| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Isl2
|
ENSMUSG00000032318.6 | insulin related protein 2 (islet 2) |
| CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|---|---|
| chr9_55541381_55541949 | Isl2 | 458 | 0.606538 | 0.95 | 3.6e-03 | Click! |
| chr9_55536006_55536179 | Isl2 | 2580 | 0.209170 | 0.82 | 4.7e-02 | Click! |
| chr9_55544376_55544543 | Isl2 | 2123 | 0.239394 | 0.73 | 1.0e-01 | Click! |
| chr9_55545126_55545300 | Isl2 | 2877 | 0.198861 | 0.72 | 1.1e-01 | Click! |
| chr9_55543568_55543953 | Isl2 | 1424 | 0.328237 | 0.70 | 1.2e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr1_102517589_102517767 | 3.68 |
Gm20281 |
predicted gene, 20281 |
58756 |
0.14 |
| chr2_18048778_18049088 | 3.18 |
Skida1 |
SKI/DACH domain containing 1 |
98 |
0.94 |
| chr17_80022007_80022158 | 2.91 |
Gm22215 |
predicted gene, 22215 |
11432 |
0.14 |
| chr13_115653330_115653690 | 2.86 |
Gm47892 |
predicted gene, 47892 |
65989 |
0.13 |
| chr7_113961588_113961904 | 2.73 |
Gm45615 |
predicted gene 45615 |
125152 |
0.05 |
| chr4_106354190_106354378 | 2.64 |
Usp24 |
ubiquitin specific peptidase 24 |
38050 |
0.13 |
| chr3_97649987_97650151 | 2.32 |
Prkab2 |
protein kinase, AMP-activated, beta 2 non-catalytic subunit |
8124 |
0.13 |
| chr19_40141682_40141833 | 2.30 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
45529 |
0.11 |
| chr12_73861884_73862127 | 2.27 |
Gm15283 |
predicted gene 15283 |
7607 |
0.18 |
| chr2_31519719_31520357 | 2.26 |
Ass1 |
argininosuccinate synthetase 1 |
1548 |
0.36 |
| chr12_51274477_51274668 | 2.23 |
Rps11-ps4 |
ribosomal protein S11, pseudogene 4 |
22915 |
0.22 |
| chr4_32300145_32300312 | 2.20 |
Bach2it1 |
BTB and CNC homology 2, intronic transcript 1 |
48467 |
0.14 |
| chr17_81385422_81385814 | 2.20 |
Gm50044 |
predicted gene, 50044 |
14785 |
0.24 |
| chr6_144895356_144895507 | 2.13 |
Gm22792 |
predicted gene, 22792 |
91799 |
0.07 |
| chr14_21114751_21114902 | 2.11 |
Adk |
adenosine kinase |
38674 |
0.17 |
| chr11_4832480_4832698 | 2.09 |
Nf2 |
neurofibromin 2 |
544 |
0.74 |
| chr10_89526269_89526420 | 2.08 |
Nr1h4 |
nuclear receptor subfamily 1, group H, member 4 |
7241 |
0.22 |
| chr4_126764112_126764263 | 2.08 |
AU040320 |
expressed sequence AU040320 |
10361 |
0.13 |
| chr2_70813245_70813396 | 2.08 |
Tlk1 |
tousled-like kinase 1 |
11908 |
0.21 |
| chr15_98925214_98925388 | 2.06 |
Lmbr1l |
limb region 1 like |
7070 |
0.07 |
| chr1_50806813_50807031 | 1.98 |
Gm28321 |
predicted gene 28321 |
8453 |
0.28 |
| chr3_5425056_5425268 | 1.98 |
4930555M17Rik |
RIKEN cDNA 4930555M17 gene |
90171 |
0.09 |
| chr6_29571610_29572022 | 1.95 |
Tnpo3 |
transportin 3 |
297 |
0.87 |
| chr6_24610042_24610446 | 1.91 |
Lmod2 |
leiomodin 2 (cardiac) |
12482 |
0.14 |
| chr1_100298746_100298897 | 1.90 |
Gm29667 |
predicted gene 29667 |
16030 |
0.18 |
| chr1_67227292_67227476 | 1.86 |
Gm15668 |
predicted gene 15668 |
21816 |
0.2 |
| chr12_73341772_73342027 | 1.85 |
Slc38a6 |
solute carrier family 38, member 6 |
2468 |
0.25 |
| chr3_95872352_95872534 | 1.82 |
C920021L13Rik |
RIKEN cDNA C920021L13 gene |
912 |
0.26 |
| chr3_103464289_103464471 | 1.81 |
Gm25199 |
predicted gene, 25199 |
18580 |
0.16 |
| chr14_114864274_114864425 | 1.80 |
Gm49010 |
predicted gene, 49010 |
12161 |
0.18 |
| chr19_44403240_44403567 | 1.79 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
3287 |
0.19 |
| chr8_110644559_110644860 | 1.79 |
Vac14 |
Vac14 homolog (S. cerevisiae) |
871 |
0.63 |
| chr1_157255864_157256053 | 1.79 |
Rasal2 |
RAS protein activator like 2 |
724 |
0.73 |
| chr10_87880307_87880601 | 1.74 |
Igf1os |
insulin-like growth factor 1, opposite strand |
17073 |
0.18 |
| chr1_3605947_3606103 | 1.74 |
Gm38148 |
predicted gene, 38148 |
10122 |
0.19 |
| chr13_51232215_51232383 | 1.74 |
Gm29787 |
predicted gene, 29787 |
26188 |
0.14 |
| chr4_88893074_88893256 | 1.73 |
Ifne |
interferon epsilon |
12964 |
0.08 |
| chr13_16574847_16575001 | 1.72 |
Gm48497 |
predicted gene, 48497 |
41103 |
0.17 |
| chr9_67840552_67841087 | 1.72 |
Vps13c |
vacuolar protein sorting 13C |
407 |
0.85 |
| chr4_121078016_121078199 | 1.70 |
Zmpste24 |
zinc metallopeptidase, STE24 |
369 |
0.74 |
| chr15_41832966_41833117 | 1.70 |
Oxr1 |
oxidation resistance 1 |
2048 |
0.35 |
| chr15_36281047_36281246 | 1.69 |
Rnf19a |
ring finger protein 19A |
1952 |
0.23 |
| chr1_155896484_155896645 | 1.67 |
Cep350 |
centrosomal protein 350 |
1967 |
0.24 |
| chr5_136568375_136568579 | 1.67 |
Cux1 |
cut-like homeobox 1 |
987 |
0.6 |
| chr9_106261948_106262435 | 1.64 |
Alas1 |
aminolevulinic acid synthase 1 |
13537 |
0.1 |
| chr10_87868820_87868971 | 1.64 |
Igf1os |
insulin-like growth factor 1, opposite strand |
5514 |
0.22 |
| chr17_64764123_64764318 | 1.64 |
Dreh |
down-regulated in hepatocellular carcinoma |
2891 |
0.27 |
| chr1_67185796_67186060 | 1.64 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
62902 |
0.11 |
| chr16_24892958_24893109 | 1.63 |
Gm22672 |
predicted gene, 22672 |
8860 |
0.25 |
| chr3_51888710_51888861 | 1.63 |
Gm38252 |
predicted gene, 38252 |
1894 |
0.22 |
| chr16_30941233_30941532 | 1.63 |
Gm46565 |
predicted gene, 46565 |
5753 |
0.18 |
| chr7_65902304_65902456 | 1.63 |
Pcsk6 |
proprotein convertase subtilisin/kexin type 6 |
39948 |
0.14 |
| chr7_67647931_67648100 | 1.63 |
Ttc23 |
tetratricopeptide repeat domain 23 |
555 |
0.67 |
| chr18_45582508_45582659 | 1.62 |
Kcnn2 |
potassium intermediate/small conductance calcium-activated channel, subfamily N, member 2 |
7963 |
0.24 |
| chr8_3049184_3049482 | 1.62 |
Gm44634 |
predicted gene 44634 |
6961 |
0.2 |
| chr6_108667181_108667428 | 1.60 |
Bhlhe40 |
basic helix-loop-helix family, member e40 |
4258 |
0.19 |
| chr2_113503793_113503980 | 1.60 |
Gm13964 |
predicted gene 13964 |
148 |
0.96 |
| chr3_51437862_51438013 | 1.60 |
Naa15 |
N(alpha)-acetyltransferase 15, NatA auxiliary subunit |
2980 |
0.14 |
| chr4_109104769_109104920 | 1.60 |
Osbpl9 |
oxysterol binding protein-like 9 |
3187 |
0.27 |
| chr16_78574210_78574428 | 1.59 |
D16Ertd472e |
DNA segment, Chr 16, ERATO Doi 472, expressed |
2315 |
0.29 |
| chr3_55113077_55113240 | 1.59 |
Spg20 |
spastic paraplegia 20, spartin (Troyer syndrome) homolog (human) |
562 |
0.72 |
| chr9_104107214_104107444 | 1.58 |
Gm46999 |
predicted gene, 46999 |
2893 |
0.14 |
| chr3_97630832_97631292 | 1.58 |
Fmo5 |
flavin containing monooxygenase 5 |
2179 |
0.23 |
| chr4_121189851_121190483 | 1.56 |
Rlf |
rearranged L-myc fusion sequence |
1633 |
0.32 |
| chr3_51204305_51204466 | 1.56 |
Noct |
nocturnin |
20062 |
0.14 |
| chr3_144110073_144110233 | 1.55 |
Gm34078 |
predicted gene, 34078 |
25601 |
0.2 |
| chr19_44400621_44400791 | 1.55 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
5984 |
0.15 |
| chr10_4618620_4618773 | 1.55 |
Esr1 |
estrogen receptor 1 (alpha) |
6675 |
0.25 |
| chr10_87051307_87051578 | 1.55 |
1700113H08Rik |
RIKEN cDNA 1700113H08 gene |
6603 |
0.2 |
| chr13_52180794_52180957 | 1.55 |
Gm48199 |
predicted gene, 48199 |
464 |
0.87 |
| chr1_127751068_127751248 | 1.54 |
Acmsd |
amino carboxymuconate semialdehyde decarboxylase |
5599 |
0.19 |
| chr1_51761473_51761660 | 1.54 |
Myo1b |
myosin IB |
2904 |
0.27 |
| chr9_44096490_44096809 | 1.54 |
Usp2 |
ubiquitin specific peptidase 2 |
3975 |
0.08 |
| chr11_28695597_28695762 | 1.54 |
2810471M01Rik |
RIKEN cDNA 2810471M01 gene |
14115 |
0.17 |
| chr11_111998446_111998808 | 1.54 |
Gm11679 |
predicted gene 11679 |
44951 |
0.19 |
| chr15_6218493_6218848 | 1.52 |
Gm23139 |
predicted gene, 23139 |
67322 |
0.11 |
| chr6_58611375_58611579 | 1.52 |
Abcg2 |
ATP binding cassette subfamily G member 2 (Junior blood group) |
14806 |
0.19 |
| chr12_108235642_108235812 | 1.52 |
Ccnk |
cyclin K |
36642 |
0.13 |
| chr19_12654035_12654281 | 1.51 |
Gm24521 |
predicted gene, 24521 |
11097 |
0.09 |
| chr7_120604351_120604519 | 1.50 |
E130201H02Rik |
RIKEN cDNA E130201H02 gene |
6810 |
0.11 |
| chr18_53280047_53280198 | 1.50 |
Snx24 |
sorting nexing 24 |
34353 |
0.18 |
| chr8_109981175_109981347 | 1.49 |
Gm45795 |
predicted gene 45795 |
6909 |
0.13 |
| chr15_4678897_4679270 | 1.49 |
C6 |
complement component 6 |
48092 |
0.17 |
| chr1_191362120_191362299 | 1.47 |
Ppp2r5a |
protein phosphatase 2, regulatory subunit B', alpha |
5744 |
0.17 |
| chr3_131485378_131485553 | 1.46 |
Sgms2 |
sphingomyelin synthase 2 |
5014 |
0.28 |
| chr2_128968966_128969121 | 1.46 |
Gm10762 |
predicted gene 10762 |
999 |
0.34 |
| chr5_43309511_43309822 | 1.46 |
6030400A10Rik |
RIKEN cDNA 6030400A10 gene |
44509 |
0.11 |
| chr9_108729006_108729157 | 1.46 |
Gm24259 |
predicted gene, 24259 |
9777 |
0.1 |
| chr4_99037726_99038187 | 1.45 |
Angptl3 |
angiopoietin-like 3 |
4753 |
0.21 |
| chr10_87937503_87937727 | 1.45 |
Tyms-ps |
thymidylate synthase, pseudogene |
29232 |
0.15 |
| chr16_42947764_42948084 | 1.45 |
Ndufs5-ps |
NADH:ubiquinone oxidoreductase core subunit S5, pseudogene |
7707 |
0.21 |
| chr3_14787462_14787685 | 1.45 |
Car1 |
carbonic anhydrase 1 |
9114 |
0.18 |
| chr9_80629501_80629676 | 1.44 |
Gm48387 |
predicted gene, 48387 |
28491 |
0.22 |
| chr4_129823304_129823557 | 1.44 |
Ptp4a2 |
protein tyrosine phosphatase 4a2 |
2709 |
0.2 |
| chr11_90184166_90184514 | 1.43 |
n-R5s72 |
nuclear encoded rRNA 5S 72 |
787 |
0.57 |
| chr2_135297004_135297155 | 1.43 |
Plcb1 |
phospholipase C, beta 1 |
47906 |
0.18 |
| chr14_25396821_25396972 | 1.42 |
Gm26660 |
predicted gene, 26660 |
17287 |
0.16 |
| chr7_98357834_98358027 | 1.41 |
Tsku |
tsukushi, small leucine rich proteoglycan |
2149 |
0.28 |
| chr1_21266470_21266781 | 1.40 |
Gm28836 |
predicted gene 28836 |
4968 |
0.12 |
| chr19_38107253_38107404 | 1.40 |
Ffar4 |
free fatty acid receptor 4 |
10257 |
0.13 |
| chr4_53222171_53222454 | 1.40 |
4930412L05Rik |
RIKEN cDNA 4930412L05 gene |
4455 |
0.21 |
| chr3_127895308_127895459 | 1.39 |
Fam241a |
family with sequence similarity 241, member A |
905 |
0.47 |
| chr19_21654390_21654886 | 1.39 |
Abhd17b |
abhydrolase domain containing 17B |
1113 |
0.45 |
| chr10_67100073_67100416 | 1.39 |
Reep3 |
receptor accessory protein 3 |
3299 |
0.24 |
| chr13_9043369_9043570 | 1.38 |
Gm36264 |
predicted gene, 36264 |
32982 |
0.1 |
| chr11_28699819_28700011 | 1.37 |
2810471M01Rik |
RIKEN cDNA 2810471M01 gene |
18351 |
0.16 |
| chr4_19707158_19707309 | 1.37 |
Wwp1 |
WW domain containing E3 ubiquitin protein ligase 1 |
1760 |
0.39 |
| chr4_46507940_46508116 | 1.36 |
Gm22247 |
predicted gene, 22247 |
12873 |
0.12 |
| chr2_68890514_68890665 | 1.36 |
Gm37159 |
predicted gene, 37159 |
777 |
0.58 |
| chr2_134977060_134977253 | 1.36 |
Gm14036 |
predicted gene 14036 |
173207 |
0.03 |
| chr3_75530671_75531016 | 1.36 |
Pdcd10 |
programmed cell death 10 |
9273 |
0.2 |
| chr12_42372111_42372274 | 1.36 |
Gm25248 |
predicted gene, 25248 |
90476 |
0.1 |
| chr11_62433617_62433927 | 1.36 |
Ncor1 |
nuclear receptor co-repressor 1 |
4709 |
0.17 |
| chr1_51760527_51760678 | 1.35 |
Myo1b |
myosin IB |
3868 |
0.24 |
| chr7_68285442_68285612 | 1.34 |
Gm16157 |
predicted gene 16157 |
8933 |
0.14 |
| chr8_109803384_109803547 | 1.34 |
Ap1g1 |
adaptor protein complex AP-1, gamma 1 subunit |
24559 |
0.12 |
| chr3_58520131_58520481 | 1.34 |
Eif2a |
eukaryotic translation initiation factor 2A |
5515 |
0.16 |
| chr19_45902358_45902683 | 1.34 |
Gm6813 |
predicted gene 6813 |
24394 |
0.14 |
| chr7_87371791_87371944 | 1.34 |
Tyr |
tyrosinase |
121525 |
0.05 |
| chr11_104387140_104387291 | 1.34 |
Gm47315 |
predicted gene, 47315 |
38085 |
0.13 |
| chr7_99678243_99678394 | 1.34 |
Gm15635 |
predicted gene 15635 |
13165 |
0.09 |
| chr5_87378725_87378979 | 1.34 |
Gm21049 |
predicted gene, 21049 |
1068 |
0.35 |
| chr5_151041237_151041402 | 1.34 |
Gm8675 |
predicted gene 8675 |
32018 |
0.17 |
| chr10_89502299_89502578 | 1.33 |
Nr1h4 |
nuclear receptor subfamily 1, group H, member 4 |
4211 |
0.26 |
| chr6_86209779_86209967 | 1.33 |
Tgfa |
transforming growth factor alpha |
1721 |
0.32 |
| chr2_14596063_14596214 | 1.32 |
Cacnb2 |
calcium channel, voltage-dependent, beta 2 subunit |
6950 |
0.13 |
| chr2_148017296_148017455 | 1.32 |
9030622O22Rik |
RIKEN cDNA 9030622O22 gene |
20895 |
0.16 |
| chr15_10485447_10485602 | 1.31 |
Brix1 |
BRX1, biogenesis of ribosomes |
139 |
0.83 |
| chr17_35814760_35815402 | 1.31 |
Ier3 |
immediate early response 3 |
6603 |
0.07 |
| chr16_79059250_79059443 | 1.30 |
Tmprss15 |
transmembrane protease, serine 15 |
31746 |
0.22 |
| chr9_43081429_43081580 | 1.30 |
Arhgef12 |
Rho guanine nucleotide exchange factor (GEF) 12 |
23982 |
0.17 |
| chr8_127097367_127097518 | 1.29 |
Pard3 |
par-3 family cell polarity regulator |
24202 |
0.18 |
| chr12_101954170_101954556 | 1.29 |
Atxn3 |
ataxin 3 |
3785 |
0.17 |
| chr16_42998828_42999221 | 1.29 |
Ndufs5-ps |
NADH:ubiquinone oxidoreductase core subunit S5, pseudogene |
43393 |
0.16 |
| chr15_3536892_3537043 | 1.29 |
Ghr |
growth hormone receptor |
44875 |
0.17 |
| chr15_102752976_102753138 | 1.28 |
Calcoco1 |
calcium binding and coiled coil domain 1 |
30879 |
0.11 |
| chr7_98401453_98401769 | 1.28 |
Gm44507 |
predicted gene 44507 |
14013 |
0.13 |
| chr15_80718933_80719091 | 1.28 |
Gm49512 |
predicted gene, 49512 |
6741 |
0.15 |
| chr9_15301981_15302132 | 1.28 |
4931406C07Rik |
RIKEN cDNA 4931406C07 gene |
500 |
0.46 |
| chr5_101758048_101758202 | 1.28 |
Cds1 |
CDP-diacylglycerol synthase 1 |
7005 |
0.17 |
| chr10_24471395_24471560 | 1.28 |
Gm15271 |
predicted gene 15271 |
23987 |
0.18 |
| chr16_65665507_65665824 | 1.27 |
Gm49633 |
predicted gene, 49633 |
52246 |
0.14 |
| chr6_116111505_116111816 | 1.27 |
Tmcc1 |
transmembrane and coiled coil domains 1 |
1266 |
0.4 |
| chr9_55280024_55280330 | 1.27 |
Nrg4 |
neuregulin 4 |
3395 |
0.23 |
| chr9_122826708_122826859 | 1.26 |
Gm35549 |
predicted gene, 35549 |
17103 |
0.1 |
| chr2_77155937_77156088 | 1.26 |
Ccdc141 |
coiled-coil domain containing 141 |
14564 |
0.21 |
| chr17_17375909_17376093 | 1.25 |
Riok2 |
RIO kinase 2 |
1411 |
0.29 |
| chr12_75531904_75532183 | 1.25 |
Ppp2r5e |
protein phosphatase 2, regulatory subunit B', epsilon |
17631 |
0.18 |
| chr11_88618341_88618520 | 1.25 |
Msi2 |
musashi RNA-binding protein 2 |
28283 |
0.2 |
| chr5_45427372_45427523 | 1.25 |
D5Ertd615e |
DNA segment, Chr 5, ERATO Doi 615, expressed |
3045 |
0.19 |
| chr11_110249489_110249640 | 1.25 |
Abca6 |
ATP-binding cassette, sub-family A (ABC1), member 6 |
2212 |
0.39 |
| chr9_74328635_74328791 | 1.24 |
Gm24141 |
predicted gene, 24141 |
33897 |
0.17 |
| chr4_134814659_134814853 | 1.24 |
Maco1 |
macoilin 1 |
3543 |
0.24 |
| chr9_69287947_69288127 | 1.23 |
Rora |
RAR-related orphan receptor alpha |
1645 |
0.46 |
| chr10_61139154_61139351 | 1.23 |
Sgpl1 |
sphingosine phosphate lyase 1 |
7646 |
0.15 |
| chr2_122737415_122737579 | 1.23 |
Bloc1s6os |
biogenesis of lysosomal organelles complex-1, subunit 6, pallidin, opposite strand |
865 |
0.39 |
| chr11_111996515_111996723 | 1.23 |
Gm11679 |
predicted gene 11679 |
46959 |
0.19 |
| chr6_31260546_31260737 | 1.23 |
2210408F21Rik |
RIKEN cDNA 2210408F21 gene |
17207 |
0.15 |
| chr8_84944570_84944741 | 1.23 |
Rtbdn |
retbindin |
2336 |
0.1 |
| chr16_25221904_25222082 | 1.22 |
Tprg |
transformation related protein 63 regulated |
64824 |
0.14 |
| chr9_106264996_106265377 | 1.21 |
Poc1a |
POC1 centriolar protein A |
15875 |
0.1 |
| chr11_21713674_21713848 | 1.21 |
Wdpcp |
WD repeat containing planar cell polarity effector |
18632 |
0.2 |
| chr17_64607771_64607970 | 1.21 |
Man2a1 |
mannosidase 2, alpha 1 |
7134 |
0.26 |
| chr4_97102666_97103047 | 1.21 |
Gm27521 |
predicted gene, 27521 |
185836 |
0.03 |
| chr1_21261382_21261702 | 1.21 |
Gsta3 |
glutathione S-transferase, alpha 3 |
8021 |
0.11 |
| chr15_75506866_75507028 | 1.21 |
Gm34593 |
predicted gene, 34593 |
8173 |
0.13 |
| chr9_122126128_122126308 | 1.20 |
4632418H02Rik |
RIKEN cDNA 4632418H02 gene |
1076 |
0.38 |
| chr6_72120521_72121047 | 1.20 |
4933431G14Rik |
RIKEN cDNA 4933431G14 gene |
2156 |
0.2 |
| chr2_67956563_67957019 | 1.20 |
Gm37964 |
predicted gene, 37964 |
58195 |
0.14 |
| chr14_52196558_52196748 | 1.20 |
Supt16 |
SPT16, facilitates chromatin remodeling subunit |
763 |
0.35 |
| chr19_34717517_34717702 | 1.19 |
Gm18425 |
predicted gene, 18425 |
7601 |
0.14 |
| chr10_69208126_69208295 | 1.19 |
Rhobtb1 |
Rho-related BTB domain containing 1 |
342 |
0.87 |
| chr12_16864896_16865104 | 1.19 |
Gm36495 |
predicted gene, 36495 |
14119 |
0.14 |
| chr3_158035265_158035416 | 1.19 |
Gm43362 |
predicted gene 43362 |
1069 |
0.28 |
| chr2_130911441_130911592 | 1.18 |
Atrn |
attractin |
4585 |
0.15 |
| chr17_28502859_28503010 | 1.18 |
Fkbp5 |
FK506 binding protein 5 |
4472 |
0.09 |
| chr17_81376267_81376581 | 1.18 |
Gm50044 |
predicted gene, 50044 |
5591 |
0.28 |
| chr13_21917052_21917354 | 1.18 |
Gm44456 |
predicted gene, 44456 |
7813 |
0.07 |
| chr13_37756552_37756712 | 1.18 |
Gm31600 |
predicted gene, 31600 |
5116 |
0.16 |
| chr13_107645708_107645859 | 1.18 |
Gm32090 |
predicted gene, 32090 |
32934 |
0.17 |
| chr3_129593850_129594054 | 1.17 |
Elovl6 |
ELOVL family member 6, elongation of long chain fatty acids (yeast) |
41572 |
0.12 |
| chr5_72220168_72220334 | 1.17 |
Atp10d |
ATPase, class V, type 10D |
16898 |
0.18 |
| chr1_179632334_179632515 | 1.17 |
Sccpdh |
saccharopine dehydrogenase (putative) |
35786 |
0.14 |
| chr4_39672261_39672517 | 1.17 |
Gm12385 |
predicted gene 12385 |
95229 |
0.08 |
| chr1_67152094_67152459 | 1.16 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
29250 |
0.19 |
| chr2_155062362_155062698 | 1.16 |
Gm45609 |
predicted gene 45609 |
11651 |
0.13 |
| chr13_117745874_117746186 | 1.16 |
4933413L06Rik |
RIKEN cDNA 4933413L06 gene |
26019 |
0.26 |
| chr3_110141763_110141919 | 1.16 |
Ntng1 |
netrin G1 |
1163 |
0.6 |
| chr9_74966993_74967440 | 1.16 |
Fam214a |
family with sequence similarity 214, member A |
8895 |
0.2 |
| chr18_51150358_51150691 | 1.16 |
Prr16 |
proline rich 16 |
32786 |
0.23 |
| chr17_27996645_27996796 | 1.15 |
Gm35290 |
predicted gene, 35290 |
5642 |
0.13 |
| chr12_12940858_12941058 | 1.15 |
Mycn |
v-myc avian myelocytomatosis viral related oncogene, neuroblastoma derived |
342 |
0.83 |
| chr7_16597600_16597898 | 1.15 |
Gm29443 |
predicted gene 29443 |
16075 |
0.09 |
| chr3_57743459_57743610 | 1.15 |
Rnf13 |
ring finger protein 13 |
7414 |
0.14 |
| chr2_59160190_59160538 | 1.15 |
Ccdc148 |
coiled-coil domain containing 148 |
170 |
0.8 |
| chr17_45566542_45566693 | 1.15 |
Slc35b2 |
solute carrier family 35, member B2 |
1878 |
0.17 |
| chr19_43830800_43831008 | 1.14 |
Abcc2 |
ATP-binding cassette, sub-family C (CFTR/MRP), member 2 |
7899 |
0.15 |
| chr10_24396476_24396638 | 1.14 |
Gm15271 |
predicted gene 15271 |
50933 |
0.14 |
| chr10_110717138_110717467 | 1.14 |
E2f7 |
E2F transcription factor 7 |
28137 |
0.19 |
| chr10_4781737_4781912 | 1.14 |
Esr1 |
estrogen receptor 1 (alpha) |
69173 |
0.13 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.8 | 4.1 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
| 0.7 | 2.2 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
| 0.7 | 2.2 | GO:0060523 | prostate epithelial cord elongation(GO:0060523) |
| 0.7 | 2.1 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
| 0.5 | 2.1 | GO:0072338 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
| 0.5 | 2.0 | GO:0042524 | negative regulation of tyrosine phosphorylation of Stat5 protein(GO:0042524) |
| 0.5 | 1.5 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
| 0.4 | 2.0 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
| 0.4 | 1.6 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.4 | 1.9 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
| 0.4 | 1.1 | GO:0048696 | regulation of collateral sprouting in absence of injury(GO:0048696) |
| 0.4 | 1.4 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.3 | 1.0 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
| 0.3 | 1.0 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
| 0.3 | 2.1 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
| 0.3 | 1.0 | GO:1904017 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
| 0.3 | 2.3 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.3 | 1.3 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
| 0.3 | 1.3 | GO:0052428 | negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
| 0.3 | 0.9 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.3 | 0.6 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 0.3 | 1.2 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
| 0.3 | 0.9 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
| 0.3 | 1.1 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
| 0.3 | 1.1 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
| 0.3 | 0.8 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.3 | 1.1 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
| 0.3 | 1.0 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
| 0.3 | 1.0 | GO:0003099 | positive regulation of the force of heart contraction by epinephrine-norepinephrine(GO:0001997) positive regulation of the force of heart contraction by chemical signal(GO:0003099) |
| 0.3 | 1.3 | GO:0060839 | endothelial cell fate commitment(GO:0060839) |
| 0.2 | 0.7 | GO:1900222 | negative regulation of beta-amyloid clearance(GO:1900222) |
| 0.2 | 0.7 | GO:0061010 | gall bladder development(GO:0061010) |
| 0.2 | 1.0 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.2 | 0.5 | GO:0000429 | carbon catabolite regulation of transcription from RNA polymerase II promoter(GO:0000429) carbon catabolite activation of transcription from RNA polymerase II promoter(GO:0000436) positive regulation of transcription by glucose(GO:0046016) |
| 0.2 | 0.5 | GO:2000809 | positive regulation of synaptic vesicle clustering(GO:2000809) |
| 0.2 | 0.7 | GO:0002386 | immune response in mucosal-associated lymphoid tissue(GO:0002386) |
| 0.2 | 0.7 | GO:0060620 | regulation of cholesterol import(GO:0060620) regulation of sterol import(GO:2000909) |
| 0.2 | 1.1 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
| 0.2 | 0.9 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
| 0.2 | 1.5 | GO:0072102 | glomerulus morphogenesis(GO:0072102) |
| 0.2 | 1.1 | GO:0015780 | nucleotide-sugar transport(GO:0015780) pyrimidine nucleotide-sugar transport(GO:0015781) |
| 0.2 | 0.7 | GO:1903599 | positive regulation of mitophagy(GO:1903599) |
| 0.2 | 0.6 | GO:0018894 | dibenzo-p-dioxin metabolic process(GO:0018894) |
| 0.2 | 0.4 | GO:0060687 | regulation of branching involved in prostate gland morphogenesis(GO:0060687) |
| 0.2 | 1.3 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
| 0.2 | 0.2 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.2 | 0.6 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
| 0.2 | 0.8 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
| 0.2 | 0.6 | GO:0019086 | late viral transcription(GO:0019086) |
| 0.2 | 0.8 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) |
| 0.2 | 0.6 | GO:0061368 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
| 0.2 | 0.6 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.2 | 0.6 | GO:0002282 | microglial cell activation involved in immune response(GO:0002282) |
| 0.2 | 0.8 | GO:2001184 | positive regulation of interleukin-12 secretion(GO:2001184) |
| 0.2 | 0.6 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.2 | 0.8 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
| 0.2 | 0.6 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
| 0.2 | 0.6 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
| 0.2 | 1.5 | GO:0055091 | phospholipid homeostasis(GO:0055091) |
| 0.2 | 0.5 | GO:1903659 | regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
| 0.2 | 0.2 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
| 0.2 | 0.2 | GO:0070447 | positive regulation of oligodendrocyte progenitor proliferation(GO:0070447) |
| 0.2 | 0.4 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
| 0.2 | 0.4 | GO:0035973 | aggrephagy(GO:0035973) |
| 0.2 | 0.5 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.2 | 1.2 | GO:0045908 | negative regulation of vasodilation(GO:0045908) |
| 0.2 | 0.5 | GO:0008228 | opsonization(GO:0008228) |
| 0.2 | 1.2 | GO:0042118 | endothelial cell activation(GO:0042118) |
| 0.2 | 0.5 | GO:0032789 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
| 0.2 | 0.7 | GO:0007258 | JUN phosphorylation(GO:0007258) |
| 0.2 | 0.5 | GO:0019478 | D-amino acid catabolic process(GO:0019478) |
| 0.2 | 1.0 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
| 0.2 | 0.5 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 0.2 | 1.0 | GO:0051136 | regulation of NK T cell differentiation(GO:0051136) positive regulation of NK T cell differentiation(GO:0051138) |
| 0.2 | 0.7 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
| 0.2 | 0.5 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
| 0.2 | 0.5 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 0.2 | 0.5 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.2 | 1.0 | GO:0014870 | response to inactivity(GO:0014854) response to muscle inactivity(GO:0014870) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
| 0.2 | 1.4 | GO:0043651 | linoleic acid metabolic process(GO:0043651) |
| 0.2 | 0.3 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.2 | 0.5 | GO:0006553 | lysine metabolic process(GO:0006553) |
| 0.2 | 0.8 | GO:0015867 | ATP transport(GO:0015867) |
| 0.2 | 0.5 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
| 0.2 | 0.5 | GO:0006068 | ethanol catabolic process(GO:0006068) |
| 0.2 | 1.3 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.2 | 1.2 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
| 0.2 | 0.9 | GO:0015074 | DNA integration(GO:0015074) |
| 0.2 | 1.4 | GO:0090051 | negative regulation of cell migration involved in sprouting angiogenesis(GO:0090051) |
| 0.2 | 1.2 | GO:0000459 | exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) |
| 0.2 | 0.3 | GO:0039534 | regulation of MDA-5 signaling pathway(GO:0039533) negative regulation of MDA-5 signaling pathway(GO:0039534) |
| 0.2 | 0.8 | GO:0032237 | activation of store-operated calcium channel activity(GO:0032237) |
| 0.2 | 0.5 | GO:0021553 | olfactory nerve development(GO:0021553) |
| 0.2 | 0.3 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
| 0.2 | 0.8 | GO:0046618 | drug export(GO:0046618) |
| 0.2 | 0.5 | GO:0006562 | proline catabolic process(GO:0006562) |
| 0.2 | 0.5 | GO:0031086 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.2 | 1.1 | GO:0045607 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.2 | 0.6 | GO:0048619 | embryonic hindgut morphogenesis(GO:0048619) |
| 0.1 | 0.1 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
| 0.1 | 0.4 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
| 0.1 | 0.3 | GO:0008050 | female courtship behavior(GO:0008050) |
| 0.1 | 0.1 | GO:1901339 | regulation of store-operated calcium channel activity(GO:1901339) |
| 0.1 | 1.0 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
| 0.1 | 0.9 | GO:0071763 | nuclear membrane organization(GO:0071763) |
| 0.1 | 0.7 | GO:1904970 | brush border assembly(GO:1904970) |
| 0.1 | 0.4 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.1 | 0.4 | GO:0071725 | response to triacyl bacterial lipopeptide(GO:0071725) cellular response to triacyl bacterial lipopeptide(GO:0071727) |
| 0.1 | 0.4 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
| 0.1 | 0.4 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
| 0.1 | 0.3 | GO:0032741 | positive regulation of interleukin-18 production(GO:0032741) |
| 0.1 | 0.4 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
| 0.1 | 0.5 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
| 0.1 | 0.4 | GO:0005984 | disaccharide metabolic process(GO:0005984) |
| 0.1 | 0.5 | GO:0042737 | drug catabolic process(GO:0042737) |
| 0.1 | 0.5 | GO:0002901 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
| 0.1 | 0.4 | GO:1900060 | negative regulation of ceramide biosynthetic process(GO:1900060) |
| 0.1 | 0.4 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.1 | 0.1 | GO:1904339 | negative regulation of dopaminergic neuron differentiation(GO:1904339) |
| 0.1 | 0.3 | GO:0070672 | response to interleukin-15(GO:0070672) |
| 0.1 | 0.1 | GO:0035790 | platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
| 0.1 | 0.5 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
| 0.1 | 0.3 | GO:0002740 | negative regulation of cytokine secretion involved in immune response(GO:0002740) |
| 0.1 | 0.1 | GO:0035627 | ceramide transport(GO:0035627) |
| 0.1 | 0.9 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
| 0.1 | 0.8 | GO:0030638 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.1 | 0.4 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.1 | 0.4 | GO:0097167 | circadian regulation of translation(GO:0097167) |
| 0.1 | 0.1 | GO:0071042 | nuclear polyadenylation-dependent mRNA catabolic process(GO:0071042) polyadenylation-dependent mRNA catabolic process(GO:0071047) |
| 0.1 | 0.4 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
| 0.1 | 1.1 | GO:0052697 | xenobiotic glucuronidation(GO:0052697) |
| 0.1 | 0.2 | GO:0003162 | atrioventricular node development(GO:0003162) |
| 0.1 | 0.4 | GO:0061724 | lipophagy(GO:0061724) |
| 0.1 | 0.1 | GO:0016539 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
| 0.1 | 0.2 | GO:0002154 | thyroid hormone mediated signaling pathway(GO:0002154) |
| 0.1 | 0.6 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 0.1 | 0.6 | GO:0044829 | positive regulation by host of viral genome replication(GO:0044829) |
| 0.1 | 0.1 | GO:0061438 | renal system vasculature morphogenesis(GO:0061438) kidney vasculature morphogenesis(GO:0061439) |
| 0.1 | 0.2 | GO:1903972 | regulation of macrophage colony-stimulating factor signaling pathway(GO:1902226) regulation of response to macrophage colony-stimulating factor(GO:1903969) regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903972) |
| 0.1 | 1.1 | GO:0006517 | protein deglycosylation(GO:0006517) |
| 0.1 | 0.4 | GO:0061511 | centriole elongation(GO:0061511) |
| 0.1 | 0.7 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.1 | 0.4 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
| 0.1 | 0.6 | GO:1903689 | regulation of wound healing, spreading of epidermal cells(GO:1903689) |
| 0.1 | 0.7 | GO:0006777 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
| 0.1 | 0.6 | GO:0051409 | response to nitrosative stress(GO:0051409) |
| 0.1 | 0.1 | GO:0052055 | modulation by symbiont of host molecular function(GO:0052055) |
| 0.1 | 0.6 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.1 | 0.5 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
| 0.1 | 0.1 | GO:0036015 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
| 0.1 | 0.2 | GO:0003383 | apical constriction(GO:0003383) |
| 0.1 | 1.4 | GO:0045898 | regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045898) |
| 0.1 | 0.3 | GO:2001274 | negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
| 0.1 | 0.2 | GO:1901844 | regulation of cell communication by electrical coupling involved in cardiac conduction(GO:1901844) |
| 0.1 | 0.2 | GO:0003213 | cardiac right atrium morphogenesis(GO:0003213) |
| 0.1 | 1.0 | GO:0036315 | cellular response to sterol(GO:0036315) |
| 0.1 | 0.5 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
| 0.1 | 0.3 | GO:0019471 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) 4-hydroxyproline metabolic process(GO:0019471) |
| 0.1 | 0.3 | GO:1902514 | regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1902514) |
| 0.1 | 0.4 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
| 0.1 | 0.2 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
| 0.1 | 1.1 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
| 0.1 | 0.5 | GO:0009438 | methylglyoxal metabolic process(GO:0009438) |
| 0.1 | 0.3 | GO:0039689 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 0.1 | 0.9 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.1 | 0.1 | GO:0034310 | primary alcohol catabolic process(GO:0034310) |
| 0.1 | 0.7 | GO:1904153 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) regulation of retrograde protein transport, ER to cytosol(GO:1904152) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
| 0.1 | 0.5 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
| 0.1 | 0.1 | GO:0035441 | cell migration involved in vasculogenesis(GO:0035441) |
| 0.1 | 0.1 | GO:1904192 | cholangiocyte apoptotic process(GO:1902488) regulation of cholangiocyte apoptotic process(GO:1904192) negative regulation of cholangiocyte apoptotic process(GO:1904193) |
| 0.1 | 0.3 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
| 0.1 | 0.1 | GO:0048382 | mesendoderm development(GO:0048382) |
| 0.1 | 0.6 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
| 0.1 | 0.5 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
| 0.1 | 0.3 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.1 | 1.3 | GO:0003085 | negative regulation of systemic arterial blood pressure(GO:0003085) |
| 0.1 | 0.4 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
| 0.1 | 0.3 | GO:0032532 | regulation of microvillus length(GO:0032532) |
| 0.1 | 0.5 | GO:1902774 | late endosome to lysosome transport(GO:1902774) |
| 0.1 | 0.6 | GO:0006591 | ornithine metabolic process(GO:0006591) |
| 0.1 | 0.2 | GO:1900377 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
| 0.1 | 0.5 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.1 | 0.2 | GO:0007354 | zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
| 0.1 | 0.4 | GO:0019087 | transformation of host cell by virus(GO:0019087) |
| 0.1 | 0.6 | GO:0009404 | toxin metabolic process(GO:0009404) |
| 0.1 | 1.0 | GO:0045176 | apical protein localization(GO:0045176) |
| 0.1 | 0.3 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
| 0.1 | 0.2 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
| 0.1 | 0.4 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.1 | 0.1 | GO:0045416 | positive regulation of interleukin-8 biosynthetic process(GO:0045416) |
| 0.1 | 0.7 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
| 0.1 | 0.5 | GO:0046836 | glycolipid transport(GO:0046836) |
| 0.1 | 0.6 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
| 0.1 | 0.2 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
| 0.1 | 0.5 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.1 | 0.7 | GO:0035372 | protein localization to microtubule(GO:0035372) |
| 0.1 | 0.4 | GO:0014744 | positive regulation of muscle adaptation(GO:0014744) |
| 0.1 | 0.9 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.1 | 0.5 | GO:1902177 | positive regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902177) |
| 0.1 | 0.4 | GO:0033015 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) |
| 0.1 | 2.1 | GO:0006376 | mRNA splice site selection(GO:0006376) |
| 0.1 | 0.1 | GO:0016095 | polyprenol catabolic process(GO:0016095) |
| 0.1 | 0.2 | GO:0036296 | cellular response to increased oxygen levels(GO:0036295) response to increased oxygen levels(GO:0036296) response to hyperoxia(GO:0055093) cellular response to hyperoxia(GO:0071455) |
| 0.1 | 0.1 | GO:0046416 | D-amino acid metabolic process(GO:0046416) |
| 0.1 | 0.2 | GO:0010760 | negative regulation of macrophage chemotaxis(GO:0010760) |
| 0.1 | 0.4 | GO:0008594 | photoreceptor cell morphogenesis(GO:0008594) |
| 0.1 | 0.2 | GO:0035672 | oligopeptide transmembrane transport(GO:0035672) |
| 0.1 | 0.6 | GO:1902369 | negative regulation of RNA catabolic process(GO:1902369) |
| 0.1 | 0.3 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.1 | 0.3 | GO:0071680 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
| 0.1 | 0.6 | GO:0042759 | long-chain fatty acid biosynthetic process(GO:0042759) |
| 0.1 | 0.4 | GO:0060501 | positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
| 0.1 | 0.3 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.1 | 0.5 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.1 | 0.2 | GO:0015868 | purine ribonucleotide transport(GO:0015868) |
| 0.1 | 0.6 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
| 0.1 | 0.3 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
| 0.1 | 0.3 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
| 0.1 | 0.3 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
| 0.1 | 0.2 | GO:0071799 | response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
| 0.1 | 0.2 | GO:0070662 | mast cell proliferation(GO:0070662) regulation of mast cell proliferation(GO:0070666) positive regulation of mast cell proliferation(GO:0070668) |
| 0.1 | 0.3 | GO:0060059 | embryonic retina morphogenesis in camera-type eye(GO:0060059) |
| 0.1 | 1.2 | GO:0008210 | estrogen metabolic process(GO:0008210) |
| 0.1 | 1.4 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
| 0.1 | 0.1 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
| 0.1 | 0.3 | GO:0090292 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.1 | 0.2 | GO:0032439 | endosome localization(GO:0032439) |
| 0.1 | 0.3 | GO:0070723 | response to cholesterol(GO:0070723) |
| 0.1 | 0.2 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
| 0.1 | 0.1 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
| 0.1 | 0.4 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
| 0.1 | 0.2 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
| 0.1 | 0.5 | GO:0048318 | axial mesoderm development(GO:0048318) |
| 0.1 | 0.5 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
| 0.1 | 0.2 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
| 0.1 | 0.2 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
| 0.1 | 0.2 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
| 0.1 | 0.4 | GO:0006563 | L-serine metabolic process(GO:0006563) |
| 0.1 | 0.1 | GO:2001182 | regulation of interleukin-12 secretion(GO:2001182) |
| 0.1 | 0.2 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
| 0.1 | 0.2 | GO:0035459 | cargo loading into vesicle(GO:0035459) |
| 0.1 | 0.6 | GO:0033129 | positive regulation of histone phosphorylation(GO:0033129) |
| 0.1 | 0.2 | GO:0043486 | histone exchange(GO:0043486) |
| 0.1 | 0.2 | GO:0022007 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
| 0.1 | 0.2 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
| 0.1 | 0.1 | GO:0003278 | apoptotic process involved in heart morphogenesis(GO:0003278) |
| 0.1 | 0.5 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
| 0.1 | 0.1 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
| 0.1 | 0.2 | GO:1901300 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
| 0.1 | 0.2 | GO:0070947 | neutrophil mediated killing of fungus(GO:0070947) |
| 0.1 | 0.1 | GO:0046100 | hypoxanthine metabolic process(GO:0046100) hypoxanthine biosynthetic process(GO:0046101) |
| 0.1 | 0.6 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
| 0.1 | 0.5 | GO:0006707 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.1 | 0.3 | GO:0002765 | immune response-inhibiting signal transduction(GO:0002765) |
| 0.1 | 0.2 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
| 0.1 | 0.2 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
| 0.1 | 0.4 | GO:0006569 | tryptophan catabolic process(GO:0006569) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) |
| 0.1 | 0.2 | GO:0090009 | primitive streak formation(GO:0090009) |
| 0.1 | 0.1 | GO:1904833 | positive regulation of superoxide dismutase activity(GO:1901671) positive regulation of removal of superoxide radicals(GO:1904833) |
| 0.1 | 0.3 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
| 0.1 | 0.1 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
| 0.1 | 0.1 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
| 0.1 | 0.1 | GO:0072309 | mesenchymal stem cell maintenance involved in metanephric nephron morphogenesis(GO:0072309) |
| 0.1 | 0.8 | GO:0007176 | regulation of epidermal growth factor-activated receptor activity(GO:0007176) |
| 0.1 | 0.1 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 0.1 | 0.3 | GO:0070814 | hydrogen sulfide biosynthetic process(GO:0070814) |
| 0.1 | 0.5 | GO:0002072 | optic cup morphogenesis involved in camera-type eye development(GO:0002072) |
| 0.1 | 0.2 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 0.2 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
| 0.1 | 0.2 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
| 0.1 | 0.2 | GO:1990928 | response to amino acid starvation(GO:1990928) |
| 0.1 | 0.4 | GO:0045345 | MHC class I biosynthetic process(GO:0045341) regulation of MHC class I biosynthetic process(GO:0045343) positive regulation of MHC class I biosynthetic process(GO:0045345) |
| 0.1 | 0.1 | GO:0034197 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
| 0.1 | 0.2 | GO:0042427 | serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
| 0.1 | 0.1 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
| 0.1 | 1.3 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
| 0.1 | 0.6 | GO:0043116 | negative regulation of vascular permeability(GO:0043116) |
| 0.1 | 0.1 | GO:0044337 | canonical Wnt signaling pathway involved in positive regulation of apoptotic process(GO:0044337) |
| 0.1 | 1.2 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.1 | 0.4 | GO:0048752 | semicircular canal morphogenesis(GO:0048752) |
| 0.1 | 0.5 | GO:0010875 | positive regulation of cholesterol efflux(GO:0010875) |
| 0.1 | 0.2 | GO:0050955 | thermoception(GO:0050955) |
| 0.1 | 0.3 | GO:0006573 | valine metabolic process(GO:0006573) |
| 0.1 | 0.1 | GO:0046098 | guanine metabolic process(GO:0046098) |
| 0.1 | 0.1 | GO:0045113 | regulation of integrin biosynthetic process(GO:0045113) |
| 0.1 | 0.2 | GO:0061043 | regulation of vascular wound healing(GO:0061043) |
| 0.1 | 0.2 | GO:0045091 | regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045091) |
| 0.1 | 0.3 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
| 0.1 | 0.3 | GO:0061641 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.1 | 0.2 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.1 | 0.3 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
| 0.1 | 0.4 | GO:0090005 | negative regulation of establishment of protein localization to plasma membrane(GO:0090005) |
| 0.1 | 0.1 | GO:0071336 | regulation of hair follicle cell proliferation(GO:0071336) |
| 0.1 | 0.5 | GO:0060037 | pharyngeal system development(GO:0060037) |
| 0.1 | 0.3 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
| 0.1 | 0.2 | GO:0090315 | negative regulation of protein targeting to membrane(GO:0090315) |
| 0.1 | 0.1 | GO:0090170 | regulation of Golgi inheritance(GO:0090170) |
| 0.1 | 0.4 | GO:0019367 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.1 | 0.1 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
| 0.1 | 0.3 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
| 0.1 | 0.3 | GO:0051547 | regulation of keratinocyte migration(GO:0051547) positive regulation of keratinocyte migration(GO:0051549) |
| 0.1 | 0.2 | GO:0030241 | skeletal muscle myosin thick filament assembly(GO:0030241) striated muscle myosin thick filament assembly(GO:0071688) |
| 0.1 | 0.1 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
| 0.1 | 0.1 | GO:1900107 | regulation of nodal signaling pathway(GO:1900107) |
| 0.1 | 0.1 | GO:0034436 | glycoprotein transport(GO:0034436) |
| 0.1 | 0.1 | GO:0072318 | clathrin coat disassembly(GO:0072318) |
| 0.1 | 0.8 | GO:0009143 | nucleoside triphosphate catabolic process(GO:0009143) |
| 0.1 | 0.2 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
| 0.1 | 0.2 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
| 0.1 | 0.2 | GO:0034653 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
| 0.1 | 0.1 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
| 0.1 | 0.2 | GO:0061370 | testosterone biosynthetic process(GO:0061370) |
| 0.1 | 0.3 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
| 0.1 | 0.1 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
| 0.1 | 0.4 | GO:0021707 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
| 0.1 | 0.2 | GO:0001514 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.1 | 0.4 | GO:1901409 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
| 0.1 | 0.2 | GO:0090085 | regulation of protein deubiquitination(GO:0090085) |
| 0.1 | 0.4 | GO:1902969 | mitotic DNA replication(GO:1902969) |
| 0.1 | 0.1 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
| 0.1 | 0.1 | GO:0072092 | ureteric bud invasion(GO:0072092) |
| 0.1 | 0.2 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
| 0.1 | 0.1 | GO:0071492 | cellular response to UV-A(GO:0071492) |
| 0.1 | 0.3 | GO:1901984 | negative regulation of protein acetylation(GO:1901984) |
| 0.1 | 0.1 | GO:0060526 | prostate glandular acinus morphogenesis(GO:0060526) prostate epithelial cord arborization involved in prostate glandular acinus morphogenesis(GO:0060527) |
| 0.1 | 0.2 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.1 | 0.2 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.1 | 0.1 | GO:0072093 | metanephric renal vesicle formation(GO:0072093) |
| 0.1 | 0.1 | GO:0061738 | late endosomal microautophagy(GO:0061738) |
| 0.1 | 0.1 | GO:0021564 | vagus nerve development(GO:0021564) |
| 0.1 | 0.2 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
| 0.1 | 1.3 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
| 0.1 | 0.3 | GO:2000675 | negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
| 0.1 | 0.2 | GO:1904469 | positive regulation of tumor necrosis factor secretion(GO:1904469) |
| 0.1 | 0.1 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
| 0.1 | 0.2 | GO:2000409 | positive regulation of T cell extravasation(GO:2000409) |
| 0.1 | 0.2 | GO:0018406 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.1 | 0.2 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
| 0.1 | 0.2 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
| 0.1 | 0.1 | GO:0038108 | negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) |
| 0.1 | 0.2 | GO:0006768 | biotin metabolic process(GO:0006768) |
| 0.1 | 0.1 | GO:0070601 | centromeric sister chromatid cohesion(GO:0070601) |
| 0.1 | 0.2 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
| 0.1 | 0.1 | GO:0034756 | regulation of iron ion transport(GO:0034756) |
| 0.1 | 0.3 | GO:0016093 | polyprenol metabolic process(GO:0016093) dolichol metabolic process(GO:0019348) |
| 0.1 | 0.2 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
| 0.1 | 0.7 | GO:0009812 | flavonoid metabolic process(GO:0009812) |
| 0.1 | 0.1 | GO:1903059 | regulation of protein lipidation(GO:1903059) |
| 0.1 | 0.2 | GO:0035360 | positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
| 0.1 | 0.1 | GO:0060744 | thelarche(GO:0042695) mammary gland branching involved in thelarche(GO:0060744) |
| 0.1 | 0.2 | GO:0010390 | histone monoubiquitination(GO:0010390) |
| 0.1 | 0.2 | GO:0015871 | choline transport(GO:0015871) |
| 0.1 | 0.2 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
| 0.1 | 0.2 | GO:0006393 | termination of mitochondrial transcription(GO:0006393) |
| 0.1 | 0.2 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.1 | 0.8 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
| 0.1 | 0.2 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
| 0.1 | 0.2 | GO:0019740 | nitrogen utilization(GO:0019740) |
| 0.1 | 0.2 | GO:0045950 | negative regulation of mitotic recombination(GO:0045950) |
| 0.1 | 0.1 | GO:2000370 | positive regulation of clathrin-mediated endocytosis(GO:2000370) |
| 0.1 | 0.1 | GO:2000646 | positive regulation of receptor catabolic process(GO:2000646) |
| 0.1 | 0.1 | GO:0060279 | positive regulation of ovulation(GO:0060279) |
| 0.1 | 0.2 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
| 0.1 | 0.3 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.1 | 0.2 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
| 0.1 | 0.3 | GO:0036089 | cleavage furrow formation(GO:0036089) |
| 0.1 | 1.2 | GO:0007099 | centriole replication(GO:0007099) |
| 0.1 | 0.7 | GO:0045475 | locomotor rhythm(GO:0045475) |
| 0.1 | 0.8 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
| 0.1 | 0.2 | GO:0060696 | regulation of phospholipid catabolic process(GO:0060696) |
| 0.1 | 0.1 | GO:0072025 | distal convoluted tubule development(GO:0072025) DCT cell differentiation(GO:0072069) metanephric distal convoluted tubule development(GO:0072221) metanephric distal tubule development(GO:0072235) metanephric DCT cell differentiation(GO:0072240) |
| 0.1 | 0.2 | GO:2000303 | regulation of ceramide biosynthetic process(GO:2000303) |
| 0.1 | 0.1 | GO:0060665 | regulation of branching involved in salivary gland morphogenesis by mesenchymal-epithelial signaling(GO:0060665) |
| 0.1 | 0.2 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
| 0.1 | 0.3 | GO:0097210 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.1 | 0.1 | GO:0036498 | IRE1-mediated unfolded protein response(GO:0036498) regulation of IRE1-mediated unfolded protein response(GO:1903894) |
| 0.1 | 0.7 | GO:0045116 | protein neddylation(GO:0045116) |
| 0.1 | 0.1 | GO:0086064 | cell communication by electrical coupling involved in cardiac conduction(GO:0086064) |
| 0.0 | 0.3 | GO:0006098 | pentose-phosphate shunt(GO:0006098) |
| 0.0 | 1.1 | GO:0046677 | response to antibiotic(GO:0046677) |
| 0.0 | 0.1 | GO:0006533 | aspartate catabolic process(GO:0006533) |
| 0.0 | 0.0 | GO:1903671 | negative regulation of sprouting angiogenesis(GO:1903671) |
| 0.0 | 0.1 | GO:0018343 | protein farnesylation(GO:0018343) |
| 0.0 | 0.1 | GO:0071922 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
| 0.0 | 0.2 | GO:0042795 | snRNA transcription from RNA polymerase II promoter(GO:0042795) |
| 0.0 | 1.0 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
| 0.0 | 0.4 | GO:0042219 | cellular modified amino acid catabolic process(GO:0042219) |
| 0.0 | 0.1 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
| 0.0 | 0.3 | GO:0060211 | regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
| 0.0 | 0.0 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.0 | 0.2 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
| 0.0 | 0.1 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
| 0.0 | 0.3 | GO:0090308 | regulation of methylation-dependent chromatin silencing(GO:0090308) |
| 0.0 | 0.1 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
| 0.0 | 0.4 | GO:0044273 | sulfur compound catabolic process(GO:0044273) |
| 0.0 | 0.2 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.0 | 0.2 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
| 0.0 | 0.0 | GO:0033578 | protein glycosylation in Golgi(GO:0033578) |
| 0.0 | 1.1 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
| 0.0 | 0.1 | GO:0014889 | muscle atrophy(GO:0014889) |
| 0.0 | 0.1 | GO:2000828 | regulation of parathyroid hormone secretion(GO:2000828) |
| 0.0 | 0.0 | GO:2001016 | positive regulation of skeletal muscle cell differentiation(GO:2001016) |
| 0.0 | 0.1 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
| 0.0 | 0.9 | GO:0016578 | histone deubiquitination(GO:0016578) |
| 0.0 | 0.0 | GO:0010749 | regulation of nitric oxide mediated signal transduction(GO:0010749) |
| 0.0 | 0.2 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.0 | 0.8 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
| 0.0 | 0.0 | GO:0071360 | cellular response to exogenous dsRNA(GO:0071360) |
| 0.0 | 0.1 | GO:0048597 | post-embryonic camera-type eye morphogenesis(GO:0048597) |
| 0.0 | 0.1 | GO:0002215 | defense response to nematode(GO:0002215) |
| 0.0 | 0.1 | GO:1904742 | regulation of telomeric DNA binding(GO:1904742) |
| 0.0 | 0.2 | GO:0071684 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
| 0.0 | 0.2 | GO:0051454 | pH elevation(GO:0045852) intracellular pH elevation(GO:0051454) |
| 0.0 | 1.2 | GO:0048538 | thymus development(GO:0048538) |
| 0.0 | 0.1 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
| 0.0 | 0.5 | GO:0043586 | tongue development(GO:0043586) |
| 0.0 | 0.8 | GO:0034243 | regulation of transcription elongation from RNA polymerase II promoter(GO:0034243) |
| 0.0 | 0.0 | GO:0019530 | taurine metabolic process(GO:0019530) |
| 0.0 | 0.3 | GO:0048671 | negative regulation of collateral sprouting(GO:0048671) |
| 0.0 | 0.1 | GO:2000562 | regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000561) negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
| 0.0 | 0.1 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.0 | 0.1 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
| 0.0 | 0.2 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
| 0.0 | 0.4 | GO:1904869 | protein localization to nuclear body(GO:1903405) protein localization to Cajal body(GO:1904867) regulation of protein localization to Cajal body(GO:1904869) positive regulation of protein localization to Cajal body(GO:1904871) protein localization to nucleoplasm(GO:1990173) |
| 0.0 | 0.3 | GO:0046069 | cGMP catabolic process(GO:0046069) |
| 0.0 | 0.1 | GO:2000074 | regulation of type B pancreatic cell development(GO:2000074) |
| 0.0 | 0.0 | GO:1903297 | regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903297) negative regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903298) |
| 0.0 | 0.0 | GO:0032252 | secretory granule localization(GO:0032252) |
| 0.0 | 0.4 | GO:0035518 | histone H2A monoubiquitination(GO:0035518) |
| 0.0 | 0.1 | GO:0036394 | amylase secretion(GO:0036394) |
| 0.0 | 0.1 | GO:0033145 | positive regulation of intracellular steroid hormone receptor signaling pathway(GO:0033145) |
| 0.0 | 0.1 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.0 | 0.3 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
| 0.0 | 0.8 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.0 | 0.4 | GO:0045056 | transcytosis(GO:0045056) |
| 0.0 | 0.2 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
| 0.0 | 0.1 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
| 0.0 | 0.2 | GO:0030853 | negative regulation of granulocyte differentiation(GO:0030853) |
| 0.0 | 0.2 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
| 0.0 | 0.1 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.0 | 0.1 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.0 | 0.0 | GO:0072205 | metanephric collecting duct development(GO:0072205) |
| 0.0 | 0.3 | GO:0051971 | positive regulation of transmission of nerve impulse(GO:0051971) |
| 0.0 | 0.3 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
| 0.0 | 0.1 | GO:0060748 | tertiary branching involved in mammary gland duct morphogenesis(GO:0060748) |
| 0.0 | 0.3 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
| 0.0 | 0.2 | GO:0034227 | tRNA thio-modification(GO:0034227) |
| 0.0 | 0.1 | GO:1903977 | positive regulation of glial cell migration(GO:1903977) |
| 0.0 | 0.2 | GO:0035356 | cellular triglyceride homeostasis(GO:0035356) |
| 0.0 | 0.1 | GO:0033522 | histone H2A ubiquitination(GO:0033522) |
| 0.0 | 0.1 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.0 | 0.4 | GO:0006691 | leukotriene metabolic process(GO:0006691) |
| 0.0 | 0.2 | GO:0035878 | nail development(GO:0035878) |
| 0.0 | 0.3 | GO:0017121 | phospholipid scrambling(GO:0017121) |
| 0.0 | 0.1 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
| 0.0 | 0.2 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.0 | 0.2 | GO:0032367 | intracellular cholesterol transport(GO:0032367) |
| 0.0 | 0.0 | GO:0051890 | regulation of cardioblast differentiation(GO:0051890) |
| 0.0 | 0.0 | GO:0043382 | positive regulation of memory T cell differentiation(GO:0043382) |
| 0.0 | 0.1 | GO:0039703 | viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
| 0.0 | 0.3 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
| 0.0 | 0.1 | GO:0021898 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) commitment of multipotent stem cells to neuronal lineage in forebrain(GO:0021898) |
| 0.0 | 0.2 | GO:0048680 | positive regulation of axon regeneration(GO:0048680) |
| 0.0 | 0.2 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
| 0.0 | 0.2 | GO:0048478 | replication fork protection(GO:0048478) |
| 0.0 | 0.5 | GO:0097150 | neuronal stem cell population maintenance(GO:0097150) |
| 0.0 | 0.3 | GO:0006266 | DNA ligation(GO:0006266) |
| 0.0 | 0.1 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
| 0.0 | 0.1 | GO:0045821 | positive regulation of glycolytic process(GO:0045821) |
| 0.0 | 0.1 | GO:0019532 | oxalate transport(GO:0019532) |
| 0.0 | 0.0 | GO:0071335 | hair follicle cell proliferation(GO:0071335) |
| 0.0 | 0.1 | GO:0038171 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
| 0.0 | 0.2 | GO:0070986 | left/right axis specification(GO:0070986) |
| 0.0 | 0.2 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 0.0 | 0.2 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
| 0.0 | 0.3 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
| 0.0 | 0.1 | GO:0086023 | adrenergic receptor signaling pathway involved in heart process(GO:0086023) |
| 0.0 | 0.1 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
| 0.0 | 0.3 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.0 | 0.4 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.0 | 0.1 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
| 0.0 | 0.2 | GO:2000345 | regulation of hepatocyte proliferation(GO:2000345) |
| 0.0 | 0.2 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.0 | 0.2 | GO:0090188 | negative regulation of pancreatic juice secretion(GO:0090188) |
| 0.0 | 0.1 | GO:0006222 | UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
| 0.0 | 0.1 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
| 0.0 | 0.2 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
| 0.0 | 0.0 | GO:1990564 | protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
| 0.0 | 0.1 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
| 0.0 | 0.1 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
| 0.0 | 0.1 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
| 0.0 | 0.2 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
| 0.0 | 0.2 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
| 0.0 | 0.4 | GO:0017144 | drug metabolic process(GO:0017144) |
| 0.0 | 0.0 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
| 0.0 | 0.2 | GO:0097070 | ductus arteriosus closure(GO:0097070) |
| 0.0 | 0.0 | GO:0046487 | glyoxylate metabolic process(GO:0046487) |
| 0.0 | 0.0 | GO:0061428 | negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
| 0.0 | 0.1 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.0 | 0.0 | GO:0036118 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
| 0.0 | 0.0 | GO:0010958 | regulation of amino acid import(GO:0010958) |
| 0.0 | 0.2 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
| 0.0 | 0.6 | GO:0030520 | intracellular estrogen receptor signaling pathway(GO:0030520) |
| 0.0 | 0.2 | GO:0070417 | cellular response to cold(GO:0070417) |
| 0.0 | 0.2 | GO:0098734 | protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
| 0.0 | 0.2 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
| 0.0 | 0.1 | GO:1902267 | polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.0 | 0.1 | GO:0048014 | Tie signaling pathway(GO:0048014) |
| 0.0 | 0.1 | GO:0042447 | hormone catabolic process(GO:0042447) |
| 0.0 | 0.5 | GO:0072698 | protein localization to microtubule cytoskeleton(GO:0072698) |
| 0.0 | 0.4 | GO:0048026 | positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
| 0.0 | 0.1 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.0 | 0.3 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
| 0.0 | 0.1 | GO:0044793 | negative regulation by host of viral process(GO:0044793) |
| 0.0 | 0.1 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
| 0.0 | 0.3 | GO:0051770 | positive regulation of nitric-oxide synthase biosynthetic process(GO:0051770) |
| 0.0 | 0.9 | GO:0043550 | regulation of lipid kinase activity(GO:0043550) |
| 0.0 | 0.1 | GO:0033092 | positive regulation of immature T cell proliferation in thymus(GO:0033092) |
| 0.0 | 0.0 | GO:0060842 | arterial endothelial cell differentiation(GO:0060842) |
| 0.0 | 0.1 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.0 | 0.1 | GO:0007262 | STAT protein import into nucleus(GO:0007262) |
| 0.0 | 0.9 | GO:0042491 | auditory receptor cell differentiation(GO:0042491) |
| 0.0 | 0.1 | GO:0097384 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) cellular lipid biosynthetic process(GO:0097384) ether biosynthetic process(GO:1901503) |
| 0.0 | 0.4 | GO:0035025 | positive regulation of Rho protein signal transduction(GO:0035025) |
| 0.0 | 0.4 | GO:0006582 | melanin metabolic process(GO:0006582) melanin biosynthetic process(GO:0042438) |
| 0.0 | 0.6 | GO:0007026 | negative regulation of microtubule depolymerization(GO:0007026) |
| 0.0 | 0.2 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.0 | 0.2 | GO:0032703 | negative regulation of interleukin-2 production(GO:0032703) |
| 0.0 | 0.1 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
| 0.0 | 0.0 | GO:0043633 | polyadenylation-dependent RNA catabolic process(GO:0043633) |
| 0.0 | 0.2 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
| 0.0 | 0.1 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
| 0.0 | 0.3 | GO:0001675 | acrosome assembly(GO:0001675) |
| 0.0 | 0.1 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
| 0.0 | 0.8 | GO:0000266 | mitochondrial fission(GO:0000266) |
| 0.0 | 0.1 | GO:1902287 | semaphorin-plexin signaling pathway involved in axon guidance(GO:1902287) |
| 0.0 | 0.1 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
| 0.0 | 0.1 | GO:0021798 | forebrain dorsal/ventral pattern formation(GO:0021798) |
| 0.0 | 0.2 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) |
| 0.0 | 0.1 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
| 0.0 | 0.1 | GO:0001880 | Mullerian duct regression(GO:0001880) |
| 0.0 | 0.3 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.0 | 0.0 | GO:0045348 | positive regulation of MHC class II biosynthetic process(GO:0045348) |
| 0.0 | 0.0 | GO:2000343 | positive regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000343) |
| 0.0 | 0.1 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
| 0.0 | 0.1 | GO:0051918 | negative regulation of fibrinolysis(GO:0051918) |
| 0.0 | 0.1 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
| 0.0 | 0.2 | GO:0006655 | phosphatidylglycerol biosynthetic process(GO:0006655) |
| 0.0 | 0.1 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.0 | 0.0 | GO:1903802 | L-glutamate(1-) import into cell(GO:1903802) L-glutamate import into cell(GO:1990123) |
| 0.0 | 0.1 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
| 0.0 | 0.0 | GO:0090324 | negative regulation of oxidative phosphorylation(GO:0090324) |
| 0.0 | 0.0 | GO:0002930 | trabecular meshwork development(GO:0002930) |
| 0.0 | 0.2 | GO:0045144 | meiotic sister chromatid segregation(GO:0045144) meiotic sister chromatid cohesion(GO:0051177) |
| 0.0 | 0.1 | GO:0046628 | positive regulation of insulin receptor signaling pathway(GO:0046628) |
| 0.0 | 0.1 | GO:0035799 | ureter maturation(GO:0035799) |
| 0.0 | 0.2 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 0.0 | 0.1 | GO:0042473 | outer ear morphogenesis(GO:0042473) |
| 0.0 | 0.1 | GO:0031034 | myosin filament assembly(GO:0031034) |
| 0.0 | 0.2 | GO:0060546 | negative regulation of necroptotic process(GO:0060546) |
| 0.0 | 0.3 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.0 | 0.2 | GO:1904424 | regulation of GTP binding(GO:1904424) |
| 0.0 | 0.1 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
| 0.0 | 0.1 | GO:0051124 | regulation of synaptic growth at neuromuscular junction(GO:0008582) synaptic growth at neuromuscular junction(GO:0051124) |
| 0.0 | 0.4 | GO:0070207 | protein homotrimerization(GO:0070207) |
| 0.0 | 0.2 | GO:0016574 | histone ubiquitination(GO:0016574) |
| 0.0 | 1.0 | GO:0033141 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
| 0.0 | 0.1 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
| 0.0 | 0.1 | GO:0003011 | involuntary skeletal muscle contraction(GO:0003011) |
| 0.0 | 0.1 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.0 | 0.2 | GO:0048742 | regulation of skeletal muscle fiber development(GO:0048742) |
| 0.0 | 0.1 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
| 0.0 | 0.3 | GO:0060124 | positive regulation of growth hormone secretion(GO:0060124) |
| 0.0 | 0.1 | GO:0090209 | negative regulation of triglyceride metabolic process(GO:0090209) |
| 0.0 | 0.0 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
| 0.0 | 0.3 | GO:0006670 | sphingosine metabolic process(GO:0006670) |
| 0.0 | 0.0 | GO:0045112 | integrin biosynthetic process(GO:0045112) |
| 0.0 | 0.1 | GO:0015766 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.0 | 0.2 | GO:0006590 | thyroid hormone generation(GO:0006590) |
| 0.0 | 0.1 | GO:0071265 | amino acid salvage(GO:0043102) L-methionine biosynthetic process(GO:0071265) L-methionine salvage(GO:0071267) |
| 0.0 | 0.2 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 0.0 | 0.7 | GO:0000184 | nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
| 0.0 | 0.0 | GO:1901228 | positive regulation of transcription from RNA polymerase II promoter involved in heart development(GO:1901228) |
| 0.0 | 0.4 | GO:0006379 | mRNA cleavage(GO:0006379) |
| 0.0 | 0.1 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
| 0.0 | 0.5 | GO:0046579 | positive regulation of Ras protein signal transduction(GO:0046579) |
| 0.0 | 0.0 | GO:2000321 | positive regulation of T-helper 17 cell differentiation(GO:2000321) |
| 0.0 | 0.0 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
| 0.0 | 0.1 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
| 0.0 | 0.1 | GO:0045586 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
| 0.0 | 0.1 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.0 | 0.1 | GO:0090214 | spongiotrophoblast layer developmental growth(GO:0090214) |
| 0.0 | 0.2 | GO:0006921 | cellular component disassembly involved in execution phase of apoptosis(GO:0006921) apoptotic nuclear changes(GO:0030262) |
| 0.0 | 0.0 | GO:0048003 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
| 0.0 | 0.1 | GO:0006522 | alanine metabolic process(GO:0006522) pyruvate family amino acid metabolic process(GO:0009078) L-alanine metabolic process(GO:0042851) |
| 0.0 | 0.2 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
| 0.0 | 0.1 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 0.0 | 0.1 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.0 | 0.1 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
| 0.0 | 0.2 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
| 0.0 | 0.1 | GO:1902261 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.0 | 0.1 | GO:0032224 | positive regulation of synaptic transmission, cholinergic(GO:0032224) |
| 0.0 | 0.0 | GO:2000586 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
| 0.0 | 0.2 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
| 0.0 | 0.1 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
| 0.0 | 0.1 | GO:0033131 | regulation of glucokinase activity(GO:0033131) |
| 0.0 | 0.1 | GO:0022605 | oogenesis stage(GO:0022605) |
| 0.0 | 0.1 | GO:1900037 | regulation of cellular response to hypoxia(GO:1900037) |
| 0.0 | 0.1 | GO:0090031 | positive regulation of steroid hormone biosynthetic process(GO:0090031) |
| 0.0 | 0.2 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
| 0.0 | 0.1 | GO:0035927 | RNA import into mitochondrion(GO:0035927) |
| 0.0 | 0.1 | GO:0010642 | negative regulation of platelet-derived growth factor receptor signaling pathway(GO:0010642) |
| 0.0 | 0.2 | GO:0045835 | negative regulation of meiotic nuclear division(GO:0045835) |
| 0.0 | 0.2 | GO:0021785 | branchiomotor neuron axon guidance(GO:0021785) |
| 0.0 | 0.1 | GO:0021699 | cerebellar cortex maturation(GO:0021699) |
| 0.0 | 0.1 | GO:0006528 | asparagine metabolic process(GO:0006528) |
| 0.0 | 0.1 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.0 | 0.2 | GO:0051415 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.0 | 0.2 | GO:0071420 | cellular response to histamine(GO:0071420) |
| 0.0 | 0.1 | GO:0000820 | regulation of glutamine family amino acid metabolic process(GO:0000820) |
| 0.0 | 0.1 | GO:0046684 | response to pyrethroid(GO:0046684) |
| 0.0 | 0.1 | GO:0070189 | kynurenine metabolic process(GO:0070189) |
| 0.0 | 0.4 | GO:0006298 | mismatch repair(GO:0006298) |
| 0.0 | 0.1 | GO:0031440 | regulation of mRNA 3'-end processing(GO:0031440) |
| 0.0 | 0.0 | GO:0072044 | collecting duct development(GO:0072044) |
| 0.0 | 0.1 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
| 0.0 | 0.1 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
| 0.0 | 0.1 | GO:0047484 | regulation of response to osmotic stress(GO:0047484) |
| 0.0 | 0.1 | GO:0060430 | lung saccule development(GO:0060430) |
| 0.0 | 0.2 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.0 | 0.1 | GO:0051799 | negative regulation of hair follicle development(GO:0051799) |
| 0.0 | 0.0 | GO:0032696 | negative regulation of interleukin-13 production(GO:0032696) |
| 0.0 | 0.0 | GO:0046543 | development of secondary female sexual characteristics(GO:0046543) |
| 0.0 | 0.5 | GO:0046513 | ceramide biosynthetic process(GO:0046513) |
| 0.0 | 0.1 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.0 | 0.3 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
| 0.0 | 0.1 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
| 0.0 | 0.0 | GO:0009155 | purine deoxyribonucleotide catabolic process(GO:0009155) |
| 0.0 | 0.1 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
| 0.0 | 0.1 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.0 | 0.2 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
| 0.0 | 0.1 | GO:0009445 | putrescine metabolic process(GO:0009445) |
| 0.0 | 0.0 | GO:0046985 | positive regulation of hemoglobin biosynthetic process(GO:0046985) |
| 0.0 | 0.1 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
| 0.0 | 0.0 | GO:0002461 | tolerance induction dependent upon immune response(GO:0002461) |
| 0.0 | 0.1 | GO:0045901 | positive regulation of translational elongation(GO:0045901) |
| 0.0 | 0.1 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
| 0.0 | 0.2 | GO:0000103 | sulfate assimilation(GO:0000103) |
| 0.0 | 0.0 | GO:0055059 | asymmetric neuroblast division(GO:0055059) |
| 0.0 | 0.1 | GO:0042518 | negative regulation of tyrosine phosphorylation of Stat3 protein(GO:0042518) |
| 0.0 | 0.5 | GO:0051647 | nucleus localization(GO:0051647) |
| 0.0 | 0.1 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.0 | 0.2 | GO:0007398 | ectoderm development(GO:0007398) |
| 0.0 | 0.1 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
| 0.0 | 0.1 | GO:0019659 | fermentation(GO:0006113) glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
| 0.0 | 0.1 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
| 0.0 | 0.0 | GO:1902001 | plasma membrane long-chain fatty acid transport(GO:0015911) fatty acid transmembrane transport(GO:1902001) |
| 0.0 | 0.1 | GO:0070914 | UV-damage excision repair(GO:0070914) |
| 0.0 | 0.1 | GO:0014827 | intestine smooth muscle contraction(GO:0014827) |
| 0.0 | 0.1 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
| 0.0 | 0.0 | GO:0065001 | specification of axis polarity(GO:0065001) |
| 0.0 | 0.1 | GO:0070309 | lens fiber cell morphogenesis(GO:0070309) |
| 0.0 | 0.1 | GO:0045585 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
| 0.0 | 0.2 | GO:0007210 | serotonin receptor signaling pathway(GO:0007210) |
| 0.0 | 0.2 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
| 0.0 | 0.1 | GO:0090427 | activation of meiosis(GO:0090427) |
| 0.0 | 0.2 | GO:0010800 | positive regulation of peptidyl-threonine phosphorylation(GO:0010800) |
| 0.0 | 0.0 | GO:0001998 | angiotensin mediated vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001998) |
| 0.0 | 0.1 | GO:0060684 | epithelial-mesenchymal cell signaling(GO:0060684) |
| 0.0 | 0.1 | GO:0014883 | transition between fast and slow fiber(GO:0014883) |
| 0.0 | 0.1 | GO:0002566 | somatic diversification of immune receptors via somatic mutation(GO:0002566) somatic hypermutation of immunoglobulin genes(GO:0016446) |
| 0.0 | 0.1 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
| 0.0 | 0.2 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
| 0.0 | 0.1 | GO:0035988 | chondrocyte proliferation(GO:0035988) |
| 0.0 | 0.1 | GO:1900044 | regulation of protein K63-linked ubiquitination(GO:1900044) |
| 0.0 | 0.2 | GO:0010867 | positive regulation of triglyceride biosynthetic process(GO:0010867) |
| 0.0 | 0.1 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.0 | 0.0 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
| 0.0 | 0.2 | GO:0036260 | 7-methylguanosine RNA capping(GO:0009452) RNA capping(GO:0036260) |
| 0.0 | 0.3 | GO:0006491 | N-glycan processing(GO:0006491) |
| 0.0 | 0.0 | GO:0007227 | signal transduction downstream of smoothened(GO:0007227) |
| 0.0 | 0.5 | GO:1901998 | toxin transport(GO:1901998) |
| 0.0 | 0.3 | GO:0033235 | positive regulation of protein sumoylation(GO:0033235) |
| 0.0 | 0.1 | GO:0006048 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
| 0.0 | 0.0 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
| 0.0 | 0.0 | GO:0051447 | negative regulation of meiotic cell cycle(GO:0051447) |
| 0.0 | 0.6 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
| 0.0 | 0.0 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
| 0.0 | 0.4 | GO:0006308 | DNA catabolic process(GO:0006308) |
| 0.0 | 0.1 | GO:0009214 | cyclic nucleotide catabolic process(GO:0009214) |
| 0.0 | 0.2 | GO:0060009 | Sertoli cell development(GO:0060009) |
| 0.0 | 0.0 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
| 0.0 | 0.0 | GO:0033026 | serotonin production involved in inflammatory response(GO:0002351) serotonin secretion involved in inflammatory response(GO:0002442) serotonin secretion by platelet(GO:0002554) negative regulation of mast cell apoptotic process(GO:0033026) |
| 0.0 | 0.2 | GO:0042407 | cristae formation(GO:0042407) |
| 0.0 | 0.1 | GO:0045046 | peroxisomal membrane transport(GO:0015919) protein import into peroxisome membrane(GO:0045046) |
| 0.0 | 0.4 | GO:0045071 | negative regulation of viral genome replication(GO:0045071) |
| 0.0 | 0.1 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.0 | 0.0 | GO:0034551 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
| 0.0 | 0.1 | GO:0060671 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.0 | 0.0 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
| 0.0 | 0.0 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
| 0.0 | 0.1 | GO:0006824 | cobalt ion transport(GO:0006824) |
| 0.0 | 0.2 | GO:0007190 | activation of adenylate cyclase activity(GO:0007190) |
| 0.0 | 0.0 | GO:0032786 | positive regulation of DNA-templated transcription, elongation(GO:0032786) |
| 0.0 | 0.0 | GO:0010993 | regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
| 0.0 | 0.0 | GO:1900094 | determination of left/right asymmetry in lateral mesoderm(GO:0003140) nodal signaling pathway involved in determination of left/right asymmetry(GO:0038107) regulation of transcription from RNA polymerase II promoter involved in determination of left/right symmetry(GO:1900094) nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900164) |
| 0.0 | 0.1 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
| 0.0 | 0.0 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
| 0.0 | 0.1 | GO:0045542 | positive regulation of cholesterol biosynthetic process(GO:0045542) positive regulation of cholesterol metabolic process(GO:0090205) |
| 0.0 | 0.1 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
| 0.0 | 0.0 | GO:0006600 | creatine metabolic process(GO:0006600) |
| 0.0 | 0.1 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.0 | 0.4 | GO:0043029 | T cell homeostasis(GO:0043029) |
| 0.0 | 0.0 | GO:0032817 | regulation of natural killer cell proliferation(GO:0032817) |
| 0.0 | 0.0 | GO:1903799 | negative regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903799) |
| 0.0 | 0.3 | GO:0046621 | negative regulation of organ growth(GO:0046621) |
| 0.0 | 0.0 | GO:0007529 | establishment of synaptic specificity at neuromuscular junction(GO:0007529) |
| 0.0 | 0.1 | GO:1902414 | protein localization to cell junction(GO:1902414) |
| 0.0 | 0.2 | GO:0042773 | ATP synthesis coupled electron transport(GO:0042773) |
| 0.0 | 0.1 | GO:0052312 | modulation by host of viral transcription(GO:0043921) modulation of transcription in other organism involved in symbiotic interaction(GO:0052312) modulation by host of symbiont transcription(GO:0052472) |
| 0.0 | 0.2 | GO:0014819 | regulation of skeletal muscle contraction(GO:0014819) |
| 0.0 | 0.2 | GO:0031116 | positive regulation of microtubule polymerization(GO:0031116) |
| 0.0 | 0.0 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.0 | 0.5 | GO:0033014 | porphyrin-containing compound biosynthetic process(GO:0006779) tetrapyrrole biosynthetic process(GO:0033014) |
| 0.0 | 0.1 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.0 | 0.0 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
| 0.0 | 0.1 | GO:1900153 | regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
| 0.0 | 0.0 | GO:0070093 | negative regulation of glucagon secretion(GO:0070093) |
| 0.0 | 0.0 | GO:0002904 | positive regulation of B cell apoptotic process(GO:0002904) |
| 0.0 | 0.1 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.0 | 0.1 | GO:0051683 | establishment of Golgi localization(GO:0051683) |
| 0.0 | 0.1 | GO:0001778 | plasma membrane repair(GO:0001778) |
| 0.0 | 0.3 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
| 0.0 | 0.0 | GO:0002727 | natural killer cell cytokine production(GO:0002370) regulation of natural killer cell cytokine production(GO:0002727) |
| 0.0 | 0.1 | GO:0001842 | neural fold formation(GO:0001842) |
| 0.0 | 0.1 | GO:0003413 | chondrocyte differentiation involved in endochondral bone morphogenesis(GO:0003413) |
| 0.0 | 0.1 | GO:0045217 | cell-cell junction maintenance(GO:0045217) |
| 0.0 | 0.1 | GO:0018065 | protein lipoylation(GO:0009249) protein-cofactor linkage(GO:0018065) |
| 0.0 | 0.0 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
| 0.0 | 0.0 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.0 | 0.1 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
| 0.0 | 0.1 | GO:0046719 | regulation by virus of viral protein levels in host cell(GO:0046719) |
| 0.0 | 0.1 | GO:0015884 | folic acid transport(GO:0015884) |
| 0.0 | 0.1 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
| 0.0 | 0.1 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 0.0 | 0.8 | GO:0045454 | cell redox homeostasis(GO:0045454) |
| 0.0 | 0.0 | GO:0061314 | Notch signaling involved in heart development(GO:0061314) |
| 0.0 | 0.1 | GO:0006072 | glycerol-3-phosphate metabolic process(GO:0006072) |
| 0.0 | 0.0 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
| 0.0 | 0.1 | GO:0032754 | positive regulation of interleukin-5 production(GO:0032754) |
| 0.0 | 0.0 | GO:0060431 | primary lung bud formation(GO:0060431) |
| 0.0 | 0.1 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.0 | 0.0 | GO:0097242 | beta-amyloid clearance(GO:0097242) |
| 0.0 | 0.0 | GO:0001828 | inner cell mass cellular morphogenesis(GO:0001828) |
| 0.0 | 0.3 | GO:0032012 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
| 0.0 | 0.1 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
| 0.0 | 0.1 | GO:0002317 | plasma cell differentiation(GO:0002317) |
| 0.0 | 0.1 | GO:1903142 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
| 0.0 | 0.0 | GO:0070368 | positive regulation of hepatocyte differentiation(GO:0070368) |
| 0.0 | 0.2 | GO:0033120 | positive regulation of RNA splicing(GO:0033120) |
| 0.0 | 0.1 | GO:0007468 | regulation of rhodopsin gene expression(GO:0007468) |
| 0.0 | 0.0 | GO:0010536 | regulation of activation of Janus kinase activity(GO:0010533) positive regulation of activation of Janus kinase activity(GO:0010536) |
| 0.0 | 0.4 | GO:0060999 | positive regulation of dendritic spine development(GO:0060999) |
| 0.0 | 0.0 | GO:1901536 | regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
| 0.0 | 0.0 | GO:0030242 | pexophagy(GO:0030242) |
| 0.0 | 0.1 | GO:0010544 | negative regulation of platelet activation(GO:0010544) |
| 0.0 | 0.1 | GO:0032897 | negative regulation of viral transcription(GO:0032897) |
| 0.0 | 0.0 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
| 0.0 | 0.1 | GO:0042535 | positive regulation of tumor necrosis factor biosynthetic process(GO:0042535) |
| 0.0 | 0.0 | GO:1902109 | negative regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902109) |
| 0.0 | 0.1 | GO:0061162 | establishment of apical/basal cell polarity(GO:0035089) establishment of monopolar cell polarity(GO:0061162) establishment or maintenance of monopolar cell polarity(GO:0061339) |
| 0.0 | 0.0 | GO:0009996 | negative regulation of cell fate specification(GO:0009996) |
| 0.0 | 0.1 | GO:0006346 | methylation-dependent chromatin silencing(GO:0006346) |
| 0.0 | 0.0 | GO:0035701 | hematopoietic stem cell migration(GO:0035701) |
| 0.0 | 0.1 | GO:0021764 | amygdala development(GO:0021764) |
| 0.0 | 0.0 | GO:1904261 | regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904259) positive regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904261) basement membrane assembly involved in embryonic body morphogenesis(GO:2001197) |
| 0.0 | 0.1 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.0 | 0.0 | GO:0045023 | G0 to G1 transition(GO:0045023) regulation of G0 to G1 transition(GO:0070316) |
| 0.0 | 0.2 | GO:0002862 | negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
| 0.0 | 0.1 | GO:0034628 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
| 0.0 | 0.0 | GO:0048808 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
| 0.0 | 0.1 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
| 0.0 | 0.2 | GO:0046549 | retinal cone cell development(GO:0046549) |
| 0.0 | 0.0 | GO:0048880 | sensory system development(GO:0048880) |
| 0.0 | 0.0 | GO:1903069 | regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903069) |
| 0.0 | 0.1 | GO:0003338 | metanephros morphogenesis(GO:0003338) |
| 0.0 | 0.1 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.0 | 0.3 | GO:0048240 | sperm capacitation(GO:0048240) |
| 0.0 | 0.7 | GO:0032543 | mitochondrial translation(GO:0032543) |
| 0.0 | 0.0 | GO:0090237 | regulation of arachidonic acid secretion(GO:0090237) |
| 0.0 | 0.0 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) |
| 0.0 | 0.2 | GO:0002931 | response to ischemia(GO:0002931) |
| 0.0 | 0.1 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
| 0.0 | 0.1 | GO:0035745 | T-helper 2 cell cytokine production(GO:0035745) |
| 0.0 | 0.0 | GO:0048550 | negative regulation of pinocytosis(GO:0048550) |
| 0.0 | 0.0 | GO:1902473 | regulation of protein localization to synapse(GO:1902473) |
| 0.0 | 0.1 | GO:0033280 | response to vitamin D(GO:0033280) |
| 0.0 | 0.1 | GO:0038030 | non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 0.0 | 0.1 | GO:0051446 | positive regulation of meiotic cell cycle(GO:0051446) |
| 0.0 | 0.1 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
| 0.0 | 0.1 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
| 0.0 | 0.0 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
| 0.0 | 0.1 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
| 0.0 | 0.0 | GO:0006368 | transcription elongation from RNA polymerase II promoter(GO:0006368) |
| 0.0 | 0.1 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
| 0.0 | 0.1 | GO:0043691 | reverse cholesterol transport(GO:0043691) |
| 0.0 | 0.1 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
| 0.0 | 0.0 | GO:0002894 | type IIa hypersensitivity(GO:0001794) regulation of type IIa hypersensitivity(GO:0001796) positive regulation of type IIa hypersensitivity(GO:0001798) type II hypersensitivity(GO:0002445) regulation of type II hypersensitivity(GO:0002892) positive regulation of type II hypersensitivity(GO:0002894) |
| 0.0 | 0.0 | GO:0035106 | operant conditioning(GO:0035106) |
| 0.0 | 0.1 | GO:0040020 | regulation of meiotic nuclear division(GO:0040020) |
| 0.0 | 0.1 | GO:0015838 | amino-acid betaine transport(GO:0015838) |
| 0.0 | 0.1 | GO:0031297 | replication fork processing(GO:0031297) |
| 0.0 | 0.1 | GO:0006044 | N-acetylglucosamine metabolic process(GO:0006044) |
| 0.0 | 0.1 | GO:0046490 | isopentenyl diphosphate metabolic process(GO:0046490) |
| 0.0 | 0.1 | GO:0002176 | male germ cell proliferation(GO:0002176) |
| 0.0 | 0.1 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.0 | 0.0 | GO:0046519 | sphingoid metabolic process(GO:0046519) |
| 0.0 | 0.1 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
| 0.0 | 0.0 | GO:0001905 | activation of membrane attack complex(GO:0001905) regulation of activation of membrane attack complex(GO:0001969) |
| 0.0 | 0.0 | GO:0015889 | cobalamin transport(GO:0015889) |
| 0.0 | 0.1 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.0 | 0.0 | GO:0090527 | actin filament reorganization(GO:0090527) |
| 0.0 | 0.1 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
| 0.0 | 0.1 | GO:0020027 | hemoglobin metabolic process(GO:0020027) |
| 0.0 | 0.1 | GO:0035437 | maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
| 0.0 | 0.1 | GO:0032509 | endosome transport via multivesicular body sorting pathway(GO:0032509) |
| 0.0 | 0.1 | GO:2000108 | positive regulation of leukocyte apoptotic process(GO:2000108) |
| 0.0 | 0.1 | GO:0090201 | negative regulation of release of cytochrome c from mitochondria(GO:0090201) |
| 0.0 | 0.0 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
| 0.0 | 0.7 | GO:0006892 | post-Golgi vesicle-mediated transport(GO:0006892) |
| 0.0 | 0.0 | GO:0032304 | negative regulation of icosanoid secretion(GO:0032304) |
| 0.0 | 0.0 | GO:0032570 | response to progesterone(GO:0032570) |
| 0.0 | 0.0 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
| 0.0 | 0.1 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
| 0.0 | 0.0 | GO:0042636 | negative regulation of hair cycle(GO:0042636) |
| 0.0 | 0.4 | GO:0006506 | GPI anchor biosynthetic process(GO:0006506) |
| 0.0 | 0.0 | GO:0023041 | neuronal signal transduction(GO:0023041) |
| 0.0 | 0.1 | GO:0072189 | ureter development(GO:0072189) |
| 0.0 | 0.0 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
| 0.0 | 0.0 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
| 0.0 | 0.0 | GO:0019054 | modulation by virus of host process(GO:0019054) |
| 0.0 | 0.0 | GO:0045074 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
| 0.0 | 0.1 | GO:0032525 | somite rostral/caudal axis specification(GO:0032525) |
| 0.0 | 0.0 | GO:0001957 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
| 0.0 | 0.0 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
| 0.0 | 0.0 | GO:0060872 | semicircular canal development(GO:0060872) |
| 0.0 | 0.1 | GO:0048490 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
| 0.0 | 0.0 | GO:0043537 | negative regulation of blood vessel endothelial cell migration(GO:0043537) |
| 0.0 | 0.0 | GO:0051204 | protein insertion into mitochondrial membrane(GO:0051204) |
| 0.0 | 0.1 | GO:0032277 | negative regulation of gonadotropin secretion(GO:0032277) |
| 0.0 | 0.0 | GO:0032621 | interleukin-18 production(GO:0032621) |
| 0.0 | 0.0 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.0 | 0.1 | GO:0042754 | negative regulation of circadian rhythm(GO:0042754) |
| 0.0 | 0.0 | GO:0090244 | Wnt signaling pathway involved in somitogenesis(GO:0090244) |
| 0.0 | 0.0 | GO:0071872 | response to epinephrine(GO:0071871) cellular response to epinephrine stimulus(GO:0071872) |
| 0.0 | 0.1 | GO:0032967 | positive regulation of collagen biosynthetic process(GO:0032967) |
| 0.0 | 1.6 | GO:0071230 | cellular response to amino acid stimulus(GO:0071230) |
| 0.0 | 0.1 | GO:0002115 | store-operated calcium entry(GO:0002115) |
| 0.0 | 0.0 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
| 0.0 | 0.0 | GO:0051665 | membrane raft localization(GO:0051665) |
| 0.0 | 0.0 | GO:0046084 | adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
| 0.0 | 0.0 | GO:1901896 | positive regulation of calcium-transporting ATPase activity(GO:1901896) |
| 0.0 | 0.1 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
| 0.0 | 0.0 | GO:0046864 | retinol transport(GO:0034633) isoprenoid transport(GO:0046864) terpenoid transport(GO:0046865) |
| 0.0 | 0.1 | GO:0043249 | erythrocyte maturation(GO:0043249) |
| 0.0 | 0.1 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
| 0.0 | 0.0 | GO:0071801 | regulation of podosome assembly(GO:0071801) |
| 0.0 | 0.0 | GO:0008105 | asymmetric protein localization(GO:0008105) |
| 0.0 | 0.1 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
| 0.0 | 0.0 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
| 0.0 | 0.0 | GO:0030948 | negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
| 0.0 | 0.1 | GO:0043330 | response to exogenous dsRNA(GO:0043330) |
| 0.0 | 0.0 | GO:0001781 | neutrophil apoptotic process(GO:0001781) |
| 0.0 | 0.1 | GO:0006828 | manganese ion transport(GO:0006828) |
| 0.0 | 0.0 | GO:0019372 | lipoxygenase pathway(GO:0019372) |
| 0.0 | 0.1 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
| 0.0 | 0.0 | GO:0044351 | macropinocytosis(GO:0044351) |
| 0.0 | 0.1 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
| 0.0 | 0.0 | GO:0021559 | trigeminal nerve development(GO:0021559) |
| 0.0 | 0.0 | GO:0032069 | regulation of nuclease activity(GO:0032069) |
| 0.0 | 0.0 | GO:2000010 | positive regulation of protein localization to cell surface(GO:2000010) |
| 0.0 | 0.2 | GO:0034605 | cellular response to heat(GO:0034605) |
| 0.0 | 0.0 | GO:0034969 | histone arginine methylation(GO:0034969) |
| 0.0 | 0.1 | GO:0045059 | positive thymic T cell selection(GO:0045059) |
| 0.0 | 0.0 | GO:1901030 | positive regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901030) |
| 0.0 | 0.1 | GO:0045047 | protein targeting to ER(GO:0045047) |
| 0.0 | 0.1 | GO:0035493 | SNARE complex assembly(GO:0035493) |
| 0.0 | 0.1 | GO:0007141 | male meiosis I(GO:0007141) |
| 0.0 | 0.0 | GO:0048677 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
| 0.0 | 0.0 | GO:0009111 | vitamin catabolic process(GO:0009111) fat-soluble vitamin catabolic process(GO:0042363) |
| 0.0 | 0.2 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.0 | 0.1 | GO:0061088 | sequestering of zinc ion(GO:0032119) regulation of sequestering of zinc ion(GO:0061088) |
| 0.0 | 0.0 | GO:0031125 | rRNA 3'-end processing(GO:0031125) |
| 0.0 | 0.2 | GO:0043124 | negative regulation of I-kappaB kinase/NF-kappaB signaling(GO:0043124) |
| 0.0 | 0.4 | GO:0070227 | lymphocyte apoptotic process(GO:0070227) |
| 0.0 | 0.0 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
| 0.0 | 0.1 | GO:0098876 | vesicle-mediated transport to the plasma membrane(GO:0098876) |
| 0.0 | 0.2 | GO:0000281 | mitotic cytokinesis(GO:0000281) |
| 0.0 | 0.1 | GO:0045060 | negative thymic T cell selection(GO:0045060) |
| 0.0 | 0.0 | GO:0010578 | regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010578) positive regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010579) |
| 0.0 | 0.0 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
| 0.0 | 0.0 | GO:0032506 | cytokinetic process(GO:0032506) |
| 0.0 | 0.0 | GO:0071694 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
| 0.0 | 0.0 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
| 0.0 | 0.0 | GO:1901069 | guanosine-containing compound catabolic process(GO:1901069) |
| 0.0 | 0.0 | GO:0070428 | regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070428) |
| 0.0 | 0.0 | GO:0070459 | prolactin secretion(GO:0070459) |
| 0.0 | 0.0 | GO:0090289 | regulation of osteoclast proliferation(GO:0090289) positive regulation of osteoclast proliferation(GO:0090290) |
| 0.0 | 0.1 | GO:0032480 | negative regulation of type I interferon production(GO:0032480) |
| 0.0 | 0.1 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.0 | 0.1 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.0 | 0.0 | GO:0030423 | targeting of mRNA for destruction involved in RNA interference(GO:0030423) siRNA loading onto RISC involved in RNA interference(GO:0035087) |
| 0.0 | 0.0 | GO:0034770 | histone H4-K20 methylation(GO:0034770) |
| 0.0 | 0.2 | GO:0019228 | neuronal action potential(GO:0019228) |
| 0.0 | 0.3 | GO:0006400 | tRNA modification(GO:0006400) |
| 0.0 | 0.0 | GO:0031937 | positive regulation of chromatin silencing(GO:0031937) |
| 0.0 | 0.1 | GO:0007379 | segment specification(GO:0007379) |
| 0.0 | 0.1 | GO:1901881 | positive regulation of protein depolymerization(GO:1901881) |
| 0.0 | 0.1 | GO:0045069 | regulation of viral genome replication(GO:0045069) |
| 0.0 | 0.0 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 1.7 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.4 | 0.4 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
| 0.3 | 1.0 | GO:0097413 | Lewy body(GO:0097413) |
| 0.3 | 1.3 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
| 0.3 | 1.9 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.3 | 1.1 | GO:0070545 | PeBoW complex(GO:0070545) |
| 0.2 | 0.6 | GO:0070765 | gamma-secretase complex(GO:0070765) |
| 0.2 | 0.8 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
| 0.2 | 1.0 | GO:0045098 | type III intermediate filament(GO:0045098) |
| 0.2 | 0.8 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.2 | 1.1 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
| 0.2 | 0.7 | GO:0045293 | mRNA editing complex(GO:0045293) |
| 0.2 | 1.0 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 0.2 | 0.3 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
| 0.2 | 0.6 | GO:0044316 | cone cell pedicle(GO:0044316) |
| 0.2 | 0.5 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
| 0.2 | 0.5 | GO:0000811 | GINS complex(GO:0000811) |
| 0.2 | 0.6 | GO:0097524 | sperm plasma membrane(GO:0097524) |
| 0.2 | 1.7 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.1 | 1.0 | GO:0016342 | catenin complex(GO:0016342) |
| 0.1 | 0.6 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| 0.1 | 0.4 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.1 | 0.1 | GO:0036449 | microtubule minus-end(GO:0036449) |
| 0.1 | 2.3 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.1 | 0.7 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
| 0.1 | 0.5 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.1 | 0.4 | GO:0035355 | Toll-like receptor 2-Toll-like receptor 6 protein complex(GO:0035355) |
| 0.1 | 3.8 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
| 0.1 | 1.7 | GO:0097431 | mitotic spindle pole(GO:0097431) |
| 0.1 | 0.4 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
| 0.1 | 0.2 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
| 0.1 | 0.5 | GO:0030478 | actin cap(GO:0030478) |
| 0.1 | 0.8 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.1 | 0.7 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
| 0.1 | 0.6 | GO:0005579 | membrane attack complex(GO:0005579) |
| 0.1 | 0.6 | GO:0097433 | dense body(GO:0097433) |
| 0.1 | 0.5 | GO:0035339 | SPOTS complex(GO:0035339) |
| 0.1 | 0.5 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
| 0.1 | 5.2 | GO:0031903 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
| 0.1 | 0.3 | GO:0032437 | cuticular plate(GO:0032437) |
| 0.1 | 0.1 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
| 0.1 | 0.5 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
| 0.1 | 0.4 | GO:0032389 | MutLalpha complex(GO:0032389) |
| 0.1 | 0.3 | GO:0034992 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.1 | 0.1 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
| 0.1 | 0.3 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
| 0.1 | 0.8 | GO:0097208 | alveolar lamellar body(GO:0097208) |
| 0.1 | 0.5 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
| 0.1 | 4.0 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.1 | 0.3 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 0.1 | 0.3 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
| 0.1 | 0.7 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
| 0.1 | 1.3 | GO:0031430 | M band(GO:0031430) |
| 0.1 | 0.3 | GO:0045009 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
| 0.1 | 0.3 | GO:0030127 | COPII vesicle coat(GO:0030127) |
| 0.1 | 0.7 | GO:0071439 | clathrin complex(GO:0071439) |
| 0.1 | 1.7 | GO:0005719 | nuclear euchromatin(GO:0005719) |
| 0.1 | 0.2 | GO:0008091 | spectrin(GO:0008091) |
| 0.1 | 0.7 | GO:0045263 | proton-transporting ATP synthase complex, coupling factor F(o)(GO:0045263) |
| 0.1 | 0.2 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
| 0.1 | 0.5 | GO:0031415 | NatA complex(GO:0031415) |
| 0.1 | 0.2 | GO:0048179 | activin receptor complex(GO:0048179) |
| 0.1 | 0.3 | GO:0030313 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
| 0.1 | 0.9 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
| 0.1 | 1.1 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
| 0.1 | 0.8 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.1 | 0.5 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.1 | 0.3 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
| 0.1 | 1.3 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
| 0.1 | 0.4 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.1 | 1.4 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.1 | 0.6 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.1 | 0.7 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.1 | 0.2 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.1 | 1.3 | GO:0031672 | A band(GO:0031672) |
| 0.1 | 0.5 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
| 0.1 | 0.2 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.1 | 0.8 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.1 | 0.8 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
| 0.1 | 0.4 | GO:0045180 | basal cortex(GO:0045180) |
| 0.1 | 0.3 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.1 | 0.1 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
| 0.1 | 2.5 | GO:0030964 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
| 0.1 | 0.4 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.1 | 0.3 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.1 | 0.2 | GO:0045261 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
| 0.1 | 1.5 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
| 0.1 | 0.2 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.1 | 0.7 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 0.1 | 0.1 | GO:0098803 | respiratory chain complex(GO:0098803) |
| 0.1 | 5.8 | GO:0030176 | integral component of endoplasmic reticulum membrane(GO:0030176) |
| 0.1 | 0.1 | GO:0043259 | laminin-10 complex(GO:0043259) |
| 0.1 | 0.5 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.1 | 0.2 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
| 0.1 | 0.7 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
| 0.1 | 0.3 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
| 0.1 | 0.2 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.1 | 0.2 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
| 0.1 | 0.2 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.1 | 0.3 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
| 0.1 | 0.5 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
| 0.1 | 0.5 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.1 | 0.4 | GO:0070578 | RISC-loading complex(GO:0070578) |
| 0.1 | 0.5 | GO:0000124 | SAGA complex(GO:0000124) |
| 0.1 | 0.3 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
| 0.1 | 1.9 | GO:0045335 | phagocytic vesicle(GO:0045335) |
| 0.0 | 1.3 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.0 | 0.2 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.0 | 0.7 | GO:0030315 | T-tubule(GO:0030315) |
| 0.0 | 0.2 | GO:0005638 | lamin filament(GO:0005638) |
| 0.0 | 0.3 | GO:0071014 | post-mRNA release spliceosomal complex(GO:0071014) |
| 0.0 | 0.2 | GO:0000805 | X chromosome(GO:0000805) |
| 0.0 | 0.1 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.0 | 0.1 | GO:1990923 | PET complex(GO:1990923) |
| 0.0 | 0.4 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.0 | 0.1 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
| 0.0 | 1.1 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
| 0.0 | 0.2 | GO:0005610 | laminin-5 complex(GO:0005610) |
| 0.0 | 0.2 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.0 | 1.1 | GO:0097610 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
| 0.0 | 0.1 | GO:0035189 | Rb-E2F complex(GO:0035189) |
| 0.0 | 1.8 | GO:0031519 | PcG protein complex(GO:0031519) |
| 0.0 | 0.1 | GO:0034457 | Mpp10 complex(GO:0034457) |
| 0.0 | 2.3 | GO:0005811 | lipid particle(GO:0005811) |
| 0.0 | 0.2 | GO:0044308 | axonal spine(GO:0044308) |
| 0.0 | 0.1 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
| 0.0 | 0.1 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
| 0.0 | 0.0 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
| 0.0 | 0.2 | GO:0000931 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
| 0.0 | 0.9 | GO:0051233 | spindle midzone(GO:0051233) |
| 0.0 | 0.1 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.0 | 0.4 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
| 0.0 | 0.1 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.0 | 0.3 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.0 | 0.1 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
| 0.0 | 0.2 | GO:0031305 | integral component of mitochondrial inner membrane(GO:0031305) |
| 0.0 | 0.2 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
| 0.0 | 0.2 | GO:0070695 | FHF complex(GO:0070695) |
| 0.0 | 0.1 | GO:0042583 | chromaffin granule(GO:0042583) |
| 0.0 | 0.1 | GO:0045251 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
| 0.0 | 0.3 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
| 0.0 | 1.4 | GO:0016592 | mediator complex(GO:0016592) |
| 0.0 | 0.2 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.0 | 0.2 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.0 | 0.0 | GO:0046930 | pore complex(GO:0046930) |
| 0.0 | 0.2 | GO:0098536 | deuterosome(GO:0098536) |
| 0.0 | 0.4 | GO:0000242 | pericentriolar material(GO:0000242) |
| 0.0 | 0.2 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
| 0.0 | 0.3 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.0 | 0.1 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.0 | 0.3 | GO:0098563 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
| 0.0 | 0.3 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.0 | 0.1 | GO:0044354 | pinosome(GO:0044352) macropinosome(GO:0044354) |
| 0.0 | 0.0 | GO:1990745 | EARP complex(GO:1990745) |
| 0.0 | 0.2 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.0 | 0.4 | GO:0000346 | transcription export complex(GO:0000346) |
| 0.0 | 0.6 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
| 0.0 | 0.1 | GO:0097443 | sorting endosome(GO:0097443) |
| 0.0 | 0.8 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.0 | 0.5 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.0 | 0.1 | GO:0032127 | dense core granule membrane(GO:0032127) |
| 0.0 | 0.3 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
| 0.0 | 0.2 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
| 0.0 | 0.2 | GO:0033270 | paranode region of axon(GO:0033270) |
| 0.0 | 0.2 | GO:0000243 | commitment complex(GO:0000243) |
| 0.0 | 0.4 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
| 0.0 | 0.5 | GO:0042101 | T cell receptor complex(GO:0042101) |
| 0.0 | 0.1 | GO:0098798 | mitochondrial protein complex(GO:0098798) |
| 0.0 | 0.1 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 0.0 | 0.2 | GO:0036157 | outer dynein arm(GO:0036157) |
| 0.0 | 0.1 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
| 0.0 | 0.1 | GO:0071203 | WASH complex(GO:0071203) |
| 0.0 | 1.0 | GO:0005801 | cis-Golgi network(GO:0005801) |
| 0.0 | 0.4 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
| 0.0 | 0.2 | GO:0002177 | manchette(GO:0002177) |
| 0.0 | 0.1 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.0 | 0.0 | GO:0000835 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) |
| 0.0 | 0.5 | GO:0043034 | costamere(GO:0043034) |
| 0.0 | 0.2 | GO:0089701 | U2AF(GO:0089701) |
| 0.0 | 1.0 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
| 0.0 | 0.1 | GO:0031094 | platelet dense tubular network(GO:0031094) |
| 0.0 | 0.4 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.0 | 1.2 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
| 0.0 | 0.1 | GO:0097648 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
| 0.0 | 0.1 | GO:1990909 | Wnt signalosome(GO:1990909) |
| 0.0 | 0.0 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
| 0.0 | 1.5 | GO:0000922 | spindle pole(GO:0000922) |
| 0.0 | 0.1 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
| 0.0 | 0.1 | GO:0001940 | male pronucleus(GO:0001940) |
| 0.0 | 0.1 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.0 | 0.4 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
| 0.0 | 0.2 | GO:0005652 | nuclear lamina(GO:0005652) |
| 0.0 | 0.1 | GO:1990131 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.0 | 0.3 | GO:0000783 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
| 0.0 | 0.8 | GO:0000795 | synaptonemal complex(GO:0000795) |
| 0.0 | 0.1 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
| 0.0 | 0.4 | GO:0071339 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
| 0.0 | 0.9 | GO:0098800 | inner mitochondrial membrane protein complex(GO:0098800) |
| 0.0 | 0.1 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.0 | 0.1 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.0 | 0.1 | GO:0071942 | XPC complex(GO:0071942) |
| 0.0 | 0.1 | GO:0000938 | GARP complex(GO:0000938) |
| 0.0 | 0.2 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.0 | 0.2 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.0 | 0.3 | GO:0005776 | autophagosome(GO:0005776) |
| 0.0 | 0.1 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
| 0.0 | 0.1 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.0 | 0.1 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.0 | 0.0 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.0 | 0.0 | GO:0097441 | basilar dendrite(GO:0097441) |
| 0.0 | 0.2 | GO:0036128 | CatSper complex(GO:0036128) |
| 0.0 | 0.2 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.0 | 0.4 | GO:0034451 | centriolar satellite(GO:0034451) |
| 0.0 | 0.1 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
| 0.0 | 0.1 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
| 0.0 | 0.1 | GO:0033503 | HULC complex(GO:0033503) |
| 0.0 | 0.6 | GO:0060170 | ciliary membrane(GO:0060170) |
| 0.0 | 0.4 | GO:0005865 | striated muscle thin filament(GO:0005865) |
| 0.0 | 0.6 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
| 0.0 | 0.9 | GO:0000502 | proteasome complex(GO:0000502) |
| 0.0 | 0.1 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
| 0.0 | 0.4 | GO:0030660 | Golgi-associated vesicle membrane(GO:0030660) |
| 0.0 | 0.4 | GO:0016235 | aggresome(GO:0016235) |
| 0.0 | 0.0 | GO:0000814 | ESCRT II complex(GO:0000814) |
| 0.0 | 0.2 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.0 | 0.0 | GO:0005767 | secondary lysosome(GO:0005767) |
| 0.0 | 0.0 | GO:0005746 | mitochondrial respiratory chain(GO:0005746) |
| 0.0 | 0.1 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
| 0.0 | 0.4 | GO:0044447 | axoneme part(GO:0044447) |
| 0.0 | 0.1 | GO:0001650 | fibrillar center(GO:0001650) |
| 0.0 | 0.0 | GO:0000780 | condensed nuclear chromosome, centromeric region(GO:0000780) |
| 0.0 | 0.3 | GO:1902711 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
| 0.0 | 0.3 | GO:0005614 | interstitial matrix(GO:0005614) |
| 0.0 | 0.1 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
| 0.0 | 0.1 | GO:0031512 | motile primary cilium(GO:0031512) |
| 0.0 | 0.0 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
| 0.0 | 0.1 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
| 0.0 | 0.1 | GO:0005594 | collagen type IX trimer(GO:0005594) |
| 0.0 | 0.0 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
| 0.0 | 0.1 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.0 | 0.1 | GO:0072687 | meiotic spindle(GO:0072687) |
| 0.0 | 0.4 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.0 | 0.2 | GO:0010369 | chromocenter(GO:0010369) |
| 0.0 | 0.2 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
| 0.0 | 0.1 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
| 0.0 | 0.1 | GO:0070531 | BRCA1-A complex(GO:0070531) |
| 0.0 | 0.0 | GO:0071256 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
| 0.0 | 0.1 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
| 0.0 | 0.2 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
| 0.0 | 0.1 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.0 | 1.2 | GO:0005770 | late endosome(GO:0005770) |
| 0.0 | 0.5 | GO:0034704 | calcium channel complex(GO:0034704) |
| 0.0 | 0.1 | GO:0044216 | other organism(GO:0044215) other organism cell(GO:0044216) other organism part(GO:0044217) |
| 0.0 | 1.5 | GO:0001669 | acrosomal vesicle(GO:0001669) |
| 0.0 | 0.2 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.0 | 0.3 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
| 0.0 | 0.2 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.0 | 0.1 | GO:0097386 | glial cell projection(GO:0097386) |
| 0.0 | 0.3 | GO:0000777 | condensed chromosome kinetochore(GO:0000777) |
| 0.0 | 0.0 | GO:0042575 | DNA polymerase complex(GO:0042575) |
| 0.0 | 0.4 | GO:0005637 | nuclear inner membrane(GO:0005637) |
| 0.0 | 0.0 | GO:0070939 | Dsl1p complex(GO:0070939) |
| 0.0 | 0.2 | GO:0001527 | microfibril(GO:0001527) |
| 0.0 | 0.1 | GO:0043202 | lysosomal lumen(GO:0043202) |
| 0.0 | 0.4 | GO:0008305 | integrin complex(GO:0008305) |
| 0.0 | 1.7 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
| 0.0 | 0.8 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.0 | 0.1 | GO:0034464 | BBSome(GO:0034464) |
| 0.0 | 2.1 | GO:0030133 | transport vesicle(GO:0030133) |
| 0.0 | 0.0 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
| 0.0 | 0.1 | GO:0098533 | ATPase dependent transmembrane transport complex(GO:0098533) |
| 0.0 | 0.2 | GO:0005682 | U5 snRNP(GO:0005682) |
| 0.0 | 0.1 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
| 0.0 | 0.1 | GO:0019908 | nuclear cyclin-dependent protein kinase holoenzyme complex(GO:0019908) |
| 0.0 | 0.7 | GO:0005814 | centriole(GO:0005814) |
| 0.0 | 0.0 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
| 0.0 | 1.7 | GO:0005759 | mitochondrial matrix(GO:0005759) |
| 0.0 | 0.4 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
| 0.0 | 13.5 | GO:0005783 | endoplasmic reticulum(GO:0005783) |
| 0.0 | 0.1 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.0 | 0.8 | GO:0030016 | myofibril(GO:0030016) |
| 0.0 | 0.0 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
| 0.0 | 0.0 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
| 0.0 | 0.1 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
| 0.0 | 0.0 | GO:0097342 | ripoptosome(GO:0097342) |
| 0.0 | 0.3 | GO:0034707 | chloride channel complex(GO:0034707) |
| 0.0 | 0.0 | GO:0034709 | methylosome(GO:0034709) |
| 0.0 | 3.3 | GO:0005667 | transcription factor complex(GO:0005667) |
| 0.0 | 0.1 | GO:0042589 | zymogen granule membrane(GO:0042589) |
| 0.0 | 0.0 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
| 0.0 | 0.1 | GO:0001652 | granular component(GO:0001652) |
| 0.0 | 0.0 | GO:0070820 | tertiary granule(GO:0070820) |
| 0.0 | 0.1 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.0 | 0.0 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.0 | 0.1 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.0 | 0.2 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.0 | 0.1 | GO:0071546 | pi-body(GO:0071546) |
| 0.0 | 0.0 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.0 | 0.0 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 0.0 | 0.1 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.8 | 2.3 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
| 0.7 | 2.7 | GO:0034056 | estrogen response element binding(GO:0034056) |
| 0.6 | 1.9 | GO:0038181 | bile acid receptor activity(GO:0038181) |
| 0.5 | 0.5 | GO:0015927 | trehalase activity(GO:0015927) |
| 0.5 | 1.4 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.5 | 4.1 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.4 | 2.2 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) |
| 0.4 | 1.1 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.4 | 1.1 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
| 0.3 | 1.0 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.3 | 1.3 | GO:0071614 | linoleic acid epoxygenase activity(GO:0071614) |
| 0.3 | 1.0 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
| 0.3 | 0.9 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
| 0.3 | 0.6 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
| 0.3 | 0.8 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.3 | 0.8 | GO:0005347 | ATP transmembrane transporter activity(GO:0005347) |
| 0.3 | 0.3 | GO:0051723 | protein methylesterase activity(GO:0051723) |
| 0.2 | 0.5 | GO:0070644 | vitamin D response element binding(GO:0070644) |
| 0.2 | 0.2 | GO:0000009 | alpha-1,6-mannosyltransferase activity(GO:0000009) |
| 0.2 | 0.2 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
| 0.2 | 0.7 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
| 0.2 | 1.0 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.2 | 0.7 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
| 0.2 | 0.7 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
| 0.2 | 0.7 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
| 0.2 | 0.6 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
| 0.2 | 0.6 | GO:0032551 | UTP binding(GO:0002134) pyrimidine ribonucleoside binding(GO:0032551) |
| 0.2 | 1.1 | GO:0070728 | leucine binding(GO:0070728) |
| 0.2 | 1.4 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
| 0.2 | 0.6 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.2 | 0.8 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
| 0.2 | 1.6 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
| 0.2 | 0.6 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
| 0.2 | 0.6 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
| 0.2 | 1.0 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
| 0.2 | 0.6 | GO:0016823 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 0.2 | 0.7 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
| 0.2 | 1.3 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 0.2 | 0.7 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
| 0.2 | 0.9 | GO:0071723 | lipopeptide binding(GO:0071723) |
| 0.2 | 0.9 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
| 0.2 | 1.0 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.2 | 0.9 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.2 | 0.7 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
| 0.2 | 0.7 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.2 | 1.8 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
| 0.2 | 1.2 | GO:0035325 | Toll-like receptor binding(GO:0035325) |
| 0.2 | 0.5 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.2 | 0.5 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.2 | 0.5 | GO:0005119 | smoothened binding(GO:0005119) |
| 0.2 | 0.5 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
| 0.2 | 0.8 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
| 0.1 | 0.4 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
| 0.1 | 0.4 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
| 0.1 | 1.6 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
| 0.1 | 0.4 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
| 0.1 | 0.4 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
| 0.1 | 1.2 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.1 | 0.3 | GO:0016909 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
| 0.1 | 0.7 | GO:0000828 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
| 0.1 | 0.5 | GO:0050693 | LBD domain binding(GO:0050693) |
| 0.1 | 0.5 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
| 0.1 | 0.7 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.1 | 0.5 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
| 0.1 | 0.2 | GO:0043398 | HLH domain binding(GO:0043398) |
| 0.1 | 0.7 | GO:0043338 | CTP:2,3-di-O-geranylgeranyl-sn-glycero-1-phosphate cytidyltransferase activity(GO:0043338) phospholactate guanylyltransferase activity(GO:0043814) ATP:coenzyme F420 adenylyltransferase activity(GO:0043910) UDP-N-acetylgalactosamine diphosphorylase activity(GO:0052630) |
| 0.1 | 0.7 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.1 | 0.1 | GO:0030792 | methylarsonite methyltransferase activity(GO:0030792) |
| 0.1 | 1.1 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.1 | 0.4 | GO:0080130 | L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
| 0.1 | 0.6 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
| 0.1 | 0.4 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
| 0.1 | 0.4 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.1 | 0.6 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
| 0.1 | 0.7 | GO:0004064 | arylesterase activity(GO:0004064) |
| 0.1 | 0.7 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
| 0.1 | 0.2 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
| 0.1 | 0.4 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.1 | 0.3 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.1 | 0.3 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
| 0.1 | 0.1 | GO:0009019 | tRNA (guanine-N1-)-methyltransferase activity(GO:0009019) |
| 0.1 | 1.4 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.1 | 0.2 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
| 0.1 | 0.7 | GO:0046790 | virion binding(GO:0046790) |
| 0.1 | 0.7 | GO:0019763 | immunoglobulin receptor activity(GO:0019763) |
| 0.1 | 0.7 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
| 0.1 | 0.5 | GO:0035671 | enone reductase activity(GO:0035671) |
| 0.1 | 0.3 | GO:0030620 | U2 snRNA binding(GO:0030620) |
| 0.1 | 0.6 | GO:0031685 | adenosine receptor binding(GO:0031685) |
| 0.1 | 0.3 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
| 0.1 | 0.4 | GO:0033142 | progesterone receptor binding(GO:0033142) |
| 0.1 | 0.7 | GO:0016679 | oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) |
| 0.1 | 0.9 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.1 | 0.3 | GO:0034870 | fluorene oxygenase activity(GO:0018585) mono-butyltin dioxygenase activity(GO:0018586) tri-n-butyltin dioxygenase activity(GO:0018588) di-n-butyltin dioxygenase activity(GO:0018589) methylsilanetriol hydroxylase activity(GO:0018590) methyl tertiary butyl ether 3-monooxygenase activity(GO:0018591) 4-nitrocatechol 4-monooxygenase activity(GO:0018592) 4-chlorophenoxyacetate monooxygenase activity(GO:0018593) tert-butanol 2-monooxygenase activity(GO:0018594) alpha-pinene monooxygenase activity(GO:0018595) dimethylsilanediol hydroxylase activity(GO:0018596) ammonia monooxygenase activity(GO:0018597) hydroxymethylsilanetriol oxidase activity(GO:0018598) 2-hydroxyisobutyrate 3-monooxygenase activity(GO:0018599) alpha-pinene dehydrogenase activity(GO:0018600) bisphenol A hydroxylase B activity(GO:0034559) 2,2-bis(4-hydroxyphenyl)-1-propanol hydroxylase activity(GO:0034562) 9-fluorenone-3,4-dioxygenase activity(GO:0034786) anthracene 9,10-dioxygenase activity(GO:0034816) 2-(methylthio)benzothiazole monooxygenase activity(GO:0034857) 2-hydroxybenzothiazole monooxygenase activity(GO:0034858) benzothiazole monooxygenase activity(GO:0034859) 2,6-dihydroxybenzothiazole monooxygenase activity(GO:0034862) pinacolone 5-monooxygenase activity(GO:0034870) thioacetamide S-oxygenase activity(GO:0034873) thioacetamide S-oxide S-oxygenase activity(GO:0034874) endosulfan monooxygenase I activity(GO:0034888) N-nitrodimethylamine hydroxylase activity(GO:0034893) 4-(1-ethyl-1,4-dimethyl-pentyl)phenol monoxygenase activity(GO:0034897) endosulfan ether monooxygenase activity(GO:0034903) pyrene 4,5-monooxygenase activity(GO:0034925) pyrene 1,2-monooxygenase activity(GO:0034927) 1-hydroxypyrene 6,7-monooxygenase activity(GO:0034928) 1-hydroxypyrene 7,8-monooxygenase activity(GO:0034929) phenylboronic acid monooxygenase activity(GO:0034950) spheroidene monooxygenase activity(GO:0043823) |
| 0.1 | 0.6 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
| 0.1 | 0.4 | GO:0038100 | nodal binding(GO:0038100) |
| 0.1 | 0.4 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
| 0.1 | 1.1 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
| 0.1 | 0.5 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 0.1 | 0.8 | GO:1990446 | U1 snRNP binding(GO:1990446) |
| 0.1 | 2.1 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.1 | 0.4 | GO:1990239 | steroid hormone binding(GO:1990239) |
| 0.1 | 1.1 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
| 0.1 | 0.2 | GO:0005346 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) |
| 0.1 | 0.4 | GO:0008808 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) |
| 0.1 | 0.3 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
| 0.1 | 0.4 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
| 0.1 | 0.3 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.1 | 0.4 | GO:0009374 | biotin binding(GO:0009374) |
| 0.1 | 0.3 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
| 0.1 | 1.3 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.1 | 0.3 | GO:2001069 | glycogen binding(GO:2001069) |
| 0.1 | 0.3 | GO:0004802 | transketolase activity(GO:0004802) |
| 0.1 | 1.0 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.1 | 0.3 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
| 0.1 | 0.7 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
| 0.1 | 0.1 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
| 0.1 | 1.0 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.1 | 0.3 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
| 0.1 | 0.7 | GO:0002162 | dystroglycan binding(GO:0002162) |
| 0.1 | 0.3 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
| 0.1 | 0.4 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
| 0.1 | 1.1 | GO:0045295 | gamma-catenin binding(GO:0045295) |
| 0.1 | 0.5 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.1 | 0.2 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
| 0.1 | 0.6 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
| 0.1 | 1.1 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
| 0.1 | 0.5 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
| 0.1 | 0.2 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
| 0.1 | 0.6 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
| 0.1 | 0.3 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
| 0.1 | 0.3 | GO:0038064 | collagen receptor activity(GO:0038064) |
| 0.1 | 0.4 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.1 | 0.2 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
| 0.1 | 1.0 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
| 0.1 | 0.4 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.1 | 0.1 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
| 0.1 | 0.4 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.1 | 0.4 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
| 0.1 | 0.9 | GO:0070402 | NADPH binding(GO:0070402) |
| 0.1 | 0.2 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
| 0.1 | 0.1 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
| 0.1 | 0.4 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.1 | 0.4 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
| 0.1 | 0.2 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
| 0.1 | 0.5 | GO:0009922 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.1 | 0.1 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
| 0.1 | 0.2 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
| 0.1 | 0.2 | GO:0004096 | catalase activity(GO:0004096) |
| 0.1 | 0.2 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
| 0.1 | 0.2 | GO:0004103 | choline kinase activity(GO:0004103) |
| 0.1 | 1.6 | GO:0004120 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) photoreceptor cyclic-nucleotide phosphodiesterase activity(GO:0004120) 7,8-dihydro-D-neopterin 2',3'-cyclic phosphate phosphodiesterase activity(GO:0044688) inositol phosphosphingolipid phospholipase activity(GO:0052712) inositol phosphorylceramide phospholipase activity(GO:0052713) mannosyl-inositol phosphorylceramide phospholipase activity(GO:0052714) mannosyl-diinositol phosphorylceramide phospholipase activity(GO:0052715) |
| 0.1 | 0.2 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
| 0.1 | 1.1 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
| 0.1 | 0.4 | GO:0015288 | porin activity(GO:0015288) |
| 0.1 | 0.3 | GO:0070878 | primary miRNA binding(GO:0070878) |
| 0.1 | 0.9 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
| 0.1 | 1.7 | GO:0016790 | thiolester hydrolase activity(GO:0016790) |
| 0.1 | 0.1 | GO:0019187 | beta-1,4-mannosyltransferase activity(GO:0019187) |
| 0.1 | 1.4 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.1 | 0.5 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.1 | 0.7 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.1 | 0.3 | GO:0019145 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
| 0.1 | 0.2 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
| 0.1 | 0.8 | GO:0008301 | DNA binding, bending(GO:0008301) |
| 0.1 | 0.3 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
| 0.1 | 0.3 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
| 0.1 | 0.4 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
| 0.1 | 2.0 | GO:0070888 | E-box binding(GO:0070888) |
| 0.1 | 0.3 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.1 | 0.9 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
| 0.1 | 0.3 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.1 | 0.2 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.1 | 0.2 | GO:0005047 | signal recognition particle binding(GO:0005047) |
| 0.1 | 0.4 | GO:0035197 | siRNA binding(GO:0035197) |
| 0.1 | 0.2 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
| 0.1 | 0.4 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
| 0.1 | 0.2 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
| 0.1 | 0.3 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.1 | 0.6 | GO:0071949 | FAD binding(GO:0071949) |
| 0.1 | 0.1 | GO:0004723 | calcium-dependent protein serine/threonine phosphatase activity(GO:0004723) |
| 0.1 | 1.4 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
| 0.1 | 0.5 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
| 0.1 | 1.1 | GO:0043531 | ADP binding(GO:0043531) |
| 0.1 | 0.3 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.1 | 0.2 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
| 0.1 | 0.3 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
| 0.1 | 0.2 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.1 | 0.6 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.1 | 0.1 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
| 0.1 | 1.3 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
| 0.1 | 0.6 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
| 0.1 | 0.1 | GO:0070546 | L-phenylalanine aminotransferase activity(GO:0070546) |
| 0.1 | 0.1 | GO:0004376 | glycolipid mannosyltransferase activity(GO:0004376) |
| 0.1 | 1.4 | GO:0045296 | cadherin binding(GO:0045296) |
| 0.1 | 0.2 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 0.1 | 0.4 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.1 | 0.2 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.1 | 0.3 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
| 0.1 | 0.5 | GO:0070513 | death domain binding(GO:0070513) |
| 0.1 | 0.2 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
| 0.1 | 0.3 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
| 0.1 | 0.5 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.1 | 0.9 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
| 0.1 | 0.4 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.1 | 0.2 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
| 0.1 | 0.2 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
| 0.1 | 0.2 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
| 0.1 | 0.4 | GO:0046972 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
| 0.1 | 0.3 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.1 | 0.1 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
| 0.1 | 1.5 | GO:0042169 | SH2 domain binding(GO:0042169) |
| 0.1 | 0.3 | GO:0004017 | adenylate kinase activity(GO:0004017) |
| 0.1 | 0.3 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.1 | 0.3 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
| 0.1 | 0.8 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
| 0.1 | 0.1 | GO:0030911 | TPR domain binding(GO:0030911) |
| 0.1 | 0.6 | GO:0032183 | SUMO binding(GO:0032183) |
| 0.1 | 0.7 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
| 0.1 | 0.1 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
| 0.1 | 0.2 | GO:0035939 | microsatellite binding(GO:0035939) |
| 0.1 | 0.2 | GO:0030519 | snoRNP binding(GO:0030519) |
| 0.1 | 0.2 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 0.1 | 0.2 | GO:0001642 | group III metabotropic glutamate receptor activity(GO:0001642) |
| 0.1 | 1.5 | GO:0052770 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
| 0.0 | 0.8 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
| 0.0 | 1.2 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
| 0.0 | 0.2 | GO:0004690 | cyclic nucleotide-dependent protein kinase activity(GO:0004690) |
| 0.0 | 0.3 | GO:0030983 | mismatched DNA binding(GO:0030983) |
| 0.0 | 0.1 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
| 0.0 | 0.2 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
| 0.0 | 0.2 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
| 0.0 | 0.3 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
| 0.0 | 2.3 | GO:0015924 | mannosyl-oligosaccharide mannosidase activity(GO:0015924) |
| 0.0 | 0.7 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
| 0.0 | 0.5 | GO:0004955 | prostaglandin receptor activity(GO:0004955) |
| 0.0 | 0.3 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.0 | 0.0 | GO:0032554 | purine deoxyribonucleotide binding(GO:0032554) |
| 0.0 | 0.5 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.0 | 0.1 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
| 0.0 | 0.4 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.0 | 0.1 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
| 0.0 | 0.2 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
| 0.0 | 0.2 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
| 0.0 | 1.3 | GO:0008408 | 3'-5' exonuclease activity(GO:0008408) |
| 0.0 | 0.7 | GO:0016864 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
| 0.0 | 0.5 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
| 0.0 | 0.7 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
| 0.0 | 0.1 | GO:0043559 | insulin binding(GO:0043559) |
| 0.0 | 0.4 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
| 0.0 | 0.3 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.0 | 0.2 | GO:0005113 | patched binding(GO:0005113) |
| 0.0 | 0.1 | GO:0015119 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
| 0.0 | 0.7 | GO:1990939 | ATP-dependent microtubule motor activity(GO:1990939) |
| 0.0 | 0.6 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.0 | 0.2 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.0 | 0.1 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
| 0.0 | 0.1 | GO:0015651 | quaternary ammonium group transmembrane transporter activity(GO:0015651) |
| 0.0 | 0.1 | GO:0010485 | H4 histone acetyltransferase activity(GO:0010485) |
| 0.0 | 0.4 | GO:0005523 | tropomyosin binding(GO:0005523) |
| 0.0 | 0.7 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.0 | 0.7 | GO:0030552 | cAMP binding(GO:0030552) |
| 0.0 | 1.0 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
| 0.0 | 0.1 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 0.0 | 0.3 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
| 0.0 | 0.2 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
| 0.0 | 0.3 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.0 | 0.1 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.0 | 0.2 | GO:0016443 | bidentate ribonuclease III activity(GO:0016443) |
| 0.0 | 0.2 | GO:0098847 | sequence-specific single stranded DNA binding(GO:0098847) |
| 0.0 | 0.2 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
| 0.0 | 0.1 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
| 0.0 | 0.2 | GO:0052794 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
| 0.0 | 0.1 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
| 0.0 | 0.2 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.0 | 0.0 | GO:0016212 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
| 0.0 | 0.1 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 0.0 | 0.6 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.0 | 0.1 | GO:0070410 | co-SMAD binding(GO:0070410) |
| 0.0 | 0.2 | GO:0016668 | oxidoreductase activity, acting on a sulfur group of donors, NAD(P) as acceptor(GO:0016668) |
| 0.0 | 0.2 | GO:0000146 | microfilament motor activity(GO:0000146) |
| 0.0 | 0.3 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 0.0 | 0.2 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
| 0.0 | 0.0 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
| 0.0 | 0.2 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
| 0.0 | 0.1 | GO:0010861 | thyroid hormone receptor activator activity(GO:0010861) |
| 0.0 | 0.2 | GO:0001223 | transcription coactivator binding(GO:0001223) |
| 0.0 | 0.3 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
| 0.0 | 0.2 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
| 0.0 | 0.1 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
| 0.0 | 0.2 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.0 | 0.2 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
| 0.0 | 0.2 | GO:0001972 | retinoic acid binding(GO:0001972) |
| 0.0 | 0.7 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
| 0.0 | 3.5 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.0 | 0.5 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.0 | 0.0 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
| 0.0 | 0.1 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.0 | 0.1 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
| 0.0 | 0.1 | GO:0019862 | IgA binding(GO:0019862) |
| 0.0 | 0.1 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) |
| 0.0 | 0.3 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
| 0.0 | 0.1 | GO:0004936 | alpha-adrenergic receptor activity(GO:0004936) |
| 0.0 | 0.1 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.0 | 0.1 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
| 0.0 | 0.1 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
| 0.0 | 0.1 | GO:0035514 | DNA demethylase activity(GO:0035514) |
| 0.0 | 0.3 | GO:0042300 | pivalyl-CoA mutase activity(GO:0034784) o-hydroxylaminobenzoate mutase activity(GO:0034951) lupeol synthase activity(GO:0042299) beta-amyrin synthase activity(GO:0042300) baruol synthase activity(GO:0080011) |
| 0.0 | 0.1 | GO:0031779 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
| 0.0 | 0.2 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
| 0.0 | 0.1 | GO:0033677 | DNA/RNA helicase activity(GO:0033677) |
| 0.0 | 0.1 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
| 0.0 | 0.5 | GO:0043295 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
| 0.0 | 0.1 | GO:0016530 | metallochaperone activity(GO:0016530) |
| 0.0 | 0.1 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
| 0.0 | 0.1 | GO:0016842 | amidine-lyase activity(GO:0016842) |
| 0.0 | 0.1 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 0.0 | 0.1 | GO:0000182 | rDNA binding(GO:0000182) |
| 0.0 | 0.1 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
| 0.0 | 0.0 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
| 0.0 | 0.1 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.0 | 0.2 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.0 | 0.3 | GO:0030228 | lipoprotein particle receptor activity(GO:0030228) |
| 0.0 | 1.0 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
| 0.0 | 0.1 | GO:0005415 | nucleoside:sodium symporter activity(GO:0005415) |
| 0.0 | 0.0 | GO:0070883 | pre-miRNA binding(GO:0070883) |
| 0.0 | 0.2 | GO:0002054 | nucleobase binding(GO:0002054) |
| 0.0 | 0.1 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.0 | 0.1 | GO:0089720 | caspase binding(GO:0089720) |
| 0.0 | 0.1 | GO:0003909 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
| 0.0 | 0.1 | GO:0034235 | GPI anchor binding(GO:0034235) |
| 0.0 | 0.0 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
| 0.0 | 0.0 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
| 0.0 | 0.1 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
| 0.0 | 0.2 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
| 0.0 | 2.2 | GO:0005178 | integrin binding(GO:0005178) |
| 0.0 | 0.3 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
| 0.0 | 0.1 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
| 0.0 | 0.2 | GO:0004112 | cyclic-nucleotide phosphodiesterase activity(GO:0004112) |
| 0.0 | 0.5 | GO:0016860 | intramolecular oxidoreductase activity(GO:0016860) |
| 0.0 | 0.1 | GO:0016901 | oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
| 0.0 | 0.5 | GO:0003785 | actin monomer binding(GO:0003785) |
| 0.0 | 0.1 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
| 0.0 | 0.1 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
| 0.0 | 0.1 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
| 0.0 | 0.0 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 0.0 | 0.2 | GO:0045545 | syndecan binding(GO:0045545) |
| 0.0 | 0.1 | GO:0032052 | bile acid binding(GO:0032052) |
| 0.0 | 1.0 | GO:0008080 | N-acetyltransferase activity(GO:0008080) |
| 0.0 | 0.2 | GO:0008276 | protein methyltransferase activity(GO:0008276) |
| 0.0 | 0.1 | GO:0016423 | tRNA (guanine) methyltransferase activity(GO:0016423) |
| 0.0 | 0.1 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
| 0.0 | 0.4 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.0 | 0.1 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
| 0.0 | 1.0 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
| 0.0 | 0.6 | GO:0016667 | oxidoreductase activity, acting on a sulfur group of donors(GO:0016667) |
| 0.0 | 0.6 | GO:0030507 | spectrin binding(GO:0030507) |
| 0.0 | 1.9 | GO:0016300 | tRNA (uracil) methyltransferase activity(GO:0016300) |
| 0.0 | 2.1 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
| 0.0 | 0.1 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
| 0.0 | 0.1 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
| 0.0 | 0.3 | GO:0008171 | O-methyltransferase activity(GO:0008171) |
| 0.0 | 0.1 | GO:0008430 | selenium binding(GO:0008430) |
| 0.0 | 0.1 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
| 0.0 | 0.1 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
| 0.0 | 0.1 | GO:0008494 | translation activator activity(GO:0008494) |
| 0.0 | 0.1 | GO:0004556 | alpha-amylase activity(GO:0004556) |
| 0.0 | 0.1 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
| 0.0 | 0.1 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
| 0.0 | 0.3 | GO:0005351 | sugar:proton symporter activity(GO:0005351) |
| 0.0 | 0.1 | GO:0004303 | estradiol 17-beta-dehydrogenase activity(GO:0004303) |
| 0.0 | 0.1 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.0 | 0.3 | GO:0004993 | G-protein coupled serotonin receptor activity(GO:0004993) serotonin receptor activity(GO:0099589) |
| 0.0 | 0.3 | GO:0031210 | phosphatidylcholine binding(GO:0031210) |
| 0.0 | 1.1 | GO:0032182 | ubiquitin-like protein binding(GO:0032182) |
| 0.0 | 0.1 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
| 0.0 | 0.1 | GO:0030291 | protein serine/threonine kinase inhibitor activity(GO:0030291) |
| 0.0 | 0.7 | GO:0016748 | succinyltransferase activity(GO:0016748) |
| 0.0 | 0.1 | GO:0098988 | G-protein coupled glutamate receptor activity(GO:0098988) |
| 0.0 | 0.1 | GO:0034584 | piRNA binding(GO:0034584) |
| 0.0 | 1.8 | GO:0004702 | receptor signaling protein serine/threonine kinase activity(GO:0004702) |
| 0.0 | 0.0 | GO:0051870 | methotrexate binding(GO:0051870) |
| 0.0 | 0.7 | GO:0005546 | phosphatidylinositol-4,5-bisphosphate binding(GO:0005546) |
| 0.0 | 0.1 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
| 0.0 | 0.2 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
| 0.0 | 0.4 | GO:0031489 | myosin V binding(GO:0031489) |
| 0.0 | 0.1 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
| 0.0 | 0.7 | GO:0048487 | beta-tubulin binding(GO:0048487) |
| 0.0 | 0.1 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
| 0.0 | 0.2 | GO:0005248 | voltage-gated sodium channel activity(GO:0005248) voltage-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1905030) |
| 0.0 | 0.6 | GO:0019894 | kinesin binding(GO:0019894) |
| 0.0 | 0.1 | GO:0008432 | JUN kinase binding(GO:0008432) |
| 0.0 | 0.1 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
| 0.0 | 0.1 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
| 0.0 | 0.2 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
| 0.0 | 0.0 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
| 0.0 | 1.0 | GO:0048306 | calcium-dependent protein binding(GO:0048306) |
| 0.0 | 0.3 | GO:0016917 | GABA-A receptor activity(GO:0004890) GABA receptor activity(GO:0016917) |
| 0.0 | 0.1 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
| 0.0 | 0.1 | GO:0008517 | folic acid transporter activity(GO:0008517) |
| 0.0 | 0.9 | GO:0051219 | phosphoprotein binding(GO:0051219) |
| 0.0 | 0.5 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
| 0.0 | 0.0 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
| 0.0 | 0.3 | GO:0015299 | solute:proton antiporter activity(GO:0015299) |
| 0.0 | 0.1 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
| 0.0 | 0.1 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
| 0.0 | 0.3 | GO:0004364 | glutathione transferase activity(GO:0004364) |
| 0.0 | 1.3 | GO:0036459 | thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) ubiquitinyl hydrolase activity(GO:0101005) |
| 0.0 | 0.1 | GO:0015266 | protein channel activity(GO:0015266) |
| 0.0 | 0.1 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
| 0.0 | 0.0 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
| 0.0 | 0.2 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
| 0.0 | 0.0 | GO:0019237 | centromeric DNA binding(GO:0019237) |
| 0.0 | 0.3 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.0 | 0.1 | GO:0004931 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.0 | 0.3 | GO:0046961 | proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
| 0.0 | 0.1 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
| 0.0 | 0.1 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.0 | 0.0 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
| 0.0 | 0.1 | GO:0009881 | photoreceptor activity(GO:0009881) |
| 0.0 | 0.6 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.0 | 0.6 | GO:0035064 | methylated histone binding(GO:0035064) |
| 0.0 | 0.6 | GO:0008170 | N-methyltransferase activity(GO:0008170) |
| 0.0 | 0.0 | GO:0031726 | CCR1 chemokine receptor binding(GO:0031726) |
| 0.0 | 0.0 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
| 0.0 | 0.0 | GO:0001016 | RNA polymerase III regulatory region DNA binding(GO:0001016) |
| 0.0 | 0.1 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
| 0.0 | 0.4 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.0 | 0.2 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
| 0.0 | 0.0 | GO:0035175 | histone kinase activity (H3-S10 specific)(GO:0035175) |
| 0.0 | 0.3 | GO:0005527 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.0 | 0.8 | GO:0051082 | unfolded protein binding(GO:0051082) |
| 0.0 | 0.1 | GO:0042171 | lysophosphatidic acid acyltransferase activity(GO:0042171) |
| 0.0 | 0.3 | GO:0070566 | adenylyltransferase activity(GO:0070566) |
| 0.0 | 0.3 | GO:0016893 | endoribonuclease activity, producing 5'-phosphomonoesters(GO:0016891) endonuclease activity, active with either ribo- or deoxyribonucleic acids and producing 5'-phosphomonoesters(GO:0016893) |
| 0.0 | 0.0 | GO:0016662 | oxidoreductase activity, acting on other nitrogenous compounds as donors, cytochrome as acceptor(GO:0016662) |
| 0.0 | 0.0 | GO:0034618 | arginine binding(GO:0034618) |
| 0.0 | 0.0 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.0 | 0.0 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
| 0.0 | 0.0 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
| 0.0 | 0.0 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
| 0.0 | 0.1 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
| 0.0 | 0.2 | GO:0043548 | phosphatidylinositol 3-kinase binding(GO:0043548) |
| 0.0 | 0.1 | GO:0004467 | long-chain fatty acid-CoA ligase activity(GO:0004467) |
| 0.0 | 0.3 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.0 | 0.0 | GO:0008147 | structural constituent of bone(GO:0008147) |
| 0.0 | 0.3 | GO:0016620 | oxidoreductase activity, acting on the aldehyde or oxo group of donors, NAD or NADP as acceptor(GO:0016620) |
| 0.0 | 0.1 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
| 0.0 | 0.0 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
| 0.0 | 0.2 | GO:0008519 | ammonium transmembrane transporter activity(GO:0008519) |
| 0.0 | 0.0 | GO:0070052 | collagen V binding(GO:0070052) |
| 0.0 | 0.0 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 0.0 | 0.0 | GO:0043495 | protein anchor(GO:0043495) |
| 0.0 | 0.0 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
| 0.0 | 0.2 | GO:0005227 | calcium activated cation channel activity(GO:0005227) |
| 0.0 | 0.2 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
| 0.0 | 0.3 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.0 | 0.2 | GO:0046875 | ephrin receptor binding(GO:0046875) |
| 0.0 | 1.6 | GO:0003729 | mRNA binding(GO:0003729) |
| 0.0 | 0.0 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
| 0.0 | 0.1 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.0 | 0.0 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.0 | 0.0 | GO:0032407 | MutSalpha complex binding(GO:0032407) |
| 0.0 | 0.0 | GO:0016882 | cyclo-ligase activity(GO:0016882) |
| 0.0 | 0.0 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
| 0.0 | 0.0 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
| 0.0 | 0.4 | GO:0003725 | double-stranded RNA binding(GO:0003725) |
| 0.0 | 0.1 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
| 0.0 | 0.1 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.0 | 0.1 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.0 | 0.1 | GO:0017025 | TBP-class protein binding(GO:0017025) |
| 0.0 | 0.0 | GO:0008320 | protein transmembrane transporter activity(GO:0008320) |
| 0.0 | 0.0 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.0 | 0.0 | GO:0048256 | flap endonuclease activity(GO:0048256) |
| 0.0 | 0.0 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
| 0.0 | 0.1 | GO:0018498 | enoyl-[acyl-carrier-protein] reductase activity(GO:0016631) 2,3-dihydroxy-2,3-dihydro-phenylpropionate dehydrogenase activity(GO:0018498) cis-2,3-dihydrodiol DDT dehydrogenase activity(GO:0018499) trans-9R,10R-dihydrodiolphenanthrene dehydrogenase activity(GO:0018500) cis-chlorobenzene dihydrodiol dehydrogenase activity(GO:0018501) 2,5-dichloro-2,5-cyclohexadiene-1,4-diol dehydrogenase activity(GO:0018502) trans-1,2-dihydrodiolphenanthrene dehydrogenase activity(GO:0018503) 3,4-dihydroxy-3,4-dihydrofluorene dehydrogenase activity(GO:0034790) benzo(a)pyrene-trans-11,12-dihydrodiol dehydrogenase activity(GO:0034805) benzo(a)pyrene-cis-4,5-dihydrodiol dehydrogenase activity(GO:0034809) citronellyl-CoA dehydrogenase activity(GO:0034824) menthone dehydrogenase activity(GO:0034838) phthalate 3,4-cis-dihydrodiol dehydrogenase activity(GO:0034912) cinnamate reductase activity(GO:0043786) NADPH-dependent curcumin reductase activity(GO:0052849) NADPH-dependent dihydrocurcumin reductase activity(GO:0052850) |
| 0.0 | 0.0 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
| 0.0 | 0.1 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 0.0 | 0.0 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.2 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
| 0.1 | 3.9 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.1 | 2.8 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.1 | 0.1 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.1 | 0.1 | PID SHP2 PATHWAY | SHP2 signaling |
| 0.1 | 3.4 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.1 | 1.8 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.1 | 1.2 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.1 | 1.3 | PID IGF1 PATHWAY | IGF1 pathway |
| 0.1 | 0.9 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.1 | 0.3 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
| 0.1 | 0.1 | PID CD40 PATHWAY | CD40/CD40L signaling |
| 0.1 | 2.3 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
| 0.1 | 0.2 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
| 0.1 | 0.9 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.1 | 0.7 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.1 | 0.5 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.1 | 0.7 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.1 | 2.9 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
| 0.1 | 2.8 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.1 | 1.5 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.1 | 0.6 | PID ERBB1 RECEPTOR PROXIMAL PATHWAY | EGF receptor (ErbB1) signaling pathway |
| 0.1 | 0.7 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.1 | 0.8 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 0.1 | 0.3 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
| 0.1 | 0.6 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 0.1 | 0.3 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
| 0.1 | 0.5 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
| 0.0 | 0.3 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
| 0.0 | 1.3 | PID RHOA PATHWAY | RhoA signaling pathway |
| 0.0 | 0.6 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
| 0.0 | 2.2 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
| 0.0 | 0.2 | ST STAT3 PATHWAY | STAT3 Pathway |
| 0.0 | 0.6 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.0 | 0.2 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
| 0.0 | 0.4 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
| 0.0 | 0.1 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
| 0.0 | 0.2 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.0 | 0.0 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
| 0.0 | 0.2 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
| 0.0 | 0.2 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.0 | 0.7 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
| 0.0 | 0.9 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.0 | 0.6 | ST G ALPHA I PATHWAY | G alpha i Pathway |
| 0.0 | 0.5 | PID EPHB FWD PATHWAY | EPHB forward signaling |
| 0.0 | 1.0 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.0 | 1.3 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
| 0.0 | 0.6 | PID IL27 PATHWAY | IL27-mediated signaling events |
| 0.0 | 1.2 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
| 0.0 | 0.0 | PID S1P S1P3 PATHWAY | S1P3 pathway |
| 0.0 | 0.6 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.0 | 0.3 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
| 0.0 | 1.2 | PID IL4 2PATHWAY | IL4-mediated signaling events |
| 0.0 | 0.2 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.0 | 0.6 | PID IL23 PATHWAY | IL23-mediated signaling events |
| 0.0 | 0.2 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.0 | 0.2 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
| 0.0 | 0.3 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.0 | 1.0 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.0 | 0.6 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
| 0.0 | 0.3 | PID INSULIN PATHWAY | Insulin Pathway |
| 0.0 | 0.3 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.0 | 0.1 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.0 | 0.1 | PID IL3 PATHWAY | IL3-mediated signaling events |
| 0.0 | 0.5 | PID ARF6 PATHWAY | Arf6 signaling events |
| 0.0 | 0.1 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.0 | 0.2 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.0 | 0.9 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
| 0.0 | 0.2 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.0 | 0.1 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
| 0.0 | 0.4 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.0 | 0.2 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
| 0.0 | 0.5 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
| 0.0 | 0.1 | PID IL2 1PATHWAY | IL2-mediated signaling events |
| 0.0 | 0.0 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
| 0.0 | 0.3 | PID TNF PATHWAY | TNF receptor signaling pathway |
| 0.0 | 0.2 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
| 0.0 | 0.6 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 0.0 | 0.4 | PID BARD1 PATHWAY | BARD1 signaling events |
| 0.0 | 0.0 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.0 | 0.5 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
| 0.0 | 0.2 | NABA COLLAGENS | Genes encoding collagen proteins |
| 0.0 | 0.1 | ST GAQ PATHWAY | G alpha q Pathway |
| 0.0 | 0.3 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
| 0.0 | 0.2 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
| 0.0 | 0.0 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
| 0.0 | 0.0 | PID NECTIN PATHWAY | Nectin adhesion pathway |
| 0.0 | 0.3 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.0 | 0.2 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.0 | 0.1 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.0 | 0.1 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 2.1 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.2 | 0.2 | REACTOME PLC BETA MEDIATED EVENTS | Genes involved in PLC beta mediated events |
| 0.2 | 0.2 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.2 | 1.7 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
| 0.2 | 2.5 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.2 | 2.6 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 0.2 | 1.5 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.1 | 1.5 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
| 0.1 | 1.2 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
| 0.1 | 3.5 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
| 0.1 | 0.4 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
| 0.1 | 1.8 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
| 0.1 | 1.9 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
| 0.1 | 1.3 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.1 | 0.5 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
| 0.1 | 0.3 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
| 0.1 | 1.5 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
| 0.1 | 2.7 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
| 0.1 | 0.1 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
| 0.1 | 0.4 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
| 0.1 | 2.1 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
| 0.1 | 1.0 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.1 | 0.8 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.1 | 0.5 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.1 | 0.8 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.1 | 1.6 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.1 | 0.9 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.1 | 3.6 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.1 | 1.5 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.1 | 1.1 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.1 | 0.8 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
| 0.1 | 0.1 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
| 0.1 | 0.6 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.1 | 1.2 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
| 0.1 | 0.9 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.1 | 0.9 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 0.1 | 0.9 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.1 | 0.2 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 0.1 | 0.6 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
| 0.1 | 1.1 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
| 0.1 | 0.1 | REACTOME DOWNSTREAM SIGNALING EVENTS OF B CELL RECEPTOR BCR | Genes involved in Downstream Signaling Events Of B Cell Receptor (BCR) |
| 0.1 | 1.2 | REACTOME ACTIVATION OF GENES BY ATF4 | Genes involved in Activation of Genes by ATF4 |
| 0.1 | 0.7 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
| 0.1 | 0.1 | REACTOME RIG I MDA5 MEDIATED INDUCTION OF IFN ALPHA BETA PATHWAYS | Genes involved in RIG-I/MDA5 mediated induction of IFN-alpha/beta pathways |
| 0.1 | 2.2 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.1 | 0.7 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
| 0.1 | 1.2 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
| 0.0 | 0.5 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.0 | 0.2 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
| 0.0 | 0.6 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.0 | 1.0 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.0 | 0.5 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
| 0.0 | 0.8 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.0 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
| 0.0 | 0.4 | REACTOME SHC1 EVENTS IN EGFR SIGNALING | Genes involved in SHC1 events in EGFR signaling |
| 0.0 | 1.8 | REACTOME PHASE II CONJUGATION | Genes involved in Phase II conjugation |
| 0.0 | 0.2 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.0 | 0.4 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 0.0 | 0.2 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.0 | 0.3 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
| 0.0 | 1.4 | REACTOME TRANSCRIPTIONAL ACTIVITY OF SMAD2 SMAD3 SMAD4 HETEROTRIMER | Genes involved in Transcriptional activity of SMAD2/SMAD3:SMAD4 heterotrimer |
| 0.0 | 2.5 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
| 0.0 | 0.2 | REACTOME SIGNALING BY NOTCH4 | Genes involved in Signaling by NOTCH4 |
| 0.0 | 6.2 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
| 0.0 | 0.5 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
| 0.0 | 0.0 | REACTOME FORMATION OF THE HIV1 EARLY ELONGATION COMPLEX | Genes involved in Formation of the HIV-1 Early Elongation Complex |
| 0.0 | 0.4 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.0 | 0.4 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
| 0.0 | 0.2 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
| 0.0 | 1.0 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
| 0.0 | 0.2 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
| 0.0 | 0.4 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
| 0.0 | 0.3 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
| 0.0 | 0.1 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.0 | 0.0 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
| 0.0 | 2.1 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
| 0.0 | 1.6 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
| 0.0 | 1.2 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
| 0.0 | 0.4 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
| 0.0 | 0.3 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
| 0.0 | 0.0 | REACTOME BILE ACID AND BILE SALT METABOLISM | Genes involved in Bile acid and bile salt metabolism |
| 0.0 | 0.3 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
| 0.0 | 0.2 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
| 0.0 | 0.5 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
| 0.0 | 0.3 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
| 0.0 | 0.1 | REACTOME RNA POL II PRE TRANSCRIPTION EVENTS | Genes involved in RNA Polymerase II Pre-transcription Events |
| 0.0 | 0.2 | REACTOME OPSINS | Genes involved in Opsins |
| 0.0 | 0.1 | REACTOME CA DEPENDENT EVENTS | Genes involved in Ca-dependent events |
| 0.0 | 0.3 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
| 0.0 | 0.1 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
| 0.0 | 0.1 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
| 0.0 | 0.1 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
| 0.0 | 0.1 | REACTOME PERK REGULATED GENE EXPRESSION | Genes involved in PERK regulated gene expression |
| 0.0 | 0.2 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.0 | 0.5 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
| 0.0 | 0.9 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
| 0.0 | 0.5 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.0 | 0.5 | REACTOME MRNA 3 END PROCESSING | Genes involved in mRNA 3'-end processing |
| 0.0 | 0.3 | REACTOME PHOSPHORYLATION OF THE APC C | Genes involved in Phosphorylation of the APC/C |
| 0.0 | 0.1 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
| 0.0 | 0.2 | REACTOME SIGNALING BY NOTCH1 | Genes involved in Signaling by NOTCH1 |
| 0.0 | 0.4 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 0.0 | 0.1 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.0 | 0.2 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
| 0.0 | 0.1 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 0.0 | 0.2 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
| 0.0 | 0.1 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
| 0.0 | 0.0 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 0.0 | 0.2 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
| 0.0 | 0.4 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
| 0.0 | 0.2 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
| 0.0 | 0.5 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
| 0.0 | 0.2 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
| 0.0 | 0.3 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.0 | 0.2 | REACTOME RESOLUTION OF AP SITES VIA THE MULTIPLE NUCLEOTIDE PATCH REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the multiple-nucleotide patch replacement pathway |
| 0.0 | 0.3 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
| 0.0 | 0.4 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.0 | 0.3 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.0 | 0.9 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
| 0.0 | 0.2 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
| 0.0 | 0.3 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.0 | 0.2 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
| 0.0 | 0.1 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
| 0.0 | 0.5 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
| 0.0 | 0.2 | REACTOME FRS2 MEDIATED CASCADE | Genes involved in FRS2-mediated cascade |
| 0.0 | 0.0 | REACTOME CDT1 ASSOCIATION WITH THE CDC6 ORC ORIGIN COMPLEX | Genes involved in CDT1 association with the CDC6:ORC:origin complex |
| 0.0 | 0.1 | REACTOME EICOSANOID LIGAND BINDING RECEPTORS | Genes involved in Eicosanoid ligand-binding receptors |
| 0.0 | 0.3 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.0 | 0.1 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.0 | 0.1 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
| 0.0 | 0.1 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
| 0.0 | 0.4 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.0 | 0.0 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
| 0.0 | 0.2 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
| 0.0 | 0.4 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
| 0.0 | 0.2 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
| 0.0 | 0.5 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
| 0.0 | 0.4 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
| 0.0 | 0.2 | REACTOME DEADENYLATION DEPENDENT MRNA DECAY | Genes involved in Deadenylation-dependent mRNA decay |
| 0.0 | 0.2 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.0 | 0.3 | REACTOME KINESINS | Genes involved in Kinesins |
| 0.0 | 1.0 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
| 0.0 | 0.5 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
| 0.0 | 0.1 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.0 | 0.1 | REACTOME HYALURONAN METABOLISM | Genes involved in Hyaluronan metabolism |
| 0.0 | 0.2 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.0 | 0.5 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
| 0.0 | 0.1 | REACTOME ASPARAGINE N LINKED GLYCOSYLATION | Genes involved in Asparagine N-linked glycosylation |
| 0.0 | 0.5 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
| 0.0 | 0.4 | REACTOME G ALPHA S SIGNALLING EVENTS | Genes involved in G alpha (s) signalling events |
| 0.0 | 0.1 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
| 0.0 | 0.0 | REACTOME ADP SIGNALLING THROUGH P2RY1 | Genes involved in ADP signalling through P2Y purinoceptor 1 |
| 0.0 | 0.1 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
| 0.0 | 0.1 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.0 | 0.0 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
| 0.0 | 0.1 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
| 0.0 | 0.1 | REACTOME RNA POL III CHAIN ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
| 0.0 | 0.4 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
| 0.0 | 0.0 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF CYCLIN B | Genes involved in APC/C:Cdc20 mediated degradation of Cyclin B |
| 0.0 | 0.1 | REACTOME NEF MEDIATES DOWN MODULATION OF CELL SURFACE RECEPTORS BY RECRUITING THEM TO CLATHRIN ADAPTERS | Genes involved in Nef-mediates down modulation of cell surface receptors by recruiting them to clathrin adapters |
| 0.0 | 1.2 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
| 0.0 | 0.2 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |