Gene Symbol | Gene ID | Gene Info |
---|---|---|
Isl1
|
ENSMUSG00000042258.7 | Isl1 |
Gene | Promoter | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Isl1 | chr13_116312233_116312403 | 2629 | 0.310554 | 0.79 | 6.3e-02 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr15_34500771_34501210 | 7.45 |
Pop1 |
processing of precursor 1, ribonuclease P/MRP family, (S. cerevisiae) |
5667 |
0.12 |
chr19_44399803_44399962 | 5.73 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
6808 |
0.15 |
chr1_162986828_162987029 | 3.61 |
Fmo3 |
flavin containing monooxygenase 3 |
2400 |
0.25 |
chr4_84548919_84549079 | 3.61 |
Bnc2 |
basonuclin 2 |
2380 |
0.42 |
chr8_93164567_93164980 | 3.59 |
Ces1d |
carboxylesterase 1D |
5202 |
0.15 |
chr8_93183570_93183871 | 3.31 |
Gm45909 |
predicted gene 45909 |
7638 |
0.14 |
chr15_59005379_59005677 | 3.17 |
4930544F09Rik |
RIKEN cDNA 4930544F09 gene |
21392 |
0.16 |
chr7_24927963_24928117 | 3.16 |
Arhgef1 |
Rho guanine nucleotide exchange factor (GEF) 1 |
4677 |
0.1 |
chr2_34775525_34776380 | 3.10 |
Hspa5 |
heat shock protein 5 |
1105 |
0.4 |
chr8_114150614_114151007 | 3.05 |
Nudt7 |
nudix (nucleoside diphosphate linked moiety X)-type motif 7 |
17168 |
0.25 |
chr1_67223699_67224148 | 2.96 |
Gm15668 |
predicted gene 15668 |
25277 |
0.19 |
chr15_3513860_3514011 | 2.93 |
Ghr |
growth hormone receptor |
42291 |
0.19 |
chr11_111996515_111996723 | 2.92 |
Gm11679 |
predicted gene 11679 |
46959 |
0.19 |
chr15_34501373_34501524 | 2.80 |
Pop1 |
processing of precursor 1, ribonuclease P/MRP family, (S. cerevisiae) |
6125 |
0.12 |
chr7_101085910_101086353 | 2.75 |
Fchsd2 |
FCH and double SH3 domains 2 |
6732 |
0.17 |
chr5_66094198_66094378 | 2.69 |
Rbm47 |
RNA binding motif protein 47 |
3903 |
0.15 |
chr19_43778712_43778869 | 2.67 |
Abcc2 |
ATP-binding cassette, sub-family C (CFTR/MRP), member 2 |
3402 |
0.18 |
chr2_130931353_130931504 | 2.64 |
Atrn |
attractin |
24497 |
0.11 |
chr19_40153747_40153898 | 2.64 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
33464 |
0.13 |
chr19_21480679_21480830 | 2.63 |
Gda |
guanine deaminase |
7309 |
0.26 |
chr1_56623913_56624064 | 2.63 |
Hsfy2 |
heat shock transcription factor, Y-linked 2 |
13447 |
0.28 |
chr1_44576462_44576616 | 2.59 |
Gm37626 |
predicted gene, 37626 |
15654 |
0.19 |
chr1_67233878_67234117 | 2.57 |
Gm15668 |
predicted gene 15668 |
15203 |
0.21 |
chr18_16664224_16664392 | 2.57 |
Cdh2 |
cadherin 2 |
5761 |
0.3 |
chr8_3048417_3048569 | 2.55 |
Gm44634 |
predicted gene 44634 |
7801 |
0.2 |
chr11_16808519_16808674 | 2.54 |
Egfros |
epidermal growth factor receptor, opposite strand |
22106 |
0.19 |
chr14_8035648_8035848 | 2.53 |
Abhd6 |
abhydrolase domain containing 6 |
32782 |
0.13 |
chr13_16574847_16575001 | 2.51 |
Gm48497 |
predicted gene, 48497 |
41103 |
0.17 |
chr2_84995821_84996178 | 2.50 |
Prg3 |
proteoglycan 3 |
7784 |
0.12 |
chr1_162891903_162892071 | 2.46 |
Fmo2 |
flavin containing monooxygenase 2 |
5472 |
0.19 |
chr12_24679446_24679817 | 2.40 |
Cys1 |
cystin 1 |
316 |
0.86 |
chr17_84650692_84651003 | 2.39 |
Dync2li1 |
dynein cytoplasmic 2 light intermediate chain 1 |
1572 |
0.29 |
chr11_28694681_28694832 | 2.37 |
2810471M01Rik |
RIKEN cDNA 2810471M01 gene |
13192 |
0.17 |
chr1_67185796_67186060 | 2.35 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
62902 |
0.11 |
chr6_66963164_66963414 | 2.35 |
Gm36816 |
predicted gene, 36816 |
45124 |
0.08 |
chr12_16536781_16536932 | 2.35 |
Lpin1 |
lipin 1 |
25182 |
0.22 |
chr9_103217995_103218146 | 2.33 |
Trf |
transferrin |
1796 |
0.31 |
chr5_151042731_151042918 | 2.30 |
Gm8675 |
predicted gene 8675 |
33523 |
0.17 |
chr7_97413837_97414007 | 2.29 |
Thrsp |
thyroid hormone responsive |
3597 |
0.16 |
chr11_79720137_79720288 | 2.28 |
Mir365-2 |
microRNA 365-2 |
6188 |
0.13 |
chr9_106231818_106232229 | 2.27 |
Alas1 |
aminolevulinic acid synthase 1 |
5061 |
0.11 |
chr8_93170915_93171066 | 2.26 |
Ces1d |
carboxylesterase 1D |
1015 |
0.44 |
chr19_12613616_12613767 | 2.25 |
Gm4952 |
predicted gene 4952 |
13675 |
0.09 |
chr6_129510240_129510426 | 2.23 |
Tmem52b |
transmembrane protein 52B |
2222 |
0.14 |
chr4_125391632_125391783 | 2.20 |
Grik3 |
glutamate receptor, ionotropic, kainate 3 |
98993 |
0.07 |
chr17_28451583_28451747 | 2.19 |
Gm22146 |
predicted gene, 22146 |
5165 |
0.11 |
chr9_74331100_74331251 | 2.18 |
Gm24141 |
predicted gene, 24141 |
31435 |
0.18 |
chr9_47348407_47348558 | 2.17 |
Gm31816 |
predicted gene, 31816 |
14268 |
0.26 |
chr12_16585344_16585551 | 2.17 |
Lpin1 |
lipin 1 |
4273 |
0.27 |
chr11_28696545_28697113 | 2.16 |
2810471M01Rik |
RIKEN cDNA 2810471M01 gene |
15265 |
0.17 |
chr3_112823445_112823641 | 2.15 |
Gm43587 |
predicted gene 43587 |
56531 |
0.16 |
chr3_116204045_116204241 | 2.15 |
Gm31651 |
predicted gene, 31651 |
3735 |
0.2 |
chr8_35383605_35384049 | 2.14 |
Ppp1r3b |
protein phosphatase 1, regulatory subunit 3B |
7167 |
0.17 |
chr12_104083020_104083260 | 2.14 |
Serpina4-ps1 |
serine (or cysteine) peptidase inhibitor, clade A, member 4, pseudogene 1 |
2491 |
0.16 |
chr10_87923338_87923500 | 2.13 |
Tyms-ps |
thymidylate synthase, pseudogene |
43428 |
0.12 |
chr1_23261263_23261446 | 2.12 |
Gm6420 |
predicted gene 6420 |
4947 |
0.13 |
chr10_4605446_4605660 | 2.11 |
Esr1 |
estrogen receptor 1 (alpha) |
6040 |
0.23 |
chr3_51226339_51227024 | 2.11 |
Noct |
nocturnin |
2211 |
0.23 |
chr3_149437041_149437628 | 2.11 |
Gm30382 |
predicted gene, 30382 |
7942 |
0.29 |
chr18_75371968_75372846 | 2.08 |
Smad7 |
SMAD family member 7 |
2431 |
0.3 |
chr1_70927826_70928016 | 2.08 |
Gm16236 |
predicted gene 16236 |
112109 |
0.07 |
chr12_100935982_100936133 | 2.08 |
A630072L19Rik |
RIKEN cDNA A630072L19 gene |
5685 |
0.13 |
chr8_36264838_36264990 | 2.08 |
Lonrf1 |
LON peptidase N-terminal domain and ring finger 1 |
15398 |
0.2 |
chr8_80983213_80983373 | 2.07 |
Gm9725 |
predicted gene 9725 |
30283 |
0.13 |
chr8_5106582_5106796 | 2.07 |
Slc10a2 |
solute carrier family 10, member 2 |
1338 |
0.42 |
chr14_21144535_21144690 | 2.07 |
Adk |
adenosine kinase |
68460 |
0.11 |
chr5_43309511_43309822 | 2.06 |
6030400A10Rik |
RIKEN cDNA 6030400A10 gene |
44509 |
0.11 |
chr8_36246171_36246329 | 2.06 |
Lonrf1 |
LON peptidase N-terminal domain and ring finger 1 |
3266 |
0.26 |
chr16_37630277_37630428 | 2.06 |
Hgd |
homogentisate 1, 2-dioxygenase |
8503 |
0.16 |
chr6_149133983_149134169 | 2.06 |
Gm10203 |
predicted gene 10203 |
3906 |
0.15 |
chr8_29133062_29133289 | 2.05 |
Svet1 |
subventricular expressed transcript 1 |
20399 |
0.19 |
chr3_18151182_18151333 | 2.05 |
Gm23686 |
predicted gene, 23686 |
26368 |
0.2 |
chr14_21114751_21114902 | 2.04 |
Adk |
adenosine kinase |
38674 |
0.17 |
chr13_9932808_9933042 | 2.04 |
Gm47406 |
predicted gene, 47406 |
40015 |
0.14 |
chr15_99033646_99034208 | 2.04 |
Tuba1c |
tubulin, alpha 1C |
3606 |
0.11 |
chr14_105125216_105125368 | 2.02 |
Rbm26 |
RNA binding motif protein 26 |
5045 |
0.2 |
chr7_119961473_119961651 | 2.02 |
Dnah3 |
dynein, axonemal, heavy chain 3 |
6280 |
0.16 |
chr17_87443321_87443472 | 2.01 |
Calm2 |
calmodulin 2 |
3452 |
0.15 |
chr14_86346221_86346400 | 2.00 |
Gm4350 |
predicted gene 4350 |
26025 |
0.13 |
chr1_51751367_51751637 | 1.99 |
Gm28055 |
predicted gene 28055 |
4559 |
0.23 |
chr6_23252645_23253334 | 1.99 |
C130093G08Rik |
RIKEN cDNA C130093G08 gene |
1856 |
0.32 |
chr9_122848915_122849207 | 1.98 |
Gm47140 |
predicted gene, 47140 |
643 |
0.55 |
chr1_172373715_172373866 | 1.97 |
Pigm |
phosphatidylinositol glycan anchor biosynthesis, class M |
2756 |
0.17 |
chr11_28702228_28702389 | 1.97 |
2810471M01Rik |
RIKEN cDNA 2810471M01 gene |
20744 |
0.15 |
chr15_34501595_34501764 | 1.96 |
Pop1 |
processing of precursor 1, ribonuclease P/MRP family, (S. cerevisiae) |
6356 |
0.12 |
chr9_106231317_106231582 | 1.96 |
Alas1 |
aminolevulinic acid synthase 1 |
5635 |
0.1 |
chr3_144110073_144110233 | 1.96 |
Gm34078 |
predicted gene, 34078 |
25601 |
0.2 |
chr9_65191450_65191617 | 1.95 |
Parp16 |
poly (ADP-ribose) polymerase family, member 16 |
3820 |
0.14 |
chr15_34501830_34501985 | 1.95 |
Pop1 |
processing of precursor 1, ribonuclease P/MRP family, (S. cerevisiae) |
6584 |
0.12 |
chr15_3107704_3107855 | 1.95 |
Gm49222 |
predicted gene, 49222 |
7830 |
0.21 |
chr19_26823641_26823967 | 1.93 |
4931403E22Rik |
RIKEN cDNA 4931403E22 gene |
103 |
0.97 |
chr14_34339389_34339887 | 1.93 |
Glud1 |
glutamate dehydrogenase 1 |
4266 |
0.12 |
chr6_108240862_108241030 | 1.93 |
Itpr1 |
inositol 1,4,5-trisphosphate receptor 1 |
12012 |
0.24 |
chr1_57342614_57342768 | 1.92 |
4930558J18Rik |
RIKEN cDNA 4930558J18 gene |
34853 |
0.12 |
chr12_34989363_34989548 | 1.92 |
Prps1l1 |
phosphoribosyl pyrophosphate synthetase 1-like 1 |
4694 |
0.24 |
chr11_77417847_77418056 | 1.91 |
Ssh2 |
slingshot protein phosphatase 2 |
26514 |
0.13 |
chr10_19471906_19472057 | 1.91 |
Gm33104 |
predicted gene, 33104 |
14734 |
0.21 |
chr8_5030377_5030626 | 1.91 |
n-R5s93 |
nuclear encoded rRNA 5S 93 |
38876 |
0.14 |
chr16_43234125_43234650 | 1.89 |
Zbtb20 |
zinc finger and BTB domain containing 20 |
1493 |
0.45 |
chr6_108667181_108667428 | 1.89 |
Bhlhe40 |
basic helix-loop-helix family, member e40 |
4258 |
0.19 |
chr12_57515437_57515691 | 1.89 |
Gm2568 |
predicted gene 2568 |
5060 |
0.18 |
chr4_48244997_48245148 | 1.88 |
Erp44 |
endoplasmic reticulum protein 44 |
598 |
0.76 |
chr1_67215139_67215608 | 1.88 |
Gm15668 |
predicted gene 15668 |
33827 |
0.17 |
chr1_107915528_107915771 | 1.88 |
D830032E09Rik |
RIKEN cDNA D830032E09 gene |
1610 |
0.39 |
chr14_55459733_55459946 | 1.88 |
Dhrs4 |
dehydrogenase/reductase (SDR family) member 4 |
18919 |
0.09 |
chr1_67207008_67207510 | 1.87 |
Gm15668 |
predicted gene 15668 |
41941 |
0.15 |
chr6_28491147_28491308 | 1.87 |
Snd1 |
staphylococcal nuclease and tudor domain containing 1 |
10798 |
0.14 |
chr4_6239539_6239806 | 1.87 |
Gm11798 |
predicted gene 11798 |
21293 |
0.18 |
chr5_72948525_72948751 | 1.86 |
Slain2 |
SLAIN motif family, member 2 |
139 |
0.94 |
chr10_67100073_67100416 | 1.86 |
Reep3 |
receptor accessory protein 3 |
3299 |
0.24 |
chr15_3401983_3402134 | 1.85 |
Ghr |
growth hormone receptor |
69586 |
0.11 |
chr1_67147521_67147887 | 1.84 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
24678 |
0.21 |
chr6_23392505_23392811 | 1.84 |
Cadps2 |
Ca2+-dependent activator protein for secretion 2 |
36739 |
0.19 |
chr13_115653330_115653690 | 1.84 |
Gm47892 |
predicted gene, 47892 |
65989 |
0.13 |
chr15_44689672_44690007 | 1.83 |
Sybu |
syntabulin (syntaxin-interacting) |
57949 |
0.11 |
chr3_100703342_100703518 | 1.81 |
Gm43464 |
predicted gene 43464 |
10724 |
0.14 |
chr7_73546578_73546953 | 1.81 |
1810026B05Rik |
RIKEN cDNA 1810026B05 gene |
100 |
0.94 |
chr16_37902225_37902391 | 1.81 |
Gpr156 |
G protein-coupled receptor 156 |
14188 |
0.14 |
chr16_62844854_62845005 | 1.81 |
Arl13b |
ADP-ribosylation factor-like 13B |
2064 |
0.28 |
chr4_59568064_59568258 | 1.81 |
Hsdl2 |
hydroxysteroid dehydrogenase like 2 |
13402 |
0.15 |
chr7_98356538_98356689 | 1.81 |
Tsku |
tsukushi, small leucine rich proteoglycan |
3466 |
0.22 |
chr10_120893774_120893931 | 1.81 |
Msrb3 |
methionine sulfoxide reductase B3 |
5249 |
0.15 |
chr13_63562151_63562325 | 1.80 |
Ptch1 |
patched 1 |
1577 |
0.3 |
chr2_128972020_128972207 | 1.80 |
Gm10762 |
predicted gene 10762 |
4069 |
0.12 |
chr19_5799580_5799736 | 1.80 |
Malat1 |
metastasis associated lung adenocarcinoma transcript 1 (non-coding RNA) |
2194 |
0.12 |
chr17_63195864_63196015 | 1.80 |
Gm24730 |
predicted gene, 24730 |
6799 |
0.29 |
chr6_31260950_31261295 | 1.80 |
2210408F21Rik |
RIKEN cDNA 2210408F21 gene |
16726 |
0.15 |
chr5_87589802_87589979 | 1.79 |
Sult1e1 |
sulfotransferase family 1E, member 1 |
1704 |
0.22 |
chr3_101572198_101572792 | 1.79 |
Atp1a1 |
ATPase, Na+/K+ transporting, alpha 1 polypeptide |
5065 |
0.19 |
chr2_71607777_71607946 | 1.79 |
Dlx2 |
distal-less homeobox 2 |
61107 |
0.09 |
chr2_132859056_132859242 | 1.79 |
Crls1 |
cardiolipin synthase 1 |
11411 |
0.13 |
chr3_111375833_111375988 | 1.79 |
Gm9314 |
predicted gene 9314 |
53053 |
0.18 |
chr3_94705046_94705225 | 1.79 |
Selenbp2 |
selenium binding protein 2 |
11476 |
0.11 |
chr1_67140900_67141469 | 1.78 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
18158 |
0.22 |
chr8_90953330_90953683 | 1.78 |
Chd9 |
chromodomain helicase DNA binding protein 9 |
1452 |
0.39 |
chr9_120944823_120944974 | 1.77 |
Ctnnb1 |
catenin (cadherin associated protein), beta 1 |
5323 |
0.12 |
chr5_100369426_100369577 | 1.77 |
Sec31a |
Sec31 homolog A (S. cerevisiae) |
3983 |
0.2 |
chr5_39163040_39163219 | 1.77 |
Gm40293 |
predicted gene, 40293 |
143955 |
0.04 |
chr13_37601794_37602225 | 1.76 |
Gm47753 |
predicted gene, 47753 |
19738 |
0.1 |
chr17_31155739_31155923 | 1.76 |
Gm15318 |
predicted gene 15318 |
3035 |
0.15 |
chr4_76942367_76942518 | 1.76 |
Gm11246 |
predicted gene 11246 |
15131 |
0.21 |
chr13_54563146_54563464 | 1.76 |
4833439L19Rik |
RIKEN cDNA 4833439L19 gene |
1986 |
0.19 |
chr15_7198099_7198411 | 1.76 |
Egflam |
EGF-like, fibronectin type III and laminin G domains |
24814 |
0.22 |
chr18_38856344_38856590 | 1.76 |
Fgf1 |
fibroblast growth factor 1 |
2281 |
0.33 |
chr9_74893395_74893777 | 1.75 |
Onecut1 |
one cut domain, family member 1 |
27102 |
0.13 |
chr14_25516269_25516433 | 1.75 |
Zmiz1 |
zinc finger, MIZ-type containing 1 |
13696 |
0.15 |
chr6_31260546_31260737 | 1.75 |
2210408F21Rik |
RIKEN cDNA 2210408F21 gene |
17207 |
0.15 |
chr13_75226827_75226978 | 1.74 |
Gm19095 |
predicted gene, 19095 |
27688 |
0.23 |
chr3_144203913_144204064 | 1.74 |
Lmo4 |
LIM domain only 4 |
1025 |
0.54 |
chr1_21248546_21248733 | 1.74 |
Gsta3 |
glutathione S-transferase, alpha 3 |
4882 |
0.13 |
chr5_122289450_122289732 | 1.73 |
Pptc7 |
PTC7 protein phosphatase homolog |
5226 |
0.12 |
chr8_109981175_109981347 | 1.73 |
Gm45795 |
predicted gene 45795 |
6909 |
0.13 |
chr1_191591538_191591710 | 1.73 |
Gm37349 |
predicted gene, 37349 |
6023 |
0.16 |
chr1_67217690_67217947 | 1.73 |
Gm15668 |
predicted gene 15668 |
31382 |
0.18 |
chr16_91678123_91678289 | 1.73 |
Donson |
downstream neighbor of SON |
3104 |
0.14 |
chr2_90955947_90956098 | 1.72 |
Celf1 |
CUGBP, Elav-like family member 1 |
9070 |
0.12 |
chr4_147903680_147903990 | 1.71 |
Mfn2 |
mitofusin 2 |
440 |
0.7 |
chr16_93346550_93346753 | 1.71 |
1810053B23Rik |
RIKEN cDNA 1810053B23 gene |
6538 |
0.19 |
chr14_101841283_101841436 | 1.70 |
Lmo7 |
LIM domain only 7 |
540 |
0.85 |
chr19_40138748_40138899 | 1.70 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
48463 |
0.1 |
chr9_24504187_24504390 | 1.70 |
Gm47772 |
predicted gene, 47772 |
839 |
0.5 |
chr4_76368947_76369220 | 1.70 |
Gm11252 |
predicted gene 11252 |
24071 |
0.2 |
chr1_127899545_127899941 | 1.70 |
Rab3gap1 |
RAB3 GTPase activating protein subunit 1 |
1170 |
0.47 |
chr8_93176962_93177159 | 1.70 |
Ces1d |
carboxylesterase 1D |
1771 |
0.27 |
chr7_114364360_114364662 | 1.70 |
4933406I18Rik |
RIKEN cDNA 4933406I18 gene |
50510 |
0.13 |
chr7_16639158_16639452 | 1.70 |
Gm29725 |
predicted gene, 29725 |
8484 |
0.09 |
chr11_120813788_120814608 | 1.69 |
Fasn |
fatty acid synthase |
1257 |
0.26 |
chr9_78212775_78213118 | 1.69 |
Gm3126 |
predicted gene 3126 |
1899 |
0.2 |
chr11_77363992_77364232 | 1.69 |
Ssh2 |
slingshot protein phosphatase 2 |
15824 |
0.18 |
chr19_12685349_12685500 | 1.69 |
Gm49772 |
predicted gene, 49772 |
3653 |
0.11 |
chr13_92050387_92050727 | 1.69 |
Rasgrf2 |
RAS protein-specific guanine nucleotide-releasing factor 2 |
19653 |
0.26 |
chr12_72625503_72625735 | 1.68 |
Gm4756 |
predicted gene 4756 |
3218 |
0.22 |
chr7_110123521_110123740 | 1.68 |
Wee1 |
WEE 1 homolog 1 (S. pombe) |
1584 |
0.28 |
chr15_62121397_62121548 | 1.68 |
Pvt1 |
Pvt1 oncogene |
22443 |
0.25 |
chr19_21654390_21654886 | 1.67 |
Abhd17b |
abhydrolase domain containing 17B |
1113 |
0.45 |
chr11_5900030_5900230 | 1.67 |
Myl7 |
myosin, light polypeptide 7, regulatory |
1348 |
0.27 |
chr10_127408250_127408460 | 1.67 |
Gm23819 |
predicted gene, 23819 |
3963 |
0.13 |
chr9_106785613_106786013 | 1.67 |
Rad54l2 |
RAD54 like 2 (S. cerevisiae) |
3363 |
0.19 |
chr8_40271825_40271984 | 1.67 |
Fgf20 |
fibroblast growth factor 20 |
15049 |
0.2 |
chr19_44405361_44405580 | 1.67 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
1220 |
0.39 |
chr5_92712191_92712483 | 1.66 |
Gm20500 |
predicted gene 20500 |
23868 |
0.15 |
chr12_54960526_54960699 | 1.66 |
Gm27014 |
predicted gene, 27014 |
2452 |
0.2 |
chr5_20858729_20858886 | 1.66 |
Phtf2 |
putative homeodomain transcription factor 2 |
3616 |
0.22 |
chr11_28699819_28700011 | 1.66 |
2810471M01Rik |
RIKEN cDNA 2810471M01 gene |
18351 |
0.16 |
chr15_7200411_7200562 | 1.66 |
Egflam |
EGF-like, fibronectin type III and laminin G domains |
22583 |
0.22 |
chr14_20984268_20984428 | 1.65 |
Vcl |
vinculin |
37655 |
0.15 |
chr6_51701080_51701325 | 1.65 |
Gm38811 |
predicted gene, 38811 |
9879 |
0.25 |
chr13_4190924_4191201 | 1.65 |
Akr1c13 |
aldo-keto reductase family 1, member C13 |
88 |
0.96 |
chr16_43168991_43169147 | 1.64 |
Gm15712 |
predicted gene 15712 |
15504 |
0.21 |
chr4_47366562_47366857 | 1.64 |
Tgfbr1 |
transforming growth factor, beta receptor I |
13099 |
0.22 |
chr3_51256576_51256727 | 1.63 |
Elf2 |
E74-like factor 2 |
3590 |
0.16 |
chr3_18157815_18158052 | 1.63 |
Gm23686 |
predicted gene, 23686 |
19692 |
0.22 |
chr5_49060180_49060366 | 1.63 |
Gm43047 |
predicted gene 43047 |
9730 |
0.1 |
chr5_40811186_40811352 | 1.63 |
Gm23022 |
predicted gene, 23022 |
405340 |
0.01 |
chr10_117693263_117693434 | 1.63 |
Mdm2 |
transformed mouse 3T3 cell double minute 2 |
1828 |
0.27 |
chr13_37603323_37603542 | 1.63 |
Gm47753 |
predicted gene, 47753 |
21161 |
0.1 |
chr1_10155656_10155807 | 1.63 |
Arfgef1 |
ADP-ribosylation factor guanine nucleotide-exchange factor 1(brefeldin A-inhibited) |
1201 |
0.46 |
chr17_43282615_43282766 | 1.62 |
Adgrf1 |
adhesion G protein-coupled receptor F1 |
12361 |
0.26 |
chr2_34778453_34778604 | 1.62 |
Hspa5 |
heat shock protein 5 |
3681 |
0.16 |
chr10_111336390_111336820 | 1.61 |
Gm40761 |
predicted gene, 40761 |
519 |
0.8 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.4 | 7.1 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
2.2 | 13.3 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
2.1 | 6.2 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
1.2 | 2.4 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
1.1 | 3.4 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
1.1 | 4.4 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
1.0 | 3.9 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
0.9 | 3.6 | GO:0006549 | isoleucine metabolic process(GO:0006549) |
0.8 | 2.5 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
0.8 | 3.1 | GO:0006538 | glutamate catabolic process(GO:0006538) |
0.8 | 1.5 | GO:2000809 | positive regulation of synaptic vesicle clustering(GO:2000809) |
0.7 | 5.1 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.7 | 2.1 | GO:0006068 | ethanol catabolic process(GO:0006068) |
0.6 | 2.6 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
0.6 | 2.5 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.6 | 2.5 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
0.6 | 2.5 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
0.6 | 1.9 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
0.6 | 1.9 | GO:0060523 | prostate epithelial cord elongation(GO:0060523) |
0.6 | 1.2 | GO:0046098 | guanine metabolic process(GO:0046098) |
0.6 | 1.8 | GO:0044337 | canonical Wnt signaling pathway involved in positive regulation of apoptotic process(GO:0044337) |
0.6 | 1.2 | GO:0071798 | response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
0.6 | 4.2 | GO:0070995 | NADPH oxidation(GO:0070995) |
0.6 | 1.7 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
0.6 | 1.7 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
0.5 | 3.8 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
0.5 | 1.6 | GO:0034310 | primary alcohol catabolic process(GO:0034310) |
0.5 | 1.6 | GO:0042851 | L-alanine metabolic process(GO:0042851) |
0.5 | 1.5 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
0.5 | 2.5 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
0.5 | 1.5 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
0.5 | 3.0 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.5 | 1.5 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.5 | 1.4 | GO:0035283 | central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
0.5 | 1.4 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
0.5 | 2.8 | GO:0021960 | anterior commissure morphogenesis(GO:0021960) |
0.5 | 2.8 | GO:1902222 | L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
0.5 | 4.1 | GO:0006707 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
0.5 | 1.8 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
0.4 | 1.3 | GO:2000611 | positive regulation of thyroid hormone generation(GO:2000611) |
0.4 | 1.7 | GO:0044791 | modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) |
0.4 | 0.4 | GO:0031086 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.4 | 1.3 | GO:1904017 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
0.4 | 0.9 | GO:0070672 | response to interleukin-15(GO:0070672) |
0.4 | 2.1 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
0.4 | 1.7 | GO:0018406 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
0.4 | 0.4 | GO:0010544 | negative regulation of platelet activation(GO:0010544) |
0.4 | 1.2 | GO:0070447 | positive regulation of oligodendrocyte progenitor proliferation(GO:0070447) |
0.4 | 0.8 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
0.4 | 0.4 | GO:0070627 | ferrous iron import(GO:0070627) |
0.4 | 2.0 | GO:0021780 | oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
0.4 | 1.2 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
0.4 | 1.2 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
0.4 | 1.2 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
0.4 | 0.8 | GO:1903371 | regulation of endoplasmic reticulum tubular network organization(GO:1903371) |
0.4 | 1.1 | GO:2000370 | positive regulation of clathrin-mediated endocytosis(GO:2000370) |
0.4 | 1.9 | GO:0006642 | triglyceride mobilization(GO:0006642) |
0.4 | 1.4 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
0.4 | 1.1 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.4 | 1.1 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.4 | 2.8 | GO:1901407 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
0.3 | 1.0 | GO:0009106 | lipoate metabolic process(GO:0009106) |
0.3 | 1.0 | GO:0034287 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
0.3 | 1.0 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
0.3 | 1.3 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
0.3 | 0.3 | GO:0003162 | atrioventricular node development(GO:0003162) |
0.3 | 0.3 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
0.3 | 1.0 | GO:0048290 | isotype switching to IgA isotypes(GO:0048290) regulation of isotype switching to IgA isotypes(GO:0048296) |
0.3 | 1.6 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
0.3 | 1.2 | GO:0032201 | telomere maintenance via semi-conservative replication(GO:0032201) |
0.3 | 1.2 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
0.3 | 1.5 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
0.3 | 0.3 | GO:0008089 | anterograde axonal transport(GO:0008089) |
0.3 | 0.9 | GO:0006553 | lysine metabolic process(GO:0006553) |
0.3 | 0.6 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
0.3 | 0.6 | GO:0000436 | carbon catabolite regulation of transcription from RNA polymerase II promoter(GO:0000429) regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) carbon catabolite activation of transcription from RNA polymerase II promoter(GO:0000436) |
0.3 | 0.9 | GO:0038095 | Fc-epsilon receptor signaling pathway(GO:0038095) |
0.3 | 0.6 | GO:0003331 | regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
0.3 | 0.9 | GO:0010963 | regulation of L-arginine import(GO:0010963) |
0.3 | 0.6 | GO:0021823 | cerebral cortex tangential migration using cell-cell interactions(GO:0021823) postnatal olfactory bulb interneuron migration(GO:0021827) |
0.3 | 0.9 | GO:0021699 | cerebellar cortex maturation(GO:0021699) |
0.3 | 1.2 | GO:0000957 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
0.3 | 0.9 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
0.3 | 0.9 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
0.3 | 0.9 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.3 | 0.9 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
0.3 | 0.8 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.3 | 0.3 | GO:0006106 | fumarate metabolic process(GO:0006106) |
0.3 | 0.8 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
0.3 | 1.7 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
0.3 | 1.1 | GO:0060431 | primary lung bud formation(GO:0060431) |
0.3 | 2.4 | GO:0006152 | purine nucleoside catabolic process(GO:0006152) purine ribonucleoside catabolic process(GO:0046130) |
0.3 | 0.8 | GO:0021943 | formation of radial glial scaffolds(GO:0021943) |
0.3 | 0.8 | GO:0061368 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
0.3 | 0.5 | GO:0032741 | positive regulation of interleukin-18 production(GO:0032741) |
0.3 | 1.0 | GO:1901300 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
0.3 | 0.8 | GO:0046271 | phenylpropanoid catabolic process(GO:0046271) |
0.3 | 0.8 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
0.2 | 1.0 | GO:1903011 | negative regulation of bone development(GO:1903011) |
0.2 | 0.5 | GO:0060839 | endothelial cell fate commitment(GO:0060839) |
0.2 | 0.5 | GO:0072131 | kidney mesenchyme morphogenesis(GO:0072131) metanephric mesenchyme morphogenesis(GO:0072133) |
0.2 | 1.0 | GO:0045541 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
0.2 | 0.2 | GO:0042524 | negative regulation of tyrosine phosphorylation of Stat5 protein(GO:0042524) |
0.2 | 2.4 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
0.2 | 2.1 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.2 | 0.5 | GO:0003213 | cardiac right atrium morphogenesis(GO:0003213) |
0.2 | 0.9 | GO:0030035 | microspike assembly(GO:0030035) |
0.2 | 0.7 | GO:0071926 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
0.2 | 1.4 | GO:0016078 | tRNA catabolic process(GO:0016078) |
0.2 | 0.4 | GO:0002215 | defense response to nematode(GO:0002215) |
0.2 | 0.9 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
0.2 | 0.4 | GO:0036023 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) |
0.2 | 0.2 | GO:0046083 | adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
0.2 | 0.4 | GO:0002282 | microglial cell activation involved in immune response(GO:0002282) |
0.2 | 0.4 | GO:0090110 | cargo loading into COPII-coated vesicle(GO:0090110) |
0.2 | 0.7 | GO:0071866 | regulation of apoptotic process in bone marrow(GO:0071865) negative regulation of apoptotic process in bone marrow(GO:0071866) |
0.2 | 0.9 | GO:0045950 | negative regulation of mitotic recombination(GO:0045950) |
0.2 | 0.9 | GO:0046618 | drug export(GO:0046618) |
0.2 | 0.6 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
0.2 | 0.6 | GO:0035754 | B cell chemotaxis(GO:0035754) |
0.2 | 1.0 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
0.2 | 1.0 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
0.2 | 0.2 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
0.2 | 1.4 | GO:0042759 | long-chain fatty acid biosynthetic process(GO:0042759) |
0.2 | 0.4 | GO:0046104 | thymidine metabolic process(GO:0046104) |
0.2 | 0.8 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
0.2 | 0.6 | GO:0061084 | negative regulation of protein refolding(GO:0061084) |
0.2 | 0.6 | GO:0090188 | negative regulation of pancreatic juice secretion(GO:0090188) |
0.2 | 1.6 | GO:0008090 | retrograde axonal transport(GO:0008090) |
0.2 | 0.4 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
0.2 | 0.6 | GO:0006768 | biotin metabolic process(GO:0006768) |
0.2 | 0.2 | GO:0010958 | regulation of amino acid import(GO:0010958) |
0.2 | 0.6 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
0.2 | 1.2 | GO:0015871 | choline transport(GO:0015871) |
0.2 | 0.8 | GO:0035627 | ceramide transport(GO:0035627) |
0.2 | 0.6 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
0.2 | 2.4 | GO:0010801 | negative regulation of peptidyl-threonine phosphorylation(GO:0010801) |
0.2 | 1.2 | GO:1904847 | cell chemotaxis to fibroblast growth factor(GO:0035766) endothelial cell chemotaxis to fibroblast growth factor(GO:0035768) regulation of cell chemotaxis to fibroblast growth factor(GO:1904847) regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000544) |
0.2 | 0.8 | GO:0061641 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
0.2 | 0.6 | GO:1901339 | regulation of store-operated calcium channel activity(GO:1901339) |
0.2 | 0.2 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
0.2 | 0.6 | GO:0006848 | pyruvate transport(GO:0006848) pyruvate transmembrane transport(GO:1901475) |
0.2 | 0.6 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
0.2 | 0.4 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
0.2 | 5.0 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
0.2 | 0.6 | GO:0032058 | positive regulation of translational initiation in response to stress(GO:0032058) |
0.2 | 0.6 | GO:0032439 | endosome localization(GO:0032439) |
0.2 | 1.0 | GO:0032237 | activation of store-operated calcium channel activity(GO:0032237) |
0.2 | 0.6 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
0.2 | 0.6 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
0.2 | 1.1 | GO:0015074 | DNA integration(GO:0015074) |
0.2 | 0.4 | GO:0060355 | positive regulation of cell adhesion molecule production(GO:0060355) |
0.2 | 1.3 | GO:0036089 | cleavage furrow formation(GO:0036089) |
0.2 | 0.9 | GO:0015867 | ATP transport(GO:0015867) |
0.2 | 1.5 | GO:0048194 | Golgi vesicle budding(GO:0048194) |
0.2 | 0.6 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
0.2 | 0.9 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
0.2 | 0.4 | GO:0014732 | skeletal muscle atrophy(GO:0014732) |
0.2 | 1.5 | GO:0043651 | linoleic acid metabolic process(GO:0043651) |
0.2 | 0.5 | GO:0045583 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
0.2 | 1.6 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
0.2 | 1.5 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
0.2 | 0.4 | GO:1900045 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
0.2 | 0.7 | GO:0040034 | regulation of development, heterochronic(GO:0040034) |
0.2 | 0.5 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
0.2 | 2.7 | GO:0031116 | positive regulation of microtubule polymerization(GO:0031116) |
0.2 | 0.5 | GO:0045416 | positive regulation of interleukin-8 biosynthetic process(GO:0045416) |
0.2 | 0.9 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
0.2 | 0.5 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
0.2 | 0.9 | GO:0046085 | adenosine metabolic process(GO:0046085) |
0.2 | 0.5 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
0.2 | 0.3 | GO:0035973 | aggrephagy(GO:0035973) |
0.2 | 0.3 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) |
0.2 | 0.9 | GO:0042436 | tryptophan catabolic process(GO:0006569) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) |
0.2 | 0.7 | GO:0018243 | protein O-linked glycosylation via threonine(GO:0018243) |
0.2 | 0.5 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
0.2 | 0.5 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.2 | 0.7 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
0.2 | 0.2 | GO:1900425 | negative regulation of defense response to bacterium(GO:1900425) |
0.2 | 0.5 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
0.2 | 0.2 | GO:0052695 | cellular glucuronidation(GO:0052695) |
0.2 | 1.2 | GO:0045908 | negative regulation of vasodilation(GO:0045908) |
0.2 | 0.7 | GO:0071455 | cellular response to increased oxygen levels(GO:0036295) cellular response to hyperoxia(GO:0071455) |
0.2 | 0.2 | GO:0072309 | mesenchymal stem cell maintenance involved in metanephric nephron morphogenesis(GO:0072309) |
0.2 | 0.2 | GO:0002434 | immune complex clearance(GO:0002434) |
0.2 | 0.8 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.2 | 0.5 | GO:0006573 | valine metabolic process(GO:0006573) |
0.2 | 0.5 | GO:0048143 | astrocyte activation(GO:0048143) |
0.2 | 1.3 | GO:0090051 | negative regulation of cell migration involved in sprouting angiogenesis(GO:0090051) |
0.2 | 1.1 | GO:0006265 | DNA topological change(GO:0006265) |
0.2 | 2.8 | GO:0043586 | tongue development(GO:0043586) |
0.2 | 0.5 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
0.2 | 0.6 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.2 | 0.6 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.2 | 0.3 | GO:0010727 | negative regulation of hydrogen peroxide metabolic process(GO:0010727) |
0.2 | 0.5 | GO:0060447 | bud outgrowth involved in lung branching(GO:0060447) |
0.2 | 0.5 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.2 | 0.3 | GO:0090315 | negative regulation of protein targeting to membrane(GO:0090315) |
0.2 | 1.1 | GO:0002072 | optic cup morphogenesis involved in camera-type eye development(GO:0002072) |
0.2 | 0.3 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
0.2 | 0.8 | GO:0071476 | cellular hypotonic response(GO:0071476) |
0.2 | 0.8 | GO:1904970 | brush border assembly(GO:1904970) |
0.2 | 0.2 | GO:1903061 | positive regulation of protein lipidation(GO:1903061) |
0.2 | 0.8 | GO:0015781 | nucleotide-sugar transport(GO:0015780) pyrimidine nucleotide-sugar transport(GO:0015781) |
0.2 | 0.3 | GO:0035672 | oligopeptide transmembrane transport(GO:0035672) |
0.2 | 1.4 | GO:0006855 | drug transmembrane transport(GO:0006855) |
0.2 | 0.2 | GO:0010046 | response to mycotoxin(GO:0010046) |
0.2 | 0.5 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
0.2 | 0.6 | GO:0032055 | negative regulation of translation in response to stress(GO:0032055) |
0.2 | 0.2 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
0.2 | 0.5 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.2 | 0.3 | GO:0043091 | L-arginine import(GO:0043091) arginine import(GO:0090467) L-arginine transport(GO:1902023) |
0.2 | 0.5 | GO:0009157 | deoxyribonucleoside monophosphate biosynthetic process(GO:0009157) pyrimidine deoxyribonucleoside monophosphate biosynthetic process(GO:0009177) |
0.2 | 0.6 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
0.2 | 0.5 | GO:1904502 | regulation of lipophagy(GO:1904502) positive regulation of lipophagy(GO:1904504) |
0.2 | 1.1 | GO:0060020 | Bergmann glial cell differentiation(GO:0060020) |
0.2 | 0.3 | GO:0002154 | thyroid hormone mediated signaling pathway(GO:0002154) |
0.2 | 1.5 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
0.2 | 1.1 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.2 | 0.2 | GO:1904742 | regulation of telomeric DNA binding(GO:1904742) |
0.2 | 0.9 | GO:0061042 | vascular wound healing(GO:0061042) |
0.2 | 0.5 | GO:1903347 | negative regulation of bicellular tight junction assembly(GO:1903347) |
0.2 | 1.7 | GO:0071380 | cellular response to prostaglandin E stimulus(GO:0071380) |
0.1 | 0.4 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
0.1 | 0.6 | GO:0006531 | aspartate metabolic process(GO:0006531) |
0.1 | 0.4 | GO:1903849 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
0.1 | 0.3 | GO:0061643 | chemorepulsion of axon(GO:0061643) |
0.1 | 0.9 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
0.1 | 0.3 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
0.1 | 0.9 | GO:0086013 | membrane repolarization during cardiac muscle cell action potential(GO:0086013) |
0.1 | 0.3 | GO:0046066 | purine deoxyribonucleoside diphosphate metabolic process(GO:0009182) dGDP metabolic process(GO:0046066) |
0.1 | 0.6 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
0.1 | 0.3 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
0.1 | 0.1 | GO:0046322 | negative regulation of fatty acid oxidation(GO:0046322) |
0.1 | 1.7 | GO:0003334 | keratinocyte development(GO:0003334) |
0.1 | 2.4 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
0.1 | 0.7 | GO:0060501 | positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
0.1 | 0.3 | GO:0072361 | regulation of glycolytic process by regulation of transcription from RNA polymerase II promoter(GO:0072361) |
0.1 | 1.0 | GO:0006655 | phosphatidylglycerol biosynthetic process(GO:0006655) |
0.1 | 0.3 | GO:0086023 | adrenergic receptor signaling pathway involved in heart process(GO:0086023) |
0.1 | 0.4 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
0.1 | 0.3 | GO:0060591 | chondroblast differentiation(GO:0060591) |
0.1 | 0.6 | GO:0009414 | response to water deprivation(GO:0009414) |
0.1 | 0.3 | GO:0071374 | cellular response to parathyroid hormone stimulus(GO:0071374) |
0.1 | 0.4 | GO:0090148 | membrane fission(GO:0090148) |
0.1 | 0.6 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
0.1 | 0.4 | GO:1901492 | positive regulation of lymphangiogenesis(GO:1901492) |
0.1 | 0.4 | GO:0070782 | phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
0.1 | 1.5 | GO:0046686 | response to cadmium ion(GO:0046686) |
0.1 | 1.5 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
0.1 | 0.8 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
0.1 | 0.7 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
0.1 | 0.1 | GO:0006545 | glycine biosynthetic process(GO:0006545) |
0.1 | 0.4 | GO:0046469 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
0.1 | 1.2 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
0.1 | 2.5 | GO:0006783 | heme biosynthetic process(GO:0006783) |
0.1 | 0.1 | GO:0042706 | eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
0.1 | 0.5 | GO:0006048 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
0.1 | 0.3 | GO:1903689 | regulation of wound healing, spreading of epidermal cells(GO:1903689) |
0.1 | 1.1 | GO:0009435 | NAD biosynthetic process(GO:0009435) |
0.1 | 0.9 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.1 | 0.3 | GO:0007529 | establishment of synaptic specificity at neuromuscular junction(GO:0007529) |
0.1 | 0.4 | GO:0039689 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
0.1 | 0.3 | GO:0051503 | adenine nucleotide transport(GO:0051503) |
0.1 | 0.3 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
0.1 | 0.4 | GO:0021882 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) |
0.1 | 2.0 | GO:0017144 | drug metabolic process(GO:0017144) |
0.1 | 0.4 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.1 | 0.3 | GO:1901740 | negative regulation of myoblast fusion(GO:1901740) |
0.1 | 0.4 | GO:1903237 | negative regulation of leukocyte tethering or rolling(GO:1903237) negative regulation of leukocyte adhesion to vascular endothelial cell(GO:1904995) |
0.1 | 0.4 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
0.1 | 0.4 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
0.1 | 1.9 | GO:0060765 | regulation of androgen receptor signaling pathway(GO:0060765) |
0.1 | 0.5 | GO:0048597 | post-embryonic camera-type eye morphogenesis(GO:0048597) |
0.1 | 0.7 | GO:1903961 | positive regulation of anion transmembrane transport(GO:1903961) |
0.1 | 0.2 | GO:0060750 | epithelial cell proliferation involved in mammary gland duct elongation(GO:0060750) |
0.1 | 0.4 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
0.1 | 1.4 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
0.1 | 1.0 | GO:0097033 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
0.1 | 0.4 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
0.1 | 0.4 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
0.1 | 0.2 | GO:0071394 | cellular response to testosterone stimulus(GO:0071394) |
0.1 | 0.5 | GO:1990874 | regulation of vascular smooth muscle cell proliferation(GO:1904705) vascular smooth muscle cell proliferation(GO:1990874) |
0.1 | 0.2 | GO:0035509 | negative regulation of myosin-light-chain-phosphatase activity(GO:0035509) |
0.1 | 1.5 | GO:0071545 | inositol phosphate catabolic process(GO:0071545) |
0.1 | 0.5 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
0.1 | 0.4 | GO:1903799 | negative regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903799) |
0.1 | 0.7 | GO:0051639 | actin filament network formation(GO:0051639) |
0.1 | 1.0 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
0.1 | 0.4 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
0.1 | 0.8 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
0.1 | 0.5 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
0.1 | 0.6 | GO:2000643 | positive regulation of early endosome to late endosome transport(GO:2000643) |
0.1 | 0.7 | GO:0043247 | protection from non-homologous end joining at telomere(GO:0031848) telomere maintenance in response to DNA damage(GO:0043247) |
0.1 | 0.5 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
0.1 | 0.1 | GO:0048254 | snoRNA localization(GO:0048254) |
0.1 | 0.5 | GO:1903069 | regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903069) |
0.1 | 0.4 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
0.1 | 0.1 | GO:0006290 | pyrimidine dimer repair(GO:0006290) |
0.1 | 1.3 | GO:0006465 | signal peptide processing(GO:0006465) |
0.1 | 0.4 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
0.1 | 0.2 | GO:0045726 | positive regulation of integrin biosynthetic process(GO:0045726) |
0.1 | 0.1 | GO:0045917 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
0.1 | 0.2 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
0.1 | 0.9 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
0.1 | 0.3 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.1 | 0.6 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
0.1 | 0.2 | GO:0090267 | positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
0.1 | 0.1 | GO:0006069 | ethanol metabolic process(GO:0006067) ethanol oxidation(GO:0006069) |
0.1 | 0.1 | GO:0003358 | noradrenergic neuron development(GO:0003358) |
0.1 | 1.0 | GO:0000103 | sulfate assimilation(GO:0000103) |
0.1 | 0.2 | GO:0006562 | proline catabolic process(GO:0006562) |
0.1 | 0.5 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
0.1 | 1.0 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
0.1 | 0.6 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
0.1 | 0.3 | GO:0000467 | exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) |
0.1 | 0.3 | GO:0043201 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
0.1 | 0.2 | GO:2001270 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) |
0.1 | 0.3 | GO:1904469 | positive regulation of tumor necrosis factor secretion(GO:1904469) |
0.1 | 0.3 | GO:0034214 | protein hexamerization(GO:0034214) |
0.1 | 1.1 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.1 | 0.5 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
0.1 | 0.1 | GO:0010288 | response to lead ion(GO:0010288) |
0.1 | 0.4 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
0.1 | 0.5 | GO:0046512 | diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
0.1 | 0.3 | GO:0015747 | urate transport(GO:0015747) |
0.1 | 0.5 | GO:0050684 | regulation of mRNA processing(GO:0050684) |
0.1 | 1.2 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
0.1 | 0.8 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
0.1 | 0.2 | GO:0006930 | substrate-dependent cell migration, cell extension(GO:0006930) |
0.1 | 0.4 | GO:1900127 | positive regulation of hyaluronan biosynthetic process(GO:1900127) |
0.1 | 0.5 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
0.1 | 0.1 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
0.1 | 0.4 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
0.1 | 0.2 | GO:0018197 | peptidyl-aspartic acid modification(GO:0018197) |
0.1 | 0.2 | GO:0042723 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
0.1 | 0.2 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
0.1 | 0.3 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
0.1 | 0.2 | GO:1903337 | positive regulation of vacuolar transport(GO:1903337) |
0.1 | 0.1 | GO:0061626 | pharyngeal arch artery morphogenesis(GO:0061626) |
0.1 | 0.6 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
0.1 | 0.1 | GO:0003184 | pulmonary valve development(GO:0003177) pulmonary valve morphogenesis(GO:0003184) |
0.1 | 0.2 | GO:0030948 | negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
0.1 | 0.3 | GO:0070102 | interleukin-6-mediated signaling pathway(GO:0070102) |
0.1 | 1.2 | GO:0021514 | ventral spinal cord interneuron differentiation(GO:0021514) |
0.1 | 2.2 | GO:0009812 | flavonoid metabolic process(GO:0009812) |
0.1 | 0.6 | GO:2000095 | regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000095) |
0.1 | 0.2 | GO:0048382 | mesendoderm development(GO:0048382) |
0.1 | 0.7 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
0.1 | 0.3 | GO:1990168 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
0.1 | 0.3 | GO:0046005 | positive regulation of circadian sleep/wake cycle, REM sleep(GO:0046005) |
0.1 | 0.2 | GO:0070947 | neutrophil mediated killing of fungus(GO:0070947) |
0.1 | 1.4 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.1 | 0.3 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
0.1 | 0.8 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.1 | 0.2 | GO:0072092 | ureteric bud invasion(GO:0072092) metanephric renal vesicle formation(GO:0072093) |
0.1 | 0.3 | GO:2000562 | negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
0.1 | 2.1 | GO:0006376 | mRNA splice site selection(GO:0006376) |
0.1 | 0.3 | GO:0032788 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
0.1 | 0.3 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) |
0.1 | 0.2 | GO:0060164 | regulation of timing of neuron differentiation(GO:0060164) |
0.1 | 0.2 | GO:0035457 | cellular response to interferon-alpha(GO:0035457) |
0.1 | 0.3 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
0.1 | 0.3 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
0.1 | 0.2 | GO:0051593 | response to folic acid(GO:0051593) |
0.1 | 0.1 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
0.1 | 0.6 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
0.1 | 0.2 | GO:1900747 | negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) |
0.1 | 0.3 | GO:0021873 | forebrain neuroblast division(GO:0021873) |
0.1 | 0.3 | GO:0038031 | non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
0.1 | 0.1 | GO:0009756 | carbohydrate mediated signaling(GO:0009756) hexose mediated signaling(GO:0009757) sugar mediated signaling pathway(GO:0010182) glucose mediated signaling pathway(GO:0010255) |
0.1 | 0.6 | GO:0006477 | protein sulfation(GO:0006477) |
0.1 | 0.5 | GO:0042448 | progesterone metabolic process(GO:0042448) |
0.1 | 0.1 | GO:1903935 | response to sodium arsenite(GO:1903935) |
0.1 | 0.4 | GO:0048014 | Tie signaling pathway(GO:0048014) |
0.1 | 0.4 | GO:0072488 | ammonium transmembrane transport(GO:0072488) |
0.1 | 2.4 | GO:0000186 | activation of MAPKK activity(GO:0000186) |
0.1 | 1.3 | GO:0071353 | cellular response to interleukin-4(GO:0071353) |
0.1 | 0.6 | GO:0001842 | neural fold formation(GO:0001842) |
0.1 | 0.3 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
0.1 | 1.1 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
0.1 | 0.4 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
0.1 | 0.4 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
0.1 | 0.6 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
0.1 | 0.3 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
0.1 | 0.4 | GO:0080009 | mRNA methylation(GO:0080009) |
0.1 | 0.3 | GO:0045048 | protein insertion into ER membrane(GO:0045048) tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
0.1 | 0.5 | GO:0060742 | epithelial cell differentiation involved in prostate gland development(GO:0060742) |
0.1 | 0.4 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
0.1 | 0.2 | GO:0006551 | leucine metabolic process(GO:0006551) |
0.1 | 0.7 | GO:0046069 | cGMP catabolic process(GO:0046069) |
0.1 | 0.3 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
0.1 | 0.5 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
0.1 | 0.2 | GO:1990928 | response to amino acid starvation(GO:1990928) |
0.1 | 0.1 | GO:0021553 | olfactory nerve development(GO:0021553) |
0.1 | 0.6 | GO:0019348 | dolichol metabolic process(GO:0019348) |
0.1 | 0.5 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
0.1 | 0.7 | GO:1900363 | regulation of mRNA polyadenylation(GO:1900363) |
0.1 | 0.3 | GO:0008050 | female courtship behavior(GO:0008050) |
0.1 | 0.2 | GO:1903972 | regulation of macrophage colony-stimulating factor signaling pathway(GO:1902226) regulation of response to macrophage colony-stimulating factor(GO:1903969) regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903972) |
0.1 | 0.3 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
0.1 | 0.5 | GO:0045046 | peroxisomal membrane transport(GO:0015919) protein import into peroxisome membrane(GO:0045046) |
0.1 | 0.4 | GO:0051001 | negative regulation of nitric-oxide synthase activity(GO:0051001) |
0.1 | 1.1 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
0.1 | 4.2 | GO:0045454 | cell redox homeostasis(GO:0045454) |
0.1 | 0.1 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
0.1 | 0.1 | GO:0002091 | negative regulation of receptor internalization(GO:0002091) |
0.1 | 0.3 | GO:0071280 | cellular response to copper ion(GO:0071280) |
0.1 | 0.3 | GO:0009249 | protein lipoylation(GO:0009249) |
0.1 | 0.7 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
0.1 | 0.2 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
0.1 | 0.2 | GO:1903912 | regulation of translation in response to endoplasmic reticulum stress(GO:0036490) regulation of translation initiation in response to endoplasmic reticulum stress(GO:0036491) eiF2alpha phosphorylation in response to endoplasmic reticulum stress(GO:0036492) negative regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:1903912) |
0.1 | 0.7 | GO:0097340 | inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
0.1 | 0.4 | GO:0048318 | axial mesoderm development(GO:0048318) |
0.1 | 0.1 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
0.1 | 0.6 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
0.1 | 0.7 | GO:0030325 | adrenal gland development(GO:0030325) |
0.1 | 0.7 | GO:0060628 | regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
0.1 | 0.4 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.1 | 0.3 | GO:0044598 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.1 | 0.4 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
0.1 | 0.6 | GO:0007638 | mechanosensory behavior(GO:0007638) |
0.1 | 0.2 | GO:0070669 | response to interleukin-2(GO:0070669) |
0.1 | 0.2 | GO:1903677 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
0.1 | 0.2 | GO:0050955 | thermoception(GO:0050955) |
0.1 | 0.1 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
0.1 | 0.7 | GO:0008343 | adult feeding behavior(GO:0008343) |
0.1 | 1.7 | GO:0006805 | xenobiotic metabolic process(GO:0006805) |
0.1 | 0.5 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.1 | 0.2 | GO:2000409 | positive regulation of T cell extravasation(GO:2000409) |
0.1 | 0.2 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
0.1 | 0.4 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
0.1 | 0.6 | GO:0045631 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
0.1 | 0.3 | GO:0015791 | polyol transport(GO:0015791) |
0.1 | 0.1 | GO:0036476 | neuron death in response to hydrogen peroxide(GO:0036476) regulation of hydrogen peroxide-induced neuron death(GO:1903207) negative regulation of hydrogen peroxide-induced neuron death(GO:1903208) |
0.1 | 0.4 | GO:0042532 | negative regulation of tyrosine phosphorylation of STAT protein(GO:0042532) |
0.1 | 0.2 | GO:0070189 | kynurenine metabolic process(GO:0070189) |
0.1 | 0.1 | GO:0033184 | positive regulation of histone ubiquitination(GO:0033184) |
0.1 | 0.1 | GO:0006449 | regulation of translational termination(GO:0006449) |
0.1 | 0.1 | GO:0045764 | positive regulation of cellular amino acid metabolic process(GO:0045764) |
0.1 | 0.7 | GO:0002084 | protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
0.1 | 0.5 | GO:0030836 | positive regulation of actin filament depolymerization(GO:0030836) |
0.1 | 0.2 | GO:0030421 | defecation(GO:0030421) |
0.1 | 0.3 | GO:0032532 | regulation of microvillus length(GO:0032532) |
0.1 | 0.2 | GO:0006570 | tyrosine metabolic process(GO:0006570) |
0.1 | 0.2 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
0.1 | 0.2 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
0.1 | 0.1 | GO:0032786 | positive regulation of DNA-templated transcription, elongation(GO:0032786) |
0.1 | 0.7 | GO:0006517 | protein deglycosylation(GO:0006517) |
0.1 | 0.7 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
0.1 | 0.2 | GO:1903977 | positive regulation of glial cell migration(GO:1903977) |
0.1 | 0.7 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
0.1 | 0.2 | GO:1903416 | response to glycoside(GO:1903416) |
0.1 | 1.1 | GO:0045742 | positive regulation of epidermal growth factor receptor signaling pathway(GO:0045742) |
0.1 | 0.3 | GO:0031999 | negative regulation of fatty acid beta-oxidation(GO:0031999) |
0.1 | 0.2 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
0.1 | 0.2 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
0.1 | 0.6 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
0.1 | 0.6 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
0.1 | 0.1 | GO:0060596 | mammary placode formation(GO:0060596) |
0.1 | 0.2 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
0.1 | 0.8 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
0.1 | 0.4 | GO:0010804 | negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
0.1 | 0.3 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
0.1 | 0.6 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.1 | 0.2 | GO:0046471 | cardiolipin metabolic process(GO:0032048) phosphatidylglycerol metabolic process(GO:0046471) |
0.1 | 0.2 | GO:0010040 | response to iron(II) ion(GO:0010040) |
0.1 | 0.2 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
0.1 | 0.3 | GO:0051697 | protein delipidation(GO:0051697) |
0.1 | 0.2 | GO:0008611 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) cellular lipid biosynthetic process(GO:0097384) ether biosynthetic process(GO:1901503) |
0.1 | 0.3 | GO:2000973 | regulation of pro-B cell differentiation(GO:2000973) |
0.1 | 0.3 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
0.1 | 0.5 | GO:0015824 | proline transport(GO:0015824) |
0.1 | 0.2 | GO:0060468 | prevention of polyspermy(GO:0060468) |
0.1 | 0.3 | GO:0046146 | tetrahydrobiopterin metabolic process(GO:0046146) |
0.1 | 0.4 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
0.1 | 0.2 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
0.1 | 2.6 | GO:0009166 | nucleotide catabolic process(GO:0009166) |
0.1 | 0.6 | GO:0042795 | snRNA transcription from RNA polymerase II promoter(GO:0042795) |
0.1 | 0.2 | GO:1901857 | positive regulation of cellular respiration(GO:1901857) |
0.1 | 0.5 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
0.1 | 0.1 | GO:0036499 | PERK-mediated unfolded protein response(GO:0036499) |
0.1 | 0.5 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
0.1 | 0.2 | GO:0016584 | nucleosome positioning(GO:0016584) |
0.1 | 0.1 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
0.1 | 0.4 | GO:0045793 | positive regulation of cell size(GO:0045793) |
0.1 | 0.1 | GO:0071360 | cellular response to exogenous dsRNA(GO:0071360) |
0.1 | 0.4 | GO:0070922 | small RNA loading onto RISC(GO:0070922) |
0.1 | 0.3 | GO:0002043 | blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:0002043) |
0.1 | 0.2 | GO:0001555 | oocyte growth(GO:0001555) |
0.1 | 1.0 | GO:0019430 | removal of superoxide radicals(GO:0019430) |
0.1 | 0.4 | GO:0061051 | positive regulation of cell growth involved in cardiac muscle cell development(GO:0061051) |
0.1 | 0.4 | GO:0048934 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
0.1 | 0.1 | GO:1902031 | regulation of NADP metabolic process(GO:1902031) |
0.1 | 0.4 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
0.1 | 0.1 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
0.1 | 0.4 | GO:0047484 | regulation of response to osmotic stress(GO:0047484) |
0.1 | 0.6 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
0.1 | 0.1 | GO:1903753 | negative regulation of p38MAPK cascade(GO:1903753) |
0.1 | 1.1 | GO:0008053 | mitochondrial fusion(GO:0008053) |
0.1 | 0.1 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
0.1 | 0.4 | GO:0098728 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
0.1 | 0.3 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.1 | 0.6 | GO:0045161 | neuronal ion channel clustering(GO:0045161) |
0.1 | 0.4 | GO:0006924 | activation-induced cell death of T cells(GO:0006924) |
0.1 | 0.2 | GO:0031443 | fast-twitch skeletal muscle fiber contraction(GO:0031443) |
0.1 | 0.2 | GO:0033227 | dsRNA transport(GO:0033227) |
0.1 | 2.3 | GO:1904893 | negative regulation of JAK-STAT cascade(GO:0046426) negative regulation of STAT cascade(GO:1904893) |
0.1 | 0.6 | GO:0042559 | pteridine-containing compound biosynthetic process(GO:0042559) |
0.1 | 0.1 | GO:0051451 | myoblast migration(GO:0051451) |
0.1 | 0.1 | GO:0060266 | negative regulation of respiratory burst involved in inflammatory response(GO:0060266) |
0.1 | 0.3 | GO:0055091 | phospholipid homeostasis(GO:0055091) |
0.1 | 0.4 | GO:0002087 | regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
0.1 | 0.8 | GO:0090671 | RNA localization to Cajal body(GO:0090670) telomerase RNA localization to Cajal body(GO:0090671) telomerase RNA localization(GO:0090672) |
0.1 | 0.2 | GO:0035336 | long-chain fatty-acyl-CoA metabolic process(GO:0035336) |
0.1 | 0.2 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
0.1 | 0.1 | GO:0042939 | glutathione transport(GO:0034635) tripeptide transport(GO:0042939) |
0.1 | 0.1 | GO:0033629 | negative regulation of cell adhesion mediated by integrin(GO:0033629) |
0.1 | 0.1 | GO:0034137 | positive regulation of toll-like receptor 2 signaling pathway(GO:0034137) |
0.1 | 0.1 | GO:1900157 | regulation of bone mineralization involved in bone maturation(GO:1900157) |
0.1 | 0.3 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
0.1 | 0.3 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
0.1 | 0.2 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.1 | 0.3 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
0.1 | 1.7 | GO:0034605 | cellular response to heat(GO:0034605) |
0.1 | 0.3 | GO:0032304 | negative regulation of icosanoid secretion(GO:0032304) |
0.1 | 0.3 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
0.1 | 0.3 | GO:0021544 | subpallium development(GO:0021544) |
0.1 | 0.5 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
0.1 | 0.6 | GO:0007614 | short-term memory(GO:0007614) |
0.1 | 0.1 | GO:0071498 | cellular response to fluid shear stress(GO:0071498) |
0.1 | 0.1 | GO:0035553 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
0.1 | 0.3 | GO:0006779 | porphyrin-containing compound biosynthetic process(GO:0006779) tetrapyrrole biosynthetic process(GO:0033014) |
0.1 | 0.4 | GO:0043102 | amino acid salvage(GO:0043102) L-methionine biosynthetic process(GO:0071265) L-methionine salvage(GO:0071267) |
0.1 | 0.1 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.1 | 0.1 | GO:0036498 | IRE1-mediated unfolded protein response(GO:0036498) regulation of IRE1-mediated unfolded protein response(GO:1903894) |
0.1 | 0.5 | GO:0033131 | regulation of glucokinase activity(GO:0033131) regulation of hexokinase activity(GO:1903299) |
0.1 | 0.2 | GO:0044794 | positive regulation by host of viral process(GO:0044794) |
0.1 | 0.3 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
0.1 | 0.1 | GO:0035799 | ureter maturation(GO:0035799) |
0.1 | 0.5 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
0.1 | 0.7 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
0.1 | 0.1 | GO:0071492 | cellular response to UV-A(GO:0071492) |
0.1 | 1.4 | GO:0006368 | transcription elongation from RNA polymerase II promoter(GO:0006368) |
0.1 | 0.1 | GO:2001225 | regulation of chloride transport(GO:2001225) |
0.1 | 0.3 | GO:0045586 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
0.1 | 0.2 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
0.1 | 0.5 | GO:0060252 | positive regulation of glial cell proliferation(GO:0060252) |
0.1 | 0.1 | GO:0098597 | observational learning(GO:0098597) |
0.1 | 0.1 | GO:0070141 | response to UV-A(GO:0070141) |
0.1 | 0.1 | GO:0035905 | ascending aorta development(GO:0035905) ascending aorta morphogenesis(GO:0035910) |
0.1 | 0.2 | GO:0060467 | negative regulation of fertilization(GO:0060467) |
0.1 | 0.4 | GO:0032060 | bleb assembly(GO:0032060) |
0.1 | 0.1 | GO:1990144 | intrinsic apoptotic signaling pathway in response to hypoxia(GO:1990144) |
0.1 | 0.1 | GO:0019478 | D-amino acid catabolic process(GO:0019478) |
0.1 | 0.2 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.1 | 0.1 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.1 | 0.4 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) |
0.1 | 0.2 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
0.1 | 0.4 | GO:0032310 | prostaglandin secretion(GO:0032310) |
0.1 | 0.7 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
0.1 | 0.6 | GO:0045898 | regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045898) |
0.1 | 0.1 | GO:1901838 | positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
0.1 | 0.1 | GO:1902514 | regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1902514) |
0.1 | 0.2 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
0.1 | 0.2 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.1 | 0.1 | GO:0007468 | regulation of rhodopsin gene expression(GO:0007468) |
0.1 | 0.2 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
0.1 | 0.3 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
0.1 | 0.1 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
0.1 | 0.4 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
0.1 | 0.2 | GO:0001835 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
0.1 | 0.1 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
0.1 | 0.1 | GO:0006971 | hypotonic response(GO:0006971) |
0.1 | 0.7 | GO:0015693 | magnesium ion transport(GO:0015693) |
0.1 | 0.2 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
0.1 | 0.1 | GO:0045759 | negative regulation of action potential(GO:0045759) |
0.1 | 0.1 | GO:0061325 | cell proliferation involved in outflow tract morphogenesis(GO:0061325) |
0.1 | 0.3 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
0.1 | 0.2 | GO:0086017 | Purkinje myocyte action potential(GO:0086017) |
0.1 | 0.4 | GO:0019511 | peptidyl-proline hydroxylation(GO:0019511) |
0.1 | 0.1 | GO:0003056 | regulation of vascular smooth muscle contraction(GO:0003056) |
0.1 | 0.2 | GO:0046952 | ketone body catabolic process(GO:0046952) |
0.1 | 0.1 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
0.1 | 0.1 | GO:0001834 | trophectodermal cell proliferation(GO:0001834) |
0.1 | 0.1 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
0.1 | 0.2 | GO:1905049 | negative regulation of metalloendopeptidase activity(GO:1904684) negative regulation of metallopeptidase activity(GO:1905049) |
0.1 | 0.2 | GO:0009129 | pyrimidine nucleoside monophosphate metabolic process(GO:0009129) |
0.1 | 0.2 | GO:0000492 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
0.1 | 0.3 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
0.1 | 0.6 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
0.1 | 0.1 | GO:0061511 | centriole elongation(GO:0061511) |
0.1 | 0.3 | GO:0032815 | negative regulation of natural killer cell activation(GO:0032815) |
0.1 | 0.6 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
0.1 | 0.8 | GO:0060216 | definitive hemopoiesis(GO:0060216) |
0.1 | 0.2 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.1 | 0.3 | GO:0071044 | histone mRNA catabolic process(GO:0071044) |
0.1 | 0.5 | GO:0021785 | branchiomotor neuron axon guidance(GO:0021785) |
0.1 | 0.3 | GO:0009191 | ribonucleoside diphosphate catabolic process(GO:0009191) |
0.1 | 0.2 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.1 | 0.1 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.1 | 0.1 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
0.1 | 0.1 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
0.1 | 0.4 | GO:0055070 | copper ion homeostasis(GO:0055070) |
0.1 | 0.1 | GO:0003257 | positive regulation of transcription from RNA polymerase II promoter involved in myocardial precursor cell differentiation(GO:0003257) |
0.1 | 0.1 | GO:0031034 | myosin filament assembly(GO:0031034) |
0.1 | 0.2 | GO:0071318 | cellular response to ATP(GO:0071318) |
0.1 | 0.2 | GO:0071139 | resolution of recombination intermediates(GO:0071139) |
0.1 | 0.8 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
0.1 | 0.4 | GO:0007194 | negative regulation of adenylate cyclase activity(GO:0007194) |
0.1 | 0.7 | GO:0042491 | auditory receptor cell differentiation(GO:0042491) |
0.1 | 0.5 | GO:0010225 | response to UV-C(GO:0010225) |
0.1 | 0.3 | GO:0008063 | Toll signaling pathway(GO:0008063) |
0.1 | 0.2 | GO:2000774 | positive regulation of cellular senescence(GO:2000774) |
0.1 | 0.1 | GO:0035726 | common myeloid progenitor cell proliferation(GO:0035726) |
0.1 | 0.2 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.1 | 0.4 | GO:0031440 | regulation of mRNA 3'-end processing(GO:0031440) |
0.1 | 0.2 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
0.1 | 0.2 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
0.1 | 0.1 | GO:0045617 | negative regulation of keratinocyte differentiation(GO:0045617) |
0.1 | 0.1 | GO:0006555 | methionine metabolic process(GO:0006555) |
0.1 | 0.1 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
0.1 | 0.2 | GO:0070842 | aggresome assembly(GO:0070842) |
0.1 | 0.2 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
0.1 | 0.2 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
0.1 | 0.1 | GO:0075509 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
0.1 | 0.1 | GO:0060005 | vestibular reflex(GO:0060005) |
0.1 | 0.1 | GO:0002370 | natural killer cell cytokine production(GO:0002370) regulation of natural killer cell cytokine production(GO:0002727) |
0.1 | 0.3 | GO:0021670 | lateral ventricle development(GO:0021670) |
0.1 | 0.2 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
0.1 | 0.1 | GO:0007227 | signal transduction downstream of smoothened(GO:0007227) |
0.1 | 0.2 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
0.1 | 0.2 | GO:0090086 | negative regulation of protein deubiquitination(GO:0090086) |
0.1 | 0.1 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
0.1 | 0.4 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
0.1 | 0.3 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
0.0 | 0.2 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
0.0 | 0.0 | GO:0051350 | negative regulation of lyase activity(GO:0051350) |
0.0 | 0.1 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
0.0 | 0.1 | GO:0051454 | pH elevation(GO:0045852) intracellular pH elevation(GO:0051454) |
0.0 | 0.2 | GO:0061303 | cornea development in camera-type eye(GO:0061303) |
0.0 | 0.0 | GO:0060931 | cardiac pacemaker cell differentiation(GO:0060920) sinoatrial node cell differentiation(GO:0060921) cardiac pacemaker cell development(GO:0060926) sinoatrial node cell development(GO:0060931) |
0.0 | 0.1 | GO:0015705 | iodide transport(GO:0015705) |
0.0 | 0.0 | GO:0003256 | regulation of transcription from RNA polymerase II promoter involved in myocardial precursor cell differentiation(GO:0003256) |
0.0 | 0.4 | GO:1903427 | negative regulation of reactive oxygen species biosynthetic process(GO:1903427) |
0.0 | 0.3 | GO:0043496 | regulation of protein homodimerization activity(GO:0043496) |
0.0 | 0.1 | GO:0042376 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
0.0 | 0.3 | GO:0032823 | regulation of natural killer cell differentiation(GO:0032823) |
0.0 | 0.2 | GO:0044821 | telomere tethering at nuclear periphery(GO:0034398) meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
0.0 | 0.2 | GO:0060037 | pharyngeal system development(GO:0060037) |
0.0 | 0.0 | GO:0042537 | benzene-containing compound metabolic process(GO:0042537) |
0.0 | 0.3 | GO:0071361 | cellular response to ethanol(GO:0071361) |
0.0 | 0.3 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
0.0 | 0.1 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
0.0 | 0.4 | GO:0006622 | protein targeting to lysosome(GO:0006622) |
0.0 | 0.1 | GO:0097070 | ductus arteriosus closure(GO:0097070) |
0.0 | 0.1 | GO:0045112 | integrin biosynthetic process(GO:0045112) |
0.0 | 0.4 | GO:0006743 | ubiquinone metabolic process(GO:0006743) |
0.0 | 0.2 | GO:0060346 | bone trabecula formation(GO:0060346) |
0.0 | 0.2 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
0.0 | 0.1 | GO:0018343 | protein farnesylation(GO:0018343) |
0.0 | 0.3 | GO:0032516 | positive regulation of phosphoprotein phosphatase activity(GO:0032516) |
0.0 | 0.5 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
0.0 | 0.1 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
0.0 | 0.9 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
0.0 | 0.1 | GO:0030920 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.0 | 0.0 | GO:2001055 | positive regulation of mesenchymal cell apoptotic process(GO:2001055) |
0.0 | 0.0 | GO:1901844 | regulation of cell communication by electrical coupling involved in cardiac conduction(GO:1901844) |
0.0 | 0.6 | GO:0070828 | heterochromatin organization(GO:0070828) |
0.0 | 0.0 | GO:0031441 | negative regulation of mRNA 3'-end processing(GO:0031441) |
0.0 | 0.1 | GO:0019464 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.0 | 0.3 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
0.0 | 0.1 | GO:1902969 | mitotic DNA replication(GO:1902969) |
0.0 | 0.1 | GO:0014060 | regulation of epinephrine secretion(GO:0014060) |
0.0 | 0.2 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
0.0 | 0.1 | GO:0015884 | folic acid transport(GO:0015884) |
0.0 | 0.1 | GO:1902373 | negative regulation of mRNA catabolic process(GO:1902373) regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
0.0 | 0.7 | GO:0006308 | DNA catabolic process(GO:0006308) |
0.0 | 0.7 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
0.0 | 0.0 | GO:0031585 | regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031585) cellular response to water stimulus(GO:0071462) |
0.0 | 0.6 | GO:0030852 | regulation of granulocyte differentiation(GO:0030852) |
0.0 | 0.5 | GO:0008340 | determination of adult lifespan(GO:0008340) |
0.0 | 0.3 | GO:1902414 | protein localization to cell junction(GO:1902414) |
0.0 | 0.1 | GO:0061355 | Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) |
0.0 | 0.1 | GO:1903802 | L-glutamate(1-) import into cell(GO:1903802) L-glutamate import into cell(GO:1990123) |
0.0 | 0.0 | GO:0039692 | single stranded viral RNA replication via double stranded DNA intermediate(GO:0039692) negative regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045869) |
0.0 | 0.4 | GO:0000042 | protein targeting to Golgi(GO:0000042) |
0.0 | 0.0 | GO:0021764 | amygdala development(GO:0021764) |
0.0 | 0.1 | GO:0006116 | NADH oxidation(GO:0006116) |
0.0 | 0.1 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
0.0 | 0.6 | GO:0090162 | establishment of epithelial cell polarity(GO:0090162) |
0.0 | 0.6 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
0.0 | 0.2 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
0.0 | 0.1 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
0.0 | 0.3 | GO:0000730 | DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
0.0 | 0.6 | GO:0032012 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.0 | 0.1 | GO:0051307 | meiotic chromosome separation(GO:0051307) |
0.0 | 0.1 | GO:0007525 | somatic muscle development(GO:0007525) |
0.0 | 0.3 | GO:0010919 | regulation of inositol phosphate biosynthetic process(GO:0010919) |
0.0 | 0.1 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
0.0 | 0.2 | GO:0090141 | positive regulation of mitochondrial fission(GO:0090141) |
0.0 | 0.2 | GO:0090160 | Golgi to lysosome transport(GO:0090160) |
0.0 | 0.0 | GO:1902263 | apoptotic process involved in embryonic digit morphogenesis(GO:1902263) |
0.0 | 0.1 | GO:0034182 | regulation of maintenance of sister chromatid cohesion(GO:0034091) regulation of maintenance of mitotic sister chromatid cohesion(GO:0034182) |
0.0 | 0.2 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
0.0 | 0.5 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
0.0 | 0.4 | GO:0007141 | male meiosis I(GO:0007141) |
0.0 | 0.1 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
0.0 | 0.2 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) |
0.0 | 0.5 | GO:0010591 | regulation of lamellipodium assembly(GO:0010591) |
0.0 | 0.1 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
0.0 | 0.2 | GO:0015677 | copper ion import(GO:0015677) |
0.0 | 0.1 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
0.0 | 0.3 | GO:0060539 | diaphragm development(GO:0060539) |
0.0 | 1.7 | GO:0006400 | tRNA modification(GO:0006400) |
0.0 | 1.5 | GO:0032465 | regulation of cytokinesis(GO:0032465) |
0.0 | 0.1 | GO:1901626 | regulation of postsynaptic membrane organization(GO:1901626) |
0.0 | 0.1 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
0.0 | 0.1 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
0.0 | 0.1 | GO:0051944 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
0.0 | 0.0 | GO:1902261 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
0.0 | 0.1 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
0.0 | 0.1 | GO:0090156 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) negative regulation of ceramide biosynthetic process(GO:1900060) |
0.0 | 0.0 | GO:0009448 | gamma-aminobutyric acid metabolic process(GO:0009448) |
0.0 | 0.2 | GO:0021683 | cerebellar granular layer morphogenesis(GO:0021683) |
0.0 | 0.8 | GO:0033120 | positive regulation of RNA splicing(GO:0033120) |
0.0 | 0.3 | GO:0036120 | cellular response to platelet-derived growth factor stimulus(GO:0036120) |
0.0 | 0.1 | GO:0060028 | convergent extension involved in axis elongation(GO:0060028) |
0.0 | 0.1 | GO:0090151 | establishment of protein localization to mitochondrial membrane(GO:0090151) |
0.0 | 0.3 | GO:0031167 | rRNA methylation(GO:0031167) |
0.0 | 0.2 | GO:0099500 | synaptic vesicle fusion to presynaptic active zone membrane(GO:0031629) vesicle fusion to plasma membrane(GO:0099500) |
0.0 | 0.7 | GO:0051310 | metaphase plate congression(GO:0051310) |
0.0 | 0.1 | GO:0060066 | oviduct development(GO:0060066) |
0.0 | 0.0 | GO:1903984 | positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
0.0 | 0.0 | GO:0061032 | visceral serous pericardium development(GO:0061032) |
0.0 | 0.1 | GO:0010310 | regulation of hydrogen peroxide metabolic process(GO:0010310) |
0.0 | 0.2 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
0.0 | 0.0 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
0.0 | 0.2 | GO:0060856 | establishment of blood-brain barrier(GO:0060856) |
0.0 | 0.3 | GO:0051852 | disruption by host of symbiont cells(GO:0051852) killing by host of symbiont cells(GO:0051873) |
0.0 | 0.0 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
0.0 | 0.4 | GO:0022904 | respiratory electron transport chain(GO:0022904) |
0.0 | 0.0 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
0.0 | 0.0 | GO:0048808 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
0.0 | 0.1 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
0.0 | 0.6 | GO:0006730 | one-carbon metabolic process(GO:0006730) |
0.0 | 0.1 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
0.0 | 0.1 | GO:0014063 | negative regulation of serotonin secretion(GO:0014063) |
0.0 | 0.1 | GO:0006083 | acetate metabolic process(GO:0006083) |
0.0 | 0.1 | GO:2000059 | negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
0.0 | 0.1 | GO:0048769 | sarcomerogenesis(GO:0048769) |
0.0 | 0.3 | GO:0014002 | astrocyte development(GO:0014002) |
0.0 | 0.0 | GO:0090306 | spindle assembly involved in meiosis(GO:0090306) |
0.0 | 0.1 | GO:0014054 | positive regulation of gamma-aminobutyric acid secretion(GO:0014054) |
0.0 | 0.2 | GO:0033603 | positive regulation of dopamine secretion(GO:0033603) |
0.0 | 0.1 | GO:0048563 | post-embryonic organ morphogenesis(GO:0048563) |
0.0 | 0.1 | GO:0035871 | protein K11-linked deubiquitination(GO:0035871) |
0.0 | 0.1 | GO:0060872 | semicircular canal development(GO:0060872) |
0.0 | 0.1 | GO:1901571 | icosanoid transport(GO:0071715) fatty acid derivative transport(GO:1901571) |
0.0 | 0.0 | GO:1900620 | acetylcholine biosynthetic process(GO:0008292) acetate ester biosynthetic process(GO:1900620) |
0.0 | 0.2 | GO:0045063 | T-helper 1 cell differentiation(GO:0045063) |
0.0 | 0.1 | GO:0033860 | regulation of NAD(P)H oxidase activity(GO:0033860) |
0.0 | 0.1 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
0.0 | 0.2 | GO:2000300 | regulation of synaptic vesicle exocytosis(GO:2000300) |
0.0 | 0.0 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
0.0 | 0.7 | GO:0046579 | positive regulation of Ras protein signal transduction(GO:0046579) |
0.0 | 0.0 | GO:0030397 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
0.0 | 0.0 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
0.0 | 0.2 | GO:0043249 | erythrocyte maturation(GO:0043249) |
0.0 | 0.1 | GO:0070858 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
0.0 | 0.0 | GO:0050665 | hydrogen peroxide biosynthetic process(GO:0050665) |
0.0 | 0.3 | GO:0051383 | kinetochore organization(GO:0051383) |
0.0 | 0.0 | GO:0003344 | pericardium morphogenesis(GO:0003344) |
0.0 | 0.0 | GO:0014062 | regulation of serotonin secretion(GO:0014062) |
0.0 | 0.0 | GO:0000710 | meiotic mismatch repair(GO:0000710) |
0.0 | 0.2 | GO:0007210 | serotonin receptor signaling pathway(GO:0007210) |
0.0 | 0.0 | GO:0060051 | negative regulation of protein glycosylation(GO:0060051) |
0.0 | 0.2 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
0.0 | 0.1 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
0.0 | 0.4 | GO:0051702 | interaction with symbiont(GO:0051702) |
0.0 | 0.5 | GO:0045747 | positive regulation of Notch signaling pathway(GO:0045747) |
0.0 | 0.2 | GO:0002192 | IRES-dependent translational initiation(GO:0002192) |
0.0 | 0.3 | GO:0043403 | skeletal muscle tissue regeneration(GO:0043403) |
0.0 | 0.1 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
0.0 | 0.4 | GO:0099517 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
0.0 | 0.6 | GO:0006270 | DNA replication initiation(GO:0006270) |
0.0 | 0.3 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.0 | 0.1 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
0.0 | 0.6 | GO:0006829 | zinc II ion transport(GO:0006829) |
0.0 | 0.1 | GO:0046831 | regulation of RNA export from nucleus(GO:0046831) |
0.0 | 0.4 | GO:2001240 | negative regulation of signal transduction in absence of ligand(GO:1901099) negative regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001240) |
0.0 | 0.1 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
0.0 | 0.1 | GO:0042546 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) |
0.0 | 0.8 | GO:0048536 | spleen development(GO:0048536) |
0.0 | 0.8 | GO:0090662 | energy coupled proton transmembrane transport, against electrochemical gradient(GO:0015988) ATP hydrolysis coupled proton transport(GO:0015991) ATP hydrolysis coupled transmembrane transport(GO:0090662) |
0.0 | 0.1 | GO:0046208 | spermine catabolic process(GO:0046208) |
0.0 | 0.0 | GO:1903423 | positive regulation of synaptic vesicle recycling(GO:1903423) |
0.0 | 0.1 | GO:0038001 | paracrine signaling(GO:0038001) |
0.0 | 0.2 | GO:0021859 | pyramidal neuron differentiation(GO:0021859) |
0.0 | 0.2 | GO:0010832 | negative regulation of myotube differentiation(GO:0010832) |
0.0 | 0.1 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
0.0 | 0.1 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
0.0 | 0.1 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
0.0 | 0.0 | GO:0090343 | positive regulation of cell aging(GO:0090343) |
0.0 | 0.1 | GO:0046684 | response to pyrethroid(GO:0046684) |
0.0 | 0.2 | GO:0006977 | DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) |
0.0 | 0.1 | GO:0060215 | primitive hemopoiesis(GO:0060215) |
0.0 | 0.0 | GO:0008078 | mesodermal cell migration(GO:0008078) |
0.0 | 0.1 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.0 | 0.2 | GO:1901071 | glucosamine-containing compound metabolic process(GO:1901071) |
0.0 | 0.0 | GO:0046514 | ceramide catabolic process(GO:0046514) |
0.0 | 0.0 | GO:0090091 | positive regulation of extracellular matrix disassembly(GO:0090091) |
0.0 | 0.4 | GO:0097352 | autophagosome maturation(GO:0097352) |
0.0 | 0.1 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
0.0 | 0.1 | GO:0032506 | cytokinetic process(GO:0032506) |
0.0 | 0.5 | GO:0070303 | negative regulation of stress-activated MAPK cascade(GO:0032873) negative regulation of stress-activated protein kinase signaling cascade(GO:0070303) |
0.0 | 0.1 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.0 | 0.1 | GO:0043382 | positive regulation of memory T cell differentiation(GO:0043382) |
0.0 | 0.1 | GO:1902172 | keratinocyte apoptotic process(GO:0097283) regulation of keratinocyte apoptotic process(GO:1902172) |
0.0 | 0.2 | GO:0016446 | somatic hypermutation of immunoglobulin genes(GO:0016446) |
0.0 | 0.1 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
0.0 | 0.0 | GO:0023021 | termination of signal transduction(GO:0023021) |
0.0 | 0.2 | GO:0035767 | endothelial cell chemotaxis(GO:0035767) |
0.0 | 0.6 | GO:0006182 | cGMP biosynthetic process(GO:0006182) |
0.0 | 0.0 | GO:0060687 | regulation of branching involved in prostate gland morphogenesis(GO:0060687) |
0.0 | 0.1 | GO:0070272 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
0.0 | 0.5 | GO:0006406 | mRNA export from nucleus(GO:0006406) mRNA-containing ribonucleoprotein complex export from nucleus(GO:0071427) |
0.0 | 0.1 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
0.0 | 0.1 | GO:0070970 | interleukin-2 secretion(GO:0070970) |
0.0 | 0.1 | GO:0032354 | response to follicle-stimulating hormone(GO:0032354) cellular response to gonadotropin stimulus(GO:0071371) cellular response to follicle-stimulating hormone stimulus(GO:0071372) |
0.0 | 0.3 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
0.0 | 0.1 | GO:0030091 | protein repair(GO:0030091) |
0.0 | 0.2 | GO:0051084 | 'de novo' protein folding(GO:0006458) 'de novo' posttranslational protein folding(GO:0051084) |
0.0 | 0.1 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
0.0 | 0.0 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
0.0 | 0.2 | GO:0006337 | nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
0.0 | 1.1 | GO:0008033 | tRNA processing(GO:0008033) |
0.0 | 0.2 | GO:0031954 | positive regulation of protein autophosphorylation(GO:0031954) |
0.0 | 0.2 | GO:0006020 | inositol metabolic process(GO:0006020) |
0.0 | 0.3 | GO:0046348 | amino sugar catabolic process(GO:0046348) |
0.0 | 0.1 | GO:0010749 | regulation of nitric oxide mediated signal transduction(GO:0010749) |
0.0 | 0.0 | GO:1900044 | regulation of protein K63-linked ubiquitination(GO:1900044) |
0.0 | 0.0 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
0.0 | 1.2 | GO:0043484 | regulation of RNA splicing(GO:0043484) |
0.0 | 0.1 | GO:0072319 | clathrin coat disassembly(GO:0072318) vesicle uncoating(GO:0072319) |
0.0 | 0.1 | GO:0014043 | negative regulation of neuron maturation(GO:0014043) |
0.0 | 0.1 | GO:0048102 | autophagic cell death(GO:0048102) |
0.0 | 0.1 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
0.0 | 0.1 | GO:0071435 | potassium ion export(GO:0071435) |
0.0 | 0.0 | GO:1901725 | regulation of histone deacetylase activity(GO:1901725) |
0.0 | 0.0 | GO:0039703 | viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
0.0 | 0.3 | GO:0046856 | phosphatidylinositol dephosphorylation(GO:0046856) |
0.0 | 0.1 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.0 | 0.0 | GO:1901629 | regulation of presynaptic membrane organization(GO:1901629) |
0.0 | 0.0 | GO:0032829 | regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032829) |
0.0 | 0.1 | GO:0008582 | regulation of synaptic growth at neuromuscular junction(GO:0008582) synaptic growth at neuromuscular junction(GO:0051124) |
0.0 | 0.3 | GO:0008210 | estrogen metabolic process(GO:0008210) |
0.0 | 0.2 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
0.0 | 0.1 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
0.0 | 0.0 | GO:0010870 | positive regulation of receptor biosynthetic process(GO:0010870) |
0.0 | 0.7 | GO:0006506 | GPI anchor biosynthetic process(GO:0006506) |
0.0 | 0.0 | GO:0070309 | lens fiber cell morphogenesis(GO:0070309) |
0.0 | 0.3 | GO:2000179 | positive regulation of neural precursor cell proliferation(GO:2000179) |
0.0 | 0.1 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.0 | 0.1 | GO:1900037 | regulation of cellular response to hypoxia(GO:1900037) |
0.0 | 0.1 | GO:0042149 | cellular response to glucose starvation(GO:0042149) |
0.0 | 0.1 | GO:0006787 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) |
0.0 | 0.0 | GO:0042628 | mating plug formation(GO:0042628) single-organism reproductive behavior(GO:0044704) post-mating behavior(GO:0045297) |
0.0 | 0.1 | GO:0060055 | angiogenesis involved in wound healing(GO:0060055) |
0.0 | 0.2 | GO:0071625 | vocalization behavior(GO:0071625) |
0.0 | 0.1 | GO:0032224 | positive regulation of synaptic transmission, cholinergic(GO:0032224) |
0.0 | 0.3 | GO:0007140 | male meiosis(GO:0007140) |
0.0 | 0.0 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
0.0 | 0.1 | GO:0035020 | regulation of Rac protein signal transduction(GO:0035020) |
0.0 | 0.5 | GO:0006493 | protein O-linked glycosylation(GO:0006493) |
0.0 | 0.0 | GO:0009164 | nucleoside catabolic process(GO:0009164) |
0.0 | 0.0 | GO:0048664 | neuron fate determination(GO:0048664) |
0.0 | 0.0 | GO:0070459 | prolactin secretion(GO:0070459) |
0.0 | 0.1 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
0.0 | 0.0 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
0.0 | 0.2 | GO:1902571 | regulation of serine-type endopeptidase activity(GO:1900003) negative regulation of serine-type endopeptidase activity(GO:1900004) regulation of serine-type peptidase activity(GO:1902571) negative regulation of serine-type peptidase activity(GO:1902572) |
0.0 | 0.1 | GO:0090331 | negative regulation of platelet aggregation(GO:0090331) |
0.0 | 0.0 | GO:0051571 | positive regulation of histone H3-K4 methylation(GO:0051571) |
0.0 | 0.1 | GO:0006921 | cellular component disassembly involved in execution phase of apoptosis(GO:0006921) apoptotic nuclear changes(GO:0030262) |
0.0 | 0.1 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
0.0 | 0.4 | GO:0048240 | sperm capacitation(GO:0048240) |
0.0 | 0.1 | GO:0000380 | alternative mRNA splicing, via spliceosome(GO:0000380) |
0.0 | 0.0 | GO:0060664 | epithelial cell proliferation involved in salivary gland morphogenesis(GO:0060664) |
0.0 | 0.0 | GO:0000963 | mitochondrial RNA processing(GO:0000963) |
0.0 | 0.2 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.0 | 0.0 | GO:0009125 | nucleoside monophosphate catabolic process(GO:0009125) |
0.0 | 0.6 | GO:0001541 | ovarian follicle development(GO:0001541) |
0.0 | 0.0 | GO:0015819 | lysine transport(GO:0015819) |
0.0 | 0.0 | GO:0045714 | regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045714) |
0.0 | 0.1 | GO:0030575 | nuclear body organization(GO:0030575) |
0.0 | 0.1 | GO:0002002 | regulation of angiotensin levels in blood(GO:0002002) |
0.0 | 0.1 | GO:0035584 | calcium-mediated signaling using intracellular calcium source(GO:0035584) |
0.0 | 0.1 | GO:0015858 | nucleoside transport(GO:0015858) |
0.0 | 0.1 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
0.0 | 0.0 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
0.0 | 0.0 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
0.0 | 0.5 | GO:0018345 | protein palmitoylation(GO:0018345) |
0.0 | 0.0 | GO:1990748 | cellular detoxification(GO:1990748) |
0.0 | 0.2 | GO:0048268 | clathrin coat assembly(GO:0048268) |
0.0 | 0.1 | GO:0007207 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
0.0 | 0.0 | GO:0010528 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
0.0 | 0.4 | GO:0031279 | regulation of cyclase activity(GO:0031279) |
0.0 | 0.0 | GO:0060684 | epithelial-mesenchymal cell signaling(GO:0060684) |
0.0 | 0.0 | GO:0072401 | signal transduction involved in cell cycle checkpoint(GO:0072395) signal transduction involved in DNA integrity checkpoint(GO:0072401) signal transduction involved in DNA damage checkpoint(GO:0072422) |
0.0 | 0.0 | GO:0051031 | tRNA transport(GO:0051031) |
0.0 | 0.2 | GO:1903077 | negative regulation of protein localization to plasma membrane(GO:1903077) negative regulation of protein localization to cell periphery(GO:1904376) |
0.0 | 0.1 | GO:0001514 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
0.0 | 0.0 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
0.0 | 0.1 | GO:0045654 | positive regulation of megakaryocyte differentiation(GO:0045654) |
0.0 | 0.0 | GO:1903204 | negative regulation of oxidative stress-induced neuron death(GO:1903204) |
0.0 | 0.0 | GO:0060046 | regulation of acrosome reaction(GO:0060046) |
0.0 | 0.0 | GO:0032621 | interleukin-18 production(GO:0032621) |
0.0 | 0.2 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
0.0 | 0.0 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
0.0 | 0.1 | GO:0010452 | histone H3-K36 methylation(GO:0010452) |
0.0 | 0.2 | GO:1990403 | embryonic brain development(GO:1990403) |
0.0 | 0.6 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
0.0 | 0.0 | GO:1901419 | regulation of response to alcohol(GO:1901419) |
0.0 | 0.3 | GO:0001702 | gastrulation with mouth forming second(GO:0001702) |
0.0 | 0.3 | GO:0035094 | response to nicotine(GO:0035094) |
0.0 | 0.0 | GO:0009068 | aspartate family amino acid catabolic process(GO:0009068) |
0.0 | 0.2 | GO:0072337 | modified amino acid transport(GO:0072337) |
0.0 | 0.0 | GO:0060633 | negative regulation of transcription initiation from RNA polymerase II promoter(GO:0060633) negative regulation of DNA-templated transcription, initiation(GO:2000143) |
0.0 | 0.0 | GO:0003357 | noradrenergic neuron differentiation(GO:0003357) oculomotor nerve development(GO:0021557) trochlear nerve development(GO:0021558) cranial nerve formation(GO:0021603) |
0.0 | 0.0 | GO:0043435 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
0.0 | 0.0 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
0.0 | 0.0 | GO:0033574 | response to testosterone(GO:0033574) |
0.0 | 0.2 | GO:0043631 | mRNA polyadenylation(GO:0006378) RNA polyadenylation(GO:0043631) |
0.0 | 0.0 | GO:0006678 | glucosylceramide metabolic process(GO:0006678) |
0.0 | 0.0 | GO:0014827 | intestine smooth muscle contraction(GO:0014827) |
0.0 | 0.1 | GO:0051764 | actin crosslink formation(GO:0051764) |
0.0 | 0.0 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
0.0 | 0.1 | GO:0072498 | embryonic skeletal joint development(GO:0072498) |
0.0 | 0.1 | GO:0071801 | regulation of podosome assembly(GO:0071801) |
0.0 | 0.0 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
0.0 | 0.0 | GO:0060339 | negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
0.0 | 0.0 | GO:2001138 | regulation of phospholipid transport(GO:2001138) positive regulation of phospholipid transport(GO:2001140) |
0.0 | 0.3 | GO:0000184 | nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
0.0 | 0.0 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) |
0.0 | 0.1 | GO:1901741 | positive regulation of myoblast fusion(GO:1901741) |
0.0 | 0.1 | GO:0045906 | negative regulation of vasoconstriction(GO:0045906) |
0.0 | 0.0 | GO:2000173 | negative regulation of branching morphogenesis of a nerve(GO:2000173) |
0.0 | 0.0 | GO:0002930 | trabecular meshwork development(GO:0002930) |
0.0 | 0.0 | GO:1903358 | regulation of Golgi organization(GO:1903358) |
0.0 | 0.1 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.0 | 0.1 | GO:0031340 | positive regulation of vesicle fusion(GO:0031340) |
0.0 | 0.1 | GO:0015874 | norepinephrine transport(GO:0015874) |
0.0 | 0.1 | GO:0050965 | detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
0.0 | 0.1 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
0.0 | 0.1 | GO:0046909 | intermembrane transport(GO:0046909) |
0.0 | 0.0 | GO:2000474 | regulation of opioid receptor signaling pathway(GO:2000474) |
0.0 | 0.1 | GO:0090201 | negative regulation of release of cytochrome c from mitochondria(GO:0090201) |
0.0 | 0.3 | GO:0036465 | synaptic vesicle recycling(GO:0036465) |
0.0 | 0.0 | GO:1900368 | regulation of RNA interference(GO:1900368) |
0.0 | 0.0 | GO:0061316 | canonical Wnt signaling pathway involved in heart development(GO:0061316) |
0.0 | 0.1 | GO:0048742 | regulation of skeletal muscle fiber development(GO:0048742) |
0.0 | 0.0 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
0.0 | 0.2 | GO:0016601 | Rac protein signal transduction(GO:0016601) |
0.0 | 0.1 | GO:0022900 | electron transport chain(GO:0022900) |
0.0 | 0.0 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
0.0 | 0.1 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
0.0 | 0.0 | GO:0071679 | commissural neuron axon guidance(GO:0071679) |
0.0 | 0.0 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
0.0 | 0.0 | GO:1903975 | regulation of glial cell migration(GO:1903975) |
0.0 | 0.0 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
0.0 | 0.0 | GO:0008354 | germ cell migration(GO:0008354) |
0.0 | 0.0 | GO:0042168 | heme metabolic process(GO:0042168) |
0.0 | 1.6 | GO:0071230 | cellular response to amino acid stimulus(GO:0071230) |
0.0 | 0.0 | GO:0097168 | mesenchymal stem cell proliferation(GO:0097168) |
0.0 | 0.0 | GO:0019086 | late viral transcription(GO:0019086) |
0.0 | 0.1 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
0.0 | 0.1 | GO:0002115 | store-operated calcium entry(GO:0002115) |
0.0 | 0.0 | GO:0007343 | egg activation(GO:0007343) |
0.0 | 0.1 | GO:0032801 | receptor catabolic process(GO:0032801) |
0.0 | 0.0 | GO:0070741 | response to interleukin-6(GO:0070741) |
0.0 | 0.2 | GO:0045116 | protein neddylation(GO:0045116) |
0.0 | 0.0 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
0.0 | 0.0 | GO:0046103 | inosine biosynthetic process(GO:0046103) |
0.0 | 0.0 | GO:0035315 | hair cell differentiation(GO:0035315) |
0.0 | 0.3 | GO:0040014 | regulation of multicellular organism growth(GO:0040014) |
0.0 | 0.2 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
0.0 | 0.0 | GO:0002238 | response to molecule of fungal origin(GO:0002238) |
0.0 | 0.1 | GO:0002438 | acute inflammatory response to antigenic stimulus(GO:0002438) |
0.0 | 0.0 | GO:1902855 | regulation of nonmotile primary cilium assembly(GO:1902855) |
0.0 | 0.0 | GO:0015732 | prostaglandin transport(GO:0015732) |
0.0 | 0.1 | GO:0034643 | establishment of mitochondrion localization, microtubule-mediated(GO:0034643) mitochondrion transport along microtubule(GO:0047497) |
0.0 | 0.0 | GO:0090191 | negative regulation of branching involved in ureteric bud morphogenesis(GO:0090191) |
0.0 | 0.1 | GO:0002862 | negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
0.0 | 0.0 | GO:0000289 | nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
0.0 | 0.0 | GO:0045074 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
0.0 | 0.0 | GO:0060988 | lipid tube assembly(GO:0060988) |
0.0 | 0.0 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
0.0 | 0.2 | GO:0046677 | response to antibiotic(GO:0046677) |
0.0 | 0.0 | GO:0007191 | adenylate cyclase-activating dopamine receptor signaling pathway(GO:0007191) |
0.0 | 0.0 | GO:0061074 | regulation of neural retina development(GO:0061074) |
0.0 | 0.0 | GO:0002074 | extraocular skeletal muscle development(GO:0002074) |
0.0 | 0.1 | GO:1902043 | positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.0 | GO:0022028 | tangential migration from the subventricular zone to the olfactory bulb(GO:0022028) |
0.0 | 0.1 | GO:0034625 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
0.0 | 0.0 | GO:0071034 | CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
0.0 | 0.0 | GO:0014067 | negative regulation of phosphatidylinositol 3-kinase signaling(GO:0014067) |
0.0 | 0.0 | GO:0060618 | nipple development(GO:0060618) |
0.0 | 0.0 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
0.0 | 0.0 | GO:0090399 | replicative senescence(GO:0090399) |
0.0 | 0.0 | GO:0035590 | purinergic nucleotide receptor signaling pathway(GO:0035590) |
0.0 | 0.0 | GO:0002581 | negative regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002581) |
0.0 | 0.0 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.0 | 0.0 | GO:0045986 | negative regulation of smooth muscle contraction(GO:0045986) |
0.0 | 0.1 | GO:0006968 | cellular defense response(GO:0006968) |
0.0 | 0.0 | GO:0071321 | cellular response to cGMP(GO:0071321) |
0.0 | 0.0 | GO:0010715 | regulation of extracellular matrix disassembly(GO:0010715) |
0.0 | 0.0 | GO:0021520 | spinal cord motor neuron cell fate specification(GO:0021520) |
0.0 | 0.0 | GO:2000196 | positive regulation of female gonad development(GO:2000196) |
0.0 | 0.2 | GO:0045739 | positive regulation of DNA repair(GO:0045739) |
0.0 | 0.1 | GO:1902235 | regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902235) |
0.0 | 0.0 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
0.0 | 0.0 | GO:0006505 | GPI anchor metabolic process(GO:0006505) |
0.0 | 0.1 | GO:0009084 | glutamine family amino acid biosynthetic process(GO:0009084) |
0.0 | 0.1 | GO:0035115 | embryonic forelimb morphogenesis(GO:0035115) |
0.0 | 0.0 | GO:0070199 | establishment of protein localization to chromosome(GO:0070199) |
0.0 | 0.0 | GO:0060969 | negative regulation of gene silencing(GO:0060969) |
0.0 | 0.1 | GO:0016139 | glycoside catabolic process(GO:0016139) |
0.0 | 0.0 | GO:0042483 | negative regulation of odontogenesis(GO:0042483) |
0.0 | 0.0 | GO:0038093 | Fc receptor signaling pathway(GO:0038093) |
0.0 | 0.0 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
0.0 | 0.0 | GO:0014889 | muscle atrophy(GO:0014889) |
0.0 | 0.0 | GO:0006296 | nucleotide-excision repair, DNA incision, 5'-to lesion(GO:0006296) |
0.0 | 0.0 | GO:0043649 | dicarboxylic acid catabolic process(GO:0043649) |
0.0 | 0.0 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
0.0 | 0.0 | GO:0006600 | creatine metabolic process(GO:0006600) |
0.0 | 0.0 | GO:0097211 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
0.0 | 0.1 | GO:0002827 | positive regulation of T-helper 1 type immune response(GO:0002827) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.4 | 7.2 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
1.0 | 5.2 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.7 | 2.0 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
0.6 | 6.3 | GO:0070852 | cell body fiber(GO:0070852) |
0.5 | 1.5 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.5 | 1.8 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.5 | 2.3 | GO:0097433 | dense body(GO:0097433) |
0.4 | 1.9 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.4 | 1.1 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
0.3 | 1.6 | GO:0005915 | zonula adherens(GO:0005915) |
0.3 | 1.3 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.3 | 2.5 | GO:0016342 | catenin complex(GO:0016342) |
0.3 | 1.2 | GO:0043159 | acrosomal matrix(GO:0043159) |
0.3 | 0.9 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.3 | 3.5 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.3 | 1.5 | GO:0005579 | membrane attack complex(GO:0005579) |
0.3 | 1.6 | GO:0000445 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
0.3 | 1.1 | GO:0045298 | tubulin complex(GO:0045298) |
0.3 | 11.5 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.3 | 1.3 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.2 | 1.0 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.2 | 1.2 | GO:0031298 | replication fork protection complex(GO:0031298) |
0.2 | 0.5 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.2 | 0.9 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
0.2 | 0.9 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.2 | 1.6 | GO:0045180 | basal cortex(GO:0045180) |
0.2 | 0.9 | GO:0031332 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
0.2 | 0.6 | GO:0048179 | activin receptor complex(GO:0048179) |
0.2 | 0.6 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.2 | 1.6 | GO:0042587 | glycogen granule(GO:0042587) |
0.2 | 0.8 | GO:0033269 | internode region of axon(GO:0033269) |
0.2 | 3.0 | GO:0035371 | microtubule plus-end(GO:0035371) |
0.2 | 0.5 | GO:0005712 | chiasma(GO:0005712) |
0.2 | 0.7 | GO:0005726 | perichromatin fibrils(GO:0005726) |
0.2 | 3.0 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.2 | 0.7 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
0.2 | 1.2 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
0.2 | 1.2 | GO:1990909 | Wnt signalosome(GO:1990909) |
0.2 | 2.9 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
0.2 | 2.0 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
0.2 | 1.3 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.2 | 1.3 | GO:0045275 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
0.2 | 0.3 | GO:0070552 | BRISC complex(GO:0070552) |
0.2 | 0.7 | GO:0045293 | mRNA editing complex(GO:0045293) |
0.2 | 1.0 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
0.2 | 1.1 | GO:0042382 | paraspeckles(GO:0042382) |
0.2 | 0.6 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
0.2 | 0.6 | GO:0070545 | PeBoW complex(GO:0070545) |
0.2 | 0.6 | GO:0030867 | rough endoplasmic reticulum membrane(GO:0030867) |
0.2 | 0.6 | GO:0030127 | COPII vesicle coat(GO:0030127) |
0.2 | 0.8 | GO:0005652 | nuclear lamina(GO:0005652) |
0.1 | 1.6 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
0.1 | 0.6 | GO:0031094 | platelet dense tubular network(GO:0031094) |
0.1 | 0.4 | GO:0005955 | calcineurin complex(GO:0005955) |
0.1 | 0.4 | GO:0046691 | intracellular canaliculus(GO:0046691) |
0.1 | 0.9 | GO:0031415 | NatA complex(GO:0031415) |
0.1 | 0.7 | GO:0044294 | dendritic growth cone(GO:0044294) |
0.1 | 1.1 | GO:0000243 | commitment complex(GO:0000243) |
0.1 | 0.1 | GO:0097452 | GAIT complex(GO:0097452) |
0.1 | 0.8 | GO:0000439 | core TFIIH complex(GO:0000439) |
0.1 | 1.1 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
0.1 | 0.4 | GO:0097413 | Lewy body(GO:0097413) |
0.1 | 0.4 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.1 | 0.4 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
0.1 | 0.5 | GO:0097209 | epidermal lamellar body(GO:0097209) |
0.1 | 4.2 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.1 | 1.3 | GO:0031143 | pseudopodium(GO:0031143) |
0.1 | 0.6 | GO:0071556 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) |
0.1 | 0.5 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
0.1 | 4.2 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.1 | 0.4 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
0.1 | 0.4 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.1 | 5.0 | GO:0030964 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
0.1 | 0.4 | GO:0005608 | laminin-3 complex(GO:0005608) |
0.1 | 0.5 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.1 | 0.7 | GO:0002177 | manchette(GO:0002177) |
0.1 | 1.0 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.1 | 1.8 | GO:0031430 | M band(GO:0031430) |
0.1 | 1.5 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.1 | 0.5 | GO:0031262 | Ndc80 complex(GO:0031262) |
0.1 | 0.2 | GO:0042585 | germinal vesicle(GO:0042585) |
0.1 | 0.3 | GO:0071942 | XPC complex(GO:0071942) |
0.1 | 4.6 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
0.1 | 0.6 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.1 | 0.2 | GO:0071141 | SMAD protein complex(GO:0071141) |
0.1 | 0.3 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.1 | 1.5 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.1 | 0.4 | GO:1990131 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.1 | 1.2 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.1 | 1.5 | GO:0097440 | apical dendrite(GO:0097440) |
0.1 | 0.4 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.1 | 0.3 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
0.1 | 4.7 | GO:0005778 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
0.1 | 0.3 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
0.1 | 0.3 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
0.1 | 1.0 | GO:0046581 | intercellular canaliculus(GO:0046581) |
0.1 | 0.4 | GO:0044308 | axonal spine(GO:0044308) |
0.1 | 2.1 | GO:0005719 | nuclear euchromatin(GO:0005719) |
0.1 | 1.5 | GO:0031306 | intrinsic component of mitochondrial outer membrane(GO:0031306) |
0.1 | 0.8 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.1 | 0.6 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.1 | 0.9 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.1 | 0.4 | GO:0042583 | chromaffin granule(GO:0042583) |
0.1 | 0.8 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.1 | 0.3 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.1 | 1.5 | GO:0043034 | costamere(GO:0043034) |
0.1 | 0.1 | GO:0001651 | dense fibrillar component(GO:0001651) |
0.1 | 3.2 | GO:0005637 | nuclear inner membrane(GO:0005637) |
0.1 | 0.4 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.1 | 0.5 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
0.1 | 0.5 | GO:0089717 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
0.1 | 0.7 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.1 | 0.2 | GO:0030056 | hemidesmosome(GO:0030056) |
0.1 | 0.7 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
0.1 | 0.3 | GO:0032437 | cuticular plate(GO:0032437) |
0.1 | 0.2 | GO:0016939 | kinesin II complex(GO:0016939) |
0.1 | 0.5 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.1 | 0.3 | GO:0035339 | SPOTS complex(GO:0035339) |
0.1 | 0.3 | GO:0070069 | cytochrome complex(GO:0070069) |
0.1 | 0.2 | GO:0035061 | interchromatin granule(GO:0035061) |
0.1 | 0.2 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.1 | 2.1 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
0.1 | 0.2 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.1 | 0.5 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
0.1 | 0.6 | GO:0042405 | nuclear inclusion body(GO:0042405) |
0.1 | 0.2 | GO:0005606 | laminin-1 complex(GO:0005606) |
0.1 | 0.6 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.1 | 0.4 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
0.1 | 0.4 | GO:0005827 | polar microtubule(GO:0005827) |
0.1 | 0.7 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.1 | 0.2 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
0.1 | 0.7 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.1 | 0.4 | GO:0000346 | transcription export complex(GO:0000346) |
0.1 | 0.3 | GO:0019815 | B cell receptor complex(GO:0019815) |
0.1 | 0.8 | GO:0001527 | microfibril(GO:0001527) |
0.1 | 0.1 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.1 | 0.3 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
0.1 | 0.1 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
0.1 | 1.1 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.1 | 0.3 | GO:1990745 | EARP complex(GO:1990745) |
0.1 | 0.6 | GO:0036156 | inner dynein arm(GO:0036156) |
0.1 | 0.2 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
0.1 | 0.9 | GO:0036038 | MKS complex(GO:0036038) |
0.1 | 0.3 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
0.1 | 0.4 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.1 | 0.7 | GO:0031512 | motile primary cilium(GO:0031512) |
0.1 | 3.5 | GO:0016459 | myosin complex(GO:0016459) |
0.1 | 2.3 | GO:0005762 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
0.1 | 1.0 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
0.1 | 5.7 | GO:0030176 | integral component of endoplasmic reticulum membrane(GO:0030176) |
0.1 | 4.2 | GO:0097014 | axoneme(GO:0005930) ciliary plasm(GO:0097014) |
0.1 | 0.1 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
0.1 | 0.4 | GO:0097539 | ciliary transition fiber(GO:0097539) |
0.1 | 0.1 | GO:0000805 | X chromosome(GO:0000805) |
0.1 | 0.4 | GO:0042575 | DNA polymerase complex(GO:0042575) |
0.1 | 0.3 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
0.1 | 0.2 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
0.1 | 7.5 | GO:0005759 | mitochondrial matrix(GO:0005759) |
0.1 | 0.6 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
0.1 | 0.1 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
0.1 | 0.1 | GO:0071817 | MMXD complex(GO:0071817) |
0.1 | 0.4 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.1 | 0.2 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.1 | 0.1 | GO:0000811 | GINS complex(GO:0000811) |
0.1 | 0.4 | GO:0060091 | kinocilium(GO:0060091) |
0.1 | 0.6 | GO:0030126 | COPI vesicle coat(GO:0030126) |
0.1 | 0.5 | GO:0032426 | stereocilium tip(GO:0032426) |
0.1 | 0.6 | GO:0044295 | axonal growth cone(GO:0044295) |
0.1 | 0.2 | GO:0033162 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
0.1 | 0.6 | GO:0005686 | U2 snRNP(GO:0005686) |
0.1 | 0.1 | GO:0046930 | pore complex(GO:0046930) |
0.1 | 0.2 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.1 | 0.2 | GO:0031502 | dolichyl-phosphate-mannose-protein mannosyltransferase complex(GO:0031502) |
0.1 | 5.3 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
0.1 | 0.3 | GO:0005883 | neurofilament(GO:0005883) |
0.1 | 1.0 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
0.1 | 0.2 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.1 | 0.1 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
0.1 | 0.2 | GO:0038037 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
0.1 | 0.5 | GO:0097228 | sperm principal piece(GO:0097228) |
0.1 | 0.2 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.1 | 0.3 | GO:0001939 | female pronucleus(GO:0001939) |
0.1 | 0.2 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.1 | 0.6 | GO:0005771 | multivesicular body(GO:0005771) |
0.0 | 0.6 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
0.0 | 0.8 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.0 | 0.3 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.0 | 0.1 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.0 | 0.4 | GO:0031527 | filopodium membrane(GO:0031527) |
0.0 | 0.3 | GO:0042629 | mast cell granule(GO:0042629) |
0.0 | 0.4 | GO:0030897 | HOPS complex(GO:0030897) |
0.0 | 0.5 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
0.0 | 0.4 | GO:0000791 | euchromatin(GO:0000791) |
0.0 | 0.2 | GO:0030673 | axolemma(GO:0030673) |
0.0 | 1.5 | GO:0005811 | lipid particle(GO:0005811) |
0.0 | 0.2 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.0 | 3.0 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
0.0 | 0.3 | GO:0043194 | axon initial segment(GO:0043194) |
0.0 | 0.1 | GO:0002142 | stereocilia ankle link complex(GO:0002142) |
0.0 | 0.5 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
0.0 | 0.3 | GO:0071986 | Ragulator complex(GO:0071986) |
0.0 | 0.2 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
0.0 | 0.2 | GO:0045239 | tricarboxylic acid cycle enzyme complex(GO:0045239) |
0.0 | 0.6 | GO:0010369 | chromocenter(GO:0010369) |
0.0 | 0.7 | GO:0005732 | small nucleolar ribonucleoprotein complex(GO:0005732) |
0.0 | 0.1 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.0 | 0.4 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
0.0 | 0.3 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.0 | 0.2 | GO:0043202 | lysosomal lumen(GO:0043202) |
0.0 | 0.2 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.0 | 0.2 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
0.0 | 0.4 | GO:0042613 | MHC class II protein complex(GO:0042613) |
0.0 | 1.2 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.0 | 0.0 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.0 | 0.2 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.0 | 0.1 | GO:0008091 | spectrin(GO:0008091) |
0.0 | 0.4 | GO:0097431 | mitotic spindle pole(GO:0097431) |
0.0 | 0.4 | GO:0045120 | pronucleus(GO:0045120) |
0.0 | 0.1 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
0.0 | 0.2 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.0 | 0.3 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.0 | 0.2 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.0 | 0.6 | GO:0005614 | interstitial matrix(GO:0005614) |
0.0 | 0.2 | GO:0045261 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
0.0 | 0.3 | GO:0045263 | proton-transporting ATP synthase complex, coupling factor F(o)(GO:0045263) |
0.0 | 0.4 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
0.0 | 0.1 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
0.0 | 0.3 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.0 | 0.1 | GO:1990923 | PET complex(GO:1990923) |
0.0 | 0.4 | GO:0060293 | P granule(GO:0043186) pole plasm(GO:0045495) germ plasm(GO:0060293) |
0.0 | 0.2 | GO:0032806 | holo TFIIH complex(GO:0005675) carboxy-terminal domain protein kinase complex(GO:0032806) |
0.0 | 2.0 | GO:0005902 | microvillus(GO:0005902) |
0.0 | 0.1 | GO:0031417 | NatC complex(GO:0031417) |
0.0 | 0.7 | GO:0016235 | aggresome(GO:0016235) |
0.0 | 1.6 | GO:0001725 | stress fiber(GO:0001725) contractile actin filament bundle(GO:0097517) |
0.0 | 0.0 | GO:0061574 | ASAP complex(GO:0061574) |
0.0 | 1.1 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
0.0 | 1.2 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
0.0 | 0.1 | GO:0072534 | perineuronal net(GO:0072534) |
0.0 | 0.2 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.0 | 0.3 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
0.0 | 0.1 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
0.0 | 0.1 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
0.0 | 0.4 | GO:0030532 | small nuclear ribonucleoprotein complex(GO:0030532) |
0.0 | 0.3 | GO:0031083 | BLOC-1 complex(GO:0031083) |
0.0 | 0.2 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
0.0 | 0.5 | GO:0000777 | condensed chromosome kinetochore(GO:0000777) |
0.0 | 0.1 | GO:0032021 | NELF complex(GO:0032021) |
0.0 | 0.1 | GO:0098803 | respiratory chain complex(GO:0098803) |
0.0 | 0.7 | GO:0043198 | dendritic shaft(GO:0043198) |
0.0 | 0.1 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
0.0 | 0.3 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.0 | 0.1 | GO:0005828 | kinetochore microtubule(GO:0005828) |
0.0 | 0.1 | GO:0017059 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
0.0 | 0.3 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
0.0 | 0.4 | GO:0043196 | varicosity(GO:0043196) |
0.0 | 0.4 | GO:0070822 | Sin3-type complex(GO:0070822) |
0.0 | 0.2 | GO:0097225 | sperm midpiece(GO:0097225) |
0.0 | 0.1 | GO:0034709 | methylosome(GO:0034709) |
0.0 | 0.2 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
0.0 | 0.6 | GO:0000786 | nucleosome(GO:0000786) |
0.0 | 0.2 | GO:0000782 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
0.0 | 0.2 | GO:0098645 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
0.0 | 1.7 | GO:0005604 | basement membrane(GO:0005604) |
0.0 | 1.5 | GO:0005814 | centriole(GO:0005814) |
0.0 | 0.1 | GO:0071014 | post-mRNA release spliceosomal complex(GO:0071014) |
0.0 | 0.1 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
0.0 | 1.6 | GO:0016605 | PML body(GO:0016605) |
0.0 | 0.1 | GO:0001652 | granular component(GO:0001652) |
0.0 | 0.1 | GO:0000802 | transverse filament(GO:0000802) |
0.0 | 0.1 | GO:0031084 | BLOC-2 complex(GO:0031084) |
0.0 | 2.0 | GO:0016607 | nuclear speck(GO:0016607) |
0.0 | 0.1 | GO:0089701 | U2AF(GO:0089701) |
0.0 | 0.1 | GO:0043205 | fibril(GO:0043205) |
0.0 | 1.2 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
0.0 | 0.2 | GO:0030285 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
0.0 | 0.3 | GO:0031045 | dense core granule(GO:0031045) |
0.0 | 0.1 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
0.0 | 0.1 | GO:0097470 | ribbon synapse(GO:0097470) |
0.0 | 0.1 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.0 | 0.0 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.0 | 0.0 | GO:0055087 | Ski complex(GO:0055087) |
0.0 | 0.3 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
0.0 | 0.0 | GO:0000109 | nucleotide-excision repair complex(GO:0000109) |
0.0 | 0.6 | GO:0048786 | presynaptic active zone(GO:0048786) |
0.0 | 0.4 | GO:0032154 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
0.0 | 0.1 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
0.0 | 0.5 | GO:0042734 | presynaptic membrane(GO:0042734) |
0.0 | 0.1 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.0 | 0.1 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.0 | 0.4 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
0.0 | 0.3 | GO:0005682 | U5 snRNP(GO:0005682) |
0.0 | 0.2 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
0.0 | 25.4 | GO:0005783 | endoplasmic reticulum(GO:0005783) |
0.0 | 0.2 | GO:0001673 | male germ cell nucleus(GO:0001673) |
0.0 | 0.0 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
0.0 | 0.1 | GO:0000796 | condensin complex(GO:0000796) |
0.0 | 0.2 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
0.0 | 0.1 | GO:0032300 | mismatch repair complex(GO:0032300) |
0.0 | 0.1 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.0 | 0.1 | GO:0061700 | GATOR2 complex(GO:0061700) |
0.0 | 0.0 | GO:0005753 | mitochondrial proton-transporting ATP synthase complex(GO:0005753) |
0.0 | 0.4 | GO:0005684 | U2-type spliceosomal complex(GO:0005684) |
0.0 | 1.2 | GO:0000781 | chromosome, telomeric region(GO:0000781) |
0.0 | 1.3 | GO:0000922 | spindle pole(GO:0000922) |
0.0 | 4.1 | GO:0043235 | receptor complex(GO:0043235) |
0.0 | 0.1 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.0 | 0.0 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
0.0 | 0.2 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
0.0 | 0.8 | GO:0034707 | chloride channel complex(GO:0034707) |
0.0 | 0.1 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.0 | 0.1 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.0 | 0.1 | GO:0033270 | paranode region of axon(GO:0033270) |
0.0 | 0.1 | GO:0016272 | prefoldin complex(GO:0016272) |
0.0 | 0.0 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.0 | 0.2 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.0 | 0.0 | GO:0005914 | spot adherens junction(GO:0005914) |
0.0 | 0.0 | GO:0000153 | cytoplasmic ubiquitin ligase complex(GO:0000153) |
0.0 | 0.4 | GO:0045171 | intercellular bridge(GO:0045171) |
0.0 | 0.0 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.0 | 0.3 | GO:0044665 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
0.0 | 1.7 | GO:0031225 | anchored component of membrane(GO:0031225) |
0.0 | 0.0 | GO:0034991 | nuclear meiotic cohesin complex(GO:0034991) |
0.0 | 0.0 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.0 | 0.4 | GO:0005921 | gap junction(GO:0005921) |
0.0 | 0.0 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
0.0 | 0.2 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
0.0 | 0.0 | GO:0015934 | large ribosomal subunit(GO:0015934) |
0.0 | 0.0 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
0.0 | 0.0 | GO:0032591 | dendritic spine membrane(GO:0032591) |
0.0 | 0.1 | GO:0000124 | SAGA complex(GO:0000124) |
0.0 | 0.1 | GO:0020005 | symbiont-containing vacuole membrane(GO:0020005) |
0.0 | 0.0 | GO:1990752 | microtubule end(GO:1990752) |
0.0 | 0.1 | GO:0031902 | late endosome membrane(GO:0031902) |
0.0 | 0.2 | GO:0005865 | striated muscle thin filament(GO:0005865) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.5 | 7.4 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
2.5 | 7.4 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
1.4 | 2.9 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
1.3 | 3.9 | GO:0004771 | sterol esterase activity(GO:0004771) |
1.1 | 4.4 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
0.9 | 8.1 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.8 | 2.5 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.8 | 2.4 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.8 | 2.3 | GO:0038181 | bile acid receptor activity(GO:0038181) |
0.7 | 1.5 | GO:0070644 | vitamin D response element binding(GO:0070644) |
0.7 | 2.2 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.7 | 2.2 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
0.6 | 3.1 | GO:0070728 | leucine binding(GO:0070728) |
0.6 | 1.8 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.6 | 1.2 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) |
0.6 | 2.3 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.5 | 1.6 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
0.5 | 1.5 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.5 | 3.3 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
0.5 | 1.8 | GO:0071614 | linoleic acid epoxygenase activity(GO:0071614) |
0.4 | 2.2 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
0.4 | 4.9 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.4 | 5.3 | GO:0015643 | toxic substance binding(GO:0015643) |
0.4 | 2.5 | GO:0050733 | RS domain binding(GO:0050733) |
0.4 | 2.4 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.4 | 1.2 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
0.4 | 1.5 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
0.4 | 1.5 | GO:1990239 | steroid hormone binding(GO:1990239) |
0.4 | 1.1 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.4 | 1.1 | GO:0016312 | inositol bisphosphate phosphatase activity(GO:0016312) |
0.4 | 1.1 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
0.4 | 1.4 | GO:0033142 | progesterone receptor binding(GO:0033142) |
0.3 | 1.4 | GO:0032564 | dATP binding(GO:0032564) |
0.3 | 0.7 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
0.3 | 1.3 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
0.3 | 0.3 | GO:0004337 | geranyltranstransferase activity(GO:0004337) |
0.3 | 3.5 | GO:0052810 | cobinamide kinase activity(GO:0008819) phytol kinase activity(GO:0010276) phenol kinase activity(GO:0018720) cyclin-dependent protein kinase activating kinase regulator activity(GO:0019914) inositol tetrakisphosphate 2-kinase activity(GO:0032942) heptose 7-phosphate kinase activity(GO:0033785) aminoglycoside phosphotransferase activity(GO:0034071) eukaryotic elongation factor-2 kinase regulator activity(GO:0042556) eukaryotic elongation factor-2 kinase activator activity(GO:0042557) LPPG:FO 2-phospho-L-lactate transferase activity(GO:0043743) cytidine kinase activity(GO:0043771) glycerate 2-kinase activity(GO:0043798) (S)-lactate 2-kinase activity(GO:0043841) phosphoserine:homoserine phosphotransferase activity(GO:0043899) L-seryl-tRNA(Sec) kinase activity(GO:0043915) phosphocholine transferase activity(GO:0044605) GTP-dependent polynucleotide kinase activity(GO:0051735) farnesol kinase activity(GO:0052668) CTP:2-trans,-6-trans-farnesol kinase activity(GO:0052669) geraniol kinase activity(GO:0052670) geranylgeraniol kinase activity(GO:0052671) CTP:geranylgeraniol kinase activity(GO:0052672) prenol kinase activity(GO:0052673) 1-phosphatidylinositol-5-kinase activity(GO:0052810) 1-phosphatidylinositol-3-phosphate 4-kinase activity(GO:0052811) phosphatidylinositol-3,4-bisphosphate 5-kinase activity(GO:0052812) inositol-3,4,6-trisphosphate 1-kinase activity(GO:0052835) inositol 5-diphosphate pentakisphosphate 5-kinase activity(GO:0052836) inositol diphosphate tetrakisphosphate kinase activity(GO:0052839) |
0.3 | 1.0 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.3 | 0.9 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
0.3 | 0.9 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
0.3 | 3.7 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.3 | 1.2 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.3 | 0.9 | GO:0005347 | ATP transmembrane transporter activity(GO:0005347) |
0.3 | 0.9 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.3 | 0.9 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.3 | 1.5 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.3 | 0.9 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.3 | 0.6 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
0.3 | 1.1 | GO:0035671 | enone reductase activity(GO:0035671) |
0.3 | 1.6 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
0.3 | 0.8 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.3 | 3.1 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
0.3 | 0.8 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
0.3 | 0.8 | GO:0004359 | glutaminase activity(GO:0004359) |
0.2 | 6.2 | GO:0004119 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) photoreceptor cyclic-nucleotide phosphodiesterase activity(GO:0004120) 7,8-dihydro-D-neopterin 2',3'-cyclic phosphate phosphodiesterase activity(GO:0044688) inositol phosphosphingolipid phospholipase activity(GO:0052712) inositol phosphorylceramide phospholipase activity(GO:0052713) mannosyl-inositol phosphorylceramide phospholipase activity(GO:0052714) mannosyl-diinositol phosphorylceramide phospholipase activity(GO:0052715) |
0.2 | 8.1 | GO:0080032 | prenylcysteine methylesterase activity(GO:0010296) 1-oxa-2-oxocycloheptane lactonase activity(GO:0018731) sulfolactone hydrolase activity(GO:0018732) butyrolactone hydrolase activity(GO:0018734) endosulfan lactone lactonase activity(GO:0034892) L-ascorbate 6-phosphate lactonase activity(GO:0035460) Ser-tRNA(Thr) hydrolase activity(GO:0043905) Ala-tRNA(Pro) hydrolase activity(GO:0043906) Cys-tRNA(Pro) hydrolase activity(GO:0043907) Ser(Gly)-tRNA(Ala) hydrolase activity(GO:0043908) all-trans-retinyl-palmitate hydrolase, all-trans-retinol forming activity(GO:0047376) mannosyl-oligosaccharide 1,6-alpha-mannosidase activity(GO:0052767) mannosyl-oligosaccharide 1,3-alpha-mannosidase activity(GO:0052768) methyl indole-3-acetate esterase activity(GO:0080030) methyl salicylate esterase activity(GO:0080031) methyl jasmonate esterase activity(GO:0080032) |
0.2 | 1.2 | GO:0008430 | selenium binding(GO:0008430) |
0.2 | 0.5 | GO:0042281 | dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase activity(GO:0042281) |
0.2 | 1.0 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
0.2 | 1.2 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.2 | 1.9 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
0.2 | 1.4 | GO:0043338 | CTP:2,3-di-O-geranylgeranyl-sn-glycero-1-phosphate cytidyltransferase activity(GO:0043338) phospholactate guanylyltransferase activity(GO:0043814) ATP:coenzyme F420 adenylyltransferase activity(GO:0043910) UDP-N-acetylgalactosamine diphosphorylase activity(GO:0052630) |
0.2 | 1.9 | GO:0016668 | oxidoreductase activity, acting on a sulfur group of donors, NAD(P) as acceptor(GO:0016668) |
0.2 | 0.5 | GO:0004779 | sulfate adenylyltransferase activity(GO:0004779) |
0.2 | 0.9 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.2 | 0.2 | GO:0050692 | DBD domain binding(GO:0050692) |
0.2 | 2.5 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
0.2 | 0.6 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.2 | 0.8 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
0.2 | 1.1 | GO:0016151 | nickel cation binding(GO:0016151) |
0.2 | 0.2 | GO:0030792 | methylarsonite methyltransferase activity(GO:0030792) |
0.2 | 0.6 | GO:0030350 | iron-responsive element binding(GO:0030350) |
0.2 | 3.3 | GO:0043295 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
0.2 | 0.6 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
0.2 | 0.8 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.2 | 1.2 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
0.2 | 0.4 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.2 | 0.6 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
0.2 | 0.6 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
0.2 | 1.2 | GO:0043426 | MRF binding(GO:0043426) |
0.2 | 0.8 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.2 | 1.8 | GO:0002162 | dystroglycan binding(GO:0002162) |
0.2 | 0.6 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.2 | 1.7 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
0.2 | 0.6 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
0.2 | 0.4 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
0.2 | 0.4 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
0.2 | 0.2 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
0.2 | 0.4 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.2 | 0.7 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.2 | 0.2 | GO:0001884 | pyrimidine nucleoside binding(GO:0001884) |
0.2 | 1.6 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
0.2 | 0.5 | GO:0034191 | apolipoprotein A-I receptor binding(GO:0034191) |
0.2 | 0.5 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
0.2 | 0.5 | GO:0032190 | acrosin binding(GO:0032190) |
0.2 | 0.5 | GO:0080130 | L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
0.2 | 1.3 | GO:0016679 | oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) |
0.2 | 0.5 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.2 | 0.7 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
0.2 | 0.5 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
0.2 | 0.5 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
0.2 | 0.3 | GO:0032139 | dinucleotide insertion or deletion binding(GO:0032139) |
0.2 | 0.7 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
0.2 | 3.3 | GO:0003785 | actin monomer binding(GO:0003785) |
0.2 | 1.0 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
0.2 | 0.5 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.2 | 0.8 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.2 | 0.8 | GO:0017040 | ceramidase activity(GO:0017040) |
0.2 | 1.0 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
0.2 | 1.8 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
0.2 | 0.5 | GO:0004103 | choline kinase activity(GO:0004103) |
0.2 | 0.5 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.2 | 7.2 | GO:0016763 | transferase activity, transferring pentosyl groups(GO:0016763) |
0.2 | 0.3 | GO:0008545 | JUN kinase kinase activity(GO:0008545) |
0.2 | 0.2 | GO:0000009 | alpha-1,6-mannosyltransferase activity(GO:0000009) |
0.2 | 0.5 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) |
0.2 | 0.9 | GO:0004064 | arylesterase activity(GO:0004064) |
0.2 | 0.8 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
0.2 | 0.6 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.2 | 2.3 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
0.2 | 0.5 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
0.2 | 2.3 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
0.2 | 0.3 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.2 | 0.6 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
0.2 | 0.5 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
0.1 | 0.4 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
0.1 | 0.6 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
0.1 | 0.3 | GO:0000403 | Y-form DNA binding(GO:0000403) |
0.1 | 0.7 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
0.1 | 0.4 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
0.1 | 1.5 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.1 | 0.4 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
0.1 | 0.9 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
0.1 | 0.4 | GO:0016215 | acyl-CoA desaturase activity(GO:0016215) |
0.1 | 1.8 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
0.1 | 3.0 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.1 | 1.0 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
0.1 | 0.4 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
0.1 | 2.7 | GO:0003756 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
0.1 | 0.5 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
0.1 | 1.4 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.1 | 4.3 | GO:0042169 | SH2 domain binding(GO:0042169) |
0.1 | 1.5 | GO:0001223 | transcription coactivator binding(GO:0001223) |
0.1 | 0.4 | GO:0016882 | cyclo-ligase activity(GO:0016882) |
0.1 | 1.3 | GO:0070990 | snRNP binding(GO:0070990) |
0.1 | 0.5 | GO:0005047 | signal recognition particle binding(GO:0005047) |
0.1 | 0.5 | GO:0061665 | SUMO ligase activity(GO:0061665) |
0.1 | 2.5 | GO:0001221 | transcription cofactor binding(GO:0001221) |
0.1 | 0.3 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
0.1 | 1.0 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.1 | 0.5 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.1 | 0.3 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.1 | 0.4 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.1 | 1.8 | GO:0030275 | LRR domain binding(GO:0030275) |
0.1 | 0.5 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
0.1 | 1.2 | GO:0004955 | prostaglandin receptor activity(GO:0004955) |
0.1 | 0.4 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
0.1 | 1.4 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
0.1 | 1.8 | GO:0030552 | cAMP binding(GO:0030552) |
0.1 | 2.0 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
0.1 | 3.2 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
0.1 | 1.2 | GO:0015266 | protein channel activity(GO:0015266) |
0.1 | 0.8 | GO:0043140 | ATP-dependent 3'-5' DNA helicase activity(GO:0043140) |
0.1 | 0.4 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.1 | 0.4 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
0.1 | 0.4 | GO:0015143 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
0.1 | 0.1 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.1 | 0.2 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
0.1 | 0.6 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.1 | 1.4 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.1 | 0.7 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.1 | 0.1 | GO:0070546 | L-phenylalanine aminotransferase activity(GO:0070546) |
0.1 | 0.4 | GO:0035514 | DNA demethylase activity(GO:0035514) |
0.1 | 0.4 | GO:0030519 | snoRNP binding(GO:0030519) |
0.1 | 0.7 | GO:0030235 | nitric-oxide synthase regulator activity(GO:0030235) |
0.1 | 2.3 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
0.1 | 0.6 | GO:0000828 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
0.1 | 2.2 | GO:0008483 | transaminase activity(GO:0008483) |
0.1 | 0.8 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
0.1 | 0.4 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
0.1 | 0.8 | GO:0016892 | endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
0.1 | 0.4 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.1 | 1.3 | GO:0004532 | exoribonuclease activity(GO:0004532) |
0.1 | 0.5 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.1 | 2.5 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
0.1 | 0.1 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.1 | 0.7 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.1 | 0.7 | GO:0005338 | nucleotide-sugar transmembrane transporter activity(GO:0005338) |
0.1 | 0.2 | GO:0015166 | polyol transmembrane transporter activity(GO:0015166) |
0.1 | 0.5 | GO:0016721 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
0.1 | 0.4 | GO:0002046 | opsin binding(GO:0002046) |
0.1 | 0.3 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
0.1 | 0.3 | GO:0070191 | methionine-R-sulfoxide reductase activity(GO:0070191) |
0.1 | 0.4 | GO:0052834 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
0.1 | 0.1 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
0.1 | 0.4 | GO:0016289 | CoA hydrolase activity(GO:0016289) |
0.1 | 0.9 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.1 | 1.2 | GO:0015250 | water channel activity(GO:0015250) |
0.1 | 0.1 | GO:0070403 | NAD+ binding(GO:0070403) |
0.1 | 0.3 | GO:1901612 | cardiolipin binding(GO:1901612) |
0.1 | 0.4 | GO:0052794 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
0.1 | 0.4 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
0.1 | 0.3 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
0.1 | 0.8 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
0.1 | 2.9 | GO:0004033 | aldo-keto reductase (NADP) activity(GO:0004033) |
0.1 | 0.3 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.1 | 0.7 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.1 | 0.6 | GO:0003997 | acyl-CoA oxidase activity(GO:0003997) |
0.1 | 0.4 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.1 | 0.4 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
0.1 | 0.4 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
0.1 | 1.3 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
0.1 | 0.4 | GO:0001642 | group III metabotropic glutamate receptor activity(GO:0001642) |
0.1 | 0.3 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.1 | 0.7 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
0.1 | 0.3 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
0.1 | 0.9 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.1 | 1.6 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
0.1 | 0.6 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
0.1 | 0.8 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
0.1 | 0.6 | GO:0046790 | virion binding(GO:0046790) |
0.1 | 0.3 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.1 | 0.9 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.1 | 1.2 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
0.1 | 0.5 | GO:0030291 | protein serine/threonine kinase inhibitor activity(GO:0030291) |
0.1 | 1.6 | GO:0030506 | ankyrin binding(GO:0030506) |
0.1 | 0.2 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
0.1 | 0.6 | GO:0004526 | ribonuclease P activity(GO:0004526) |
0.1 | 1.3 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
0.1 | 1.6 | GO:0004364 | glutathione transferase activity(GO:0004364) |
0.1 | 0.2 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.1 | 0.3 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
0.1 | 0.4 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
0.1 | 0.3 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
0.1 | 1.2 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
0.1 | 0.3 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
0.1 | 0.2 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
0.1 | 0.9 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
0.1 | 0.2 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.1 | 0.1 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
0.1 | 0.1 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
0.1 | 0.3 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
0.1 | 0.3 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.1 | 0.7 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.1 | 0.2 | GO:0034618 | arginine binding(GO:0034618) |
0.1 | 0.2 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
0.1 | 1.4 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
0.1 | 0.3 | GO:0031544 | peptidyl-proline 3-dioxygenase activity(GO:0031544) |
0.1 | 1.2 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.1 | 0.2 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
0.1 | 0.5 | GO:0039706 | co-receptor binding(GO:0039706) |
0.1 | 0.2 | GO:0070698 | type I activin receptor binding(GO:0070698) |
0.1 | 0.4 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
0.1 | 0.3 | GO:0003916 | DNA topoisomerase activity(GO:0003916) |
0.1 | 0.5 | GO:0035198 | miRNA binding(GO:0035198) |
0.1 | 0.1 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.1 | 0.3 | GO:0010858 | calcium-dependent protein kinase regulator activity(GO:0010858) |
0.1 | 0.4 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.1 | 1.1 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.1 | 0.2 | GO:0016769 | transferase activity, transferring nitrogenous groups(GO:0016769) |
0.1 | 0.4 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
0.1 | 0.7 | GO:0010485 | H4 histone acetyltransferase activity(GO:0010485) |
0.1 | 0.2 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.1 | 1.0 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
0.1 | 0.3 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.1 | 0.2 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
0.1 | 0.4 | GO:0016936 | galactoside binding(GO:0016936) |
0.1 | 0.4 | GO:0005114 | type II transforming growth factor beta receptor binding(GO:0005114) |
0.1 | 0.6 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.1 | 0.7 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
0.1 | 0.7 | GO:0008474 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
0.1 | 1.8 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
0.1 | 0.6 | GO:0070402 | NADPH binding(GO:0070402) |
0.1 | 0.4 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.1 | 0.3 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
0.1 | 1.4 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.1 | 0.1 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
0.1 | 0.2 | GO:0071553 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
0.1 | 1.1 | GO:0015295 | solute:proton symporter activity(GO:0015295) |
0.1 | 0.3 | GO:0008808 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) |
0.1 | 0.6 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
0.1 | 0.9 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
0.1 | 0.2 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
0.1 | 0.5 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
0.1 | 0.2 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
0.1 | 0.5 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.1 | 0.3 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
0.1 | 0.2 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
0.1 | 0.3 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
0.1 | 0.5 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.1 | 0.2 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
0.1 | 0.1 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
0.1 | 0.3 | GO:0032453 | histone demethylase activity (H3-K4 specific)(GO:0032453) |
0.1 | 0.2 | GO:0048018 | receptor agonist activity(GO:0048018) |
0.1 | 0.5 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.1 | 0.3 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.1 | 0.6 | GO:0005522 | profilin binding(GO:0005522) |
0.1 | 1.2 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
0.1 | 0.3 | GO:0004556 | alpha-amylase activity(GO:0004556) |
0.1 | 0.9 | GO:0016893 | endoribonuclease activity, producing 5'-phosphomonoesters(GO:0016891) endonuclease activity, active with either ribo- or deoxyribonucleic acids and producing 5'-phosphomonoesters(GO:0016893) |
0.1 | 0.4 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.1 | 1.4 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
0.1 | 0.2 | GO:2001070 | starch binding(GO:2001070) |
0.1 | 0.5 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
0.1 | 0.2 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.1 | 0.7 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
0.1 | 0.4 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.1 | 0.3 | GO:0008948 | oxaloacetate decarboxylase activity(GO:0008948) |
0.1 | 0.5 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
0.1 | 0.3 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
0.1 | 0.7 | GO:0005523 | tropomyosin binding(GO:0005523) |
0.1 | 1.4 | GO:0015923 | mannosidase activity(GO:0015923) |
0.1 | 0.1 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.1 | 0.3 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.1 | 0.4 | GO:0030492 | hemoglobin binding(GO:0030492) |
0.1 | 1.0 | GO:0004889 | acetylcholine-activated cation-selective channel activity(GO:0004889) |
0.1 | 0.3 | GO:1990405 | protein antigen binding(GO:1990405) |
0.1 | 0.3 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.1 | 0.9 | GO:0004629 | phospholipase C activity(GO:0004629) |
0.1 | 0.3 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.1 | 2.2 | GO:0005109 | frizzled binding(GO:0005109) |
0.1 | 0.2 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
0.1 | 0.6 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
0.1 | 0.4 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
0.1 | 0.9 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.1 | 1.5 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
0.1 | 0.2 | GO:0050897 | cobalt ion binding(GO:0050897) |
0.1 | 0.1 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
0.1 | 0.9 | GO:0050661 | NADP binding(GO:0050661) |
0.1 | 0.3 | GO:0004457 | lactate dehydrogenase activity(GO:0004457) |
0.1 | 0.1 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.1 | 0.2 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
0.1 | 1.9 | GO:0000049 | tRNA binding(GO:0000049) |
0.1 | 0.3 | GO:0070034 | telomerase RNA binding(GO:0070034) |
0.1 | 1.6 | GO:0016749 | N-succinyltransferase activity(GO:0016749) |
0.1 | 1.8 | GO:0048487 | beta-tubulin binding(GO:0048487) |
0.1 | 0.1 | GO:0004705 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
0.1 | 0.1 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.1 | 0.2 | GO:0030983 | mismatched DNA binding(GO:0030983) |
0.1 | 0.2 | GO:0071253 | connexin binding(GO:0071253) |
0.1 | 0.7 | GO:0008252 | nucleotidase activity(GO:0008252) |
0.1 | 0.2 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.1 | 0.2 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
0.1 | 0.2 | GO:0000339 | RNA cap binding(GO:0000339) |
0.1 | 0.5 | GO:0019177 | thiamine-pyrophosphatase activity(GO:0004787) UDP-2,3-diacylglucosamine hydrolase activity(GO:0008758) dATP pyrophosphohydrolase activity(GO:0008828) dihydroneopterin monophosphate phosphatase activity(GO:0019176) dihydroneopterin triphosphate pyrophosphohydrolase activity(GO:0019177) dTTP diphosphatase activity(GO:0036218) phosphocholine hydrolase activity(GO:0044606) |
0.1 | 0.1 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
0.1 | 0.1 | GO:0030911 | TPR domain binding(GO:0030911) |
0.1 | 0.4 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
0.1 | 1.5 | GO:0098531 | RNA polymerase II transcription factor activity, ligand-activated sequence-specific DNA binding(GO:0004879) transcription factor activity, direct ligand regulated sequence-specific DNA binding(GO:0098531) |
0.1 | 0.2 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
0.1 | 0.3 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.1 | 0.1 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
0.1 | 1.0 | GO:0031369 | translation initiation factor binding(GO:0031369) |
0.1 | 0.2 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.1 | 0.6 | GO:0036002 | pre-mRNA binding(GO:0036002) |
0.1 | 0.1 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
0.1 | 0.5 | GO:0019789 | SUMO transferase activity(GO:0019789) |
0.1 | 0.4 | GO:0005160 | transforming growth factor beta receptor binding(GO:0005160) |
0.0 | 0.1 | GO:0005148 | prolactin receptor binding(GO:0005148) |
0.0 | 0.1 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
0.0 | 0.1 | GO:0031685 | adenosine receptor binding(GO:0031685) |
0.0 | 2.1 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
0.0 | 0.4 | GO:0034847 | pinocarveol dehydrogenase activity(GO:0018446) chloral hydrate dehydrogenase activity(GO:0018447) hydroxymethylmethylsilanediol oxidase activity(GO:0018448) 1-phenylethanol dehydrogenase activity(GO:0018449) myrtenol dehydrogenase activity(GO:0018450) cis-1,2-dihydroxy-1,2-dihydro-8-carboxynaphthalene dehydrogenase activity(GO:0034522) 3-hydroxy-4-methyloctanoyl-CoA dehydrogenase activity(GO:0034582) 2-hydroxy-4-isopropenylcyclohexane-1-carboxyl-CoA dehydrogenase activity(GO:0034778) cis-9,10-dihydroanthracene-9,10-diol dehydrogenase activity(GO:0034817) citronellol dehydrogenase activity(GO:0034821) naphthyl-2-hydroxymethyl-succinyl-CoA dehydrogenase activity(GO:0034847) 2,4,4-trimethyl-1-pentanol dehydrogenase activity(GO:0034863) 2,4,4-trimethyl-3-hydroxypentanoyl-CoA dehydrogenase activity(GO:0034868) 1-hydroxy-4,4-dimethylpentan-3-one dehydrogenase activity(GO:0034871) endosulfan diol dehydrogenase activity(GO:0034891) endosulfan hydroxyether dehydrogenase activity(GO:0034901) 3-hydroxy-2-methylhexanoyl-CoA dehydrogenase activity(GO:0034918) 3-hydroxy-2,6-dimethyl-5-methylene-heptanoyl-CoA dehydrogenase activity(GO:0034944) versicolorin reductase activity(GO:0042469) ketoreductase activity(GO:0045703) |
0.0 | 0.2 | GO:0036374 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
0.0 | 0.1 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
0.0 | 0.6 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.0 | 0.1 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.0 | 1.2 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.0 | 0.2 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.0 | 0.1 | GO:0008147 | structural constituent of bone(GO:0008147) |
0.0 | 0.0 | GO:0016418 | S-acetyltransferase activity(GO:0016418) |
0.0 | 0.2 | GO:0001849 | complement component C1q binding(GO:0001849) |
0.0 | 0.0 | GO:0043398 | HLH domain binding(GO:0043398) |
0.0 | 1.3 | GO:0030971 | receptor tyrosine kinase binding(GO:0030971) |
0.0 | 0.2 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
0.0 | 0.1 | GO:0050815 | phosphoserine binding(GO:0050815) |
0.0 | 0.1 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
0.0 | 0.4 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
0.0 | 0.2 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.0 | 0.1 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.0 | 0.0 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) |
0.0 | 0.0 | GO:0016662 | oxidoreductase activity, acting on other nitrogenous compounds as donors, cytochrome as acceptor(GO:0016662) |
0.0 | 0.3 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.0 | 4.0 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
0.0 | 0.6 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
0.0 | 0.1 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.0 | 0.2 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
0.0 | 0.1 | GO:0000026 | alpha-1,2-mannosyltransferase activity(GO:0000026) |
0.0 | 0.0 | GO:0016933 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
0.0 | 2.8 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
0.0 | 0.1 | GO:0001161 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) |
0.0 | 0.3 | GO:0031996 | thioesterase binding(GO:0031996) |
0.0 | 0.0 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
0.0 | 0.2 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
0.0 | 0.3 | GO:0042171 | lysophosphatidic acid acyltransferase activity(GO:0042171) lysophospholipid acyltransferase activity(GO:0071617) |
0.0 | 0.5 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
0.0 | 0.4 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
0.0 | 0.2 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.0 | 0.2 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
0.0 | 0.4 | GO:0070628 | proteasome binding(GO:0070628) |
0.0 | 0.1 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
0.0 | 0.4 | GO:0051184 | cofactor transporter activity(GO:0051184) |
0.0 | 0.4 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.0 | 0.5 | GO:0038187 | signaling pattern recognition receptor activity(GO:0008329) pattern recognition receptor activity(GO:0038187) |
0.0 | 1.1 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
0.0 | 0.5 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.0 | 0.1 | GO:0016453 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
0.0 | 0.1 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
0.0 | 0.6 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
0.0 | 0.1 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
0.0 | 0.2 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
0.0 | 2.7 | GO:0008175 | tRNA methyltransferase activity(GO:0008175) |
0.0 | 0.1 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
0.0 | 0.1 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
0.0 | 6.1 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.0 | 0.1 | GO:0005165 | neurotrophin receptor binding(GO:0005165) |
0.0 | 0.4 | GO:0005227 | calcium activated cation channel activity(GO:0005227) |
0.0 | 0.2 | GO:0016653 | oxidoreductase activity, acting on NAD(P)H, heme protein as acceptor(GO:0016653) |
0.0 | 0.1 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
0.0 | 2.0 | GO:0003724 | RNA helicase activity(GO:0003724) ATP-dependent RNA helicase activity(GO:0004004) RNA-dependent ATPase activity(GO:0008186) |
0.0 | 0.1 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
0.0 | 0.5 | GO:1990939 | ATP-dependent microtubule motor activity(GO:1990939) |
0.0 | 0.3 | GO:0015645 | fatty acid ligase activity(GO:0015645) |
0.0 | 0.4 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
0.0 | 0.1 | GO:0070052 | collagen V binding(GO:0070052) |
0.0 | 0.1 | GO:0008823 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
0.0 | 0.1 | GO:0051373 | FATZ binding(GO:0051373) |
0.0 | 1.1 | GO:0035326 | enhancer binding(GO:0035326) |
0.0 | 0.0 | GO:0051723 | protein methylesterase activity(GO:0051723) |
0.0 | 0.0 | GO:0015927 | trehalase activity(GO:0015927) |
0.0 | 0.4 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.0 | 0.4 | GO:0008327 | methyl-CpG binding(GO:0008327) |
0.0 | 0.2 | GO:0005113 | patched binding(GO:0005113) |
0.0 | 0.3 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.0 | 0.2 | GO:0016208 | AMP binding(GO:0016208) |
0.0 | 0.1 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
0.0 | 0.2 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
0.0 | 0.6 | GO:0016814 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amidines(GO:0016814) |
0.0 | 0.2 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
0.0 | 0.6 | GO:0016645 | oxidoreductase activity, acting on the CH-NH group of donors(GO:0016645) |
0.0 | 0.1 | GO:0042609 | CD4 receptor binding(GO:0042609) |
0.0 | 1.3 | GO:0030276 | clathrin binding(GO:0030276) |
0.0 | 0.1 | GO:0031852 | mu-type opioid receptor binding(GO:0031852) |
0.0 | 0.0 | GO:0004376 | glycolipid mannosyltransferase activity(GO:0004376) |
0.0 | 0.2 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
0.0 | 0.0 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
0.0 | 0.7 | GO:0051059 | NF-kappaB binding(GO:0051059) |
0.0 | 0.1 | GO:0098988 | G-protein coupled glutamate receptor activity(GO:0098988) |
0.0 | 0.1 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.0 | 0.4 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.0 | 0.3 | GO:0070513 | death domain binding(GO:0070513) |
0.0 | 0.0 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
0.0 | 0.2 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
0.0 | 0.1 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.0 | 0.1 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.0 | 0.2 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
0.0 | 0.1 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.0 | 0.0 | GO:0004365 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
0.0 | 0.1 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.0 | 0.1 | GO:0051380 | norepinephrine binding(GO:0051380) |
0.0 | 0.1 | GO:0038064 | collagen receptor activity(GO:0038064) |
0.0 | 0.6 | GO:0070063 | RNA polymerase binding(GO:0070063) |
0.0 | 0.0 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
0.0 | 0.0 | GO:0008409 | 5'-3' exonuclease activity(GO:0008409) |
0.0 | 0.1 | GO:0018585 | fluorene oxygenase activity(GO:0018585) |
0.0 | 0.0 | GO:0035870 | dITP diphosphatase activity(GO:0035870) |
0.0 | 0.1 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
0.0 | 0.3 | GO:0016594 | glycine binding(GO:0016594) |
0.0 | 0.4 | GO:0043531 | ADP binding(GO:0043531) |
0.0 | 0.1 | GO:0010853 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
0.0 | 0.0 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
0.0 | 0.1 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
0.0 | 0.1 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
0.0 | 0.3 | GO:0030228 | lipoprotein particle receptor activity(GO:0030228) |
0.0 | 0.1 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
0.0 | 0.2 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.0 | 0.5 | GO:0005527 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
0.0 | 0.1 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.0 | 0.7 | GO:0019894 | kinesin binding(GO:0019894) |
0.0 | 0.1 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
0.0 | 0.0 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
0.0 | 0.8 | GO:0052770 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
0.0 | 0.2 | GO:0001608 | G-protein coupled nucleotide receptor activity(GO:0001608) G-protein coupled purinergic nucleotide receptor activity(GO:0045028) |
0.0 | 1.0 | GO:0004702 | receptor signaling protein serine/threonine kinase activity(GO:0004702) |
0.0 | 0.1 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.0 | 0.3 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.0 | 0.5 | GO:0016765 | transferase activity, transferring alkyl or aryl (other than methyl) groups(GO:0016765) |
0.0 | 1.0 | GO:0005518 | collagen binding(GO:0005518) |
0.0 | 0.1 | GO:0008174 | mRNA methyltransferase activity(GO:0008174) |
0.0 | 0.0 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.0 | 0.1 | GO:0044548 | S100 protein binding(GO:0044548) |
0.0 | 0.1 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
0.0 | 0.0 | GO:0003880 | protein C-terminal carboxyl O-methyltransferase activity(GO:0003880) |
0.0 | 0.1 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
0.0 | 0.1 | GO:0035197 | siRNA binding(GO:0035197) |
0.0 | 0.0 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
0.0 | 0.2 | GO:0008061 | chitin binding(GO:0008061) |
0.0 | 0.1 | GO:0043515 | kinetochore binding(GO:0043515) |
0.0 | 0.1 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) dopamine neurotransmitter receptor activity(GO:0004952) |
0.0 | 0.2 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
0.0 | 0.1 | GO:0046538 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
0.0 | 0.1 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.0 | 0.4 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.0 | 0.1 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.0 | 0.1 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
0.0 | 0.0 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
0.0 | 0.2 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
0.0 | 0.1 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
0.0 | 0.2 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.0 | 0.3 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
0.0 | 0.2 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.0 | 0.1 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
0.0 | 0.1 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.0 | 0.1 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.0 | 0.0 | GO:0001614 | purinergic nucleotide receptor activity(GO:0001614) nucleotide receptor activity(GO:0016502) |
0.0 | 0.3 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
0.0 | 1.9 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
0.0 | 0.1 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
0.0 | 0.1 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
0.0 | 0.3 | GO:0017025 | TBP-class protein binding(GO:0017025) |
0.0 | 0.6 | GO:0008080 | N-acetyltransferase activity(GO:0008080) |
0.0 | 0.3 | GO:0070566 | adenylyltransferase activity(GO:0070566) |
0.0 | 0.2 | GO:0016667 | oxidoreductase activity, acting on a sulfur group of donors(GO:0016667) |
0.0 | 0.1 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
0.0 | 5.3 | GO:0005525 | GTP binding(GO:0005525) |
0.0 | 0.1 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
0.0 | 0.0 | GO:0034604 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
0.0 | 0.0 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
0.0 | 0.1 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
0.0 | 2.3 | GO:0004721 | phosphoprotein phosphatase activity(GO:0004721) |
0.0 | 0.0 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
0.0 | 0.3 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
0.0 | 0.0 | GO:0070410 | co-SMAD binding(GO:0070410) |
0.0 | 0.1 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
0.0 | 0.1 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
0.0 | 0.1 | GO:1990254 | keratin filament binding(GO:1990254) |
0.0 | 0.0 | GO:0004954 | prostanoid receptor activity(GO:0004954) |
0.0 | 0.1 | GO:0015464 | acetylcholine receptor activity(GO:0015464) |
0.0 | 0.1 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
0.0 | 0.1 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
0.0 | 0.6 | GO:0001227 | transcriptional repressor activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001227) |
0.0 | 0.1 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.0 | 0.5 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
0.0 | 0.3 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.0 | 1.6 | GO:0008083 | growth factor activity(GO:0008083) |
0.0 | 0.4 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
0.0 | 0.7 | GO:1902936 | phosphatidylinositol bisphosphate binding(GO:1902936) |
0.0 | 0.2 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.0 | 3.3 | GO:0000982 | transcription factor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0000982) |
0.0 | 0.0 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
0.0 | 0.0 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
0.0 | 0.1 | GO:0015321 | sodium-dependent phosphate transmembrane transporter activity(GO:0015321) |
0.0 | 0.0 | GO:0017153 | sodium:dicarboxylate symporter activity(GO:0017153) |
0.0 | 0.2 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
0.0 | 0.1 | GO:0008494 | translation activator activity(GO:0008494) |
0.0 | 1.3 | GO:0052689 | carboxylic ester hydrolase activity(GO:0052689) |
0.0 | 0.2 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.0 | 0.1 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.0 | 0.6 | GO:0008188 | neuropeptide receptor activity(GO:0008188) |
0.0 | 0.6 | GO:0015078 | hydrogen ion transmembrane transporter activity(GO:0015078) |
0.0 | 0.0 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.0 | 0.1 | GO:0016877 | ligase activity, forming carbon-sulfur bonds(GO:0016877) |
0.0 | 0.1 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
0.0 | 1.1 | GO:0036459 | thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) ubiquitinyl hydrolase activity(GO:0101005) |
0.0 | 0.0 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
0.0 | 0.0 | GO:0015665 | alcohol transmembrane transporter activity(GO:0015665) |
0.0 | 0.0 | GO:0016723 | oxidoreductase activity, oxidizing metal ions, NAD or NADP as acceptor(GO:0016723) |
0.0 | 0.0 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) |
0.0 | 0.0 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.0 | 1.4 | GO:0008022 | protein C-terminus binding(GO:0008022) |
0.0 | 1.0 | GO:0016820 | hydrolase activity, acting on acid anhydrides, catalyzing transmembrane movement of substances(GO:0016820) |
0.0 | 0.2 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.0 | 0.1 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
0.0 | 0.0 | GO:0048256 | flap endonuclease activity(GO:0048256) |
0.0 | 0.0 | GO:1904680 | oligopeptide transmembrane transporter activity(GO:0035673) peptide transmembrane transporter activity(GO:1904680) |
0.0 | 0.0 | GO:0008142 | oxysterol binding(GO:0008142) |
0.0 | 0.3 | GO:0015485 | cholesterol binding(GO:0015485) |
0.0 | 0.0 | GO:0019976 | interleukin-2 binding(GO:0019976) |
0.0 | 0.1 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
0.0 | 0.2 | GO:0005537 | mannose binding(GO:0005537) |
0.0 | 0.0 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
0.0 | 0.7 | GO:0000149 | SNARE binding(GO:0000149) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.6 | 12.6 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.3 | 8.1 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.2 | 0.2 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
0.2 | 0.5 | ST STAT3 PATHWAY | STAT3 Pathway |
0.2 | 4.7 | ST ADRENERGIC | Adrenergic Pathway |
0.2 | 2.1 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.2 | 1.9 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.2 | 4.6 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.1 | 5.9 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
0.1 | 1.3 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.1 | 0.2 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.1 | 4.6 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.1 | 1.0 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
0.1 | 3.6 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.1 | 3.9 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
0.1 | 0.7 | ST G ALPHA I PATHWAY | G alpha i Pathway |
0.1 | 0.7 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
0.1 | 0.1 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
0.1 | 2.6 | SIG CHEMOTAXIS | Genes related to chemotaxis |
0.1 | 0.3 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.1 | 2.7 | PID SHP2 PATHWAY | SHP2 signaling |
0.1 | 1.8 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.1 | 1.4 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
0.1 | 1.4 | PID CONE PATHWAY | Visual signal transduction: Cones |
0.1 | 0.7 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.1 | 1.7 | PID BARD1 PATHWAY | BARD1 signaling events |
0.1 | 0.7 | PID ALK2 PATHWAY | ALK2 signaling events |
0.1 | 0.7 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.1 | 0.3 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
0.1 | 1.1 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.1 | 0.5 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.1 | 1.1 | PID RHOA PATHWAY | RhoA signaling pathway |
0.1 | 1.9 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
0.1 | 0.1 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
0.1 | 0.3 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
0.1 | 0.7 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.1 | 0.1 | PID ERBB4 PATHWAY | ErbB4 signaling events |
0.1 | 0.3 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.1 | 0.8 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
0.0 | 2.4 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
0.0 | 0.5 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
0.0 | 0.3 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.0 | 1.0 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
0.0 | 0.2 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
0.0 | 0.2 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
0.0 | 0.3 | PID IL27 PATHWAY | IL27-mediated signaling events |
0.0 | 0.3 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
0.0 | 0.0 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.0 | 0.5 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
0.0 | 0.7 | PID ATM PATHWAY | ATM pathway |
0.0 | 0.7 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
0.0 | 1.2 | PID E2F PATHWAY | E2F transcription factor network |
0.0 | 0.2 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
0.0 | 1.4 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
0.0 | 0.5 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.0 | 0.3 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.0 | 0.4 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
0.0 | 1.0 | PID NOTCH PATHWAY | Notch signaling pathway |
0.0 | 0.2 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
0.0 | 0.2 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
0.0 | 0.1 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
0.0 | 0.2 | NABA COLLAGENS | Genes encoding collagen proteins |
0.0 | 0.1 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.0 | 0.6 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
0.0 | 0.0 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
0.0 | 0.1 | PID CD40 PATHWAY | CD40/CD40L signaling |
0.0 | 0.7 | WNT SIGNALING | Genes related to Wnt-mediated signal transduction |
0.0 | 0.1 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
0.0 | 0.3 | PID IL1 PATHWAY | IL1-mediated signaling events |
0.0 | 0.2 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.0 | 4.6 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
0.0 | 0.0 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.0 | 0.2 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
0.0 | 0.2 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.0 | 0.0 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.0 | 0.2 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.0 | 0.0 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
0.0 | 0.1 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
0.0 | 0.1 | PID ATR PATHWAY | ATR signaling pathway |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.7 | 11.8 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.5 | 2.7 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
0.4 | 7.8 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS | Genes involved in Synthesis of bile acids and bile salts |
0.4 | 6.5 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.4 | 2.1 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
0.4 | 4.7 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.4 | 3.4 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
0.4 | 3.5 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.3 | 2.0 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
0.3 | 4.6 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
0.2 | 3.3 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.2 | 0.6 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.2 | 2.2 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.2 | 3.3 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.2 | 1.8 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
0.2 | 1.9 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
0.2 | 1.6 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.2 | 1.7 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.2 | 1.5 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.2 | 0.3 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
0.2 | 3.5 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.2 | 0.2 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
0.1 | 2.3 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.1 | 2.2 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.1 | 1.0 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.1 | 3.4 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
0.1 | 0.4 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.1 | 0.6 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
0.1 | 4.2 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
0.1 | 2.2 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
0.1 | 1.5 | REACTOME PURINE METABOLISM | Genes involved in Purine metabolism |
0.1 | 2.8 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.1 | 1.1 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
0.1 | 1.7 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.1 | 1.8 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
0.1 | 1.2 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.1 | 1.5 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
0.1 | 1.1 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
0.1 | 0.5 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
0.1 | 5.6 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.1 | 4.0 | REACTOME MRNA 3 END PROCESSING | Genes involved in mRNA 3'-end processing |
0.1 | 1.6 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.1 | 1.1 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
0.1 | 0.9 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
0.1 | 1.8 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.1 | 0.8 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.1 | 2.2 | REACTOME TGF BETA RECEPTOR SIGNALING ACTIVATES SMADS | Genes involved in TGF-beta receptor signaling activates SMADs |
0.1 | 4.5 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.1 | 0.4 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
0.1 | 1.7 | REACTOME PHASE II CONJUGATION | Genes involved in Phase II conjugation |
0.1 | 0.3 | REACTOME P53 INDEPENDENT G1 S DNA DAMAGE CHECKPOINT | Genes involved in p53-Independent G1/S DNA damage checkpoint |
0.1 | 6.3 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
0.1 | 1.3 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.1 | 0.8 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
0.1 | 2.2 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
0.1 | 0.2 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
0.1 | 0.6 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
0.1 | 1.5 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.1 | 12.1 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
0.1 | 2.7 | REACTOME FORMATION OF RNA POL II ELONGATION COMPLEX | Genes involved in Formation of RNA Pol II elongation complex |
0.1 | 0.4 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.1 | 0.9 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
0.1 | 2.0 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
0.1 | 1.6 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
0.1 | 0.9 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
0.1 | 0.6 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.1 | 0.5 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
0.1 | 0.2 | REACTOME CDK MEDIATED PHOSPHORYLATION AND REMOVAL OF CDC6 | Genes involved in CDK-mediated phosphorylation and removal of Cdc6 |
0.1 | 0.2 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.1 | 0.9 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
0.1 | 0.8 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
0.1 | 0.4 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
0.1 | 0.6 | REACTOME SIGNALING BY ERBB4 | Genes involved in Signaling by ERBB4 |
0.1 | 1.4 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
0.1 | 0.6 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
0.1 | 0.8 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.1 | 6.8 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
0.1 | 0.6 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.1 | 0.5 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
0.1 | 0.7 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
0.1 | 1.1 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.1 | 0.4 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
0.1 | 0.5 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
0.1 | 0.9 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
0.1 | 1.2 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.1 | 1.2 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.1 | 1.5 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
0.1 | 1.8 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
0.1 | 1.8 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
0.1 | 0.8 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
0.1 | 0.3 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
0.1 | 1.1 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
0.1 | 0.1 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
0.1 | 0.5 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.1 | 0.5 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.1 | 0.6 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
0.1 | 1.0 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
0.1 | 1.4 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
0.1 | 0.1 | REACTOME NEUROTRANSMITTER RECEPTOR BINDING AND DOWNSTREAM TRANSMISSION IN THE POSTSYNAPTIC CELL | Genes involved in Neurotransmitter Receptor Binding And Downstream Transmission In The Postsynaptic Cell |
0.1 | 1.3 | REACTOME ACTIVATION OF THE PRE REPLICATIVE COMPLEX | Genes involved in Activation of the pre-replicative complex |
0.1 | 0.1 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF MITOTIC PROTEINS | Genes involved in APC/C:Cdc20 mediated degradation of mitotic proteins |
0.1 | 0.1 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
0.1 | 1.3 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
0.1 | 0.9 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
0.0 | 0.4 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
0.0 | 0.0 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
0.0 | 1.1 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
0.0 | 0.8 | REACTOME GAB1 SIGNALOSOME | Genes involved in GAB1 signalosome |
0.0 | 1.6 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
0.0 | 0.4 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.0 | 0.9 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.0 | 0.7 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
0.0 | 0.5 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.0 | 0.6 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
0.0 | 0.3 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
0.0 | 0.5 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
0.0 | 0.7 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.0 | 0.5 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
0.0 | 0.3 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
0.0 | 1.1 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
0.0 | 0.2 | REACTOME NCAM SIGNALING FOR NEURITE OUT GROWTH | Genes involved in NCAM signaling for neurite out-growth |
0.0 | 0.1 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
0.0 | 0.1 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
0.0 | 0.4 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.0 | 0.5 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
0.0 | 0.4 | REACTOME DEADENYLATION DEPENDENT MRNA DECAY | Genes involved in Deadenylation-dependent mRNA decay |
0.0 | 1.0 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
0.0 | 0.0 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.0 | 0.3 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
0.0 | 0.5 | REACTOME SIGNALING BY SCF KIT | Genes involved in Signaling by SCF-KIT |
0.0 | 0.2 | REACTOME ADP SIGNALLING THROUGH P2RY1 | Genes involved in ADP signalling through P2Y purinoceptor 1 |
0.0 | 0.4 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.0 | 0.4 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
0.0 | 1.1 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
0.0 | 0.4 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.0 | 0.6 | REACTOME MUSCLE CONTRACTION | Genes involved in Muscle contraction |
0.0 | 0.3 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
0.0 | 0.1 | REACTOME DAG AND IP3 SIGNALING | Genes involved in DAG and IP3 signaling |
0.0 | 0.3 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.0 | 0.4 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
0.0 | 0.2 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
0.0 | 0.1 | REACTOME S PHASE | Genes involved in S Phase |
0.0 | 0.0 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.0 | 0.8 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
0.0 | 0.1 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
0.0 | 0.4 | REACTOME G1 PHASE | Genes involved in G1 Phase |
0.0 | 0.2 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.0 | 0.0 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
0.0 | 0.3 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
0.0 | 0.0 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
0.0 | 0.5 | REACTOME DNA REPAIR | Genes involved in DNA Repair |
0.0 | 0.0 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
0.0 | 0.1 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
0.0 | 0.1 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.0 | 0.8 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
0.0 | 0.2 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
0.0 | 0.5 | REACTOME G ALPHA S SIGNALLING EVENTS | Genes involved in G alpha (s) signalling events |
0.0 | 0.1 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
0.0 | 0.2 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
0.0 | 0.0 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
0.0 | 0.1 | REACTOME ASPARAGINE N LINKED GLYCOSYLATION | Genes involved in Asparagine N-linked glycosylation |
0.0 | 0.0 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
0.0 | 0.4 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.0 | 0.2 | REACTOME GLUCAGON TYPE LIGAND RECEPTORS | Genes involved in Glucagon-type ligand receptors |
0.0 | 0.2 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
0.0 | 0.1 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
0.0 | 0.1 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
0.0 | 0.1 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
0.0 | 0.0 | REACTOME INFLUENZA LIFE CYCLE | Genes involved in Influenza Life Cycle |
0.0 | 0.1 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
0.0 | 0.2 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
0.0 | 0.1 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |