| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Hsf2
|
ENSMUSG00000019878.7 | heat shock factor 2 |
| CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|---|---|
| chr10_57498941_57499429 | Hsf2 | 1189 | 0.467266 | 0.98 | 8.0e-04 | Click! |
| chr10_57495392_57495543 | Hsf2 | 509 | 0.781898 | 0.96 | 2.7e-03 | Click! |
| chr10_57489697_57489984 | Hsf2 | 3415 | 0.215702 | 0.93 | 6.3e-03 | Click! |
| chr10_57488437_57488620 | Hsf2 | 2103 | 0.264361 | 0.92 | 8.4e-03 | Click! |
| chr10_57487200_57487595 | Hsf2 | 972 | 0.394312 | 0.91 | 1.1e-02 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr9_115400145_115400360 | 7.01 |
Gm9487 |
predicted gene 9487 |
4897 |
0.14 |
| chr10_111367147_111367312 | 4.13 |
Gm40761 |
predicted gene, 40761 |
30105 |
0.16 |
| chr5_125525672_125525920 | 3.82 |
Tmem132b |
transmembrane protein 132B |
5978 |
0.17 |
| chr2_113503793_113503980 | 3.67 |
Gm13964 |
predicted gene 13964 |
148 |
0.96 |
| chrX_111626357_111626522 | 3.48 |
Gm7340 |
predicted gene 7340 |
54740 |
0.14 |
| chr4_97100282_97100474 | 2.93 |
Gm27521 |
predicted gene, 27521 |
183358 |
0.03 |
| chr7_24927963_24928117 | 2.86 |
Arhgef1 |
Rho guanine nucleotide exchange factor (GEF) 1 |
4677 |
0.1 |
| chr19_44398143_44398357 | 2.85 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
8440 |
0.15 |
| chr11_111998446_111998808 | 2.76 |
Gm11679 |
predicted gene 11679 |
44951 |
0.19 |
| chr6_115238722_115238899 | 2.66 |
Syn2 |
synapsin II |
184 |
0.94 |
| chr8_93168995_93169226 | 2.65 |
Ces1d |
carboxylesterase 1D |
865 |
0.51 |
| chr12_12793762_12793936 | 2.59 |
Platr19 |
pluripotency associated transcript 19 |
5864 |
0.21 |
| chr8_93181176_93181327 | 2.59 |
Ces1d |
carboxylesterase 1D |
5962 |
0.14 |
| chr8_46902999_46903150 | 2.58 |
1700011L03Rik |
RIKEN cDNA 1700011L03 gene |
45725 |
0.12 |
| chr13_107641777_107642027 | 2.55 |
Gm32090 |
predicted gene, 32090 |
29053 |
0.18 |
| chr7_12979741_12980348 | 2.51 |
Zfp446 |
zinc finger protein 446 |
524 |
0.55 |
| chr4_45411492_45411708 | 2.51 |
Slc25a51 |
solute carrier family 25, member 51 |
2834 |
0.21 |
| chr5_125524109_125525122 | 2.49 |
Tmem132b |
transmembrane protein 132B |
7159 |
0.16 |
| chr1_10155656_10155807 | 2.43 |
Arfgef1 |
ADP-ribosylation factor guanine nucleotide-exchange factor 1(brefeldin A-inhibited) |
1201 |
0.46 |
| chr12_32246180_32246331 | 2.43 |
Gm33308 |
predicted gene, 33308 |
4 |
0.98 |
| chr19_44396602_44396753 | 2.37 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
10013 |
0.14 |
| chr17_46439216_46439478 | 2.33 |
Gm5093 |
predicted gene 5093 |
750 |
0.36 |
| chr3_51232396_51232571 | 2.30 |
Gm38357 |
predicted gene, 38357 |
566 |
0.69 |
| chr13_46051322_46051732 | 2.26 |
Gm45949 |
predicted gene, 45949 |
9070 |
0.25 |
| chr11_111996515_111996723 | 2.24 |
Gm11679 |
predicted gene 11679 |
46959 |
0.19 |
| chr11_12475688_12476059 | 2.24 |
Cobl |
cordon-bleu WH2 repeat |
10913 |
0.3 |
| chr8_93166590_93166741 | 2.23 |
Ces1d |
carboxylesterase 1D |
3310 |
0.17 |
| chr3_60141611_60141822 | 2.23 |
Gm24382 |
predicted gene, 24382 |
13969 |
0.22 |
| chr6_17726352_17726546 | 2.23 |
Gm43533 |
predicted gene 43533 |
8871 |
0.13 |
| chr9_122019057_122019479 | 2.22 |
Gm47117 |
predicted gene, 47117 |
7128 |
0.11 |
| chr5_87254967_87255118 | 2.21 |
Ugt2b37 |
UDP glucuronosyltransferase 2 family, polypeptide B37 |
238 |
0.9 |
| chr7_25901958_25902263 | 2.18 |
Cyp2b10 |
cytochrome P450, family 2, subfamily b, polypeptide 10 |
4434 |
0.13 |
| chr15_95835869_95836082 | 2.14 |
Gm17546 |
predicted gene, 17546 |
5903 |
0.16 |
| chr6_51272137_51272326 | 2.11 |
Mir148a |
microRNA 148a |
2321 |
0.33 |
| chr5_9101079_9101755 | 2.07 |
Tmem243 |
transmembrane protein 243, mitochondrial |
670 |
0.68 |
| chr9_31210539_31210690 | 2.06 |
Aplp2 |
amyloid beta (A4) precursor-like protein 2 |
1173 |
0.5 |
| chr6_149168171_149168324 | 2.06 |
Amn1 |
antagonist of mitotic exit network 1 |
5124 |
0.16 |
| chr7_90141635_90141838 | 2.05 |
Gm45222 |
predicted gene 45222 |
4212 |
0.13 |
| chr11_90686948_90687471 | 2.04 |
Tom1l1 |
target of myb1-like 1 (chicken) |
370 |
0.89 |
| chr1_21250628_21250912 | 2.03 |
Gsta3 |
glutathione S-transferase, alpha 3 |
2751 |
0.16 |
| chr1_21264707_21265188 | 2.02 |
Gm28836 |
predicted gene 28836 |
6646 |
0.11 |
| chr3_107688618_107688769 | 2.01 |
Ahcyl1 |
S-adenosylhomocysteine hydrolase-like 1 |
7270 |
0.17 |
| chr12_83544904_83545068 | 2.01 |
Zfyve1 |
zinc finger, FYVE domain containing 1 |
6719 |
0.16 |
| chr4_40722272_40722627 | 2.00 |
Dnaja1 |
DnaJ heat shock protein family (Hsp40) member A1 |
31 |
0.88 |
| chr10_91321221_91321411 | 1.99 |
Gm47082 |
predicted gene, 47082 |
10971 |
0.22 |
| chr17_86505145_86505390 | 1.98 |
Gm10309 |
predicted gene 10309 |
35 |
0.98 |
| chr13_69637525_69637701 | 1.97 |
Nsun2 |
NOL1/NOP2/Sun domain family member 2 |
6873 |
0.11 |
| chr12_24680312_24680550 | 1.96 |
Cys1 |
cystin 1 |
288 |
0.87 |
| chr16_37902046_37902197 | 1.96 |
Gpr156 |
G protein-coupled receptor 156 |
14375 |
0.14 |
| chr6_104668567_104668720 | 1.96 |
Cntn6 |
contactin 6 |
175395 |
0.04 |
| chr11_5899022_5899202 | 1.94 |
Myl7 |
myosin, light polypeptide 7, regulatory |
330 |
0.8 |
| chr12_32770403_32770554 | 1.92 |
Nampt |
nicotinamide phosphoribosyltransferase |
49067 |
0.13 |
| chr2_32525017_32525309 | 1.92 |
Gm13412 |
predicted gene 13412 |
132 |
0.92 |
| chr9_55278709_55278860 | 1.91 |
Nrg4 |
neuregulin 4 |
4788 |
0.2 |
| chr10_128962032_128962183 | 1.90 |
Mettl7b |
methyltransferase like 7B |
1119 |
0.28 |
| chr1_21299781_21300307 | 1.87 |
Gm4956 |
predicted gene 4956 |
1732 |
0.22 |
| chr1_21316587_21316763 | 1.86 |
Gm21909 |
predicted gene, 21909 |
355 |
0.77 |
| chr1_67202274_67202506 | 1.86 |
Gm15668 |
predicted gene 15668 |
46810 |
0.14 |
| chr19_44399974_44400175 | 1.85 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
6616 |
0.15 |
| chr5_125477308_125477767 | 1.85 |
Aacs |
acetoacetyl-CoA synthetase |
1723 |
0.22 |
| chr9_122846040_122846480 | 1.83 |
Gm47140 |
predicted gene, 47140 |
2158 |
0.17 |
| chr10_111625398_111625575 | 1.83 |
Gm47864 |
predicted gene, 47864 |
24326 |
0.14 |
| chr17_35425882_35426323 | 1.82 |
H2-Q6 |
histocompatibility 2, Q region locus 6 |
1225 |
0.23 |
| chr9_45934116_45934318 | 1.82 |
Tagln |
transgelin |
1357 |
0.23 |
| chr3_118691496_118691647 | 1.81 |
Dpyd |
dihydropyrimidine dehydrogenase |
119651 |
0.06 |
| chr1_73684551_73684714 | 1.80 |
6030407O03Rik |
RIKEN cDNA 6030407O03 gene |
59315 |
0.12 |
| chr13_8847939_8848370 | 1.79 |
Wdr37 |
WD repeat domain 37 |
517 |
0.67 |
| chr10_87921071_87921222 | 1.79 |
Tyms-ps |
thymidylate synthase, pseudogene |
45701 |
0.12 |
| chr7_80625574_80625744 | 1.78 |
Crtc3 |
CREB regulated transcription coactivator 3 |
3967 |
0.19 |
| chr17_81383605_81383767 | 1.78 |
Gm50044 |
predicted gene, 50044 |
12853 |
0.25 |
| chr16_43169836_43170008 | 1.78 |
Gm15712 |
predicted gene 15712 |
14651 |
0.21 |
| chr12_57515437_57515691 | 1.78 |
Gm2568 |
predicted gene 2568 |
5060 |
0.18 |
| chr5_97965946_97966147 | 1.77 |
Antxr2 |
anthrax toxin receptor 2 |
30049 |
0.16 |
| chr18_11052816_11053420 | 1.76 |
Gata6 |
GATA binding protein 6 |
74 |
0.9 |
| chr10_95318784_95318935 | 1.76 |
Gm48882 |
predicted gene, 48882 |
612 |
0.63 |
| chr13_36671843_36671997 | 1.76 |
Gm26395 |
predicted gene, 26395 |
17515 |
0.16 |
| chr15_59195501_59195712 | 1.76 |
Rpl7-ps8 |
ribosomal protein L7, pseudogene 8 |
15302 |
0.19 |
| chr16_37901578_37901755 | 1.75 |
Gpr156 |
G protein-coupled receptor 156 |
14830 |
0.14 |
| chr6_149194053_149194312 | 1.75 |
Amn1 |
antagonist of mitotic exit network 1 |
5470 |
0.16 |
| chr7_126673507_126673658 | 1.75 |
Sgf29 |
SAGA complex associated factor 29 |
1551 |
0.16 |
| chr7_80973329_80973598 | 1.74 |
Gm18782 |
predicted gene, 18782 |
6430 |
0.11 |
| chr6_115717866_115718504 | 1.74 |
Gm24008 |
predicted gene, 24008 |
5647 |
0.12 |
| chr1_92049227_92049392 | 1.74 |
Gm37036 |
predicted gene, 37036 |
27212 |
0.18 |
| chr9_30851911_30852248 | 1.73 |
Adamts15 |
a disintegrin-like and metallopeptidase (reprolysin type) with thrombospondin type 1 motif, 15 |
57578 |
0.11 |
| chr2_126950478_126950775 | 1.72 |
Sppl2a |
signal peptide peptidase like 2A |
17391 |
0.16 |
| chr17_64666151_64666321 | 1.71 |
Man2a1 |
mannosidase 2, alpha 1 |
47184 |
0.15 |
| chr1_92113726_92113877 | 1.71 |
Hdac4 |
histone deacetylase 4 |
470 |
0.87 |
| chr7_81002031_81002182 | 1.71 |
Gm44967 |
predicted gene 44967 |
7423 |
0.11 |
| chr11_80974682_80974867 | 1.70 |
Gm11416 |
predicted gene 11416 |
72020 |
0.1 |
| chr18_33436546_33436697 | 1.70 |
Nrep |
neuronal regeneration related protein |
26814 |
0.18 |
| chr9_48723477_48723685 | 1.70 |
Zbtb16 |
zinc finger and BTB domain containing 16 |
112364 |
0.06 |
| chr19_17393619_17393790 | 1.68 |
Rfk |
riboflavin kinase |
339 |
0.91 |
| chr5_144364197_144364385 | 1.68 |
Dmrt1i |
Dmrt1 interacting ncRNA |
5766 |
0.18 |
| chr3_18178370_18178521 | 1.68 |
Gm23686 |
predicted gene, 23686 |
820 |
0.7 |
| chr10_59943011_59943708 | 1.67 |
Ddit4 |
DNA-damage-inducible transcript 4 |
8475 |
0.18 |
| chr17_47593664_47594464 | 1.67 |
Ccnd3 |
cyclin D3 |
249 |
0.86 |
| chr16_36933903_36934054 | 1.66 |
Hcls1 |
hematopoietic cell specific Lyn substrate 1 |
1005 |
0.38 |
| chr10_4605740_4606032 | 1.66 |
Esr1 |
estrogen receptor 1 (alpha) |
5707 |
0.24 |
| chr9_55213357_55214013 | 1.65 |
Fbxo22 |
F-box protein 22 |
22 |
0.97 |
| chr2_38221275_38221475 | 1.65 |
Gm44455 |
predicted gene, 44455 |
3747 |
0.23 |
| chr18_81264466_81264617 | 1.65 |
Gm30192 |
predicted gene, 30192 |
150 |
0.97 |
| chr3_19247644_19247795 | 1.65 |
Pde7a |
phosphodiesterase 7A |
11222 |
0.19 |
| chr7_24399784_24400299 | 1.64 |
Smg9 |
smg-9 homolog, nonsense mediated mRNA decay factor (C. elegans) |
120 |
0.92 |
| chr19_12697726_12697882 | 1.64 |
Keg1 |
kidney expressed gene 1 |
1990 |
0.18 |
| chr7_132936116_132936267 | 1.63 |
1500002F19Rik |
RIKEN cDNA 1500002F19 gene |
4994 |
0.16 |
| chr11_35961778_35961962 | 1.63 |
Wwc1 |
WW, C2 and coiled-coil domain containing 1 |
18657 |
0.21 |
| chr1_132138412_132138569 | 1.63 |
Gm29629 |
predicted gene 29629 |
1014 |
0.32 |
| chr1_67172096_67172314 | 1.63 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
49179 |
0.14 |
| chr10_117111439_117111590 | 1.62 |
Frs2 |
fibroblast growth factor receptor substrate 2 |
19332 |
0.13 |
| chr1_31154331_31154482 | 1.62 |
Gm7893 |
predicted gene 7893 |
10143 |
0.14 |
| chr12_72761973_72762438 | 1.61 |
Ppm1a |
protein phosphatase 1A, magnesium dependent, alpha isoform |
890 |
0.59 |
| chr18_33434286_33434492 | 1.60 |
Nrep |
neuronal regeneration related protein |
29046 |
0.17 |
| chr5_145912424_145912575 | 1.60 |
Gm42431 |
predicted gene 42431 |
6379 |
0.16 |
| chr9_47675220_47675386 | 1.59 |
Gm47198 |
predicted gene, 47198 |
95838 |
0.07 |
| chr6_114896405_114896875 | 1.58 |
Vgll4 |
vestigial like family member 4 |
21533 |
0.19 |
| chr4_82469279_82469447 | 1.58 |
n-R5s188 |
nuclear encoded rRNA 5S 188 |
29953 |
0.16 |
| chr1_162892544_162892705 | 1.58 |
Fmo2 |
flavin containing monooxygenase 2 |
5860 |
0.19 |
| chr4_131722124_131722286 | 1.57 |
Gm16080 |
predicted gene 16080 |
11697 |
0.19 |
| chr1_140421414_140421565 | 1.57 |
Kcnt2 |
potassium channel, subfamily T, member 2 |
21447 |
0.27 |
| chr11_100493828_100493979 | 1.57 |
Acly |
ATP citrate lyase |
296 |
0.81 |
| chr3_36483169_36483342 | 1.56 |
1810062G17Rik |
RIKEN cDNA 1810062G17 gene |
7318 |
0.12 |
| chr15_39800082_39800233 | 1.56 |
Gm16291 |
predicted gene 16291 |
3112 |
0.26 |
| chr14_93031053_93031209 | 1.55 |
Gm23509 |
predicted gene, 23509 |
107058 |
0.07 |
| chr10_66912996_66913163 | 1.55 |
1110002J07Rik |
RIKEN cDNA 1110002J07 gene |
4660 |
0.18 |
| chr15_3495710_3495861 | 1.55 |
Ghr |
growth hormone receptor |
24141 |
0.25 |
| chr12_24706013_24706174 | 1.54 |
Rrm2 |
ribonucleotide reductase M2 |
2148 |
0.23 |
| chr2_31519156_31519420 | 1.54 |
Ass1 |
argininosuccinate synthetase 1 |
798 |
0.61 |
| chr11_37149662_37149873 | 1.54 |
Tenm2 |
teneurin transmembrane protein 2 |
86115 |
0.11 |
| chr1_131921949_131922126 | 1.54 |
Nucks1 |
nuclear casein kinase and cyclin-dependent kinase substrate 1 |
7126 |
0.11 |
| chr11_110409657_110409815 | 1.54 |
Map2k6 |
mitogen-activated protein kinase kinase 6 |
10477 |
0.27 |
| chr9_106245058_106245282 | 1.53 |
Alas1 |
aminolevulinic acid synthase 1 |
1536 |
0.23 |
| chr10_23838602_23838753 | 1.53 |
Vnn3 |
vanin 3 |
12785 |
0.12 |
| chr5_40690611_40690784 | 1.53 |
Gm23022 |
predicted gene, 23022 |
284768 |
0.01 |
| chr4_135788797_135789017 | 1.53 |
Myom3 |
myomesin family, member 3 |
9283 |
0.14 |
| chr11_105905841_105906025 | 1.52 |
Tanc2 |
tetratricopeptide repeat, ankyrin repeat and coiled-coil containing 2 |
3950 |
0.17 |
| chrX_12858322_12858537 | 1.52 |
Gm25063 |
predicted gene, 25063 |
11933 |
0.19 |
| chr13_9052712_9052890 | 1.52 |
Gm36264 |
predicted gene, 36264 |
23650 |
0.12 |
| chr4_102586727_102587163 | 1.52 |
Pde4b |
phosphodiesterase 4B, cAMP specific |
613 |
0.84 |
| chr16_10676433_10676716 | 1.51 |
Gm15558 |
predicted gene 15558 |
6965 |
0.18 |
| chr2_38587083_38587234 | 1.51 |
Gm44183 |
predicted gene, 44183 |
20804 |
0.12 |
| chr4_141958991_141959142 | 1.51 |
Fhad1 |
forkhead-associated (FHA) phosphopeptide binding domain 1 |
4872 |
0.15 |
| chr19_29668488_29668647 | 1.50 |
Ermp1 |
endoplasmic reticulum metallopeptidase 1 |
20152 |
0.17 |
| chr18_34921979_34922139 | 1.50 |
Etf1 |
eukaryotic translation termination factor 1 |
9948 |
0.12 |
| chr12_104088559_104088873 | 1.50 |
Serpina4-ps1 |
serine (or cysteine) peptidase inhibitor, clade A, member 4, pseudogene 1 |
8067 |
0.1 |
| chr4_55339011_55339182 | 1.50 |
Rad23b |
RAD23 homolog B, nucleotide excision repair protein |
10947 |
0.15 |
| chr6_99409382_99409533 | 1.49 |
Gm20705 |
predicted gene 20705 |
20958 |
0.18 |
| chr4_149980056_149980645 | 1.49 |
H6pd |
hexose-6-phosphate dehydrogenase (glucose 1-dehydrogenase) |
20915 |
0.13 |
| chr11_77417847_77418056 | 1.49 |
Ssh2 |
slingshot protein phosphatase 2 |
26514 |
0.13 |
| chr6_84225136_84225617 | 1.49 |
Gm44127 |
predicted gene, 44127 |
124 |
0.97 |
| chr5_87378725_87378979 | 1.49 |
Gm21049 |
predicted gene, 21049 |
1068 |
0.35 |
| chr13_47693489_47693893 | 1.48 |
4930471G24Rik |
RIKEN cDNA 4930471G24 gene |
26141 |
0.25 |
| chr4_105328178_105328374 | 1.48 |
Gm12722 |
predicted gene 12722 |
46670 |
0.19 |
| chr11_95713370_95714182 | 1.48 |
Zfp652 |
zinc finger protein 652 |
765 |
0.43 |
| chr8_36291368_36291583 | 1.48 |
Lonrf1 |
LON peptidase N-terminal domain and ring finger 1 |
41959 |
0.14 |
| chr7_97421325_97421669 | 1.48 |
Thrsp |
thyroid hormone responsive |
3767 |
0.16 |
| chr2_129865084_129865235 | 1.48 |
Stk35 |
serine/threonine kinase 35 |
64642 |
0.1 |
| chr8_94390003_94390215 | 1.47 |
Herpud1 |
homocysteine-inducible, endoplasmic reticulum stress-inducible, ubiquitin-like domain member 1 |
681 |
0.52 |
| chr7_119960641_119960795 | 1.47 |
Dnah3 |
dynein, axonemal, heavy chain 3 |
7124 |
0.16 |
| chr8_77099938_77100089 | 1.47 |
Nr3c2 |
nuclear receptor subfamily 3, group C, member 2 |
28000 |
0.19 |
| chr17_11751604_11751755 | 1.45 |
Gm10513 |
predicted gene 10513 |
19334 |
0.26 |
| chr8_105801806_105801957 | 1.44 |
Ranbp10 |
RAN binding protein 10 |
25324 |
0.08 |
| chrX_140538466_140538617 | 1.44 |
Tsc22d3 |
TSC22 domain family, member 3 |
4127 |
0.24 |
| chr14_8013059_8013249 | 1.44 |
Abhd6 |
abhydrolase domain containing 6 |
10188 |
0.17 |
| chr15_36501789_36501940 | 1.43 |
Gm49246 |
predicted gene, 49246 |
1567 |
0.32 |
| chr8_93266650_93266871 | 1.43 |
Ces1f |
carboxylesterase 1F |
518 |
0.73 |
| chr15_58134571_58134722 | 1.43 |
Atad2 |
ATPase family, AAA domain containing 2 |
436 |
0.75 |
| chr14_75154252_75154403 | 1.43 |
Gm15628 |
predicted gene 15628 |
17415 |
0.14 |
| chr11_43900005_43900196 | 1.43 |
Adra1b |
adrenergic receptor, alpha 1b |
1110 |
0.61 |
| chr8_101350483_101350634 | 1.42 |
Gm22223 |
predicted gene, 22223 |
189150 |
0.03 |
| chr2_34771299_34771455 | 1.42 |
Hspa5 |
heat shock protein 5 |
593 |
0.66 |
| chr9_78192592_78192962 | 1.42 |
Gsta4 |
glutathione S-transferase, alpha 4 |
830 |
0.46 |
| chr2_169929567_169929785 | 1.42 |
AY702102 |
cDNA sequence AY702102 |
33311 |
0.2 |
| chr15_81249111_81249532 | 1.42 |
8430426J06Rik |
RIKEN cDNA 8430426J06 gene |
1353 |
0.36 |
| chr3_83966032_83966183 | 1.42 |
Tmem131l |
transmembrane 131 like |
2121 |
0.41 |
| chr2_134977060_134977253 | 1.41 |
Gm14036 |
predicted gene 14036 |
173207 |
0.03 |
| chr8_123808755_123809163 | 1.41 |
Rab4a |
RAB4A, member RAS oncogene family |
2891 |
0.13 |
| chr2_52579266_52579417 | 1.41 |
Cacnb4 |
calcium channel, voltage-dependent, beta 4 subunit |
20774 |
0.18 |
| chr2_67993777_67994087 | 1.40 |
Gm13607 |
predicted gene 13607 |
87859 |
0.08 |
| chr10_26855717_26855868 | 1.40 |
Arhgap18 |
Rho GTPase activating protein 18 |
7550 |
0.25 |
| chr1_162964214_162964365 | 1.40 |
Gm37273 |
predicted gene, 37273 |
18725 |
0.14 |
| chr5_70202648_70202815 | 1.40 |
Gm23067 |
predicted gene, 23067 |
15885 |
0.3 |
| chr19_40158669_40158820 | 1.40 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
28542 |
0.13 |
| chr14_105142720_105142889 | 1.40 |
Rbm26 |
RNA binding motif protein 26 |
12467 |
0.17 |
| chr10_97249598_97249782 | 1.39 |
Gm18515 |
predicted gene, 18515 |
7778 |
0.26 |
| chr4_127077236_127077665 | 1.39 |
Zmym6 |
zinc finger, MYM-type 6 |
8 |
0.96 |
| chr2_72206740_72207276 | 1.39 |
Rapgef4 |
Rap guanine nucleotide exchange factor (GEF) 4 |
8209 |
0.18 |
| chr1_21232680_21233066 | 1.38 |
Gm38224 |
predicted gene, 38224 |
1849 |
0.23 |
| chr19_14596433_14596591 | 1.38 |
Tle4 |
transducin-like enhancer of split 4 |
973 |
0.68 |
| chr11_98301768_98301944 | 1.38 |
Gm20644 |
predicted gene 20644 |
16474 |
0.09 |
| chr3_18241613_18241838 | 1.38 |
Cyp7b1 |
cytochrome P450, family 7, subfamily b, polypeptide 1 |
1613 |
0.45 |
| chr16_93353844_93354010 | 1.38 |
1810053B23Rik |
RIKEN cDNA 1810053B23 gene |
134 |
0.96 |
| chr1_67152094_67152459 | 1.38 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
29250 |
0.19 |
| chr2_102132488_102132639 | 1.37 |
Ldlrad3 |
low density lipoprotein receptor class A domain containing 3 |
5556 |
0.23 |
| chr18_36656725_36657021 | 1.37 |
Ankhd1 |
ankyrin repeat and KH domain containing 1 |
1363 |
0.23 |
| chr15_88854629_88854809 | 1.37 |
Pim3 |
proviral integration site 3 |
7467 |
0.13 |
| chr7_30665127_30665464 | 1.37 |
Haus5 |
HAUS augmin-like complex, subunit 5 |
301 |
0.47 |
| chr6_97293782_97293955 | 1.37 |
Frmd4b |
FERM domain containing 4B |
2607 |
0.3 |
| chr9_115307686_115307849 | 1.36 |
Stt3b |
STT3, subunit of the oligosaccharyltransferase complex, homolog B (S. cerevisiae) |
2654 |
0.24 |
| chr18_38370754_38370932 | 1.36 |
Gm4949 |
predicted gene 4949 |
10305 |
0.12 |
| chr5_125526782_125527104 | 1.36 |
Tmem132b |
transmembrane protein 132B |
4831 |
0.18 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.9 | 5.6 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 1.5 | 4.4 | GO:0010046 | response to mycotoxin(GO:0010046) |
| 0.8 | 3.4 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.8 | 1.7 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
| 0.8 | 2.4 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
| 0.8 | 0.8 | GO:0071492 | cellular response to UV-A(GO:0071492) |
| 0.7 | 3.7 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
| 0.7 | 3.0 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.7 | 2.8 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 0.5 | 1.6 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
| 0.5 | 1.6 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
| 0.5 | 1.6 | GO:0006068 | ethanol catabolic process(GO:0006068) |
| 0.5 | 1.5 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
| 0.5 | 1.9 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
| 0.5 | 1.5 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
| 0.5 | 1.8 | GO:0046449 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
| 0.4 | 1.8 | GO:0030035 | microspike assembly(GO:0030035) |
| 0.4 | 1.3 | GO:0060620 | regulation of cholesterol import(GO:0060620) regulation of sterol import(GO:2000909) |
| 0.4 | 1.7 | GO:0072592 | oxygen metabolic process(GO:0072592) |
| 0.4 | 2.1 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
| 0.4 | 1.3 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.4 | 1.3 | GO:1903984 | positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
| 0.4 | 1.2 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
| 0.4 | 1.5 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
| 0.4 | 0.8 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
| 0.4 | 0.8 | GO:1904016 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
| 0.4 | 0.8 | GO:0032439 | endosome localization(GO:0032439) |
| 0.4 | 1.1 | GO:0046271 | phenylpropanoid catabolic process(GO:0046271) |
| 0.4 | 1.1 | GO:0038095 | Fc-epsilon receptor signaling pathway(GO:0038095) |
| 0.4 | 1.8 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 0.4 | 0.7 | GO:0046098 | guanine metabolic process(GO:0046098) |
| 0.4 | 1.5 | GO:0061641 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.4 | 1.1 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.4 | 0.4 | GO:0009804 | coumarin metabolic process(GO:0009804) |
| 0.3 | 3.8 | GO:0048742 | regulation of skeletal muscle fiber development(GO:0048742) |
| 0.3 | 0.7 | GO:2000618 | regulation of histone H4-K16 acetylation(GO:2000618) |
| 0.3 | 1.4 | GO:0001997 | positive regulation of the force of heart contraction by epinephrine-norepinephrine(GO:0001997) positive regulation of the force of heart contraction by chemical signal(GO:0003099) |
| 0.3 | 1.7 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
| 0.3 | 1.0 | GO:1901509 | regulation of endothelial tube morphogenesis(GO:1901509) |
| 0.3 | 1.3 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
| 0.3 | 0.9 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
| 0.3 | 1.6 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.3 | 0.9 | GO:0045583 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
| 0.3 | 2.8 | GO:0009404 | toxin metabolic process(GO:0009404) |
| 0.3 | 1.2 | GO:0042420 | dopamine catabolic process(GO:0042420) |
| 0.3 | 1.8 | GO:1903799 | regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903798) negative regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903799) |
| 0.3 | 1.5 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
| 0.3 | 0.6 | GO:0030167 | proteoglycan catabolic process(GO:0030167) |
| 0.3 | 0.9 | GO:0002386 | immune response in mucosal-associated lymphoid tissue(GO:0002386) |
| 0.3 | 0.9 | GO:1904380 | endoplasmic reticulum mannose trimming(GO:1904380) |
| 0.3 | 2.5 | GO:0070189 | kynurenine metabolic process(GO:0070189) |
| 0.3 | 1.4 | GO:0048669 | collateral sprouting in absence of injury(GO:0048669) |
| 0.3 | 0.8 | GO:0021553 | olfactory nerve development(GO:0021553) |
| 0.3 | 0.8 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
| 0.3 | 1.1 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
| 0.3 | 1.1 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
| 0.3 | 1.3 | GO:0021779 | oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
| 0.3 | 1.6 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
| 0.3 | 0.3 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
| 0.3 | 1.1 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.3 | 1.0 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
| 0.3 | 1.0 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
| 0.3 | 1.3 | GO:0032237 | activation of store-operated calcium channel activity(GO:0032237) |
| 0.3 | 0.5 | GO:2000698 | positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) |
| 0.3 | 0.8 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
| 0.2 | 1.0 | GO:0052055 | modulation by symbiont of host molecular function(GO:0052055) |
| 0.2 | 0.7 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
| 0.2 | 2.6 | GO:0055089 | fatty acid homeostasis(GO:0055089) |
| 0.2 | 0.9 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.2 | 0.7 | GO:0006553 | lysine metabolic process(GO:0006553) |
| 0.2 | 0.5 | GO:0006210 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
| 0.2 | 0.9 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
| 0.2 | 0.5 | GO:0044034 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 0.2 | 0.4 | GO:0070375 | ERK5 cascade(GO:0070375) |
| 0.2 | 0.7 | GO:2000847 | negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
| 0.2 | 1.3 | GO:0009074 | aromatic amino acid family catabolic process(GO:0009074) |
| 0.2 | 0.7 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
| 0.2 | 0.7 | GO:0035284 | central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
| 0.2 | 0.9 | GO:0070535 | histone H2A K63-linked ubiquitination(GO:0070535) |
| 0.2 | 1.1 | GO:0070874 | negative regulation of glycogen biosynthetic process(GO:0045719) negative regulation of glycogen metabolic process(GO:0070874) |
| 0.2 | 0.6 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
| 0.2 | 0.4 | GO:0045722 | positive regulation of gluconeogenesis(GO:0045722) |
| 0.2 | 0.6 | GO:0072367 | regulation of lipid transport by regulation of transcription from RNA polymerase II promoter(GO:0072367) |
| 0.2 | 1.1 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.2 | 1.1 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
| 0.2 | 0.9 | GO:2000623 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.2 | 0.6 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
| 0.2 | 0.6 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.2 | 1.1 | GO:0006642 | triglyceride mobilization(GO:0006642) |
| 0.2 | 0.8 | GO:0016584 | nucleosome positioning(GO:0016584) |
| 0.2 | 0.4 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
| 0.2 | 1.4 | GO:0008354 | germ cell migration(GO:0008354) |
| 0.2 | 0.4 | GO:0001834 | trophectodermal cell proliferation(GO:0001834) |
| 0.2 | 1.8 | GO:0097459 | iron ion import into cell(GO:0097459) |
| 0.2 | 0.8 | GO:1901339 | regulation of store-operated calcium channel activity(GO:1901339) |
| 0.2 | 4.1 | GO:0052696 | flavonoid biosynthetic process(GO:0009813) flavonoid glucuronidation(GO:0052696) |
| 0.2 | 0.6 | GO:1903347 | negative regulation of bicellular tight junction assembly(GO:1903347) |
| 0.2 | 1.4 | GO:0045908 | negative regulation of vasodilation(GO:0045908) |
| 0.2 | 1.0 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
| 0.2 | 1.4 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
| 0.2 | 1.2 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
| 0.2 | 0.4 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
| 0.2 | 1.5 | GO:1904871 | protein localization to nuclear body(GO:1903405) protein localization to Cajal body(GO:1904867) regulation of protein localization to Cajal body(GO:1904869) positive regulation of protein localization to Cajal body(GO:1904871) protein localization to nucleoplasm(GO:1990173) |
| 0.2 | 1.3 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
| 0.2 | 0.6 | GO:0003383 | apical constriction(GO:0003383) |
| 0.2 | 0.7 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
| 0.2 | 0.4 | GO:2000664 | positive regulation of interleukin-5 secretion(GO:2000664) positive regulation of interleukin-13 secretion(GO:2000667) |
| 0.2 | 0.6 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
| 0.2 | 0.6 | GO:0002741 | positive regulation of cytokine secretion involved in immune response(GO:0002741) |
| 0.2 | 0.9 | GO:0060020 | Bergmann glial cell differentiation(GO:0060020) |
| 0.2 | 3.5 | GO:0031954 | positive regulation of protein autophosphorylation(GO:0031954) |
| 0.2 | 0.6 | GO:0031086 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.2 | 0.5 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
| 0.2 | 0.5 | GO:1901300 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
| 0.2 | 0.5 | GO:0021823 | cerebral cortex tangential migration using cell-cell interactions(GO:0021823) postnatal olfactory bulb interneuron migration(GO:0021827) |
| 0.2 | 0.5 | GO:0015842 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.2 | 1.8 | GO:0006103 | 2-oxoglutarate metabolic process(GO:0006103) |
| 0.2 | 0.5 | GO:0045074 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
| 0.2 | 0.5 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
| 0.2 | 0.9 | GO:1903689 | regulation of wound healing, spreading of epidermal cells(GO:1903689) |
| 0.2 | 0.2 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
| 0.2 | 1.0 | GO:0009162 | deoxyribonucleoside monophosphate metabolic process(GO:0009162) |
| 0.2 | 0.3 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
| 0.2 | 0.7 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
| 0.2 | 0.3 | GO:0050427 | 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
| 0.2 | 0.7 | GO:0030638 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.2 | 0.3 | GO:1904339 | negative regulation of dopaminergic neuron differentiation(GO:1904339) |
| 0.2 | 1.2 | GO:0002072 | optic cup morphogenesis involved in camera-type eye development(GO:0002072) |
| 0.2 | 0.8 | GO:0045349 | interferon-alpha biosynthetic process(GO:0045349) regulation of interferon-alpha biosynthetic process(GO:0045354) |
| 0.2 | 1.5 | GO:0071498 | cellular response to fluid shear stress(GO:0071498) |
| 0.2 | 0.5 | GO:0061010 | gall bladder development(GO:0061010) |
| 0.2 | 0.2 | GO:0042661 | regulation of mesodermal cell fate specification(GO:0042661) |
| 0.2 | 0.5 | GO:0016259 | selenocysteine metabolic process(GO:0016259) |
| 0.2 | 1.2 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
| 0.2 | 0.8 | GO:0014029 | neural crest formation(GO:0014029) |
| 0.2 | 1.3 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.2 | 0.2 | GO:0010908 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
| 0.2 | 0.7 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
| 0.2 | 0.3 | GO:0045917 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
| 0.2 | 0.5 | GO:0061368 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
| 0.2 | 0.5 | GO:0071314 | cellular response to cocaine(GO:0071314) |
| 0.2 | 0.5 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
| 0.2 | 1.3 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
| 0.2 | 0.2 | GO:1900020 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
| 0.2 | 0.5 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
| 0.2 | 0.8 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.2 | 0.2 | GO:0046101 | hypoxanthine metabolic process(GO:0046100) hypoxanthine biosynthetic process(GO:0046101) |
| 0.2 | 1.0 | GO:0090051 | negative regulation of cell migration involved in sprouting angiogenesis(GO:0090051) |
| 0.2 | 0.5 | GO:0045738 | negative regulation of DNA repair(GO:0045738) negative regulation of double-strand break repair(GO:2000780) |
| 0.2 | 0.5 | GO:0042628 | mating plug formation(GO:0042628) post-mating behavior(GO:0045297) |
| 0.2 | 0.3 | GO:0071455 | cellular response to increased oxygen levels(GO:0036295) cellular response to hyperoxia(GO:0071455) |
| 0.2 | 0.3 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
| 0.2 | 0.8 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.2 | 0.8 | GO:0071038 | nuclear polyadenylation-dependent tRNA catabolic process(GO:0071038) |
| 0.2 | 0.9 | GO:2000510 | positive regulation of dendritic cell chemotaxis(GO:2000510) |
| 0.2 | 0.5 | GO:0048807 | female genitalia morphogenesis(GO:0048807) |
| 0.2 | 1.1 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
| 0.1 | 0.6 | GO:0060283 | negative regulation of oocyte development(GO:0060283) |
| 0.1 | 1.0 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
| 0.1 | 0.4 | GO:0021564 | vagus nerve development(GO:0021564) |
| 0.1 | 0.1 | GO:0052173 | response to defenses of other organism involved in symbiotic interaction(GO:0052173) response to host defenses(GO:0052200) response to host(GO:0075136) |
| 0.1 | 0.6 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
| 0.1 | 0.6 | GO:0002317 | plasma cell differentiation(GO:0002317) |
| 0.1 | 0.3 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
| 0.1 | 0.4 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 0.1 | 0.6 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.1 | 0.4 | GO:0030397 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
| 0.1 | 0.4 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
| 0.1 | 0.1 | GO:0022615 | protein to membrane docking(GO:0022615) |
| 0.1 | 0.7 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
| 0.1 | 0.4 | GO:0048597 | post-embryonic camera-type eye morphogenesis(GO:0048597) |
| 0.1 | 0.1 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
| 0.1 | 0.1 | GO:0090114 | COPII-coated vesicle budding(GO:0090114) |
| 0.1 | 1.4 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
| 0.1 | 0.6 | GO:0045541 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
| 0.1 | 0.1 | GO:0071029 | polyadenylation-dependent ncRNA catabolic process(GO:0043634) nuclear ncRNA surveillance(GO:0071029) nuclear polyadenylation-dependent rRNA catabolic process(GO:0071035) nuclear polyadenylation-dependent ncRNA catabolic process(GO:0071046) |
| 0.1 | 0.6 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
| 0.1 | 0.1 | GO:0036507 | protein deglycosylation involved in glycoprotein catabolic process(GO:0035977) protein demannosylation(GO:0036507) protein alpha-1,2-demannosylation(GO:0036508) mannose trimming involved in glycoprotein ERAD pathway(GO:1904382) |
| 0.1 | 1.1 | GO:0006107 | oxaloacetate metabolic process(GO:0006107) |
| 0.1 | 0.3 | GO:1901536 | regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
| 0.1 | 0.7 | GO:0046477 | glycosylceramide catabolic process(GO:0046477) |
| 0.1 | 0.4 | GO:0000087 | mitotic M phase(GO:0000087) |
| 0.1 | 0.3 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
| 0.1 | 0.5 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
| 0.1 | 0.5 | GO:0010587 | miRNA catabolic process(GO:0010587) |
| 0.1 | 0.5 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
| 0.1 | 0.8 | GO:0009445 | putrescine metabolic process(GO:0009445) |
| 0.1 | 0.4 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) |
| 0.1 | 0.1 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 0.1 | 0.9 | GO:0071397 | cellular response to cholesterol(GO:0071397) |
| 0.1 | 0.7 | GO:0006108 | malate metabolic process(GO:0006108) |
| 0.1 | 0.8 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
| 0.1 | 0.5 | GO:0006407 | rRNA export from nucleus(GO:0006407) |
| 0.1 | 0.4 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
| 0.1 | 0.7 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
| 0.1 | 0.3 | GO:0014732 | skeletal muscle atrophy(GO:0014732) striated muscle atrophy(GO:0014891) |
| 0.1 | 0.4 | GO:1902744 | negative regulation of lamellipodium organization(GO:1902744) |
| 0.1 | 0.5 | GO:0090209 | negative regulation of triglyceride metabolic process(GO:0090209) |
| 0.1 | 0.1 | GO:0045213 | neurotransmitter receptor metabolic process(GO:0045213) |
| 0.1 | 0.3 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
| 0.1 | 0.5 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
| 0.1 | 0.6 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
| 0.1 | 0.3 | GO:2000586 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
| 0.1 | 0.4 | GO:0007529 | establishment of synaptic specificity at neuromuscular junction(GO:0007529) |
| 0.1 | 0.4 | GO:0030576 | Cajal body organization(GO:0030576) |
| 0.1 | 0.5 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
| 0.1 | 0.4 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
| 0.1 | 0.5 | GO:0008355 | olfactory learning(GO:0008355) |
| 0.1 | 0.5 | GO:0010835 | regulation of protein ADP-ribosylation(GO:0010835) |
| 0.1 | 0.4 | GO:0070427 | nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070427) |
| 0.1 | 0.4 | GO:0042117 | monocyte activation(GO:0042117) |
| 0.1 | 0.3 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
| 0.1 | 0.4 | GO:0021699 | cerebellar cortex maturation(GO:0021699) |
| 0.1 | 0.5 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
| 0.1 | 0.1 | GO:0070627 | ferrous iron import(GO:0070627) |
| 0.1 | 0.1 | GO:0055118 | negative regulation of cardiac muscle contraction(GO:0055118) |
| 0.1 | 0.9 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.1 | 0.5 | GO:0045416 | positive regulation of interleukin-8 biosynthetic process(GO:0045416) |
| 0.1 | 0.6 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
| 0.1 | 0.5 | GO:0048007 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
| 0.1 | 0.4 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.1 | 1.0 | GO:0008343 | adult feeding behavior(GO:0008343) |
| 0.1 | 0.2 | GO:0046684 | response to pyrethroid(GO:0046684) |
| 0.1 | 0.4 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.1 | 0.2 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
| 0.1 | 1.8 | GO:2000193 | positive regulation of fatty acid transport(GO:2000193) |
| 0.1 | 0.4 | GO:1902369 | negative regulation of RNA catabolic process(GO:1902369) |
| 0.1 | 0.8 | GO:0015838 | amino-acid betaine transport(GO:0015838) |
| 0.1 | 0.1 | GO:0010982 | regulation of high-density lipoprotein particle clearance(GO:0010982) |
| 0.1 | 0.1 | GO:0007135 | meiosis II(GO:0007135) |
| 0.1 | 0.5 | GO:0003241 | growth involved in heart morphogenesis(GO:0003241) |
| 0.1 | 0.8 | GO:1901407 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
| 0.1 | 0.1 | GO:0015744 | succinate transport(GO:0015744) |
| 0.1 | 0.2 | GO:0060268 | negative regulation of respiratory burst involved in inflammatory response(GO:0060266) negative regulation of respiratory burst(GO:0060268) |
| 0.1 | 1.3 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.1 | 0.9 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
| 0.1 | 0.9 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.1 | 0.3 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
| 0.1 | 2.1 | GO:0017144 | drug metabolic process(GO:0017144) |
| 0.1 | 0.8 | GO:0046628 | positive regulation of insulin receptor signaling pathway(GO:0046628) |
| 0.1 | 0.7 | GO:0061418 | regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061418) |
| 0.1 | 0.7 | GO:1900364 | negative regulation of mRNA polyadenylation(GO:1900364) |
| 0.1 | 0.3 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.1 | 0.1 | GO:0072718 | response to cisplatin(GO:0072718) |
| 0.1 | 0.3 | GO:0032310 | prostaglandin secretion(GO:0032310) |
| 0.1 | 0.3 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
| 0.1 | 0.6 | GO:0046416 | D-amino acid metabolic process(GO:0046416) |
| 0.1 | 0.8 | GO:0032532 | regulation of microvillus length(GO:0032532) |
| 0.1 | 0.2 | GO:0051295 | establishment of meiotic spindle localization(GO:0051295) |
| 0.1 | 0.4 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
| 0.1 | 0.4 | GO:0036089 | cleavage furrow formation(GO:0036089) |
| 0.1 | 0.4 | GO:0090427 | activation of meiosis(GO:0090427) |
| 0.1 | 0.7 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.1 | 0.3 | GO:0007227 | signal transduction downstream of smoothened(GO:0007227) |
| 0.1 | 0.8 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 0.1 | 0.4 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
| 0.1 | 0.7 | GO:0060049 | regulation of protein glycosylation(GO:0060049) |
| 0.1 | 0.3 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.1 | 0.5 | GO:0015867 | ATP transport(GO:0015867) |
| 0.1 | 0.4 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
| 0.1 | 1.4 | GO:0045116 | protein neddylation(GO:0045116) |
| 0.1 | 0.6 | GO:1900016 | negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
| 0.1 | 0.6 | GO:0015871 | choline transport(GO:0015871) |
| 0.1 | 0.5 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
| 0.1 | 0.4 | GO:0048478 | replication fork protection(GO:0048478) |
| 0.1 | 0.9 | GO:0006013 | mannose metabolic process(GO:0006013) |
| 0.1 | 0.5 | GO:0051683 | establishment of Golgi localization(GO:0051683) |
| 0.1 | 0.2 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
| 0.1 | 0.7 | GO:0098870 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
| 0.1 | 0.4 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.1 | 0.1 | GO:1901725 | regulation of histone deacetylase activity(GO:1901725) |
| 0.1 | 0.3 | GO:0048769 | sarcomerogenesis(GO:0048769) |
| 0.1 | 0.2 | GO:0006562 | proline catabolic process(GO:0006562) |
| 0.1 | 0.4 | GO:0045794 | negative regulation of cell volume(GO:0045794) |
| 0.1 | 0.7 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.1 | 0.9 | GO:0050995 | negative regulation of lipid catabolic process(GO:0050995) |
| 0.1 | 1.0 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.1 | 0.2 | GO:0060900 | embryonic camera-type eye formation(GO:0060900) |
| 0.1 | 1.6 | GO:0022401 | desensitization of G-protein coupled receptor protein signaling pathway(GO:0002029) negative adaptation of signaling pathway(GO:0022401) |
| 0.1 | 0.1 | GO:0035754 | B cell chemotaxis(GO:0035754) |
| 0.1 | 0.3 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
| 0.1 | 0.2 | GO:0006001 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
| 0.1 | 0.2 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
| 0.1 | 0.2 | GO:0060279 | positive regulation of ovulation(GO:0060279) |
| 0.1 | 1.2 | GO:0003334 | keratinocyte development(GO:0003334) |
| 0.1 | 0.3 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
| 0.1 | 0.2 | GO:0042660 | positive regulation of cell fate specification(GO:0042660) |
| 0.1 | 0.4 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
| 0.1 | 2.1 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
| 0.1 | 0.3 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
| 0.1 | 0.6 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.1 | 0.2 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
| 0.1 | 2.2 | GO:0000184 | nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
| 0.1 | 0.2 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
| 0.1 | 0.2 | GO:1901164 | trophoblast cell migration(GO:0061450) negative regulation of trophoblast cell migration(GO:1901164) |
| 0.1 | 0.4 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.1 | 0.5 | GO:0010727 | negative regulation of hydrogen peroxide metabolic process(GO:0010727) |
| 0.1 | 0.5 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
| 0.1 | 0.8 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
| 0.1 | 0.2 | GO:0060665 | regulation of branching involved in salivary gland morphogenesis by mesenchymal-epithelial signaling(GO:0060665) |
| 0.1 | 0.1 | GO:0070295 | renal water absorption(GO:0070295) |
| 0.1 | 0.2 | GO:0032513 | negative regulation of protein phosphatase type 2B activity(GO:0032513) |
| 0.1 | 0.5 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.1 | 0.1 | GO:0071798 | response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
| 0.1 | 0.8 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
| 0.1 | 1.0 | GO:0007194 | negative regulation of adenylate cyclase activity(GO:0007194) |
| 0.1 | 0.4 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
| 0.1 | 0.6 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
| 0.1 | 1.9 | GO:0046834 | lipid phosphorylation(GO:0046834) |
| 0.1 | 0.1 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
| 0.1 | 0.3 | GO:0034310 | primary alcohol catabolic process(GO:0034310) |
| 0.1 | 0.2 | GO:0002155 | thyroid hormone mediated signaling pathway(GO:0002154) regulation of thyroid hormone mediated signaling pathway(GO:0002155) |
| 0.1 | 0.3 | GO:0010796 | regulation of multivesicular body size(GO:0010796) |
| 0.1 | 0.2 | GO:0046643 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
| 0.1 | 0.3 | GO:1903679 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.1 | 0.3 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
| 0.1 | 0.4 | GO:0070814 | hydrogen sulfide biosynthetic process(GO:0070814) |
| 0.1 | 0.2 | GO:0009826 | unidimensional cell growth(GO:0009826) |
| 0.1 | 2.5 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
| 0.1 | 0.3 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) |
| 0.1 | 0.2 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
| 0.1 | 0.6 | GO:0015858 | nucleoside transport(GO:0015858) |
| 0.1 | 0.9 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.1 | 0.4 | GO:0032460 | negative regulation of protein oligomerization(GO:0032460) |
| 0.1 | 1.1 | GO:0006878 | cellular copper ion homeostasis(GO:0006878) |
| 0.1 | 0.2 | GO:2000347 | positive regulation of hepatocyte proliferation(GO:2000347) |
| 0.1 | 0.2 | GO:0090205 | positive regulation of cholesterol biosynthetic process(GO:0045542) positive regulation of cholesterol metabolic process(GO:0090205) |
| 0.1 | 0.3 | GO:0001927 | exocyst assembly(GO:0001927) |
| 0.1 | 0.2 | GO:0071733 | transcriptional activation by promoter-enhancer looping(GO:0071733) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
| 0.1 | 0.3 | GO:0097167 | circadian regulation of translation(GO:0097167) |
| 0.1 | 0.4 | GO:0090110 | cargo loading into COPII-coated vesicle(GO:0090110) |
| 0.1 | 0.3 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
| 0.1 | 0.3 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
| 0.1 | 0.4 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.1 | 0.3 | GO:0021603 | cranial nerve formation(GO:0021603) |
| 0.1 | 0.3 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
| 0.1 | 0.1 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
| 0.1 | 0.3 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
| 0.1 | 2.9 | GO:0033139 | regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033139) |
| 0.1 | 0.3 | GO:0061727 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 0.1 | 0.2 | GO:2001270 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) |
| 0.1 | 0.2 | GO:0003139 | secondary heart field specification(GO:0003139) |
| 0.1 | 0.3 | GO:2000381 | negative regulation of mesoderm development(GO:2000381) |
| 0.1 | 0.3 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
| 0.1 | 0.1 | GO:0072144 | glomerular mesangial cell differentiation(GO:0072008) glomerular mesangial cell development(GO:0072144) |
| 0.1 | 0.2 | GO:0090188 | negative regulation of pancreatic juice secretion(GO:0090188) |
| 0.1 | 0.1 | GO:0031627 | telomeric loop formation(GO:0031627) |
| 0.1 | 0.2 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
| 0.1 | 0.4 | GO:0046485 | ether lipid metabolic process(GO:0046485) |
| 0.1 | 0.3 | GO:0070163 | adiponectin secretion(GO:0070162) regulation of adiponectin secretion(GO:0070163) |
| 0.1 | 0.3 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
| 0.1 | 0.6 | GO:0045651 | positive regulation of macrophage differentiation(GO:0045651) |
| 0.1 | 0.1 | GO:0042231 | interleukin-13 biosynthetic process(GO:0042231) |
| 0.1 | 0.1 | GO:1903671 | negative regulation of sprouting angiogenesis(GO:1903671) |
| 0.1 | 0.3 | GO:0000019 | regulation of mitotic recombination(GO:0000019) |
| 0.1 | 0.3 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 0.1 | 0.2 | GO:0006768 | biotin metabolic process(GO:0006768) |
| 0.1 | 0.2 | GO:0019695 | choline metabolic process(GO:0019695) |
| 0.1 | 0.1 | GO:0007008 | outer mitochondrial membrane organization(GO:0007008) |
| 0.1 | 0.2 | GO:0006591 | ornithine metabolic process(GO:0006591) |
| 0.1 | 0.5 | GO:0015074 | DNA integration(GO:0015074) |
| 0.1 | 1.0 | GO:0042407 | cristae formation(GO:0042407) |
| 0.1 | 0.2 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
| 0.1 | 0.2 | GO:0006059 | hexitol metabolic process(GO:0006059) |
| 0.1 | 0.2 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
| 0.1 | 0.2 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
| 0.1 | 0.2 | GO:0090361 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.1 | 0.1 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
| 0.1 | 0.2 | GO:0015820 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
| 0.1 | 0.3 | GO:0014043 | negative regulation of neuron maturation(GO:0014043) |
| 0.1 | 0.2 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
| 0.1 | 0.2 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
| 0.1 | 0.4 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
| 0.1 | 0.2 | GO:0003344 | pericardium morphogenesis(GO:0003344) |
| 0.1 | 0.3 | GO:0018103 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.1 | 0.5 | GO:0045792 | negative regulation of cell size(GO:0045792) |
| 0.1 | 0.2 | GO:0042126 | nitrate metabolic process(GO:0042126) |
| 0.1 | 0.2 | GO:0000459 | exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) |
| 0.1 | 1.7 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
| 0.1 | 0.1 | GO:0070601 | centromeric sister chromatid cohesion(GO:0070601) |
| 0.1 | 0.8 | GO:0033137 | negative regulation of peptidyl-serine phosphorylation(GO:0033137) |
| 0.1 | 0.2 | GO:0042795 | snRNA transcription from RNA polymerase II promoter(GO:0042795) |
| 0.1 | 0.8 | GO:0043153 | entrainment of circadian clock by photoperiod(GO:0043153) |
| 0.1 | 0.2 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.1 | 1.4 | GO:0006805 | xenobiotic metabolic process(GO:0006805) |
| 0.1 | 0.4 | GO:0051639 | actin filament network formation(GO:0051639) |
| 0.1 | 0.2 | GO:0046985 | positive regulation of hemoglobin biosynthetic process(GO:0046985) |
| 0.1 | 2.7 | GO:0007584 | response to nutrient(GO:0007584) |
| 0.1 | 0.4 | GO:0071763 | nuclear membrane organization(GO:0071763) |
| 0.1 | 0.5 | GO:0035826 | rubidium ion transport(GO:0035826) |
| 0.1 | 0.3 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
| 0.1 | 0.4 | GO:0090527 | actin filament reorganization(GO:0090527) |
| 0.1 | 0.4 | GO:0086013 | membrane repolarization during cardiac muscle cell action potential(GO:0086013) |
| 0.1 | 1.0 | GO:0042573 | retinoic acid metabolic process(GO:0042573) |
| 0.1 | 0.4 | GO:0034375 | high-density lipoprotein particle remodeling(GO:0034375) |
| 0.1 | 0.5 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
| 0.1 | 0.1 | GO:1903298 | regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903297) negative regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903298) |
| 0.1 | 0.1 | GO:0032898 | neurotrophin production(GO:0032898) |
| 0.1 | 0.3 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.1 | 0.3 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
| 0.1 | 0.2 | GO:0014063 | negative regulation of serotonin secretion(GO:0014063) |
| 0.1 | 0.2 | GO:0071895 | odontoblast differentiation(GO:0071895) |
| 0.1 | 0.2 | GO:0006393 | termination of mitochondrial transcription(GO:0006393) |
| 0.1 | 0.2 | GO:0035166 | post-embryonic hemopoiesis(GO:0035166) |
| 0.1 | 0.1 | GO:0007258 | JUN phosphorylation(GO:0007258) |
| 0.1 | 0.1 | GO:0061055 | myotome development(GO:0061055) |
| 0.1 | 0.4 | GO:0061032 | visceral serous pericardium development(GO:0061032) |
| 0.1 | 1.0 | GO:0071353 | cellular response to interleukin-4(GO:0071353) |
| 0.1 | 0.1 | GO:0006681 | galactosylceramide metabolic process(GO:0006681) |
| 0.1 | 0.3 | GO:0043174 | nucleoside salvage(GO:0043174) |
| 0.1 | 0.1 | GO:0046958 | nonassociative learning(GO:0046958) |
| 0.1 | 0.1 | GO:0002572 | pro-T cell differentiation(GO:0002572) |
| 0.1 | 0.6 | GO:0002097 | tRNA wobble base modification(GO:0002097) |
| 0.1 | 0.2 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.1 | 0.2 | GO:0035624 | receptor transactivation(GO:0035624) epidermal growth factor-activated receptor transactivation by G-protein coupled receptor signaling pathway(GO:0035625) |
| 0.1 | 0.1 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
| 0.1 | 0.1 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
| 0.1 | 0.2 | GO:0015746 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
| 0.1 | 0.3 | GO:0022028 | tangential migration from the subventricular zone to the olfactory bulb(GO:0022028) |
| 0.1 | 1.0 | GO:0019886 | antigen processing and presentation of exogenous peptide antigen via MHC class II(GO:0019886) |
| 0.1 | 0.1 | GO:0010728 | regulation of hydrogen peroxide biosynthetic process(GO:0010728) |
| 0.1 | 0.3 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
| 0.1 | 0.4 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
| 0.1 | 0.4 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.1 | 0.3 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
| 0.1 | 0.3 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.1 | 0.8 | GO:0044818 | mitotic G2/M transition checkpoint(GO:0044818) |
| 0.1 | 0.3 | GO:0046010 | positive regulation of circadian sleep/wake cycle, non-REM sleep(GO:0046010) |
| 0.1 | 0.1 | GO:0003032 | detection of oxygen(GO:0003032) |
| 0.1 | 1.2 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.1 | 0.1 | GO:1904749 | protein localization to nucleolus(GO:1902570) regulation of protein localization to nucleolus(GO:1904749) positive regulation of protein localization to nucleolus(GO:1904751) |
| 0.1 | 0.1 | GO:0070900 | mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
| 0.1 | 0.2 | GO:0070102 | interleukin-6-mediated signaling pathway(GO:0070102) |
| 0.1 | 0.4 | GO:2000399 | negative regulation of thymocyte aggregation(GO:2000399) |
| 0.1 | 0.3 | GO:0048488 | synaptic vesicle endocytosis(GO:0048488) |
| 0.1 | 0.2 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
| 0.1 | 0.2 | GO:0006903 | vesicle targeting(GO:0006903) |
| 0.1 | 0.3 | GO:0032754 | positive regulation of interleukin-5 production(GO:0032754) |
| 0.1 | 0.2 | GO:0042525 | tyrosine phosphorylation of Stat6 protein(GO:0042505) regulation of tyrosine phosphorylation of Stat6 protein(GO:0042525) |
| 0.1 | 1.2 | GO:2001240 | negative regulation of signal transduction in absence of ligand(GO:1901099) negative regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001240) |
| 0.1 | 0.1 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
| 0.1 | 0.3 | GO:0032960 | regulation of inositol trisphosphate biosynthetic process(GO:0032960) positive regulation of inositol trisphosphate biosynthetic process(GO:0032962) |
| 0.1 | 0.1 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
| 0.1 | 0.5 | GO:0071545 | inositol phosphate catabolic process(GO:0071545) |
| 0.1 | 0.2 | GO:0070305 | response to cGMP(GO:0070305) |
| 0.1 | 0.6 | GO:0009435 | NAD biosynthetic process(GO:0009435) |
| 0.1 | 0.4 | GO:0009084 | glutamine family amino acid biosynthetic process(GO:0009084) |
| 0.1 | 0.3 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.1 | 0.5 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
| 0.1 | 0.9 | GO:0032012 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
| 0.1 | 0.3 | GO:0046959 | habituation(GO:0046959) |
| 0.1 | 0.3 | GO:0051013 | microtubule severing(GO:0051013) |
| 0.1 | 0.2 | GO:0051025 | negative regulation of immunoglobulin secretion(GO:0051025) |
| 0.1 | 0.4 | GO:0002441 | histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 0.1 | 0.1 | GO:0046125 | pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 0.1 | 0.3 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 0.1 | 0.4 | GO:0007638 | mechanosensory behavior(GO:0007638) |
| 0.1 | 0.2 | GO:0071801 | regulation of podosome assembly(GO:0071801) |
| 0.1 | 0.4 | GO:0060394 | negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
| 0.1 | 0.7 | GO:0006465 | signal peptide processing(GO:0006465) |
| 0.1 | 0.3 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.1 | 0.1 | GO:0023021 | termination of signal transduction(GO:0023021) |
| 0.1 | 0.3 | GO:0006563 | L-serine metabolic process(GO:0006563) |
| 0.1 | 0.2 | GO:0006678 | glucosylceramide metabolic process(GO:0006678) |
| 0.1 | 1.0 | GO:0006376 | mRNA splice site selection(GO:0006376) |
| 0.1 | 0.1 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
| 0.1 | 0.1 | GO:0060685 | regulation of prostatic bud formation(GO:0060685) |
| 0.1 | 0.2 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
| 0.1 | 0.1 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
| 0.1 | 0.4 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
| 0.1 | 0.3 | GO:0000076 | DNA replication checkpoint(GO:0000076) |
| 0.1 | 0.2 | GO:0001302 | replicative cell aging(GO:0001302) |
| 0.1 | 0.4 | GO:1901660 | calcium ion export(GO:1901660) |
| 0.1 | 0.2 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.1 | 0.7 | GO:0022616 | DNA strand elongation(GO:0022616) |
| 0.1 | 0.5 | GO:0035095 | behavioral response to nicotine(GO:0035095) |
| 0.1 | 0.1 | GO:0034137 | positive regulation of toll-like receptor 2 signaling pathway(GO:0034137) |
| 0.1 | 0.2 | GO:0046909 | intermembrane transport(GO:0046909) |
| 0.1 | 0.2 | GO:0097211 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.1 | 0.1 | GO:0071276 | cellular response to cadmium ion(GO:0071276) |
| 0.1 | 0.2 | GO:0001777 | T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
| 0.1 | 0.1 | GO:0003140 | determination of left/right asymmetry in lateral mesoderm(GO:0003140) nodal signaling pathway involved in determination of left/right asymmetry(GO:0038107) regulation of transcription from RNA polymerase II promoter involved in determination of left/right symmetry(GO:1900094) nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900164) |
| 0.1 | 0.7 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
| 0.1 | 0.7 | GO:0019400 | alditol metabolic process(GO:0019400) |
| 0.1 | 0.4 | GO:0048935 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.1 | 0.7 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
| 0.1 | 0.2 | GO:0002540 | leukotriene production involved in inflammatory response(GO:0002540) |
| 0.1 | 0.1 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
| 0.1 | 0.2 | GO:0030070 | insulin processing(GO:0030070) |
| 0.1 | 0.2 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
| 0.1 | 0.2 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
| 0.1 | 0.1 | GO:0090135 | actin filament branching(GO:0090135) |
| 0.1 | 0.1 | GO:1900736 | regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900736) |
| 0.1 | 0.2 | GO:0070842 | aggresome assembly(GO:0070842) |
| 0.1 | 0.8 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
| 0.1 | 0.6 | GO:0009214 | cyclic nucleotide catabolic process(GO:0009214) |
| 0.1 | 0.1 | GO:0099515 | actin filament-based transport(GO:0099515) |
| 0.1 | 0.2 | GO:1903912 | negative regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:1903912) |
| 0.1 | 0.1 | GO:0048550 | negative regulation of pinocytosis(GO:0048550) |
| 0.1 | 0.3 | GO:0000380 | alternative mRNA splicing, via spliceosome(GO:0000380) |
| 0.1 | 0.2 | GO:0045714 | regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045714) |
| 0.1 | 0.1 | GO:0006067 | ethanol metabolic process(GO:0006067) ethanol oxidation(GO:0006069) |
| 0.1 | 0.7 | GO:0008340 | determination of adult lifespan(GO:0008340) |
| 0.1 | 0.4 | GO:0072311 | renal filtration cell differentiation(GO:0061318) glomerular epithelium development(GO:0072010) glomerular visceral epithelial cell differentiation(GO:0072112) glomerular epithelial cell differentiation(GO:0072311) |
| 0.1 | 0.1 | GO:0090381 | regulation of heart induction(GO:0090381) |
| 0.1 | 0.1 | GO:0061684 | chaperone-mediated autophagy(GO:0061684) |
| 0.1 | 0.2 | GO:0060693 | regulation of branching involved in salivary gland morphogenesis(GO:0060693) |
| 0.1 | 0.2 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
| 0.1 | 0.4 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) |
| 0.1 | 0.3 | GO:0015808 | L-alanine transport(GO:0015808) |
| 0.1 | 0.1 | GO:0010288 | response to lead ion(GO:0010288) |
| 0.1 | 0.2 | GO:0042748 | circadian sleep/wake cycle, non-REM sleep(GO:0042748) |
| 0.1 | 0.1 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
| 0.1 | 0.2 | GO:0042048 | olfactory behavior(GO:0042048) |
| 0.1 | 0.2 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
| 0.1 | 0.1 | GO:0033026 | negative regulation of mast cell apoptotic process(GO:0033026) |
| 0.1 | 0.3 | GO:0042996 | regulation of Golgi to plasma membrane protein transport(GO:0042996) |
| 0.1 | 0.4 | GO:0051447 | negative regulation of meiotic cell cycle(GO:0051447) |
| 0.1 | 0.3 | GO:2000651 | positive regulation of sodium ion transmembrane transporter activity(GO:2000651) |
| 0.1 | 0.1 | GO:1901656 | glycoside transport(GO:1901656) |
| 0.1 | 0.1 | GO:0015747 | urate transport(GO:0015747) |
| 0.1 | 0.1 | GO:1903894 | regulation of IRE1-mediated unfolded protein response(GO:1903894) |
| 0.1 | 0.1 | GO:0001828 | inner cell mass cellular morphogenesis(GO:0001828) |
| 0.1 | 0.2 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.1 | 0.1 | GO:0010874 | regulation of cholesterol efflux(GO:0010874) |
| 0.1 | 0.5 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
| 0.1 | 0.8 | GO:0006491 | N-glycan processing(GO:0006491) |
| 0.1 | 0.1 | GO:0035482 | gastric motility(GO:0035482) |
| 0.1 | 0.2 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
| 0.1 | 0.2 | GO:0008050 | female courtship behavior(GO:0008050) |
| 0.1 | 0.2 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
| 0.1 | 0.4 | GO:0043508 | negative regulation of JUN kinase activity(GO:0043508) |
| 0.1 | 0.2 | GO:0014028 | notochord formation(GO:0014028) |
| 0.1 | 0.2 | GO:0045199 | maintenance of epithelial cell apical/basal polarity(GO:0045199) |
| 0.1 | 0.1 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
| 0.1 | 0.3 | GO:0097320 | membrane tubulation(GO:0097320) |
| 0.1 | 0.2 | GO:0003310 | pancreatic A cell differentiation(GO:0003310) |
| 0.1 | 0.1 | GO:0035790 | platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
| 0.1 | 0.1 | GO:0034436 | glycoprotein transport(GO:0034436) |
| 0.1 | 0.1 | GO:1901662 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
| 0.1 | 0.1 | GO:0046149 | heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
| 0.1 | 1.1 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
| 0.1 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 0.1 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.1 | 0.3 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
| 0.1 | 0.1 | GO:0048050 | post-embryonic eye morphogenesis(GO:0048050) |
| 0.1 | 0.2 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
| 0.1 | 0.2 | GO:0021882 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) |
| 0.1 | 1.0 | GO:1904031 | positive regulation of cyclin-dependent protein kinase activity(GO:1904031) |
| 0.1 | 0.1 | GO:0031034 | myosin filament assembly(GO:0031034) |
| 0.1 | 0.3 | GO:0014842 | regulation of skeletal muscle satellite cell proliferation(GO:0014842) |
| 0.1 | 0.1 | GO:0071440 | regulation of histone H3-K14 acetylation(GO:0071440) |
| 0.1 | 0.1 | GO:0014054 | positive regulation of gamma-aminobutyric acid secretion(GO:0014054) |
| 0.1 | 0.2 | GO:0090042 | tubulin deacetylation(GO:0090042) regulation of tubulin deacetylation(GO:0090043) |
| 0.0 | 0.2 | GO:0098728 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.0 | 0.1 | GO:2000291 | regulation of myoblast proliferation(GO:2000291) |
| 0.0 | 0.2 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 0.0 | 0.1 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) |
| 0.0 | 0.1 | GO:1902805 | positive regulation of synaptic vesicle transport(GO:1902805) positive regulation of synaptic vesicle exocytosis(GO:2000302) |
| 0.0 | 0.1 | GO:0045112 | integrin biosynthetic process(GO:0045112) |
| 0.0 | 0.1 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
| 0.0 | 0.0 | GO:1903207 | neuron death in response to hydrogen peroxide(GO:0036476) regulation of hydrogen peroxide-induced neuron death(GO:1903207) negative regulation of hydrogen peroxide-induced neuron death(GO:1903208) |
| 0.0 | 0.4 | GO:0046085 | adenosine metabolic process(GO:0046085) |
| 0.0 | 0.0 | GO:0033629 | negative regulation of cell adhesion mediated by integrin(GO:0033629) |
| 0.0 | 0.4 | GO:0071157 | negative regulation of cell cycle arrest(GO:0071157) |
| 0.0 | 0.8 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.0 | 0.0 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
| 0.0 | 0.1 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
| 0.0 | 0.1 | GO:0010757 | negative regulation of plasminogen activation(GO:0010757) |
| 0.0 | 0.2 | GO:0071918 | urea transmembrane transport(GO:0071918) |
| 0.0 | 0.0 | GO:0042536 | negative regulation of tumor necrosis factor biosynthetic process(GO:0042536) |
| 0.0 | 0.2 | GO:0007183 | SMAD protein complex assembly(GO:0007183) |
| 0.0 | 1.0 | GO:0007143 | female meiotic division(GO:0007143) |
| 0.0 | 0.1 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
| 0.0 | 0.1 | GO:2001274 | negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
| 0.0 | 0.2 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
| 0.0 | 0.2 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
| 0.0 | 0.1 | GO:0048752 | semicircular canal morphogenesis(GO:0048752) |
| 0.0 | 0.1 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
| 0.0 | 0.4 | GO:0045606 | positive regulation of epidermal cell differentiation(GO:0045606) |
| 0.0 | 0.4 | GO:0031440 | regulation of mRNA 3'-end processing(GO:0031440) |
| 0.0 | 0.0 | GO:0044337 | canonical Wnt signaling pathway involved in positive regulation of apoptotic process(GO:0044337) |
| 0.0 | 0.2 | GO:0060164 | regulation of timing of neuron differentiation(GO:0060164) |
| 0.0 | 0.2 | GO:0072488 | ammonium transmembrane transport(GO:0072488) |
| 0.0 | 0.0 | GO:1900368 | regulation of RNA interference(GO:1900368) |
| 0.0 | 0.2 | GO:0051444 | negative regulation of ubiquitin-protein transferase activity(GO:0051444) |
| 0.0 | 0.1 | GO:0090166 | Golgi disassembly(GO:0090166) |
| 0.0 | 0.8 | GO:0006783 | heme biosynthetic process(GO:0006783) |
| 0.0 | 0.1 | GO:0032099 | negative regulation of appetite(GO:0032099) |
| 0.0 | 0.0 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
| 0.0 | 0.2 | GO:0070475 | rRNA base methylation(GO:0070475) |
| 0.0 | 0.0 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
| 0.0 | 0.0 | GO:0032058 | positive regulation of translational initiation in response to stress(GO:0032058) |
| 0.0 | 0.1 | GO:0072093 | metanephric renal vesicle formation(GO:0072093) |
| 0.0 | 0.2 | GO:1903887 | motile primary cilium assembly(GO:1903887) |
| 0.0 | 0.3 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
| 0.0 | 0.1 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) |
| 0.0 | 0.0 | GO:0090027 | negative regulation of monocyte chemotaxis(GO:0090027) |
| 0.0 | 0.2 | GO:0014049 | positive regulation of glutamate secretion(GO:0014049) |
| 0.0 | 1.0 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
| 0.0 | 0.0 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
| 0.0 | 0.6 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
| 0.0 | 0.0 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
| 0.0 | 0.5 | GO:0003416 | endochondral bone growth(GO:0003416) |
| 0.0 | 0.1 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
| 0.0 | 0.1 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.0 | 0.2 | GO:1903779 | regulation of cardiac conduction(GO:1903779) |
| 0.0 | 0.1 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.0 | 0.1 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
| 0.0 | 0.0 | GO:0014826 | vein smooth muscle contraction(GO:0014826) |
| 0.0 | 0.1 | GO:0048102 | autophagic cell death(GO:0048102) |
| 0.0 | 0.4 | GO:0018027 | peptidyl-lysine dimethylation(GO:0018027) |
| 0.0 | 0.2 | GO:0072366 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) regulation of cellular ketone metabolic process by positive regulation of transcription from RNA polymerase II promoter(GO:0072366) |
| 0.0 | 0.1 | GO:0000289 | nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
| 0.0 | 0.2 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.0 | 0.2 | GO:0021542 | dentate gyrus development(GO:0021542) |
| 0.0 | 0.1 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
| 0.0 | 0.2 | GO:0033574 | response to testosterone(GO:0033574) |
| 0.0 | 0.2 | GO:0071468 | cellular response to acidic pH(GO:0071468) |
| 0.0 | 0.1 | GO:1905049 | negative regulation of metalloendopeptidase activity(GO:1904684) negative regulation of metallopeptidase activity(GO:1905049) |
| 0.0 | 0.2 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.0 | 0.7 | GO:0030488 | tRNA methylation(GO:0030488) |
| 0.0 | 0.0 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
| 0.0 | 0.4 | GO:0043330 | response to exogenous dsRNA(GO:0043330) |
| 0.0 | 2.1 | GO:0006892 | post-Golgi vesicle-mediated transport(GO:0006892) |
| 0.0 | 0.1 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
| 0.0 | 0.1 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
| 0.0 | 0.5 | GO:0015693 | magnesium ion transport(GO:0015693) |
| 0.0 | 0.3 | GO:0010719 | negative regulation of epithelial to mesenchymal transition(GO:0010719) |
| 0.0 | 0.2 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.0 | 0.0 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
| 0.0 | 0.0 | GO:0033578 | protein glycosylation in Golgi(GO:0033578) |
| 0.0 | 0.0 | GO:0010749 | regulation of nitric oxide mediated signal transduction(GO:0010749) |
| 0.0 | 0.3 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
| 0.0 | 0.1 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) positive regulation of protein lipidation(GO:1903061) |
| 0.0 | 0.1 | GO:0070309 | lens fiber cell morphogenesis(GO:0070309) |
| 0.0 | 0.1 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
| 0.0 | 0.1 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
| 0.0 | 0.0 | GO:0009129 | pyrimidine nucleoside monophosphate metabolic process(GO:0009129) pyrimidine nucleoside monophosphate biosynthetic process(GO:0009130) |
| 0.0 | 0.1 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
| 0.0 | 0.1 | GO:0061152 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.0 | 0.3 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.0 | 0.3 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.0 | 0.1 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
| 0.0 | 0.3 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
| 0.0 | 0.2 | GO:0032494 | response to peptidoglycan(GO:0032494) |
| 0.0 | 0.5 | GO:1901186 | positive regulation of epidermal growth factor receptor signaling pathway(GO:0045742) positive regulation of ERBB signaling pathway(GO:1901186) |
| 0.0 | 0.0 | GO:0051350 | negative regulation of lyase activity(GO:0051350) |
| 0.0 | 0.2 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
| 0.0 | 0.2 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) |
| 0.0 | 0.1 | GO:0050482 | arachidonic acid secretion(GO:0050482) arachidonate transport(GO:1903963) |
| 0.0 | 0.1 | GO:0035413 | positive regulation of catenin import into nucleus(GO:0035413) |
| 0.0 | 0.3 | GO:0016074 | snoRNA metabolic process(GO:0016074) |
| 0.0 | 0.0 | GO:0090186 | regulation of pancreatic juice secretion(GO:0090186) |
| 0.0 | 0.1 | GO:1900153 | regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
| 0.0 | 0.0 | GO:1904192 | cholangiocyte apoptotic process(GO:1902488) regulation of cholangiocyte apoptotic process(GO:1904192) negative regulation of cholangiocyte apoptotic process(GO:1904193) |
| 0.0 | 0.6 | GO:0043029 | T cell homeostasis(GO:0043029) |
| 0.0 | 0.2 | GO:0090267 | positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
| 0.0 | 0.2 | GO:0090343 | positive regulation of cell aging(GO:0090343) |
| 0.0 | 0.2 | GO:0035814 | negative regulation of renal sodium excretion(GO:0035814) |
| 0.0 | 0.2 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
| 0.0 | 0.2 | GO:0006656 | phosphatidylcholine biosynthetic process(GO:0006656) |
| 0.0 | 0.1 | GO:0006290 | pyrimidine dimer repair(GO:0006290) |
| 0.0 | 0.0 | GO:0010801 | negative regulation of peptidyl-threonine phosphorylation(GO:0010801) |
| 0.0 | 0.2 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.0 | 0.1 | GO:0031167 | rRNA methylation(GO:0031167) |
| 0.0 | 0.2 | GO:0042219 | cellular modified amino acid catabolic process(GO:0042219) |
| 0.0 | 0.4 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
| 0.0 | 0.1 | GO:0002043 | blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:0002043) |
| 0.0 | 0.1 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
| 0.0 | 0.1 | GO:2000834 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
| 0.0 | 0.4 | GO:0014002 | astrocyte development(GO:0014002) |
| 0.0 | 0.1 | GO:0000237 | leptotene(GO:0000237) |
| 0.0 | 0.2 | GO:0060029 | convergent extension involved in organogenesis(GO:0060029) |
| 0.0 | 0.1 | GO:0023041 | neuronal signal transduction(GO:0023041) |
| 0.0 | 0.1 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
| 0.0 | 0.2 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
| 0.0 | 0.3 | GO:0048671 | negative regulation of collateral sprouting(GO:0048671) |
| 0.0 | 0.2 | GO:0032515 | negative regulation of phosphoprotein phosphatase activity(GO:0032515) |
| 0.0 | 0.1 | GO:0033860 | regulation of NAD(P)H oxidase activity(GO:0033860) |
| 0.0 | 0.1 | GO:0061743 | motor learning(GO:0061743) |
| 0.0 | 0.3 | GO:0006353 | DNA-templated transcription, termination(GO:0006353) |
| 0.0 | 0.1 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
| 0.0 | 0.1 | GO:0090244 | Wnt signaling pathway involved in somitogenesis(GO:0090244) |
| 0.0 | 0.2 | GO:0090031 | positive regulation of steroid hormone biosynthetic process(GO:0090031) |
| 0.0 | 0.1 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
| 0.0 | 0.2 | GO:0032048 | cardiolipin metabolic process(GO:0032048) |
| 0.0 | 0.1 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
| 0.0 | 0.1 | GO:0002636 | positive regulation of germinal center formation(GO:0002636) |
| 0.0 | 0.2 | GO:0042532 | negative regulation of tyrosine phosphorylation of STAT protein(GO:0042532) |
| 0.0 | 0.1 | GO:0019087 | transformation of host cell by virus(GO:0019087) |
| 0.0 | 0.1 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
| 0.0 | 0.1 | GO:1901679 | pyrimidine-containing compound transmembrane transport(GO:0072531) nucleotide transmembrane transport(GO:1901679) |
| 0.0 | 0.2 | GO:0033227 | dsRNA transport(GO:0033227) |
| 0.0 | 0.6 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.0 | 0.3 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
| 0.0 | 0.1 | GO:0035581 | sequestering of extracellular ligand from receptor(GO:0035581) extracellular regulation of signal transduction(GO:1900115) extracellular negative regulation of signal transduction(GO:1900116) |
| 0.0 | 0.8 | GO:0060999 | positive regulation of dendritic spine development(GO:0060999) |
| 0.0 | 0.2 | GO:0001514 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.0 | 0.1 | GO:0035627 | ceramide transport(GO:0035627) |
| 0.0 | 0.9 | GO:0048536 | spleen development(GO:0048536) |
| 0.0 | 0.1 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
| 0.0 | 0.9 | GO:0071479 | cellular response to ionizing radiation(GO:0071479) |
| 0.0 | 0.1 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
| 0.0 | 0.0 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 0.0 | 0.1 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
| 0.0 | 0.6 | GO:0008209 | androgen metabolic process(GO:0008209) |
| 0.0 | 0.6 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
| 0.0 | 0.2 | GO:0010332 | response to gamma radiation(GO:0010332) |
| 0.0 | 0.2 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
| 0.0 | 0.0 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
| 0.0 | 0.2 | GO:0051764 | actin crosslink formation(GO:0051764) |
| 0.0 | 0.1 | GO:2000035 | regulation of stem cell division(GO:2000035) |
| 0.0 | 1.4 | GO:0045454 | cell redox homeostasis(GO:0045454) |
| 0.0 | 0.0 | GO:2000615 | regulation of histone H3-K9 acetylation(GO:2000615) |
| 0.0 | 0.1 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
| 0.0 | 0.3 | GO:0090141 | positive regulation of mitochondrial fission(GO:0090141) |
| 0.0 | 0.3 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
| 0.0 | 0.3 | GO:1901032 | negative regulation of response to reactive oxygen species(GO:1901032) |
| 0.0 | 0.1 | GO:0030157 | pancreatic juice secretion(GO:0030157) |
| 0.0 | 0.1 | GO:2000543 | positive regulation of gastrulation(GO:2000543) |
| 0.0 | 0.1 | GO:2000643 | positive regulation of early endosome to late endosome transport(GO:2000643) |
| 0.0 | 0.0 | GO:0014735 | regulation of muscle atrophy(GO:0014735) |
| 0.0 | 0.8 | GO:0008088 | axo-dendritic transport(GO:0008088) |
| 0.0 | 0.0 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
| 0.0 | 0.1 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
| 0.0 | 0.0 | GO:0090306 | spindle assembly involved in meiosis(GO:0090306) |
| 0.0 | 0.1 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
| 0.0 | 0.5 | GO:0002011 | morphogenesis of an epithelial sheet(GO:0002011) |
| 0.0 | 0.2 | GO:0060134 | prepulse inhibition(GO:0060134) |
| 0.0 | 0.3 | GO:0006998 | nuclear envelope organization(GO:0006998) |
| 0.0 | 0.1 | GO:0060017 | parathyroid gland development(GO:0060017) |
| 0.0 | 0.3 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
| 0.0 | 0.1 | GO:0002884 | negative regulation of hypersensitivity(GO:0002884) |
| 0.0 | 0.1 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
| 0.0 | 0.1 | GO:0097070 | ductus arteriosus closure(GO:0097070) |
| 0.0 | 0.4 | GO:0050435 | beta-amyloid metabolic process(GO:0050435) |
| 0.0 | 0.5 | GO:0000132 | establishment of mitotic spindle orientation(GO:0000132) |
| 0.0 | 0.9 | GO:0016925 | protein sumoylation(GO:0016925) |
| 0.0 | 1.5 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
| 0.0 | 0.1 | GO:0014045 | establishment of endothelial blood-brain barrier(GO:0014045) |
| 0.0 | 0.0 | GO:0006000 | fructose metabolic process(GO:0006000) |
| 0.0 | 0.1 | GO:1900113 | regulation of histone H3-K9 trimethylation(GO:1900112) negative regulation of histone H3-K9 trimethylation(GO:1900113) |
| 0.0 | 0.1 | GO:0006825 | copper ion transport(GO:0006825) |
| 0.0 | 0.1 | GO:0045141 | telomere tethering at nuclear periphery(GO:0034398) meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic telomere clustering(GO:0045141) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
| 0.0 | 0.1 | GO:0021523 | somatic motor neuron differentiation(GO:0021523) |
| 0.0 | 0.1 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) |
| 0.0 | 0.1 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
| 0.0 | 0.0 | GO:0046877 | regulation of saliva secretion(GO:0046877) positive regulation of saliva secretion(GO:0046878) |
| 0.0 | 0.1 | GO:0007262 | STAT protein import into nucleus(GO:0007262) |
| 0.0 | 0.1 | GO:0035510 | DNA dealkylation(GO:0035510) |
| 0.0 | 0.2 | GO:0036336 | dendritic cell migration(GO:0036336) |
| 0.0 | 0.2 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
| 0.0 | 0.0 | GO:0003223 | ventricular compact myocardium morphogenesis(GO:0003223) |
| 0.0 | 0.1 | GO:0060988 | lipid tube assembly(GO:0060988) |
| 0.0 | 0.2 | GO:0046329 | negative regulation of JNK cascade(GO:0046329) |
| 0.0 | 0.2 | GO:0001696 | gastric acid secretion(GO:0001696) |
| 0.0 | 0.2 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.0 | 0.3 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
| 0.0 | 0.1 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
| 0.0 | 0.1 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 0.0 | 0.3 | GO:0000394 | RNA splicing, via endonucleolytic cleavage and ligation(GO:0000394) tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.0 | 0.2 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
| 0.0 | 0.1 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.0 | 0.0 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
| 0.0 | 0.1 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.0 | 0.0 | GO:0071698 | olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
| 0.0 | 0.0 | GO:0010520 | regulation of reciprocal meiotic recombination(GO:0010520) |
| 0.0 | 0.0 | GO:0090399 | replicative senescence(GO:0090399) |
| 0.0 | 0.1 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
| 0.0 | 0.3 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
| 0.0 | 0.4 | GO:2000144 | positive regulation of DNA-templated transcription, initiation(GO:2000144) |
| 0.0 | 0.2 | GO:0050687 | negative regulation of defense response to virus(GO:0050687) |
| 0.0 | 0.4 | GO:0032981 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.0 | 0.3 | GO:0051383 | kinetochore organization(GO:0051383) |
| 0.0 | 0.2 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
| 0.0 | 0.1 | GO:0045759 | negative regulation of action potential(GO:0045759) |
| 0.0 | 0.1 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
| 0.0 | 0.0 | GO:0048149 | behavioral response to ethanol(GO:0048149) |
| 0.0 | 0.2 | GO:0010832 | negative regulation of myotube differentiation(GO:0010832) |
| 0.0 | 0.2 | GO:0008216 | spermidine metabolic process(GO:0008216) |
| 0.0 | 0.1 | GO:1903672 | positive regulation of sprouting angiogenesis(GO:1903672) |
| 0.0 | 0.4 | GO:0006884 | cell volume homeostasis(GO:0006884) |
| 0.0 | 0.2 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
| 0.0 | 0.2 | GO:0006851 | mitochondrial calcium ion transport(GO:0006851) |
| 0.0 | 1.1 | GO:0071391 | cellular response to estrogen stimulus(GO:0071391) |
| 0.0 | 0.1 | GO:0035372 | protein localization to microtubule(GO:0035372) |
| 0.0 | 0.1 | GO:0048014 | Tie signaling pathway(GO:0048014) |
| 0.0 | 0.1 | GO:0033686 | positive regulation of luteinizing hormone secretion(GO:0033686) |
| 0.0 | 0.2 | GO:0006515 | misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
| 0.0 | 0.1 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.0 | 0.1 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
| 0.0 | 0.0 | GO:0014841 | skeletal muscle satellite cell proliferation(GO:0014841) |
| 0.0 | 0.1 | GO:0008228 | opsonization(GO:0008228) |
| 0.0 | 0.1 | GO:0071027 | nuclear RNA surveillance(GO:0071027) nuclear mRNA surveillance(GO:0071028) |
| 0.0 | 0.1 | GO:0045836 | positive regulation of meiotic nuclear division(GO:0045836) |
| 0.0 | 0.1 | GO:0086026 | atrial cardiac muscle cell action potential(GO:0086014) atrial cardiac muscle cell to AV node cell signaling(GO:0086026) atrial cardiac muscle cell to AV node cell communication(GO:0086066) |
| 0.0 | 0.0 | GO:0051385 | response to mineralocorticoid(GO:0051385) |
| 0.0 | 0.1 | GO:0034350 | regulation of glial cell apoptotic process(GO:0034350) |
| 0.0 | 0.1 | GO:0060456 | positive regulation of digestive system process(GO:0060456) |
| 0.0 | 0.3 | GO:0006670 | sphingosine metabolic process(GO:0006670) |
| 0.0 | 0.1 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
| 0.0 | 0.0 | GO:0042537 | benzene-containing compound metabolic process(GO:0042537) |
| 0.0 | 0.1 | GO:1901096 | regulation of autophagosome maturation(GO:1901096) |
| 0.0 | 0.6 | GO:0043550 | regulation of lipid kinase activity(GO:0043550) |
| 0.0 | 0.2 | GO:0032508 | DNA duplex unwinding(GO:0032508) |
| 0.0 | 0.1 | GO:0045655 | regulation of monocyte differentiation(GO:0045655) |
| 0.0 | 0.0 | GO:0046337 | phosphatidylethanolamine metabolic process(GO:0046337) |
| 0.0 | 0.1 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
| 0.0 | 0.2 | GO:0098815 | modulation of excitatory postsynaptic potential(GO:0098815) |
| 0.0 | 0.0 | GO:1900222 | negative regulation of beta-amyloid clearance(GO:1900222) |
| 0.0 | 0.2 | GO:0032648 | regulation of interferon-beta production(GO:0032648) |
| 0.0 | 0.1 | GO:0051697 | protein delipidation(GO:0051697) |
| 0.0 | 0.1 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 0.0 | 0.0 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
| 0.0 | 0.0 | GO:0071025 | RNA surveillance(GO:0071025) |
| 0.0 | 0.0 | GO:0046084 | adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
| 0.0 | 0.1 | GO:0001967 | suckling behavior(GO:0001967) |
| 0.0 | 0.1 | GO:0060005 | vestibular reflex(GO:0060005) |
| 0.0 | 0.0 | GO:0043382 | positive regulation of memory T cell differentiation(GO:0043382) |
| 0.0 | 0.1 | GO:0015670 | carbon dioxide transport(GO:0015670) |
| 0.0 | 0.0 | GO:0014062 | regulation of serotonin secretion(GO:0014062) |
| 0.0 | 0.1 | GO:0042711 | maternal behavior(GO:0042711) |
| 0.0 | 0.0 | GO:0043970 | histone H3-K9 acetylation(GO:0043970) |
| 0.0 | 0.1 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.0 | 0.0 | GO:0003160 | endocardium morphogenesis(GO:0003160) |
| 0.0 | 0.1 | GO:0036314 | response to sterol(GO:0036314) |
| 0.0 | 0.1 | GO:0051956 | negative regulation of amino acid transport(GO:0051956) |
| 0.0 | 0.0 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.0 | 0.1 | GO:0007210 | serotonin receptor signaling pathway(GO:0007210) |
| 0.0 | 0.2 | GO:0010623 | programmed cell death involved in cell development(GO:0010623) |
| 0.0 | 0.2 | GO:0030007 | cellular potassium ion homeostasis(GO:0030007) |
| 0.0 | 0.1 | GO:0009125 | nucleoside monophosphate catabolic process(GO:0009125) |
| 0.0 | 0.2 | GO:0046457 | prostaglandin biosynthetic process(GO:0001516) prostanoid biosynthetic process(GO:0046457) |
| 0.0 | 0.1 | GO:0032224 | positive regulation of synaptic transmission, cholinergic(GO:0032224) |
| 0.0 | 0.1 | GO:0045901 | positive regulation of translational elongation(GO:0045901) |
| 0.0 | 0.0 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
| 0.0 | 0.2 | GO:0048538 | thymus development(GO:0048538) |
| 0.0 | 0.2 | GO:0002176 | male germ cell proliferation(GO:0002176) |
| 0.0 | 0.1 | GO:0002087 | regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
| 0.0 | 0.1 | GO:0006083 | acetate metabolic process(GO:0006083) |
| 0.0 | 0.0 | GO:0008078 | mesodermal cell migration(GO:0008078) |
| 0.0 | 0.1 | GO:0007320 | insemination(GO:0007320) |
| 0.0 | 0.1 | GO:0038089 | positive regulation of cell migration by vascular endothelial growth factor signaling pathway(GO:0038089) |
| 0.0 | 0.0 | GO:0042182 | ketone catabolic process(GO:0042182) |
| 0.0 | 0.0 | GO:0071873 | response to norepinephrine(GO:0071873) |
| 0.0 | 0.1 | GO:0015770 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.0 | 0.1 | GO:0007468 | regulation of rhodopsin gene expression(GO:0007468) |
| 0.0 | 0.0 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
| 0.0 | 0.1 | GO:1902855 | regulation of nonmotile primary cilium assembly(GO:1902855) positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.0 | 0.2 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
| 0.0 | 0.3 | GO:0006400 | tRNA modification(GO:0006400) |
| 0.0 | 0.1 | GO:1902400 | signal transduction involved in mitotic G1 DNA damage checkpoint(GO:0072431) intracellular signal transduction involved in G1 DNA damage checkpoint(GO:1902400) |
| 0.0 | 0.1 | GO:0002566 | somatic diversification of immune receptors via somatic mutation(GO:0002566) |
| 0.0 | 0.0 | GO:0008292 | acetylcholine biosynthetic process(GO:0008292) acetate ester biosynthetic process(GO:1900620) |
| 0.0 | 0.0 | GO:0001951 | intestinal D-glucose absorption(GO:0001951) |
| 0.0 | 0.1 | GO:0044062 | regulation of excretion(GO:0044062) |
| 0.0 | 0.0 | GO:0000963 | mitochondrial RNA processing(GO:0000963) |
| 0.0 | 0.1 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
| 0.0 | 0.0 | GO:0071280 | cellular response to copper ion(GO:0071280) |
| 0.0 | 0.1 | GO:0060856 | establishment of blood-brain barrier(GO:0060856) |
| 0.0 | 0.3 | GO:0051290 | protein heterotetramerization(GO:0051290) |
| 0.0 | 0.1 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
| 0.0 | 0.4 | GO:0060259 | regulation of feeding behavior(GO:0060259) |
| 0.0 | 0.1 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
| 0.0 | 0.1 | GO:0043374 | CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
| 0.0 | 0.4 | GO:0006182 | cGMP biosynthetic process(GO:0006182) |
| 0.0 | 0.1 | GO:0032516 | positive regulation of phosphoprotein phosphatase activity(GO:0032516) |
| 0.0 | 0.1 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
| 0.0 | 0.1 | GO:0046548 | retinal rod cell development(GO:0046548) |
| 0.0 | 0.0 | GO:0048808 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
| 0.0 | 0.1 | GO:0042701 | progesterone secretion(GO:0042701) |
| 0.0 | 0.0 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
| 0.0 | 0.3 | GO:0000186 | activation of MAPKK activity(GO:0000186) |
| 0.0 | 0.0 | GO:0021683 | cerebellar granular layer morphogenesis(GO:0021683) |
| 0.0 | 0.2 | GO:0048853 | forebrain morphogenesis(GO:0048853) |
| 0.0 | 0.2 | GO:0019432 | triglyceride biosynthetic process(GO:0019432) |
| 0.0 | 0.1 | GO:0039535 | regulation of RIG-I signaling pathway(GO:0039535) |
| 0.0 | 0.2 | GO:0050908 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| 0.0 | 0.0 | GO:0097050 | type B pancreatic cell apoptotic process(GO:0097050) |
| 0.0 | 0.1 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.0 | 0.0 | GO:0044065 | regulation of respiratory system process(GO:0044065) |
| 0.0 | 0.1 | GO:0060921 | sinoatrial node cell differentiation(GO:0060921) sinoatrial node cell development(GO:0060931) |
| 0.0 | 0.2 | GO:0071577 | zinc II ion transmembrane transport(GO:0071577) |
| 0.0 | 0.1 | GO:0031268 | pseudopodium organization(GO:0031268) |
| 0.0 | 0.1 | GO:0032277 | negative regulation of gonadotropin secretion(GO:0032277) |
| 0.0 | 0.2 | GO:0008053 | mitochondrial fusion(GO:0008053) |
| 0.0 | 0.1 | GO:0046473 | phosphatidic acid metabolic process(GO:0046473) |
| 0.0 | 0.0 | GO:1900038 | negative regulation of cellular response to hypoxia(GO:1900038) |
| 0.0 | 0.3 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
| 0.0 | 0.0 | GO:0051665 | membrane raft localization(GO:0051665) |
| 0.0 | 0.0 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
| 0.0 | 0.0 | GO:0019336 | phenol-containing compound catabolic process(GO:0019336) |
| 0.0 | 0.0 | GO:0009113 | purine nucleobase biosynthetic process(GO:0009113) |
| 0.0 | 0.1 | GO:0033132 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.0 | 0.0 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
| 0.0 | 0.1 | GO:0045607 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.0 | 0.0 | GO:0001844 | protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:0001844) |
| 0.0 | 0.1 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.0 | 0.0 | GO:0035106 | operant conditioning(GO:0035106) |
| 0.0 | 0.0 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
| 0.0 | 0.1 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
| 0.0 | 0.4 | GO:0038083 | peptidyl-tyrosine autophosphorylation(GO:0038083) |
| 0.0 | 0.1 | GO:0048368 | lateral mesoderm development(GO:0048368) |
| 0.0 | 0.0 | GO:0045351 | type I interferon biosynthetic process(GO:0045351) |
| 0.0 | 0.1 | GO:0016056 | rhodopsin mediated signaling pathway(GO:0016056) |
| 0.0 | 0.1 | GO:0045046 | peroxisomal membrane transport(GO:0015919) protein import into peroxisome membrane(GO:0045046) |
| 0.0 | 0.1 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
| 0.0 | 0.3 | GO:0030970 | retrograde protein transport, ER to cytosol(GO:0030970) |
| 0.0 | 0.2 | GO:0007080 | mitotic metaphase plate congression(GO:0007080) |
| 0.0 | 0.4 | GO:0018345 | protein palmitoylation(GO:0018345) |
| 0.0 | 0.1 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
| 0.0 | 0.0 | GO:0002504 | antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002504) |
| 0.0 | 0.1 | GO:0010155 | regulation of proton transport(GO:0010155) |
| 0.0 | 0.1 | GO:0002725 | negative regulation of T cell cytokine production(GO:0002725) |
| 0.0 | 0.1 | GO:0051121 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
| 0.0 | 0.1 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
| 0.0 | 0.0 | GO:0060947 | cardiac vascular smooth muscle cell differentiation(GO:0060947) |
| 0.0 | 0.3 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
| 0.0 | 0.0 | GO:2000383 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
| 0.0 | 0.0 | GO:0040001 | establishment of mitotic spindle localization(GO:0040001) |
| 0.0 | 0.0 | GO:0030240 | skeletal myofibril assembly(GO:0014866) skeletal muscle thin filament assembly(GO:0030240) |
| 0.0 | 0.4 | GO:0030261 | chromosome condensation(GO:0030261) |
| 0.0 | 0.0 | GO:0003164 | His-Purkinje system development(GO:0003164) |
| 0.0 | 0.3 | GO:0033120 | positive regulation of RNA splicing(GO:0033120) |
| 0.0 | 0.0 | GO:0051043 | regulation of membrane protein ectodomain proteolysis(GO:0051043) |
| 0.0 | 0.2 | GO:0006829 | zinc II ion transport(GO:0006829) |
| 0.0 | 0.1 | GO:0010458 | exit from mitosis(GO:0010458) |
| 0.0 | 0.1 | GO:0033004 | negative regulation of mast cell activation(GO:0033004) |
| 0.0 | 0.2 | GO:0097352 | autophagosome maturation(GO:0097352) |
| 0.0 | 0.0 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
| 0.0 | 0.0 | GO:0016237 | lysosomal microautophagy(GO:0016237) piecemeal microautophagy of nucleus(GO:0034727) late nucleophagy(GO:0044805) |
| 0.0 | 0.0 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
| 0.0 | 0.2 | GO:0042538 | hyperosmotic salinity response(GO:0042538) |
| 0.0 | 0.1 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
| 0.0 | 0.0 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
| 0.0 | 0.1 | GO:0043102 | amino acid salvage(GO:0043102) L-methionine biosynthetic process(GO:0071265) L-methionine salvage(GO:0071267) |
| 0.0 | 0.0 | GO:0006336 | DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
| 0.0 | 1.1 | GO:0099643 | neurotransmitter secretion(GO:0007269) signal release from synapse(GO:0099643) |
| 0.0 | 0.3 | GO:0042491 | auditory receptor cell differentiation(GO:0042491) |
| 0.0 | 0.0 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.0 | 0.3 | GO:0007031 | peroxisome organization(GO:0007031) |
| 0.0 | 0.0 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
| 0.0 | 0.0 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
| 0.0 | 0.0 | GO:0070366 | regulation of hepatocyte differentiation(GO:0070366) positive regulation of hepatocyte differentiation(GO:0070368) |
| 0.0 | 0.1 | GO:0031340 | positive regulation of vesicle fusion(GO:0031340) |
| 0.0 | 0.1 | GO:0051769 | nitric-oxide synthase biosynthetic process(GO:0051767) regulation of nitric-oxide synthase biosynthetic process(GO:0051769) |
| 0.0 | 0.0 | GO:0010579 | regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010578) positive regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010579) |
| 0.0 | 0.0 | GO:0050665 | hydrogen peroxide biosynthetic process(GO:0050665) |
| 0.0 | 0.0 | GO:0099531 | presynaptic process involved in chemical synaptic transmission(GO:0099531) |
| 0.0 | 0.0 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
| 0.0 | 0.1 | GO:0060012 | synaptic transmission, glycinergic(GO:0060012) |
| 0.0 | 0.0 | GO:0060969 | negative regulation of gene silencing(GO:0060969) |
| 0.0 | 0.4 | GO:0031110 | regulation of microtubule polymerization or depolymerization(GO:0031110) |
| 0.0 | 0.0 | GO:0007199 | G-protein coupled receptor signaling pathway coupled to cGMP nucleotide second messenger(GO:0007199) |
| 0.0 | 0.0 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
| 0.0 | 0.1 | GO:0045579 | positive regulation of B cell differentiation(GO:0045579) |
| 0.0 | 0.3 | GO:0042255 | ribosome assembly(GO:0042255) |
| 0.0 | 0.1 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
| 0.0 | 0.0 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.0 | 0.1 | GO:0045217 | cell-cell junction maintenance(GO:0045217) |
| 0.0 | 0.1 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
| 0.0 | 0.0 | GO:0018216 | peptidyl-arginine methylation(GO:0018216) |
| 0.0 | 0.6 | GO:0010923 | negative regulation of phosphatase activity(GO:0010923) |
| 0.0 | 0.1 | GO:0000301 | retrograde transport, vesicle recycling within Golgi(GO:0000301) |
| 0.0 | 0.0 | GO:0033260 | nuclear DNA replication(GO:0033260) |
| 0.0 | 0.0 | GO:2000969 | positive regulation of glutamate receptor signaling pathway(GO:1900451) positive regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000969) |
| 0.0 | 0.1 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
| 0.0 | 0.1 | GO:0050774 | negative regulation of dendrite morphogenesis(GO:0050774) |
| 0.0 | 0.0 | GO:0061303 | cornea development in camera-type eye(GO:0061303) |
| 0.0 | 0.1 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
| 0.0 | 0.0 | GO:2001055 | positive regulation of mesenchymal cell apoptotic process(GO:2001055) |
| 0.0 | 0.0 | GO:0008105 | asymmetric protein localization(GO:0008105) |
| 0.0 | 0.0 | GO:0032511 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.0 | 0.0 | GO:2001028 | positive regulation of endothelial cell chemotaxis(GO:2001028) |
| 0.0 | 0.1 | GO:0010818 | T cell chemotaxis(GO:0010818) |
| 0.0 | 0.0 | GO:0033131 | regulation of glucokinase activity(GO:0033131) positive regulation of hexokinase activity(GO:1903301) |
| 0.0 | 0.0 | GO:0002727 | natural killer cell cytokine production(GO:0002370) regulation of natural killer cell cytokine production(GO:0002727) |
| 0.0 | 0.1 | GO:0035909 | aorta morphogenesis(GO:0035909) |
| 0.0 | 0.0 | GO:0019048 | modulation by virus of host morphology or physiology(GO:0019048) |
| 0.0 | 0.0 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
| 0.0 | 0.0 | GO:0051799 | negative regulation of hair follicle development(GO:0051799) |
| 0.0 | 0.1 | GO:0031297 | replication fork processing(GO:0031297) |
| 0.0 | 0.0 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
| 0.0 | 0.0 | GO:1902414 | protein localization to cell junction(GO:1902414) |
| 0.0 | 0.1 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.0 | 0.1 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.0 | 0.1 | GO:0030539 | male genitalia development(GO:0030539) |
| 0.0 | 0.1 | GO:0018195 | peptidyl-arginine modification(GO:0018195) |
| 0.0 | 0.0 | GO:0042574 | retinal metabolic process(GO:0042574) |
| 0.0 | 0.0 | GO:0030421 | defecation(GO:0030421) |
| 0.0 | 0.0 | GO:2000767 | positive regulation of cytoplasmic translation(GO:2000767) |
| 0.0 | 0.0 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.0 | 0.0 | GO:0070989 | oxidative demethylation(GO:0070989) |
| 0.0 | 0.0 | GO:1901571 | prostaglandin transport(GO:0015732) icosanoid transport(GO:0071715) fatty acid derivative transport(GO:1901571) |
| 0.0 | 0.0 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
| 0.0 | 0.5 | GO:0043484 | regulation of RNA splicing(GO:0043484) |
| 0.0 | 0.1 | GO:0045948 | positive regulation of translational initiation(GO:0045948) |
| 0.0 | 0.0 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
| 0.0 | 0.0 | GO:2000321 | positive regulation of T-helper 17 cell differentiation(GO:2000321) |
| 0.0 | 0.0 | GO:0000820 | regulation of glutamine family amino acid metabolic process(GO:0000820) |
| 0.0 | 0.1 | GO:0009249 | protein lipoylation(GO:0009249) |
| 0.0 | 0.0 | GO:0042222 | interleukin-1 biosynthetic process(GO:0042222) |
| 0.0 | 0.1 | GO:0006030 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
| 0.0 | 0.0 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
| 0.0 | 0.0 | GO:0070234 | positive regulation of T cell apoptotic process(GO:0070234) |
| 0.0 | 0.2 | GO:0007271 | synaptic transmission, cholinergic(GO:0007271) |
| 0.0 | 0.0 | GO:0002320 | lymphoid progenitor cell differentiation(GO:0002320) |
| 0.0 | 0.0 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
| 0.0 | 0.0 | GO:0030908 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
| 0.0 | 0.0 | GO:0007501 | mesodermal cell fate specification(GO:0007501) |
| 0.0 | 0.0 | GO:0047484 | regulation of response to osmotic stress(GO:0047484) |
| 0.0 | 0.1 | GO:0042744 | hydrogen peroxide catabolic process(GO:0042744) |
| 0.0 | 0.0 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.0 | 0.0 | GO:0019374 | galactolipid metabolic process(GO:0019374) |
| 0.0 | 0.0 | GO:1900425 | negative regulation of defense response to bacterium(GO:1900425) |
| 0.0 | 0.0 | GO:0060180 | female mating behavior(GO:0060180) |
| 0.0 | 0.0 | GO:0071351 | response to interleukin-18(GO:0070673) cellular response to interleukin-18(GO:0071351) |
| 0.0 | 0.0 | GO:0035992 | tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
| 0.0 | 0.0 | GO:0072203 | cell proliferation involved in metanephros development(GO:0072203) |
| 0.0 | 0.0 | GO:0036124 | histone H3-K9 trimethylation(GO:0036124) |
| 0.0 | 0.0 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
| 0.0 | 0.0 | GO:0046541 | saliva secretion(GO:0046541) |
| 0.0 | 0.0 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
| 0.0 | 0.0 | GO:0014067 | negative regulation of phosphatidylinositol 3-kinase signaling(GO:0014067) |
| 0.0 | 0.4 | GO:0006352 | DNA-templated transcription, initiation(GO:0006352) |
| 0.0 | 0.1 | GO:0035428 | hexose transmembrane transport(GO:0035428) |
| 0.0 | 0.2 | GO:0048240 | sperm capacitation(GO:0048240) |
| 0.0 | 0.0 | GO:0002832 | negative regulation of response to biotic stimulus(GO:0002832) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.6 | 3.0 | GO:0031094 | platelet dense tubular network(GO:0031094) |
| 0.5 | 1.5 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
| 0.5 | 2.0 | GO:0042567 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
| 0.5 | 5.2 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.5 | 0.5 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
| 0.4 | 1.7 | GO:0070545 | PeBoW complex(GO:0070545) |
| 0.4 | 1.8 | GO:0045098 | type III intermediate filament(GO:0045098) |
| 0.3 | 1.3 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.3 | 0.9 | GO:0070939 | Dsl1p complex(GO:0070939) |
| 0.3 | 1.4 | GO:0005579 | membrane attack complex(GO:0005579) |
| 0.3 | 1.3 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 0.3 | 1.6 | GO:0016589 | NURF complex(GO:0016589) |
| 0.2 | 1.0 | GO:0097524 | sperm plasma membrane(GO:0097524) |
| 0.2 | 0.7 | GO:0097441 | basilar dendrite(GO:0097441) |
| 0.2 | 1.9 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.2 | 0.7 | GO:0097413 | Lewy body(GO:0097413) |
| 0.2 | 0.7 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.2 | 1.4 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.2 | 1.1 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.2 | 0.9 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.2 | 1.3 | GO:0070847 | core mediator complex(GO:0070847) |
| 0.2 | 3.1 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
| 0.2 | 0.6 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
| 0.2 | 2.3 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.2 | 2.3 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.2 | 0.8 | GO:0030891 | VCB complex(GO:0030891) |
| 0.2 | 0.4 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
| 0.2 | 0.7 | GO:0044354 | pinosome(GO:0044352) macropinosome(GO:0044354) |
| 0.2 | 0.9 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
| 0.2 | 1.6 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
| 0.2 | 0.9 | GO:0042824 | MHC class I peptide loading complex(GO:0042824) |
| 0.2 | 0.7 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.2 | 0.5 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
| 0.2 | 6.2 | GO:0031672 | A band(GO:0031672) |
| 0.2 | 3.0 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
| 0.2 | 0.7 | GO:0044316 | cone cell pedicle(GO:0044316) |
| 0.2 | 1.8 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.2 | 0.3 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.2 | 0.6 | GO:0032021 | NELF complex(GO:0032021) |
| 0.1 | 0.7 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.1 | 2.5 | GO:0002102 | podosome(GO:0002102) |
| 0.1 | 0.6 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.1 | 1.2 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.1 | 2.1 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
| 0.1 | 1.0 | GO:0001650 | fibrillar center(GO:0001650) |
| 0.1 | 0.6 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
| 0.1 | 0.4 | GO:0097452 | GAIT complex(GO:0097452) |
| 0.1 | 1.9 | GO:0000242 | pericentriolar material(GO:0000242) |
| 0.1 | 1.4 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
| 0.1 | 1.1 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.1 | 0.8 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
| 0.1 | 0.2 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 0.1 | 0.5 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
| 0.1 | 0.4 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
| 0.1 | 1.8 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.1 | 0.3 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
| 0.1 | 0.1 | GO:0042175 | nuclear outer membrane-endoplasmic reticulum membrane network(GO:0042175) |
| 0.1 | 1.0 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
| 0.1 | 0.8 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.1 | 0.3 | GO:0098536 | deuterosome(GO:0098536) |
| 0.1 | 0.6 | GO:0071986 | Ragulator complex(GO:0071986) |
| 0.1 | 0.9 | GO:0042613 | MHC class II protein complex(GO:0042613) |
| 0.1 | 0.6 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
| 0.1 | 0.3 | GO:0005712 | chiasma(GO:0005712) |
| 0.1 | 0.7 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.1 | 0.7 | GO:0000439 | core TFIIH complex(GO:0000439) |
| 0.1 | 5.4 | GO:0005811 | lipid particle(GO:0005811) |
| 0.1 | 1.8 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.1 | 0.2 | GO:0071942 | XPC complex(GO:0071942) |
| 0.1 | 0.3 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
| 0.1 | 0.1 | GO:0044393 | microspike(GO:0044393) |
| 0.1 | 0.5 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.1 | 0.5 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
| 0.1 | 0.5 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
| 0.1 | 0.4 | GO:0044308 | axonal spine(GO:0044308) |
| 0.1 | 0.4 | GO:0030127 | COPII vesicle coat(GO:0030127) |
| 0.1 | 1.0 | GO:0042581 | specific granule(GO:0042581) |
| 0.1 | 0.3 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
| 0.1 | 0.4 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
| 0.1 | 0.8 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
| 0.1 | 0.6 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
| 0.1 | 0.3 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.1 | 0.3 | GO:0030478 | actin cap(GO:0030478) |
| 0.1 | 4.0 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.1 | 0.3 | GO:0031983 | vesicle lumen(GO:0031983) |
| 0.1 | 0.3 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
| 0.1 | 0.7 | GO:1904115 | axon cytoplasm(GO:1904115) |
| 0.1 | 0.6 | GO:0042575 | DNA polymerase complex(GO:0042575) |
| 0.1 | 0.2 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
| 0.1 | 0.3 | GO:0000811 | GINS complex(GO:0000811) |
| 0.1 | 0.2 | GO:0017133 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
| 0.1 | 0.2 | GO:0033647 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
| 0.1 | 2.5 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
| 0.1 | 0.1 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.1 | 0.2 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
| 0.1 | 0.4 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
| 0.1 | 1.0 | GO:0001741 | XY body(GO:0001741) |
| 0.1 | 0.7 | GO:0036128 | CatSper complex(GO:0036128) |
| 0.1 | 0.4 | GO:0001739 | sex chromatin(GO:0001739) |
| 0.1 | 0.8 | GO:0032797 | SMN complex(GO:0032797) |
| 0.1 | 0.3 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
| 0.1 | 0.4 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
| 0.1 | 0.3 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| 0.1 | 0.5 | GO:0045180 | basal cortex(GO:0045180) |
| 0.1 | 0.1 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
| 0.1 | 2.8 | GO:0031201 | SNARE complex(GO:0031201) |
| 0.1 | 0.7 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
| 0.1 | 0.3 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
| 0.1 | 0.5 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.1 | 0.6 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.1 | 0.9 | GO:0031528 | microvillus membrane(GO:0031528) |
| 0.1 | 0.6 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.1 | 0.3 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
| 0.1 | 0.3 | GO:0000835 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) |
| 0.1 | 0.2 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.1 | 1.1 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
| 0.1 | 0.1 | GO:0036449 | microtubule minus-end(GO:0036449) |
| 0.1 | 0.7 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.1 | 0.1 | GO:0005652 | nuclear lamina(GO:0005652) |
| 0.1 | 0.3 | GO:0005610 | laminin-5 complex(GO:0005610) |
| 0.1 | 0.4 | GO:0031415 | NatA complex(GO:0031415) |
| 0.1 | 0.1 | GO:0031261 | DNA replication preinitiation complex(GO:0031261) |
| 0.1 | 0.7 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.1 | 0.2 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.1 | 0.3 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
| 0.1 | 0.2 | GO:0046691 | intracellular canaliculus(GO:0046691) |
| 0.1 | 1.4 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.1 | 0.2 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
| 0.1 | 1.0 | GO:0010369 | chromocenter(GO:0010369) |
| 0.1 | 0.4 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.1 | 0.2 | GO:0001940 | male pronucleus(GO:0001940) |
| 0.1 | 0.1 | GO:0055087 | Ski complex(GO:0055087) |
| 0.1 | 0.4 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.1 | 0.5 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 0.1 | 0.5 | GO:0031932 | TORC2 complex(GO:0031932) |
| 0.1 | 5.0 | GO:0005930 | axoneme(GO:0005930) ciliary plasm(GO:0097014) |
| 0.1 | 2.4 | GO:0045271 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
| 0.1 | 0.3 | GO:0030056 | hemidesmosome(GO:0030056) |
| 0.1 | 0.1 | GO:1990745 | EARP complex(GO:1990745) |
| 0.1 | 0.5 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.1 | 0.3 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.1 | 0.2 | GO:0071256 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
| 0.1 | 0.2 | GO:0071458 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) |
| 0.1 | 0.2 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
| 0.1 | 0.2 | GO:1990131 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.1 | 0.2 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
| 0.1 | 0.3 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.1 | 2.5 | GO:0005778 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
| 0.1 | 0.3 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 0.1 | 0.2 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 0.1 | 0.2 | GO:0070688 | MLL5-L complex(GO:0070688) |
| 0.1 | 0.2 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
| 0.1 | 0.3 | GO:0001652 | granular component(GO:0001652) |
| 0.1 | 0.2 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.1 | 0.3 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
| 0.1 | 0.4 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
| 0.1 | 0.4 | GO:0005845 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
| 0.0 | 0.5 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
| 0.0 | 0.2 | GO:0032009 | early phagosome(GO:0032009) |
| 0.0 | 0.1 | GO:0001939 | female pronucleus(GO:0001939) |
| 0.0 | 0.5 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.0 | 0.1 | GO:0097433 | dense body(GO:0097433) |
| 0.0 | 0.2 | GO:0070187 | telosome(GO:0070187) |
| 0.0 | 0.1 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
| 0.0 | 0.6 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
| 0.0 | 0.1 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.0 | 0.3 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
| 0.0 | 1.3 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.0 | 0.4 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
| 0.0 | 0.4 | GO:0045263 | proton-transporting ATP synthase complex, coupling factor F(o)(GO:0045263) |
| 0.0 | 0.5 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
| 0.0 | 0.1 | GO:0031084 | BLOC-2 complex(GO:0031084) |
| 0.0 | 1.5 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.0 | 0.1 | GO:0005927 | muscle tendon junction(GO:0005927) |
| 0.0 | 1.0 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.0 | 0.3 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.0 | 0.5 | GO:0043196 | varicosity(GO:0043196) |
| 0.0 | 0.2 | GO:0071203 | WASH complex(GO:0071203) |
| 0.0 | 0.2 | GO:0030870 | Mre11 complex(GO:0030870) |
| 0.0 | 0.0 | GO:0001651 | dense fibrillar component(GO:0001651) |
| 0.0 | 0.2 | GO:0051286 | cell tip(GO:0051286) |
| 0.0 | 0.0 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
| 0.0 | 0.4 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
| 0.0 | 0.3 | GO:0097539 | ciliary transition fiber(GO:0097539) |
| 0.0 | 0.4 | GO:0031045 | dense core granule(GO:0031045) |
| 0.0 | 0.4 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
| 0.0 | 0.1 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.0 | 1.4 | GO:0014704 | intercalated disc(GO:0014704) |
| 0.0 | 0.1 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.0 | 0.6 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.0 | 0.2 | GO:0000938 | GARP complex(GO:0000938) |
| 0.0 | 0.6 | GO:0005614 | interstitial matrix(GO:0005614) |
| 0.0 | 0.3 | GO:0070578 | RISC-loading complex(GO:0070578) |
| 0.0 | 0.3 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
| 0.0 | 0.2 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
| 0.0 | 0.1 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.0 | 7.1 | GO:0019898 | extrinsic component of membrane(GO:0019898) |
| 0.0 | 0.2 | GO:0034704 | calcium channel complex(GO:0034704) |
| 0.0 | 0.7 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.0 | 1.8 | GO:0016605 | PML body(GO:0016605) |
| 0.0 | 0.4 | GO:0030126 | COPI vesicle coat(GO:0030126) |
| 0.0 | 0.2 | GO:0098533 | ATPase dependent transmembrane transport complex(GO:0098533) |
| 0.0 | 0.1 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.0 | 0.4 | GO:0005639 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) nuclear membrane part(GO:0044453) |
| 0.0 | 0.6 | GO:0005637 | nuclear inner membrane(GO:0005637) |
| 0.0 | 0.6 | GO:0097228 | sperm principal piece(GO:0097228) |
| 0.0 | 0.7 | GO:0071339 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
| 0.0 | 0.0 | GO:0032280 | symmetric synapse(GO:0032280) |
| 0.0 | 0.1 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.0 | 0.1 | GO:0070938 | contractile ring(GO:0070938) |
| 0.0 | 0.7 | GO:0005720 | nuclear heterochromatin(GO:0005720) |
| 0.0 | 0.4 | GO:0044295 | axonal growth cone(GO:0044295) |
| 0.0 | 0.3 | GO:0000346 | transcription export complex(GO:0000346) |
| 0.0 | 0.3 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
| 0.0 | 0.4 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.0 | 0.4 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.0 | 0.1 | GO:0005638 | lamin filament(GO:0005638) |
| 0.0 | 0.8 | GO:0005876 | spindle microtubule(GO:0005876) |
| 0.0 | 0.3 | GO:0048770 | melanosome(GO:0042470) pigment granule(GO:0048770) |
| 0.0 | 1.2 | GO:0005643 | nuclear pore(GO:0005643) |
| 0.0 | 0.1 | GO:0071817 | MMXD complex(GO:0071817) |
| 0.0 | 0.2 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
| 0.0 | 0.3 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
| 0.0 | 3.1 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
| 0.0 | 0.5 | GO:0046540 | U4/U6 x U5 tri-snRNP complex(GO:0046540) |
| 0.0 | 0.5 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
| 0.0 | 0.1 | GO:0072588 | box H/ACA snoRNP complex(GO:0031429) box H/ACA RNP complex(GO:0072588) box H/ACA telomerase RNP complex(GO:0090661) |
| 0.0 | 0.1 | GO:0034706 | sodium channel complex(GO:0034706) |
| 0.0 | 0.1 | GO:0000802 | transverse filament(GO:0000802) |
| 0.0 | 0.1 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
| 0.0 | 1.4 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
| 0.0 | 0.1 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.0 | 0.5 | GO:0071012 | catalytic step 1 spliceosome(GO:0071012) |
| 0.0 | 0.7 | GO:0005801 | cis-Golgi network(GO:0005801) |
| 0.0 | 0.1 | GO:0033270 | paranode region of axon(GO:0033270) |
| 0.0 | 1.0 | GO:0045171 | intercellular bridge(GO:0045171) |
| 0.0 | 0.1 | GO:0005594 | collagen type IX trimer(GO:0005594) |
| 0.0 | 0.1 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
| 0.0 | 0.1 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.0 | 0.1 | GO:0032591 | dendritic spine membrane(GO:0032591) |
| 0.0 | 0.1 | GO:0030286 | dynein complex(GO:0030286) |
| 0.0 | 0.1 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 0.0 | 0.2 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.0 | 0.7 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.0 | 0.1 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.0 | 0.3 | GO:0031305 | intrinsic component of mitochondrial inner membrane(GO:0031304) integral component of mitochondrial inner membrane(GO:0031305) |
| 0.0 | 0.2 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.0 | 0.1 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
| 0.0 | 0.3 | GO:0032426 | stereocilium tip(GO:0032426) |
| 0.0 | 0.2 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.0 | 0.4 | GO:0043034 | costamere(GO:0043034) |
| 0.0 | 0.6 | GO:0005865 | striated muscle thin filament(GO:0005865) |
| 0.0 | 0.1 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
| 0.0 | 1.4 | GO:0005814 | centriole(GO:0005814) |
| 0.0 | 0.1 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
| 0.0 | 0.0 | GO:0043219 | lateral loop(GO:0043219) |
| 0.0 | 0.0 | GO:0061574 | ASAP complex(GO:0061574) |
| 0.0 | 0.1 | GO:0042583 | chromaffin granule(GO:0042583) |
| 0.0 | 0.3 | GO:0002080 | acrosomal membrane(GO:0002080) |
| 0.0 | 0.1 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
| 0.0 | 0.2 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.0 | 0.3 | GO:0000777 | condensed chromosome kinetochore(GO:0000777) |
| 0.0 | 0.3 | GO:0005771 | multivesicular body(GO:0005771) |
| 0.0 | 0.1 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
| 0.0 | 27.0 | GO:0005783 | endoplasmic reticulum(GO:0005783) |
| 0.0 | 0.1 | GO:0000796 | condensin complex(GO:0000796) |
| 0.0 | 0.0 | GO:0033263 | CORVET complex(GO:0033263) |
| 0.0 | 0.2 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.0 | 0.0 | GO:0030128 | clathrin coat of endocytic vesicle(GO:0030128) |
| 0.0 | 0.0 | GO:0031332 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
| 0.0 | 0.1 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.0 | 0.6 | GO:0032587 | ruffle membrane(GO:0032587) |
| 0.0 | 0.0 | GO:0000805 | X chromosome(GO:0000805) |
| 0.0 | 0.4 | GO:0005776 | autophagosome(GO:0005776) |
| 0.0 | 0.0 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.0 | 0.1 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
| 0.0 | 0.1 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.0 | 0.3 | GO:0005839 | proteasome core complex(GO:0005839) |
| 0.0 | 0.1 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
| 0.0 | 0.0 | GO:1990923 | PET complex(GO:1990923) |
| 0.0 | 0.1 | GO:0031010 | ISWI-type complex(GO:0031010) |
| 0.0 | 0.2 | GO:0008278 | cohesin complex(GO:0008278) |
| 0.0 | 0.1 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.0 | 0.9 | GO:0098858 | actin-based cell projection(GO:0098858) |
| 0.0 | 0.7 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
| 0.0 | 0.2 | GO:0001673 | male germ cell nucleus(GO:0001673) |
| 0.0 | 0.3 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.0 | 0.1 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
| 0.0 | 0.1 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
| 0.0 | 0.4 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
| 0.0 | 0.2 | GO:0044291 | cell-cell contact zone(GO:0044291) |
| 0.0 | 0.4 | GO:0005901 | caveola(GO:0005901) |
| 0.0 | 0.0 | GO:0034464 | BBSome(GO:0034464) |
| 0.0 | 0.7 | GO:0015935 | small ribosomal subunit(GO:0015935) |
| 0.0 | 0.7 | GO:0030175 | filopodium(GO:0030175) |
| 0.0 | 0.1 | GO:0042588 | zymogen granule(GO:0042588) |
| 0.0 | 0.3 | GO:0016235 | aggresome(GO:0016235) |
| 0.0 | 0.1 | GO:0000124 | SAGA complex(GO:0000124) |
| 0.0 | 0.0 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
| 0.0 | 1.1 | GO:0005777 | peroxisome(GO:0005777) microbody(GO:0042579) |
| 0.0 | 0.1 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
| 0.0 | 0.0 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
| 0.0 | 0.2 | GO:0030315 | T-tubule(GO:0030315) |
| 0.0 | 0.2 | GO:0035861 | site of double-strand break(GO:0035861) |
| 0.0 | 0.1 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
| 0.0 | 0.0 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.0 | 1.0 | GO:0005770 | late endosome(GO:0005770) |
| 0.0 | 0.0 | GO:0043293 | apoptosome(GO:0043293) |
| 0.0 | 0.1 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
| 0.0 | 0.5 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.0 | 0.0 | GO:0000814 | ESCRT II complex(GO:0000814) |
| 0.0 | 0.0 | GO:1904949 | ATPase complex(GO:1904949) |
| 0.0 | 13.9 | GO:0005739 | mitochondrion(GO:0005739) |
| 0.0 | 1.5 | GO:0099572 | postsynaptic density(GO:0014069) postsynaptic specialization(GO:0099572) |
| 0.0 | 0.1 | GO:0030904 | retromer complex(GO:0030904) |
| 0.0 | 1.5 | GO:0005759 | mitochondrial matrix(GO:0005759) |
| 0.0 | 0.2 | GO:0044815 | DNA packaging complex(GO:0044815) |
| 0.0 | 0.4 | GO:0036064 | ciliary basal body(GO:0036064) |
| 0.0 | 0.1 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
| 0.0 | 0.1 | GO:0070461 | SAGA-type complex(GO:0070461) |
| 0.0 | 0.3 | GO:0042383 | sarcolemma(GO:0042383) |
| 0.0 | 0.0 | GO:0090543 | Flemming body(GO:0090543) |
| 0.0 | 0.0 | GO:0031417 | NatC complex(GO:0031417) |
| 0.0 | 0.0 | GO:0043259 | laminin-10 complex(GO:0043259) |
| 0.0 | 0.0 | GO:0097512 | cardiac myofibril(GO:0097512) |
| 0.0 | 0.7 | GO:0005802 | trans-Golgi network(GO:0005802) |
| 0.0 | 0.3 | GO:0016592 | mediator complex(GO:0016592) |
| 0.0 | 0.1 | GO:0061702 | inflammasome complex(GO:0061702) |
| 0.0 | 0.1 | GO:0042555 | MCM complex(GO:0042555) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.2 | 3.6 | GO:0004771 | sterol esterase activity(GO:0004771) |
| 1.1 | 3.3 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
| 0.8 | 2.3 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
| 0.7 | 3.0 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
| 0.6 | 1.9 | GO:0070644 | vitamin D response element binding(GO:0070644) |
| 0.6 | 5.3 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.6 | 3.4 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
| 0.6 | 1.7 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
| 0.5 | 1.5 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
| 0.5 | 1.5 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.5 | 1.4 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.5 | 1.4 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
| 0.5 | 1.4 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
| 0.4 | 2.1 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
| 0.4 | 1.3 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
| 0.4 | 4.9 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.4 | 1.9 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.4 | 1.1 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
| 0.4 | 1.1 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
| 0.4 | 1.1 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.4 | 2.1 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
| 0.3 | 1.0 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.3 | 0.7 | GO:0038181 | bile acid receptor activity(GO:0038181) |
| 0.3 | 1.0 | GO:0016842 | amidine-lyase activity(GO:0016842) |
| 0.3 | 1.0 | GO:0055100 | adiponectin binding(GO:0055100) |
| 0.3 | 1.0 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.3 | 0.9 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.3 | 9.1 | GO:0080030 | prenylcysteine methylesterase activity(GO:0010296) 1-oxa-2-oxocycloheptane lactonase activity(GO:0018731) sulfolactone hydrolase activity(GO:0018732) butyrolactone hydrolase activity(GO:0018734) endosulfan lactone lactonase activity(GO:0034892) L-ascorbate 6-phosphate lactonase activity(GO:0035460) Ser-tRNA(Thr) hydrolase activity(GO:0043905) Ala-tRNA(Pro) hydrolase activity(GO:0043906) Cys-tRNA(Pro) hydrolase activity(GO:0043907) Ser(Gly)-tRNA(Ala) hydrolase activity(GO:0043908) all-trans-retinyl-palmitate hydrolase, all-trans-retinol forming activity(GO:0047376) mannosyl-oligosaccharide 1,6-alpha-mannosidase activity(GO:0052767) mannosyl-oligosaccharide 1,3-alpha-mannosidase activity(GO:0052768) methyl indole-3-acetate esterase activity(GO:0080030) methyl salicylate esterase activity(GO:0080031) methyl jasmonate esterase activity(GO:0080032) |
| 0.3 | 0.8 | GO:2001070 | starch binding(GO:2001070) |
| 0.3 | 1.1 | GO:0034056 | estrogen response element binding(GO:0034056) |
| 0.3 | 0.3 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
| 0.3 | 0.8 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
| 0.3 | 1.3 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
| 0.3 | 0.8 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
| 0.3 | 3.6 | GO:0070402 | NADPH binding(GO:0070402) |
| 0.2 | 0.7 | GO:0016823 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 0.2 | 0.7 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 0.2 | 0.5 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
| 0.2 | 2.0 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
| 0.2 | 1.4 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
| 0.2 | 0.7 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
| 0.2 | 1.2 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
| 0.2 | 1.8 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.2 | 0.9 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
| 0.2 | 1.1 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
| 0.2 | 1.1 | GO:0000828 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
| 0.2 | 1.7 | GO:0035174 | histone serine kinase activity(GO:0035174) |
| 0.2 | 0.4 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
| 0.2 | 0.6 | GO:0050816 | phosphothreonine binding(GO:0050816) |
| 0.2 | 0.8 | GO:0016972 | thiol oxidase activity(GO:0016972) |
| 0.2 | 4.1 | GO:0003785 | actin monomer binding(GO:0003785) |
| 0.2 | 0.8 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
| 0.2 | 1.4 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.2 | 0.6 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
| 0.2 | 0.4 | GO:0031686 | A1 adenosine receptor binding(GO:0031686) |
| 0.2 | 2.0 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.2 | 0.8 | GO:0033142 | progesterone receptor binding(GO:0033142) |
| 0.2 | 1.0 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.2 | 0.6 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
| 0.2 | 0.8 | GO:0008823 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
| 0.2 | 0.6 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
| 0.2 | 0.6 | GO:0005347 | ATP transmembrane transporter activity(GO:0005347) |
| 0.2 | 0.9 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
| 0.2 | 5.4 | GO:0004114 | 3',5'-cyclic-nucleotide phosphodiesterase activity(GO:0004114) |
| 0.2 | 0.9 | GO:1990254 | keratin filament binding(GO:1990254) |
| 0.2 | 0.5 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
| 0.2 | 1.6 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.2 | 1.0 | GO:0002054 | nucleobase binding(GO:0002054) |
| 0.2 | 0.7 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
| 0.2 | 0.7 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.2 | 0.3 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
| 0.2 | 0.8 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.2 | 0.8 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
| 0.2 | 1.0 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.2 | 0.2 | GO:0048406 | nerve growth factor binding(GO:0048406) |
| 0.2 | 0.8 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
| 0.2 | 0.6 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
| 0.2 | 0.5 | GO:0008948 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) oxaloacetate decarboxylase activity(GO:0008948) |
| 0.2 | 1.1 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
| 0.2 | 0.6 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
| 0.2 | 0.6 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
| 0.2 | 1.7 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
| 0.2 | 0.5 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.2 | 0.8 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
| 0.2 | 0.5 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
| 0.2 | 1.2 | GO:0016668 | oxidoreductase activity, acting on a sulfur group of donors, NAD(P) as acceptor(GO:0016668) |
| 0.2 | 0.6 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
| 0.2 | 0.6 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
| 0.2 | 0.6 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
| 0.1 | 0.4 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 0.1 | 0.9 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.1 | 1.5 | GO:0001223 | transcription coactivator binding(GO:0001223) |
| 0.1 | 0.4 | GO:0005119 | smoothened binding(GO:0005119) |
| 0.1 | 0.4 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
| 0.1 | 0.4 | GO:0070699 | type II activin receptor binding(GO:0070699) |
| 0.1 | 0.6 | GO:0070052 | collagen V binding(GO:0070052) |
| 0.1 | 0.4 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) |
| 0.1 | 0.6 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
| 0.1 | 0.6 | GO:0046790 | virion binding(GO:0046790) |
| 0.1 | 1.6 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
| 0.1 | 0.4 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
| 0.1 | 2.3 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.1 | 0.1 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.1 | 1.5 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
| 0.1 | 0.4 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
| 0.1 | 0.1 | GO:0008905 | mannose-phosphate guanylyltransferase activity(GO:0008905) |
| 0.1 | 0.6 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
| 0.1 | 0.6 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 0.1 | 0.5 | GO:0044548 | S100 protein binding(GO:0044548) |
| 0.1 | 0.1 | GO:0001030 | RNA polymerase III type 1 promoter DNA binding(GO:0001030) RNA polymerase III type 2 promoter DNA binding(GO:0001031) RNA polymerase III type 3 promoter DNA binding(GO:0001032) 5S rDNA binding(GO:0080084) |
| 0.1 | 0.4 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
| 0.1 | 0.7 | GO:0016721 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.1 | 0.7 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.1 | 0.4 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
| 0.1 | 0.4 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
| 0.1 | 0.6 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.1 | 0.4 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
| 0.1 | 2.0 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
| 0.1 | 0.5 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
| 0.1 | 0.4 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.1 | 0.4 | GO:0000182 | rDNA binding(GO:0000182) |
| 0.1 | 0.7 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
| 0.1 | 0.2 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
| 0.1 | 0.5 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.1 | 0.4 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
| 0.1 | 0.5 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
| 0.1 | 1.4 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
| 0.1 | 0.7 | GO:0016151 | nickel cation binding(GO:0016151) |
| 0.1 | 0.2 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
| 0.1 | 3.6 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.1 | 0.5 | GO:0018636 | phenanthrene 9,10-monooxygenase activity(GO:0018636) |
| 0.1 | 0.4 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 0.1 | 0.1 | GO:0015141 | succinate transmembrane transporter activity(GO:0015141) |
| 0.1 | 0.5 | GO:0004030 | aldehyde dehydrogenase [NAD(P)+] activity(GO:0004030) |
| 0.1 | 0.5 | GO:0016018 | cyclosporin A binding(GO:0016018) |
| 0.1 | 0.3 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.1 | 0.7 | GO:0043426 | MRF binding(GO:0043426) |
| 0.1 | 0.3 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
| 0.1 | 0.3 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.1 | 0.5 | GO:0016723 | oxidoreductase activity, oxidizing metal ions, NAD or NADP as acceptor(GO:0016723) |
| 0.1 | 0.2 | GO:0015142 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
| 0.1 | 1.2 | GO:0046977 | TAP binding(GO:0046977) |
| 0.1 | 0.3 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
| 0.1 | 2.0 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
| 0.1 | 0.1 | GO:0050253 | retinyl-palmitate esterase activity(GO:0050253) |
| 0.1 | 0.6 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
| 0.1 | 2.1 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
| 0.1 | 1.4 | GO:0004467 | long-chain fatty acid-CoA ligase activity(GO:0004467) |
| 0.1 | 0.4 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
| 0.1 | 1.8 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
| 0.1 | 0.1 | GO:0035939 | microsatellite binding(GO:0035939) |
| 0.1 | 0.2 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
| 0.1 | 0.1 | GO:0005350 | purine nucleobase transmembrane transporter activity(GO:0005345) pyrimidine nucleobase transmembrane transporter activity(GO:0005350) nucleobase transmembrane transporter activity(GO:0015205) |
| 0.1 | 1.8 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
| 0.1 | 1.1 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.1 | 0.6 | GO:0015288 | porin activity(GO:0015288) |
| 0.1 | 0.4 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
| 0.1 | 0.5 | GO:0004396 | glucokinase activity(GO:0004340) hexokinase activity(GO:0004396) |
| 0.1 | 0.3 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.1 | 0.4 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
| 0.1 | 0.5 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
| 0.1 | 1.7 | GO:0010485 | H4 histone acetyltransferase activity(GO:0010485) |
| 0.1 | 0.3 | GO:0019862 | IgA binding(GO:0019862) |
| 0.1 | 0.3 | GO:0004096 | catalase activity(GO:0004096) |
| 0.1 | 1.4 | GO:0003756 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
| 0.1 | 0.3 | GO:0008301 | DNA binding, bending(GO:0008301) |
| 0.1 | 1.1 | GO:0070403 | NAD+ binding(GO:0070403) |
| 0.1 | 0.3 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
| 0.1 | 0.4 | GO:0051880 | G-quadruplex DNA binding(GO:0051880) |
| 0.1 | 0.3 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
| 0.1 | 1.5 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
| 0.1 | 0.2 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
| 0.1 | 1.1 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
| 0.1 | 0.3 | GO:0004103 | choline kinase activity(GO:0004103) |
| 0.1 | 2.1 | GO:0097472 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
| 0.1 | 0.6 | GO:0016803 | ether hydrolase activity(GO:0016803) |
| 0.1 | 0.5 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
| 0.1 | 1.1 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.1 | 0.6 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
| 0.1 | 0.3 | GO:0031685 | adenosine receptor binding(GO:0031685) |
| 0.1 | 0.1 | GO:0000009 | alpha-1,6-mannosyltransferase activity(GO:0000009) |
| 0.1 | 1.2 | GO:0032183 | SUMO binding(GO:0032183) |
| 0.1 | 0.6 | GO:0016679 | oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) |
| 0.1 | 2.9 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
| 0.1 | 0.5 | GO:0000146 | microfilament motor activity(GO:0000146) |
| 0.1 | 0.7 | GO:0042171 | lysophosphatidic acid acyltransferase activity(GO:0042171) |
| 0.1 | 0.3 | GO:0004365 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
| 0.1 | 0.7 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
| 0.1 | 0.4 | GO:0035251 | UDP-glucosyltransferase activity(GO:0035251) |
| 0.1 | 1.4 | GO:0030552 | cAMP binding(GO:0030552) |
| 0.1 | 0.3 | GO:0061731 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.1 | 0.4 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.1 | 0.4 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
| 0.1 | 0.3 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
| 0.1 | 0.2 | GO:0015216 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) |
| 0.1 | 0.3 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
| 0.1 | 0.3 | GO:1901612 | cardiolipin binding(GO:1901612) |
| 0.1 | 0.1 | GO:0004331 | fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
| 0.1 | 0.3 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.1 | 0.2 | GO:0043175 | RNA polymerase core enzyme binding(GO:0043175) |
| 0.1 | 0.1 | GO:0051723 | protein methylesterase activity(GO:0051723) |
| 0.1 | 1.6 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
| 0.1 | 0.5 | GO:0008409 | 5'-3' exonuclease activity(GO:0008409) |
| 0.1 | 1.3 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| 0.1 | 0.3 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
| 0.1 | 0.6 | GO:0008097 | 5S rRNA binding(GO:0008097) |
| 0.1 | 2.4 | GO:0016749 | N-succinyltransferase activity(GO:0016749) |
| 0.1 | 0.2 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.1 | 0.7 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
| 0.1 | 0.6 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
| 0.1 | 0.2 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
| 0.1 | 0.2 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
| 0.1 | 0.6 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.1 | 0.1 | GO:0070905 | serine binding(GO:0070905) |
| 0.1 | 0.2 | GO:0004936 | alpha-adrenergic receptor activity(GO:0004936) |
| 0.1 | 0.2 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
| 0.1 | 1.3 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
| 0.1 | 0.4 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.1 | 0.2 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
| 0.1 | 0.3 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.1 | 0.2 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
| 0.1 | 0.7 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.1 | 0.2 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.1 | 0.5 | GO:0036122 | BMP binding(GO:0036122) |
| 0.1 | 0.3 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
| 0.1 | 0.6 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
| 0.1 | 0.2 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
| 0.1 | 0.3 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
| 0.1 | 0.9 | GO:0017160 | Ral GTPase binding(GO:0017160) |
| 0.1 | 0.8 | GO:0008061 | chitin binding(GO:0008061) |
| 0.1 | 0.3 | GO:0016936 | galactoside binding(GO:0016936) |
| 0.1 | 1.1 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
| 0.1 | 0.5 | GO:0035197 | siRNA binding(GO:0035197) |
| 0.1 | 1.7 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
| 0.1 | 0.2 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 0.1 | 0.4 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 0.1 | 0.7 | GO:0034713 | type I transforming growth factor beta receptor binding(GO:0034713) |
| 0.1 | 0.3 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
| 0.1 | 0.4 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
| 0.1 | 0.4 | GO:0022820 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.1 | 0.3 | GO:0052794 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
| 0.1 | 0.6 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
| 0.1 | 0.2 | GO:0070878 | primary miRNA binding(GO:0070878) |
| 0.1 | 4.0 | GO:0051082 | unfolded protein binding(GO:0051082) |
| 0.1 | 0.2 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 0.1 | 0.2 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
| 0.1 | 0.1 | GO:0000339 | RNA cap binding(GO:0000339) |
| 0.1 | 0.2 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
| 0.1 | 0.6 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.1 | 0.3 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
| 0.1 | 0.1 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
| 0.1 | 0.5 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.1 | 0.2 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
| 0.1 | 0.2 | GO:0051430 | corticotropin-releasing hormone receptor 1 binding(GO:0051430) |
| 0.1 | 0.3 | GO:0034596 | phosphatidylinositol phosphate 4-phosphatase activity(GO:0034596) |
| 0.1 | 0.8 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
| 0.1 | 1.1 | GO:0005112 | Notch binding(GO:0005112) |
| 0.1 | 0.1 | GO:0048156 | tau protein binding(GO:0048156) |
| 0.1 | 0.7 | GO:0009881 | photoreceptor activity(GO:0009881) |
| 0.1 | 0.3 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
| 0.1 | 0.2 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.1 | 2.9 | GO:0019209 | kinase activator activity(GO:0019209) |
| 0.1 | 0.3 | GO:1990239 | steroid hormone binding(GO:1990239) |
| 0.1 | 0.9 | GO:0016646 | oxidoreductase activity, acting on the CH-NH group of donors, NAD or NADP as acceptor(GO:0016646) |
| 0.1 | 0.3 | GO:0098821 | BMP receptor activity(GO:0098821) |
| 0.1 | 0.3 | GO:0005499 | vitamin D binding(GO:0005499) |
| 0.1 | 0.6 | GO:0070513 | death domain binding(GO:0070513) |
| 0.1 | 0.1 | GO:0004723 | calcium-dependent protein serine/threonine phosphatase activity(GO:0004723) |
| 0.1 | 0.6 | GO:0042043 | neurexin family protein binding(GO:0042043) |
| 0.1 | 0.5 | GO:0035250 | UDP-galactosyltransferase activity(GO:0035250) |
| 0.1 | 0.1 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
| 0.1 | 0.1 | GO:0043842 | Kdo transferase activity(GO:0043842) |
| 0.1 | 0.1 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
| 0.1 | 0.1 | GO:0089720 | caspase binding(GO:0089720) |
| 0.1 | 0.2 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.1 | 0.8 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
| 0.1 | 0.3 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
| 0.1 | 1.0 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
| 0.1 | 0.2 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.1 | 0.2 | GO:0097016 | L27 domain binding(GO:0097016) |
| 0.1 | 0.4 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.1 | 0.1 | GO:0001642 | group III metabotropic glutamate receptor activity(GO:0001642) |
| 0.1 | 1.1 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
| 0.1 | 0.7 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
| 0.1 | 1.2 | GO:0008137 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.1 | 0.2 | GO:0001640 | adenylate cyclase inhibiting G-protein coupled glutamate receptor activity(GO:0001640) |
| 0.1 | 0.1 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.1 | 0.8 | GO:0030275 | LRR domain binding(GO:0030275) |
| 0.1 | 0.5 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.1 | 0.2 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.1 | 0.1 | GO:0016015 | morphogen activity(GO:0016015) |
| 0.1 | 2.0 | GO:0017046 | peptide hormone binding(GO:0017046) |
| 0.1 | 1.2 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
| 0.1 | 1.1 | GO:0004364 | glutathione transferase activity(GO:0004364) |
| 0.1 | 0.9 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 0.1 | 0.1 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
| 0.1 | 0.5 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
| 0.1 | 0.2 | GO:0035671 | enone reductase activity(GO:0035671) |
| 0.1 | 0.7 | GO:0008308 | voltage-gated anion channel activity(GO:0008308) |
| 0.1 | 0.2 | GO:0005114 | type II transforming growth factor beta receptor binding(GO:0005114) |
| 0.1 | 0.9 | GO:0070888 | E-box binding(GO:0070888) |
| 0.1 | 0.1 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
| 0.1 | 0.2 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
| 0.1 | 0.2 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| 0.1 | 0.3 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.1 | 2.0 | GO:0016763 | transferase activity, transferring pentosyl groups(GO:0016763) |
| 0.1 | 0.2 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
| 0.1 | 0.6 | GO:0045295 | gamma-catenin binding(GO:0045295) |
| 0.1 | 0.2 | GO:0019237 | centromeric DNA binding(GO:0019237) |
| 0.1 | 0.2 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
| 0.1 | 0.8 | GO:1990939 | ATP-dependent microtubule motor activity(GO:1990939) |
| 0.1 | 0.2 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
| 0.1 | 0.2 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
| 0.1 | 0.3 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.1 | 0.2 | GO:0036033 | mediator complex binding(GO:0036033) |
| 0.1 | 0.2 | GO:0017116 | single-stranded DNA-dependent ATP-dependent DNA helicase activity(GO:0017116) |
| 0.1 | 0.7 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
| 0.1 | 0.2 | GO:0015265 | urea channel activity(GO:0015265) |
| 0.1 | 0.5 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
| 0.1 | 0.1 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
| 0.1 | 0.2 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
| 0.1 | 0.1 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
| 0.1 | 3.1 | GO:0048306 | calcium-dependent protein binding(GO:0048306) |
| 0.1 | 0.1 | GO:0016885 | ligase activity, forming carbon-carbon bonds(GO:0016885) |
| 0.1 | 0.1 | GO:0016631 | enoyl-[acyl-carrier-protein] reductase activity(GO:0016631) 2,3-dihydroxy-2,3-dihydro-phenylpropionate dehydrogenase activity(GO:0018498) cis-2,3-dihydrodiol DDT dehydrogenase activity(GO:0018499) trans-9R,10R-dihydrodiolphenanthrene dehydrogenase activity(GO:0018500) cis-chlorobenzene dihydrodiol dehydrogenase activity(GO:0018501) 2,5-dichloro-2,5-cyclohexadiene-1,4-diol dehydrogenase activity(GO:0018502) trans-1,2-dihydrodiolphenanthrene dehydrogenase activity(GO:0018503) 3,4-dihydroxy-3,4-dihydrofluorene dehydrogenase activity(GO:0034790) benzo(a)pyrene-trans-11,12-dihydrodiol dehydrogenase activity(GO:0034805) benzo(a)pyrene-cis-4,5-dihydrodiol dehydrogenase activity(GO:0034809) citronellyl-CoA dehydrogenase activity(GO:0034824) menthone dehydrogenase activity(GO:0034838) phthalate 3,4-cis-dihydrodiol dehydrogenase activity(GO:0034912) cinnamate reductase activity(GO:0043786) NADPH-dependent curcumin reductase activity(GO:0052849) NADPH-dependent dihydrocurcumin reductase activity(GO:0052850) |
| 0.1 | 0.2 | GO:0015057 | thrombin receptor activity(GO:0015057) |
| 0.0 | 0.3 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.0 | 0.1 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
| 0.0 | 0.1 | GO:0030350 | iron-responsive element binding(GO:0030350) |
| 0.0 | 0.3 | GO:0030492 | hemoglobin binding(GO:0030492) |
| 0.0 | 1.9 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
| 0.0 | 0.7 | GO:0008307 | structural constituent of muscle(GO:0008307) |
| 0.0 | 0.5 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
| 0.0 | 1.2 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.0 | 0.2 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.0 | 0.2 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
| 0.0 | 1.4 | GO:0052771 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
| 0.0 | 0.3 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
| 0.0 | 0.5 | GO:0005123 | death receptor binding(GO:0005123) |
| 0.0 | 0.2 | GO:0035241 | protein-arginine omega-N monomethyltransferase activity(GO:0035241) |
| 0.0 | 0.2 | GO:0005042 | netrin receptor activity(GO:0005042) |
| 0.0 | 0.2 | GO:0004673 | protein histidine kinase activity(GO:0004673) |
| 0.0 | 0.4 | GO:0005523 | tropomyosin binding(GO:0005523) |
| 0.0 | 0.2 | GO:0046923 | ER retention sequence binding(GO:0046923) |
| 0.0 | 0.2 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
| 0.0 | 0.5 | GO:0004697 | protein kinase C activity(GO:0004697) |
| 0.0 | 0.3 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.0 | 0.3 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.0 | 0.2 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
| 0.0 | 0.1 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
| 0.0 | 0.4 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
| 0.0 | 0.3 | GO:0008494 | translation activator activity(GO:0008494) |
| 0.0 | 0.6 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.0 | 0.3 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
| 0.0 | 0.1 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.0 | 0.1 | GO:0004385 | guanylate kinase activity(GO:0004385) |
| 0.0 | 0.5 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
| 0.0 | 0.7 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.0 | 0.1 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
| 0.0 | 0.4 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
| 0.0 | 0.2 | GO:0034549 | N-cyclopropylmelamine deaminase activity(GO:0034547) N-cyclopropylammeline deaminase activity(GO:0034548) N-cyclopropylammelide alkylamino hydrolase activity(GO:0034549) 2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate deaminase activity(GO:0043723) tRNA-specific adenosine-37 deaminase activity(GO:0043829) archaeal-specific GTP cyclohydrolase activity(GO:0044682) tRNA-specific adenosine-34 deaminase activity(GO:0052717) |
| 0.0 | 0.6 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.0 | 0.3 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
| 0.0 | 0.0 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
| 0.0 | 0.2 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
| 0.0 | 0.3 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
| 0.0 | 0.2 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
| 0.0 | 0.2 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.0 | 0.7 | GO:0004889 | acetylcholine-activated cation-selective channel activity(GO:0004889) |
| 0.0 | 0.3 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
| 0.0 | 0.8 | GO:0008483 | transaminase activity(GO:0008483) |
| 0.0 | 0.1 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
| 0.0 | 0.5 | GO:0015924 | mannosyl-oligosaccharide mannosidase activity(GO:0015924) |
| 0.0 | 0.2 | GO:0002162 | dystroglycan binding(GO:0002162) |
| 0.0 | 0.1 | GO:0038132 | neuregulin binding(GO:0038132) |
| 0.0 | 0.2 | GO:0016937 | short-branched-chain-acyl-CoA dehydrogenase activity(GO:0016937) |
| 0.0 | 2.9 | GO:0005496 | steroid binding(GO:0005496) |
| 0.0 | 0.1 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
| 0.0 | 0.3 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.0 | 0.1 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
| 0.0 | 0.6 | GO:0016896 | 3'-5'-exoribonuclease activity(GO:0000175) exoribonuclease activity, producing 5'-phosphomonoesters(GO:0016896) |
| 0.0 | 0.3 | GO:0008828 | thiamine-pyrophosphatase activity(GO:0004787) UDP-2,3-diacylglucosamine hydrolase activity(GO:0008758) dATP pyrophosphohydrolase activity(GO:0008828) dihydroneopterin monophosphate phosphatase activity(GO:0019176) dihydroneopterin triphosphate pyrophosphohydrolase activity(GO:0019177) dTTP diphosphatase activity(GO:0036218) phosphocholine hydrolase activity(GO:0044606) |
| 0.0 | 0.3 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
| 0.0 | 0.0 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
| 0.0 | 0.1 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
| 0.0 | 0.3 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
| 0.0 | 0.2 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.0 | 0.1 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
| 0.0 | 0.1 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
| 0.0 | 0.1 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
| 0.0 | 0.2 | GO:0031628 | opioid receptor binding(GO:0031628) |
| 0.0 | 0.6 | GO:0005537 | mannose binding(GO:0005537) |
| 0.0 | 0.1 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
| 0.0 | 0.1 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
| 0.0 | 0.2 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
| 0.0 | 0.1 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
| 0.0 | 3.0 | GO:0008175 | tRNA methyltransferase activity(GO:0008175) |
| 0.0 | 0.1 | GO:0035514 | DNA demethylase activity(GO:0035514) |
| 0.0 | 0.3 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
| 0.0 | 0.1 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
| 0.0 | 0.1 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
| 0.0 | 0.1 | GO:0004705 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
| 0.0 | 0.0 | GO:0016662 | oxidoreductase activity, acting on other nitrogenous compounds as donors, cytochrome as acceptor(GO:0016662) |
| 0.0 | 0.1 | GO:1990190 | peptide-serine-N-acetyltransferase activity(GO:1990189) peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
| 0.0 | 0.4 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
| 0.0 | 0.1 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
| 0.0 | 0.0 | GO:0048030 | disaccharide binding(GO:0048030) |
| 0.0 | 0.0 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
| 0.0 | 0.1 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
| 0.0 | 0.5 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
| 0.0 | 0.1 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
| 0.0 | 0.7 | GO:0031593 | polyubiquitin binding(GO:0031593) |
| 0.0 | 0.6 | GO:0017025 | TBP-class protein binding(GO:0017025) |
| 0.0 | 0.7 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.0 | 0.2 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.0 | 0.1 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
| 0.0 | 0.1 | GO:0036374 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
| 0.0 | 0.7 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
| 0.0 | 0.1 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
| 0.0 | 0.5 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.0 | 0.7 | GO:0019707 | protein-cysteine S-acyltransferase activity(GO:0019707) |
| 0.0 | 0.1 | GO:0008147 | structural constituent of bone(GO:0008147) |
| 0.0 | 0.6 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
| 0.0 | 0.1 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.0 | 0.3 | GO:0055106 | ligase regulator activity(GO:0055103) ubiquitin-protein transferase regulator activity(GO:0055106) |
| 0.0 | 0.9 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
| 0.0 | 0.1 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
| 0.0 | 0.2 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
| 0.0 | 0.3 | GO:0043422 | protein kinase B binding(GO:0043422) |
| 0.0 | 0.1 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
| 0.0 | 0.3 | GO:0019789 | SUMO transferase activity(GO:0019789) |
| 0.0 | 0.2 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
| 0.0 | 0.4 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.0 | 0.1 | GO:0019976 | interleukin-2 binding(GO:0019976) |
| 0.0 | 2.5 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
| 0.0 | 0.0 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
| 0.0 | 0.2 | GO:0005113 | patched binding(GO:0005113) |
| 0.0 | 0.1 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
| 0.0 | 0.5 | GO:0005246 | calcium channel regulator activity(GO:0005246) |
| 0.0 | 0.4 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
| 0.0 | 0.0 | GO:0036222 | XTP diphosphatase activity(GO:0036222) |
| 0.0 | 0.1 | GO:0071253 | connexin binding(GO:0071253) |
| 0.0 | 0.5 | GO:0008252 | nucleotidase activity(GO:0008252) |
| 0.0 | 0.5 | GO:0003755 | peptidyl-prolyl cis-trans isomerase activity(GO:0003755) |
| 0.0 | 0.1 | GO:0034235 | GPI anchor binding(GO:0034235) |
| 0.0 | 0.2 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
| 0.0 | 0.5 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
| 0.0 | 0.3 | GO:0034185 | apolipoprotein binding(GO:0034185) |
| 0.0 | 0.1 | GO:0031781 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
| 0.0 | 0.1 | GO:0042731 | PH domain binding(GO:0042731) |
| 0.0 | 0.2 | GO:0003993 | acid phosphatase activity(GO:0003993) |
| 0.0 | 0.0 | GO:0016532 | superoxide dismutase copper chaperone activity(GO:0016532) |
| 0.0 | 0.3 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.0 | 0.1 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
| 0.0 | 0.1 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
| 0.0 | 0.1 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
| 0.0 | 0.1 | GO:0004515 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
| 0.0 | 0.2 | GO:0016933 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
| 0.0 | 0.6 | GO:0008536 | Ran GTPase binding(GO:0008536) |
| 0.0 | 0.2 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
| 0.0 | 0.1 | GO:0019959 | interleukin-8 binding(GO:0019959) |
| 0.0 | 0.1 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
| 0.0 | 0.1 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
| 0.0 | 2.2 | GO:0051015 | actin filament binding(GO:0051015) |
| 0.0 | 0.1 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
| 0.0 | 0.2 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.0 | 0.5 | GO:0019239 | deaminase activity(GO:0019239) |
| 0.0 | 0.8 | GO:1990782 | protein tyrosine kinase binding(GO:1990782) |
| 0.0 | 0.1 | GO:0030983 | mismatched DNA binding(GO:0030983) |
| 0.0 | 0.1 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
| 0.0 | 0.1 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
| 0.0 | 0.2 | GO:0004779 | sulfate adenylyltransferase activity(GO:0004779) |
| 0.0 | 0.0 | GO:0016307 | phosphatidylinositol phosphate kinase activity(GO:0016307) |
| 0.0 | 1.0 | GO:0050840 | extracellular matrix binding(GO:0050840) |
| 0.0 | 0.6 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
| 0.0 | 1.0 | GO:0008080 | N-acetyltransferase activity(GO:0008080) |
| 0.0 | 0.3 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
| 0.0 | 0.1 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.0 | 0.1 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
| 0.0 | 0.1 | GO:0015157 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.0 | 0.2 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.0 | 1.6 | GO:0003774 | motor activity(GO:0003774) |
| 0.0 | 0.1 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) |
| 0.0 | 0.0 | GO:0005111 | type 2 fibroblast growth factor receptor binding(GO:0005111) |
| 0.0 | 0.1 | GO:0010858 | calcium-dependent protein kinase regulator activity(GO:0010858) |
| 0.0 | 0.1 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
| 0.0 | 0.1 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.0 | 0.0 | GO:1901611 | phosphatidylglycerol binding(GO:1901611) |
| 0.0 | 0.0 | GO:0030621 | U4 snRNA binding(GO:0030621) |
| 0.0 | 0.0 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
| 0.0 | 0.3 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
| 0.0 | 0.3 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.0 | 0.1 | GO:0004064 | arylesterase activity(GO:0004064) |
| 0.0 | 3.9 | GO:0003779 | actin binding(GO:0003779) |
| 0.0 | 0.1 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
| 0.0 | 0.2 | GO:0016860 | intramolecular oxidoreductase activity(GO:0016860) |
| 0.0 | 0.0 | GO:0070883 | pre-miRNA binding(GO:0070883) |
| 0.0 | 0.0 | GO:0015065 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
| 0.0 | 0.1 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
| 0.0 | 0.1 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.0 | 0.0 | GO:0048256 | flap endonuclease activity(GO:0048256) |
| 0.0 | 0.1 | GO:0070061 | fructose binding(GO:0070061) |
| 0.0 | 0.1 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.0 | 0.5 | GO:0001540 | beta-amyloid binding(GO:0001540) |
| 0.0 | 0.1 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
| 0.0 | 0.0 | GO:0043495 | protein anchor(GO:0043495) |
| 0.0 | 0.0 | GO:0033677 | DNA/RNA helicase activity(GO:0033677) |
| 0.0 | 1.1 | GO:0001104 | RNA polymerase II transcription cofactor activity(GO:0001104) |
| 0.0 | 0.4 | GO:0016790 | thiolester hydrolase activity(GO:0016790) |
| 0.0 | 0.2 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
| 0.0 | 0.1 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
| 0.0 | 0.1 | GO:0031705 | bombesin receptor binding(GO:0031705) |
| 0.0 | 0.0 | GO:0071617 | lysophospholipid acyltransferase activity(GO:0071617) |
| 0.0 | 0.2 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
| 0.0 | 0.1 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
| 0.0 | 4.4 | GO:0001077 | transcriptional activator activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001077) |
| 0.0 | 0.0 | GO:0023029 | MHC class Ib protein binding(GO:0023029) |
| 0.0 | 0.3 | GO:0004629 | phospholipase C activity(GO:0004629) |
| 0.0 | 0.0 | GO:0052743 | inositol tetrakisphosphate phosphatase activity(GO:0052743) |
| 0.0 | 0.2 | GO:0039706 | co-receptor binding(GO:0039706) |
| 0.0 | 0.2 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 0.0 | 0.1 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
| 0.0 | 0.1 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
| 0.0 | 0.1 | GO:0019767 | IgE receptor activity(GO:0019767) |
| 0.0 | 0.0 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
| 0.0 | 0.1 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
| 0.0 | 0.0 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
| 0.0 | 0.1 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.0 | 0.3 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
| 0.0 | 0.1 | GO:0050661 | NADP binding(GO:0050661) |
| 0.0 | 0.1 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.0 | 0.0 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
| 0.0 | 0.1 | GO:0034885 | protein-N-terminal asparagine amidohydrolase activity(GO:0008418) UDP-3-O-[3-hydroxymyristoyl] N-acetylglucosamine deacetylase activity(GO:0008759) iprodione amidohydrolase activity(GO:0018748) (3,5-dichlorophenylurea)acetate amidohydrolase activity(GO:0018749) 4'-(2-hydroxyisopropyl)phenylurea amidohydrolase activity(GO:0034571) didemethylisoproturon amidohydrolase activity(GO:0034573) N-isopropylacetanilide amidohydrolase activity(GO:0034576) N-cyclohexylformamide amidohydrolase activity(GO:0034781) isonicotinic acid hydrazide hydrolase activity(GO:0034876) cis-aconitamide amidase activity(GO:0034882) gamma-N-formylaminovinylacetate hydrolase activity(GO:0034885) N2-acetyl-L-lysine deacetylase activity(GO:0043747) O-succinylbenzoate synthase activity(GO:0043748) indoleacetamide hydrolase activity(GO:0043864) N-acetylcitrulline deacetylase activity(GO:0043909) N-acetylgalactosamine-6-phosphate deacetylase activity(GO:0047419) diacetylchitobiose deacetylase activity(GO:0052773) chitooligosaccharide deacetylase activity(GO:0052790) |
| 0.0 | 0.0 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
| 0.0 | 0.1 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
| 0.0 | 0.1 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
| 0.0 | 0.1 | GO:0022858 | L-alanine transmembrane transporter activity(GO:0015180) alanine transmembrane transporter activity(GO:0022858) |
| 0.0 | 0.0 | GO:0003696 | satellite DNA binding(GO:0003696) |
| 0.0 | 0.6 | GO:0043130 | ubiquitin binding(GO:0043130) |
| 0.0 | 0.1 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
| 0.0 | 0.2 | GO:0001848 | complement binding(GO:0001848) |
| 0.0 | 0.1 | GO:0030984 | kininogen binding(GO:0030984) |
| 0.0 | 0.3 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
| 0.0 | 0.1 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
| 0.0 | 0.1 | GO:0034584 | piRNA binding(GO:0034584) |
| 0.0 | 1.1 | GO:0019905 | syntaxin binding(GO:0019905) |
| 0.0 | 0.1 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 0.0 | 0.0 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
| 0.0 | 1.5 | GO:0042393 | histone binding(GO:0042393) |
| 0.0 | 0.0 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
| 0.0 | 0.2 | GO:0008408 | 3'-5' exonuclease activity(GO:0008408) |
| 0.0 | 0.3 | GO:0042056 | chemoattractant activity(GO:0042056) |
| 0.0 | 0.1 | GO:0008502 | melatonin receptor activity(GO:0008502) |
| 0.0 | 0.5 | GO:0043022 | ribosome binding(GO:0043022) |
| 0.0 | 0.1 | GO:0016667 | oxidoreductase activity, acting on a sulfur group of donors(GO:0016667) |
| 0.0 | 0.0 | GO:0034617 | tetrahydrobiopterin binding(GO:0034617) |
| 0.0 | 0.1 | GO:0035198 | miRNA binding(GO:0035198) |
| 0.0 | 0.0 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
| 0.0 | 0.1 | GO:0045182 | translation regulator activity(GO:0045182) |
| 0.0 | 0.3 | GO:0000049 | tRNA binding(GO:0000049) |
| 0.0 | 0.0 | GO:0004370 | glycerol kinase activity(GO:0004370) |
| 0.0 | 0.0 | GO:0016751 | S-succinyltransferase activity(GO:0016751) |
| 0.0 | 0.0 | GO:0004046 | aminoacylase activity(GO:0004046) |
| 0.0 | 0.0 | GO:0098634 | protein binding involved in cell-matrix adhesion(GO:0098634) |
| 0.0 | 0.3 | GO:0019212 | phosphatase inhibitor activity(GO:0019212) |
| 0.0 | 0.0 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| 0.0 | 0.1 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
| 0.0 | 0.1 | GO:0043142 | single-stranded DNA-dependent ATPase activity(GO:0043142) |
| 0.0 | 0.1 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) calcium-dependent protein kinase activity(GO:0010857) |
| 0.0 | 0.1 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
| 0.0 | 0.0 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
| 0.0 | 0.0 | GO:0045545 | syndecan binding(GO:0045545) |
| 0.0 | 0.1 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
| 0.0 | 0.0 | GO:1904680 | oligopeptide transmembrane transporter activity(GO:0035673) peptide transmembrane transporter activity(GO:1904680) |
| 0.0 | 0.0 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 0.0 | 0.3 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
| 0.0 | 0.0 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
| 0.0 | 0.0 | GO:0043199 | sulfate binding(GO:0043199) |
| 0.0 | 0.3 | GO:0002039 | p53 binding(GO:0002039) |
| 0.0 | 0.1 | GO:0008327 | methyl-CpG binding(GO:0008327) |
| 0.0 | 0.4 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
| 0.0 | 1.2 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
| 0.0 | 0.0 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
| 0.0 | 1.9 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.0 | 0.1 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.0 | 0.2 | GO:0000062 | fatty-acyl-CoA binding(GO:0000062) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 2.7 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.2 | 3.5 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.1 | 3.8 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.1 | 4.0 | PID ATM PATHWAY | ATM pathway |
| 0.1 | 4.8 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
| 0.1 | 1.5 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.1 | 1.2 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.1 | 2.3 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.1 | 1.3 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.1 | 0.6 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 0.1 | 3.5 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 0.1 | 2.9 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
| 0.1 | 1.7 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
| 0.1 | 1.4 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
| 0.1 | 2.3 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 0.1 | 1.8 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
| 0.1 | 2.2 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.1 | 0.4 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.1 | 0.7 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
| 0.1 | 2.4 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
| 0.1 | 1.7 | ST ADRENERGIC | Adrenergic Pathway |
| 0.1 | 2.6 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.1 | 1.4 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.1 | 4.2 | PID E2F PATHWAY | E2F transcription factor network |
| 0.1 | 0.5 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.1 | 0.5 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
| 0.1 | 0.3 | PID MYC PATHWAY | C-MYC pathway |
| 0.1 | 0.2 | ST GA13 PATHWAY | G alpha 13 Pathway |
| 0.1 | 1.6 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.1 | 0.3 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| 0.1 | 0.3 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
| 0.1 | 0.3 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.1 | 1.3 | PID P53 REGULATION PATHWAY | p53 pathway |
| 0.0 | 0.5 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
| 0.0 | 0.5 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.0 | 1.2 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
| 0.0 | 0.5 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.0 | 2.7 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.0 | 1.1 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.0 | 1.2 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.0 | 1.2 | PID P73PATHWAY | p73 transcription factor network |
| 0.0 | 0.9 | PID CONE PATHWAY | Visual signal transduction: Cones |
| 0.0 | 0.1 | ST G ALPHA S PATHWAY | G alpha s Pathway |
| 0.0 | 0.2 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.0 | 0.2 | ST G ALPHA I PATHWAY | G alpha i Pathway |
| 0.0 | 0.5 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 0.0 | 0.2 | PID CD40 PATHWAY | CD40/CD40L signaling |
| 0.0 | 0.3 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
| 0.0 | 0.5 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.0 | 0.9 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
| 0.0 | 0.4 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.0 | 0.7 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
| 0.0 | 0.4 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.0 | 0.2 | PID IFNG PATHWAY | IFN-gamma pathway |
| 0.0 | 0.0 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.0 | 1.0 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.0 | 0.8 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
| 0.0 | 0.1 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
| 0.0 | 1.1 | NABA COLLAGENS | Genes encoding collagen proteins |
| 0.0 | 0.1 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
| 0.0 | 0.0 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
| 0.0 | 0.2 | PID IL27 PATHWAY | IL27-mediated signaling events |
| 0.0 | 0.6 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
| 0.0 | 0.7 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.0 | 0.7 | WNT SIGNALING | Genes related to Wnt-mediated signal transduction |
| 0.0 | 0.6 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
| 0.0 | 0.8 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
| 0.0 | 0.3 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
| 0.0 | 0.3 | PID ARF6 PATHWAY | Arf6 signaling events |
| 0.0 | 0.2 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.0 | 0.5 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
| 0.0 | 0.2 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
| 0.0 | 0.2 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
| 0.0 | 0.2 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.0 | 0.0 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
| 0.0 | 0.0 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.0 | 0.2 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
| 0.0 | 0.1 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.0 | 0.3 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.0 | 0.1 | PID INSULIN PATHWAY | Insulin Pathway |
| 0.0 | 0.1 | PID FOXO PATHWAY | FoxO family signaling |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.6 | 1.1 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
| 0.4 | 5.8 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.3 | 0.9 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
| 0.3 | 4.9 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
| 0.2 | 4.2 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.2 | 2.9 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.2 | 2.0 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.2 | 2.5 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
| 0.2 | 2.2 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.2 | 1.3 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.2 | 1.9 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
| 0.2 | 1.5 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.2 | 0.2 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
| 0.2 | 5.5 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
| 0.2 | 0.2 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.2 | 1.8 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
| 0.2 | 1.9 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
| 0.2 | 1.6 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.2 | 3.4 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.2 | 1.5 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
| 0.2 | 2.3 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.1 | 1.1 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
| 0.1 | 1.3 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
| 0.1 | 0.9 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
| 0.1 | 1.9 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.1 | 1.9 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
| 0.1 | 1.1 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
| 0.1 | 2.7 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
| 0.1 | 1.6 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.1 | 2.3 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.1 | 0.7 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
| 0.1 | 1.2 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
| 0.1 | 1.2 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF CAMKII | Genes involved in CREB phosphorylation through the activation of CaMKII |
| 0.1 | 2.1 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.1 | 2.4 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
| 0.1 | 2.5 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
| 0.1 | 1.0 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.1 | 0.9 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
| 0.1 | 0.2 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
| 0.1 | 1.9 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
| 0.1 | 1.3 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
| 0.1 | 1.7 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.1 | 1.2 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 0.1 | 0.6 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
| 0.1 | 0.3 | REACTOME AQUAPORIN MEDIATED TRANSPORT | Genes involved in Aquaporin-mediated transport |
| 0.1 | 2.2 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.1 | 1.2 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
| 0.1 | 0.2 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.1 | 0.6 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
| 0.1 | 1.5 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.1 | 0.2 | REACTOME SCFSKP2 MEDIATED DEGRADATION OF P27 P21 | Genes involved in SCF(Skp2)-mediated degradation of p27/p21 |
| 0.1 | 0.1 | REACTOME P53 DEPENDENT G1 DNA DAMAGE RESPONSE | Genes involved in p53-Dependent G1 DNA Damage Response |
| 0.1 | 0.2 | REACTOME INFLUENZA LIFE CYCLE | Genes involved in Influenza Life Cycle |
| 0.1 | 1.3 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.1 | 1.0 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.1 | 0.5 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.1 | 0.8 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
| 0.1 | 0.8 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
| 0.1 | 1.0 | REACTOME PHOSPHORYLATION OF THE APC C | Genes involved in Phosphorylation of the APC/C |
| 0.1 | 0.8 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.1 | 0.6 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
| 0.1 | 0.6 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 0.1 | 1.2 | REACTOME RESOLUTION OF AP SITES VIA THE MULTIPLE NUCLEOTIDE PATCH REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the multiple-nucleotide patch replacement pathway |
| 0.1 | 1.3 | REACTOME MRNA 3 END PROCESSING | Genes involved in mRNA 3'-end processing |
| 0.1 | 0.1 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.1 | 1.3 | REACTOME BIOLOGICAL OXIDATIONS | Genes involved in Biological oxidations |
| 0.1 | 0.7 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
| 0.1 | 0.6 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.1 | 1.2 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.1 | 0.1 | REACTOME KINESINS | Genes involved in Kinesins |
| 0.1 | 0.7 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.1 | 9.2 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
| 0.1 | 1.0 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
| 0.1 | 0.4 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
| 0.1 | 0.7 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.1 | 0.7 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
| 0.1 | 0.1 | REACTOME GAB1 SIGNALOSOME | Genes involved in GAB1 signalosome |
| 0.1 | 0.8 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.1 | 0.8 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.1 | 1.0 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
| 0.1 | 0.8 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
| 0.1 | 0.1 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
| 0.1 | 3.3 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
| 0.1 | 0.6 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.1 | 0.4 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
| 0.1 | 0.6 | REACTOME PURINE METABOLISM | Genes involved in Purine metabolism |
| 0.1 | 0.8 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
| 0.1 | 0.3 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
| 0.1 | 0.2 | REACTOME ADENYLATE CYCLASE INHIBITORY PATHWAY | Genes involved in Adenylate cyclase inhibitory pathway |
| 0.1 | 1.3 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.0 | 0.7 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.0 | 0.2 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
| 0.0 | 1.8 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
| 0.0 | 0.1 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
| 0.0 | 0.9 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
| 0.0 | 1.2 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
| 0.0 | 1.0 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
| 0.0 | 1.0 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.0 | 0.1 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.0 | 1.6 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
| 0.0 | 1.1 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
| 0.0 | 0.6 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 0.0 | 0.0 | REACTOME THROMBOXANE SIGNALLING THROUGH TP RECEPTOR | Genes involved in Thromboxane signalling through TP receptor |
| 0.0 | 1.0 | REACTOME SIGNALING BY ERBB4 | Genes involved in Signaling by ERBB4 |
| 0.0 | 0.4 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
| 0.0 | 1.8 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.0 | 0.0 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
| 0.0 | 0.4 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
| 0.0 | 0.3 | REACTOME DOUBLE STRAND BREAK REPAIR | Genes involved in Double-Strand Break Repair |
| 0.0 | 0.2 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
| 0.0 | 0.5 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
| 0.0 | 0.0 | REACTOME CDT1 ASSOCIATION WITH THE CDC6 ORC ORIGIN COMPLEX | Genes involved in CDT1 association with the CDC6:ORC:origin complex |
| 0.0 | 0.0 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
| 0.0 | 0.4 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.0 | 0.2 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.0 | 0.9 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
| 0.0 | 0.2 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
| 0.0 | 0.1 | REACTOME PROLONGED ERK ACTIVATION EVENTS | Genes involved in Prolonged ERK activation events |
| 0.0 | 0.3 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.0 | 2.6 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
| 0.0 | 0.6 | REACTOME TRANSCRIPTIONAL ACTIVITY OF SMAD2 SMAD3 SMAD4 HETEROTRIMER | Genes involved in Transcriptional activity of SMAD2/SMAD3:SMAD4 heterotrimer |
| 0.0 | 0.0 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
| 0.0 | 0.1 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
| 0.0 | 0.6 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
| 0.0 | 0.8 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
| 0.0 | 0.3 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
| 0.0 | 0.3 | REACTOME COSTIMULATION BY THE CD28 FAMILY | Genes involved in Costimulation by the CD28 family |
| 0.0 | 0.2 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
| 0.0 | 0.3 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.0 | 0.2 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF RAS | Genes involved in CREB phosphorylation through the activation of Ras |
| 0.0 | 0.0 | REACTOME PI3K EVENTS IN ERBB2 SIGNALING | Genes involved in PI3K events in ERBB2 signaling |
| 0.0 | 0.1 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
| 0.0 | 1.5 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
| 0.0 | 0.0 | REACTOME N GLYCAN TRIMMING IN THE ER AND CALNEXIN CALRETICULIN CYCLE | Genes involved in N-glycan trimming in the ER and Calnexin/Calreticulin cycle |
| 0.0 | 0.0 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
| 0.0 | 0.0 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
| 0.0 | 0.0 | REACTOME POST NMDA RECEPTOR ACTIVATION EVENTS | Genes involved in Post NMDA receptor activation events |
| 0.0 | 0.3 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
| 0.0 | 0.2 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
| 0.0 | 0.2 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.0 | 0.0 | REACTOME PI3K AKT ACTIVATION | Genes involved in PI3K/AKT activation |
| 0.0 | 0.0 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
| 0.0 | 0.7 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.0 | 0.0 | REACTOME TGF BETA RECEPTOR SIGNALING ACTIVATES SMADS | Genes involved in TGF-beta receptor signaling activates SMADs |
| 0.0 | 0.3 | REACTOME SIGNALING BY SCF KIT | Genes involved in Signaling by SCF-KIT |
| 0.0 | 0.4 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
| 0.0 | 0.4 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
| 0.0 | 1.0 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
| 0.0 | 0.3 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
| 0.0 | 0.4 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.0 | 0.2 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.0 | 0.4 | REACTOME SEMA4D IN SEMAPHORIN SIGNALING | Genes involved in Sema4D in semaphorin signaling |
| 0.0 | 0.1 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
| 0.0 | 0.2 | REACTOME CTLA4 INHIBITORY SIGNALING | Genes involved in CTLA4 inhibitory signaling |
| 0.0 | 0.0 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
| 0.0 | 0.4 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
| 0.0 | 0.3 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
| 0.0 | 0.2 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
| 0.0 | 0.6 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
| 0.0 | 0.1 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
| 0.0 | 0.2 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.0 | 0.3 | REACTOME CELL CYCLE CHECKPOINTS | Genes involved in Cell Cycle Checkpoints |
| 0.0 | 0.1 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
| 0.0 | 0.1 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
| 0.0 | 0.1 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
| 0.0 | 0.6 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.0 | 0.2 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.0 | 0.0 | REACTOME TRANSPORT OF MATURE TRANSCRIPT TO CYTOPLASM | Genes involved in Transport of Mature Transcript to Cytoplasm |
| 0.0 | 0.1 | REACTOME ACTIVATION OF IRF3 IRF7 MEDIATED BY TBK1 IKK EPSILON | Genes involved in Activation of IRF3/IRF7 mediated by TBK1/IKK epsilon |
| 0.0 | 0.1 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
| 0.0 | 0.1 | REACTOME OPSINS | Genes involved in Opsins |
| 0.0 | 0.0 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
| 0.0 | 0.1 | REACTOME SIGNAL TRANSDUCTION BY L1 | Genes involved in Signal transduction by L1 |
| 0.0 | 0.0 | REACTOME NEF MEDIATES DOWN MODULATION OF CELL SURFACE RECEPTORS BY RECRUITING THEM TO CLATHRIN ADAPTERS | Genes involved in Nef-mediates down modulation of cell surface receptors by recruiting them to clathrin adapters |
| 0.0 | 0.5 | REACTOME PPARA ACTIVATES GENE EXPRESSION | Genes involved in PPARA Activates Gene Expression |
| 0.0 | 0.1 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.0 | 0.1 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |