0.0 | 0.1 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
0.0 | 0.1 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
0.0 | 0.2 | GO:0000400 | four-way junction DNA binding(GO:0000400) |
0.0 | 0.3 | GO:0036002 | pre-mRNA binding(GO:0036002) |
0.0 | 0.0 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
0.0 | 0.1 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
0.0 | 0.0 | GO:0000403 | Y-form DNA binding(GO:0000403) |
0.0 | 0.8 | GO:0019208 | phosphatase regulator activity(GO:0019208) |
0.0 | 0.2 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.0 | 0.0 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.0 | 0.2 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
0.0 | 0.2 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
0.0 | 0.1 | GO:0039706 | co-receptor binding(GO:0039706) |
0.0 | 0.0 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.0 | 0.0 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
0.0 | 0.1 | GO:0009378 | four-way junction helicase activity(GO:0009378) |
0.0 | 0.0 | GO:0016823 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
0.0 | 0.1 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.0 | 0.3 | GO:0001540 | beta-amyloid binding(GO:0001540) |
0.0 | 0.0 | GO:0045503 | dynein light chain binding(GO:0045503) |
0.0 | 0.0 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
0.0 | 0.1 | GO:0015651 | quaternary ammonium group transmembrane transporter activity(GO:0015651) |
0.0 | 0.7 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
0.0 | 0.0 | GO:0032564 | dATP binding(GO:0032564) |
0.0 | 0.1 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
0.0 | 0.1 | GO:0070991 | medium-chain-acyl-CoA dehydrogenase activity(GO:0070991) |
0.0 | 0.1 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
0.0 | 0.2 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
0.0 | 0.3 | GO:0052743 | inositol tetrakisphosphate phosphatase activity(GO:0052743) |
0.0 | 0.3 | GO:0031543 | peptidyl-proline dioxygenase activity(GO:0031543) |
0.0 | 0.1 | GO:0050544 | icosanoid binding(GO:0050542) icosatetraenoic acid binding(GO:0050543) arachidonic acid binding(GO:0050544) fatty acid derivative binding(GO:1901567) |
0.0 | 0.0 | GO:0046848 | hydroxyapatite binding(GO:0046848) |
0.0 | 0.0 | GO:0042301 | phosphate ion binding(GO:0042301) |
0.0 | 0.1 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
0.0 | 0.0 | GO:0008579 | JUN kinase phosphatase activity(GO:0008579) |
0.0 | 0.2 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
0.0 | 0.4 | GO:0030145 | manganese ion binding(GO:0030145) |
0.0 | 0.2 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
0.0 | 0.1 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.0 | 0.0 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
0.0 | 0.0 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
0.0 | 0.0 | GO:0031433 | telethonin binding(GO:0031433) |
0.0 | 0.7 | GO:0016209 | antioxidant activity(GO:0016209) |
0.0 | 0.1 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.0 | 0.1 | GO:0005534 | galactose binding(GO:0005534) |
0.0 | 0.1 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
0.0 | 0.0 | GO:0035175 | histone kinase activity (H3-S10 specific)(GO:0035175) |
0.0 | 0.1 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
0.0 | 0.0 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) |
0.0 | 0.1 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
0.0 | 0.0 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
0.0 | 0.0 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.0 | 0.5 | GO:0005546 | phosphatidylinositol-4,5-bisphosphate binding(GO:0005546) |
0.0 | 0.1 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.0 | 0.4 | GO:0042605 | peptide antigen binding(GO:0042605) |
0.0 | 0.0 | GO:0046870 | cadmium ion binding(GO:0046870) |
0.0 | 0.0 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
0.0 | 0.0 | GO:0034584 | piRNA binding(GO:0034584) |
0.0 | 0.0 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.0 | 0.0 | GO:0030021 | extracellular matrix structural constituent conferring compression resistance(GO:0030021) structural constituent of tooth enamel(GO:0030345) |
0.0 | 0.1 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
0.0 | 0.0 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
0.0 | 0.2 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.0 | 0.0 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.0 | 0.1 | GO:0005402 | cation:sugar symporter activity(GO:0005402) |
0.0 | 0.0 | GO:0004967 | glucagon receptor activity(GO:0004967) |
0.0 | 0.2 | GO:0042166 | acetylcholine binding(GO:0042166) |
0.0 | 0.2 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
0.0 | 0.0 | GO:0043237 | laminin-1 binding(GO:0043237) |
0.0 | 0.2 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.0 | 0.1 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
0.0 | 0.1 | GO:0008061 | chitin binding(GO:0008061) |
0.0 | 0.1 | GO:0043422 | protein kinase B binding(GO:0043422) |
0.0 | 0.1 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
0.0 | 0.0 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.0 | 0.1 | GO:0001965 | G-protein alpha-subunit binding(GO:0001965) |
0.0 | 0.0 | GO:0004103 | choline kinase activity(GO:0004103) |
0.0 | 0.7 | GO:0004540 | ribonuclease activity(GO:0004540) |
0.0 | 0.2 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
0.0 | 0.0 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
0.0 | 0.1 | GO:0000146 | microfilament motor activity(GO:0000146) |
0.0 | 0.0 | GO:0052851 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
0.0 | 0.0 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.0 | 0.1 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.0 | 0.0 | GO:0016725 | oxidoreductase activity, acting on CH or CH2 groups(GO:0016725) |
0.0 | 0.1 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
0.0 | 1.8 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
0.0 | 0.1 | GO:0034582 | pinocarveol dehydrogenase activity(GO:0018446) chloral hydrate dehydrogenase activity(GO:0018447) hydroxymethylmethylsilanediol oxidase activity(GO:0018448) 1-phenylethanol dehydrogenase activity(GO:0018449) myrtenol dehydrogenase activity(GO:0018450) cis-1,2-dihydroxy-1,2-dihydro-8-carboxynaphthalene dehydrogenase activity(GO:0034522) 3-hydroxy-4-methyloctanoyl-CoA dehydrogenase activity(GO:0034582) 2-hydroxy-4-isopropenylcyclohexane-1-carboxyl-CoA dehydrogenase activity(GO:0034778) cis-9,10-dihydroanthracene-9,10-diol dehydrogenase activity(GO:0034817) citronellol dehydrogenase activity(GO:0034821) naphthyl-2-hydroxymethyl-succinyl-CoA dehydrogenase activity(GO:0034847) 2,4,4-trimethyl-1-pentanol dehydrogenase activity(GO:0034863) 2,4,4-trimethyl-3-hydroxypentanoyl-CoA dehydrogenase activity(GO:0034868) 1-hydroxy-4,4-dimethylpentan-3-one dehydrogenase activity(GO:0034871) endosulfan diol dehydrogenase activity(GO:0034891) endosulfan hydroxyether dehydrogenase activity(GO:0034901) 3-hydroxy-2-methylhexanoyl-CoA dehydrogenase activity(GO:0034918) 3-hydroxy-2,6-dimethyl-5-methylene-heptanoyl-CoA dehydrogenase activity(GO:0034944) versicolorin reductase activity(GO:0042469) ketoreductase activity(GO:0045703) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 0.2 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
0.2 | 7.4 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.1 | 1.0 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
0.1 | 2.5 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
0.1 | 1.0 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.1 | 0.1 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
0.1 | 0.5 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.1 | 1.9 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.1 | 2.7 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
0.1 | 0.1 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
0.1 | 0.2 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
0.0 | 0.3 | PID REELIN PATHWAY | Reelin signaling pathway |
0.0 | 0.4 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.0 | 0.5 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.0 | 0.0 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
0.0 | 1.1 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.0 | 0.5 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
0.0 | 1.5 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.0 | 1.4 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
0.0 | 1.0 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
0.0 | 0.9 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
0.0 | 0.6 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
0.0 | 0.3 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
0.0 | 1.2 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
0.0 | 1.0 | PID AP1 PATHWAY | AP-1 transcription factor network |
0.0 | 1.9 | PID CMYB PATHWAY | C-MYB transcription factor network |
0.0 | 0.8 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
0.0 | 0.8 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
0.0 | 0.3 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.0 | 0.1 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.0 | 0.8 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
0.0 | 0.1 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.0 | 0.1 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.0 | 0.3 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.0 | 0.7 | PID FGF PATHWAY | FGF signaling pathway |
0.0 | 0.6 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.0 | 0.2 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
0.0 | 0.1 | PID SHP2 PATHWAY | SHP2 signaling |
0.0 | 0.1 | PID CDC42 PATHWAY | CDC42 signaling events |
0.0 | 0.5 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
0.0 | 0.4 | PID RHOA PATHWAY | RhoA signaling pathway |
0.0 | 0.3 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.0 | 0.3 | PID AURORA A PATHWAY | Aurora A signaling |
0.0 | 0.1 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
0.0 | 0.6 | PID AURORA B PATHWAY | Aurora B signaling |
0.0 | 0.4 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
0.0 | 0.3 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
0.0 | 0.5 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
0.0 | 0.8 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
0.0 | 0.2 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.0 | 0.3 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
0.0 | 0.2 | PID CD40 PATHWAY | CD40/CD40L signaling |
0.0 | 0.2 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.0 | 0.1 | PID EPO PATHWAY | EPO signaling pathway |
0.0 | 0.2 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.0 | 0.1 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.0 | 0.1 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
0.0 | 0.4 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
0.0 | 0.1 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.0 | 0.4 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
0.0 | 0.2 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.0 | 0.0 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
0.0 | 0.1 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
0.0 | 0.4 | PID IL4 2PATHWAY | IL4-mediated signaling events |
0.0 | 0.0 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.0 | 0.3 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
0.0 | 0.1 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.0 | 0.1 | PID ENDOTHELIN PATHWAY | Endothelins |
0.0 | 0.1 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.0 | 0.1 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.0 | 0.0 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
0.0 | 0.2 | PID MYC PATHWAY | C-MYC pathway |
0.0 | 0.2 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.0 | 0.1 | PID ATR PATHWAY | ATR signaling pathway |
0.0 | 0.1 | PID TNF PATHWAY | TNF receptor signaling pathway |
0.0 | 0.1 | PID IL2 1PATHWAY | IL2-mediated signaling events |
0.0 | 0.1 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.0 | 0.4 | PID E2F PATHWAY | E2F transcription factor network |
0.0 | 0.1 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
0.0 | 0.1 | PID BCR 5PATHWAY | BCR signaling pathway |
0.0 | 0.1 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
0.0 | 0.1 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.0 | 0.1 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.0 | 0.1 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 5.4 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.3 | 0.8 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
0.2 | 2.3 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
0.2 | 1.4 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
0.1 | 0.4 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
0.1 | 1.1 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
0.1 | 1.0 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.1 | 0.6 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
0.1 | 0.4 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.1 | 1.1 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.1 | 0.7 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
0.1 | 1.3 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
0.1 | 0.9 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
0.1 | 0.1 | REACTOME SIGNALING BY ERBB2 | Genes involved in Signaling by ERBB2 |
0.1 | 0.8 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
0.1 | 1.2 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
0.1 | 1.6 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
0.1 | 0.6 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.1 | 2.3 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
0.1 | 0.6 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.1 | 0.8 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.1 | 0.9 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
0.1 | 1.4 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.1 | 0.3 | REACTOME ARMS MEDIATED ACTIVATION | Genes involved in ARMS-mediated activation |
0.0 | 0.5 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
0.0 | 0.2 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
0.0 | 0.0 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
0.0 | 0.3 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
0.0 | 1.9 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
0.0 | 0.8 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.0 | 0.6 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
0.0 | 0.4 | REACTOME ACYL CHAIN REMODELLING OF PE | Genes involved in Acyl chain remodelling of PE |
0.0 | 0.0 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
0.0 | 0.5 | REACTOME SHC RELATED EVENTS | Genes involved in SHC-related events |
0.0 | 0.7 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
0.0 | 0.6 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
0.0 | 0.3 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.0 | 0.5 | REACTOME AMYLOIDS | Genes involved in Amyloids |
0.0 | 0.2 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.0 | 0.4 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.0 | 0.3 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
0.0 | 0.6 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
0.0 | 0.9 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
0.0 | 0.7 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.0 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
0.0 | 0.2 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
0.0 | 0.3 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
0.0 | 0.2 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.0 | 0.4 | REACTOME EICOSANOID LIGAND BINDING RECEPTORS | Genes involved in Eicosanoid ligand-binding receptors |
0.0 | 0.7 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
0.0 | 0.4 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.0 | 0.0 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
0.0 | 0.1 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
0.0 | 0.5 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.0 | 0.7 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
0.0 | 0.2 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
0.0 | 1.4 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
0.0 | 0.6 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
0.0 | 0.1 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.0 | 0.2 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
0.0 | 0.2 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
0.0 | 0.6 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
0.0 | 0.4 | REACTOME RNA POL III CHAIN ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
0.0 | 0.7 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.0 | 0.6 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
0.0 | 0.4 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.0 | 0.8 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
0.0 | 0.2 | REACTOME P130CAS LINKAGE TO MAPK SIGNALING FOR INTEGRINS | Genes involved in p130Cas linkage to MAPK signaling for integrins |
0.0 | 0.2 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
0.0 | 0.2 | REACTOME PKA MEDIATED PHOSPHORYLATION OF CREB | Genes involved in PKA-mediated phosphorylation of CREB |
0.0 | 0.3 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
0.0 | 1.0 | REACTOME RESPONSE TO ELEVATED PLATELET CYTOSOLIC CA2 | Genes involved in Response to elevated platelet cytosolic Ca2+ |
0.0 | 0.4 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
0.0 | 0.2 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
0.0 | 0.5 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
0.0 | 0.1 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
0.0 | 0.1 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
0.0 | 0.1 | REACTOME CA DEPENDENT EVENTS | Genes involved in Ca-dependent events |
0.0 | 0.1 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
0.0 | 0.1 | REACTOME FGFR LIGAND BINDING AND ACTIVATION | Genes involved in FGFR ligand binding and activation |
0.0 | 0.2 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.0 | 0.1 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
0.0 | 0.1 | REACTOME IL 3 5 AND GM CSF SIGNALING | Genes involved in Interleukin-3, 5 and GM-CSF signaling |
0.0 | 0.1 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.0 | 0.0 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
0.0 | 0.1 | REACTOME CTLA4 INHIBITORY SIGNALING | Genes involved in CTLA4 inhibitory signaling |
0.0 | 0.1 | REACTOME SIGNALING BY FGFR IN DISEASE | Genes involved in Signaling by FGFR in disease |
0.0 | 0.1 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
0.0 | 0.2 | REACTOME EARLY PHASE OF HIV LIFE CYCLE | Genes involved in Early Phase of HIV Life Cycle |
0.0 | 0.1 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
0.0 | 0.3 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
0.0 | 0.0 | REACTOME ACYL CHAIN REMODELLING OF PC | Genes involved in Acyl chain remodelling of PC |
0.0 | 0.3 | REACTOME DOWNSTREAM SIGNAL TRANSDUCTION | Genes involved in Downstream signal transduction |
0.0 | 1.5 | REACTOME MRNA PROCESSING | Genes involved in mRNA Processing |
0.0 | 0.2 | REACTOME PRESYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
0.0 | 0.2 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
0.0 | 0.2 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
0.0 | 0.1 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
0.0 | 0.1 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.0 | 0.2 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
0.0 | 0.2 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
0.0 | 0.2 | REACTOME G1 PHASE | Genes involved in G1 Phase |
0.0 | 0.1 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.0 | 0.0 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
0.0 | 0.1 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
0.0 | 0.1 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
0.0 | 0.0 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
0.0 | 0.1 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
0.0 | 0.1 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.0 | 0.0 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
0.0 | 0.1 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
0.0 | 0.1 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
0.0 | 0.1 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.0 | 0.1 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.0 | 0.2 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |