Gene Symbol | Gene ID | Gene Info |
---|---|---|
Hoxb5
|
ENSMUSG00000038700.3 | Hoxb5 |
Gene | Promoter | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Hoxb5 | chr11_96303209_96303398 | 33 | 0.921156 | -0.50 | 3.1e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr9_74886235_74886449 | 1.83 |
Onecut1 |
one cut domain, family member 1 |
19858 |
0.14 |
chr17_57200639_57201014 | 1.54 |
Tnfsf14 |
tumor necrosis factor (ligand) superfamily, member 14 |
6649 |
0.11 |
chr18_33437665_33437816 | 1.44 |
Nrep |
neuronal regeneration related protein |
25695 |
0.18 |
chr16_41161594_41161767 | 1.30 |
Gm26381 |
predicted gene, 26381 |
56065 |
0.15 |
chr14_69626550_69626701 | 1.13 |
Gm37513 |
predicted gene, 37513 |
10579 |
0.11 |
chr5_33466079_33466243 | 1.09 |
Gm43851 |
predicted gene 43851 |
28697 |
0.15 |
chr5_33459431_33459801 | 1.01 |
Gm43851 |
predicted gene 43851 |
22152 |
0.16 |
chr18_20652197_20652348 | 0.97 |
Gm16090 |
predicted gene 16090 |
12988 |
0.16 |
chrX_140591087_140591238 | 0.96 |
AL683809.1 |
TSC22 domain family, member 3 (Tsc22d3), pseuodgene |
7563 |
0.17 |
chr2_58791731_58791950 | 0.96 |
Upp2 |
uridine phosphorylase 2 |
26515 |
0.17 |
chr11_16841273_16841607 | 0.95 |
Egfros |
epidermal growth factor receptor, opposite strand |
10738 |
0.21 |
chr6_70874493_70874669 | 0.94 |
Eif2ak3 |
eukaryotic translation initiation factor 2 alpha kinase 3 |
3980 |
0.17 |
chr13_51095199_51095382 | 0.90 |
Spin1 |
spindlin 1 |
5590 |
0.26 |
chr1_100497686_100497861 | 0.89 |
Gm18700 |
predicted gene, 18700 |
99302 |
0.08 |
chr1_67138759_67139000 | 0.87 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
15853 |
0.23 |
chr4_100398171_100398368 | 0.84 |
Gm12706 |
predicted gene 12706 |
36210 |
0.19 |
chr15_81301984_81302161 | 0.82 |
8430426J06Rik |
RIKEN cDNA 8430426J06 gene |
10794 |
0.15 |
chr17_57200072_57200273 | 0.76 |
Tnfsf14 |
tumor necrosis factor (ligand) superfamily, member 14 |
5995 |
0.12 |
chr9_74893793_74894014 | 0.76 |
Onecut1 |
one cut domain, family member 1 |
27419 |
0.13 |
chr16_43170805_43170956 | 0.76 |
Gm15712 |
predicted gene 15712 |
13693 |
0.21 |
chr8_126928052_126928350 | 0.75 |
Gm26397 |
predicted gene, 26397 |
16779 |
0.14 |
chr9_98423199_98423389 | 0.73 |
Rbp1 |
retinol binding protein 1, cellular |
333 |
0.9 |
chr1_185608227_185608404 | 0.72 |
5033404E19Rik |
RIKEN cDNA 5033404E19 gene |
110927 |
0.05 |
chr1_55685863_55686014 | 0.71 |
Plcl1 |
phospholipase C-like 1 |
16087 |
0.27 |
chr2_58779732_58779883 | 0.71 |
Upp2 |
uridine phosphorylase 2 |
14482 |
0.2 |
chr19_55099918_55100172 | 0.70 |
Gm31356 |
predicted gene, 31356 |
543 |
0.49 |
chr19_44399803_44399962 | 0.70 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
6808 |
0.15 |
chr16_37875038_37875343 | 0.69 |
Lrrc58 |
leucine rich repeat containing 58 |
6801 |
0.14 |
chr7_114232335_114232486 | 0.69 |
Copb1 |
coatomer protein complex, subunit beta 1 |
14249 |
0.19 |
chr1_133645585_133645754 | 0.68 |
Zc3h11a |
zinc finger CCCH type containing 11A |
6499 |
0.14 |
chr2_175276086_175276252 | 0.68 |
Gm14440 |
predicted gene 14440 |
1044 |
0.42 |
chr12_104346326_104346873 | 0.67 |
Serpina3k |
serine (or cysteine) peptidase inhibitor, clade A, member 3K |
8113 |
0.12 |
chr12_32690066_32690384 | 0.67 |
Gm47937 |
predicted gene, 47937 |
16931 |
0.2 |
chr2_176424621_176424782 | 0.66 |
Zfp968-ps |
zinc finger protein 968, pseudogene |
1040 |
0.53 |
chr9_7943950_7944118 | 0.65 |
Yap1 |
yes-associated protein 1 |
21787 |
0.15 |
chr15_3413229_3413380 | 0.65 |
Ghr |
growth hormone receptor |
58340 |
0.14 |
chr10_68137101_68137496 | 0.65 |
Arid5b |
AT rich interactive domain 5B (MRF1-like) |
672 |
0.78 |
chr8_34927398_34927800 | 0.65 |
Tnks |
tankyrase, TRF1-interacting ankyrin-related ADP-ribose polymerase |
8831 |
0.2 |
chr19_40184696_40184852 | 0.64 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
2512 |
0.23 |
chr2_175799904_175800073 | 0.64 |
Gm14288 |
predicted gene 14288 |
973 |
0.46 |
chr19_40184875_40185171 | 0.64 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
2263 |
0.24 |
chr2_177499192_177499383 | 0.63 |
Gm14403 |
predicted gene 14403 |
972 |
0.52 |
chr9_44078711_44078862 | 0.63 |
Usp2 |
ubiquitin specific peptidase 2 |
6153 |
0.07 |
chr11_77216718_77216887 | 0.63 |
Ssh2 |
slingshot protein phosphatase 2 |
515 |
0.72 |
chr7_16576614_16576765 | 0.63 |
Gm29443 |
predicted gene 29443 |
37135 |
0.07 |
chrX_23364676_23365159 | 0.62 |
Klhl13 |
kelch-like 13 |
136 |
0.51 |
chr9_32243733_32243884 | 0.62 |
Arhgap32 |
Rho GTPase activating protein 32 |
1356 |
0.48 |
chr17_57198093_57198326 | 0.62 |
Tnfsf14 |
tumor necrosis factor (ligand) superfamily, member 14 |
4032 |
0.13 |
chr2_31476497_31476676 | 0.61 |
Ass1 |
argininosuccinate synthetase 1 |
6379 |
0.2 |
chr9_110985950_110986443 | 0.61 |
1700061E17Rik |
RIKEN cDNA 1700061E17 gene |
5 |
0.94 |
chr10_95234014_95234323 | 0.61 |
Gm48874 |
predicted gene, 48874 |
73807 |
0.07 |
chr17_57199524_57200036 | 0.60 |
Tnfsf14 |
tumor necrosis factor (ligand) superfamily, member 14 |
5603 |
0.12 |
chr16_37596956_37597107 | 0.60 |
Gm46559 |
predicted gene, 46559 |
841 |
0.55 |
chr6_13676526_13676747 | 0.59 |
Bmt2 |
base methyltransferase of 25S rRNA 2 |
1302 |
0.55 |
chr9_74693880_74694046 | 0.59 |
Gm27233 |
predicted gene 27233 |
15299 |
0.23 |
chr6_114877506_114877696 | 0.57 |
Vgll4 |
vestigial like family member 4 |
2494 |
0.3 |
chr2_26021405_26022065 | 0.57 |
Ubac1 |
ubiquitin associated domain containing 1 |
12 |
0.97 |
chr6_48445383_48445907 | 0.57 |
Zfp467 |
zinc finger protein 467 |
48 |
0.95 |
chr2_180678351_180678502 | 0.57 |
Dido1 |
death inducer-obliterator 1 |
2471 |
0.19 |
chr11_119038095_119038250 | 0.57 |
Cbx8 |
chromobox 8 |
2659 |
0.22 |
chr5_129941480_129942081 | 0.56 |
Vkorc1l1 |
vitamin K epoxide reductase complex, subunit 1-like 1 |
190 |
0.89 |
chr15_55152954_55153171 | 0.56 |
Deptor |
DEP domain containing MTOR-interacting protein |
19609 |
0.17 |
chr15_59008383_59008581 | 0.56 |
4930544F09Rik |
RIKEN cDNA 4930544F09 gene |
24346 |
0.16 |
chr8_10030198_10030353 | 0.55 |
Tnfsf13b |
tumor necrosis factor (ligand) superfamily, member 13b |
1043 |
0.48 |
chr3_51230122_51230437 | 0.55 |
Gm38357 |
predicted gene, 38357 |
1638 |
0.29 |
chr15_66578165_66578401 | 0.54 |
Phf20l1 |
PHD finger protein 20-like 1 |
678 |
0.73 |
chr4_150587732_150587916 | 0.54 |
Rere |
arginine glutamic acid dipeptide (RE) repeats |
18167 |
0.18 |
chr5_120484543_120484824 | 0.54 |
Gm15690 |
predicted gene 15690 |
3780 |
0.13 |
chr3_149181265_149181842 | 0.52 |
Gm42647 |
predicted gene 42647 |
28718 |
0.19 |
chr12_7751611_7751762 | 0.52 |
Gm32828 |
predicted gene, 32828 |
108005 |
0.06 |
chr3_89140809_89141081 | 0.52 |
Pklr |
pyruvate kinase liver and red blood cell |
4322 |
0.08 |
chr4_139631622_139632150 | 0.51 |
Aldh4a1 |
aldehyde dehydrogenase 4 family, member A1 |
8777 |
0.14 |
chr3_111102424_111102592 | 0.51 |
Gm43407 |
predicted gene 43407 |
5992 |
0.34 |
chr7_114420923_114421192 | 0.51 |
Pde3b |
phosphodiesterase 3B, cGMP-inhibited |
5776 |
0.23 |
chr2_177898137_177898301 | 0.51 |
Gm14327 |
predicted gene 14327 |
1123 |
0.41 |
chr2_90560658_90560846 | 0.50 |
Ptprj |
protein tyrosine phosphatase, receptor type, J |
19895 |
0.2 |
chr17_63010676_63010827 | 0.50 |
Gm25348 |
predicted gene, 25348 |
86249 |
0.1 |
chr11_99050175_99050326 | 0.50 |
Igfbp4 |
insulin-like growth factor binding protein 4 |
2939 |
0.17 |
chr2_156729623_156729805 | 0.49 |
Dlgap4 |
DLG associated protein 4 |
8222 |
0.14 |
chr13_21917052_21917354 | 0.49 |
Gm44456 |
predicted gene, 44456 |
7813 |
0.07 |
chr15_7135984_7136307 | 0.48 |
Lifr |
LIF receptor alpha |
4397 |
0.32 |
chr5_99284196_99284371 | 0.48 |
Gm35394 |
predicted gene, 35394 |
10188 |
0.24 |
chr5_125528990_125529141 | 0.48 |
Tmem132b |
transmembrane protein 132B |
2709 |
0.23 |
chr15_58947289_58947444 | 0.47 |
Mtss1 |
MTSS I-BAR domain containing 1 |
6214 |
0.14 |
chr11_16859692_16859843 | 0.47 |
Egfr |
epidermal growth factor receptor |
18383 |
0.18 |
chr18_12727402_12727927 | 0.47 |
Ttc39c |
tetratricopeptide repeat domain 39C |
7041 |
0.14 |
chr7_130989257_130989408 | 0.46 |
Htra1 |
HtrA serine peptidase 1 |
6602 |
0.21 |
chr6_146270994_146271175 | 0.46 |
Gm44086 |
predicted gene, 44086 |
104 |
0.97 |
chr17_25127135_25127453 | 0.46 |
Clcn7 |
chloride channel, voltage-sensitive 7 |
6097 |
0.1 |
chr11_79340199_79340405 | 0.46 |
Nf1 |
neurofibromin 1 |
415 |
0.82 |
chr19_8993151_8993324 | 0.46 |
Ahnak |
AHNAK nucleoprotein (desmoyokin) |
3942 |
0.11 |
chr9_40804588_40804799 | 0.45 |
Snord14e |
small nucleolar RNA, C/D box 14E |
55 |
0.66 |
chr8_25609907_25610083 | 0.45 |
Gm23184 |
predicted gene, 23184 |
563 |
0.58 |
chr18_35748735_35748902 | 0.45 |
Sting1 |
stimulator of interferon response cGAMP interactor 1 |
8264 |
0.1 |
chr7_140723099_140723551 | 0.45 |
Olfr542-ps1 |
olfactory receptor 542, pseudogene 1 |
2043 |
0.18 |
chrX_42068446_42068784 | 0.45 |
Xiap |
X-linked inhibitor of apoptosis |
140 |
0.97 |
chr3_129444766_129445057 | 0.44 |
Gm5712 |
predicted gene 5712 |
11238 |
0.17 |
chr2_177901070_177901508 | 0.44 |
Gm14327 |
predicted gene 14327 |
2996 |
0.19 |
chr5_116020452_116020643 | 0.44 |
Prkab1 |
protein kinase, AMP-activated, beta 1 non-catalytic subunit |
1099 |
0.39 |
chr5_144255609_144256174 | 0.44 |
2900089D17Rik |
RIKEN cDNA 2900089D17 gene |
295 |
0.71 |
chr18_74301601_74301911 | 0.43 |
Gm14328 |
predicted gene 14328 |
2175 |
0.26 |
chr13_9073792_9074124 | 0.43 |
Gm36264 |
predicted gene, 36264 |
2493 |
0.23 |
chr3_18191923_18192090 | 0.43 |
Gm23686 |
predicted gene, 23686 |
14381 |
0.22 |
chr11_16902164_16902468 | 0.43 |
Egfr |
epidermal growth factor receptor |
2869 |
0.27 |
chr1_179108579_179108982 | 0.43 |
Smyd3 |
SET and MYND domain containing 3 |
119435 |
0.06 |
chr6_42360337_42360550 | 0.43 |
Zyx |
zyxin |
5306 |
0.09 |
chr11_16795963_16796156 | 0.43 |
Egfros |
epidermal growth factor receptor, opposite strand |
34643 |
0.15 |
chr8_115830669_115830820 | 0.43 |
Maf |
avian musculoaponeurotic fibrosarcoma oncogene homolog |
122950 |
0.06 |
chr6_145866005_145866307 | 0.42 |
Bhlhe41 |
basic helix-loop-helix family, member e41 |
598 |
0.7 |
chr5_24424830_24425266 | 0.42 |
Slc4a2 |
solute carrier family 4 (anion exchanger), member 2 |
184 |
0.83 |
chr7_139020930_139021245 | 0.42 |
Gm45613 |
predicted gene 45613 |
88 |
0.97 |
chr15_103250533_103250768 | 0.42 |
Nfe2 |
nuclear factor, erythroid derived 2 |
815 |
0.45 |
chr2_178024005_178024418 | 0.42 |
Zfp971 |
zinc finger protein 971 |
832 |
0.62 |
chr2_31477009_31477347 | 0.41 |
Ass1 |
argininosuccinate synthetase 1 |
6971 |
0.19 |
chr4_108059486_108059709 | 0.41 |
Scp2 |
sterol carrier protein 2, liver |
11718 |
0.13 |
chr2_160805166_160805505 | 0.41 |
Gm11447 |
predicted gene 11447 |
40278 |
0.11 |
chr2_58761406_58761587 | 0.41 |
Upp2 |
uridine phosphorylase 2 |
3829 |
0.24 |
chr7_99164077_99164275 | 0.41 |
Dgat2 |
diacylglycerol O-acyltransferase 2 |
5930 |
0.14 |
chr5_137115772_137116317 | 0.41 |
Trim56 |
tripartite motif-containing 56 |
163 |
0.92 |
chr2_51145289_51145440 | 0.40 |
Rnd3 |
Rho family GTPase 3 |
3730 |
0.3 |
chr7_127026907_127027653 | 0.40 |
Maz |
MYC-associated zinc finger protein (purine-binding transcription factor) |
243 |
0.69 |
chr11_70653511_70654114 | 0.40 |
Pfn1 |
profilin 1 |
786 |
0.31 |
chr4_109721933_109722084 | 0.39 |
Gm12808 |
predicted gene 12808 |
32809 |
0.15 |
chr2_148034677_148034980 | 0.39 |
9030622O22Rik |
RIKEN cDNA 9030622O22 gene |
3442 |
0.21 |
chr13_48533860_48534011 | 0.39 |
Mirlet7d |
microRNA let7d |
2179 |
0.14 |
chr13_67194609_67194806 | 0.39 |
Zfp455 |
zinc finger protein 455 |
172 |
0.88 |
chr2_27244113_27244980 | 0.39 |
Sardh |
sarcosine dehydrogenase |
2302 |
0.25 |
chr10_87870357_87870520 | 0.39 |
Igf1os |
insulin-like growth factor 1, opposite strand |
7057 |
0.21 |
chr12_12800018_12800179 | 0.39 |
Platr19 |
pluripotency associated transcript 19 |
12113 |
0.19 |
chr16_13359323_13359477 | 0.39 |
Mrtfb |
myocardin related transcription factor B |
979 |
0.59 |
chr2_177839201_177839672 | 0.39 |
Gm14325 |
predicted gene 14325 |
882 |
0.56 |
chr10_78245322_78245474 | 0.39 |
Trappc10 |
trafficking protein particle complex 10 |
757 |
0.49 |
chr11_119085344_119085795 | 0.39 |
Cbx4 |
chromobox 4 |
652 |
0.65 |
chr13_24375115_24375330 | 0.39 |
Gm11342 |
predicted gene 11342 |
728 |
0.42 |
chr3_105686569_105686720 | 0.39 |
Ddx20 |
DEAD (Asp-Glu-Ala-Asp) box polypeptide 20 |
800 |
0.53 |
chr8_123805341_123805997 | 0.38 |
Rab4a |
RAB4A, member RAS oncogene family |
316 |
0.79 |
chr9_74868189_74868408 | 0.38 |
Onecut1 |
one cut domain, family member 1 |
1814 |
0.29 |
chr1_160260042_160260204 | 0.38 |
Gm36975 |
predicted gene, 36975 |
4201 |
0.16 |
chr4_53217859_53218037 | 0.38 |
4930412L05Rik |
RIKEN cDNA 4930412L05 gene |
91 |
0.97 |
chr17_46052426_46052577 | 0.38 |
Vegfa |
vascular endothelial growth factor A |
20132 |
0.13 |
chr5_150452004_150452186 | 0.38 |
Fry |
FRY microtubule binding protein |
965 |
0.43 |
chrX_142517055_142517225 | 0.38 |
Gm4995 |
predicted pseudogene 4995 |
16730 |
0.18 |
chr2_154868249_154868417 | 0.37 |
Eif2s2 |
eukaryotic translation initiation factor 2, subunit 2 (beta) |
24449 |
0.17 |
chr18_33337551_33337772 | 0.37 |
Gm5503 |
predicted gene 5503 |
47294 |
0.17 |
chr9_35116903_35117294 | 0.37 |
St3gal4 |
ST3 beta-galactoside alpha-2,3-sialyltransferase 4 |
225 |
0.59 |
chr10_80577672_80578424 | 0.37 |
Klf16 |
Kruppel-like factor 16 |
727 |
0.41 |
chr10_111960652_111960806 | 0.37 |
Krr1 |
KRR1, small subunit (SSU) processome component, homolog (yeast) |
11935 |
0.16 |
chr8_93183570_93183871 | 0.37 |
Gm45909 |
predicted gene 45909 |
7638 |
0.14 |
chr1_166409283_166409518 | 0.37 |
Pogk |
pogo transposable element with KRAB domain |
9 |
0.97 |
chr5_125021735_125021920 | 0.37 |
Ncor2 |
nuclear receptor co-repressor 2 |
1393 |
0.4 |
chr15_59078380_59078599 | 0.37 |
Mtss1 |
MTSS I-BAR domain containing 1 |
3500 |
0.29 |
chr3_130634058_130634674 | 0.36 |
Etnppl |
ethanolamine phosphate phospholyase |
7846 |
0.17 |
chr11_76803310_76803471 | 0.36 |
Cpd |
carboxypeptidase D |
5436 |
0.22 |
chr1_74026626_74026783 | 0.36 |
Tns1 |
tensin 1 |
10282 |
0.22 |
chr6_119446088_119446268 | 0.36 |
Wnt5b |
wingless-type MMTV integration site family, member 5B |
3208 |
0.25 |
chr12_100393204_100393374 | 0.36 |
Ttc7b |
tetratricopeptide repeat domain 7B |
7389 |
0.18 |
chr1_175633873_175634052 | 0.36 |
Kmo |
kynurenine 3-monooxygenase (kynurenine 3-hydroxylase) |
1723 |
0.33 |
chr9_44512040_44512495 | 0.36 |
Bcl9l |
B cell CLL/lymphoma 9-like |
12995 |
0.07 |
chr19_4596445_4596623 | 0.36 |
Pcx |
pyruvate carboxylase |
2126 |
0.2 |
chr2_77506322_77506668 | 0.36 |
Zfp385b |
zinc finger protein 385B |
13040 |
0.24 |
chr10_69192399_69192560 | 0.35 |
Rhobtb1 |
Rho-related BTB domain containing 1 |
16073 |
0.16 |
chr15_62743599_62743898 | 0.35 |
Gm22521 |
predicted gene, 22521 |
49453 |
0.17 |
chr11_108344097_108344385 | 0.35 |
Prkca |
protein kinase C, alpha |
313 |
0.79 |
chr17_30111153_30111304 | 0.35 |
Zfand3 |
zinc finger, AN1-type domain 3 |
24962 |
0.16 |
chr7_130225038_130225258 | 0.35 |
Fgfr2 |
fibroblast growth factor receptor 2 |
3608 |
0.34 |
chr11_19851376_19851638 | 0.35 |
Gm12029 |
predicted gene 12029 |
67855 |
0.1 |
chr7_19756083_19756234 | 0.35 |
Bcam |
basal cell adhesion molecule |
793 |
0.37 |
chr1_31072664_31072818 | 0.35 |
4931428L18Rik |
RIKEN cDNA 4931428L18 gene |
23713 |
0.14 |
chr4_106441548_106441699 | 0.34 |
Usp24 |
ubiquitin specific peptidase 24 |
13130 |
0.15 |
chr11_16819306_16819457 | 0.34 |
Egfros |
epidermal growth factor receptor, opposite strand |
11321 |
0.22 |
chr7_35107621_35107973 | 0.34 |
Gm22535 |
predicted gene, 22535 |
5975 |
0.1 |
chr5_28079954_28080114 | 0.34 |
Insig1 |
insulin induced gene 1 |
5368 |
0.18 |
chr5_96737616_96737767 | 0.34 |
Gm42604 |
predicted gene 42604 |
1673 |
0.39 |
chr8_40874097_40874545 | 0.34 |
Slc7a2 |
solute carrier family 7 (cationic amino acid transporter, y+ system), member 2 |
627 |
0.68 |
chr19_26606580_26606779 | 0.34 |
Smarca2 |
SWI/SNF related, matrix associated, actin dependent regulator of chromatin, subfamily a, member 2 |
591 |
0.75 |
chr8_93181874_93182111 | 0.34 |
Ces1d |
carboxylesterase 1D |
6703 |
0.14 |
chr2_122245449_122245959 | 0.34 |
Sord |
sorbitol dehydrogenase |
10955 |
0.11 |
chr7_101178542_101179097 | 0.34 |
Fchsd2 |
FCH and double SH3 domains 2 |
11424 |
0.17 |
chr19_39347329_39347591 | 0.34 |
Cyp2c72-ps |
cytochrome P450, family 2, subfamily c, polypeptide 72, pseudogene |
93 |
0.98 |
chr9_86675546_86675705 | 0.34 |
Gm38230 |
predicted gene, 38230 |
9583 |
0.12 |
chr14_121093961_121094139 | 0.33 |
Farp1 |
FERM, RhoGEF (Arhgef) and pleckstrin domain protein 1 (chondrocyte-derived) |
8029 |
0.29 |
chr3_52007468_52007706 | 0.33 |
Gm37465 |
predicted gene, 37465 |
3562 |
0.16 |
chr9_43224415_43225053 | 0.33 |
Oaf |
out at first homolog |
358 |
0.84 |
chr19_44393747_44393961 | 0.33 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
12836 |
0.14 |
chr17_24896022_24896534 | 0.33 |
Nme3 |
NME/NM23 nucleoside diphosphate kinase 3 |
222 |
0.77 |
chr11_63897172_63897366 | 0.33 |
Hs3st3b1 |
heparan sulfate (glucosamine) 3-O-sulfotransferase 3B1 |
25021 |
0.18 |
chr4_151953083_151953245 | 0.33 |
Dnajc11 |
DnaJ heat shock protein family (Hsp40) member C11 |
3979 |
0.16 |
chr12_16947098_16947259 | 0.33 |
Gm22303 |
predicted gene, 22303 |
7184 |
0.16 |
chr3_34020715_34021194 | 0.33 |
Fxr1 |
fragile X mental retardation gene 1, autosomal homolog |
846 |
0.39 |
chr11_107326151_107326306 | 0.33 |
Gm11719 |
predicted gene 11719 |
4480 |
0.17 |
chr2_27710975_27711350 | 0.33 |
Rxra |
retinoid X receptor alpha |
579 |
0.83 |
chr6_88737581_88737810 | 0.33 |
Gm44005 |
predicted gene, 44005 |
497 |
0.7 |
chr13_101478901_101479052 | 0.33 |
Gm36994 |
predicted gene, 36994 |
35725 |
0.15 |
chr8_103501684_103501874 | 0.33 |
Gm45277 |
predicted gene 45277 |
61844 |
0.14 |
chr15_39845407_39845558 | 0.33 |
Dpys |
dihydropyrimidinase |
11985 |
0.21 |
chr18_12669046_12669223 | 0.33 |
Ttc39c |
tetratricopeptide repeat domain 39C |
20594 |
0.13 |
chr7_27332366_27332527 | 0.33 |
Ltbp4 |
latent transforming growth factor beta binding protein 4 |
1167 |
0.33 |
chr11_4822321_4822472 | 0.33 |
Nf2 |
neurofibromin 2 |
2000 |
0.29 |
chr16_43423980_43424131 | 0.32 |
Gm15713 |
predicted gene 15713 |
3859 |
0.27 |
chr3_89247265_89247416 | 0.32 |
Krtcap2 |
keratinocyte associated protein 2 |
906 |
0.23 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 0.6 | GO:0010046 | response to mycotoxin(GO:0010046) |
0.2 | 0.7 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
0.2 | 0.5 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) |
0.2 | 0.5 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
0.1 | 0.5 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
0.1 | 0.4 | GO:0045917 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
0.1 | 0.4 | GO:0061535 | glutamate secretion, neurotransmission(GO:0061535) |
0.1 | 0.5 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.1 | 0.3 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
0.1 | 0.6 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
0.1 | 0.4 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
0.1 | 0.5 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
0.1 | 0.3 | GO:2000705 | regulation of dense core granule biogenesis(GO:2000705) |
0.1 | 0.3 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
0.1 | 0.3 | GO:0031296 | B cell costimulation(GO:0031296) |
0.1 | 0.2 | GO:0060523 | prostate epithelial cord elongation(GO:0060523) |
0.1 | 0.3 | GO:0015819 | lysine transport(GO:0015819) |
0.1 | 0.1 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
0.1 | 0.3 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.1 | 0.5 | GO:0060613 | fat pad development(GO:0060613) |
0.1 | 0.3 | GO:0010887 | negative regulation of cholesterol storage(GO:0010887) |
0.1 | 0.1 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
0.1 | 0.2 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.1 | 0.4 | GO:1903799 | regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903798) negative regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903799) |
0.1 | 0.3 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.1 | 0.2 | GO:0032513 | negative regulation of protein phosphatase type 2B activity(GO:0032513) |
0.1 | 0.2 | GO:0001692 | histamine metabolic process(GO:0001692) |
0.1 | 0.3 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
0.1 | 0.2 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
0.1 | 0.2 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
0.1 | 0.3 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
0.1 | 0.2 | GO:1900045 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
0.1 | 0.2 | GO:0035935 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
0.1 | 0.2 | GO:0051182 | coenzyme transport(GO:0051182) |
0.1 | 0.2 | GO:0006106 | fumarate metabolic process(GO:0006106) |
0.1 | 0.2 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
0.1 | 0.2 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
0.0 | 0.1 | GO:0097167 | circadian regulation of translation(GO:0097167) |
0.0 | 0.2 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
0.0 | 0.1 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
0.0 | 0.1 | GO:0035973 | aggrephagy(GO:0035973) |
0.0 | 0.1 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
0.0 | 0.1 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
0.0 | 0.1 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
0.0 | 0.2 | GO:1902534 | single-organism membrane invagination(GO:1902534) |
0.0 | 0.1 | GO:0045726 | positive regulation of integrin biosynthetic process(GO:0045726) |
0.0 | 0.1 | GO:0045914 | negative regulation of catecholamine metabolic process(GO:0045914) negative regulation of dopamine metabolic process(GO:0045963) |
0.0 | 0.1 | GO:0006068 | ethanol catabolic process(GO:0006068) |
0.0 | 0.3 | GO:0006228 | UTP biosynthetic process(GO:0006228) |
0.0 | 0.2 | GO:0006848 | pyruvate transport(GO:0006848) |
0.0 | 0.2 | GO:0032055 | negative regulation of translation in response to stress(GO:0032055) |
0.0 | 0.2 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
0.0 | 0.3 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
0.0 | 0.1 | GO:0003383 | apical constriction(GO:0003383) |
0.0 | 0.2 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
0.0 | 0.5 | GO:0060396 | growth hormone receptor signaling pathway(GO:0060396) cellular response to growth hormone stimulus(GO:0071378) |
0.0 | 0.3 | GO:0018095 | protein polyglutamylation(GO:0018095) |
0.0 | 0.2 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
0.0 | 0.1 | GO:0038171 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
0.0 | 0.2 | GO:0006477 | protein sulfation(GO:0006477) |
0.0 | 0.1 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
0.0 | 0.2 | GO:0060839 | endothelial cell fate commitment(GO:0060839) |
0.0 | 0.2 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
0.0 | 0.1 | GO:2000645 | negative regulation of receptor catabolic process(GO:2000645) |
0.0 | 0.1 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
0.0 | 0.1 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
0.0 | 0.2 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.0 | 0.1 | GO:0031087 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.0 | 0.1 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
0.0 | 0.1 | GO:0090135 | actin filament branching(GO:0090135) |
0.0 | 0.1 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
0.0 | 0.1 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
0.0 | 0.1 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
0.0 | 0.3 | GO:0052697 | xenobiotic glucuronidation(GO:0052697) |
0.0 | 0.1 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
0.0 | 0.0 | GO:0046084 | adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
0.0 | 0.1 | GO:0010728 | regulation of hydrogen peroxide biosynthetic process(GO:0010728) |
0.0 | 0.1 | GO:1900222 | negative regulation of beta-amyloid clearance(GO:1900222) |
0.0 | 0.9 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
0.0 | 0.2 | GO:0042518 | negative regulation of tyrosine phosphorylation of Stat3 protein(GO:0042518) |
0.0 | 0.2 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
0.0 | 0.3 | GO:0010832 | negative regulation of myotube differentiation(GO:0010832) |
0.0 | 0.4 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
0.0 | 0.1 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
0.0 | 0.1 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.0 | 0.0 | GO:0060331 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
0.0 | 0.1 | GO:0045583 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
0.0 | 0.1 | GO:0010166 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
0.0 | 0.2 | GO:0070995 | NADPH oxidation(GO:0070995) |
0.0 | 0.1 | GO:0032058 | positive regulation of translational initiation in response to stress(GO:0032058) |
0.0 | 0.1 | GO:0060268 | negative regulation of respiratory burst(GO:0060268) |
0.0 | 0.1 | GO:2000173 | negative regulation of branching morphogenesis of a nerve(GO:2000173) |
0.0 | 0.1 | GO:0046684 | response to pyrethroid(GO:0046684) |
0.0 | 0.1 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
0.0 | 0.1 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
0.0 | 0.1 | GO:0051031 | tRNA transport(GO:0051031) |
0.0 | 0.1 | GO:0048478 | replication fork protection(GO:0048478) |
0.0 | 0.1 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
0.0 | 0.2 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
0.0 | 0.1 | GO:0006714 | sesquiterpenoid metabolic process(GO:0006714) |
0.0 | 0.1 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
0.0 | 0.2 | GO:0051503 | adenine nucleotide transport(GO:0051503) |
0.0 | 0.1 | GO:0006059 | hexitol metabolic process(GO:0006059) |
0.0 | 0.1 | GO:0035627 | ceramide transport(GO:0035627) |
0.0 | 0.2 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
0.0 | 0.1 | GO:0031585 | regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031585) |
0.0 | 0.4 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
0.0 | 0.1 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.0 | 0.1 | GO:1902267 | polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) |
0.0 | 0.1 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
0.0 | 0.2 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
0.0 | 0.1 | GO:0021823 | cerebral cortex tangential migration using cell-cell interactions(GO:0021823) postnatal olfactory bulb interneuron migration(GO:0021827) |
0.0 | 0.1 | GO:0070327 | thyroid hormone transport(GO:0070327) |
0.0 | 0.1 | GO:0009249 | protein lipoylation(GO:0009249) |
0.0 | 0.1 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
0.0 | 0.0 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
0.0 | 0.1 | GO:0051639 | actin filament network formation(GO:0051639) |
0.0 | 0.1 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.0 | 0.1 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
0.0 | 0.1 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
0.0 | 0.1 | GO:0032364 | oxygen homeostasis(GO:0032364) |
0.0 | 0.0 | GO:0032056 | positive regulation of translation in response to stress(GO:0032056) positive regulation of translation in response to endoplasmic reticulum stress(GO:0036493) |
0.0 | 0.0 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
0.0 | 0.3 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.0 | 0.2 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
0.0 | 0.1 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
0.0 | 0.1 | GO:1903026 | negative regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903026) |
0.0 | 0.1 | GO:0009730 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
0.0 | 0.1 | GO:2000637 | positive regulation of gene silencing by miRNA(GO:2000637) |
0.0 | 0.1 | GO:0045607 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
0.0 | 0.1 | GO:0045199 | maintenance of epithelial cell apical/basal polarity(GO:0045199) |
0.0 | 0.0 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
0.0 | 0.2 | GO:0070886 | positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
0.0 | 0.2 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
0.0 | 0.1 | GO:0006265 | DNA topological change(GO:0006265) |
0.0 | 0.1 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
0.0 | 0.1 | GO:0045080 | positive regulation of chemokine biosynthetic process(GO:0045080) |
0.0 | 0.0 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
0.0 | 0.3 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
0.0 | 0.2 | GO:0045075 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
0.0 | 0.1 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
0.0 | 0.1 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
0.0 | 0.1 | GO:0006013 | mannose metabolic process(GO:0006013) |
0.0 | 0.0 | GO:0090027 | negative regulation of monocyte chemotaxis(GO:0090027) |
0.0 | 0.1 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
0.0 | 0.1 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
0.0 | 0.1 | GO:0006517 | protein deglycosylation(GO:0006517) |
0.0 | 0.1 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
0.0 | 0.1 | GO:0003164 | His-Purkinje system development(GO:0003164) |
0.0 | 0.2 | GO:2000060 | positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
0.0 | 0.1 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
0.0 | 0.1 | GO:0035280 | miRNA loading onto RISC involved in gene silencing by miRNA(GO:0035280) |
0.0 | 0.1 | GO:1900226 | negative regulation of NLRP3 inflammasome complex assembly(GO:1900226) |
0.0 | 0.0 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
0.0 | 0.1 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
0.0 | 0.1 | GO:0048143 | astrocyte activation(GO:0048143) |
0.0 | 0.0 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
0.0 | 0.0 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.1 | GO:0006742 | NADP catabolic process(GO:0006742) |
0.0 | 0.0 | GO:0003289 | atrial septum primum morphogenesis(GO:0003289) |
0.0 | 0.0 | GO:0045764 | positive regulation of cellular amino acid metabolic process(GO:0045764) |
0.0 | 0.0 | GO:0060416 | response to growth hormone(GO:0060416) |
0.0 | 0.1 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
0.0 | 0.1 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
0.0 | 0.2 | GO:0006198 | cAMP catabolic process(GO:0006198) |
0.0 | 0.0 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
0.0 | 0.2 | GO:0006089 | lactate metabolic process(GO:0006089) |
0.0 | 0.0 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
0.0 | 0.1 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
0.0 | 0.1 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
0.0 | 0.0 | GO:0002884 | negative regulation of hypersensitivity(GO:0002884) |
0.0 | 0.0 | GO:2000468 | regulation of peroxidase activity(GO:2000468) |
0.0 | 0.0 | GO:2000667 | positive regulation of interleukin-5 secretion(GO:2000664) positive regulation of interleukin-13 secretion(GO:2000667) |
0.0 | 0.1 | GO:0032959 | inositol trisphosphate biosynthetic process(GO:0032959) |
0.0 | 0.1 | GO:0015825 | L-serine transport(GO:0015825) |
0.0 | 0.1 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.0 | 0.1 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
0.0 | 0.0 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
0.0 | 0.1 | GO:1900086 | regulation of peptidyl-tyrosine autophosphorylation(GO:1900084) positive regulation of peptidyl-tyrosine autophosphorylation(GO:1900086) |
0.0 | 0.0 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
0.0 | 0.0 | GO:0070094 | positive regulation of glucagon secretion(GO:0070094) |
0.0 | 0.2 | GO:0017144 | drug metabolic process(GO:0017144) |
0.0 | 0.1 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
0.0 | 0.1 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
0.0 | 0.1 | GO:0060718 | chorionic trophoblast cell differentiation(GO:0060718) |
0.0 | 0.0 | GO:0090310 | negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
0.0 | 0.0 | GO:0010482 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
0.0 | 0.0 | GO:0021699 | cerebellar cortex maturation(GO:0021699) |
0.0 | 0.1 | GO:0034080 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
0.0 | 0.0 | GO:1901069 | guanosine-containing compound catabolic process(GO:1901069) |
0.0 | 0.0 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
0.0 | 0.1 | GO:0033030 | negative regulation of neutrophil apoptotic process(GO:0033030) |
0.0 | 0.1 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
0.0 | 0.1 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
0.0 | 0.1 | GO:1904729 | regulation of intestinal cholesterol absorption(GO:0030300) regulation of intestinal absorption(GO:1904478) regulation of intestinal lipid absorption(GO:1904729) |
0.0 | 0.1 | GO:0061038 | uterus morphogenesis(GO:0061038) |
0.0 | 0.1 | GO:1900107 | regulation of nodal signaling pathway(GO:1900107) |
0.0 | 0.0 | GO:0034184 | positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
0.0 | 0.1 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
0.0 | 0.0 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
0.0 | 0.1 | GO:0055091 | phospholipid homeostasis(GO:0055091) |
0.0 | 0.1 | GO:0006688 | glycosphingolipid biosynthetic process(GO:0006688) |
0.0 | 0.0 | GO:0048208 | vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
0.0 | 0.0 | GO:0097460 | ferrous iron import into cell(GO:0097460) |
0.0 | 0.1 | GO:0070445 | oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
0.0 | 0.1 | GO:0045176 | apical protein localization(GO:0045176) |
0.0 | 0.0 | GO:1900020 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
0.0 | 0.0 | GO:0071280 | cellular response to copper ion(GO:0071280) |
0.0 | 0.0 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
0.0 | 0.1 | GO:0002566 | somatic diversification of immune receptors via somatic mutation(GO:0002566) somatic hypermutation of immunoglobulin genes(GO:0016446) |
0.0 | 0.0 | GO:0071455 | cellular response to increased oxygen levels(GO:0036295) cellular response to hyperoxia(GO:0071455) |
0.0 | 0.1 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
0.0 | 0.0 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.0 | 0.0 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.0 | 0.1 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
0.0 | 0.3 | GO:0019432 | triglyceride biosynthetic process(GO:0019432) |
0.0 | 0.3 | GO:0010591 | regulation of lamellipodium assembly(GO:0010591) |
0.0 | 0.1 | GO:0032071 | regulation of endodeoxyribonuclease activity(GO:0032071) |
0.0 | 0.0 | GO:0042939 | glutathione transport(GO:0034635) tripeptide transport(GO:0042939) |
0.0 | 0.0 | GO:2000370 | positive regulation of clathrin-mediated endocytosis(GO:2000370) |
0.0 | 0.0 | GO:0032741 | positive regulation of interleukin-18 production(GO:0032741) |
0.0 | 0.0 | GO:0072656 | maintenance of protein location in mitochondrion(GO:0072656) |
0.0 | 0.2 | GO:0009303 | rRNA transcription(GO:0009303) |
0.0 | 0.1 | GO:0035999 | tetrahydrofolate interconversion(GO:0035999) |
0.0 | 0.0 | GO:0009209 | CTP biosynthetic process(GO:0006241) pyrimidine ribonucleoside triphosphate biosynthetic process(GO:0009209) CTP metabolic process(GO:0046036) |
0.0 | 0.1 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
0.0 | 0.0 | GO:0033629 | negative regulation of cell adhesion mediated by integrin(GO:0033629) |
0.0 | 0.0 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) |
0.0 | 0.1 | GO:0006107 | oxaloacetate metabolic process(GO:0006107) |
0.0 | 0.1 | GO:0032308 | positive regulation of prostaglandin secretion(GO:0032308) |
0.0 | 0.0 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
0.0 | 0.0 | GO:0071046 | polyadenylation-dependent ncRNA catabolic process(GO:0043634) nuclear ncRNA surveillance(GO:0071029) nuclear polyadenylation-dependent rRNA catabolic process(GO:0071035) nuclear polyadenylation-dependent ncRNA catabolic process(GO:0071046) |
0.0 | 0.1 | GO:0090085 | regulation of protein deubiquitination(GO:0090085) |
0.0 | 0.0 | GO:0060750 | epithelial cell proliferation involved in mammary gland duct elongation(GO:0060750) branch elongation involved in mammary gland duct branching(GO:0060751) |
0.0 | 0.2 | GO:0042438 | melanin biosynthetic process(GO:0042438) |
0.0 | 0.0 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
0.0 | 0.0 | GO:0071503 | response to heparin(GO:0071503) cellular response to heparin(GO:0071504) |
0.0 | 0.1 | GO:0055089 | fatty acid homeostasis(GO:0055089) |
0.0 | 0.1 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
0.0 | 0.0 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
0.0 | 0.1 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
0.0 | 0.0 | GO:0034756 | regulation of iron ion transport(GO:0034756) |
0.0 | 0.2 | GO:0032012 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.0 | 0.1 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
0.0 | 0.1 | GO:0016973 | poly(A)+ mRNA export from nucleus(GO:0016973) |
0.0 | 0.0 | GO:0015770 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.0 | 0.0 | GO:0072488 | ammonium transmembrane transport(GO:0072488) |
0.0 | 0.1 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
0.0 | 0.1 | GO:0001921 | positive regulation of receptor recycling(GO:0001921) |
0.0 | 0.1 | GO:0002862 | negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
0.0 | 0.0 | GO:1903242 | regulation of cardiac muscle adaptation(GO:0010612) regulation of cardiac muscle hypertrophy in response to stress(GO:1903242) |
0.0 | 0.0 | GO:0034196 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
0.0 | 0.2 | GO:0016578 | histone deubiquitination(GO:0016578) |
0.0 | 0.0 | GO:0018197 | peptidyl-aspartic acid modification(GO:0018197) |
0.0 | 0.0 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.0 | 0.1 | GO:1903772 | regulation of viral budding via host ESCRT complex(GO:1903772) |
0.0 | 0.0 | GO:0008105 | asymmetric protein localization(GO:0008105) |
0.0 | 0.1 | GO:0021527 | spinal cord association neuron differentiation(GO:0021527) |
0.0 | 0.0 | GO:0046618 | drug export(GO:0046618) |
0.0 | 0.0 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
0.0 | 0.0 | GO:0032776 | DNA methylation on cytosine within a CG sequence(GO:0010424) DNA methylation on cytosine(GO:0032776) |
0.0 | 0.0 | GO:0060334 | regulation of interferon-gamma-mediated signaling pathway(GO:0060334) |
0.0 | 0.2 | GO:0042538 | hyperosmotic salinity response(GO:0042538) |
0.0 | 0.3 | GO:0045739 | positive regulation of DNA repair(GO:0045739) |
0.0 | 0.0 | GO:0071472 | cellular response to salt stress(GO:0071472) |
0.0 | 0.1 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
0.0 | 0.1 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
0.0 | 0.0 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.0 | 0.0 | GO:0086045 | membrane depolarization during AV node cell action potential(GO:0086045) |
0.0 | 0.0 | GO:0090188 | negative regulation of pancreatic juice secretion(GO:0090188) |
0.0 | 0.0 | GO:0061368 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
0.0 | 0.1 | GO:0046475 | glycerophospholipid catabolic process(GO:0046475) |
0.0 | 0.0 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 0.4 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.1 | 0.5 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.1 | 0.2 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.1 | 0.5 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.1 | 0.6 | GO:0035102 | PRC1 complex(GO:0035102) |
0.1 | 0.6 | GO:0070852 | cell body fiber(GO:0070852) |
0.1 | 0.2 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
0.0 | 0.4 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.0 | 0.2 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.0 | 0.2 | GO:0016942 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
0.0 | 0.2 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.0 | 0.2 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.0 | 0.1 | GO:0043202 | lysosomal lumen(GO:0043202) |
0.0 | 0.2 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.0 | 0.1 | GO:0033269 | internode region of axon(GO:0033269) |
0.0 | 0.3 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.0 | 0.4 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
0.0 | 0.1 | GO:0098536 | deuterosome(GO:0098536) |
0.0 | 0.2 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
0.0 | 0.1 | GO:0031298 | replication fork protection complex(GO:0031298) |
0.0 | 0.2 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
0.0 | 0.1 | GO:0001739 | sex chromatin(GO:0001739) |
0.0 | 0.3 | GO:0000346 | transcription export complex(GO:0000346) |
0.0 | 0.1 | GO:0097433 | dense body(GO:0097433) |
0.0 | 0.1 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.0 | 0.1 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.0 | 0.1 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
0.0 | 0.0 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
0.0 | 0.2 | GO:0097208 | alveolar lamellar body(GO:0097208) |
0.0 | 0.1 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.0 | 0.1 | GO:0030008 | TRAPP complex(GO:0030008) |
0.0 | 0.2 | GO:0016442 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
0.0 | 0.2 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
0.0 | 0.3 | GO:0005685 | U1 snRNP(GO:0005685) |
0.0 | 0.2 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.0 | 0.2 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.0 | 0.1 | GO:0005955 | calcineurin complex(GO:0005955) |
0.0 | 0.1 | GO:0005827 | polar microtubule(GO:0005827) |
0.0 | 0.3 | GO:0043034 | costamere(GO:0043034) |
0.0 | 0.0 | GO:0097427 | microtubule bundle(GO:0097427) |
0.0 | 0.2 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.0 | 0.1 | GO:0070876 | SOSS complex(GO:0070876) |
0.0 | 0.2 | GO:0032426 | stereocilium tip(GO:0032426) |
0.0 | 0.1 | GO:0097342 | ripoptosome(GO:0097342) |
0.0 | 0.2 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.0 | 0.1 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
0.0 | 0.1 | GO:0071458 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) |
0.0 | 0.0 | GO:0005914 | spot adherens junction(GO:0005914) |
0.0 | 0.1 | GO:0031415 | NatA complex(GO:0031415) |
0.0 | 0.0 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
0.0 | 0.1 | GO:0033503 | HULC complex(GO:0033503) |
0.0 | 0.1 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.0 | 0.1 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
0.0 | 0.1 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
0.0 | 0.0 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.0 | 0.1 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.0 | 0.0 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
0.0 | 0.2 | GO:0005614 | interstitial matrix(GO:0005614) |
0.0 | 0.1 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.0 | 0.1 | GO:0030126 | COPI vesicle coat(GO:0030126) |
0.0 | 0.1 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
0.0 | 0.0 | GO:0035189 | Rb-E2F complex(GO:0035189) |
0.0 | 0.1 | GO:0005579 | membrane attack complex(GO:0005579) |
0.0 | 0.0 | GO:0030127 | COPII vesicle coat(GO:0030127) |
0.0 | 0.0 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.0 | 0.2 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.0 | 0.2 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.0 | 0.3 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
0.0 | 0.1 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.0 | 0.1 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.0 | 0.0 | GO:0045293 | mRNA editing complex(GO:0045293) |
0.0 | 0.0 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.0 | 0.1 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.0 | 0.0 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
0.0 | 0.0 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.0 | 0.4 | GO:0005747 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 0.5 | GO:0070644 | vitamin D response element binding(GO:0070644) |
0.1 | 0.4 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
0.1 | 0.1 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
0.1 | 0.3 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
0.1 | 0.5 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
0.1 | 0.3 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
0.1 | 0.3 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.1 | 0.2 | GO:0034191 | apolipoprotein A-I receptor binding(GO:0034191) |
0.1 | 0.4 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
0.1 | 0.3 | GO:0015181 | arginine transmembrane transporter activity(GO:0015181) L-lysine transmembrane transporter activity(GO:0015189) |
0.1 | 0.7 | GO:0019841 | retinol binding(GO:0019841) |
0.1 | 0.2 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.1 | 0.4 | GO:0045545 | syndecan binding(GO:0045545) |
0.1 | 0.2 | GO:0004771 | sterol esterase activity(GO:0004771) |
0.0 | 0.2 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.0 | 0.1 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
0.0 | 0.3 | GO:0043426 | MRF binding(GO:0043426) |
0.0 | 0.1 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
0.0 | 0.2 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.0 | 0.1 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.0 | 0.2 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
0.0 | 0.2 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
0.0 | 0.1 | GO:0031686 | A1 adenosine receptor binding(GO:0031686) |
0.0 | 0.5 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.0 | 0.9 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
0.0 | 0.1 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
0.0 | 0.5 | GO:0048038 | quinone binding(GO:0048038) |
0.0 | 0.2 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
0.0 | 0.2 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
0.0 | 0.1 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.0 | 0.1 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.0 | 0.2 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.0 | 0.3 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.0 | 0.1 | GO:0005347 | ATP transmembrane transporter activity(GO:0005347) |
0.0 | 0.1 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
0.0 | 0.3 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
0.0 | 0.1 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
0.0 | 0.1 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
0.0 | 0.1 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
0.0 | 0.1 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
0.0 | 0.1 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
0.0 | 0.2 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
0.0 | 0.2 | GO:0090482 | vitamin transmembrane transporter activity(GO:0090482) |
0.0 | 0.2 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
0.0 | 0.1 | GO:0080130 | L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
0.0 | 0.6 | GO:0003785 | actin monomer binding(GO:0003785) |
0.0 | 0.1 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
0.0 | 0.4 | GO:0015643 | toxic substance binding(GO:0015643) |
0.0 | 0.1 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
0.0 | 0.1 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
0.0 | 0.1 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.0 | 0.1 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.0 | 0.1 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
0.0 | 0.1 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.0 | 0.2 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
0.0 | 0.1 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
0.0 | 0.1 | GO:0055100 | adiponectin binding(GO:0055100) |
0.0 | 0.1 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
0.0 | 0.1 | GO:0097001 | ceramide binding(GO:0097001) |
0.0 | 0.3 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.0 | 0.1 | GO:0003918 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.0 | 0.1 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
0.0 | 0.4 | GO:0019789 | SUMO transferase activity(GO:0019789) |
0.0 | 0.3 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.0 | 0.3 | GO:0032942 | cobinamide kinase activity(GO:0008819) phytol kinase activity(GO:0010276) phenol kinase activity(GO:0018720) cyclin-dependent protein kinase activating kinase regulator activity(GO:0019914) inositol tetrakisphosphate 2-kinase activity(GO:0032942) heptose 7-phosphate kinase activity(GO:0033785) aminoglycoside phosphotransferase activity(GO:0034071) eukaryotic elongation factor-2 kinase regulator activity(GO:0042556) eukaryotic elongation factor-2 kinase activator activity(GO:0042557) LPPG:FO 2-phospho-L-lactate transferase activity(GO:0043743) cytidine kinase activity(GO:0043771) glycerate 2-kinase activity(GO:0043798) (S)-lactate 2-kinase activity(GO:0043841) phosphoserine:homoserine phosphotransferase activity(GO:0043899) L-seryl-tRNA(Sec) kinase activity(GO:0043915) phosphocholine transferase activity(GO:0044605) GTP-dependent polynucleotide kinase activity(GO:0051735) farnesol kinase activity(GO:0052668) CTP:2-trans,-6-trans-farnesol kinase activity(GO:0052669) geraniol kinase activity(GO:0052670) geranylgeraniol kinase activity(GO:0052671) CTP:geranylgeraniol kinase activity(GO:0052672) prenol kinase activity(GO:0052673) 1-phosphatidylinositol-5-kinase activity(GO:0052810) 1-phosphatidylinositol-3-phosphate 4-kinase activity(GO:0052811) phosphatidylinositol-3,4-bisphosphate 5-kinase activity(GO:0052812) inositol-3,4,6-trisphosphate 1-kinase activity(GO:0052835) inositol 5-diphosphate pentakisphosphate 5-kinase activity(GO:0052836) inositol diphosphate tetrakisphosphate kinase activity(GO:0052839) |
0.0 | 0.1 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.0 | 1.1 | GO:0008391 | arachidonic acid monooxygenase activity(GO:0008391) |
0.0 | 0.4 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
0.0 | 0.2 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.0 | 0.1 | GO:0019862 | IgA binding(GO:0019862) |
0.0 | 0.2 | GO:0034713 | type I transforming growth factor beta receptor binding(GO:0034713) |
0.0 | 0.3 | GO:0070402 | NADPH binding(GO:0070402) |
0.0 | 0.0 | GO:0002060 | purine nucleobase binding(GO:0002060) |
0.0 | 0.3 | GO:0001671 | ATPase activator activity(GO:0001671) |
0.0 | 0.1 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
0.0 | 0.2 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.0 | 0.6 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
0.0 | 0.1 | GO:0016453 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
0.0 | 0.2 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
0.0 | 0.1 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.0 | 0.2 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
0.0 | 0.1 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.0 | 0.1 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.0 | 0.2 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
0.0 | 0.1 | GO:0070492 | oligosaccharide binding(GO:0070492) |
0.0 | 0.4 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.0 | 0.0 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
0.0 | 0.1 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
0.0 | 0.3 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
0.0 | 0.1 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.0 | 0.2 | GO:0030881 | beta-2-microglobulin binding(GO:0030881) |
0.0 | 0.3 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
0.0 | 0.2 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
0.0 | 0.0 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
0.0 | 0.1 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.0 | 0.1 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
0.0 | 0.2 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.0 | 0.3 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
0.0 | 0.0 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
0.0 | 0.0 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
0.0 | 0.1 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
0.0 | 0.5 | GO:0004693 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
0.0 | 0.1 | GO:0030235 | nitric-oxide synthase regulator activity(GO:0030235) |
0.0 | 0.0 | GO:0047391 | alkylglycerophosphoethanolamine phosphodiesterase activity(GO:0047391) |
0.0 | 0.1 | GO:0004556 | alpha-amylase activity(GO:0004556) |
0.0 | 0.1 | GO:0032564 | dATP binding(GO:0032564) |
0.0 | 0.1 | GO:0031701 | angiotensin receptor binding(GO:0031701) |
0.0 | 0.1 | GO:0086007 | voltage-gated calcium channel activity involved in cardiac muscle cell action potential(GO:0086007) |
0.0 | 0.0 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
0.0 | 0.0 | GO:0051434 | BH3 domain binding(GO:0051434) |
0.0 | 0.1 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.0 | 0.1 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.0 | 0.1 | GO:0070324 | thyroid hormone binding(GO:0070324) |
0.0 | 0.0 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
0.0 | 0.2 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
0.0 | 0.0 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
0.0 | 0.0 | GO:0050815 | phosphoserine binding(GO:0050815) |
0.0 | 0.0 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.0 | 0.1 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.0 | 0.1 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.0 | 0.0 | GO:0030911 | TPR domain binding(GO:0030911) |
0.0 | 0.1 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.0 | 0.1 | GO:1990446 | U1 snRNP binding(GO:1990446) |
0.0 | 0.1 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.0 | 0.0 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
0.0 | 0.2 | GO:0019215 | intermediate filament binding(GO:0019215) |
0.0 | 0.1 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
0.0 | 0.0 | GO:2001070 | starch binding(GO:2001070) |
0.0 | 0.0 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.0 | 0.1 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
0.0 | 0.0 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
0.0 | 0.1 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.0 | 0.1 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
0.0 | 0.0 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.0 | 0.0 | GO:0038100 | nodal binding(GO:0038100) |
0.0 | 0.0 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.0 | 0.2 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
0.0 | 0.0 | GO:0019959 | interleukin-8 binding(GO:0019959) |
0.0 | 0.0 | GO:0004802 | transketolase activity(GO:0004802) |
0.0 | 0.0 | GO:0097016 | L27 domain binding(GO:0097016) |
0.0 | 0.5 | GO:0035064 | methylated histone binding(GO:0035064) |
0.0 | 0.0 | GO:0003909 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
0.0 | 0.0 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.0 | 0.1 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.0 | 0.0 | GO:0070513 | death domain binding(GO:0070513) |
0.0 | 0.0 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
0.0 | 0.3 | GO:0042169 | SH2 domain binding(GO:0042169) |
0.0 | 0.1 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.0 | 0.1 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
0.0 | 0.5 | GO:0016763 | transferase activity, transferring pentosyl groups(GO:0016763) |
0.0 | 0.0 | GO:0016015 | morphogen activity(GO:0016015) |
0.0 | 0.2 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
0.0 | 0.3 | GO:0003899 | DNA-directed RNA polymerase activity(GO:0003899) |
0.0 | 0.1 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) |
0.0 | 0.1 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
0.0 | 0.0 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.0 | 0.0 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.0 | 0.1 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.0 | 0.0 | GO:0008948 | oxaloacetate decarboxylase activity(GO:0008948) |
0.0 | 0.0 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.0 | 0.2 | GO:0016645 | oxidoreductase activity, acting on the CH-NH group of donors(GO:0016645) |
0.0 | 0.1 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 1.9 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.0 | 0.7 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.0 | 0.4 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.0 | 0.5 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.0 | 0.1 | PID S1P S1P4 PATHWAY | S1P4 pathway |
0.0 | 0.0 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.0 | 0.1 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
0.0 | 0.4 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
0.0 | 0.2 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.0 | 0.1 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
0.0 | 0.4 | ST ADRENERGIC | Adrenergic Pathway |
0.0 | 0.2 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.0 | 0.0 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.0 | 0.2 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.0 | 0.1 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
0.0 | 0.0 | ST GAQ PATHWAY | G alpha q Pathway |
0.0 | 0.1 | PID ALK2 PATHWAY | ALK2 signaling events |
0.0 | 0.1 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
0.0 | 0.3 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
0.0 | 0.0 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.0 | 0.3 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.0 | 0.3 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
0.0 | 0.2 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
0.0 | 0.3 | PID AURORA B PATHWAY | Aurora B signaling |
0.0 | 0.1 | PID ERBB1 RECEPTOR PROXIMAL PATHWAY | EGF receptor (ErbB1) signaling pathway |
0.0 | 0.3 | PID FGF PATHWAY | FGF signaling pathway |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 0.5 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
0.0 | 0.1 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
0.0 | 0.5 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
0.0 | 0.0 | REACTOME IL 2 SIGNALING | Genes involved in Interleukin-2 signaling |
0.0 | 0.7 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.0 | 0.6 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.0 | 0.3 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
0.0 | 0.7 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.0 | 0.2 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.0 | 0.0 | REACTOME SIGNAL AMPLIFICATION | Genes involved in Signal amplification |
0.0 | 0.3 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.0 | 0.2 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
0.0 | 0.2 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
0.0 | 0.3 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
0.0 | 0.2 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
0.0 | 0.2 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.0 | 0.5 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
0.0 | 0.2 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.0 | 0.2 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
0.0 | 0.2 | REACTOME TRAF6 MEDIATED INDUCTION OF TAK1 COMPLEX | Genes involved in TRAF6 mediated induction of TAK1 complex |
0.0 | 0.0 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
0.0 | 0.2 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
0.0 | 0.2 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.0 | 0.2 | REACTOME VIRAL MESSENGER RNA SYNTHESIS | Genes involved in Viral Messenger RNA Synthesis |
0.0 | 0.1 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.0 | 0.0 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
0.0 | 0.2 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
0.0 | 0.1 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
0.0 | 0.1 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.0 | 0.2 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.0 | 0.2 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
0.0 | 0.1 | REACTOME CTLA4 INHIBITORY SIGNALING | Genes involved in CTLA4 inhibitory signaling |
0.0 | 0.1 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.0 | 0.1 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.0 | 0.0 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
0.0 | 0.1 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.0 | 0.0 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
0.0 | 0.2 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.0 | 0.2 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.0 | 0.0 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
0.0 | 0.1 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
0.0 | 0.1 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
0.0 | 0.0 | REACTOME CYTOKINE SIGNALING IN IMMUNE SYSTEM | Genes involved in Cytokine Signaling in Immune system |