| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Hoxa7
|
ENSMUSG00000038236.6 | homeobox A7 |
|
Hoxc8
|
ENSMUSG00000001657.6 | homeobox C8 |
| CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|---|---|
| chr6_52221723_52221893 | Hoxa7 | 46 | 0.902852 | 0.84 | 3.5e-02 | Click! |
| chr6_52221470_52221659 | Hoxa7 | 290 | 0.686161 | 0.48 | 3.4e-01 | Click! |
| chr15_102987519_102987677 | Hoxc8 | 3009 | 0.107816 | 0.87 | 2.5e-02 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr12_21142640_21142894 | 2.18 |
Asap2 |
ArfGAP with SH3 domain, ankyrin repeat and PH domain 2 |
30813 |
0.16 |
| chr5_138080510_138080792 | 2.02 |
Zkscan1 |
zinc finger with KRAB and SCAN domains 1 |
4433 |
0.1 |
| chr13_117745874_117746186 | 1.75 |
4933413L06Rik |
RIKEN cDNA 4933413L06 gene |
26019 |
0.26 |
| chr18_20969991_20970173 | 1.27 |
Rnf125 |
ring finger protein 125 |
8610 |
0.21 |
| chr11_98590413_98590578 | 1.22 |
Ormdl3 |
ORM1-like 3 (S. cerevisiae) |
3127 |
0.14 |
| chr15_67420672_67420895 | 0.99 |
1700012I11Rik |
RIKEN cDNA 1700012I11 gene |
194014 |
0.03 |
| chr8_14259594_14259775 | 0.92 |
Gm26184 |
predicted gene, 26184 |
13627 |
0.23 |
| chr8_46434024_46434202 | 0.90 |
Gm45245 |
predicted gene 45245 |
18191 |
0.14 |
| chr16_26359307_26359474 | 0.86 |
Cldn1 |
claudin 1 |
1404 |
0.57 |
| chr14_70700792_70700966 | 0.86 |
Xpo7 |
exportin 7 |
7156 |
0.15 |
| chr11_101927287_101927461 | 0.81 |
Rpl27-ps2 |
ribosomal protein L27, pseudogene 2 |
12127 |
0.1 |
| chr14_65740190_65740357 | 0.81 |
Scara5 |
scavenger receptor class A, member 5 |
63796 |
0.1 |
| chr19_46138051_46138212 | 0.78 |
Pitx3 |
paired-like homeodomain transcription factor 3 |
842 |
0.48 |
| chr18_46336206_46336490 | 0.78 |
4930415P13Rik |
RIKEN cDNA 4930415P13 gene |
4081 |
0.17 |
| chr11_100836746_100836921 | 0.77 |
Stat5b |
signal transducer and activator of transcription 5B |
13705 |
0.12 |
| chr6_58611375_58611579 | 0.77 |
Abcg2 |
ATP binding cassette subfamily G member 2 (Junior blood group) |
14806 |
0.19 |
| chr13_34073322_34073568 | 0.76 |
Tubb2a |
tubulin, beta 2A class IIA |
4562 |
0.12 |
| chr6_112944047_112944200 | 0.73 |
Srgap3 |
SLIT-ROBO Rho GTPase activating protein 3 |
2631 |
0.19 |
| chr6_39241464_39242040 | 0.73 |
Gm43479 |
predicted gene 43479 |
1638 |
0.32 |
| chr8_56281836_56281987 | 0.72 |
Hpgd |
hydroxyprostaglandin dehydrogenase 15 (NAD) |
12674 |
0.23 |
| chr11_53419846_53420072 | 0.72 |
Leap2 |
liver-expressed antimicrobial peptide 2 |
3211 |
0.11 |
| chr14_31604102_31604253 | 0.71 |
Hacl1 |
2-hydroxyacyl-CoA lyase 1 |
6157 |
0.16 |
| chr5_9032113_9032264 | 0.68 |
Gm40264 |
predicted gene, 40264 |
2592 |
0.21 |
| chr10_23489676_23489827 | 0.68 |
Gm47843 |
predicted gene, 47843 |
119680 |
0.05 |
| chr2_32606655_32606830 | 0.67 |
St6galnac6 |
ST6 (alpha-N-acetyl-neuraminyl-2,3-beta-galactosyl-1,3)-N-acetylgalactosaminide alpha-2,6-sialyltransferase 6 |
219 |
0.84 |
| chr9_70935063_70935240 | 0.67 |
Lipc |
lipase, hepatic |
343 |
0.89 |
| chr7_45013798_45013975 | 0.65 |
Scaf1 |
SR-related CTD-associated factor 1 |
325 |
0.64 |
| chr1_69585481_69585632 | 0.65 |
Gm29112 |
predicted gene 29112 |
12966 |
0.22 |
| chr11_102741952_102742137 | 0.63 |
Gm16342 |
predicted gene 16342 |
9639 |
0.11 |
| chr9_46036951_46037323 | 0.63 |
Sik3 |
SIK family kinase 3 |
24137 |
0.13 |
| chr5_151137806_151137957 | 0.63 |
Stard13 |
StAR-related lipid transfer (START) domain containing 13 |
10338 |
0.25 |
| chr8_71699244_71699423 | 0.62 |
B3gnt3 |
UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 3 |
2456 |
0.13 |
| chr19_20657323_20657499 | 0.62 |
Aldh1a1 |
aldehyde dehydrogenase family 1, subfamily A1 |
55450 |
0.13 |
| chr18_15330500_15330684 | 0.62 |
E430002N23Rik |
RIKEN cDNA E430002N23 gene |
17893 |
0.18 |
| chr1_51751367_51751637 | 0.61 |
Gm28055 |
predicted gene 28055 |
4559 |
0.23 |
| chr10_31644816_31644968 | 0.61 |
Gm8793 |
predicted gene 8793 |
5734 |
0.23 |
| chr6_12465944_12466328 | 0.60 |
Thsd7a |
thrombospondin, type I, domain containing 7A |
46775 |
0.18 |
| chr5_52980027_52980180 | 0.60 |
Gm30301 |
predicted gene, 30301 |
1934 |
0.27 |
| chr19_30092253_30092507 | 0.60 |
Uhrf2 |
ubiquitin-like, containing PHD and RING finger domains 2 |
419 |
0.86 |
| chr7_112197041_112197260 | 0.58 |
Mical2 |
microtubule associated monooxygenase, calponin and LIM domain containing 2 |
28706 |
0.2 |
| chr13_30084875_30085042 | 0.58 |
Gm47259 |
predicted gene, 47259 |
13535 |
0.16 |
| chr6_135133072_135133223 | 0.58 |
Gm29803 |
predicted gene, 29803 |
1305 |
0.32 |
| chr4_141304942_141305506 | 0.58 |
Epha2 |
Eph receptor A2 |
2817 |
0.15 |
| chr3_133765600_133766533 | 0.57 |
Gm6135 |
prediticted gene 6135 |
25438 |
0.2 |
| chr11_90184166_90184514 | 0.57 |
n-R5s72 |
nuclear encoded rRNA 5S 72 |
787 |
0.57 |
| chr3_108701624_108701775 | 0.57 |
Gpsm2 |
G-protein signalling modulator 2 (AGS3-like, C. elegans) |
814 |
0.52 |
| chr5_89033271_89033463 | 0.56 |
Slc4a4 |
solute carrier family 4 (anion exchanger), member 4 |
5275 |
0.32 |
| chr18_66520076_66520249 | 0.56 |
Gm50157 |
predicted gene, 50157 |
2810 |
0.16 |
| chr4_147452443_147452608 | 0.56 |
Vmn2r-ps19 |
vomeronasal 2, receptor, pseudogene 19 |
8145 |
0.13 |
| chr11_102229092_102229243 | 0.56 |
Hdac5 |
histone deacetylase 5 |
957 |
0.28 |
| chr14_119831250_119831463 | 0.55 |
4930404K13Rik |
RIKEN cDNA 4930404K13 gene |
32378 |
0.19 |
| chr7_49764294_49764503 | 0.55 |
Htatip2 |
HIV-1 Tat interactive protein 2 |
5245 |
0.23 |
| chr2_172448719_172448909 | 0.54 |
Rtf2 |
replication termination factor 2 |
4163 |
0.15 |
| chr2_165869197_165869348 | 0.54 |
Zmynd8 |
zinc finger, MYND-type containing 8 |
6505 |
0.15 |
| chr19_39005964_39006115 | 0.54 |
Cyp2c55 |
cytochrome P450, family 2, subfamily c, polypeptide 55 |
980 |
0.38 |
| chr11_49088297_49088883 | 0.53 |
Gm12188 |
predicted gene 12188 |
47 |
0.79 |
| chr2_165921904_165922055 | 0.53 |
Gm11461 |
predicted gene 11461 |
3862 |
0.16 |
| chr19_61057720_61057890 | 0.53 |
Gm22520 |
predicted gene, 22520 |
44260 |
0.12 |
| chr6_93153422_93153582 | 0.53 |
Gm5313 |
predicted gene 5313 |
15512 |
0.21 |
| chr6_121874198_121874349 | 0.53 |
Mug1 |
murinoglobulin 1 |
11304 |
0.19 |
| chr2_43592382_43592533 | 0.53 |
Kynu |
kynureninase |
7158 |
0.3 |
| chr14_17864277_17864546 | 0.51 |
Gm48320 |
predicted gene, 48320 |
93289 |
0.08 |
| chr19_36629275_36629447 | 0.51 |
Hectd2os |
Hectd2, opposite strand |
3337 |
0.28 |
| chr17_18321520_18321874 | 0.51 |
Vmn2r93 |
vomeronasal 2, receptor 93 |
23598 |
0.19 |
| chr1_181000299_181000450 | 0.51 |
Ephx1 |
epoxide hydrolase 1, microsomal |
4204 |
0.11 |
| chrX_100480103_100480280 | 0.51 |
Igbp1 |
immunoglobulin (CD79A) binding protein 1 |
14100 |
0.15 |
| chr3_54522568_54522756 | 0.51 |
Gm5641 |
predicted gene 5641 |
41202 |
0.17 |
| chr11_88618341_88618520 | 0.51 |
Msi2 |
musashi RNA-binding protein 2 |
28283 |
0.2 |
| chr3_19997345_19997496 | 0.51 |
Cp |
ceruloplasmin |
8268 |
0.18 |
| chr4_43499888_43500064 | 0.50 |
Arhgef39 |
Rho guanine nucleotide exchange factor (GEF) 39 |
281 |
0.77 |
| chr3_133750379_133750596 | 0.50 |
Gm6135 |
prediticted gene 6135 |
41017 |
0.15 |
| chr18_6502200_6502357 | 0.50 |
Epc1 |
enhancer of polycomb homolog 1 |
11422 |
0.16 |
| chr15_82404193_82404671 | 0.49 |
Cyp2d10 |
cytochrome P450, family 2, subfamily d, polypeptide 10 |
1535 |
0.14 |
| chr15_82451710_82451871 | 0.49 |
Cyp2d9 |
cytochrome P450, family 2, subfamily d, polypeptide 9 |
544 |
0.36 |
| chr10_96232437_96233110 | 0.49 |
4930459C07Rik |
RIKEN cDNA 4930459C07 gene |
6566 |
0.21 |
| chr3_89481624_89481785 | 0.49 |
Pmvk |
phosphomevalonate kinase |
22133 |
0.1 |
| chr11_98972114_98972272 | 0.49 |
Gjd3 |
gap junction protein, delta 3 |
10823 |
0.1 |
| chr9_108296266_108296431 | 0.49 |
Amt |
aminomethyltransferase |
505 |
0.57 |
| chr10_100031523_100031679 | 0.49 |
Kitl |
kit ligand |
15685 |
0.19 |
| chr2_67956563_67957019 | 0.48 |
Gm37964 |
predicted gene, 37964 |
58195 |
0.14 |
| chr10_93196295_93196461 | 0.48 |
Cdk17 |
cyclin-dependent kinase 17 |
10609 |
0.2 |
| chr12_28636385_28636550 | 0.48 |
Rps7 |
ribosomal protein S7 |
514 |
0.71 |
| chr6_16701529_16701791 | 0.48 |
Gm36669 |
predicted gene, 36669 |
75864 |
0.11 |
| chr10_61135528_61135708 | 0.48 |
Gm44308 |
predicted gene, 44308 |
10383 |
0.14 |
| chr9_67840552_67841087 | 0.48 |
Vps13c |
vacuolar protein sorting 13C |
407 |
0.85 |
| chr6_88041389_88041579 | 0.48 |
Gm44187 |
predicted gene, 44187 |
983 |
0.39 |
| chr17_88614606_88614762 | 0.47 |
Gm9406 |
predicted gene 9406 |
6140 |
0.17 |
| chr15_26355371_26355533 | 0.47 |
Marchf11 |
membrane associated ring-CH-type finger 11 |
32267 |
0.24 |
| chr7_68306877_68307191 | 0.47 |
Fam169b |
family with sequence similarity 169, member B |
6921 |
0.14 |
| chr5_145873496_145873886 | 0.47 |
Cyp3a11 |
cytochrome P450, family 3, subfamily a, polypeptide 11 |
3000 |
0.22 |
| chr11_86917162_86917343 | 0.47 |
Ypel2 |
yippee like 2 |
54772 |
0.11 |
| chr14_11716901_11717053 | 0.46 |
Gm48602 |
predicted gene, 48602 |
50966 |
0.16 |
| chr13_95326893_95327258 | 0.46 |
Zbed3 |
zinc finger, BED type containing 3 |
308 |
0.86 |
| chr4_124809297_124809476 | 0.46 |
Mtf1 |
metal response element binding transcription factor 1 |
6708 |
0.1 |
| chr13_111804301_111804479 | 0.46 |
Map3k1 |
mitogen-activated protein kinase kinase kinase 1 |
3925 |
0.17 |
| chr8_106589214_106589384 | 0.45 |
1110028F18Rik |
RIKEN cDNA 1110028F18 gene |
2156 |
0.27 |
| chr6_120318643_120318978 | 0.45 |
B4galnt3 |
beta-1,4-N-acetyl-galactosaminyl transferase 3 |
24251 |
0.15 |
| chr3_146778044_146778430 | 0.45 |
Prkacb |
protein kinase, cAMP dependent, catalytic, beta |
3179 |
0.23 |
| chr4_115601507_115601664 | 0.45 |
Cyp4a32 |
cytochrome P450, family 4, subfamily a, polypeptide 32 |
610 |
0.63 |
| chr5_105730925_105731082 | 0.44 |
Lrrc8d |
leucine rich repeat containing 8D |
386 |
0.88 |
| chr13_93629307_93629685 | 0.44 |
Gm15622 |
predicted gene 15622 |
4114 |
0.18 |
| chr19_24153611_24153973 | 0.44 |
Gm50308 |
predicted gene, 50308 |
278 |
0.9 |
| chrX_108621044_108621195 | 0.44 |
Gm379 |
predicted gene 379 |
43336 |
0.19 |
| chr6_94158246_94158403 | 0.44 |
Magi1 |
membrane associated guanylate kinase, WW and PDZ domain containing 1 |
124701 |
0.06 |
| chr13_93624235_93624413 | 0.44 |
Gm15622 |
predicted gene 15622 |
1058 |
0.48 |
| chr16_6366127_6366312 | 0.44 |
Rbfox1 |
RNA binding protein, fox-1 homolog (C. elegans) 1 |
17081 |
0.31 |
| chr9_48738986_48739137 | 0.43 |
Zbtb16 |
zinc finger and BTB domain containing 16 |
96884 |
0.07 |
| chr9_57391313_57391472 | 0.43 |
Ppcdc |
phosphopantothenoylcysteine decarboxylase |
29926 |
0.12 |
| chr11_46291010_46291204 | 0.43 |
Cyfip2 |
cytoplasmic FMR1 interacting protein 2 |
20438 |
0.14 |
| chr8_88856887_88857038 | 0.43 |
Gm45504 |
predicted gene 45504 |
6112 |
0.25 |
| chr19_30096271_30096642 | 0.43 |
Uhrf2 |
ubiquitin-like, containing PHD and RING finger domains 2 |
4495 |
0.24 |
| chr4_106354190_106354378 | 0.42 |
Usp24 |
ubiquitin specific peptidase 24 |
38050 |
0.13 |
| chr12_17492687_17492998 | 0.42 |
Odc1 |
ornithine decarboxylase, structural 1 |
51952 |
0.09 |
| chr9_65302674_65302855 | 0.42 |
Gm16218 |
predicted gene 16218 |
4845 |
0.11 |
| chr12_4583826_4584201 | 0.42 |
Gm48610 |
predicted gene, 48610 |
7257 |
0.13 |
| chr19_3864646_3865022 | 0.42 |
Gm50383 |
predicted gene, 50383 |
2839 |
0.13 |
| chr3_36864586_36864747 | 0.42 |
4932438A13Rik |
RIKEN cDNA 4932438A13 gene |
197 |
0.95 |
| chr16_58331456_58331620 | 0.41 |
Gm37825 |
predicted gene, 37825 |
12467 |
0.22 |
| chr2_45443502_45443687 | 0.41 |
Gm13479 |
predicted gene 13479 |
86329 |
0.09 |
| chr1_156056827_156057192 | 0.41 |
Tor1aip2 |
torsin A interacting protein 2 |
6204 |
0.17 |
| chr5_139536351_139536528 | 0.41 |
Uncx |
UNC homeobox |
7055 |
0.17 |
| chr3_88496170_88496337 | 0.41 |
Lmna |
lamin A |
2941 |
0.11 |
| chr6_97871999_97872401 | 0.41 |
Gm15531 |
predicted gene 15531 |
18339 |
0.23 |
| chr5_89451503_89451828 | 0.41 |
Gc |
vitamin D binding protein |
6233 |
0.25 |
| chr4_26470101_26470279 | 0.41 |
Gm11903 |
predicted gene 11903 |
27729 |
0.19 |
| chr7_25448767_25449204 | 0.41 |
Gm15495 |
predicted gene 15495 |
5522 |
0.11 |
| chr15_67045551_67045755 | 0.41 |
Gm31342 |
predicted gene, 31342 |
5595 |
0.25 |
| chr15_77293251_77293402 | 0.41 |
Rbfox2 |
RNA binding protein, fox-1 homolog (C. elegans) 2 |
13279 |
0.15 |
| chr8_36720734_36721068 | 0.41 |
Dlc1 |
deleted in liver cancer 1 |
12153 |
0.29 |
| chr10_40077940_40078315 | 0.41 |
Slc16a10 |
solute carrier family 16 (monocarboxylic acid transporters), member 10 |
1522 |
0.32 |
| chr14_73174671_73174837 | 0.41 |
Rcbtb2 |
regulator of chromosome condensation (RCC1) and BTB (POZ) domain containing protein 2 |
303 |
0.88 |
| chr1_63136268_63136443 | 0.40 |
Ndufs1 |
NADH:ubiquinone oxidoreductase core subunit S1 |
8606 |
0.09 |
| chr7_48823990_48824190 | 0.40 |
Csrp3 |
cysteine and glycine-rich protein 3 |
15470 |
0.14 |
| chr1_165609107_165609258 | 0.40 |
Mpzl1 |
myelin protein zero-like 1 |
364 |
0.78 |
| chr1_69108268_69108432 | 0.40 |
Erbb4 |
erb-b2 receptor tyrosine kinase 4 |
291 |
0.88 |
| chr5_150174001_150174152 | 0.40 |
Fry |
FRY microtubule binding protein |
22390 |
0.18 |
| chr7_80134260_80134421 | 0.40 |
Idh2 |
isocitrate dehydrogenase 2 (NADP+), mitochondrial |
18948 |
0.1 |
| chr11_43783562_43783743 | 0.40 |
Ttc1 |
tetratricopeptide repeat domain 1 |
35644 |
0.16 |
| chr17_88605968_88606119 | 0.40 |
Gm9406 |
predicted gene 9406 |
2501 |
0.24 |
| chr5_62640418_62640632 | 0.40 |
Arap2 |
ArfGAP with RhoGAP domain, ankyrin repeat and PH domain 2 |
1614 |
0.41 |
| chr18_56607212_56607383 | 0.40 |
Gm50283 |
predicted gene, 50283 |
6362 |
0.14 |
| chr4_58148098_58148270 | 0.40 |
Svep1 |
sushi, von Willebrand factor type A, EGF and pentraxin domain containing 1 |
58412 |
0.14 |
| chr12_4526866_4527037 | 0.39 |
Gm31938 |
predicted gene, 31938 |
2838 |
0.19 |
| chr11_78137421_78137589 | 0.39 |
Gm12571 |
predicted gene 12571 |
11933 |
0.07 |
| chr14_8302836_8303294 | 0.39 |
Fam107a |
family with sequence similarity 107, member A |
6712 |
0.2 |
| chr10_99600138_99600289 | 0.39 |
Gm20110 |
predicted gene, 20110 |
8958 |
0.19 |
| chr8_93253165_93253392 | 0.39 |
Gm45727 |
predicted gene 45727 |
2103 |
0.24 |
| chr18_56399543_56399729 | 0.39 |
Gramd3 |
GRAM domain containing 3 |
701 |
0.7 |
| chr17_5049254_5049572 | 0.38 |
Arid1b |
AT rich interactive domain 1B (SWI-like) |
8835 |
0.26 |
| chr6_108102509_108102711 | 0.38 |
Sumf1 |
sulfatase modifying factor 1 |
24453 |
0.18 |
| chr9_69327081_69327428 | 0.38 |
Gm15511 |
predicted gene 15511 |
36993 |
0.14 |
| chr11_98864073_98864363 | 0.38 |
Wipf2 |
WAS/WASL interacting protein family, member 2 |
101 |
0.94 |
| chr16_24039400_24039567 | 0.38 |
Gm49518 |
predicted gene, 49518 |
423 |
0.83 |
| chr9_112123067_112123261 | 0.38 |
Mir128-2 |
microRNA 128-2 |
4453 |
0.29 |
| chr8_20550810_20551171 | 0.38 |
Gm21182 |
predicted gene, 21182 |
6496 |
0.19 |
| chr5_146315505_146315741 | 0.37 |
Cdk8 |
cyclin-dependent kinase 8 |
19258 |
0.16 |
| chr7_30095803_30095954 | 0.37 |
Zfp260 |
zinc finger protein 260 |
693 |
0.43 |
| chr11_78846905_78847063 | 0.37 |
Lyrm9 |
LYR motif containing 9 |
20355 |
0.15 |
| chr6_121872993_121873786 | 0.37 |
Mug1 |
murinoglobulin 1 |
12188 |
0.19 |
| chr7_113219987_113220140 | 0.37 |
Arntl |
aryl hydrocarbon receptor nuclear translocator-like |
12506 |
0.21 |
| chr5_147469423_147469844 | 0.37 |
Pan3 |
PAN3 poly(A) specific ribonuclease subunit |
16344 |
0.12 |
| chr3_131489084_131489522 | 0.37 |
Sgms2 |
sphingomyelin synthase 2 |
1176 |
0.58 |
| chr19_24270105_24270479 | 0.37 |
Fxn |
frataxin |
7879 |
0.18 |
| chr7_100646495_100646665 | 0.37 |
Plekhb1 |
pleckstrin homology domain containing, family B (evectins) member 1 |
7211 |
0.11 |
| chr5_87030613_87030972 | 0.37 |
Gm18635 |
predicted gene, 18635 |
16632 |
0.1 |
| chr2_107628721_107628872 | 0.37 |
Gm9864 |
predicted gene 9864 |
28257 |
0.26 |
| chr15_82443168_82443376 | 0.37 |
Gm49421 |
predicted gene, 49421 |
208 |
0.81 |
| chr5_77357793_77357964 | 0.37 |
Polr2b |
polymerase (RNA) II (DNA directed) polypeptide B |
17510 |
0.13 |
| chr6_78919289_78919462 | 0.37 |
Gm29005 |
predicted gene 29005 |
6451 |
0.24 |
| chr6_5237798_5237950 | 0.37 |
Pon3 |
paraoxonase 3 |
16992 |
0.15 |
| chr16_9527007_9527182 | 0.37 |
Grin2a |
glutamate receptor, ionotropic, NMDA2A (epsilon 1) |
270239 |
0.01 |
| chr17_74395775_74396124 | 0.37 |
Slc30a6 |
solute carrier family 30 (zinc transporter), member 6 |
294 |
0.87 |
| chr6_59412258_59412432 | 0.36 |
Gprin3 |
GPRIN family member 3 |
13949 |
0.29 |
| chr1_151158026_151158565 | 0.36 |
C730036E19Rik |
RIKEN cDNA C730036E19 gene |
20261 |
0.1 |
| chr13_10443487_10443813 | 0.36 |
Gm47407 |
predicted gene, 47407 |
74037 |
0.1 |
| chr6_146730929_146731080 | 0.36 |
Stk38l |
serine/threonine kinase 38 like |
5692 |
0.17 |
| chr11_115919240_115919538 | 0.36 |
Recql5os1 |
RecQ-like 5, opposite strand 1 |
5638 |
0.09 |
| chr5_122060223_122060392 | 0.36 |
Cux2 |
cut-like homeobox 2 |
10205 |
0.14 |
| chr13_98594899_98595134 | 0.36 |
Gm4815 |
predicted gene 4815 |
18485 |
0.12 |
| chr13_30085348_30085499 | 0.36 |
Gm47259 |
predicted gene, 47259 |
13070 |
0.16 |
| chr11_80974932_80975087 | 0.36 |
Gm11416 |
predicted gene 11416 |
71785 |
0.1 |
| chr18_9708346_9708584 | 0.36 |
Colec12 |
collectin sub-family member 12 |
817 |
0.47 |
| chr2_132733042_132733214 | 0.36 |
Gm22245 |
predicted gene, 22245 |
16022 |
0.12 |
| chr10_122387308_122387658 | 0.36 |
Gm36041 |
predicted gene, 36041 |
591 |
0.79 |
| chr14_50991070_50991230 | 0.36 |
Gm49038 |
predicted gene, 49038 |
5925 |
0.08 |
| chr2_66712021_66712193 | 0.36 |
Scn7a |
sodium channel, voltage-gated, type VII, alpha |
72807 |
0.1 |
| chr14_76845807_76845966 | 0.36 |
Gm48968 |
predicted gene, 48968 |
13065 |
0.19 |
| chr9_80629501_80629676 | 0.36 |
Gm48387 |
predicted gene, 48387 |
28491 |
0.22 |
| chr19_48883437_48883771 | 0.36 |
Gm50436 |
predicted gene, 50436 |
72468 |
0.11 |
| chrX_99471005_99471231 | 0.35 |
Pja1 |
praja ring finger ubiquitin ligase 1 |
155 |
0.96 |
| chr2_24478822_24479034 | 0.35 |
Pax8 |
paired box 8 |
3329 |
0.17 |
| chr3_96541676_96541827 | 0.35 |
Gm15441 |
predicted gene 15441 |
16064 |
0.07 |
| chr3_107690573_107690757 | 0.35 |
Ahcyl1 |
S-adenosylhomocysteine hydrolase-like 1 |
5298 |
0.18 |
| chr11_116491647_116491831 | 0.35 |
Prpsap1 |
phosphoribosyl pyrophosphate synthetase-associated protein 1 |
1391 |
0.25 |
| chr7_49458254_49458469 | 0.35 |
Nav2 |
neuron navigator 2 |
7601 |
0.23 |
| chr10_127158373_127158600 | 0.35 |
B4galnt1 |
beta-1,4-N-acetyl-galactosaminyl transferase 1 |
6739 |
0.08 |
| chr11_7192407_7192598 | 0.35 |
Ccdc201 |
coiled coil domain 201 |
3933 |
0.2 |
| chr5_89353005_89353188 | 0.35 |
Gc |
vitamin D binding protein |
82532 |
0.1 |
| chr5_87018703_87019362 | 0.35 |
Gm18635 |
predicted gene, 18635 |
4872 |
0.12 |
| chr3_149088469_149088777 | 0.35 |
Gm25127 |
predicted gene, 25127 |
59691 |
0.12 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.5 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.1 | 0.7 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
| 0.1 | 0.4 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
| 0.1 | 0.8 | GO:0071830 | chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
| 0.1 | 0.3 | GO:0032789 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
| 0.1 | 0.3 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.1 | 0.5 | GO:0046618 | drug export(GO:0046618) |
| 0.1 | 0.4 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
| 0.1 | 0.7 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
| 0.1 | 0.4 | GO:0014858 | positive regulation of skeletal muscle cell proliferation(GO:0014858) |
| 0.1 | 0.3 | GO:0072367 | regulation of lipid transport by regulation of transcription from RNA polymerase II promoter(GO:0072367) |
| 0.1 | 0.2 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.1 | 0.2 | GO:0030070 | insulin processing(GO:0030070) |
| 0.1 | 0.2 | GO:0046439 | cysteine catabolic process(GO:0009093) L-cysteine catabolic process(GO:0019448) L-cysteine metabolic process(GO:0046439) |
| 0.1 | 0.2 | GO:0002282 | microglial cell activation involved in immune response(GO:0002282) |
| 0.1 | 0.3 | GO:0015691 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.1 | 0.2 | GO:0046271 | phenylpropanoid catabolic process(GO:0046271) |
| 0.1 | 0.2 | GO:1901509 | regulation of endothelial tube morphogenesis(GO:1901509) |
| 0.1 | 0.2 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
| 0.1 | 0.3 | GO:0061724 | lipophagy(GO:0061724) |
| 0.1 | 0.2 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.1 | 0.3 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
| 0.1 | 0.2 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
| 0.1 | 0.1 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
| 0.1 | 0.2 | GO:1900060 | negative regulation of ceramide biosynthetic process(GO:1900060) |
| 0.1 | 0.2 | GO:0006203 | dGTP catabolic process(GO:0006203) |
| 0.1 | 0.1 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
| 0.1 | 0.1 | GO:1904339 | negative regulation of dopaminergic neuron differentiation(GO:1904339) |
| 0.1 | 0.2 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
| 0.1 | 0.4 | GO:0007262 | STAT protein import into nucleus(GO:0007262) |
| 0.1 | 0.3 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.1 | 0.2 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
| 0.1 | 0.3 | GO:0071267 | amino acid salvage(GO:0043102) L-methionine biosynthetic process(GO:0071265) L-methionine salvage(GO:0071267) |
| 0.1 | 0.2 | GO:0060355 | positive regulation of cell adhesion molecule production(GO:0060355) |
| 0.1 | 0.3 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
| 0.1 | 0.1 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
| 0.1 | 0.2 | GO:0021564 | vagus nerve development(GO:0021564) |
| 0.1 | 0.2 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
| 0.1 | 0.2 | GO:0032345 | negative regulation of aldosterone metabolic process(GO:0032345) negative regulation of aldosterone biosynthetic process(GO:0032348) negative regulation of cortisol biosynthetic process(GO:2000065) |
| 0.1 | 0.2 | GO:0033026 | negative regulation of mast cell apoptotic process(GO:0033026) |
| 0.1 | 0.2 | GO:0021553 | olfactory nerve development(GO:0021553) |
| 0.1 | 0.2 | GO:0070777 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
| 0.1 | 0.2 | GO:0006768 | biotin metabolic process(GO:0006768) |
| 0.1 | 0.5 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
| 0.1 | 0.5 | GO:0090051 | negative regulation of cell migration involved in sprouting angiogenesis(GO:0090051) |
| 0.0 | 0.2 | GO:0042524 | negative regulation of tyrosine phosphorylation of Stat5 protein(GO:0042524) |
| 0.0 | 0.1 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
| 0.0 | 0.1 | GO:0010046 | response to mycotoxin(GO:0010046) |
| 0.0 | 0.4 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.0 | 0.1 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
| 0.0 | 0.1 | GO:0070460 | thyroid-stimulating hormone secretion(GO:0070460) |
| 0.0 | 0.2 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
| 0.0 | 0.2 | GO:0052173 | response to defenses of other organism involved in symbiotic interaction(GO:0052173) response to host defenses(GO:0052200) response to host(GO:0075136) |
| 0.0 | 0.1 | GO:0009826 | unidimensional cell growth(GO:0009826) |
| 0.0 | 0.3 | GO:0051799 | negative regulation of hair follicle development(GO:0051799) |
| 0.0 | 0.1 | GO:1903802 | L-glutamate(1-) import into cell(GO:1903802) L-glutamate import into cell(GO:1990123) |
| 0.0 | 0.1 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
| 0.0 | 0.1 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
| 0.0 | 0.1 | GO:0045896 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
| 0.0 | 0.2 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.0 | 0.1 | GO:0071492 | cellular response to UV-A(GO:0071492) |
| 0.0 | 0.2 | GO:0046813 | receptor-mediated virion attachment to host cell(GO:0046813) |
| 0.0 | 0.1 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
| 0.0 | 0.2 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
| 0.0 | 0.3 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.0 | 0.1 | GO:0006562 | proline catabolic process(GO:0006562) |
| 0.0 | 0.2 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.0 | GO:0060353 | regulation of cell adhesion molecule production(GO:0060353) |
| 0.0 | 0.1 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
| 0.0 | 0.3 | GO:0021684 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
| 0.0 | 0.1 | GO:0060137 | maternal process involved in parturition(GO:0060137) |
| 0.0 | 0.1 | GO:0003099 | positive regulation of the force of heart contraction by epinephrine-norepinephrine(GO:0001997) positive regulation of the force of heart contraction by chemical signal(GO:0003099) |
| 0.0 | 0.1 | GO:0048319 | axial mesoderm morphogenesis(GO:0048319) axial mesoderm formation(GO:0048320) |
| 0.0 | 0.1 | GO:0060167 | regulation of adenosine receptor signaling pathway(GO:0060167) |
| 0.0 | 0.1 | GO:0019087 | transformation of host cell by virus(GO:0019087) |
| 0.0 | 0.5 | GO:2000811 | negative regulation of anoikis(GO:2000811) |
| 0.0 | 0.3 | GO:0060363 | cranial suture morphogenesis(GO:0060363) |
| 0.0 | 0.3 | GO:0061088 | sequestering of zinc ion(GO:0032119) regulation of sequestering of zinc ion(GO:0061088) |
| 0.0 | 0.4 | GO:0009143 | nucleoside triphosphate catabolic process(GO:0009143) |
| 0.0 | 0.0 | GO:0033024 | mast cell homeostasis(GO:0033023) mast cell apoptotic process(GO:0033024) regulation of mast cell apoptotic process(GO:0033025) |
| 0.0 | 0.1 | GO:0060054 | positive regulation of epithelial cell proliferation involved in wound healing(GO:0060054) |
| 0.0 | 0.1 | GO:0097694 | establishment of RNA localization to telomere(GO:0097694) |
| 0.0 | 0.1 | GO:0046098 | guanine metabolic process(GO:0046098) |
| 0.0 | 0.1 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
| 0.0 | 0.1 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
| 0.0 | 0.2 | GO:0048133 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.0 | 0.1 | GO:0032489 | regulation of Cdc42 protein signal transduction(GO:0032489) |
| 0.0 | 0.0 | GO:0014873 | response to muscle activity involved in regulation of muscle adaptation(GO:0014873) |
| 0.0 | 0.1 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
| 0.0 | 0.1 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
| 0.0 | 0.1 | GO:0007567 | parturition(GO:0007567) |
| 0.0 | 0.1 | GO:0019344 | cysteine biosynthetic process(GO:0019344) |
| 0.0 | 0.0 | GO:0044650 | virion attachment to host cell(GO:0019062) adhesion of symbiont to host cell(GO:0044650) |
| 0.0 | 0.2 | GO:0070475 | rRNA base methylation(GO:0070475) |
| 0.0 | 0.1 | GO:0008050 | female courtship behavior(GO:0008050) |
| 0.0 | 0.1 | GO:0071727 | response to triacyl bacterial lipopeptide(GO:0071725) cellular response to triacyl bacterial lipopeptide(GO:0071727) |
| 0.0 | 0.1 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
| 0.0 | 0.1 | GO:0060051 | negative regulation of protein glycosylation(GO:0060051) |
| 0.0 | 0.1 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
| 0.0 | 0.2 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
| 0.0 | 0.3 | GO:1900025 | negative regulation of substrate adhesion-dependent cell spreading(GO:1900025) |
| 0.0 | 0.3 | GO:0035999 | tetrahydrofolate interconversion(GO:0035999) |
| 0.0 | 0.1 | GO:0090296 | regulation of mitochondrial DNA replication(GO:0090296) |
| 0.0 | 0.1 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
| 0.0 | 0.1 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.0 | 0.3 | GO:0006851 | mitochondrial calcium ion transport(GO:0006851) |
| 0.0 | 0.0 | GO:0001996 | positive regulation of heart rate by epinephrine-norepinephrine(GO:0001996) |
| 0.0 | 0.1 | GO:0090527 | actin filament reorganization(GO:0090527) |
| 0.0 | 0.2 | GO:0006670 | sphingosine metabolic process(GO:0006670) |
| 0.0 | 0.1 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
| 0.0 | 0.1 | GO:0001712 | ectodermal cell fate commitment(GO:0001712) |
| 0.0 | 0.1 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
| 0.0 | 0.1 | GO:0021586 | pons maturation(GO:0021586) |
| 0.0 | 0.1 | GO:0007529 | establishment of synaptic specificity at neuromuscular junction(GO:0007529) |
| 0.0 | 0.1 | GO:1900019 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
| 0.0 | 0.1 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
| 0.0 | 0.1 | GO:0007403 | glial cell fate determination(GO:0007403) |
| 0.0 | 0.3 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.0 | 0.1 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
| 0.0 | 0.1 | GO:0006842 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
| 0.0 | 0.1 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
| 0.0 | 0.1 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
| 0.0 | 0.2 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
| 0.0 | 0.1 | GO:1904526 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
| 0.0 | 0.1 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
| 0.0 | 0.1 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.0 | 0.2 | GO:0046473 | phosphatidic acid biosynthetic process(GO:0006654) phosphatidic acid metabolic process(GO:0046473) |
| 0.0 | 0.1 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
| 0.0 | 0.1 | GO:2000646 | positive regulation of receptor catabolic process(GO:2000646) |
| 0.0 | 0.1 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
| 0.0 | 0.1 | GO:0045950 | negative regulation of mitotic recombination(GO:0045950) |
| 0.0 | 0.1 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
| 0.0 | 0.2 | GO:0086013 | membrane repolarization during cardiac muscle cell action potential(GO:0086013) |
| 0.0 | 0.1 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
| 0.0 | 0.1 | GO:0051791 | medium-chain fatty acid metabolic process(GO:0051791) |
| 0.0 | 0.2 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
| 0.0 | 0.1 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
| 0.0 | 0.1 | GO:0036258 | multivesicular body assembly(GO:0036258) |
| 0.0 | 0.1 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
| 0.0 | 0.1 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
| 0.0 | 0.0 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
| 0.0 | 0.1 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
| 0.0 | 0.1 | GO:0070782 | phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
| 0.0 | 0.1 | GO:0072675 | osteoclast fusion(GO:0072675) |
| 0.0 | 0.1 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
| 0.0 | 0.1 | GO:0060066 | oviduct development(GO:0060066) |
| 0.0 | 0.1 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
| 0.0 | 0.1 | GO:1902969 | mitotic DNA replication(GO:1902969) |
| 0.0 | 0.1 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.0 | 0.0 | GO:0008611 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) cellular lipid biosynthetic process(GO:0097384) ether biosynthetic process(GO:1901503) |
| 0.0 | 0.1 | GO:0032025 | response to cobalt ion(GO:0032025) |
| 0.0 | 0.1 | GO:0001555 | oocyte growth(GO:0001555) |
| 0.0 | 0.2 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
| 0.0 | 0.1 | GO:0071494 | cellular response to UV-C(GO:0071494) |
| 0.0 | 0.1 | GO:0001757 | somite specification(GO:0001757) |
| 0.0 | 0.0 | GO:0032907 | transforming growth factor beta3 production(GO:0032907) regulation of transforming growth factor beta3 production(GO:0032910) |
| 0.0 | 0.0 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
| 0.0 | 0.0 | GO:0001705 | ectoderm formation(GO:0001705) |
| 0.0 | 0.1 | GO:0015871 | choline transport(GO:0015871) |
| 0.0 | 0.1 | GO:0048478 | replication fork protection(GO:0048478) |
| 0.0 | 0.1 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
| 0.0 | 0.1 | GO:0061030 | epithelial cell differentiation involved in mammary gland alveolus development(GO:0061030) |
| 0.0 | 0.1 | GO:0050713 | negative regulation of interleukin-1 beta secretion(GO:0050713) |
| 0.0 | 0.1 | GO:1904222 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.0 | 0.1 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
| 0.0 | 0.1 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
| 0.0 | 0.0 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
| 0.0 | 0.1 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
| 0.0 | 0.1 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
| 0.0 | 0.1 | GO:0090110 | cargo loading into COPII-coated vesicle(GO:0090110) |
| 0.0 | 0.0 | GO:1901844 | regulation of cell communication by electrical coupling involved in cardiac conduction(GO:1901844) |
| 0.0 | 0.2 | GO:0035871 | protein K11-linked deubiquitination(GO:0035871) |
| 0.0 | 0.2 | GO:0017121 | phospholipid scrambling(GO:0017121) |
| 0.0 | 0.0 | GO:0019065 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.0 | 0.1 | GO:0008582 | regulation of synaptic growth at neuromuscular junction(GO:0008582) |
| 0.0 | 0.1 | GO:0035995 | detection of muscle stretch(GO:0035995) |
| 0.0 | 0.1 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.0 | 0.1 | GO:0051013 | microtubule severing(GO:0051013) |
| 0.0 | 0.0 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 0.0 | 0.1 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
| 0.0 | 0.1 | GO:0036089 | cleavage furrow formation(GO:0036089) |
| 0.0 | 0.1 | GO:0032377 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.0 | 0.0 | GO:0065001 | specification of axis polarity(GO:0065001) |
| 0.0 | 0.0 | GO:0035973 | aggrephagy(GO:0035973) |
| 0.0 | 0.0 | GO:2000828 | regulation of parathyroid hormone secretion(GO:2000828) |
| 0.0 | 0.1 | GO:0010025 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
| 0.0 | 0.1 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
| 0.0 | 0.1 | GO:2000054 | negative regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000054) |
| 0.0 | 0.3 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
| 0.0 | 0.3 | GO:0070306 | lens fiber cell differentiation(GO:0070306) |
| 0.0 | 0.1 | GO:1904380 | endoplasmic reticulum mannose trimming(GO:1904380) |
| 0.0 | 0.0 | GO:0046101 | hypoxanthine metabolic process(GO:0046100) hypoxanthine biosynthetic process(GO:0046101) |
| 0.0 | 0.1 | GO:0060501 | positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
| 0.0 | 0.1 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
| 0.0 | 0.1 | GO:0044829 | positive regulation by host of viral genome replication(GO:0044829) |
| 0.0 | 0.1 | GO:0097527 | necroptotic signaling pathway(GO:0097527) |
| 0.0 | 0.1 | GO:0051410 | detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
| 0.0 | 0.1 | GO:1904469 | positive regulation of tumor necrosis factor secretion(GO:1904469) |
| 0.0 | 0.3 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
| 0.0 | 0.0 | GO:0061738 | late endosomal microautophagy(GO:0061738) |
| 0.0 | 0.0 | GO:0036016 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
| 0.0 | 0.1 | GO:0060693 | regulation of branching involved in salivary gland morphogenesis(GO:0060693) |
| 0.0 | 0.1 | GO:2000670 | positive regulation of dendritic cell apoptotic process(GO:2000670) |
| 0.0 | 0.1 | GO:0043651 | linoleic acid metabolic process(GO:0043651) |
| 0.0 | 0.1 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
| 0.0 | 0.1 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
| 0.0 | 0.2 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.0 | 0.4 | GO:0051647 | nucleus localization(GO:0051647) |
| 0.0 | 0.1 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.0 | 0.1 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
| 0.0 | 0.2 | GO:0009650 | UV protection(GO:0009650) |
| 0.0 | 0.0 | GO:0035054 | embryonic heart tube anterior/posterior pattern specification(GO:0035054) |
| 0.0 | 0.1 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
| 0.0 | 0.3 | GO:0006625 | protein targeting to peroxisome(GO:0006625) peroxisomal transport(GO:0043574) protein localization to peroxisome(GO:0072662) establishment of protein localization to peroxisome(GO:0072663) |
| 0.0 | 0.2 | GO:0035024 | negative regulation of Rho protein signal transduction(GO:0035024) |
| 0.0 | 0.1 | GO:0006106 | fumarate metabolic process(GO:0006106) |
| 0.0 | 0.0 | GO:0009155 | purine deoxyribonucleotide catabolic process(GO:0009155) |
| 0.0 | 0.0 | GO:0050427 | 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
| 0.0 | 0.1 | GO:0045631 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.0 | 0.0 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
| 0.0 | 0.1 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
| 0.0 | 0.1 | GO:0008355 | olfactory learning(GO:0008355) |
| 0.0 | 0.1 | GO:0021540 | corpus callosum morphogenesis(GO:0021540) |
| 0.0 | 0.1 | GO:0019368 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.0 | 0.0 | GO:0051890 | regulation of cardioblast differentiation(GO:0051890) |
| 0.0 | 0.1 | GO:0051771 | negative regulation of nitric-oxide synthase biosynthetic process(GO:0051771) |
| 0.0 | 0.1 | GO:0002606 | positive regulation of dendritic cell antigen processing and presentation(GO:0002606) |
| 0.0 | 0.1 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
| 0.0 | 0.0 | GO:0002155 | regulation of thyroid hormone mediated signaling pathway(GO:0002155) |
| 0.0 | 0.0 | GO:0001692 | histamine metabolic process(GO:0001692) |
| 0.0 | 0.1 | GO:0018317 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.0 | 0.0 | GO:0044034 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 0.0 | 0.1 | GO:2000169 | regulation of peptidyl-cysteine S-nitrosylation(GO:2000169) |
| 0.0 | 0.1 | GO:0006501 | C-terminal protein lipidation(GO:0006501) |
| 0.0 | 0.1 | GO:0031937 | positive regulation of chromatin silencing(GO:0031937) |
| 0.0 | 0.1 | GO:0042473 | outer ear morphogenesis(GO:0042473) |
| 0.0 | 0.0 | GO:0061153 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.0 | 0.0 | GO:0021776 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
| 0.0 | 0.0 | GO:0060594 | mammary gland specification(GO:0060594) |
| 0.0 | 0.0 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
| 0.0 | 0.2 | GO:0006825 | copper ion transport(GO:0006825) |
| 0.0 | 0.0 | GO:0071351 | cellular response to interleukin-18(GO:0071351) |
| 0.0 | 0.1 | GO:0044849 | estrous cycle(GO:0044849) |
| 0.0 | 0.0 | GO:0014045 | establishment of endothelial blood-brain barrier(GO:0014045) |
| 0.0 | 0.2 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
| 0.0 | 0.1 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
| 0.0 | 0.0 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
| 0.0 | 0.0 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
| 0.0 | 0.0 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
| 0.0 | 0.0 | GO:0015770 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.0 | 0.0 | GO:0007412 | axon target recognition(GO:0007412) |
| 0.0 | 0.0 | GO:0060534 | trachea cartilage development(GO:0060534) |
| 0.0 | 0.1 | GO:0045332 | phospholipid translocation(GO:0045332) |
| 0.0 | 0.1 | GO:0030311 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.0 | 0.0 | GO:0070343 | white fat cell proliferation(GO:0070343) regulation of white fat cell proliferation(GO:0070350) |
| 0.0 | 0.1 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.0 | 0.0 | GO:1901656 | glycoside transport(GO:1901656) |
| 0.0 | 0.1 | GO:0016576 | histone dephosphorylation(GO:0016576) |
| 0.0 | 0.0 | GO:0034035 | purine ribonucleoside bisphosphate metabolic process(GO:0034035) |
| 0.0 | 0.0 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.0 | 0.0 | GO:0009086 | methionine biosynthetic process(GO:0009086) |
| 0.0 | 0.1 | GO:0052055 | modulation by symbiont of host molecular function(GO:0052055) |
| 0.0 | 0.0 | GO:0019287 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.0 | 0.1 | GO:2000188 | regulation of cholesterol homeostasis(GO:2000188) |
| 0.0 | 0.2 | GO:0072520 | seminiferous tubule development(GO:0072520) |
| 0.0 | 0.7 | GO:0007566 | embryo implantation(GO:0007566) |
| 0.0 | 0.1 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
| 0.0 | 0.0 | GO:0021943 | formation of radial glial scaffolds(GO:0021943) |
| 0.0 | 0.1 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.0 | 0.0 | GO:0031296 | B cell costimulation(GO:0031296) |
| 0.0 | 0.1 | GO:0010561 | negative regulation of glycoprotein biosynthetic process(GO:0010561) |
| 0.0 | 0.0 | GO:0009106 | lipoate metabolic process(GO:0009106) |
| 0.0 | 0.3 | GO:0046834 | lipid phosphorylation(GO:0046834) |
| 0.0 | 0.3 | GO:2001014 | regulation of skeletal muscle cell differentiation(GO:2001014) |
| 0.0 | 0.0 | GO:1900157 | regulation of bone mineralization involved in bone maturation(GO:1900157) |
| 0.0 | 0.1 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
| 0.0 | 0.1 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
| 0.0 | 0.1 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.0 | 0.1 | GO:0045820 | negative regulation of glycolytic process(GO:0045820) negative regulation of cofactor metabolic process(GO:0051195) negative regulation of coenzyme metabolic process(GO:0051198) |
| 0.0 | 0.0 | GO:0050904 | diapedesis(GO:0050904) |
| 0.0 | 0.0 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
| 0.0 | 0.0 | GO:0030242 | pexophagy(GO:0030242) |
| 0.0 | 0.0 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
| 0.0 | 0.1 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
| 0.0 | 0.1 | GO:1901621 | negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
| 0.0 | 0.1 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
| 0.0 | 0.2 | GO:0007020 | microtubule nucleation(GO:0007020) |
| 0.0 | 0.1 | GO:0007614 | short-term memory(GO:0007614) |
| 0.0 | 0.0 | GO:0072053 | renal inner medulla development(GO:0072053) |
| 0.0 | 0.1 | GO:1901533 | negative regulation of hematopoietic progenitor cell differentiation(GO:1901533) |
| 0.0 | 0.0 | GO:0060729 | intestinal epithelial structure maintenance(GO:0060729) |
| 0.0 | 0.0 | GO:0018992 | germ-line sex determination(GO:0018992) |
| 0.0 | 0.1 | GO:0098719 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.0 | 0.1 | GO:0038166 | angiotensin-activated signaling pathway(GO:0038166) |
| 0.0 | 0.1 | GO:0046416 | D-amino acid metabolic process(GO:0046416) |
| 0.0 | 0.0 | GO:1901069 | guanosine-containing compound catabolic process(GO:1901069) |
| 0.0 | 0.1 | GO:0098787 | mRNA cleavage involved in mRNA processing(GO:0098787) |
| 0.0 | 0.0 | GO:0021683 | cerebellar granular layer morphogenesis(GO:0021683) |
| 0.0 | 0.0 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
| 0.0 | 0.0 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
| 0.0 | 0.0 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
| 0.0 | 0.1 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.0 | 0.1 | GO:0046040 | IMP metabolic process(GO:0046040) |
| 0.0 | 0.0 | GO:0034770 | histone H4-K20 methylation(GO:0034770) |
| 0.0 | 0.0 | GO:0015825 | L-serine transport(GO:0015825) |
| 0.0 | 0.0 | GO:0045196 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
| 0.0 | 0.0 | GO:1903626 | positive regulation of apoptotic DNA fragmentation(GO:1902512) positive regulation of DNA catabolic process(GO:1903626) |
| 0.0 | 0.0 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
| 0.0 | 0.0 | GO:0090188 | negative regulation of pancreatic juice secretion(GO:0090188) |
| 0.0 | 0.1 | GO:0043586 | tongue development(GO:0043586) |
| 0.0 | 0.1 | GO:0002115 | store-operated calcium entry(GO:0002115) |
| 0.0 | 0.0 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
| 0.0 | 0.1 | GO:0010744 | positive regulation of macrophage derived foam cell differentiation(GO:0010744) |
| 0.0 | 0.1 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.0 | 0.2 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.0 | 0.0 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
| 0.0 | 0.1 | GO:0022038 | corpus callosum development(GO:0022038) |
| 0.0 | 0.1 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
| 0.0 | 0.1 | GO:0042359 | vitamin D metabolic process(GO:0042359) |
| 0.0 | 0.0 | GO:0010694 | positive regulation of alkaline phosphatase activity(GO:0010694) |
| 0.0 | 0.1 | GO:0015693 | magnesium ion transport(GO:0015693) |
| 0.0 | 0.1 | GO:0042640 | anagen(GO:0042640) |
| 0.0 | 0.1 | GO:0036035 | osteoclast development(GO:0036035) |
| 0.0 | 0.0 | GO:2000860 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
| 0.0 | 0.0 | GO:0048341 | paraxial mesoderm formation(GO:0048341) |
| 0.0 | 0.0 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
| 0.0 | 0.0 | GO:0060056 | mammary gland involution(GO:0060056) |
| 0.0 | 0.0 | GO:0061684 | chaperone-mediated autophagy(GO:0061684) |
| 0.0 | 0.1 | GO:0048642 | negative regulation of skeletal muscle tissue development(GO:0048642) |
| 0.0 | 0.0 | GO:0046499 | S-adenosylmethioninamine metabolic process(GO:0046499) |
| 0.0 | 0.2 | GO:0018279 | protein N-linked glycosylation via asparagine(GO:0018279) |
| 0.0 | 0.1 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.0 | 0.1 | GO:1990564 | protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
| 0.0 | 0.1 | GO:0003310 | pancreatic A cell differentiation(GO:0003310) |
| 0.0 | 0.0 | GO:0001955 | blood vessel maturation(GO:0001955) |
| 0.0 | 0.0 | GO:0051561 | positive regulation of mitochondrial calcium ion concentration(GO:0051561) |
| 0.0 | 0.0 | GO:2001184 | positive regulation of interleukin-12 secretion(GO:2001184) |
| 0.0 | 0.1 | GO:1900165 | negative regulation of interleukin-6 secretion(GO:1900165) |
| 0.0 | 0.0 | GO:2000726 | negative regulation of cardiac muscle cell differentiation(GO:2000726) |
| 0.0 | 0.0 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
| 0.0 | 0.0 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
| 0.0 | 0.0 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.0 | 0.0 | GO:0051103 | DNA ligation involved in DNA repair(GO:0051103) |
| 0.0 | 0.0 | GO:0010994 | regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
| 0.0 | 0.0 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.0 | 0.0 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
| 0.0 | 0.0 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
| 0.0 | 0.0 | GO:0032513 | negative regulation of protein phosphatase type 2B activity(GO:0032513) |
| 0.0 | 0.2 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
| 0.0 | 0.1 | GO:0050957 | equilibrioception(GO:0050957) |
| 0.0 | 0.1 | GO:1904152 | regulation of retrograde protein transport, ER to cytosol(GO:1904152) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.5 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
| 0.1 | 0.6 | GO:0009279 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
| 0.1 | 0.4 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
| 0.1 | 0.3 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 0.1 | 0.3 | GO:0033503 | HULC complex(GO:0033503) |
| 0.1 | 0.1 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
| 0.0 | 0.2 | GO:0035339 | SPOTS complex(GO:0035339) |
| 0.0 | 0.1 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
| 0.0 | 0.1 | GO:0000811 | GINS complex(GO:0000811) |
| 0.0 | 0.2 | GO:0005683 | U7 snRNP(GO:0005683) |
| 0.0 | 0.1 | GO:0031084 | BLOC-2 complex(GO:0031084) |
| 0.0 | 0.2 | GO:0005828 | kinetochore microtubule(GO:0005828) |
| 0.0 | 0.1 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
| 0.0 | 0.8 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
| 0.0 | 0.1 | GO:0035355 | Toll-like receptor 2-Toll-like receptor 6 protein complex(GO:0035355) |
| 0.0 | 0.2 | GO:0000306 | extrinsic component of vacuolar membrane(GO:0000306) |
| 0.0 | 1.0 | GO:0005720 | nuclear heterochromatin(GO:0005720) |
| 0.0 | 0.4 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
| 0.0 | 0.1 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.0 | 0.1 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.0 | 0.2 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
| 0.0 | 0.1 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
| 0.0 | 0.1 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
| 0.0 | 0.2 | GO:0005688 | U6 snRNP(GO:0005688) |
| 0.0 | 0.4 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.0 | 0.3 | GO:0097431 | mitotic spindle pole(GO:0097431) |
| 0.0 | 0.2 | GO:0031258 | lamellipodium membrane(GO:0031258) |
| 0.0 | 0.1 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.0 | 0.1 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.0 | 0.1 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
| 0.0 | 0.3 | GO:0046930 | pore complex(GO:0046930) |
| 0.0 | 0.1 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.0 | 0.1 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.0 | 0.1 | GO:0005745 | m-AAA complex(GO:0005745) |
| 0.0 | 0.1 | GO:0031211 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
| 0.0 | 0.1 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
| 0.0 | 0.1 | GO:0071141 | SMAD protein complex(GO:0071141) |
| 0.0 | 0.1 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.0 | 0.1 | GO:0000788 | nuclear nucleosome(GO:0000788) |
| 0.0 | 0.2 | GO:0016580 | Sin3 complex(GO:0016580) |
| 0.0 | 0.1 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.0 | 0.3 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 0.0 | 0.1 | GO:0097651 | phosphatidylinositol 3-kinase complex, class I(GO:0097651) |
| 0.0 | 0.1 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
| 0.0 | 0.0 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.0 | 0.1 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.0 | 0.1 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.0 | 0.2 | GO:0010369 | chromocenter(GO:0010369) |
| 0.0 | 0.0 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.0 | 0.1 | GO:0030127 | COPII vesicle coat(GO:0030127) |
| 0.0 | 0.0 | GO:0032010 | phagolysosome(GO:0032010) |
| 0.0 | 0.1 | GO:0035363 | histone locus body(GO:0035363) |
| 0.0 | 0.0 | GO:0038037 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
| 0.0 | 0.4 | GO:0016235 | aggresome(GO:0016235) |
| 0.0 | 0.3 | GO:0005782 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
| 0.0 | 0.1 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
| 0.0 | 0.1 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
| 0.0 | 0.6 | GO:0005778 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
| 0.0 | 0.1 | GO:0097342 | ripoptosome(GO:0097342) |
| 0.0 | 0.1 | GO:1990246 | uniplex complex(GO:1990246) |
| 0.0 | 0.1 | GO:0030130 | clathrin coat of trans-Golgi network vesicle(GO:0030130) |
| 0.0 | 0.0 | GO:0005712 | chiasma(GO:0005712) |
| 0.0 | 0.0 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.0 | 0.1 | GO:0005638 | lamin filament(GO:0005638) |
| 0.0 | 0.0 | GO:0098536 | deuterosome(GO:0098536) |
| 0.0 | 0.3 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.0 | 0.1 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
| 0.0 | 0.6 | GO:0005811 | lipid particle(GO:0005811) |
| 0.0 | 0.1 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.0 | 0.2 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
| 0.0 | 0.0 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
| 0.0 | 0.1 | GO:0001741 | XY body(GO:0001741) |
| 0.0 | 0.1 | GO:0005577 | fibrinogen complex(GO:0005577) |
| 0.0 | 0.1 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.0 | 0.0 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
| 0.0 | 0.1 | GO:1904115 | axon cytoplasm(GO:1904115) |
| 0.0 | 0.1 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.0 | 0.0 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
| 0.0 | 0.1 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.0 | 0.0 | GO:0030478 | actin cap(GO:0030478) |
| 0.0 | 0.1 | GO:0033391 | chromatoid body(GO:0033391) |
| 0.0 | 0.1 | GO:0034719 | SMN-Sm protein complex(GO:0034719) |
| 0.0 | 0.0 | GO:0000938 | GARP complex(GO:0000938) |
| 0.0 | 0.1 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.8 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
| 0.1 | 0.4 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
| 0.1 | 0.6 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
| 0.1 | 0.3 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
| 0.1 | 0.5 | GO:0018685 | alkane 1-monooxygenase activity(GO:0018685) |
| 0.1 | 0.2 | GO:0004771 | sterol esterase activity(GO:0004771) |
| 0.1 | 0.3 | GO:0004144 | diacylglycerol O-acyltransferase activity(GO:0004144) |
| 0.1 | 0.2 | GO:0071209 | U7 snRNA binding(GO:0071209) |
| 0.1 | 0.2 | GO:0016822 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 0.1 | 0.4 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) |
| 0.1 | 0.4 | GO:0038132 | neuregulin binding(GO:0038132) |
| 0.1 | 0.3 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
| 0.1 | 0.2 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
| 0.1 | 0.2 | GO:0001226 | RNA polymerase II transcription corepressor binding(GO:0001226) |
| 0.1 | 0.2 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
| 0.1 | 0.1 | GO:0004676 | 3-phosphoinositide-dependent protein kinase activity(GO:0004676) |
| 0.1 | 0.3 | GO:0015288 | porin activity(GO:0015288) |
| 0.0 | 0.4 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
| 0.0 | 0.3 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.0 | 0.1 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
| 0.0 | 0.0 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
| 0.0 | 0.2 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
| 0.0 | 0.3 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
| 0.0 | 0.3 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
| 0.0 | 0.2 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 0.0 | 0.2 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
| 0.0 | 0.2 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
| 0.0 | 0.4 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.0 | 0.1 | GO:0004096 | catalase activity(GO:0004096) |
| 0.0 | 0.2 | GO:0070191 | methionine-R-sulfoxide reductase activity(GO:0070191) |
| 0.0 | 0.1 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
| 0.0 | 0.1 | GO:0071614 | linoleic acid epoxygenase activity(GO:0071614) |
| 0.0 | 0.3 | GO:0034823 | 3-oxo-2-(2'-pentenyl)cyclopentane-1-octanoic acid CoA ligase activity(GO:0010435) 3-isopropenyl-6-oxoheptanoyl-CoA synthetase activity(GO:0018854) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA synthetase activity(GO:0018855) benzoyl acetate-CoA ligase activity(GO:0018856) 2,4-dichlorobenzoate-CoA ligase activity(GO:0018857) pivalate-CoA ligase activity(GO:0034783) cyclopropanecarboxylate-CoA ligase activity(GO:0034793) adipate-CoA ligase activity(GO:0034796) citronellyl-CoA ligase activity(GO:0034823) mentha-1,3-dione-CoA ligase activity(GO:0034841) thiophene-2-carboxylate-CoA ligase activity(GO:0034842) 2,4,4-trimethylpentanoate-CoA ligase activity(GO:0034865) cis-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034942) trans-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034943) branched-chain acyl-CoA synthetase (ADP-forming) activity(GO:0043759) aryl-CoA synthetase (ADP-forming) activity(GO:0043762) 3-hydroxypropionyl-CoA synthetase activity(GO:0043955) perillic acid:CoA ligase (ADP-forming) activity(GO:0052685) perillic acid:CoA ligase (AMP-forming) activity(GO:0052686) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (ADP-forming) activity(GO:0052687) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (AMP-forming) activity(GO:0052688) pristanate-CoA ligase activity(GO:0070251) malonyl-CoA synthetase activity(GO:0090409) |
| 0.0 | 0.1 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.0 | 0.4 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.0 | 0.1 | GO:0050692 | DBD domain binding(GO:0050692) |
| 0.0 | 0.1 | GO:0102007 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
| 0.0 | 0.2 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
| 0.0 | 0.2 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
| 0.0 | 0.2 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
| 0.0 | 0.1 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
| 0.0 | 0.1 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
| 0.0 | 0.3 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
| 0.0 | 0.1 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
| 0.0 | 0.2 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
| 0.0 | 0.1 | GO:0004346 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
| 0.0 | 0.1 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
| 0.0 | 0.1 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.0 | 0.1 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.0 | 0.5 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
| 0.0 | 0.1 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.0 | 0.1 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
| 0.0 | 0.1 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
| 0.0 | 0.1 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
| 0.0 | 0.1 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
| 0.0 | 0.1 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 0.0 | 0.1 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.0 | 0.1 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) |
| 0.0 | 0.1 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.0 | 0.2 | GO:0003997 | acyl-CoA oxidase activity(GO:0003997) |
| 0.0 | 0.2 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
| 0.0 | 0.1 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
| 0.0 | 0.1 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.0 | 0.1 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| 0.0 | 0.2 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.0 | 0.1 | GO:0016882 | cyclo-ligase activity(GO:0016882) |
| 0.0 | 0.2 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
| 0.0 | 0.3 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.0 | 0.2 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
| 0.0 | 0.3 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
| 0.0 | 0.1 | GO:0032407 | MutSalpha complex binding(GO:0032407) |
| 0.0 | 0.1 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
| 0.0 | 0.2 | GO:0004445 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) |
| 0.0 | 0.1 | GO:0008390 | testosterone 16-alpha-hydroxylase activity(GO:0008390) |
| 0.0 | 0.1 | GO:0000099 | sulfur amino acid transmembrane transporter activity(GO:0000099) |
| 0.0 | 0.1 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.0 | 0.1 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
| 0.0 | 0.2 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 0.0 | 0.3 | GO:0001671 | ATPase activator activity(GO:0001671) |
| 0.0 | 0.1 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
| 0.0 | 0.0 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
| 0.0 | 0.1 | GO:0005499 | vitamin D binding(GO:0005499) |
| 0.0 | 0.1 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.0 | 0.0 | GO:0043398 | HLH domain binding(GO:0043398) |
| 0.0 | 0.1 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
| 0.0 | 0.1 | GO:0019959 | interleukin-8 binding(GO:0019959) |
| 0.0 | 0.5 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.0 | 0.1 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 0.0 | 0.1 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
| 0.0 | 0.1 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
| 0.0 | 0.1 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.0 | 0.0 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.0 | 0.1 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
| 0.0 | 0.1 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
| 0.0 | 0.3 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.0 | 0.4 | GO:0046961 | proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
| 0.0 | 0.1 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
| 0.0 | 0.2 | GO:0016505 | peptidase activator activity involved in apoptotic process(GO:0016505) |
| 0.0 | 0.1 | GO:0035197 | siRNA binding(GO:0035197) |
| 0.0 | 0.1 | GO:0008410 | CoA-transferase activity(GO:0008410) |
| 0.0 | 0.0 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
| 0.0 | 0.0 | GO:0001224 | RNA polymerase II transcription cofactor binding(GO:0001224) |
| 0.0 | 0.1 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
| 0.0 | 0.1 | GO:0071253 | connexin binding(GO:0071253) |
| 0.0 | 0.1 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
| 0.0 | 0.1 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
| 0.0 | 0.0 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
| 0.0 | 0.1 | GO:0004945 | angiotensin type II receptor activity(GO:0004945) |
| 0.0 | 0.0 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
| 0.0 | 0.2 | GO:0005542 | folic acid binding(GO:0005542) |
| 0.0 | 0.0 | GO:0050816 | phosphothreonine binding(GO:0050816) |
| 0.0 | 0.1 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
| 0.0 | 0.1 | GO:0070324 | thyroid hormone binding(GO:0070324) |
| 0.0 | 0.2 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
| 0.0 | 0.2 | GO:0038187 | signaling pattern recognition receptor activity(GO:0008329) pattern recognition receptor activity(GO:0038187) |
| 0.0 | 0.1 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.0 | 0.1 | GO:0050649 | testosterone 6-beta-hydroxylase activity(GO:0050649) |
| 0.0 | 0.1 | GO:0055100 | adiponectin binding(GO:0055100) |
| 0.0 | 0.1 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
| 0.0 | 0.1 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.0 | 0.1 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.0 | 0.1 | GO:0001163 | RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
| 0.0 | 0.2 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
| 0.0 | 0.5 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
| 0.0 | 0.1 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 0.0 | 0.1 | GO:0034711 | inhibin binding(GO:0034711) |
| 0.0 | 0.1 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
| 0.0 | 0.0 | GO:0008187 | poly-pyrimidine tract binding(GO:0008187) |
| 0.0 | 0.1 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
| 0.0 | 0.1 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 0.0 | 0.2 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
| 0.0 | 0.1 | GO:0102338 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.0 | 0.1 | GO:0031748 | D1 dopamine receptor binding(GO:0031748) |
| 0.0 | 0.0 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.0 | 0.0 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
| 0.0 | 0.5 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
| 0.0 | 0.1 | GO:0000828 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
| 0.0 | 0.3 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
| 0.0 | 0.4 | GO:0008483 | transaminase activity(GO:0008483) |
| 0.0 | 0.1 | GO:0018633 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) tocotrienol omega-hydroxylase activity(GO:0052872) thalianol hydroxylase activity(GO:0080014) |
| 0.0 | 0.1 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.0 | 0.1 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.0 | 0.0 | GO:0016453 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
| 0.0 | 0.1 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.0 | 0.1 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
| 0.0 | 0.1 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
| 0.0 | 0.0 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
| 0.0 | 0.1 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
| 0.0 | 0.2 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
| 0.0 | 0.1 | GO:0001727 | lipid kinase activity(GO:0001727) |
| 0.0 | 0.0 | GO:0008515 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.0 | 0.1 | GO:0000405 | bubble DNA binding(GO:0000405) |
| 0.0 | 0.2 | GO:0016594 | glycine binding(GO:0016594) |
| 0.0 | 0.1 | GO:0070513 | death domain binding(GO:0070513) |
| 0.0 | 0.1 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
| 0.0 | 0.0 | GO:0051718 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
| 0.0 | 0.1 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
| 0.0 | 0.1 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.0 | 0.1 | GO:0008430 | selenium binding(GO:0008430) |
| 0.0 | 0.1 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
| 0.0 | 0.1 | GO:0052813 | phosphatidylinositol bisphosphate kinase activity(GO:0052813) |
| 0.0 | 0.0 | GO:0070698 | type I activin receptor binding(GO:0070698) |
| 0.0 | 0.2 | GO:0001846 | opsonin binding(GO:0001846) |
| 0.0 | 0.1 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.0 | 0.1 | GO:0004661 | protein geranylgeranyltransferase activity(GO:0004661) |
| 0.0 | 0.0 | GO:1901612 | cardiolipin binding(GO:1901612) |
| 0.0 | 0.1 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
| 0.0 | 0.1 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 0.0 | 0.1 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
| 0.0 | 0.1 | GO:0017166 | vinculin binding(GO:0017166) |
| 0.0 | 0.1 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
| 0.0 | 0.0 | GO:0004065 | arylsulfatase activity(GO:0004065) |
| 0.0 | 0.1 | GO:0005534 | galactose binding(GO:0005534) |
| 0.0 | 0.0 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
| 0.0 | 0.0 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
| 0.0 | 0.2 | GO:0017025 | TBP-class protein binding(GO:0017025) |
| 0.0 | 0.0 | GO:0004103 | choline kinase activity(GO:0004103) |
| 0.0 | 0.0 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.0 | 0.0 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.0 | 0.0 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
| 0.0 | 0.1 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.0 | 0.1 | GO:0008494 | translation activator activity(GO:0008494) |
| 0.0 | 2.0 | GO:0061630 | ubiquitin protein ligase activity(GO:0061630) |
| 0.0 | 0.1 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
| 0.0 | 0.0 | GO:0015199 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
| 0.0 | 0.1 | GO:0034902 | alkyl sulfatase activity(GO:0018741) endosulfan hemisulfate sulfatase activity(GO:0034889) endosulfan sulfate hydrolase activity(GO:0034902) |
| 0.0 | 0.1 | GO:0015386 | sodium:proton antiporter activity(GO:0015385) potassium:proton antiporter activity(GO:0015386) |
| 0.0 | 0.3 | GO:0036002 | pre-mRNA binding(GO:0036002) |
| 0.0 | 0.0 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
| 0.0 | 0.0 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
| 0.0 | 0.2 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.0 | 0.2 | GO:0016780 | phosphotransferase activity, for other substituted phosphate groups(GO:0016780) |
| 0.0 | 0.0 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
| 0.0 | 0.0 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
| 0.0 | 0.1 | GO:0043237 | laminin-1 binding(GO:0043237) |
| 0.0 | 0.1 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
| 0.0 | 0.2 | GO:0008198 | ferrous iron binding(GO:0008198) |
| 0.0 | 0.0 | GO:0005350 | purine nucleobase transmembrane transporter activity(GO:0005345) pyrimidine nucleobase transmembrane transporter activity(GO:0005350) nucleobase transmembrane transporter activity(GO:0015205) |
| 0.0 | 0.0 | GO:2001070 | starch binding(GO:2001070) |
| 0.0 | 0.1 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.0 | 0.0 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
| 0.0 | 0.0 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.0 | 0.1 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
| 0.0 | 0.0 | GO:0004365 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
| 0.0 | 0.3 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.0 | 0.0 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.0 | 0.1 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
| 0.0 | 0.2 | GO:0044653 | dextrin alpha-glucosidase activity(GO:0044653) starch alpha-glucosidase activity(GO:0044654) beta-glucanase activity(GO:0052736) beta-6-sulfate-N-acetylglucosaminidase activity(GO:0052769) glucan endo-1,4-beta-glucosidase activity(GO:0052859) |
| 0.0 | 0.0 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.0 | 0.0 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.0 | 0.3 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
| 0.0 | 0.1 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.0 | 0.3 | ST STAT3 PATHWAY | STAT3 Pathway |
| 0.0 | 0.5 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.0 | 0.2 | PID ARF6 PATHWAY | Arf6 signaling events |
| 0.0 | 0.4 | PID NECTIN PATHWAY | Nectin adhesion pathway |
| 0.0 | 0.4 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.0 | 0.2 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| 0.0 | 0.1 | PID IGF1 PATHWAY | IGF1 pathway |
| 0.0 | 0.5 | PID ERBB4 PATHWAY | ErbB4 signaling events |
| 0.0 | 0.2 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.0 | 0.1 | PID IL2 1PATHWAY | IL2-mediated signaling events |
| 0.0 | 0.3 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.0 | 0.8 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.0 | 0.4 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.0 | 0.1 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
| 0.0 | 0.5 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
| 0.0 | 0.0 | PID S1P S1P4 PATHWAY | S1P4 pathway |
| 0.0 | 0.1 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.0 | 0.2 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.0 | 0.1 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
| 0.0 | 0.2 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
| 0.0 | 0.2 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
| 0.0 | 0.1 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.0 | 0.2 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 0.1 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
| 0.1 | 0.5 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.1 | 0.3 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.1 | 0.9 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
| 0.0 | 0.8 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
| 0.0 | 0.3 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.0 | 0.0 | REACTOME FORMATION OF THE HIV1 EARLY ELONGATION COMPLEX | Genes involved in Formation of the HIV-1 Early Elongation Complex |
| 0.0 | 0.1 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
| 0.0 | 0.3 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
| 0.0 | 0.2 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
| 0.0 | 0.1 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
| 0.0 | 0.2 | REACTOME SIGNALING BY EGFR IN CANCER | Genes involved in Signaling by EGFR in Cancer |
| 0.0 | 0.2 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.0 | 0.7 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.0 | 0.3 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
| 0.0 | 0.6 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.0 | 0.1 | REACTOME APC CDC20 MEDIATED DEGRADATION OF NEK2A | Genes involved in APC-Cdc20 mediated degradation of Nek2A |
| 0.0 | 0.2 | REACTOME TRAF6 MEDIATED INDUCTION OF TAK1 COMPLEX | Genes involved in TRAF6 mediated induction of TAK1 complex |
| 0.0 | 0.2 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
| 0.0 | 0.1 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
| 0.0 | 0.3 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.0 | 0.2 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
| 0.0 | 0.2 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
| 0.0 | 0.3 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
| 0.0 | 0.1 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
| 0.0 | 0.4 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
| 0.0 | 0.5 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
| 0.0 | 0.2 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.0 | 0.2 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.0 | 0.0 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS | Genes involved in Synthesis of bile acids and bile salts |
| 0.0 | 0.2 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
| 0.0 | 0.1 | REACTOME IL 2 SIGNALING | Genes involved in Interleukin-2 signaling |
| 0.0 | 0.2 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
| 0.0 | 0.2 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.0 | 0.1 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
| 0.0 | 0.2 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.0 | 0.2 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
| 0.0 | 0.2 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.0 | 0.2 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
| 0.0 | 0.1 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
| 0.0 | 0.1 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
| 0.0 | 0.0 | REACTOME NUCLEOTIDE BINDING DOMAIN LEUCINE RICH REPEAT CONTAINING RECEPTOR NLR SIGNALING PATHWAYS | Genes involved in Nucleotide-binding domain, leucine rich repeat containing receptor (NLR) signaling pathways |
| 0.0 | 0.2 | REACTOME GRB2 SOS PROVIDES LINKAGE TO MAPK SIGNALING FOR INTERGRINS | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
| 0.0 | 0.3 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
| 0.0 | 0.1 | REACTOME SCF BETA TRCP MEDIATED DEGRADATION OF EMI1 | Genes involved in SCF-beta-TrCP mediated degradation of Emi1 |
| 0.0 | 0.1 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.0 | 0.2 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
| 0.0 | 0.2 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 0.0 | 0.2 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.0 | 0.0 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
| 0.0 | 0.5 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
| 0.0 | 0.0 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
| 0.0 | 0.0 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
| 0.0 | 0.2 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
| 0.0 | 0.3 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |