| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Hoxd1
|
ENSMUSG00000042448.4 | homeobox D1 |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr5_125526040_125526191 | 1.69 |
Tmem132b |
transmembrane protein 132B |
5659 |
0.17 |
| chr4_121078016_121078199 | 1.64 |
Zmpste24 |
zinc metallopeptidase, STE24 |
369 |
0.74 |
| chr1_100298746_100298897 | 1.33 |
Gm29667 |
predicted gene 29667 |
16030 |
0.18 |
| chr12_51274477_51274668 | 1.23 |
Rps11-ps4 |
ribosomal protein S11, pseudogene 4 |
22915 |
0.22 |
| chr19_40153747_40153898 | 1.21 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
33464 |
0.13 |
| chr1_102517589_102517767 | 1.14 |
Gm20281 |
predicted gene, 20281 |
58756 |
0.14 |
| chr4_44777019_44777170 | 1.13 |
Zcchc7 |
zinc finger, CCHC domain containing 7 |
16650 |
0.16 |
| chr5_102010214_102010423 | 1.10 |
Wdfy3 |
WD repeat and FYVE domain containing 3 |
28760 |
0.16 |
| chr16_42947764_42948084 | 1.06 |
Ndufs5-ps |
NADH:ubiquinone oxidoreductase core subunit S5, pseudogene |
7707 |
0.21 |
| chr2_38823684_38823849 | 1.05 |
Nr6a1os |
nuclear receptor subfamily 6, group A, member 1, opposite strand |
425 |
0.74 |
| chr6_58611375_58611579 | 1.05 |
Abcg2 |
ATP binding cassette subfamily G member 2 (Junior blood group) |
14806 |
0.19 |
| chr13_44437957_44438156 | 1.02 |
1700029N11Rik |
RIKEN cDNA 1700029N11 gene |
1656 |
0.27 |
| chr3_95881097_95881422 | 1.02 |
Ciart |
circadian associated repressor of transcription |
13 |
0.94 |
| chr1_51751367_51751637 | 0.97 |
Gm28055 |
predicted gene 28055 |
4559 |
0.23 |
| chr3_97649987_97650151 | 0.96 |
Prkab2 |
protein kinase, AMP-activated, beta 2 non-catalytic subunit |
8124 |
0.13 |
| chr16_87627804_87628113 | 0.94 |
Gm22808 |
predicted gene, 22808 |
6838 |
0.21 |
| chr12_57537784_57538085 | 0.92 |
Foxa1 |
forkhead box A1 |
8187 |
0.15 |
| chr19_40138748_40138899 | 0.91 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
48463 |
0.1 |
| chr15_3463467_3463618 | 0.86 |
Ghr |
growth hormone receptor |
8102 |
0.29 |
| chr6_29772335_29772499 | 0.86 |
Ahcyl2 |
S-adenosylhomocysteine hydrolase-like 2 |
3889 |
0.2 |
| chr13_4270161_4270342 | 0.85 |
Akr1c12 |
aldo-keto reductase family 1, member C12 |
9182 |
0.15 |
| chr8_36290613_36290918 | 0.85 |
Lonrf1 |
LON peptidase N-terminal domain and ring finger 1 |
41249 |
0.14 |
| chr19_44401346_44401497 | 0.85 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
5269 |
0.16 |
| chr5_43309511_43309822 | 0.85 |
6030400A10Rik |
RIKEN cDNA 6030400A10 gene |
44509 |
0.11 |
| chr8_93176743_93176912 | 0.85 |
Ces1d |
carboxylesterase 1D |
1538 |
0.3 |
| chr17_81386211_81386362 | 0.84 |
Gm50044 |
predicted gene, 50044 |
15453 |
0.24 |
| chr15_3495710_3495861 | 0.83 |
Ghr |
growth hormone receptor |
24141 |
0.25 |
| chr15_59067650_59068255 | 0.82 |
Mtss1 |
MTSS I-BAR domain containing 1 |
12488 |
0.22 |
| chr2_18048778_18049088 | 0.80 |
Skida1 |
SKI/DACH domain containing 1 |
98 |
0.94 |
| chr19_26823641_26823967 | 0.80 |
4931403E22Rik |
RIKEN cDNA 4931403E22 gene |
103 |
0.97 |
| chr10_111583801_111583952 | 0.79 |
4933440J02Rik |
RIKEN cDNA 4933440J02 gene |
10397 |
0.16 |
| chr3_35970899_35971050 | 0.78 |
Gm43080 |
predicted gene 43080 |
1052 |
0.32 |
| chr11_16790428_16790580 | 0.77 |
Egfr |
epidermal growth factor receptor |
38274 |
0.14 |
| chr11_16843001_16843162 | 0.77 |
Egfros |
epidermal growth factor receptor, opposite strand |
12379 |
0.2 |
| chr17_89646332_89646522 | 0.75 |
Gm50061 |
predicted gene, 50061 |
106099 |
0.08 |
| chr9_60982764_60983106 | 0.74 |
Gm5122 |
predicted gene 5122 |
30546 |
0.14 |
| chr3_8963133_8963313 | 0.74 |
Tpd52 |
tumor protein D52 |
823 |
0.64 |
| chr16_93333790_93334136 | 0.73 |
1810053B23Rik |
RIKEN cDNA 1810053B23 gene |
19226 |
0.18 |
| chr12_73061092_73061267 | 0.73 |
Six1 |
sine oculis-related homeobox 1 |
7292 |
0.2 |
| chr16_24892958_24893109 | 0.73 |
Gm22672 |
predicted gene, 22672 |
8860 |
0.25 |
| chr10_87560730_87560881 | 0.71 |
Pah |
phenylalanine hydroxylase |
14132 |
0.22 |
| chr12_104341895_104342090 | 0.70 |
Serpina3k |
serine (or cysteine) peptidase inhibitor, clade A, member 3K |
3506 |
0.14 |
| chr3_18246603_18246795 | 0.70 |
Cyp7b1 |
cytochrome P450, family 7, subfamily b, polypeptide 1 |
3361 |
0.3 |
| chr4_109104769_109104920 | 0.69 |
Osbpl9 |
oxysterol binding protein-like 9 |
3187 |
0.27 |
| chr6_90499813_90499975 | 0.69 |
Gm44236 |
predicted gene, 44236 |
13408 |
0.1 |
| chr14_46615680_46615835 | 0.69 |
Gm49319 |
predicted gene, 49319 |
4747 |
0.13 |
| chr1_67182326_67182537 | 0.68 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
59405 |
0.11 |
| chr11_16798476_16798627 | 0.67 |
Egfros |
epidermal growth factor receptor, opposite strand |
32151 |
0.16 |
| chr17_63370765_63370929 | 0.67 |
Gm24813 |
predicted gene, 24813 |
23176 |
0.18 |
| chr14_21435070_21435221 | 0.66 |
Gm25864 |
predicted gene, 25864 |
15329 |
0.19 |
| chr2_146546861_146547083 | 0.66 |
4933406D12Rik |
RIKEN cDNA 4933406D12 gene |
4041 |
0.3 |
| chr13_115653330_115653690 | 0.66 |
Gm47892 |
predicted gene, 47892 |
65989 |
0.13 |
| chr2_31519719_31520357 | 0.66 |
Ass1 |
argininosuccinate synthetase 1 |
1548 |
0.36 |
| chr5_150918259_150918412 | 0.66 |
Kl |
klotho |
34272 |
0.15 |
| chr8_40650987_40651138 | 0.65 |
Mtmr7 |
myotubularin related protein 7 |
16265 |
0.14 |
| chr13_9932808_9933042 | 0.65 |
Gm47406 |
predicted gene, 47406 |
40015 |
0.14 |
| chr13_24360335_24360523 | 0.65 |
Gm11342 |
predicted gene 11342 |
15521 |
0.12 |
| chr10_89563955_89564134 | 0.64 |
Gm48087 |
predicted gene, 48087 |
8325 |
0.2 |
| chr13_52979672_52979858 | 0.64 |
Nfil3 |
nuclear factor, interleukin 3, regulated |
1308 |
0.43 |
| chr3_60525375_60525543 | 0.64 |
Mbnl1 |
muscleblind like splicing factor 1 |
2669 |
0.31 |
| chr4_47366562_47366857 | 0.64 |
Tgfbr1 |
transforming growth factor, beta receptor I |
13099 |
0.22 |
| chr3_18165162_18165350 | 0.63 |
Gm23686 |
predicted gene, 23686 |
12369 |
0.23 |
| chr3_51255928_51256079 | 0.63 |
Elf2 |
E74-like factor 2 |
4238 |
0.15 |
| chr10_52420605_52420773 | 0.62 |
Nus1 |
NUS1 dehydrodolichyl diphosphate synthase subunit |
3142 |
0.15 |
| chr6_72120521_72121047 | 0.61 |
4933431G14Rik |
RIKEN cDNA 4933431G14 gene |
2156 |
0.2 |
| chr2_107628721_107628872 | 0.61 |
Gm9864 |
predicted gene 9864 |
28257 |
0.26 |
| chr10_87870357_87870520 | 0.60 |
Igf1os |
insulin-like growth factor 1, opposite strand |
7057 |
0.21 |
| chr10_42271611_42271917 | 0.60 |
Foxo3 |
forkhead box O3 |
4932 |
0.28 |
| chr4_147433621_147433808 | 0.60 |
Gm13161 |
predicted gene 13161 |
9757 |
0.14 |
| chr19_56521472_56521623 | 0.59 |
Dclre1a |
DNA cross-link repair 1A |
15835 |
0.17 |
| chr4_148590620_148590972 | 0.58 |
Srm |
spermidine synthase |
707 |
0.49 |
| chr10_10925442_10925593 | 0.58 |
Gm48406 |
predicted gene, 48406 |
110399 |
0.06 |
| chr17_80022007_80022158 | 0.58 |
Gm22215 |
predicted gene, 22215 |
11432 |
0.14 |
| chr2_58787554_58787770 | 0.58 |
Upp2 |
uridine phosphorylase 2 |
22337 |
0.18 |
| chr15_41832966_41833117 | 0.58 |
Oxr1 |
oxidation resistance 1 |
2048 |
0.35 |
| chr5_40908767_40908928 | 0.58 |
4930519E07Rik |
RIKEN cDNA 4930519E07 gene |
372389 |
0.01 |
| chr9_109966945_109967106 | 0.57 |
Map4 |
microtubule-associated protein 4 |
1992 |
0.21 |
| chr5_102009929_102010121 | 0.57 |
Wdfy3 |
WD repeat and FYVE domain containing 3 |
28467 |
0.16 |
| chr6_27967716_27967883 | 0.57 |
Mir592 |
microRNA 592 |
31049 |
0.23 |
| chr7_65902304_65902456 | 0.57 |
Pcsk6 |
proprotein convertase subtilisin/kexin type 6 |
39948 |
0.14 |
| chr16_78574210_78574428 | 0.57 |
D16Ertd472e |
DNA segment, Chr 16, ERATO Doi 472, expressed |
2315 |
0.29 |
| chr9_15301981_15302132 | 0.57 |
4931406C07Rik |
RIKEN cDNA 4931406C07 gene |
500 |
0.46 |
| chr4_88893074_88893256 | 0.56 |
Ifne |
interferon epsilon |
12964 |
0.08 |
| chr3_58520131_58520481 | 0.56 |
Eif2a |
eukaryotic translation initiation factor 2A |
5515 |
0.16 |
| chr3_102384557_102384708 | 0.56 |
Gm43245 |
predicted gene 43245 |
5375 |
0.21 |
| chr4_101198122_101198415 | 0.56 |
Gm24468 |
predicted gene, 24468 |
11504 |
0.14 |
| chrX_85734642_85734808 | 0.56 |
Gk |
glycerol kinase |
2885 |
0.21 |
| chr18_12524493_12524662 | 0.56 |
Gm29200 |
predicted gene 29200 |
20151 |
0.14 |
| chr3_95872352_95872534 | 0.56 |
C920021L13Rik |
RIKEN cDNA C920021L13 gene |
912 |
0.26 |
| chr2_31489958_31490302 | 0.56 |
Ass1 |
argininosuccinate synthetase 1 |
7642 |
0.19 |
| chr10_87040962_87041138 | 0.56 |
1700113H08Rik |
RIKEN cDNA 1700113H08 gene |
16995 |
0.16 |
| chr16_6503702_6503861 | 0.55 |
Rbfox1 |
RNA binding protein, fox-1 homolog (C. elegans) 1 |
154643 |
0.05 |
| chr19_16280365_16280542 | 0.55 |
Gm17068 |
predicted gene 17068 |
2656 |
0.25 |
| chr11_111996515_111996723 | 0.55 |
Gm11679 |
predicted gene 11679 |
46959 |
0.19 |
| chr15_38105734_38106027 | 0.55 |
Gm49312 |
predicted gene, 49312 |
26778 |
0.13 |
| chr17_64607771_64607970 | 0.55 |
Man2a1 |
mannosidase 2, alpha 1 |
7134 |
0.26 |
| chr12_32692767_32692945 | 0.55 |
Gm18726 |
predicted gene, 18726 |
17305 |
0.2 |
| chr9_122826708_122826859 | 0.54 |
Gm35549 |
predicted gene, 35549 |
17103 |
0.1 |
| chr12_73861884_73862127 | 0.54 |
Gm15283 |
predicted gene 15283 |
7607 |
0.18 |
| chr17_28513542_28513712 | 0.54 |
Fkbp5 |
FK506 binding protein 5 |
2270 |
0.13 |
| chr17_70661451_70661755 | 0.54 |
5031415H12Rik |
RIKEN cDNA 5031415H12 gene |
93979 |
0.07 |
| chr5_117089265_117089549 | 0.54 |
Suds3 |
suppressor of defective silencing 3 homolog (S. cerevisiae) |
9404 |
0.15 |
| chr5_66421556_66421781 | 0.54 |
Gm43792 |
predicted gene 43792 |
10458 |
0.16 |
| chr4_126764112_126764263 | 0.54 |
AU040320 |
expressed sequence AU040320 |
10361 |
0.13 |
| chr8_109803384_109803547 | 0.53 |
Ap1g1 |
adaptor protein complex AP-1, gamma 1 subunit |
24559 |
0.12 |
| chr2_31487515_31488471 | 0.53 |
Ass1 |
argininosuccinate synthetase 1 |
9779 |
0.18 |
| chr2_154875946_154876097 | 0.53 |
Eif2s2 |
eukaryotic translation initiation factor 2, subunit 2 (beta) |
16761 |
0.19 |
| chr10_87932167_87932318 | 0.53 |
Tyms-ps |
thymidylate synthase, pseudogene |
34605 |
0.14 |
| chr3_131485378_131485553 | 0.52 |
Sgms2 |
sphingomyelin synthase 2 |
5014 |
0.28 |
| chr8_94394237_94394701 | 0.52 |
Herpud1 |
homocysteine-inducible, endoplasmic reticulum stress-inducible, ubiquitin-like domain member 1 |
938 |
0.39 |
| chr12_41068657_41068813 | 0.52 |
Immp2l |
IMP2 inner mitochondrial membrane peptidase-like (S. cerevisiae) |
423 |
0.86 |
| chr2_32606655_32606830 | 0.52 |
St6galnac6 |
ST6 (alpha-N-acetyl-neuraminyl-2,3-beta-galactosyl-1,3)-N-acetylgalactosaminide alpha-2,6-sialyltransferase 6 |
219 |
0.84 |
| chr9_108729006_108729157 | 0.51 |
Gm24259 |
predicted gene, 24259 |
9777 |
0.1 |
| chr13_109652718_109653039 | 0.51 |
Pde4d |
phosphodiesterase 4D, cAMP specific |
20098 |
0.29 |
| chr6_72155996_72156358 | 0.51 |
Gm38832 |
predicted gene, 38832 |
6672 |
0.15 |
| chr18_54739961_54740121 | 0.51 |
Gm5821 |
predicted gene 5821 |
26091 |
0.21 |
| chr5_107874706_107874894 | 0.51 |
Evi5 |
ecotropic viral integration site 5 |
244 |
0.86 |
| chr1_59687443_59687606 | 0.51 |
Nop58 |
NOP58 ribonucleoprotein |
2470 |
0.14 |
| chr10_89450844_89451017 | 0.51 |
Gas2l3 |
growth arrest-specific 2 like 3 |
6963 |
0.25 |
| chr9_106788095_106788832 | 0.51 |
Rad54l2 |
RAD54 like 2 (S. cerevisiae) |
713 |
0.62 |
| chr5_92607049_92607221 | 0.51 |
Stbd1 |
starch binding domain 1 |
4067 |
0.19 |
| chr19_44394517_44394772 | 0.51 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
12046 |
0.14 |
| chr1_63136268_63136443 | 0.50 |
Ndufs1 |
NADH:ubiquinone oxidoreductase core subunit S1 |
8606 |
0.09 |
| chr10_10818471_10818631 | 0.50 |
4930567K20Rik |
RIKEN cDNA 4930567K20 gene |
67471 |
0.1 |
| chr2_73628966_73629117 | 0.50 |
Chn1 |
chimerin 1 |
3301 |
0.21 |
| chr3_5425056_5425268 | 0.50 |
4930555M17Rik |
RIKEN cDNA 4930555M17 gene |
90171 |
0.09 |
| chr16_10675930_10676129 | 0.50 |
Gm15558 |
predicted gene 15558 |
7510 |
0.18 |
| chr9_66591422_66591607 | 0.49 |
Usp3 |
ubiquitin specific peptidase 3 |
1444 |
0.42 |
| chr9_122850567_122851008 | 0.49 |
Gm47140 |
predicted gene, 47140 |
2369 |
0.16 |
| chr11_80974682_80974867 | 0.49 |
Gm11416 |
predicted gene 11416 |
72020 |
0.1 |
| chr12_54960526_54960699 | 0.49 |
Gm27014 |
predicted gene, 27014 |
2452 |
0.2 |
| chr7_116034196_116034353 | 0.49 |
Sox6 |
SRY (sex determining region Y)-box 6 |
239 |
0.89 |
| chr15_3450798_3451092 | 0.49 |
Ghr |
growth hormone receptor |
20699 |
0.26 |
| chr6_116085797_116086002 | 0.48 |
Tmcc1 |
transmembrane and coiled coil domains 1 |
12743 |
0.16 |
| chr13_75387054_75387205 | 0.48 |
Gm48234 |
predicted gene, 48234 |
92258 |
0.07 |
| chr8_22874695_22874860 | 0.48 |
Gm45555 |
predicted gene 45555 |
1188 |
0.43 |
| chr1_162892544_162892705 | 0.48 |
Fmo2 |
flavin containing monooxygenase 2 |
5860 |
0.19 |
| chr5_151041237_151041402 | 0.48 |
Gm8675 |
predicted gene 8675 |
32018 |
0.17 |
| chr11_68854403_68854915 | 0.48 |
Ndel1 |
nudE neurodevelopment protein 1 like 1 |
1524 |
0.3 |
| chr11_111269853_111270023 | 0.48 |
Gm11675 |
predicted gene 11675 |
6162 |
0.34 |
| chr2_42022610_42022815 | 0.48 |
Gm13461 |
predicted gene 13461 |
33883 |
0.23 |
| chr5_97075928_97076348 | 0.48 |
Paqr3 |
progestin and adipoQ receptor family member III |
21633 |
0.15 |
| chr19_40191993_40192245 | 0.48 |
Gm5827 |
predicted gene 5827 |
1081 |
0.44 |
| chr11_16854059_16854210 | 0.47 |
Egfros |
epidermal growth factor receptor, opposite strand |
23432 |
0.17 |
| chr4_6239539_6239806 | 0.47 |
Gm11798 |
predicted gene 11798 |
21293 |
0.18 |
| chr17_46054574_46054727 | 0.47 |
Vegfa |
vascular endothelial growth factor A |
22281 |
0.12 |
| chr9_80629501_80629676 | 0.47 |
Gm48387 |
predicted gene, 48387 |
28491 |
0.22 |
| chr1_67197806_67198015 | 0.46 |
Gm15668 |
predicted gene 15668 |
51290 |
0.13 |
| chr13_8847939_8848370 | 0.46 |
Wdr37 |
WD repeat domain 37 |
517 |
0.67 |
| chr8_44955232_44955417 | 0.46 |
Fat1 |
FAT atypical cadherin 1 |
5110 |
0.23 |
| chr19_12654035_12654281 | 0.46 |
Gm24521 |
predicted gene, 24521 |
11097 |
0.09 |
| chr6_52610697_52610915 | 0.46 |
Gm44434 |
predicted gene, 44434 |
7561 |
0.15 |
| chr9_67840552_67841087 | 0.46 |
Vps13c |
vacuolar protein sorting 13C |
407 |
0.85 |
| chr10_24362567_24362800 | 0.46 |
Gm15271 |
predicted gene 15271 |
84807 |
0.08 |
| chr9_55280024_55280330 | 0.46 |
Nrg4 |
neuregulin 4 |
3395 |
0.23 |
| chr18_51150358_51150691 | 0.46 |
Prr16 |
proline rich 16 |
32786 |
0.23 |
| chr2_160865219_160865594 | 0.46 |
Zhx3 |
zinc fingers and homeoboxes 3 |
5775 |
0.14 |
| chr14_59199574_59199727 | 0.45 |
Rcbtb1 |
regulator of chromosome condensation (RCC1) and BTB (POZ) domain containing protein 1 |
1559 |
0.37 |
| chr11_16764973_16765411 | 0.45 |
Egfr |
epidermal growth factor receptor |
12962 |
0.2 |
| chr11_95385743_95385947 | 0.45 |
Slc35b1 |
solute carrier family 35, member B1 |
939 |
0.38 |
| chr10_69217231_69217448 | 0.45 |
Rhobtb1 |
Rho-related BTB domain containing 1 |
2037 |
0.3 |
| chr8_45719244_45719451 | 0.45 |
Sorbs2 |
sorbin and SH3 domain containing 2 |
23834 |
0.18 |
| chr16_43534199_43534642 | 0.45 |
Zbtb20 |
zinc finger and BTB domain containing 20 |
24112 |
0.21 |
| chr5_123975512_123975863 | 0.45 |
Hip1r |
huntingtin interacting protein 1 related |
2059 |
0.19 |
| chr2_36201411_36201590 | 0.45 |
Gm13429 |
predicted gene 13429 |
814 |
0.51 |
| chr19_21654390_21654886 | 0.45 |
Abhd17b |
abhydrolase domain containing 17B |
1113 |
0.45 |
| chr1_67227292_67227476 | 0.45 |
Gm15668 |
predicted gene 15668 |
21816 |
0.2 |
| chr9_106264996_106265377 | 0.44 |
Poc1a |
POC1 centriolar protein A |
15875 |
0.1 |
| chr12_73341772_73342027 | 0.44 |
Slc38a6 |
solute carrier family 38, member 6 |
2468 |
0.25 |
| chr3_118590994_118591174 | 0.44 |
Dpyd |
dihydropyrimidine dehydrogenase |
28898 |
0.17 |
| chr18_65154932_65155123 | 0.44 |
Nedd4l |
neural precursor cell expressed, developmentally down-regulated gene 4-like |
707 |
0.74 |
| chr18_75661611_75661825 | 0.44 |
Ctif |
CBP80/20-dependent translation initiation factor |
24445 |
0.23 |
| chr15_98925214_98925388 | 0.44 |
Lmbr1l |
limb region 1 like |
7070 |
0.07 |
| chr11_12501574_12501742 | 0.44 |
Cobl |
cordon-bleu WH2 repeat |
36698 |
0.22 |
| chr6_144070883_144071211 | 0.44 |
Sox5os1 |
SRY (sex determining region Y)-box 5, opposite strand 1 |
49139 |
0.17 |
| chr19_12685171_12685322 | 0.44 |
Gm49772 |
predicted gene, 49772 |
3475 |
0.12 |
| chr18_33335901_33336212 | 0.44 |
Gm5503 |
predicted gene 5503 |
48899 |
0.16 |
| chr11_58614498_58614839 | 0.44 |
2210407C18Rik |
RIKEN cDNA 2210407C18 gene |
1176 |
0.25 |
| chr1_172700535_172700739 | 0.43 |
Crp |
C-reactive protein, pentraxin-related |
2581 |
0.25 |
| chr8_105090981_105091315 | 0.43 |
Ces3b |
carboxylesterase 3B |
2529 |
0.16 |
| chr2_31505484_31505674 | 0.43 |
Ass1 |
argininosuccinate synthetase 1 |
4853 |
0.2 |
| chr5_90891820_90892079 | 0.43 |
Cxcl1 |
chemokine (C-X-C motif) ligand 1 |
706 |
0.49 |
| chr10_88505415_88505608 | 0.43 |
Chpt1 |
choline phosphotransferase 1 |
1438 |
0.36 |
| chr4_84548710_84548884 | 0.43 |
Bnc2 |
basonuclin 2 |
2178 |
0.44 |
| chr2_104594636_104594787 | 0.43 |
Cstf3 |
cleavage stimulation factor, 3' pre-RNA, subunit 3 |
4093 |
0.15 |
| chr5_20590310_20590514 | 0.43 |
Gm3544 |
predicted gene 3544 |
1816 |
0.41 |
| chr2_67956563_67957019 | 0.43 |
Gm37964 |
predicted gene, 37964 |
58195 |
0.14 |
| chr4_135255267_135255418 | 0.43 |
Clic4 |
chloride intracellular channel 4 (mitochondrial) |
17472 |
0.14 |
| chr1_88055296_88055515 | 0.43 |
Ugt1a10 |
UDP glycosyltransferase 1 family, polypeptide A10 |
6 |
0.94 |
| chr1_171034205_171034368 | 0.43 |
Gm26110 |
predicted gene, 26110 |
6321 |
0.1 |
| chr11_16830427_16830830 | 0.43 |
Egfros |
epidermal growth factor receptor, opposite strand |
74 |
0.98 |
| chr16_65665507_65665824 | 0.42 |
Gm49633 |
predicted gene, 49633 |
52246 |
0.14 |
| chr9_48787462_48787613 | 0.42 |
Zbtb16 |
zinc finger and BTB domain containing 16 |
48408 |
0.15 |
| chr13_63290686_63291046 | 0.42 |
Aopep |
aminopeptidase O |
7927 |
0.08 |
| chr7_68285442_68285612 | 0.42 |
Gm16157 |
predicted gene 16157 |
8933 |
0.14 |
| chr5_122936823_122936974 | 0.42 |
Kdm2b |
lysine (K)-specific demethylase 2B |
11096 |
0.13 |
| chr2_103790393_103790544 | 0.42 |
Caprin1 |
cell cycle associated protein 1 |
6076 |
0.11 |
| chr6_31253045_31253249 | 0.42 |
2210408F21Rik |
RIKEN cDNA 2210408F21 gene |
24701 |
0.14 |
| chr15_57218546_57218718 | 0.42 |
Gm26178 |
predicted gene, 26178 |
20481 |
0.23 |
| chr7_39809662_39809816 | 0.42 |
4930558N11Rik |
RIKEN cDNA 4930558N11 gene |
11997 |
0.16 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 1.1 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
| 0.4 | 1.1 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
| 0.3 | 1.0 | GO:0010046 | response to mycotoxin(GO:0010046) |
| 0.2 | 0.9 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.2 | 0.8 | GO:0046449 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
| 0.2 | 0.5 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
| 0.2 | 0.5 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
| 0.1 | 0.4 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.1 | 0.6 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
| 0.1 | 0.4 | GO:0006068 | ethanol catabolic process(GO:0006068) |
| 0.1 | 0.3 | GO:0035973 | aggrephagy(GO:0035973) |
| 0.1 | 0.5 | GO:0006207 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
| 0.1 | 0.4 | GO:1903964 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.1 | 0.3 | GO:0070340 | detection of bacterial lipopeptide(GO:0070340) |
| 0.1 | 0.3 | GO:0060523 | prostate epithelial cord elongation(GO:0060523) prostate gland morphogenetic growth(GO:0060737) |
| 0.1 | 0.6 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
| 0.1 | 0.5 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.1 | 0.3 | GO:0046104 | thymidine metabolic process(GO:0046104) |
| 0.1 | 0.3 | GO:0046271 | phenylpropanoid catabolic process(GO:0046271) |
| 0.1 | 0.4 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
| 0.1 | 0.4 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
| 0.1 | 0.3 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
| 0.1 | 0.3 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
| 0.1 | 0.4 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.1 | 0.3 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
| 0.1 | 0.2 | GO:0006538 | glutamate catabolic process(GO:0006538) |
| 0.1 | 0.4 | GO:0046618 | drug export(GO:0046618) |
| 0.1 | 0.2 | GO:0034310 | primary alcohol catabolic process(GO:0034310) |
| 0.1 | 0.2 | GO:2000729 | positive regulation of mesenchymal cell proliferation involved in ureter development(GO:2000729) |
| 0.1 | 0.3 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
| 0.1 | 0.2 | GO:0003162 | atrioventricular node development(GO:0003162) |
| 0.1 | 0.2 | GO:0071233 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
| 0.1 | 0.2 | GO:0030397 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
| 0.1 | 0.1 | GO:0006067 | ethanol metabolic process(GO:0006067) ethanol oxidation(GO:0006069) |
| 0.1 | 0.3 | GO:0010694 | positive regulation of alkaline phosphatase activity(GO:0010694) |
| 0.1 | 0.2 | GO:0000430 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) |
| 0.1 | 0.2 | GO:0032383 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.1 | 0.2 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
| 0.1 | 0.6 | GO:0052697 | xenobiotic glucuronidation(GO:0052697) |
| 0.1 | 0.2 | GO:0048696 | regulation of collateral sprouting in absence of injury(GO:0048696) |
| 0.1 | 0.2 | GO:0070947 | neutrophil mediated killing of fungus(GO:0070947) |
| 0.1 | 0.5 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
| 0.1 | 0.2 | GO:0051025 | negative regulation of immunoglobulin secretion(GO:0051025) |
| 0.1 | 0.3 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
| 0.1 | 0.4 | GO:0015871 | choline transport(GO:0015871) |
| 0.1 | 0.2 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 0.1 | 0.3 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
| 0.1 | 0.2 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
| 0.1 | 0.2 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.1 | 0.3 | GO:0015781 | nucleotide-sugar transport(GO:0015780) pyrimidine nucleotide-sugar transport(GO:0015781) |
| 0.1 | 0.2 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.1 | 0.1 | GO:0045608 | negative regulation of auditory receptor cell differentiation(GO:0045608) |
| 0.1 | 0.3 | GO:0044362 | modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) |
| 0.1 | 0.3 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.1 | 0.5 | GO:0043651 | linoleic acid metabolic process(GO:0043651) |
| 0.1 | 0.3 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
| 0.1 | 0.1 | GO:0070103 | regulation of interleukin-6-mediated signaling pathway(GO:0070103) |
| 0.1 | 0.2 | GO:0070782 | phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
| 0.1 | 0.2 | GO:0006059 | hexitol metabolic process(GO:0006059) |
| 0.1 | 0.2 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
| 0.1 | 0.4 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
| 0.1 | 0.2 | GO:0018406 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.1 | 0.4 | GO:0051657 | maintenance of organelle location(GO:0051657) |
| 0.1 | 0.1 | GO:0070672 | response to interleukin-15(GO:0070672) |
| 0.1 | 0.9 | GO:0045475 | locomotor rhythm(GO:0045475) |
| 0.1 | 0.2 | GO:0006106 | fumarate metabolic process(GO:0006106) |
| 0.1 | 0.2 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
| 0.1 | 0.2 | GO:0042524 | negative regulation of tyrosine phosphorylation of Stat5 protein(GO:0042524) |
| 0.1 | 0.6 | GO:0009404 | toxin metabolic process(GO:0009404) |
| 0.1 | 0.2 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
| 0.1 | 0.1 | GO:0007228 | positive regulation of hh target transcription factor activity(GO:0007228) |
| 0.1 | 0.2 | GO:0061419 | positive regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061419) |
| 0.1 | 0.5 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.1 | 0.2 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
| 0.1 | 0.2 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
| 0.0 | 0.1 | GO:0009446 | putrescine biosynthetic process(GO:0009446) putrescine biosynthetic process from ornithine(GO:0033387) |
| 0.0 | 0.1 | GO:0046469 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
| 0.0 | 0.2 | GO:0061724 | lipophagy(GO:0061724) |
| 0.0 | 0.2 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
| 0.0 | 0.5 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
| 0.0 | 0.2 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.0 | 0.5 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
| 0.0 | 0.1 | GO:0060468 | prevention of polyspermy(GO:0060468) |
| 0.0 | 0.1 | GO:0061535 | glutamate secretion, neurotransmission(GO:0061535) |
| 0.0 | 0.2 | GO:0042737 | drug catabolic process(GO:0042737) |
| 0.0 | 0.1 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 0.0 | 0.1 | GO:0001997 | positive regulation of the force of heart contraction by epinephrine-norepinephrine(GO:0001997) positive regulation of the force of heart contraction by chemical signal(GO:0003099) |
| 0.0 | 0.1 | GO:1901740 | negative regulation of myoblast fusion(GO:1901740) |
| 0.0 | 0.2 | GO:0090168 | Golgi reassembly(GO:0090168) |
| 0.0 | 0.1 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
| 0.0 | 0.1 | GO:0070669 | response to interleukin-2(GO:0070669) |
| 0.0 | 0.1 | GO:0032489 | regulation of Cdc42 protein signal transduction(GO:0032489) |
| 0.0 | 0.1 | GO:0035672 | oligopeptide transmembrane transport(GO:0035672) |
| 0.0 | 0.3 | GO:0006013 | mannose metabolic process(GO:0006013) |
| 0.0 | 0.1 | GO:0014016 | neuroblast differentiation(GO:0014016) |
| 0.0 | 0.1 | GO:1903660 | regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
| 0.0 | 0.1 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
| 0.0 | 0.0 | GO:1900019 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
| 0.0 | 0.2 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
| 0.0 | 0.1 | GO:1900045 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.0 | 0.1 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
| 0.0 | 0.2 | GO:0001547 | antral ovarian follicle growth(GO:0001547) |
| 0.0 | 0.1 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
| 0.0 | 0.1 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
| 0.0 | 0.3 | GO:0045908 | negative regulation of vasodilation(GO:0045908) |
| 0.0 | 0.3 | GO:0000467 | exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) |
| 0.0 | 0.1 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
| 0.0 | 0.5 | GO:0070723 | response to cholesterol(GO:0070723) |
| 0.0 | 0.6 | GO:0031954 | positive regulation of protein autophosphorylation(GO:0031954) |
| 0.0 | 0.2 | GO:0010612 | regulation of cardiac muscle adaptation(GO:0010612) regulation of cardiac muscle hypertrophy in response to stress(GO:1903242) |
| 0.0 | 0.2 | GO:0044829 | positive regulation by host of viral genome replication(GO:0044829) |
| 0.0 | 0.1 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
| 0.0 | 0.2 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
| 0.0 | 0.3 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.0 | 0.1 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
| 0.0 | 0.1 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.0 | 0.0 | GO:0075136 | response to defenses of other organism involved in symbiotic interaction(GO:0052173) response to host defenses(GO:0052200) response to host(GO:0075136) |
| 0.0 | 0.1 | GO:0006573 | valine metabolic process(GO:0006573) |
| 0.0 | 0.1 | GO:0008050 | female courtship behavior(GO:0008050) |
| 0.0 | 0.2 | GO:0071763 | nuclear membrane organization(GO:0071763) |
| 0.0 | 0.1 | GO:0036394 | amylase secretion(GO:0036394) |
| 0.0 | 0.1 | GO:0003160 | endocardium morphogenesis(GO:0003160) |
| 0.0 | 0.2 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.0 | 0.0 | GO:0072107 | regulation of ureteric bud formation(GO:0072106) positive regulation of ureteric bud formation(GO:0072107) |
| 0.0 | 0.1 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.0 | 0.1 | GO:0048669 | collateral sprouting in absence of injury(GO:0048669) |
| 0.0 | 0.6 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.0 | 0.1 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
| 0.0 | 0.1 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.0 | 0.1 | GO:0032741 | positive regulation of interleukin-18 production(GO:0032741) |
| 0.0 | 0.0 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
| 0.0 | 0.1 | GO:0010963 | regulation of L-arginine import(GO:0010963) |
| 0.0 | 0.1 | GO:0001842 | neural fold formation(GO:0001842) |
| 0.0 | 0.1 | GO:0072584 | caveolin-mediated endocytosis(GO:0072584) |
| 0.0 | 0.1 | GO:0060956 | endocardial cell differentiation(GO:0060956) |
| 0.0 | 0.1 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
| 0.0 | 0.1 | GO:0048478 | replication fork protection(GO:0048478) |
| 0.0 | 0.2 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
| 0.0 | 0.0 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
| 0.0 | 0.2 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.0 | 0.0 | GO:0002215 | defense response to nematode(GO:0002215) |
| 0.0 | 0.1 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.0 | 0.1 | GO:0032959 | inositol trisphosphate biosynthetic process(GO:0032959) |
| 0.0 | 0.1 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
| 0.0 | 0.1 | GO:2000370 | positive regulation of clathrin-mediated endocytosis(GO:2000370) |
| 0.0 | 0.1 | GO:0000957 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
| 0.0 | 0.1 | GO:2000618 | regulation of histone H4-K16 acetylation(GO:2000618) |
| 0.0 | 0.2 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
| 0.0 | 0.1 | GO:0006768 | biotin metabolic process(GO:0006768) |
| 0.0 | 0.1 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.0 | 0.0 | GO:0021564 | vagus nerve development(GO:0021564) |
| 0.0 | 0.1 | GO:0035627 | ceramide transport(GO:0035627) |
| 0.0 | 0.1 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
| 0.0 | 0.1 | GO:0031585 | regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031585) |
| 0.0 | 0.0 | GO:0071046 | polyadenylation-dependent ncRNA catabolic process(GO:0043634) nuclear ncRNA surveillance(GO:0071029) nuclear polyadenylation-dependent rRNA catabolic process(GO:0071035) nuclear polyadenylation-dependent ncRNA catabolic process(GO:0071046) |
| 0.0 | 0.1 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
| 0.0 | 0.0 | GO:0044314 | protein K27-linked ubiquitination(GO:0044314) |
| 0.0 | 0.1 | GO:1990928 | response to amino acid starvation(GO:1990928) |
| 0.0 | 0.1 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.0 | 0.1 | GO:0034756 | regulation of iron ion transport(GO:0034756) |
| 0.0 | 0.1 | GO:0034227 | tRNA thio-modification(GO:0034227) |
| 0.0 | 0.6 | GO:0006376 | mRNA splice site selection(GO:0006376) |
| 0.0 | 0.0 | GO:0006533 | aspartate catabolic process(GO:0006533) |
| 0.0 | 0.1 | GO:0032077 | positive regulation of deoxyribonuclease activity(GO:0032077) |
| 0.0 | 0.1 | GO:0046098 | guanine metabolic process(GO:0046098) |
| 0.0 | 0.1 | GO:0061010 | gall bladder development(GO:0061010) |
| 0.0 | 0.1 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.0 | 0.1 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 0.0 | 0.2 | GO:0035646 | endosome to melanosome transport(GO:0035646) endosome to pigment granule transport(GO:0043485) pigment granule maturation(GO:0048757) |
| 0.0 | 0.1 | GO:0032898 | neurotrophin production(GO:0032898) |
| 0.0 | 0.2 | GO:0000012 | single strand break repair(GO:0000012) |
| 0.0 | 0.1 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
| 0.0 | 0.4 | GO:0045898 | regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045898) |
| 0.0 | 0.2 | GO:0021960 | anterior commissure morphogenesis(GO:0021960) |
| 0.0 | 0.1 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
| 0.0 | 0.1 | GO:0036023 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) |
| 0.0 | 0.1 | GO:0032058 | positive regulation of translational initiation in response to stress(GO:0032058) |
| 0.0 | 0.1 | GO:0072718 | response to cisplatin(GO:0072718) |
| 0.0 | 0.3 | GO:0045116 | protein neddylation(GO:0045116) |
| 0.0 | 0.1 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
| 0.0 | 0.1 | GO:0071865 | regulation of apoptotic process in bone marrow(GO:0071865) negative regulation of apoptotic process in bone marrow(GO:0071866) |
| 0.0 | 0.1 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
| 0.0 | 0.1 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.0 | 0.1 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.0 | 0.1 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
| 0.0 | 0.5 | GO:0016578 | histone deubiquitination(GO:0016578) |
| 0.0 | 0.0 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
| 0.0 | 0.0 | GO:0006570 | tyrosine metabolic process(GO:0006570) |
| 0.0 | 0.1 | GO:0044597 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.0 | 0.1 | GO:0051799 | negative regulation of hair follicle development(GO:0051799) |
| 0.0 | 0.1 | GO:0019740 | nitrogen utilization(GO:0019740) |
| 0.0 | 0.1 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
| 0.0 | 0.0 | GO:1900623 | regulation of monocyte aggregation(GO:1900623) positive regulation of monocyte aggregation(GO:1900625) |
| 0.0 | 0.0 | GO:1903999 | negative regulation of eating behavior(GO:1903999) |
| 0.0 | 0.0 | GO:2000646 | positive regulation of receptor catabolic process(GO:2000646) |
| 0.0 | 0.0 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
| 0.0 | 0.0 | GO:2000304 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
| 0.0 | 0.3 | GO:0042744 | hydrogen peroxide catabolic process(GO:0042744) |
| 0.0 | 0.1 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
| 0.0 | 0.1 | GO:0072108 | positive regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0072108) |
| 0.0 | 0.0 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
| 0.0 | 0.1 | GO:1903689 | regulation of wound healing, spreading of epidermal cells(GO:1903689) |
| 0.0 | 0.2 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
| 0.0 | 0.1 | GO:0048597 | post-embryonic camera-type eye morphogenesis(GO:0048597) |
| 0.0 | 0.0 | GO:0003223 | ventricular compact myocardium morphogenesis(GO:0003223) |
| 0.0 | 0.0 | GO:0071492 | cellular response to UV-A(GO:0071492) |
| 0.0 | 0.1 | GO:1902969 | mitotic DNA replication(GO:1902969) |
| 0.0 | 0.1 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.0 | 0.0 | GO:0071895 | odontoblast differentiation(GO:0071895) |
| 0.0 | 0.0 | GO:2000196 | positive regulation of female gonad development(GO:2000196) |
| 0.0 | 0.1 | GO:0045416 | positive regulation of interleukin-8 biosynthetic process(GO:0045416) |
| 0.0 | 0.0 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
| 0.0 | 0.0 | GO:1904058 | positive regulation of sensory perception of pain(GO:1904058) |
| 0.0 | 0.1 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
| 0.0 | 0.1 | GO:0070094 | positive regulation of glucagon secretion(GO:0070094) |
| 0.0 | 0.1 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
| 0.0 | 0.0 | GO:1903298 | regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903297) negative regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903298) |
| 0.0 | 0.1 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
| 0.0 | 0.1 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
| 0.0 | 0.1 | GO:0006558 | L-phenylalanine metabolic process(GO:0006558) L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
| 0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.1 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
| 0.0 | 0.1 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
| 0.0 | 0.1 | GO:0051138 | regulation of NK T cell differentiation(GO:0051136) positive regulation of NK T cell differentiation(GO:0051138) |
| 0.0 | 0.0 | GO:0097212 | lysosomal membrane organization(GO:0097212) |
| 0.0 | 0.1 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
| 0.0 | 0.0 | GO:0060509 | Type I pneumocyte differentiation(GO:0060509) |
| 0.0 | 0.0 | GO:1902488 | cholangiocyte apoptotic process(GO:1902488) regulation of cholangiocyte apoptotic process(GO:1904192) negative regulation of cholangiocyte apoptotic process(GO:1904193) |
| 0.0 | 0.0 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
| 0.0 | 0.1 | GO:0048318 | axial mesoderm development(GO:0048318) |
| 0.0 | 0.0 | GO:1904469 | positive regulation of tumor necrosis factor secretion(GO:1904469) |
| 0.0 | 0.2 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
| 0.0 | 0.0 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
| 0.0 | 0.4 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
| 0.0 | 0.2 | GO:0009143 | nucleoside triphosphate catabolic process(GO:0009143) |
| 0.0 | 0.1 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
| 0.0 | 0.2 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
| 0.0 | 0.2 | GO:0010919 | regulation of inositol phosphate biosynthetic process(GO:0010919) |
| 0.0 | 0.1 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
| 0.0 | 0.0 | GO:0031087 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.0 | 0.1 | GO:0048014 | Tie signaling pathway(GO:0048014) |
| 0.0 | 0.1 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
| 0.0 | 0.0 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.0 | 0.1 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
| 0.0 | 0.0 | GO:0001828 | inner cell mass cellular morphogenesis(GO:0001828) |
| 0.0 | 0.1 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.0 | 0.0 | GO:2000409 | positive regulation of T cell extravasation(GO:2000409) |
| 0.0 | 0.2 | GO:0043586 | tongue development(GO:0043586) |
| 0.0 | 0.3 | GO:0071353 | cellular response to interleukin-4(GO:0071353) |
| 0.0 | 0.1 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 0.0 | 0.0 | GO:0045764 | positive regulation of cellular amino acid metabolic process(GO:0045764) |
| 0.0 | 0.0 | GO:0001998 | angiotensin mediated vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001998) |
| 0.0 | 0.1 | GO:0042518 | negative regulation of tyrosine phosphorylation of Stat3 protein(GO:0042518) |
| 0.0 | 0.1 | GO:0034436 | glycoprotein transport(GO:0034436) |
| 0.0 | 0.0 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
| 0.0 | 0.1 | GO:0009249 | protein lipoylation(GO:0009249) |
| 0.0 | 0.1 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
| 0.0 | 0.1 | GO:0098700 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.0 | 0.1 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
| 0.0 | 0.1 | GO:1903405 | protein localization to nuclear body(GO:1903405) protein localization to Cajal body(GO:1904867) regulation of protein localization to Cajal body(GO:1904869) positive regulation of protein localization to Cajal body(GO:1904871) protein localization to nucleoplasm(GO:1990173) |
| 0.0 | 0.1 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
| 0.0 | 0.1 | GO:0018243 | protein O-linked glycosylation via threonine(GO:0018243) |
| 0.0 | 0.1 | GO:0051639 | actin filament network formation(GO:0051639) |
| 0.0 | 0.0 | GO:0048341 | paraxial mesoderm formation(GO:0048341) |
| 0.0 | 0.0 | GO:0050955 | thermoception(GO:0050955) |
| 0.0 | 0.2 | GO:0048026 | positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
| 0.0 | 0.1 | GO:0019695 | choline metabolic process(GO:0019695) |
| 0.0 | 0.0 | GO:0045896 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
| 0.0 | 0.1 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
| 0.0 | 0.1 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
| 0.0 | 0.1 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.0 | 0.1 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
| 0.0 | 0.0 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
| 0.0 | 0.1 | GO:0006048 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
| 0.0 | 0.1 | GO:0018343 | protein farnesylation(GO:0018343) |
| 0.0 | 0.2 | GO:0060539 | diaphragm development(GO:0060539) |
| 0.0 | 0.2 | GO:0017144 | drug metabolic process(GO:0017144) |
| 0.0 | 0.1 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 0.0 | 0.0 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
| 0.0 | 0.1 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
| 0.0 | 0.0 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
| 0.0 | 0.1 | GO:0051549 | regulation of keratinocyte migration(GO:0051547) positive regulation of keratinocyte migration(GO:0051549) |
| 0.0 | 0.2 | GO:0003334 | keratinocyte development(GO:0003334) |
| 0.0 | 0.1 | GO:0045113 | regulation of integrin biosynthetic process(GO:0045113) |
| 0.0 | 0.0 | GO:0010982 | regulation of high-density lipoprotein particle clearance(GO:0010982) |
| 0.0 | 0.0 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
| 0.0 | 0.4 | GO:0006805 | xenobiotic metabolic process(GO:0006805) |
| 0.0 | 0.1 | GO:0002072 | optic cup morphogenesis involved in camera-type eye development(GO:0002072) |
| 0.0 | 0.1 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
| 0.0 | 0.0 | GO:0048254 | snoRNA localization(GO:0048254) |
| 0.0 | 0.1 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
| 0.0 | 0.0 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
| 0.0 | 0.1 | GO:0045986 | negative regulation of smooth muscle contraction(GO:0045986) |
| 0.0 | 0.1 | GO:0070814 | hydrogen sulfide biosynthetic process(GO:0070814) |
| 0.0 | 0.0 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
| 0.0 | 0.0 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
| 0.0 | 0.2 | GO:0060712 | spongiotrophoblast layer development(GO:0060712) |
| 0.0 | 0.0 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.0 | 0.0 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
| 0.0 | 0.1 | GO:0050961 | detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
| 0.0 | 0.0 | GO:0071455 | cellular response to increased oxygen levels(GO:0036295) cellular response to hyperoxia(GO:0071455) |
| 0.0 | 0.1 | GO:0061418 | regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061418) |
| 0.0 | 0.1 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
| 0.0 | 0.0 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
| 0.0 | 0.1 | GO:0055064 | chloride ion homeostasis(GO:0055064) |
| 0.0 | 0.1 | GO:0035878 | nail development(GO:0035878) |
| 0.0 | 0.1 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.0 | 0.1 | GO:0090037 | positive regulation of protein kinase C signaling(GO:0090037) |
| 0.0 | 0.2 | GO:0008210 | estrogen metabolic process(GO:0008210) |
| 0.0 | 0.0 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.0 | 0.0 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
| 0.0 | 0.1 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
| 0.0 | 0.0 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.0 | 0.1 | GO:0003056 | regulation of vascular smooth muscle contraction(GO:0003056) |
| 0.0 | 0.1 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
| 0.0 | 0.0 | GO:1904528 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
| 0.0 | 0.0 | GO:0010536 | positive regulation of activation of Janus kinase activity(GO:0010536) |
| 0.0 | 0.1 | GO:0015677 | copper ion import(GO:0015677) |
| 0.0 | 0.1 | GO:0001880 | Mullerian duct regression(GO:0001880) |
| 0.0 | 0.1 | GO:0045217 | cell-cell junction maintenance(GO:0045217) |
| 0.0 | 0.2 | GO:0008340 | determination of adult lifespan(GO:0008340) |
| 0.0 | 0.0 | GO:0055091 | phospholipid homeostasis(GO:0055091) |
| 0.0 | 0.0 | GO:0090427 | activation of meiosis(GO:0090427) |
| 0.0 | 0.1 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.0 | 0.0 | GO:0050883 | musculoskeletal movement, spinal reflex action(GO:0050883) |
| 0.0 | 0.1 | GO:0045792 | negative regulation of cell size(GO:0045792) |
| 0.0 | 0.1 | GO:0048752 | semicircular canal morphogenesis(GO:0048752) |
| 0.0 | 0.1 | GO:0090209 | negative regulation of triglyceride metabolic process(GO:0090209) |
| 0.0 | 0.1 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.0 | 0.0 | GO:2000680 | regulation of rubidium ion transport(GO:2000680) |
| 0.0 | 0.1 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
| 0.0 | 0.2 | GO:0000466 | maturation of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000466) |
| 0.0 | 0.1 | GO:0060591 | chondroblast differentiation(GO:0060591) |
| 0.0 | 0.3 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
| 0.0 | 0.1 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.0 | 0.1 | GO:0050872 | white fat cell differentiation(GO:0050872) |
| 0.0 | 0.0 | GO:2001180 | negative regulation of interleukin-10 secretion(GO:2001180) |
| 0.0 | 0.1 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
| 0.0 | 0.1 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
| 0.0 | 0.0 | GO:0072221 | distal convoluted tubule development(GO:0072025) DCT cell differentiation(GO:0072069) metanephric distal convoluted tubule development(GO:0072221) metanephric distal tubule development(GO:0072235) metanephric DCT cell differentiation(GO:0072240) |
| 0.0 | 0.0 | GO:0032474 | otolith morphogenesis(GO:0032474) |
| 0.0 | 0.2 | GO:0010738 | regulation of protein kinase A signaling(GO:0010738) |
| 0.0 | 0.0 | GO:0006562 | proline catabolic process(GO:0006562) |
| 0.0 | 0.0 | GO:0051665 | membrane raft localization(GO:0051665) |
| 0.0 | 0.1 | GO:0032532 | regulation of microvillus length(GO:0032532) |
| 0.0 | 0.1 | GO:0071694 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
| 0.0 | 0.1 | GO:0008343 | adult feeding behavior(GO:0008343) |
| 0.0 | 0.1 | GO:0035865 | response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
| 0.0 | 0.0 | GO:0061738 | late endosomal microautophagy(GO:0061738) |
| 0.0 | 0.0 | GO:0000429 | carbon catabolite regulation of transcription from RNA polymerase II promoter(GO:0000429) carbon catabolite activation of transcription from RNA polymerase II promoter(GO:0000436) |
| 0.0 | 0.0 | GO:0036507 | protein deglycosylation involved in glycoprotein catabolic process(GO:0035977) protein demannosylation(GO:0036507) protein alpha-1,2-demannosylation(GO:0036508) mannose trimming involved in glycoprotein ERAD pathway(GO:1904382) |
| 0.0 | 0.0 | GO:1901725 | regulation of histone deacetylase activity(GO:1901725) |
| 0.0 | 0.1 | GO:0030252 | growth hormone secretion(GO:0030252) |
| 0.0 | 0.0 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
| 0.0 | 0.2 | GO:0043486 | histone exchange(GO:0043486) |
| 0.0 | 0.1 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
| 0.0 | 0.1 | GO:0006983 | ER overload response(GO:0006983) |
| 0.0 | 0.0 | GO:0007227 | signal transduction downstream of smoothened(GO:0007227) |
| 0.0 | 0.0 | GO:0072553 | terminal button organization(GO:0072553) |
| 0.0 | 0.0 | GO:0033058 | directional locomotion(GO:0033058) |
| 0.0 | 0.0 | GO:0033578 | protein glycosylation in Golgi(GO:0033578) |
| 0.0 | 0.1 | GO:1903671 | negative regulation of sprouting angiogenesis(GO:1903671) |
| 0.0 | 0.0 | GO:0001834 | trophectodermal cell proliferation(GO:0001834) |
| 0.0 | 0.2 | GO:0007026 | negative regulation of microtubule depolymerization(GO:0007026) |
| 0.0 | 0.0 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
| 0.0 | 0.1 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
| 0.0 | 0.0 | GO:1902047 | polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) |
| 0.0 | 0.0 | GO:0038095 | Fc-epsilon receptor signaling pathway(GO:0038095) |
| 0.0 | 0.0 | GO:0036016 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
| 0.0 | 0.0 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
| 0.0 | 0.0 | GO:0009106 | lipoate metabolic process(GO:0009106) |
| 0.0 | 0.0 | GO:0046684 | response to pyrethroid(GO:0046684) |
| 0.0 | 0.0 | GO:0046100 | hypoxanthine metabolic process(GO:0046100) hypoxanthine biosynthetic process(GO:0046101) |
| 0.0 | 0.0 | GO:0033629 | negative regulation of cell adhesion mediated by integrin(GO:0033629) |
| 0.0 | 0.1 | GO:1902170 | cellular response to reactive nitrogen species(GO:1902170) |
| 0.0 | 0.1 | GO:1903975 | regulation of glial cell migration(GO:1903975) |
| 0.0 | 0.0 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
| 0.0 | 0.2 | GO:0044247 | glycogen catabolic process(GO:0005980) glucan catabolic process(GO:0009251) cellular polysaccharide catabolic process(GO:0044247) |
| 0.0 | 0.0 | GO:0006553 | lysine metabolic process(GO:0006553) |
| 0.0 | 0.0 | GO:0044337 | canonical Wnt signaling pathway involved in positive regulation of apoptotic process(GO:0044337) |
| 0.0 | 0.1 | GO:0090005 | negative regulation of establishment of protein localization to plasma membrane(GO:0090005) |
| 0.0 | 0.1 | GO:0060211 | regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
| 0.0 | 0.0 | GO:0051103 | DNA ligation involved in DNA repair(GO:0051103) |
| 0.0 | 0.0 | GO:0090292 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.0 | 0.0 | GO:0043923 | positive regulation by host of viral transcription(GO:0043923) |
| 0.0 | 0.0 | GO:0015747 | urate transport(GO:0015747) |
| 0.0 | 0.1 | GO:1904970 | brush border assembly(GO:1904970) |
| 0.0 | 0.0 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
| 0.0 | 0.1 | GO:0002176 | male germ cell proliferation(GO:0002176) |
| 0.0 | 0.0 | GO:0002930 | trabecular meshwork development(GO:0002930) |
| 0.0 | 0.0 | GO:0002098 | tRNA wobble uridine modification(GO:0002098) |
| 0.0 | 0.0 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
| 0.0 | 0.0 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
| 0.0 | 0.0 | GO:0060279 | positive regulation of ovulation(GO:0060279) |
| 0.0 | 0.0 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) |
| 0.0 | 0.0 | GO:0010040 | response to iron(II) ion(GO:0010040) |
| 0.0 | 0.0 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
| 0.0 | 0.0 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.0 | 0.1 | GO:0050995 | negative regulation of lipid catabolic process(GO:0050995) |
| 0.0 | 0.1 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
| 0.0 | 0.0 | GO:0019896 | axonal transport of mitochondrion(GO:0019896) |
| 0.0 | 0.1 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.0 | 0.1 | GO:0006707 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.0 | 0.1 | GO:0016068 | regulation of type I hypersensitivity(GO:0001810) type I hypersensitivity(GO:0016068) |
| 0.0 | 0.0 | GO:0070900 | mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
| 0.0 | 0.1 | GO:1902414 | protein localization to cell junction(GO:1902414) |
| 0.0 | 0.0 | GO:0061511 | centriole elongation(GO:0061511) |
| 0.0 | 0.0 | GO:0000087 | mitotic M phase(GO:0000087) |
| 0.0 | 0.0 | GO:0060020 | Bergmann glial cell differentiation(GO:0060020) |
| 0.0 | 0.0 | GO:0010760 | negative regulation of macrophage chemotaxis(GO:0010760) |
| 0.0 | 0.0 | GO:0003278 | apoptotic process involved in heart morphogenesis(GO:0003278) |
| 0.0 | 0.0 | GO:0072366 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) regulation of cellular ketone metabolic process by positive regulation of transcription from RNA polymerase II promoter(GO:0072366) |
| 0.0 | 0.1 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
| 0.0 | 0.0 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
| 0.0 | 0.0 | GO:0015755 | fructose transport(GO:0015755) |
| 0.0 | 0.1 | GO:0032754 | positive regulation of interleukin-5 production(GO:0032754) |
| 0.0 | 0.0 | GO:0071872 | response to epinephrine(GO:0071871) cellular response to epinephrine stimulus(GO:0071872) |
| 0.0 | 0.0 | GO:0002370 | natural killer cell cytokine production(GO:0002370) regulation of natural killer cell cytokine production(GO:0002727) |
| 0.0 | 0.0 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.0 | 0.0 | GO:0045448 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
| 0.0 | 0.0 | GO:0033015 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) |
| 0.0 | 0.1 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
| 0.0 | 0.0 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
| 0.0 | 0.1 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.0 | 0.0 | GO:0042695 | thelarche(GO:0042695) mammary gland branching involved in thelarche(GO:0060744) |
| 0.0 | 0.0 | GO:0045343 | MHC class I biosynthetic process(GO:0045341) regulation of MHC class I biosynthetic process(GO:0045343) positive regulation of MHC class I biosynthetic process(GO:0045345) |
| 0.0 | 0.3 | GO:0033141 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
| 0.0 | 0.0 | GO:0008655 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
| 0.0 | 0.1 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
| 0.0 | 0.1 | GO:0042754 | negative regulation of circadian rhythm(GO:0042754) |
| 0.0 | 0.0 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.0 | 0.2 | GO:0009303 | rRNA transcription(GO:0009303) |
| 0.0 | 0.1 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
| 0.0 | 0.1 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) |
| 0.0 | 0.0 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
| 0.0 | 0.1 | GO:0046548 | retinal rod cell development(GO:0046548) |
| 0.0 | 0.0 | GO:0044557 | relaxation of smooth muscle(GO:0044557) |
| 0.0 | 0.1 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
| 0.0 | 0.1 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 1.1 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
| 0.1 | 0.4 | GO:0070545 | PeBoW complex(GO:0070545) |
| 0.1 | 0.3 | GO:0035355 | Toll-like receptor 2-Toll-like receptor 6 protein complex(GO:0035355) |
| 0.1 | 1.0 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.1 | 0.3 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
| 0.1 | 0.3 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.1 | 0.2 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
| 0.1 | 0.3 | GO:0045098 | type III intermediate filament(GO:0045098) |
| 0.1 | 0.6 | GO:0045263 | proton-transporting ATP synthase complex, coupling factor F(o)(GO:0045263) |
| 0.1 | 0.2 | GO:0044316 | cone cell pedicle(GO:0044316) |
| 0.1 | 0.2 | GO:0097413 | Lewy body(GO:0097413) |
| 0.1 | 0.2 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.1 | 0.2 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
| 0.0 | 0.1 | GO:0097451 | glial limiting end-foot(GO:0097451) |
| 0.0 | 0.1 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.0 | 0.6 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.0 | 0.1 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
| 0.0 | 0.2 | GO:0032389 | MutLalpha complex(GO:0032389) |
| 0.0 | 0.1 | GO:0000811 | GINS complex(GO:0000811) |
| 0.0 | 0.1 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
| 0.0 | 0.2 | GO:0005579 | membrane attack complex(GO:0005579) |
| 0.0 | 0.1 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
| 0.0 | 0.1 | GO:0038037 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
| 0.0 | 0.1 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
| 0.0 | 0.2 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 0.0 | 0.3 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.0 | 0.1 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
| 0.0 | 0.1 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.0 | 0.1 | GO:0005683 | U7 snRNP(GO:0005683) |
| 0.0 | 0.1 | GO:0097524 | sperm plasma membrane(GO:0097524) |
| 0.0 | 0.2 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 0.0 | 0.2 | GO:0016589 | NURF complex(GO:0016589) |
| 0.0 | 0.1 | GO:0005608 | laminin-3 complex(GO:0005608) |
| 0.0 | 0.1 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.0 | 0.3 | GO:0016342 | catenin complex(GO:0016342) |
| 0.0 | 0.2 | GO:0000306 | extrinsic component of vacuolar membrane(GO:0000306) |
| 0.0 | 0.1 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
| 0.0 | 0.7 | GO:0005719 | nuclear euchromatin(GO:0005719) |
| 0.0 | 0.1 | GO:0097209 | epidermal lamellar body(GO:0097209) |
| 0.0 | 0.1 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
| 0.0 | 0.1 | GO:0048179 | activin receptor complex(GO:0048179) |
| 0.0 | 0.0 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
| 0.0 | 0.1 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| 0.0 | 0.3 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
| 0.0 | 0.3 | GO:0030126 | COPI vesicle coat(GO:0030126) |
| 0.0 | 0.4 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
| 0.0 | 0.3 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.0 | 0.4 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.0 | 0.1 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
| 0.0 | 0.1 | GO:0008091 | spectrin(GO:0008091) |
| 0.0 | 0.1 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 0.0 | 0.1 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
| 0.0 | 0.1 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
| 0.0 | 0.1 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
| 0.0 | 0.3 | GO:0005682 | U5 snRNP(GO:0005682) |
| 0.0 | 0.2 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 0.0 | 0.1 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
| 0.0 | 0.1 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
| 0.0 | 0.1 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
| 0.0 | 0.2 | GO:0000124 | SAGA complex(GO:0000124) |
| 0.0 | 0.1 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.0 | 0.1 | GO:0045251 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
| 0.0 | 0.1 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.0 | 0.0 | GO:1990812 | growth cone filopodium(GO:1990812) |
| 0.0 | 0.1 | GO:0009279 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
| 0.0 | 0.2 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
| 0.0 | 0.1 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.0 | 0.1 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
| 0.0 | 0.1 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.0 | 0.1 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.0 | 0.1 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.0 | 0.1 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
| 0.0 | 0.1 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.0 | 0.0 | GO:0005712 | chiasma(GO:0005712) |
| 0.0 | 0.1 | GO:0042824 | MHC class I peptide loading complex(GO:0042824) |
| 0.0 | 0.0 | GO:0005606 | laminin-1 complex(GO:0005606) |
| 0.0 | 0.3 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.0 | 0.7 | GO:0031903 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
| 0.0 | 0.1 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
| 0.0 | 0.1 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.0 | 0.2 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.0 | 0.1 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
| 0.0 | 0.2 | GO:0031430 | M band(GO:0031430) |
| 0.0 | 0.1 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
| 0.0 | 0.3 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.0 | 0.0 | GO:0070688 | MLL5-L complex(GO:0070688) |
| 0.0 | 0.0 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.0 | 0.1 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.0 | 0.1 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.0 | 0.1 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.0 | 0.0 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 0.0 | 0.2 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.0 | 0.1 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
| 0.0 | 0.1 | GO:0042405 | nuclear inclusion body(GO:0042405) |
| 0.0 | 0.1 | GO:0070578 | RISC-loading complex(GO:0070578) |
| 0.0 | 0.0 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
| 0.0 | 0.1 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
| 0.0 | 0.2 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.0 | 0.0 | GO:0030669 | clathrin-coated endocytic vesicle membrane(GO:0030669) |
| 0.0 | 0.2 | GO:0032806 | carboxy-terminal domain protein kinase complex(GO:0032806) |
| 0.0 | 0.1 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.0 | 0.1 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
| 0.0 | 0.0 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
| 0.0 | 0.1 | GO:0097431 | mitotic spindle pole(GO:0097431) |
| 0.0 | 0.1 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.0 | 0.2 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
| 0.0 | 0.1 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
| 0.0 | 0.0 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
| 0.0 | 0.0 | GO:0071942 | XPC complex(GO:0071942) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 1.1 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
| 0.2 | 0.5 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
| 0.1 | 0.4 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
| 0.1 | 0.4 | GO:0038181 | bile acid receptor activity(GO:0038181) |
| 0.1 | 0.5 | GO:0034056 | estrogen response element binding(GO:0034056) |
| 0.1 | 0.4 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.1 | 0.5 | GO:0071614 | linoleic acid epoxygenase activity(GO:0071614) |
| 0.1 | 0.3 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
| 0.1 | 0.3 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
| 0.1 | 1.0 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.1 | 0.3 | GO:0030620 | U2 snRNA binding(GO:0030620) |
| 0.1 | 0.4 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
| 0.1 | 0.3 | GO:0055100 | adiponectin binding(GO:0055100) |
| 0.1 | 0.3 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
| 0.1 | 1.2 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.1 | 0.2 | GO:0070644 | vitamin D response element binding(GO:0070644) |
| 0.1 | 0.3 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
| 0.1 | 0.4 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
| 0.1 | 0.4 | GO:0070728 | leucine binding(GO:0070728) |
| 0.1 | 0.3 | GO:0038064 | collagen receptor activity(GO:0038064) |
| 0.1 | 0.2 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.1 | 0.2 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.1 | 0.4 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
| 0.1 | 0.2 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
| 0.1 | 0.4 | GO:0046790 | virion binding(GO:0046790) |
| 0.1 | 0.2 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.1 | 0.3 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
| 0.1 | 0.1 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
| 0.1 | 0.4 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
| 0.1 | 0.2 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
| 0.1 | 0.2 | GO:0032564 | dATP binding(GO:0032564) |
| 0.1 | 0.3 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
| 0.1 | 0.2 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
| 0.1 | 0.2 | GO:0070538 | oleic acid binding(GO:0070538) |
| 0.1 | 0.3 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.1 | 0.3 | GO:0000832 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
| 0.1 | 1.0 | GO:0003785 | actin monomer binding(GO:0003785) |
| 0.1 | 0.1 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
| 0.0 | 0.6 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.0 | 0.1 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
| 0.0 | 0.1 | GO:0034191 | apolipoprotein A-I receptor binding(GO:0034191) |
| 0.0 | 0.1 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.0 | 0.1 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
| 0.0 | 0.2 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
| 0.0 | 0.1 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
| 0.0 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.0 | 0.0 | GO:0004723 | calcium-dependent protein serine/threonine phosphatase activity(GO:0004723) |
| 0.0 | 0.3 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
| 0.0 | 0.1 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
| 0.0 | 0.1 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
| 0.0 | 0.2 | GO:1990239 | steroid hormone binding(GO:1990239) |
| 0.0 | 0.1 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
| 0.0 | 0.2 | GO:0004064 | arylesterase activity(GO:0004064) |
| 0.0 | 0.2 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
| 0.0 | 0.2 | GO:0000403 | Y-form DNA binding(GO:0000403) |
| 0.0 | 0.5 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
| 0.0 | 0.2 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
| 0.0 | 0.1 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
| 0.0 | 0.1 | GO:0098748 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
| 0.0 | 0.1 | GO:0031781 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
| 0.0 | 0.1 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
| 0.0 | 0.3 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
| 0.0 | 0.1 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.0 | 0.2 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
| 0.0 | 0.2 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.0 | 0.2 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
| 0.0 | 0.1 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
| 0.0 | 0.2 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.0 | 0.1 | GO:0033142 | progesterone receptor binding(GO:0033142) |
| 0.0 | 0.1 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.0 | 0.1 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
| 0.0 | 0.2 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
| 0.0 | 0.1 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 0.0 | 0.1 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
| 0.0 | 0.1 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.0 | 0.1 | GO:0016822 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 0.0 | 0.2 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
| 0.0 | 0.2 | GO:0045545 | syndecan binding(GO:0045545) |
| 0.0 | 0.1 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
| 0.0 | 1.0 | GO:0070888 | E-box binding(GO:0070888) |
| 0.0 | 0.2 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
| 0.0 | 0.3 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.0 | 0.1 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
| 0.0 | 0.3 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.0 | 0.5 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
| 0.0 | 0.1 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
| 0.0 | 0.1 | GO:2001069 | glycogen binding(GO:2001069) |
| 0.0 | 0.1 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
| 0.0 | 0.1 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.0 | 0.1 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
| 0.0 | 0.1 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.0 | 0.3 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.0 | 0.2 | GO:0033695 | oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
| 0.0 | 0.1 | GO:0032139 | dinucleotide insertion or deletion binding(GO:0032139) |
| 0.0 | 0.3 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.0 | 0.2 | GO:0043910 | CTP:2,3-di-O-geranylgeranyl-sn-glycero-1-phosphate cytidyltransferase activity(GO:0043338) phospholactate guanylyltransferase activity(GO:0043814) ATP:coenzyme F420 adenylyltransferase activity(GO:0043910) UDP-N-acetylgalactosamine diphosphorylase activity(GO:0052630) |
| 0.0 | 0.2 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.0 | 0.1 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 0.0 | 0.1 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
| 0.0 | 0.1 | GO:0004030 | aldehyde dehydrogenase [NAD(P)+] activity(GO:0004030) |
| 0.0 | 0.1 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
| 0.0 | 0.1 | GO:0004771 | sterol esterase activity(GO:0004771) |
| 0.0 | 0.1 | GO:0080130 | L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
| 0.0 | 0.0 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
| 0.0 | 0.1 | GO:0043559 | insulin binding(GO:0043559) |
| 0.0 | 0.1 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
| 0.0 | 0.0 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
| 0.0 | 0.7 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
| 0.0 | 0.1 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
| 0.0 | 0.1 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
| 0.0 | 0.1 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
| 0.0 | 0.0 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
| 0.0 | 0.5 | GO:0030552 | cAMP binding(GO:0030552) |
| 0.0 | 0.4 | GO:0043295 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
| 0.0 | 0.1 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.0 | 0.2 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.0 | 0.1 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.0 | 0.1 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
| 0.0 | 0.1 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
| 0.0 | 0.1 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 0.0 | 0.1 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
| 0.0 | 0.1 | GO:0005113 | patched binding(GO:0005113) |
| 0.0 | 0.6 | GO:0042169 | SH2 domain binding(GO:0042169) |
| 0.0 | 0.1 | GO:0016151 | nickel cation binding(GO:0016151) |
| 0.0 | 0.1 | GO:0035514 | DNA demethylase activity(GO:0035514) |
| 0.0 | 0.1 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
| 0.0 | 0.1 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 0.0 | 0.1 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
| 0.0 | 0.1 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
| 0.0 | 0.1 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.0 | 0.1 | GO:0016530 | metallochaperone activity(GO:0016530) |
| 0.0 | 0.1 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
| 0.0 | 0.1 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.0 | 0.1 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
| 0.0 | 0.0 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
| 0.0 | 0.0 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
| 0.0 | 0.1 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
| 0.0 | 0.1 | GO:0004370 | glycerol kinase activity(GO:0004370) |
| 0.0 | 0.1 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
| 0.0 | 0.1 | GO:0034711 | inhibin binding(GO:0034711) |
| 0.0 | 0.2 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
| 0.0 | 0.1 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
| 0.0 | 0.1 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
| 0.0 | 0.1 | GO:0038132 | neuregulin binding(GO:0038132) |
| 0.0 | 0.1 | GO:0015288 | porin activity(GO:0015288) |
| 0.0 | 0.2 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) |
| 0.0 | 0.1 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
| 0.0 | 0.3 | GO:0005527 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.0 | 0.1 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
| 0.0 | 0.5 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
| 0.0 | 0.0 | GO:0016662 | oxidoreductase activity, acting on other nitrogenous compounds as donors, cytochrome as acceptor(GO:0016662) |
| 0.0 | 0.0 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
| 0.0 | 0.2 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.0 | 0.1 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
| 0.0 | 0.0 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.0 | 0.3 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
| 0.0 | 0.1 | GO:0019992 | diacylglycerol binding(GO:0019992) |
| 0.0 | 0.0 | GO:0070699 | type II activin receptor binding(GO:0070699) |
| 0.0 | 0.1 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.0 | 0.0 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
| 0.0 | 0.1 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.0 | 0.0 | GO:0008545 | JUN kinase kinase activity(GO:0008545) |
| 0.0 | 0.2 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
| 0.0 | 0.1 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
| 0.0 | 0.0 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.0 | 0.1 | GO:1990405 | protein antigen binding(GO:1990405) |
| 0.0 | 0.2 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.0 | 0.0 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
| 0.0 | 0.1 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.0 | 0.1 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
| 0.0 | 0.0 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.0 | 0.1 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
| 0.0 | 0.1 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
| 0.0 | 0.6 | GO:0015924 | mannosyl-oligosaccharide mannosidase activity(GO:0015924) |
| 0.0 | 0.0 | GO:0004104 | cholinesterase activity(GO:0004104) |
| 0.0 | 0.0 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.0 | 0.0 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
| 0.0 | 0.0 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
| 0.0 | 0.1 | GO:0070513 | death domain binding(GO:0070513) |
| 0.0 | 0.1 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
| 0.0 | 0.0 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
| 0.0 | 0.1 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
| 0.0 | 0.1 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 0.0 | 0.3 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.0 | 0.1 | GO:0004065 | arylsulfatase activity(GO:0004065) |
| 0.0 | 0.1 | GO:0005047 | signal recognition particle binding(GO:0005047) |
| 0.0 | 0.1 | GO:0000339 | RNA cap binding(GO:0000339) |
| 0.0 | 0.0 | GO:0016882 | cyclo-ligase activity(GO:0016882) |
| 0.0 | 0.1 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.0 | 0.1 | GO:0034235 | GPI anchor binding(GO:0034235) |
| 0.0 | 0.0 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
| 0.0 | 0.2 | GO:0052712 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) photoreceptor cyclic-nucleotide phosphodiesterase activity(GO:0004120) 7,8-dihydro-D-neopterin 2',3'-cyclic phosphate phosphodiesterase activity(GO:0044688) inositol phosphosphingolipid phospholipase activity(GO:0052712) inositol phosphorylceramide phospholipase activity(GO:0052713) mannosyl-inositol phosphorylceramide phospholipase activity(GO:0052714) mannosyl-diinositol phosphorylceramide phospholipase activity(GO:0052715) |
| 0.0 | 0.1 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.0 | 0.3 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
| 0.0 | 0.3 | GO:0070063 | RNA polymerase binding(GO:0070063) |
| 0.0 | 0.0 | GO:0035877 | death effector domain binding(GO:0035877) |
| 0.0 | 0.0 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
| 0.0 | 0.1 | GO:0005346 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) |
| 0.0 | 0.1 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.0 | 0.0 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
| 0.0 | 0.1 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.0 | 0.0 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) |
| 0.0 | 0.1 | GO:0002054 | nucleobase binding(GO:0002054) |
| 0.0 | 0.0 | GO:0030911 | TPR domain binding(GO:0030911) |
| 0.0 | 0.0 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
| 0.0 | 0.0 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
| 0.0 | 0.1 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.0 | 0.1 | GO:0004017 | adenylate kinase activity(GO:0004017) |
| 0.0 | 0.0 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
| 0.0 | 0.0 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.0 | 0.1 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
| 0.0 | 0.0 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
| 0.0 | 0.1 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
| 0.0 | 0.1 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.0 | 0.5 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
| 0.0 | 0.1 | GO:0098988 | G-protein coupled glutamate receptor activity(GO:0098988) |
| 0.0 | 0.1 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
| 0.0 | 0.3 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
| 0.0 | 0.1 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
| 0.0 | 0.0 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.0 | 0.0 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
| 0.0 | 0.0 | GO:0001846 | opsonin binding(GO:0001846) |
| 0.0 | 0.2 | GO:0005112 | Notch binding(GO:0005112) |
| 0.0 | 0.0 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
| 0.0 | 0.3 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
| 0.0 | 0.1 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.0 | 0.0 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.0 | 0.3 | GO:0097472 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
| 0.0 | 0.1 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
| 0.0 | 0.1 | GO:0016668 | oxidoreductase activity, acting on a sulfur group of donors, NAD(P) as acceptor(GO:0016668) |
| 0.0 | 0.0 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
| 0.0 | 0.0 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 0.0 | 0.0 | GO:0005042 | netrin receptor activity(GO:0005042) |
| 0.0 | 1.0 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.0 | 0.0 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.0 | 0.0 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 0.2 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
| 0.1 | 1.1 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.0 | 0.0 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
| 0.0 | 0.3 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.0 | 0.1 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
| 0.0 | 0.7 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.0 | 1.3 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
| 0.0 | 0.8 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
| 0.0 | 0.3 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 0.0 | 1.1 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.0 | 0.6 | PID ALK1 PATHWAY | ALK1 signaling events |
| 0.0 | 0.4 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
| 0.0 | 0.5 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.0 | 0.1 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
| 0.0 | 0.4 | PID SHP2 PATHWAY | SHP2 signaling |
| 0.0 | 0.9 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
| 0.0 | 0.2 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.0 | 0.2 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.0 | 0.1 | ST ADRENERGIC | Adrenergic Pathway |
| 0.0 | 0.2 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.0 | 0.1 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
| 0.0 | 0.1 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
| 0.0 | 0.1 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.0 | 0.1 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.0 | 0.1 | PID CDC42 PATHWAY | CDC42 signaling events |
| 0.0 | 0.1 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| 0.0 | 0.0 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
| 0.0 | 0.2 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
| 0.0 | 0.5 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.0 | 0.2 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
| 0.0 | 0.0 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.0 | 0.0 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
| 0.0 | 0.2 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
| 0.0 | 0.3 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
| 0.0 | 0.2 | ST G ALPHA I PATHWAY | G alpha i Pathway |
| 0.0 | 0.2 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
| 0.0 | 0.1 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.0 | 0.2 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.0 | 0.2 | PID IL23 PATHWAY | IL23-mediated signaling events |
| 0.0 | 0.1 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.0 | 0.2 | PID BARD1 PATHWAY | BARD1 signaling events |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 1.1 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.1 | 0.7 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
| 0.1 | 0.6 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.1 | 0.8 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
| 0.1 | 0.8 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.0 | 0.5 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
| 0.0 | 0.7 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
| 0.0 | 0.1 | REACTOME GAP JUNCTION TRAFFICKING | Genes involved in Gap junction trafficking |
| 0.0 | 0.6 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.0 | 0.3 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
| 0.0 | 0.3 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.0 | 0.1 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
| 0.0 | 0.5 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.0 | 0.2 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
| 0.0 | 0.9 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
| 0.0 | 0.3 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
| 0.0 | 0.1 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.0 | 0.2 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.0 | 0.3 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.0 | 0.3 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.0 | 0.3 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.0 | 0.2 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
| 0.0 | 0.5 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
| 0.0 | 0.2 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
| 0.0 | 0.1 | REACTOME ARMS MEDIATED ACTIVATION | Genes involved in ARMS-mediated activation |
| 0.0 | 0.3 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
| 0.0 | 0.4 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.0 | 0.2 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.0 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
| 0.0 | 0.2 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.0 | 0.2 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.0 | 0.2 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.0 | 0.1 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
| 0.0 | 0.2 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
| 0.0 | 0.3 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
| 0.0 | 0.1 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.0 | 0.0 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.0 | 0.3 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
| 0.0 | 0.2 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
| 0.0 | 0.1 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
| 0.0 | 0.3 | REACTOME BIOLOGICAL OXIDATIONS | Genes involved in Biological oxidations |
| 0.0 | 0.1 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 0.0 | 0.1 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.0 | 0.0 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
| 0.0 | 0.6 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
| 0.0 | 0.5 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
| 0.0 | 0.1 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
| 0.0 | 0.3 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
| 0.0 | 0.4 | REACTOME MRNA 3 END PROCESSING | Genes involved in mRNA 3'-end processing |
| 0.0 | 0.2 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
| 0.0 | 0.2 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
| 0.0 | 0.1 | REACTOME FORMATION OF FIBRIN CLOT CLOTTING CASCADE | Genes involved in Formation of Fibrin Clot (Clotting Cascade) |
| 0.0 | 0.1 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.0 | 0.1 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
| 0.0 | 0.2 | REACTOME SHC MEDIATED CASCADE | Genes involved in SHC-mediated cascade |
| 0.0 | 0.1 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
| 0.0 | 0.1 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
| 0.0 | 0.0 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
| 0.0 | 0.2 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
| 0.0 | 0.1 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 0.0 | 0.3 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
| 0.0 | 0.1 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.0 | 0.1 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |