Gene Symbol | Gene ID | Gene Info |
---|---|---|
Klf16
|
ENSMUSG00000035397.8 | Klf16 |
Sp8
|
ENSMUSG00000048562.6 | Sp8 |
Gene | Promoter | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Klf16 | chr10_80570267_80570418 | 6979 | 0.077304 | -0.80 | 5.4e-02 | Click! |
Klf16 | chr10_80576408_80576559 | 838 | 0.353094 | 0.56 | 2.4e-01 | Click! |
Klf16 | chr10_80578750_80578929 | 1518 | 0.180008 | -0.45 | 3.7e-01 | Click! |
Klf16 | chr10_80577406_80577585 | 174 | 0.866561 | 0.39 | 4.4e-01 | Click! |
Klf16 | chr10_80569765_80569930 | 7474 | 0.076457 | 0.37 | 4.7e-01 | Click! |
Sp8 | chr12_118836968_118837119 | 9286 | 0.214284 | -0.57 | 2.3e-01 | Click! |
Sp8 | chr12_118855211_118855378 | 7708 | 0.224308 | 0.46 | 3.6e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr8_94172420_94173095 | 6.04 |
Mt2 |
metallothionein 2 |
93 |
0.88 |
chr5_33694927_33695093 | 5.96 |
Gm42965 |
predicted gene 42965 |
12036 |
0.1 |
chr5_122662337_122662510 | 5.72 |
P2rx7 |
purinergic receptor P2X, ligand-gated ion channel, 7 |
11999 |
0.12 |
chr17_27826034_27826569 | 5.40 |
Ilrun |
inflammation and lipid regulator with UBA-like and NBR1-like domains |
5653 |
0.13 |
chr2_68873804_68874167 | 4.76 |
Cers6 |
ceramide synthase 6 |
12399 |
0.14 |
chr14_65299395_65299546 | 4.67 |
Gm48433 |
predicted gene, 48433 |
26861 |
0.13 |
chr8_119417171_119417322 | 4.51 |
Osgin1 |
oxidative stress induced growth inhibitor 1 |
16878 |
0.13 |
chr18_20945707_20945922 | 4.47 |
Rnf125 |
ring finger protein 125 |
1189 |
0.52 |
chr1_39186773_39187108 | 4.37 |
Mir6349 |
microRNA 6349 |
52 |
0.98 |
chr7_6362621_6363146 | 4.19 |
Zfp78 |
zinc finger protein 78 |
397 |
0.69 |
chr6_145343654_145343918 | 4.15 |
Gm23498 |
predicted gene, 23498 |
23072 |
0.11 |
chr1_72806058_72806277 | 4.12 |
Igfbp2 |
insulin-like growth factor binding protein 2 |
18336 |
0.2 |
chr2_158179056_158179229 | 4.07 |
1700060C20Rik |
RIKEN cDNA 1700060C20 gene |
12866 |
0.14 |
chr18_32239390_32239541 | 4.00 |
Ercc3 |
excision repair cross-complementing rodent repair deficiency, complementation group 3 |
835 |
0.63 |
chr14_20317904_20318198 | 3.98 |
Nudt13 |
nudix (nucleoside diphosphate linked moiety X)-type motif 13 |
6622 |
0.13 |
chr17_26601133_26601303 | 3.95 |
Ergic1 |
endoplasmic reticulum-golgi intermediate compartment (ERGIC) 1 |
64 |
0.96 |
chr6_126048159_126048341 | 3.94 |
Ntf3 |
neurotrophin 3 |
116710 |
0.06 |
chr1_72827270_72827421 | 3.79 |
Igfbp2 |
insulin-like growth factor binding protein 2 |
2023 |
0.37 |
chr15_10675955_10676106 | 3.72 |
Rai14 |
retinoic acid induced 14 |
37510 |
0.14 |
chr8_119417985_119418136 | 3.71 |
Osgin1 |
oxidative stress induced growth inhibitor 1 |
16064 |
0.14 |
chr15_77150122_77150279 | 3.66 |
Rbfox2 |
RNA binding protein, fox-1 homolog (C. elegans) 2 |
3356 |
0.18 |
chr19_3850170_3850502 | 3.65 |
Chka |
choline kinase alpha |
1437 |
0.22 |
chr11_102749526_102749741 | 3.56 |
Adam11 |
a disintegrin and metallopeptidase domain 11 |
11806 |
0.11 |
chr7_113228562_113228716 | 3.54 |
Arntl |
aryl hydrocarbon receptor nuclear translocator-like |
5984 |
0.23 |
chr10_75044491_75044663 | 3.46 |
Rab36 |
RAB36, member RAS oncogene family |
6354 |
0.16 |
chr19_47660118_47660275 | 3.35 |
Col17a1 |
collagen, type XVII, alpha 1 |
10601 |
0.12 |
chr2_32714756_32714912 | 3.33 |
Cdk9 |
cyclin-dependent kinase 9 (CDC2-related kinase) |
1758 |
0.13 |
chr10_80139371_80139556 | 3.33 |
Cbarp |
calcium channel, voltage-dependent, beta subunit associated regulatory protein |
98 |
0.88 |
chr2_166115851_166116023 | 3.31 |
Sulf2 |
sulfatase 2 |
37818 |
0.13 |
chr16_80273340_80273491 | 3.30 |
Gm23083 |
predicted gene, 23083 |
136063 |
0.05 |
chr8_70538228_70538406 | 3.28 |
Ell |
elongation factor RNA polymerase II |
1140 |
0.27 |
chr9_120731019_120731170 | 3.27 |
Gm47064 |
predicted gene, 47064 |
20049 |
0.12 |
chr4_139798704_139798855 | 3.22 |
Pax7 |
paired box 7 |
34228 |
0.17 |
chr9_104002362_104002733 | 3.19 |
Nphp3 |
nephronophthisis 3 (adolescent) |
1 |
0.73 |
chr1_39193049_39193247 | 3.19 |
Npas2 |
neuronal PAS domain protein 2 |
583 |
0.75 |
chr5_115732580_115732733 | 3.18 |
Bicdl1 |
BICD family like cargo adaptor 1 |
1035 |
0.52 |
chr1_39192284_39192607 | 3.14 |
Npas2 |
neuronal PAS domain protein 2 |
1286 |
0.45 |
chr7_139020930_139021245 | 3.14 |
Gm45613 |
predicted gene 45613 |
88 |
0.97 |
chr11_98767825_98767976 | 3.14 |
Nr1d1 |
nuclear receptor subfamily 1, group D, member 1 |
2526 |
0.15 |
chr15_79741187_79741771 | 3.12 |
Sun2 |
Sad1 and UNC84 domain containing 2 |
613 |
0.45 |
chr4_118015852_118016015 | 3.10 |
St3gal3 |
ST3 beta-galactoside alpha-2,3-sialyltransferase 3 |
15949 |
0.16 |
chr5_117348441_117348592 | 3.09 |
Gm15727 |
predicted gene 15727 |
827 |
0.39 |
chr1_165617606_165617906 | 3.07 |
Mpzl1 |
myelin protein zero-like 1 |
3777 |
0.14 |
chr12_24463865_24464016 | 3.07 |
Gm16372 |
predicted pseudogene 16372 |
29716 |
0.14 |
chr7_143599041_143599206 | 2.96 |
Cars |
cysteinyl-tRNA synthetase |
558 |
0.5 |
chr9_66802090_66802293 | 2.95 |
BC050972 |
cDNA sequence BC050972 |
368 |
0.78 |
chr11_115212171_115212324 | 2.92 |
Nat9 |
N-acetyltransferase 9 (GCN5-related, putative) |
24388 |
0.09 |
chr19_4616707_4616858 | 2.91 |
Lrfn4 |
leucine rich repeat and fibronectin type III domain containing 4 |
1115 |
0.34 |
chr17_27557519_27557704 | 2.90 |
Hmga1 |
high mobility group AT-hook 1 |
916 |
0.28 |
chr12_21142640_21142894 | 2.89 |
Asap2 |
ArfGAP with SH3 domain, ankyrin repeat and PH domain 2 |
30813 |
0.16 |
chr14_30916422_30916581 | 2.87 |
Itih3 |
inter-alpha trypsin inhibitor, heavy chain 3 |
1114 |
0.35 |
chr8_119417830_119417981 | 2.87 |
Osgin1 |
oxidative stress induced growth inhibitor 1 |
16219 |
0.14 |
chr17_31874093_31874279 | 2.84 |
Sik1 |
salt inducible kinase 1 |
18382 |
0.13 |
chr11_101668758_101669043 | 2.84 |
Arl4d |
ADP-ribosylation factor-like 4D |
3359 |
0.12 |
chr11_98770256_98770457 | 2.83 |
Nr1d1 |
nuclear receptor subfamily 1, group D, member 1 |
70 |
0.94 |
chr8_84978044_84978195 | 2.79 |
Junb |
jun B proto-oncogene |
599 |
0.41 |
chr13_98594899_98595134 | 2.77 |
Gm4815 |
predicted gene 4815 |
18485 |
0.12 |
chr12_84190226_84190393 | 2.75 |
Gm19327 |
predicted gene, 19327 |
2503 |
0.16 |
chr4_137874478_137874749 | 2.72 |
Gm13012 |
predicted gene 13012 |
8799 |
0.2 |
chr18_20986270_20986434 | 2.68 |
Rnf138 |
ring finger protein 138 |
14989 |
0.19 |
chr3_105705277_105705434 | 2.67 |
Inka2 |
inka box actin regulator 2 |
103 |
0.95 |
chr17_68004161_68004320 | 2.66 |
Arhgap28 |
Rho GTPase activating protein 28 |
120 |
0.98 |
chr9_106452941_106453115 | 2.64 |
Gm28959 |
predicted gene 28959 |
110 |
0.68 |
chr5_114435733_114435884 | 2.62 |
Mmab |
methylmalonic aciduria (cobalamin deficiency) cblB type homolog (human) |
8184 |
0.14 |
chr11_103106497_103106684 | 2.62 |
Acbd4 |
acyl-Coenzyme A binding domain containing 4 |
386 |
0.77 |
chr2_154609281_154609723 | 2.60 |
Zfp341 |
zinc finger protein 341 |
3795 |
0.12 |
chr10_12278450_12278601 | 2.59 |
Gm48723 |
predicted gene, 48723 |
46136 |
0.14 |
chr11_49088297_49088883 | 2.59 |
Gm12188 |
predicted gene 12188 |
47 |
0.79 |
chr2_121866807_121866994 | 2.59 |
Casc4 |
cancer susceptibility candidate 4 |
70 |
0.66 |
chr10_120217129_120217291 | 2.54 |
Tmbim4 |
transmembrane BAX inhibitor motif containing 4 |
3478 |
0.18 |
chr15_31117311_31117579 | 2.53 |
Gm26416 |
predicted gene, 26416 |
76893 |
0.08 |
chr5_114560586_114560754 | 2.53 |
Fam222a |
family with sequence similarity 222, member A |
7346 |
0.16 |
chr19_58441609_58442090 | 2.48 |
Gfra1 |
glial cell line derived neurotrophic factor family receptor alpha 1 |
12617 |
0.22 |
chr5_144358410_144358608 | 2.48 |
Dmrt1i |
Dmrt1 interacting ncRNA |
16 |
0.87 |
chr3_90446574_90447024 | 2.47 |
Gm16048 |
predicted gene 16048 |
4784 |
0.1 |
chr1_13103635_13103786 | 2.46 |
Prdm14 |
PR domain containing 14 |
23453 |
0.13 |
chr7_24500065_24500216 | 2.45 |
Cadm4 |
cell adhesion molecule 4 |
179 |
0.88 |
chr12_21145146_21145377 | 2.45 |
Asap2 |
ArfGAP with SH3 domain, ankyrin repeat and PH domain 2 |
33307 |
0.16 |
chr7_27447795_27447954 | 2.45 |
Blvrb |
biliverdin reductase B (flavin reductase (NADPH)) |
104 |
0.61 |
chr11_112810941_112811143 | 2.44 |
Gm11681 |
predicted gene 11681 |
12034 |
0.18 |
chr11_62076764_62076946 | 2.44 |
Specc1 |
sperm antigen with calponin homology and coiled-coil domains 1 |
140 |
0.96 |
chr14_25456911_25457241 | 2.43 |
Zmiz1os1 |
Zmiz1 opposite strand 1 |
722 |
0.52 |
chr11_116615779_116616354 | 2.43 |
Rhbdf2 |
rhomboid 5 homolog 2 |
8134 |
0.1 |
chr8_22652977_22653289 | 2.43 |
Polb |
polymerase (DNA directed), beta |
285 |
0.87 |
chr10_7852226_7852377 | 2.43 |
Gm24726 |
predicted gene, 24726 |
3820 |
0.16 |
chr15_38452834_38452985 | 2.42 |
G930009F23Rik |
RIKEN cDNA G930009F23 gene |
2225 |
0.25 |
chr9_61347110_61347271 | 2.42 |
Gm10655 |
predicted gene 10655 |
24437 |
0.16 |
chr8_84984897_84985063 | 2.41 |
Hook2 |
hook microtubule tethering protein 2 |
5623 |
0.06 |
chr19_44997151_44997302 | 2.41 |
Sema4g |
sema domain, immunoglobulin domain (Ig), transmembrane domain (TM) and short cytoplasmic domain, (semaphorin) 4G |
5090 |
0.11 |
chr15_82290409_82290560 | 2.41 |
Septin3 |
septin 3 |
6054 |
0.09 |
chr15_102245005_102245156 | 2.40 |
Rarg |
retinoic acid receptor, gamma |
151 |
0.91 |
chr5_122513930_122514081 | 2.39 |
Gm22965 |
predicted gene, 22965 |
7216 |
0.1 |
chr11_115276837_115277180 | 2.38 |
Fdxr |
ferredoxin reductase |
42 |
0.95 |
chr2_31825447_31825664 | 2.35 |
Qrfp |
pyroglutamylated RFamide peptide |
14975 |
0.13 |
chr8_119445523_119446899 | 2.35 |
Necab2 |
N-terminal EF-hand calcium binding protein 2 |
508 |
0.74 |
chr8_119444266_119444532 | 2.34 |
Necab2 |
N-terminal EF-hand calcium binding protein 2 |
2320 |
0.23 |
chr6_72233913_72234064 | 2.34 |
Atoh8 |
atonal bHLH transcription factor 8 |
549 |
0.74 |
chr13_41253417_41253699 | 2.31 |
Smim13 |
small integral membrane protein 13 |
3714 |
0.15 |
chr11_69601181_69601332 | 2.30 |
Atp1b2 |
ATPase, Na+/K+ transporting, beta 2 polypeptide |
1485 |
0.15 |
chr14_63605914_63606082 | 2.28 |
Xkr6 |
X-linked Kx blood group related 6 |
505 |
0.71 |
chr6_88842035_88842313 | 2.28 |
Abtb1 |
ankyrin repeat and BTB (POZ) domain containing 1 |
190 |
0.79 |
chr8_71572922_71573096 | 2.27 |
Slc27a1 |
solute carrier family 27 (fatty acid transporter), member 1 |
2354 |
0.12 |
chr11_51857780_51858123 | 2.26 |
Jade2 |
jade family PHD finger 2 |
298 |
0.9 |
chr1_74807002_74807292 | 2.25 |
Wnt10a |
wingless-type MMTV integration site family, member 10A |
13784 |
0.11 |
chr6_113991518_113991701 | 2.24 |
Gm15083 |
predicted gene 15083 |
13180 |
0.17 |
chr1_92718220_92718503 | 2.24 |
Gm29483 |
predicted gene 29483 |
1159 |
0.42 |
chr17_29078234_29078394 | 2.24 |
Trp53cor1 |
tumor protein p53 pathway corepressor 1 |
865 |
0.39 |
chr11_58239237_58239562 | 2.22 |
Gm5038 |
predicted gene 5038 |
7949 |
0.11 |
chr1_133908470_133908621 | 2.21 |
Optc |
opticin |
546 |
0.66 |
chr4_128947381_128947553 | 2.21 |
Gm15904 |
predicted gene 15904 |
11462 |
0.15 |
chr3_57136965_57137116 | 2.20 |
Gm8177 |
predicted gene 8177 |
209 |
0.96 |
chr3_89391856_89392032 | 2.20 |
Gm15417 |
predicted gene 15417 |
26 |
0.6 |
chr7_6286327_6286735 | 2.19 |
Zfp667 |
zinc finger protein 667 |
48 |
0.95 |
chr16_95769487_95769687 | 2.18 |
Gm37259 |
predicted gene, 37259 |
9751 |
0.17 |
chr10_79879613_79879900 | 2.18 |
Prtn3 |
proteinase 3 |
142 |
0.85 |
chr7_30717382_30717736 | 2.17 |
Atp4a |
ATPase, H+/K+ exchanging, gastric, alpha polypeptide |
273 |
0.75 |
chr4_133133228_133133391 | 2.17 |
Wasf2 |
WAS protein family, member 2 |
2680 |
0.25 |
chr12_25092894_25093391 | 2.17 |
Id2 |
inhibitor of DNA binding 2 |
2945 |
0.22 |
chr9_21918187_21918359 | 2.15 |
Rab3d |
RAB3D, member RAS oncogene family |
81 |
0.93 |
chr19_45079796_45079947 | 2.15 |
Kazald1 |
Kazal-type serine peptidase inhibitor domain 1 |
3732 |
0.15 |
chr17_31612429_31612580 | 2.14 |
Cbs |
cystathionine beta-synthase |
5369 |
0.1 |
chr9_58112850_58113072 | 2.14 |
Ccdc33 |
coiled-coil domain containing 33 |
1399 |
0.31 |
chr11_89028954_89029121 | 2.14 |
Trim25 |
tripartite motif-containing 25 |
29661 |
0.09 |
chr1_155112239_155112390 | 2.14 |
Ier5 |
immediate early response 5 |
12678 |
0.14 |
chr5_134941937_134942100 | 2.13 |
Mettl27 |
methyltransferase like 27 |
1556 |
0.18 |
chr3_68493989_68494284 | 2.13 |
Schip1 |
schwannomin interacting protein 1 |
72 |
0.98 |
chr16_28881932_28882083 | 2.13 |
Mb21d2 |
Mab-21 domain containing 2 |
45640 |
0.17 |
chrX_87238307_87238458 | 2.13 |
Gm8855 |
predicted gene 8855 |
435487 |
0.01 |
chr2_25095172_25095346 | 2.13 |
Noxa1 |
NADPH oxidase activator 1 |
110 |
0.92 |
chr3_101941844_101942006 | 2.12 |
Slc22a15 |
solute carrier family 22 (organic anion/cation transporter), member 15 |
17472 |
0.2 |
chr9_61370295_61371248 | 2.12 |
Gm10655 |
predicted gene 10655 |
856 |
0.53 |
chr2_168518274_168518450 | 2.12 |
Nfatc2 |
nuclear factor of activated T cells, cytoplasmic, calcineurin dependent 2 |
33914 |
0.18 |
chr15_25945393_25945754 | 2.11 |
Mir7212 |
microRNA 7212 |
2654 |
0.25 |
chr3_88121794_88122072 | 2.11 |
Iqgap3 |
IQ motif containing GTPase activating protein 3 |
14817 |
0.1 |
chr10_81320539_81320949 | 2.11 |
Cactin |
cactin, spliceosome C complex subunit |
359 |
0.64 |
chr7_35333860_35334195 | 2.09 |
Rhpn2 |
rhophilin, Rho GTPase binding protein 2 |
143 |
0.94 |
chr10_41677490_41677641 | 2.09 |
Mir3473b |
microRNA 3473b |
6826 |
0.15 |
chr8_126615919_126616193 | 2.08 |
Irf2bp2 |
interferon regulatory factor 2 binding protein 2 |
22070 |
0.21 |
chr12_111454995_111455516 | 2.08 |
Tnfaip2 |
tumor necrosis factor, alpha-induced protein 2 |
4736 |
0.13 |
chr4_35134107_35134262 | 2.07 |
Ifnk |
interferon kappa |
17872 |
0.17 |
chr12_86825129_86825313 | 2.06 |
Gm10095 |
predicted gene 10095 |
21246 |
0.17 |
chr11_117875729_117875880 | 2.05 |
Tha1 |
threonine aldolase 1 |
2323 |
0.16 |
chr16_30257794_30257955 | 2.05 |
Gm49645 |
predicted gene, 49645 |
2722 |
0.2 |
chr13_111809159_111809796 | 2.05 |
Gm15327 |
predicted gene 15327 |
336 |
0.59 |
chr8_33902816_33903036 | 2.05 |
Rbpms |
RNA binding protein gene with multiple splicing |
11162 |
0.17 |
chr11_121099879_121100030 | 2.05 |
Gm11791 |
predicted gene 11791 |
2747 |
0.12 |
chr17_31871058_31871230 | 2.05 |
Sik1 |
salt inducible kinase 1 |
15340 |
0.14 |
chr19_55744520_55744671 | 2.04 |
Tcf7l2 |
transcription factor 7 like 2, T cell specific, HMG box |
1750 |
0.5 |
chr15_102245447_102245598 | 2.03 |
Rarg |
retinoic acid receptor, gamma |
291 |
0.81 |
chr5_118294350_118294584 | 2.03 |
Gm25076 |
predicted gene, 25076 |
28018 |
0.15 |
chr11_77870675_77870826 | 2.02 |
Pipox |
pipecolic acid oxidase |
11936 |
0.14 |
chr1_184276149_184276321 | 2.02 |
Gm37223 |
predicted gene, 37223 |
82094 |
0.09 |
chr8_10899350_10899661 | 2.01 |
4833411C07Rik |
RIKEN cDNA 4833411C07 gene |
417 |
0.64 |
chr5_86065571_86066077 | 2.01 |
Cenpc1 |
centromere protein C1 |
241 |
0.84 |
chr1_194978480_194978631 | 2.01 |
Gm16897 |
predicted gene, 16897 |
1595 |
0.21 |
chr4_53012158_53012319 | 2.00 |
Nipsnap3b |
nipsnap homolog 3B |
288 |
0.88 |
chr10_69910495_69910908 | 2.00 |
Ank3 |
ankyrin 3, epithelial |
4164 |
0.35 |
chr8_70539199_70539597 | 1.99 |
Ell |
elongation factor RNA polymerase II |
59 |
0.94 |
chr17_56462430_56462799 | 1.99 |
Ptprs |
protein tyrosine phosphatase, receptor type, S |
398 |
0.82 |
chr13_64367699_64367881 | 1.98 |
Ctsl |
cathepsin L |
735 |
0.5 |
chr16_30964920_30965271 | 1.98 |
Gm15742 |
predicted gene 15742 |
8423 |
0.18 |
chr1_118627791_118627969 | 1.97 |
Tfcp2l1 |
transcription factor CP2-like 1 |
65 |
0.97 |
chr17_28178418_28178590 | 1.97 |
C230013L11Rik |
RIKEN cDNA C230013L11 gene |
822 |
0.37 |
chr15_100659267_100659476 | 1.96 |
Bin2 |
bridging integrator 2 |
7711 |
0.09 |
chr7_112300238_112300389 | 1.96 |
Mical2 |
microtubule associated monooxygenase, calponin and LIM domain containing 2 |
15716 |
0.27 |
chr5_109558445_109558806 | 1.95 |
Crlf2 |
cytokine receptor-like factor 2 |
311 |
0.86 |
chr19_23035930_23036081 | 1.95 |
Gm50136 |
predicted gene, 50136 |
25449 |
0.19 |
chr2_103625378_103625529 | 1.94 |
Abtb2 |
ankyrin repeat and BTB (POZ) domain containing 2 |
59143 |
0.1 |
chr2_24351263_24351430 | 1.93 |
Il1rn |
interleukin 1 receptor antagonist |
5998 |
0.15 |
chr17_29093649_29093812 | 1.92 |
Cdkn1a |
cyclin-dependent kinase inhibitor 1A (P21) |
39 |
0.91 |
chr2_93462501_93462656 | 1.92 |
Cd82 |
CD82 antigen |
76 |
0.97 |
chr11_50188709_50189126 | 1.92 |
Mrnip |
MRN complex interacting protein |
14010 |
0.1 |
chr5_134985683_134985851 | 1.91 |
Cldn3 |
claudin 3 |
447 |
0.63 |
chr18_53136315_53136466 | 1.91 |
Snx2 |
sorting nexin 2 |
39926 |
0.19 |
chr11_78886456_78886607 | 1.91 |
Nos2 |
nitric oxide synthase 2, inducible |
34256 |
0.14 |
chr15_79690269_79690868 | 1.91 |
Gtpbp1 |
GTP binding protein 1 |
277 |
0.78 |
chr2_118388403_118388563 | 1.91 |
Eif2ak4 |
eukaryotic translation initiation factor 2 alpha kinase 4 |
135 |
0.95 |
chr19_42610535_42610705 | 1.91 |
Loxl4 |
lysyl oxidase-like 4 |
2089 |
0.31 |
chr8_10866041_10866207 | 1.90 |
Gm32540 |
predicted gene, 32540 |
62 |
0.96 |
chr4_122455220_122455373 | 1.90 |
Gm12895 |
predicted gene 12895 |
86 |
0.98 |
chr6_48595408_48595586 | 1.89 |
Repin1 |
replication initiator 1 |
1178 |
0.2 |
chr8_84705414_84705592 | 1.88 |
Nfix |
nuclear factor I/X |
2213 |
0.16 |
chr5_45493187_45493547 | 1.88 |
Lap3 |
leucine aminopeptidase 3 |
7 |
0.97 |
chr4_122122855_122123016 | 1.88 |
Gm12896 |
predicted gene 12896 |
88 |
0.98 |
chr4_151044647_151045045 | 1.87 |
Per3 |
period circadian clock 3 |
181 |
0.94 |
chr15_67039473_67039636 | 1.87 |
Gm31342 |
predicted gene, 31342 |
504 |
0.83 |
chr1_72243876_72244033 | 1.87 |
Gm24497 |
predicted gene, 24497 |
259 |
0.87 |
chr17_24208968_24209522 | 1.87 |
Ntn3 |
netrin 3 |
154 |
0.72 |
chr8_119417331_119417482 | 1.86 |
Osgin1 |
oxidative stress induced growth inhibitor 1 |
16718 |
0.14 |
chr10_108612751_108612908 | 1.86 |
Syt1 |
synaptotagmin I |
24135 |
0.23 |
chr11_97884386_97884555 | 1.86 |
Gm11630 |
predicted gene 11630 |
124 |
0.73 |
chr15_83704064_83704215 | 1.86 |
Scube1 |
signal peptide, CUB domain, EGF-like 1 |
20787 |
0.2 |
chr4_148159839_148160231 | 1.86 |
Fbxo44 |
F-box protein 44 |
48 |
0.89 |
chr12_112428711_112428862 | 1.86 |
A730018C14Rik |
RIKEN cDNA A730018C14 gene |
5574 |
0.16 |
chr1_91893698_91893865 | 1.86 |
Gm37600 |
predicted gene, 37600 |
22479 |
0.17 |
chr7_84409303_84409461 | 1.85 |
Arnt2 |
aryl hydrocarbon receptor nuclear translocator 2 |
501 |
0.78 |
chr1_72833162_72833313 | 1.85 |
Igfbp2 |
insulin-like growth factor binding protein 2 |
7915 |
0.22 |
chr1_87764802_87764962 | 1.85 |
Atg16l1 |
autophagy related 16-like 1 (S. cerevisiae) |
2019 |
0.23 |
chr1_133452688_133453146 | 1.85 |
Sox13 |
SRY (sex determining region Y)-box 13 |
28540 |
0.16 |
chr4_120230002_120230153 | 1.84 |
Foxo6 |
forkhead box O6 |
57272 |
0.11 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.3 | 7.0 | GO:0070384 | Harderian gland development(GO:0070384) |
1.5 | 5.9 | GO:0010273 | detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
1.4 | 4.1 | GO:0030538 | embryonic genitalia morphogenesis(GO:0030538) |
1.3 | 5.2 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
1.3 | 5.0 | GO:0060397 | JAK-STAT cascade involved in growth hormone signaling pathway(GO:0060397) |
1.1 | 2.2 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
1.1 | 3.3 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
1.1 | 3.2 | GO:2000586 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
1.1 | 7.4 | GO:0034144 | negative regulation of toll-like receptor 4 signaling pathway(GO:0034144) |
1.0 | 5.2 | GO:0006548 | histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
1.0 | 3.0 | GO:0019448 | cysteine catabolic process(GO:0009093) L-cysteine catabolic process(GO:0019448) L-cysteine metabolic process(GO:0046439) |
1.0 | 3.0 | GO:1905216 | positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
1.0 | 2.9 | GO:0030242 | pexophagy(GO:0030242) |
1.0 | 4.9 | GO:0032056 | positive regulation of translation in response to stress(GO:0032056) |
1.0 | 2.9 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
0.9 | 4.7 | GO:0034638 | phosphatidylcholine catabolic process(GO:0034638) |
0.9 | 2.8 | GO:0060137 | maternal process involved in parturition(GO:0060137) |
0.9 | 0.9 | GO:0061687 | detoxification of inorganic compound(GO:0061687) |
0.9 | 3.5 | GO:0060264 | regulation of respiratory burst involved in inflammatory response(GO:0060264) |
0.9 | 0.9 | GO:1990314 | cellular response to insulin-like growth factor stimulus(GO:1990314) |
0.9 | 4.3 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.9 | 1.7 | GO:0090361 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
0.8 | 2.4 | GO:0043974 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
0.8 | 3.1 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
0.8 | 2.4 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
0.8 | 2.3 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
0.8 | 4.6 | GO:0051775 | response to redox state(GO:0051775) |
0.8 | 0.8 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
0.8 | 1.5 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
0.8 | 0.8 | GO:0021943 | formation of radial glial scaffolds(GO:0021943) |
0.8 | 9.9 | GO:0006577 | amino-acid betaine metabolic process(GO:0006577) |
0.8 | 0.8 | GO:1903898 | negative regulation of PERK-mediated unfolded protein response(GO:1903898) |
0.7 | 4.5 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
0.7 | 5.8 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
0.7 | 2.1 | GO:0090309 | positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
0.7 | 3.5 | GO:0015760 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
0.7 | 2.1 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
0.7 | 0.7 | GO:0051195 | negative regulation of nucleotide catabolic process(GO:0030812) negative regulation of cofactor metabolic process(GO:0051195) negative regulation of coenzyme metabolic process(GO:0051198) |
0.7 | 2.1 | GO:0071376 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
0.7 | 2.8 | GO:0007296 | vitellogenesis(GO:0007296) |
0.7 | 0.7 | GO:0003162 | atrioventricular node development(GO:0003162) |
0.7 | 2.7 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
0.7 | 2.7 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
0.7 | 2.7 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
0.7 | 2.0 | GO:0042126 | nitrate metabolic process(GO:0042126) |
0.7 | 3.9 | GO:0001842 | neural fold formation(GO:0001842) |
0.7 | 8.5 | GO:0046697 | decidualization(GO:0046697) |
0.6 | 1.9 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.6 | 2.6 | GO:2000065 | negative regulation of aldosterone metabolic process(GO:0032345) negative regulation of aldosterone biosynthetic process(GO:0032348) negative regulation of cortisol biosynthetic process(GO:2000065) |
0.6 | 1.9 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
0.6 | 3.2 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
0.6 | 5.1 | GO:0021707 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
0.6 | 1.3 | GO:0034635 | glutathione transport(GO:0034635) tripeptide transport(GO:0042939) |
0.6 | 2.5 | GO:0098795 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
0.6 | 1.9 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.6 | 3.8 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
0.6 | 0.6 | GO:0002434 | immune complex clearance(GO:0002434) |
0.6 | 0.6 | GO:0048369 | lateral mesoderm morphogenesis(GO:0048369) lateral mesoderm formation(GO:0048370) lateral mesodermal cell differentiation(GO:0048371) |
0.6 | 2.4 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
0.6 | 1.8 | GO:0061030 | epithelial cell differentiation involved in mammary gland alveolus development(GO:0061030) |
0.6 | 1.8 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
0.6 | 1.2 | GO:0046149 | heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
0.6 | 1.2 | GO:0034033 | nucleoside bisphosphate biosynthetic process(GO:0033866) ribonucleoside bisphosphate biosynthetic process(GO:0034030) purine nucleoside bisphosphate biosynthetic process(GO:0034033) |
0.6 | 3.5 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
0.6 | 1.7 | GO:0006106 | fumarate metabolic process(GO:0006106) |
0.6 | 0.6 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
0.6 | 1.2 | GO:0061419 | positive regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061419) |
0.6 | 2.3 | GO:0019695 | choline metabolic process(GO:0019695) |
0.6 | 5.7 | GO:0060213 | regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
0.6 | 1.7 | GO:0040031 | snRNA modification(GO:0040031) |
0.6 | 0.6 | GO:0043173 | nucleotide salvage(GO:0043173) |
0.6 | 2.2 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.6 | 2.8 | GO:0015886 | heme transport(GO:0015886) |
0.6 | 0.6 | GO:0010520 | regulation of reciprocal meiotic recombination(GO:0010520) |
0.6 | 1.1 | GO:0003419 | growth plate cartilage chondrocyte proliferation(GO:0003419) |
0.6 | 2.8 | GO:0009115 | xanthine catabolic process(GO:0009115) |
0.5 | 1.1 | GO:0035905 | ascending aorta development(GO:0035905) ascending aorta morphogenesis(GO:0035910) |
0.5 | 1.1 | GO:0044068 | modulation by symbiont of host cellular process(GO:0044068) |
0.5 | 1.6 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
0.5 | 1.6 | GO:0036015 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
0.5 | 0.5 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
0.5 | 1.6 | GO:0051466 | positive regulation of corticotropin-releasing hormone secretion(GO:0051466) |
0.5 | 2.1 | GO:0010991 | negative regulation of SMAD protein complex assembly(GO:0010991) |
0.5 | 1.6 | GO:0097503 | sialylation(GO:0097503) |
0.5 | 4.3 | GO:2001185 | regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
0.5 | 1.6 | GO:0090292 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
0.5 | 1.6 | GO:0001306 | age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
0.5 | 2.1 | GO:1903352 | ornithine transport(GO:0015822) L-ornithine transmembrane transport(GO:1903352) |
0.5 | 2.1 | GO:0071286 | cellular response to magnesium ion(GO:0071286) |
0.5 | 0.5 | GO:0086068 | Purkinje myocyte action potential(GO:0086017) Purkinje myocyte to ventricular cardiac muscle cell signaling(GO:0086029) Purkinje myocyte to ventricular cardiac muscle cell communication(GO:0086068) |
0.5 | 1.0 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
0.5 | 1.0 | GO:0071879 | positive regulation of adrenergic receptor signaling pathway(GO:0071879) |
0.5 | 2.1 | GO:0060339 | negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
0.5 | 3.1 | GO:0045654 | positive regulation of megakaryocyte differentiation(GO:0045654) |
0.5 | 3.6 | GO:0007028 | cytoplasm organization(GO:0007028) |
0.5 | 1.5 | GO:1903061 | positive regulation of protein lipidation(GO:1903061) |
0.5 | 1.0 | GO:0046813 | receptor-mediated virion attachment to host cell(GO:0046813) |
0.5 | 1.5 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
0.5 | 2.0 | GO:0035493 | SNARE complex assembly(GO:0035493) |
0.5 | 1.5 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.5 | 1.5 | GO:1904393 | regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904393) positive regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904395) |
0.5 | 2.0 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.5 | 3.4 | GO:0071318 | cellular response to ATP(GO:0071318) |
0.5 | 2.4 | GO:0051342 | regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051342) |
0.5 | 2.9 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
0.5 | 2.9 | GO:1901030 | positive regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901030) |
0.5 | 1.4 | GO:0051541 | elastin metabolic process(GO:0051541) |
0.5 | 1.4 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
0.5 | 2.9 | GO:0046654 | tetrahydrofolate biosynthetic process(GO:0046654) |
0.5 | 2.4 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
0.5 | 2.4 | GO:0014744 | positive regulation of muscle adaptation(GO:0014744) |
0.5 | 1.9 | GO:0002924 | negative regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002924) |
0.5 | 0.9 | GO:2000823 | regulation of androgen receptor activity(GO:2000823) |
0.5 | 2.8 | GO:0006559 | L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
0.5 | 0.5 | GO:1904294 | positive regulation of ERAD pathway(GO:1904294) |
0.5 | 0.9 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
0.5 | 3.8 | GO:1904754 | positive regulation of vascular associated smooth muscle cell migration(GO:1904754) |
0.5 | 1.4 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
0.5 | 1.4 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
0.5 | 1.9 | GO:0090240 | positive regulation of histone H4 acetylation(GO:0090240) |
0.5 | 1.4 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
0.5 | 0.5 | GO:2001181 | positive regulation of interleukin-10 secretion(GO:2001181) |
0.5 | 1.4 | GO:2000668 | dendritic cell apoptotic process(GO:0097048) regulation of dendritic cell apoptotic process(GO:2000668) |
0.5 | 1.4 | GO:0002432 | granuloma formation(GO:0002432) |
0.5 | 1.4 | GO:1904219 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
0.5 | 1.9 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
0.5 | 3.3 | GO:0006265 | DNA topological change(GO:0006265) |
0.5 | 1.4 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
0.5 | 3.2 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
0.5 | 1.4 | GO:2000275 | regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
0.5 | 1.4 | GO:1901492 | positive regulation of lymphangiogenesis(GO:1901492) |
0.5 | 1.4 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
0.5 | 2.3 | GO:0010694 | positive regulation of alkaline phosphatase activity(GO:0010694) |
0.5 | 1.4 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.5 | 0.5 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
0.5 | 1.8 | GO:0060054 | positive regulation of epithelial cell proliferation involved in wound healing(GO:0060054) |
0.5 | 1.4 | GO:0001712 | ectodermal cell fate commitment(GO:0001712) |
0.5 | 1.4 | GO:0036506 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
0.5 | 2.7 | GO:0006477 | protein sulfation(GO:0006477) |
0.4 | 1.3 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
0.4 | 3.1 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
0.4 | 1.8 | GO:0051572 | negative regulation of histone H3-K4 methylation(GO:0051572) |
0.4 | 1.3 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
0.4 | 1.3 | GO:0070640 | vitamin D3 metabolic process(GO:0070640) |
0.4 | 0.9 | GO:0097195 | pilomotor reflex(GO:0097195) |
0.4 | 0.9 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
0.4 | 2.2 | GO:0098814 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
0.4 | 1.3 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.4 | 1.3 | GO:0071288 | cellular response to mercury ion(GO:0071288) |
0.4 | 0.4 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
0.4 | 6.6 | GO:0015936 | coenzyme A metabolic process(GO:0015936) |
0.4 | 1.3 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
0.4 | 2.6 | GO:0040016 | embryonic cleavage(GO:0040016) |
0.4 | 2.6 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
0.4 | 1.3 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
0.4 | 1.3 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
0.4 | 1.3 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
0.4 | 0.9 | GO:0009757 | carbohydrate mediated signaling(GO:0009756) hexose mediated signaling(GO:0009757) sugar mediated signaling pathway(GO:0010182) glucose mediated signaling pathway(GO:0010255) |
0.4 | 0.9 | GO:0035166 | post-embryonic hemopoiesis(GO:0035166) |
0.4 | 0.9 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.4 | 5.2 | GO:0006047 | UDP-N-acetylglucosamine metabolic process(GO:0006047) |
0.4 | 2.1 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
0.4 | 1.7 | GO:0051697 | protein delipidation(GO:0051697) |
0.4 | 3.8 | GO:0051764 | actin crosslink formation(GO:0051764) |
0.4 | 0.9 | GO:0010993 | regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
0.4 | 2.6 | GO:0045916 | negative regulation of complement activation(GO:0045916) negative regulation of protein activation cascade(GO:2000258) |
0.4 | 1.3 | GO:0022009 | central nervous system vasculogenesis(GO:0022009) |
0.4 | 1.3 | GO:0042908 | xenobiotic transport(GO:0042908) |
0.4 | 1.7 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
0.4 | 3.0 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
0.4 | 1.7 | GO:1903847 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
0.4 | 2.1 | GO:1903300 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
0.4 | 1.2 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.4 | 1.2 | GO:0060510 | Type II pneumocyte differentiation(GO:0060510) |
0.4 | 0.8 | GO:0010796 | regulation of multivesicular body size(GO:0010796) |
0.4 | 2.9 | GO:0006977 | DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) |
0.4 | 1.2 | GO:0060319 | primitive erythrocyte differentiation(GO:0060319) |
0.4 | 0.8 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
0.4 | 0.8 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
0.4 | 2.0 | GO:0021636 | trigeminal nerve morphogenesis(GO:0021636) trigeminal nerve structural organization(GO:0021637) |
0.4 | 0.8 | GO:1902566 | regulation of eosinophil degranulation(GO:0043309) regulation of eosinophil activation(GO:1902566) |
0.4 | 1.2 | GO:1901873 | regulation of post-translational protein modification(GO:1901873) negative regulation of post-translational protein modification(GO:1901874) |
0.4 | 1.6 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
0.4 | 2.0 | GO:0072675 | osteoclast fusion(GO:0072675) |
0.4 | 4.0 | GO:0007097 | nuclear migration(GO:0007097) |
0.4 | 0.8 | GO:2000667 | positive regulation of interleukin-5 secretion(GO:2000664) positive regulation of interleukin-13 secretion(GO:2000667) |
0.4 | 3.2 | GO:0043619 | regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0043619) |
0.4 | 0.8 | GO:1904431 | positive regulation of t-circle formation(GO:1904431) |
0.4 | 3.2 | GO:0002035 | brain renin-angiotensin system(GO:0002035) |
0.4 | 2.4 | GO:0051013 | microtubule severing(GO:0051013) |
0.4 | 1.2 | GO:0000710 | meiotic mismatch repair(GO:0000710) |
0.4 | 1.2 | GO:0019086 | late viral transcription(GO:0019086) |
0.4 | 3.5 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
0.4 | 1.2 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
0.4 | 1.6 | GO:0018916 | nitrobenzene metabolic process(GO:0018916) |
0.4 | 3.1 | GO:0030917 | midbrain-hindbrain boundary development(GO:0030917) |
0.4 | 3.1 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
0.4 | 0.4 | GO:0018377 | protein myristoylation(GO:0018377) |
0.4 | 0.4 | GO:0097484 | dendrite extension(GO:0097484) |
0.4 | 0.4 | GO:0006046 | N-acetylglucosamine catabolic process(GO:0006046) |
0.4 | 4.2 | GO:0032495 | response to muramyl dipeptide(GO:0032495) |
0.4 | 0.8 | GO:0009436 | glyoxylate catabolic process(GO:0009436) |
0.4 | 0.4 | GO:0071332 | cellular response to fructose stimulus(GO:0071332) |
0.4 | 2.3 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
0.4 | 0.8 | GO:0007525 | somatic muscle development(GO:0007525) |
0.4 | 0.7 | GO:0045472 | response to ether(GO:0045472) |
0.4 | 1.5 | GO:0035630 | bone mineralization involved in bone maturation(GO:0035630) |
0.4 | 1.5 | GO:0014854 | response to inactivity(GO:0014854) response to muscle inactivity(GO:0014870) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
0.4 | 3.0 | GO:0072201 | negative regulation of mesenchymal cell proliferation(GO:0072201) |
0.4 | 1.1 | GO:0009092 | homoserine metabolic process(GO:0009092) transsulfuration(GO:0019346) |
0.4 | 3.3 | GO:0043518 | negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
0.4 | 1.5 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
0.4 | 2.6 | GO:1902033 | regulation of hematopoietic stem cell proliferation(GO:1902033) |
0.4 | 1.1 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.4 | 1.1 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
0.4 | 1.1 | GO:0042536 | negative regulation of tumor necrosis factor biosynthetic process(GO:0042536) |
0.4 | 1.5 | GO:0009180 | purine nucleoside diphosphate biosynthetic process(GO:0009136) purine ribonucleoside diphosphate biosynthetic process(GO:0009180) |
0.4 | 4.0 | GO:0031571 | mitotic G1 DNA damage checkpoint(GO:0031571) |
0.4 | 0.4 | GO:0033088 | negative regulation of immature T cell proliferation in thymus(GO:0033088) |
0.4 | 0.4 | GO:0060426 | lung vasculature development(GO:0060426) |
0.4 | 3.6 | GO:2000251 | positive regulation of actin cytoskeleton reorganization(GO:2000251) |
0.4 | 1.1 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
0.4 | 0.7 | GO:1905154 | negative regulation of membrane invagination(GO:1905154) |
0.4 | 1.8 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
0.4 | 3.3 | GO:0035745 | T-helper 2 cell cytokine production(GO:0035745) |
0.4 | 1.1 | GO:0060051 | negative regulation of protein glycosylation(GO:0060051) |
0.4 | 0.7 | GO:0090244 | Wnt signaling pathway involved in somitogenesis(GO:0090244) |
0.4 | 2.5 | GO:0045634 | regulation of melanocyte differentiation(GO:0045634) |
0.4 | 1.8 | GO:0048199 | vesicle targeting, to, from or within Golgi(GO:0048199) |
0.4 | 1.1 | GO:1901475 | pyruvate transmembrane transport(GO:1901475) |
0.4 | 2.1 | GO:0060710 | chorio-allantoic fusion(GO:0060710) |
0.4 | 1.8 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
0.4 | 0.7 | GO:0007386 | compartment pattern specification(GO:0007386) |
0.4 | 0.7 | GO:1990441 | negative regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990441) |
0.4 | 3.5 | GO:0050872 | white fat cell differentiation(GO:0050872) |
0.4 | 1.1 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
0.4 | 0.7 | GO:0072718 | response to cisplatin(GO:0072718) |
0.4 | 1.4 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
0.4 | 2.8 | GO:0033136 | serine phosphorylation of STAT3 protein(GO:0033136) |
0.3 | 6.6 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
0.3 | 1.0 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
0.3 | 1.7 | GO:0072711 | response to hydroxyurea(GO:0072710) cellular response to hydroxyurea(GO:0072711) |
0.3 | 1.4 | GO:0035872 | nucleotide-binding domain, leucine rich repeat containing receptor signaling pathway(GO:0035872) |
0.3 | 1.0 | GO:0021776 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
0.3 | 3.8 | GO:0045063 | T-helper 1 cell differentiation(GO:0045063) |
0.3 | 0.7 | GO:0045794 | negative regulation of cell volume(GO:0045794) |
0.3 | 0.7 | GO:0007354 | zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
0.3 | 0.3 | GO:0061052 | negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
0.3 | 2.4 | GO:0006851 | mitochondrial calcium ion transport(GO:0006851) |
0.3 | 1.7 | GO:0010917 | negative regulation of mitochondrial membrane potential(GO:0010917) |
0.3 | 0.7 | GO:2000060 | positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
0.3 | 1.7 | GO:1904587 | glycoprotein ERAD pathway(GO:0097466) response to glycoprotein(GO:1904587) |
0.3 | 1.0 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
0.3 | 3.7 | GO:0032926 | negative regulation of activin receptor signaling pathway(GO:0032926) |
0.3 | 1.7 | GO:0060480 | lung goblet cell differentiation(GO:0060480) |
0.3 | 1.3 | GO:2000969 | positive regulation of glutamate receptor signaling pathway(GO:1900451) positive regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000969) |
0.3 | 1.3 | GO:1903278 | positive regulation of sodium ion export(GO:1903275) positive regulation of sodium ion export from cell(GO:1903278) |
0.3 | 0.7 | GO:0070574 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
0.3 | 1.7 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.3 | 2.3 | GO:0060263 | regulation of respiratory burst(GO:0060263) |
0.3 | 0.7 | GO:0032763 | regulation of mast cell cytokine production(GO:0032763) |
0.3 | 1.0 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
0.3 | 2.7 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
0.3 | 4.7 | GO:0051895 | negative regulation of focal adhesion assembly(GO:0051895) |
0.3 | 0.3 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
0.3 | 1.7 | GO:0046070 | dGTP metabolic process(GO:0046070) |
0.3 | 1.3 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
0.3 | 2.3 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
0.3 | 2.0 | GO:0010985 | negative regulation of lipoprotein particle clearance(GO:0010985) |
0.3 | 1.0 | GO:0035425 | autocrine signaling(GO:0035425) |
0.3 | 1.3 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
0.3 | 0.7 | GO:0051106 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
0.3 | 1.0 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
0.3 | 0.3 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
0.3 | 1.6 | GO:0072673 | lamellipodium morphogenesis(GO:0072673) |
0.3 | 1.0 | GO:0035962 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
0.3 | 1.3 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
0.3 | 1.0 | GO:0006553 | lysine metabolic process(GO:0006553) |
0.3 | 1.0 | GO:0046104 | thymidine metabolic process(GO:0046104) |
0.3 | 1.3 | GO:0006116 | NADH oxidation(GO:0006116) |
0.3 | 1.0 | GO:0052490 | negative regulation by symbiont of host apoptotic process(GO:0033668) negative regulation by symbiont of host programmed cell death(GO:0052041) negative regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052490) |
0.3 | 0.6 | GO:0030035 | microspike assembly(GO:0030035) |
0.3 | 0.3 | GO:0014873 | response to muscle activity involved in regulation of muscle adaptation(GO:0014873) |
0.3 | 1.0 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
0.3 | 0.3 | GO:0061218 | negative regulation of mesonephros development(GO:0061218) regulation of branch elongation involved in ureteric bud branching(GO:0072095) |
0.3 | 1.3 | GO:1900151 | regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
0.3 | 1.3 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
0.3 | 1.6 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
0.3 | 1.6 | GO:0010886 | positive regulation of cholesterol storage(GO:0010886) |
0.3 | 2.6 | GO:0015858 | nucleoside transport(GO:0015858) |
0.3 | 1.6 | GO:0045792 | negative regulation of cell size(GO:0045792) |
0.3 | 1.0 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
0.3 | 0.9 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
0.3 | 0.6 | GO:0090210 | regulation of establishment of blood-brain barrier(GO:0090210) |
0.3 | 1.5 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
0.3 | 2.2 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
0.3 | 0.6 | GO:0035672 | oligopeptide transmembrane transport(GO:0035672) |
0.3 | 0.9 | GO:0010901 | regulation of very-low-density lipoprotein particle remodeling(GO:0010901) |
0.3 | 0.9 | GO:1990928 | response to amino acid starvation(GO:1990928) |
0.3 | 0.3 | GO:1902988 | neurofibrillary tangle assembly(GO:1902988) regulation of neurofibrillary tangle assembly(GO:1902996) |
0.3 | 0.3 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
0.3 | 0.9 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
0.3 | 0.6 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
0.3 | 1.2 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.3 | 1.5 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
0.3 | 0.9 | GO:0006534 | cysteine metabolic process(GO:0006534) |
0.3 | 1.8 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
0.3 | 0.3 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
0.3 | 0.9 | GO:2000474 | regulation of opioid receptor signaling pathway(GO:2000474) |
0.3 | 0.9 | GO:0009223 | pyrimidine deoxyribonucleotide catabolic process(GO:0009223) |
0.3 | 1.2 | GO:0032353 | negative regulation of hormone biosynthetic process(GO:0032353) |
0.3 | 1.8 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
0.3 | 0.9 | GO:0019659 | fermentation(GO:0006113) glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
0.3 | 0.6 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
0.3 | 0.9 | GO:0015888 | thiamine transport(GO:0015888) |
0.3 | 1.2 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
0.3 | 0.6 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
0.3 | 3.3 | GO:0045603 | positive regulation of endothelial cell differentiation(GO:0045603) |
0.3 | 1.5 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
0.3 | 0.9 | GO:2000507 | positive regulation of energy homeostasis(GO:2000507) |
0.3 | 0.6 | GO:0046985 | positive regulation of hemoglobin biosynthetic process(GO:0046985) |
0.3 | 2.0 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
0.3 | 0.6 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.3 | 0.3 | GO:1901668 | regulation of superoxide dismutase activity(GO:1901668) |
0.3 | 1.7 | GO:0055098 | response to low-density lipoprotein particle(GO:0055098) |
0.3 | 0.9 | GO:0042891 | antibiotic transport(GO:0042891) |
0.3 | 0.6 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
0.3 | 0.9 | GO:0030070 | insulin processing(GO:0030070) |
0.3 | 1.7 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
0.3 | 0.3 | GO:0006296 | nucleotide-excision repair, DNA incision, 5'-to lesion(GO:0006296) |
0.3 | 0.3 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
0.3 | 1.4 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
0.3 | 1.1 | GO:0060449 | bud elongation involved in lung branching(GO:0060449) |
0.3 | 0.6 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
0.3 | 0.3 | GO:2001046 | positive regulation of integrin-mediated signaling pathway(GO:2001046) |
0.3 | 1.1 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
0.3 | 4.0 | GO:0000301 | retrograde transport, vesicle recycling within Golgi(GO:0000301) |
0.3 | 1.4 | GO:0021910 | smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021910) |
0.3 | 2.0 | GO:0042090 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
0.3 | 2.0 | GO:0019368 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
0.3 | 0.3 | GO:0072674 | multinuclear osteoclast differentiation(GO:0072674) |
0.3 | 0.8 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.3 | 1.1 | GO:2000002 | negative regulation of DNA damage checkpoint(GO:2000002) |
0.3 | 1.1 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
0.3 | 1.1 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
0.3 | 0.8 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
0.3 | 0.3 | GO:0060435 | bronchiole development(GO:0060435) |
0.3 | 2.7 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
0.3 | 1.4 | GO:0010898 | positive regulation of triglyceride catabolic process(GO:0010898) |
0.3 | 1.4 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
0.3 | 1.1 | GO:0071236 | cellular response to antibiotic(GO:0071236) |
0.3 | 1.6 | GO:0046218 | tryptophan catabolic process(GO:0006569) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) |
0.3 | 1.4 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
0.3 | 0.8 | GO:0048254 | snoRNA localization(GO:0048254) |
0.3 | 0.5 | GO:0046487 | glyoxylate metabolic process(GO:0046487) |
0.3 | 1.9 | GO:0044827 | modulation by host of viral genome replication(GO:0044827) |
0.3 | 0.5 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
0.3 | 2.4 | GO:0090129 | positive regulation of synapse maturation(GO:0090129) |
0.3 | 0.8 | GO:0006501 | C-terminal protein lipidation(GO:0006501) |
0.3 | 0.8 | GO:0019287 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
0.3 | 1.3 | GO:0080009 | mRNA methylation(GO:0080009) |
0.3 | 0.5 | GO:0030397 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
0.3 | 0.3 | GO:0039534 | negative regulation of MDA-5 signaling pathway(GO:0039534) |
0.3 | 0.3 | GO:0019747 | regulation of isoprenoid metabolic process(GO:0019747) |
0.3 | 1.1 | GO:0048069 | eye pigmentation(GO:0048069) |
0.3 | 0.8 | GO:1904017 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
0.3 | 1.1 | GO:0051136 | regulation of NK T cell differentiation(GO:0051136) positive regulation of NK T cell differentiation(GO:0051138) |
0.3 | 0.3 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
0.3 | 1.0 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
0.3 | 0.5 | GO:0035441 | cell migration involved in vasculogenesis(GO:0035441) |
0.3 | 0.5 | GO:0032075 | positive regulation of nuclease activity(GO:0032075) positive regulation of deoxyribonuclease activity(GO:0032077) positive regulation of endodeoxyribonuclease activity(GO:0032079) |
0.3 | 0.5 | GO:0032430 | positive regulation of phospholipase A2 activity(GO:0032430) |
0.3 | 0.8 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
0.3 | 1.3 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
0.3 | 4.4 | GO:0051497 | negative regulation of stress fiber assembly(GO:0051497) |
0.3 | 1.5 | GO:0031507 | heterochromatin assembly(GO:0031507) |
0.3 | 4.9 | GO:0002089 | lens morphogenesis in camera-type eye(GO:0002089) |
0.3 | 0.3 | GO:0043570 | maintenance of DNA repeat elements(GO:0043570) |
0.3 | 1.5 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
0.3 | 0.8 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.3 | 0.3 | GO:0006524 | alanine catabolic process(GO:0006524) pyruvate family amino acid catabolic process(GO:0009080) |
0.3 | 0.5 | GO:1900112 | regulation of histone H3-K9 trimethylation(GO:1900112) negative regulation of histone H3-K9 trimethylation(GO:1900113) |
0.3 | 0.8 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.3 | 0.5 | GO:0016095 | polyprenol catabolic process(GO:0016095) |
0.3 | 1.8 | GO:0000103 | sulfate assimilation(GO:0000103) |
0.3 | 0.5 | GO:1904707 | positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
0.3 | 1.8 | GO:0035999 | tetrahydrofolate interconversion(GO:0035999) |
0.3 | 2.0 | GO:0030007 | cellular potassium ion homeostasis(GO:0030007) |
0.3 | 0.5 | GO:2000059 | negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
0.2 | 0.2 | GO:0006563 | L-serine metabolic process(GO:0006563) |
0.2 | 0.7 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
0.2 | 0.7 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
0.2 | 1.0 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
0.2 | 0.5 | GO:2000847 | negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
0.2 | 1.2 | GO:1902895 | positive regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902895) |
0.2 | 0.5 | GO:0046984 | regulation of hemoglobin biosynthetic process(GO:0046984) |
0.2 | 1.7 | GO:1902287 | semaphorin-plexin signaling pathway involved in axon guidance(GO:1902287) |
0.2 | 1.5 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
0.2 | 0.5 | GO:1902109 | negative regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902109) |
0.2 | 1.0 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
0.2 | 1.0 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
0.2 | 0.2 | GO:0046102 | inosine metabolic process(GO:0046102) inosine biosynthetic process(GO:0046103) |
0.2 | 1.0 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
0.2 | 2.6 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
0.2 | 1.4 | GO:0014841 | skeletal muscle satellite cell proliferation(GO:0014841) regulation of skeletal muscle satellite cell proliferation(GO:0014842) |
0.2 | 0.7 | GO:0060318 | definitive erythrocyte differentiation(GO:0060318) |
0.2 | 0.2 | GO:0033058 | directional locomotion(GO:0033058) |
0.2 | 1.2 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
0.2 | 0.5 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
0.2 | 1.9 | GO:0015865 | purine nucleotide transport(GO:0015865) |
0.2 | 0.2 | GO:0046618 | drug export(GO:0046618) |
0.2 | 0.2 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
0.2 | 0.2 | GO:0032469 | endoplasmic reticulum calcium ion homeostasis(GO:0032469) |
0.2 | 1.2 | GO:0006983 | ER overload response(GO:0006983) |
0.2 | 1.4 | GO:0044351 | macropinocytosis(GO:0044351) |
0.2 | 1.2 | GO:0009249 | protein lipoylation(GO:0009249) |
0.2 | 1.4 | GO:0071636 | positive regulation of transforming growth factor beta production(GO:0071636) |
0.2 | 0.7 | GO:0035928 | rRNA import into mitochondrion(GO:0035928) |
0.2 | 0.2 | GO:0097066 | response to thyroid hormone(GO:0097066) |
0.2 | 0.5 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
0.2 | 3.0 | GO:0009225 | nucleotide-sugar metabolic process(GO:0009225) |
0.2 | 0.5 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
0.2 | 0.5 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
0.2 | 3.0 | GO:0060337 | type I interferon signaling pathway(GO:0060337) |
0.2 | 0.9 | GO:0072553 | terminal button organization(GO:0072553) |
0.2 | 2.3 | GO:2000353 | positive regulation of endothelial cell apoptotic process(GO:2000353) |
0.2 | 1.6 | GO:0046543 | development of secondary female sexual characteristics(GO:0046543) |
0.2 | 1.1 | GO:0034382 | chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
0.2 | 0.5 | GO:0072422 | signal transduction involved in cell cycle checkpoint(GO:0072395) signal transduction involved in DNA integrity checkpoint(GO:0072401) signal transduction involved in DNA damage checkpoint(GO:0072422) |
0.2 | 0.9 | GO:0051305 | chromosome movement towards spindle pole(GO:0051305) |
0.2 | 0.7 | GO:1903587 | regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903587) |
0.2 | 0.9 | GO:0097527 | necroptotic signaling pathway(GO:0097527) |
0.2 | 0.5 | GO:0045837 | negative regulation of membrane potential(GO:0045837) |
0.2 | 0.7 | GO:1900102 | negative regulation of endoplasmic reticulum unfolded protein response(GO:1900102) |
0.2 | 0.9 | GO:0030091 | protein repair(GO:0030091) |
0.2 | 1.1 | GO:0044539 | long-chain fatty acid import(GO:0044539) |
0.2 | 0.2 | GO:0060681 | branch elongation involved in ureteric bud branching(GO:0060681) |
0.2 | 0.5 | GO:0018992 | germ-line sex determination(GO:0018992) |
0.2 | 0.7 | GO:0016264 | gap junction assembly(GO:0016264) |
0.2 | 0.4 | GO:0043970 | histone H3-K9 acetylation(GO:0043970) |
0.2 | 0.2 | GO:0002536 | respiratory burst involved in inflammatory response(GO:0002536) |
0.2 | 0.2 | GO:0051612 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
0.2 | 0.9 | GO:0006930 | substrate-dependent cell migration, cell extension(GO:0006930) |
0.2 | 1.3 | GO:2000249 | regulation of actin cytoskeleton reorganization(GO:2000249) |
0.2 | 0.7 | GO:0002726 | positive regulation of T cell cytokine production(GO:0002726) |
0.2 | 0.7 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
0.2 | 0.7 | GO:0033278 | cell proliferation in midbrain(GO:0033278) |
0.2 | 0.2 | GO:0045080 | positive regulation of chemokine biosynthetic process(GO:0045080) |
0.2 | 2.2 | GO:2000272 | negative regulation of receptor activity(GO:2000272) |
0.2 | 0.9 | GO:0035878 | nail development(GO:0035878) |
0.2 | 0.4 | GO:0000965 | mitochondrial RNA 3'-end processing(GO:0000965) |
0.2 | 0.4 | GO:1903998 | regulation of eating behavior(GO:1903998) |
0.2 | 1.3 | GO:0006044 | N-acetylglucosamine metabolic process(GO:0006044) |
0.2 | 0.9 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
0.2 | 1.7 | GO:0006349 | regulation of gene expression by genetic imprinting(GO:0006349) |
0.2 | 0.2 | GO:0034239 | macrophage fusion(GO:0034238) regulation of macrophage fusion(GO:0034239) positive regulation of macrophage fusion(GO:0034241) |
0.2 | 4.1 | GO:2000171 | negative regulation of dendrite development(GO:2000171) |
0.2 | 0.2 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
0.2 | 1.1 | GO:0070314 | G1 to G0 transition(GO:0070314) |
0.2 | 0.4 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
0.2 | 0.4 | GO:0030422 | production of siRNA involved in RNA interference(GO:0030422) |
0.2 | 0.4 | GO:0035090 | maintenance of apical/basal cell polarity(GO:0035090) |
0.2 | 2.1 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
0.2 | 1.0 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
0.2 | 0.8 | GO:0060379 | cardiac muscle cell myoblast differentiation(GO:0060379) |
0.2 | 1.9 | GO:0006677 | glycosylceramide metabolic process(GO:0006677) |
0.2 | 2.7 | GO:0043552 | positive regulation of phosphatidylinositol 3-kinase activity(GO:0043552) |
0.2 | 0.6 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
0.2 | 0.4 | GO:0097460 | ferrous iron import into cell(GO:0097460) |
0.2 | 0.4 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
0.2 | 3.7 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
0.2 | 1.2 | GO:0070327 | thyroid hormone transport(GO:0070327) |
0.2 | 1.0 | GO:0042074 | cell migration involved in gastrulation(GO:0042074) |
0.2 | 1.4 | GO:0046415 | urate metabolic process(GO:0046415) |
0.2 | 0.6 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) |
0.2 | 2.4 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) |
0.2 | 0.8 | GO:0051031 | tRNA transport(GO:0051031) |
0.2 | 0.2 | GO:0090135 | actin filament branching(GO:0090135) |
0.2 | 0.2 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
0.2 | 1.4 | GO:0009143 | nucleoside triphosphate catabolic process(GO:0009143) |
0.2 | 1.2 | GO:0006020 | inositol metabolic process(GO:0006020) |
0.2 | 1.0 | GO:0018230 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
0.2 | 0.4 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
0.2 | 0.8 | GO:0021681 | cerebellar granular layer development(GO:0021681) |
0.2 | 1.0 | GO:0006451 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
0.2 | 1.2 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
0.2 | 0.8 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.2 | 1.8 | GO:0097034 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
0.2 | 1.0 | GO:0060179 | male mating behavior(GO:0060179) |
0.2 | 0.2 | GO:1902805 | positive regulation of synaptic vesicle transport(GO:1902805) positive regulation of synaptic vesicle recycling(GO:1903423) |
0.2 | 0.6 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
0.2 | 0.2 | GO:0003241 | growth involved in heart morphogenesis(GO:0003241) |
0.2 | 0.2 | GO:0070813 | hydrogen sulfide metabolic process(GO:0070813) |
0.2 | 0.2 | GO:0060825 | fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
0.2 | 0.4 | GO:0042994 | cytoplasmic sequestering of transcription factor(GO:0042994) |
0.2 | 1.2 | GO:0048935 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
0.2 | 0.6 | GO:1904478 | regulation of intestinal absorption(GO:1904478) |
0.2 | 0.2 | GO:2000015 | regulation of determination of dorsal identity(GO:2000015) |
0.2 | 0.4 | GO:0006290 | pyrimidine dimer repair(GO:0006290) |
0.2 | 0.6 | GO:0034698 | response to gonadotropin(GO:0034698) cellular response to gonadotropin stimulus(GO:0071371) |
0.2 | 1.0 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
0.2 | 2.3 | GO:0051601 | exocyst localization(GO:0051601) |
0.2 | 1.0 | GO:0050651 | dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
0.2 | 0.8 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
0.2 | 0.6 | GO:1903960 | negative regulation of anion transmembrane transport(GO:1903960) |
0.2 | 0.8 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
0.2 | 1.0 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.2 | 0.4 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
0.2 | 0.2 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
0.2 | 0.8 | GO:0072378 | blood coagulation, fibrin clot formation(GO:0072378) |
0.2 | 0.6 | GO:0045402 | interleukin-4 biosynthetic process(GO:0042097) regulation of interleukin-4 biosynthetic process(GO:0045402) positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
0.2 | 0.8 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
0.2 | 0.8 | GO:0034434 | steroid esterification(GO:0034433) sterol esterification(GO:0034434) cholesterol esterification(GO:0034435) |
0.2 | 0.2 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
0.2 | 2.1 | GO:0035873 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
0.2 | 0.6 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
0.2 | 0.8 | GO:0045974 | negative regulation of translation, ncRNA-mediated(GO:0040033) regulation of translation, ncRNA-mediated(GO:0045974) |
0.2 | 0.8 | GO:0036120 | cellular response to platelet-derived growth factor stimulus(GO:0036120) |
0.2 | 0.4 | GO:0090128 | regulation of synapse maturation(GO:0090128) |
0.2 | 0.4 | GO:0036123 | histone H3-K9 dimethylation(GO:0036123) |
0.2 | 0.7 | GO:0045898 | regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045898) |
0.2 | 0.7 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.2 | 1.3 | GO:0006684 | sphingomyelin metabolic process(GO:0006684) |
0.2 | 1.5 | GO:0017014 | protein nitrosylation(GO:0017014) |
0.2 | 0.7 | GO:0052428 | negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
0.2 | 0.4 | GO:0017085 | response to insecticide(GO:0017085) |
0.2 | 0.6 | GO:0001907 | killing by symbiont of host cells(GO:0001907) disruption by symbiont of host cell(GO:0044004) |
0.2 | 0.6 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
0.2 | 0.2 | GO:0035990 | tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
0.2 | 0.5 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.2 | 0.5 | GO:0042511 | positive regulation of tyrosine phosphorylation of Stat1 protein(GO:0042511) |
0.2 | 0.5 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
0.2 | 0.9 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.2 | 2.4 | GO:0034219 | carbohydrate transmembrane transport(GO:0034219) |
0.2 | 0.5 | GO:0000012 | single strand break repair(GO:0000012) |
0.2 | 2.2 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
0.2 | 3.8 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
0.2 | 0.2 | GO:1900242 | regulation of synaptic vesicle endocytosis(GO:1900242) |
0.2 | 0.9 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
0.2 | 1.5 | GO:0016926 | protein desumoylation(GO:0016926) |
0.2 | 0.5 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
0.2 | 0.7 | GO:0038033 | positive regulation of endothelial cell chemotaxis by VEGF-activated vascular endothelial growth factor receptor signaling pathway(GO:0038033) |
0.2 | 0.5 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
0.2 | 0.4 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
0.2 | 0.5 | GO:2000359 | regulation of binding of sperm to zona pellucida(GO:2000359) |
0.2 | 0.4 | GO:0070368 | positive regulation of hepatocyte differentiation(GO:0070368) |
0.2 | 1.1 | GO:0070995 | NADPH oxidation(GO:0070995) |
0.2 | 0.7 | GO:1901026 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
0.2 | 0.4 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
0.2 | 0.4 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
0.2 | 0.4 | GO:0035973 | aggrephagy(GO:0035973) |
0.2 | 0.5 | GO:0090086 | negative regulation of protein deubiquitination(GO:0090086) |
0.2 | 1.6 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
0.2 | 0.2 | GO:0045002 | double-strand break repair via single-strand annealing(GO:0045002) |
0.2 | 0.2 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
0.2 | 0.3 | GO:0002677 | negative regulation of chronic inflammatory response(GO:0002677) |
0.2 | 1.4 | GO:0035994 | response to muscle stretch(GO:0035994) |
0.2 | 0.3 | GO:0001302 | replicative cell aging(GO:0001302) |
0.2 | 3.3 | GO:0000731 | DNA synthesis involved in DNA repair(GO:0000731) |
0.2 | 1.6 | GO:1990118 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
0.2 | 1.0 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
0.2 | 0.5 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
0.2 | 0.2 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.2 | 1.7 | GO:0042036 | negative regulation of cytokine biosynthetic process(GO:0042036) |
0.2 | 0.3 | GO:2000047 | regulation of cell-cell adhesion mediated by cadherin(GO:2000047) |
0.2 | 8.1 | GO:0031338 | regulation of vesicle fusion(GO:0031338) |
0.2 | 0.5 | GO:0032511 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
0.2 | 0.3 | GO:0000737 | DNA catabolic process, endonucleolytic(GO:0000737) |
0.2 | 0.3 | GO:0051299 | centrosome separation(GO:0051299) |
0.2 | 0.3 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
0.2 | 0.7 | GO:0043504 | mitochondrial DNA repair(GO:0043504) |
0.2 | 0.2 | GO:0002339 | B cell selection(GO:0002339) |
0.2 | 0.9 | GO:0090383 | phagosome acidification(GO:0090383) |
0.2 | 0.5 | GO:0032769 | negative regulation of monooxygenase activity(GO:0032769) negative regulation of nitric-oxide synthase activity(GO:0051001) |
0.2 | 0.2 | GO:0097252 | interleukin-5 secretion(GO:0072603) interleukin-13 secretion(GO:0072611) oligodendrocyte apoptotic process(GO:0097252) regulation of interleukin-5 secretion(GO:2000662) regulation of interleukin-13 secretion(GO:2000665) |
0.2 | 0.2 | GO:0060221 | retinal rod cell differentiation(GO:0060221) |
0.2 | 0.7 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.2 | 1.7 | GO:0042407 | cristae formation(GO:0042407) |
0.2 | 1.0 | GO:0007144 | female meiosis I(GO:0007144) |
0.2 | 0.2 | GO:0019184 | nonribosomal peptide biosynthetic process(GO:0019184) |
0.2 | 0.3 | GO:0033025 | mast cell homeostasis(GO:0033023) mast cell apoptotic process(GO:0033024) regulation of mast cell apoptotic process(GO:0033025) |
0.2 | 0.7 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
0.2 | 0.2 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
0.2 | 0.7 | GO:0016056 | rhodopsin mediated signaling pathway(GO:0016056) |
0.2 | 0.3 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) |
0.2 | 0.5 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
0.2 | 0.5 | GO:1901620 | regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901620) |
0.2 | 2.3 | GO:0003351 | epithelial cilium movement(GO:0003351) |
0.2 | 0.7 | GO:0015670 | carbon dioxide transport(GO:0015670) |
0.2 | 0.2 | GO:0042420 | dopamine catabolic process(GO:0042420) |
0.2 | 0.7 | GO:0006004 | fucose metabolic process(GO:0006004) |
0.2 | 0.3 | GO:2001169 | regulation of ATP biosynthetic process(GO:2001169) |
0.2 | 0.2 | GO:0060155 | platelet dense granule organization(GO:0060155) |
0.2 | 0.7 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
0.2 | 0.3 | GO:0050904 | diapedesis(GO:0050904) |
0.2 | 0.2 | GO:0046719 | regulation by virus of viral protein levels in host cell(GO:0046719) positive regulation by virus of viral protein levels in host cell(GO:0046726) |
0.2 | 0.5 | GO:0046075 | dTTP biosynthetic process(GO:0006235) pyrimidine deoxyribonucleoside triphosphate metabolic process(GO:0009211) pyrimidine deoxyribonucleoside triphosphate biosynthetic process(GO:0009212) dTTP metabolic process(GO:0046075) |
0.2 | 0.8 | GO:0045943 | positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
0.2 | 0.7 | GO:0030311 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.2 | 1.0 | GO:0009070 | serine family amino acid biosynthetic process(GO:0009070) |
0.2 | 2.6 | GO:0006730 | one-carbon metabolic process(GO:0006730) |
0.2 | 0.3 | GO:0032025 | response to cobalt ion(GO:0032025) |
0.2 | 0.5 | GO:0060988 | lipid tube assembly(GO:0060988) |
0.2 | 1.8 | GO:0055070 | copper ion homeostasis(GO:0055070) |
0.2 | 1.6 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
0.2 | 1.0 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
0.2 | 0.5 | GO:0097119 | postsynaptic density protein 95 clustering(GO:0097119) |
0.2 | 1.6 | GO:0051569 | regulation of histone H3-K4 methylation(GO:0051569) |
0.2 | 0.6 | GO:0021860 | pyramidal neuron development(GO:0021860) |
0.2 | 0.6 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
0.2 | 2.6 | GO:0035987 | endodermal cell differentiation(GO:0035987) |
0.2 | 0.2 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
0.2 | 2.9 | GO:0042832 | defense response to protozoan(GO:0042832) |
0.2 | 0.2 | GO:0034197 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
0.2 | 2.2 | GO:0015693 | magnesium ion transport(GO:0015693) |
0.2 | 0.5 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.2 | 1.0 | GO:0051444 | negative regulation of ligase activity(GO:0051352) negative regulation of ubiquitin-protein transferase activity(GO:0051444) |
0.2 | 0.6 | GO:0050667 | homocysteine metabolic process(GO:0050667) |
0.2 | 0.2 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
0.2 | 0.5 | GO:0071374 | cellular response to parathyroid hormone stimulus(GO:0071374) |
0.2 | 0.8 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
0.2 | 0.8 | GO:0019720 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
0.2 | 0.5 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
0.2 | 1.7 | GO:0016558 | protein import into peroxisome matrix(GO:0016558) |
0.2 | 0.3 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
0.2 | 0.6 | GO:0006760 | folic acid-containing compound metabolic process(GO:0006760) |
0.2 | 3.5 | GO:0001913 | T cell mediated cytotoxicity(GO:0001913) |
0.2 | 0.6 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
0.2 | 0.3 | GO:0018198 | peptidyl-cysteine modification(GO:0018198) |
0.2 | 0.9 | GO:0006013 | mannose metabolic process(GO:0006013) |
0.2 | 1.3 | GO:0044090 | positive regulation of vacuole organization(GO:0044090) |
0.2 | 0.9 | GO:0043485 | endosome to melanosome transport(GO:0035646) cellular pigment accumulation(GO:0043482) endosome to pigment granule transport(GO:0043485) pigment granule maturation(GO:0048757) |
0.2 | 0.2 | GO:0002086 | diaphragm contraction(GO:0002086) involuntary skeletal muscle contraction(GO:0003011) |
0.2 | 0.5 | GO:0032202 | telomere assembly(GO:0032202) |
0.2 | 1.2 | GO:0060576 | intestinal epithelial cell development(GO:0060576) |
0.2 | 0.6 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.2 | 0.3 | GO:0060648 | mammary gland bud morphogenesis(GO:0060648) |
0.2 | 0.5 | GO:0050855 | regulation of B cell receptor signaling pathway(GO:0050855) |
0.2 | 1.2 | GO:0030502 | negative regulation of bone mineralization(GO:0030502) |
0.2 | 5.0 | GO:0006749 | glutathione metabolic process(GO:0006749) |
0.2 | 1.5 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
0.2 | 0.5 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
0.2 | 1.2 | GO:0002418 | immune response to tumor cell(GO:0002418) |
0.2 | 1.7 | GO:0001946 | lymphangiogenesis(GO:0001946) lymph vessel morphogenesis(GO:0036303) |
0.2 | 0.5 | GO:0006083 | acetate metabolic process(GO:0006083) |
0.2 | 1.4 | GO:0019370 | leukotriene biosynthetic process(GO:0019370) |
0.2 | 0.3 | GO:0033686 | positive regulation of luteinizing hormone secretion(GO:0033686) |
0.2 | 0.5 | GO:0002317 | plasma cell differentiation(GO:0002317) |
0.2 | 2.3 | GO:0008210 | estrogen metabolic process(GO:0008210) |
0.2 | 1.1 | GO:2000463 | positive regulation of excitatory postsynaptic potential(GO:2000463) |
0.2 | 0.8 | GO:0010807 | regulation of synaptic vesicle priming(GO:0010807) |
0.2 | 0.5 | GO:0035855 | megakaryocyte development(GO:0035855) |
0.2 | 0.2 | GO:0061642 | chemoattraction of axon(GO:0061642) |
0.2 | 0.2 | GO:2000623 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
0.2 | 2.7 | GO:0031365 | N-terminal protein amino acid modification(GO:0031365) |
0.2 | 0.5 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
0.2 | 0.3 | GO:0060312 | regulation of blood vessel remodeling(GO:0060312) |
0.2 | 0.3 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
0.2 | 0.3 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
0.2 | 1.4 | GO:0032967 | positive regulation of collagen biosynthetic process(GO:0032967) |
0.1 | 0.3 | GO:0010835 | regulation of protein ADP-ribosylation(GO:0010835) |
0.1 | 0.3 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
0.1 | 3.6 | GO:0048013 | ephrin receptor signaling pathway(GO:0048013) |
0.1 | 1.0 | GO:0060307 | regulation of ventricular cardiac muscle cell membrane repolarization(GO:0060307) ventricular cardiac muscle cell membrane repolarization(GO:0099625) |
0.1 | 0.4 | GO:0006842 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.1 | 0.7 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
0.1 | 0.1 | GO:0060018 | astrocyte fate commitment(GO:0060018) |
0.1 | 0.6 | GO:0060896 | neural plate pattern specification(GO:0060896) |
0.1 | 0.4 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
0.1 | 1.6 | GO:0036075 | endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
0.1 | 0.4 | GO:0032204 | regulation of telomere maintenance(GO:0032204) |
0.1 | 0.6 | GO:0015884 | folic acid transport(GO:0015884) |
0.1 | 0.3 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
0.1 | 0.4 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
0.1 | 0.1 | GO:0048319 | axial mesoderm morphogenesis(GO:0048319) |
0.1 | 0.3 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
0.1 | 0.3 | GO:0048818 | positive regulation of hair follicle maturation(GO:0048818) regulation of catagen(GO:0051794) positive regulation of catagen(GO:0051795) |
0.1 | 0.7 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
0.1 | 0.9 | GO:0046475 | glycerophospholipid catabolic process(GO:0046475) |
0.1 | 0.1 | GO:0072223 | metanephric glomerular mesangium development(GO:0072223) metanephric glomerular mesangial cell proliferation involved in metanephros development(GO:0072262) |
0.1 | 0.1 | GO:0016559 | peroxisome fission(GO:0016559) |
0.1 | 0.3 | GO:1902774 | late endosome to lysosome transport(GO:1902774) |
0.1 | 1.3 | GO:0001706 | endoderm formation(GO:0001706) |
0.1 | 1.0 | GO:0006098 | pentose-phosphate shunt(GO:0006098) |
0.1 | 0.9 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
0.1 | 1.3 | GO:0038092 | nodal signaling pathway(GO:0038092) |
0.1 | 0.9 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.1 | 0.1 | GO:1901896 | positive regulation of calcium-transporting ATPase activity(GO:1901896) |
0.1 | 2.9 | GO:0016578 | histone deubiquitination(GO:0016578) |
0.1 | 0.4 | GO:0031062 | positive regulation of histone methylation(GO:0031062) |
0.1 | 7.1 | GO:0032436 | positive regulation of proteasomal ubiquitin-dependent protein catabolic process(GO:0032436) |
0.1 | 0.1 | GO:0072053 | renal inner medulla development(GO:0072053) |
0.1 | 0.3 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
0.1 | 0.4 | GO:0010040 | response to iron(II) ion(GO:0010040) |
0.1 | 0.1 | GO:2000121 | regulation of removal of superoxide radicals(GO:2000121) |
0.1 | 1.0 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
0.1 | 0.7 | GO:0019430 | removal of superoxide radicals(GO:0019430) |
0.1 | 2.5 | GO:2000134 | negative regulation of G1/S transition of mitotic cell cycle(GO:2000134) |
0.1 | 0.8 | GO:0002082 | regulation of oxidative phosphorylation(GO:0002082) |
0.1 | 1.7 | GO:0030968 | endoplasmic reticulum unfolded protein response(GO:0030968) |
0.1 | 0.6 | GO:0043922 | negative regulation by host of viral transcription(GO:0043922) |
0.1 | 1.2 | GO:0010718 | positive regulation of epithelial to mesenchymal transition(GO:0010718) |
0.1 | 1.1 | GO:0014898 | muscle hypertrophy in response to stress(GO:0003299) cardiac muscle adaptation(GO:0014887) cardiac muscle hypertrophy in response to stress(GO:0014898) |
0.1 | 0.3 | GO:1904417 | regulation of xenophagy(GO:1904415) positive regulation of xenophagy(GO:1904417) |
0.1 | 0.5 | GO:2000310 | regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
0.1 | 0.4 | GO:0050765 | negative regulation of phagocytosis(GO:0050765) |
0.1 | 0.7 | GO:2000042 | negative regulation of double-strand break repair via homologous recombination(GO:2000042) |
0.1 | 0.9 | GO:0018023 | peptidyl-lysine trimethylation(GO:0018023) |
0.1 | 0.3 | GO:2000647 | negative regulation of stem cell proliferation(GO:2000647) |
0.1 | 0.3 | GO:1904528 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
0.1 | 0.5 | GO:0001542 | ovulation from ovarian follicle(GO:0001542) |
0.1 | 0.7 | GO:0046133 | pyrimidine ribonucleoside catabolic process(GO:0046133) |
0.1 | 0.1 | GO:0046084 | adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
0.1 | 0.3 | GO:0071440 | regulation of histone H3-K14 acetylation(GO:0071440) |
0.1 | 0.3 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
0.1 | 0.4 | GO:0019042 | viral latency(GO:0019042) |
0.1 | 0.5 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
0.1 | 0.3 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
0.1 | 5.6 | GO:0030433 | ER-associated ubiquitin-dependent protein catabolic process(GO:0030433) |
0.1 | 2.9 | GO:0034333 | adherens junction assembly(GO:0034333) |
0.1 | 0.4 | GO:0015820 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.1 | 0.4 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
0.1 | 0.4 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
0.1 | 0.5 | GO:0042149 | cellular response to glucose starvation(GO:0042149) |
0.1 | 0.4 | GO:0032494 | response to peptidoglycan(GO:0032494) |
0.1 | 0.4 | GO:0034508 | centromere complex assembly(GO:0034508) |
0.1 | 0.4 | GO:0019852 | L-ascorbic acid metabolic process(GO:0019852) |
0.1 | 0.4 | GO:0071501 | response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
0.1 | 1.2 | GO:0044804 | nucleophagy(GO:0044804) |
0.1 | 0.1 | GO:0060948 | cardiac vascular smooth muscle cell development(GO:0060948) |
0.1 | 0.1 | GO:0051791 | medium-chain fatty acid metabolic process(GO:0051791) |
0.1 | 1.3 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
0.1 | 0.4 | GO:0045915 | positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
0.1 | 0.6 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
0.1 | 0.3 | GO:0032849 | maternal aggressive behavior(GO:0002125) positive regulation of cellular pH reduction(GO:0032849) |
0.1 | 1.0 | GO:0071420 | cellular response to histamine(GO:0071420) |
0.1 | 0.9 | GO:0045332 | phospholipid translocation(GO:0045332) |
0.1 | 0.5 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
0.1 | 0.1 | GO:2000195 | negative regulation of female gonad development(GO:2000195) |
0.1 | 0.8 | GO:1901317 | regulation of sperm motility(GO:1901317) |
0.1 | 0.4 | GO:0048733 | sebaceous gland development(GO:0048733) |
0.1 | 8.8 | GO:0035023 | regulation of Rho protein signal transduction(GO:0035023) |
0.1 | 0.1 | GO:0052055 | modulation by symbiont of host molecular function(GO:0052055) |
0.1 | 0.8 | GO:0002589 | regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002589) |
0.1 | 0.5 | GO:0014883 | transition between fast and slow fiber(GO:0014883) |
0.1 | 0.3 | GO:0051799 | negative regulation of hair follicle development(GO:0051799) |
0.1 | 0.4 | GO:1904385 | angiotensin-activated signaling pathway(GO:0038166) cellular response to angiotensin(GO:1904385) response to angiotensin(GO:1990776) |
0.1 | 0.1 | GO:0051902 | negative regulation of mitochondrial depolarization(GO:0051902) |
0.1 | 1.0 | GO:0002076 | osteoblast development(GO:0002076) |
0.1 | 0.1 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
0.1 | 0.5 | GO:0006188 | IMP biosynthetic process(GO:0006188) |
0.1 | 0.8 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
0.1 | 0.4 | GO:0008535 | respiratory chain complex IV assembly(GO:0008535) |
0.1 | 0.5 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
0.1 | 1.4 | GO:0043248 | proteasome assembly(GO:0043248) |
0.1 | 0.6 | GO:0021819 | layer formation in cerebral cortex(GO:0021819) |
0.1 | 0.7 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
0.1 | 0.1 | GO:0034035 | purine ribonucleoside bisphosphate metabolic process(GO:0034035) |
0.1 | 0.1 | GO:2000852 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
0.1 | 0.1 | GO:1903679 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
0.1 | 0.6 | GO:0061014 | positive regulation of mRNA catabolic process(GO:0061014) |
0.1 | 1.1 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
0.1 | 0.4 | GO:0030578 | PML body organization(GO:0030578) |
0.1 | 0.2 | GO:0060023 | soft palate development(GO:0060023) |
0.1 | 0.4 | GO:0014733 | regulation of skeletal muscle adaptation(GO:0014733) |
0.1 | 0.2 | GO:0002155 | thyroid hormone mediated signaling pathway(GO:0002154) regulation of thyroid hormone mediated signaling pathway(GO:0002155) |
0.1 | 0.2 | GO:0021937 | cerebellar Purkinje cell-granule cell precursor cell signaling involved in regulation of granule cell precursor cell proliferation(GO:0021937) |
0.1 | 0.2 | GO:0014721 | voluntary skeletal muscle contraction(GO:0003010) twitch skeletal muscle contraction(GO:0014721) fast-twitch skeletal muscle fiber contraction(GO:0031443) |
0.1 | 0.5 | GO:0061684 | chaperone-mediated autophagy(GO:0061684) |
0.1 | 0.1 | GO:0060674 | placenta blood vessel development(GO:0060674) |
0.1 | 0.1 | GO:0035523 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
0.1 | 1.3 | GO:0014850 | response to muscle activity(GO:0014850) |
0.1 | 0.6 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.1 | 1.3 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
0.1 | 0.4 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
0.1 | 1.1 | GO:0046519 | sphingoid metabolic process(GO:0046519) |
0.1 | 0.6 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
0.1 | 0.4 | GO:0072282 | metanephric nephron tubule morphogenesis(GO:0072282) |
0.1 | 3.4 | GO:0030835 | negative regulation of actin filament depolymerization(GO:0030835) |
0.1 | 0.4 | GO:0045908 | negative regulation of vasodilation(GO:0045908) |
0.1 | 0.6 | GO:0032480 | negative regulation of type I interferon production(GO:0032480) |
0.1 | 0.2 | GO:0031033 | myosin filament organization(GO:0031033) |
0.1 | 1.5 | GO:0034198 | cellular response to amino acid starvation(GO:0034198) |
0.1 | 0.2 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
0.1 | 0.6 | GO:0009445 | putrescine metabolic process(GO:0009445) |
0.1 | 0.8 | GO:0030224 | monocyte differentiation(GO:0030224) |
0.1 | 0.1 | GO:0045324 | late endosome to vacuole transport(GO:0045324) |
0.1 | 0.2 | GO:0086001 | cardiac muscle cell action potential(GO:0086001) |
0.1 | 0.1 | GO:0070827 | chromatin maintenance(GO:0070827) |
0.1 | 0.1 | GO:0043045 | DNA methylation involved in embryo development(GO:0043045) changes to DNA methylation involved in embryo development(GO:1901538) |
0.1 | 1.2 | GO:1901798 | positive regulation of signal transduction by p53 class mediator(GO:1901798) |
0.1 | 1.2 | GO:0035904 | aorta development(GO:0035904) |
0.1 | 1.2 | GO:0032007 | negative regulation of TOR signaling(GO:0032007) |
0.1 | 0.2 | GO:0071847 | TNFSF11-mediated signaling pathway(GO:0071847) |
0.1 | 0.2 | GO:0042754 | negative regulation of circadian rhythm(GO:0042754) |
0.1 | 0.9 | GO:0043388 | positive regulation of DNA binding(GO:0043388) |
0.1 | 0.7 | GO:0051014 | actin filament severing(GO:0051014) |
0.1 | 0.3 | GO:2001184 | positive regulation of interleukin-12 secretion(GO:2001184) |
0.1 | 0.2 | GO:2000573 | positive regulation of DNA biosynthetic process(GO:2000573) |
0.1 | 0.5 | GO:0032211 | negative regulation of telomere maintenance via telomerase(GO:0032211) |
0.1 | 0.8 | GO:0099500 | synaptic vesicle fusion to presynaptic active zone membrane(GO:0031629) vesicle fusion to plasma membrane(GO:0099500) |
0.1 | 0.1 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
0.1 | 0.3 | GO:0045824 | negative regulation of innate immune response(GO:0045824) |
0.1 | 0.7 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
0.1 | 0.3 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
0.1 | 0.3 | GO:0071218 | cellular response to misfolded protein(GO:0071218) |
0.1 | 0.2 | GO:0019377 | glycolipid catabolic process(GO:0019377) |
0.1 | 0.2 | GO:0000101 | sulfur amino acid transport(GO:0000101) |
0.1 | 0.1 | GO:0034184 | positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
0.1 | 0.3 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
0.1 | 0.2 | GO:2000018 | regulation of male gonad development(GO:2000018) |
0.1 | 0.6 | GO:0043031 | negative regulation of macrophage activation(GO:0043031) |
0.1 | 0.4 | GO:0035902 | response to immobilization stress(GO:0035902) |
0.1 | 1.1 | GO:0050961 | detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
0.1 | 1.6 | GO:0030262 | cellular component disassembly involved in execution phase of apoptosis(GO:0006921) apoptotic nuclear changes(GO:0030262) |
0.1 | 0.1 | GO:0097084 | vascular smooth muscle cell development(GO:0097084) |
0.1 | 0.2 | GO:1900037 | regulation of cellular response to hypoxia(GO:1900037) |
0.1 | 0.7 | GO:0060134 | prepulse inhibition(GO:0060134) |
0.1 | 0.2 | GO:0006356 | regulation of transcription from RNA polymerase I promoter(GO:0006356) |
0.1 | 0.7 | GO:0030497 | fatty acid elongation(GO:0030497) |
0.1 | 0.1 | GO:0036159 | inner dynein arm assembly(GO:0036159) |
0.1 | 0.2 | GO:0030916 | otic vesicle formation(GO:0030916) |
0.1 | 0.1 | GO:0045091 | regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045091) |
0.1 | 0.1 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
0.1 | 2.5 | GO:0003333 | amino acid transmembrane transport(GO:0003333) |
0.1 | 0.3 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
0.1 | 1.5 | GO:0045197 | establishment or maintenance of epithelial cell apical/basal polarity(GO:0045197) |
0.1 | 0.3 | GO:0021891 | olfactory bulb interneuron development(GO:0021891) |
0.1 | 0.3 | GO:0071051 | polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
0.1 | 0.4 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
0.1 | 0.2 | GO:0048070 | regulation of developmental pigmentation(GO:0048070) |
0.1 | 0.2 | GO:0090051 | negative regulation of cell migration involved in sprouting angiogenesis(GO:0090051) negative regulation of sprouting angiogenesis(GO:1903671) |
0.1 | 0.2 | GO:2000599 | regulation of cyclin catabolic process(GO:2000598) negative regulation of cyclin catabolic process(GO:2000599) |
0.1 | 0.4 | GO:0051026 | chiasma assembly(GO:0051026) |
0.1 | 0.3 | GO:0035728 | response to hepatocyte growth factor(GO:0035728) cellular response to hepatocyte growth factor stimulus(GO:0035729) |
0.1 | 0.1 | GO:0097212 | lysosomal membrane organization(GO:0097212) |
0.1 | 0.5 | GO:0001954 | positive regulation of cell-matrix adhesion(GO:0001954) |
0.1 | 2.8 | GO:0007157 | heterophilic cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0007157) |
0.1 | 0.9 | GO:0042415 | norepinephrine metabolic process(GO:0042415) |
0.1 | 0.4 | GO:0050820 | positive regulation of coagulation(GO:0050820) |
0.1 | 0.3 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
0.1 | 0.1 | GO:2000319 | regulation of T-helper 17 cell differentiation(GO:2000319) |
0.1 | 0.2 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
0.1 | 0.8 | GO:0099517 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
0.1 | 0.1 | GO:0040023 | establishment of nucleus localization(GO:0040023) |
0.1 | 0.6 | GO:0042744 | hydrogen peroxide catabolic process(GO:0042744) |
0.1 | 0.8 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
0.1 | 0.2 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
0.1 | 0.4 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
0.1 | 0.6 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
0.1 | 0.5 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
0.1 | 0.3 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
0.1 | 1.2 | GO:0060716 | labyrinthine layer blood vessel development(GO:0060716) |
0.1 | 0.2 | GO:0001757 | somite specification(GO:0001757) |
0.1 | 0.1 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
0.1 | 1.4 | GO:0035458 | cellular response to interferon-beta(GO:0035458) |
0.1 | 0.2 | GO:0002337 | B-1 B cell differentiation(GO:0001923) B-1a B cell differentiation(GO:0002337) |
0.1 | 0.2 | GO:0021764 | amygdala development(GO:0021764) |
0.1 | 0.3 | GO:0080154 | regulation of fertilization(GO:0080154) |
0.1 | 0.5 | GO:0045581 | negative regulation of T cell differentiation(GO:0045581) |
0.1 | 0.5 | GO:0007000 | nucleolus organization(GO:0007000) |
0.1 | 0.6 | GO:0070059 | intrinsic apoptotic signaling pathway in response to endoplasmic reticulum stress(GO:0070059) |
0.1 | 0.3 | GO:0050955 | thermoception(GO:0050955) |
0.1 | 0.1 | GO:0019885 | antigen processing and presentation of endogenous peptide antigen via MHC class I(GO:0019885) |
0.1 | 0.8 | GO:0006032 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
0.1 | 0.4 | GO:0017183 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
0.1 | 0.5 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
0.1 | 0.4 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
0.1 | 0.8 | GO:0051383 | kinetochore organization(GO:0051383) |
0.1 | 0.1 | GO:0002246 | wound healing involved in inflammatory response(GO:0002246) inflammatory response to wounding(GO:0090594) |
0.1 | 0.1 | GO:0045628 | regulation of T-helper 2 cell differentiation(GO:0045628) |
0.1 | 0.1 | GO:0046466 | membrane lipid catabolic process(GO:0046466) |
0.1 | 0.4 | GO:0034227 | tRNA thio-modification(GO:0034227) |
0.1 | 0.2 | GO:0010446 | response to alkaline pH(GO:0010446) |
0.1 | 0.2 | GO:0015755 | fructose transport(GO:0015755) |
0.1 | 0.5 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
0.1 | 0.1 | GO:0002074 | extraocular skeletal muscle development(GO:0002074) |
0.1 | 1.7 | GO:0006284 | base-excision repair(GO:0006284) |
0.1 | 0.4 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.1 | 1.6 | GO:0046928 | regulation of neurotransmitter secretion(GO:0046928) |
0.1 | 0.6 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
0.1 | 1.1 | GO:0051492 | regulation of stress fiber assembly(GO:0051492) |
0.1 | 0.8 | GO:0035966 | response to topologically incorrect protein(GO:0035966) |
0.1 | 0.2 | GO:0000492 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
0.1 | 0.2 | GO:0032700 | negative regulation of interleukin-17 production(GO:0032700) |
0.1 | 0.7 | GO:0007135 | meiosis II(GO:0007135) |
0.1 | 0.5 | GO:0035456 | response to interferon-beta(GO:0035456) |
0.1 | 0.4 | GO:0070172 | positive regulation of tooth mineralization(GO:0070172) |
0.1 | 0.2 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
0.1 | 0.1 | GO:0042524 | negative regulation of tyrosine phosphorylation of Stat5 protein(GO:0042524) |
0.1 | 0.1 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
0.1 | 0.4 | GO:2000811 | negative regulation of anoikis(GO:2000811) |
0.1 | 0.2 | GO:0046689 | response to mercury ion(GO:0046689) |
0.1 | 0.6 | GO:0032743 | positive regulation of interleukin-2 production(GO:0032743) |
0.1 | 0.4 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
0.1 | 0.3 | GO:0006772 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
0.1 | 0.2 | GO:0001810 | regulation of type I hypersensitivity(GO:0001810) type I hypersensitivity(GO:0016068) |
0.1 | 0.1 | GO:1903391 | regulation of adherens junction organization(GO:1903391) |
0.1 | 0.1 | GO:2001274 | negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
0.1 | 0.3 | GO:0021799 | cerebral cortex radially oriented cell migration(GO:0021799) |
0.1 | 0.3 | GO:1990440 | positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
0.1 | 0.8 | GO:1903077 | negative regulation of protein localization to plasma membrane(GO:1903077) negative regulation of protein localization to cell periphery(GO:1904376) |
0.1 | 0.2 | GO:0002281 | macrophage activation involved in immune response(GO:0002281) |
0.1 | 0.7 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
0.1 | 0.3 | GO:0038031 | non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
0.1 | 0.3 | GO:0090031 | positive regulation of steroid hormone biosynthetic process(GO:0090031) |
0.1 | 0.3 | GO:0046208 | spermine catabolic process(GO:0046208) |
0.1 | 1.4 | GO:0018345 | protein palmitoylation(GO:0018345) |
0.1 | 0.4 | GO:0021795 | cerebral cortex cell migration(GO:0021795) |
0.1 | 0.4 | GO:0043691 | reverse cholesterol transport(GO:0043691) |
0.1 | 0.2 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.1 | 0.6 | GO:0046579 | positive regulation of Ras protein signal transduction(GO:0046579) |
0.1 | 0.2 | GO:0010225 | response to UV-C(GO:0010225) |
0.1 | 0.4 | GO:0030970 | retrograde protein transport, ER to cytosol(GO:0030970) |
0.1 | 0.4 | GO:0051132 | NK T cell activation(GO:0051132) |
0.1 | 1.3 | GO:0061436 | establishment of skin barrier(GO:0061436) |
0.1 | 0.6 | GO:0051974 | negative regulation of telomerase activity(GO:0051974) |
0.1 | 0.3 | GO:1903204 | negative regulation of oxidative stress-induced neuron death(GO:1903204) |
0.1 | 0.1 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
0.1 | 0.4 | GO:2000144 | positive regulation of DNA-templated transcription, initiation(GO:2000144) |
0.1 | 0.2 | GO:1903441 | protein localization to ciliary membrane(GO:1903441) |
0.1 | 0.1 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
0.1 | 0.3 | GO:0003215 | cardiac right ventricle morphogenesis(GO:0003215) |
0.1 | 0.9 | GO:0060384 | innervation(GO:0060384) |
0.1 | 0.2 | GO:0030432 | peristalsis(GO:0030432) |
0.1 | 0.2 | GO:0030222 | eosinophil differentiation(GO:0030222) |
0.1 | 0.2 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
0.1 | 1.1 | GO:0045116 | protein neddylation(GO:0045116) |
0.1 | 0.2 | GO:0035988 | chondrocyte proliferation(GO:0035988) |
0.1 | 0.2 | GO:0023041 | neuronal signal transduction(GO:0023041) |
0.1 | 1.1 | GO:1900087 | positive regulation of G1/S transition of mitotic cell cycle(GO:1900087) |
0.1 | 0.1 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
0.1 | 0.6 | GO:0030828 | positive regulation of cGMP biosynthetic process(GO:0030828) |
0.1 | 0.2 | GO:0032463 | negative regulation of protein homooligomerization(GO:0032463) |
0.1 | 0.2 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
0.1 | 0.1 | GO:0048570 | notochord morphogenesis(GO:0048570) |
0.1 | 0.6 | GO:0001967 | suckling behavior(GO:0001967) |
0.1 | 0.7 | GO:1903861 | regulation of dendrite extension(GO:1903859) positive regulation of dendrite extension(GO:1903861) |
0.1 | 0.1 | GO:0030825 | positive regulation of cGMP metabolic process(GO:0030825) |
0.1 | 0.3 | GO:0006515 | misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
0.1 | 0.7 | GO:0050919 | negative chemotaxis(GO:0050919) |
0.1 | 0.1 | GO:0045632 | negative regulation of mechanoreceptor differentiation(GO:0045632) negative regulation of inner ear receptor cell differentiation(GO:2000981) |
0.1 | 0.1 | GO:0010668 | ectodermal cell differentiation(GO:0010668) |
0.1 | 0.7 | GO:0060216 | definitive hemopoiesis(GO:0060216) |
0.1 | 0.1 | GO:0006787 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) |
0.1 | 0.5 | GO:1902236 | negative regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902236) |
0.1 | 0.7 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
0.1 | 1.2 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
0.1 | 0.3 | GO:0045838 | positive regulation of membrane potential(GO:0045838) |
0.1 | 0.2 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
0.1 | 0.6 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
0.1 | 0.1 | GO:0072144 | glomerular mesangial cell differentiation(GO:0072008) glomerular mesangial cell development(GO:0072144) |
0.1 | 0.6 | GO:0010596 | negative regulation of endothelial cell migration(GO:0010596) |
0.1 | 0.3 | GO:0097264 | self proteolysis(GO:0097264) |
0.1 | 0.1 | GO:0045351 | type I interferon biosynthetic process(GO:0045351) |
0.1 | 0.4 | GO:0002097 | tRNA wobble base modification(GO:0002097) |
0.1 | 1.3 | GO:0006953 | acute-phase response(GO:0006953) |
0.1 | 0.2 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
0.1 | 0.6 | GO:0071361 | cellular response to ethanol(GO:0071361) |
0.1 | 0.2 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
0.1 | 1.0 | GO:0070584 | mitochondrion morphogenesis(GO:0070584) |
0.1 | 0.4 | GO:0033137 | negative regulation of peptidyl-serine phosphorylation(GO:0033137) |
0.1 | 0.3 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.1 | 0.1 | GO:0033599 | regulation of mammary gland epithelial cell proliferation(GO:0033599) |
0.1 | 0.2 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
0.1 | 0.3 | GO:0097237 | cellular response to toxic substance(GO:0097237) |
0.1 | 0.1 | GO:0035106 | operant conditioning(GO:0035106) |
0.1 | 0.6 | GO:0042159 | lipoprotein catabolic process(GO:0042159) |
0.1 | 0.4 | GO:0006995 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
0.1 | 0.3 | GO:0032060 | bleb assembly(GO:0032060) |
0.1 | 0.2 | GO:2001198 | regulation of dendritic cell differentiation(GO:2001198) |
0.1 | 0.4 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
0.1 | 0.5 | GO:0060765 | regulation of androgen receptor signaling pathway(GO:0060765) |
0.1 | 0.1 | GO:0044783 | G1 DNA damage checkpoint(GO:0044783) |
0.1 | 0.1 | GO:1902548 | negative regulation of cellular response to vascular endothelial growth factor stimulus(GO:1902548) |
0.1 | 0.2 | GO:0070861 | regulation of protein exit from endoplasmic reticulum(GO:0070861) |
0.1 | 0.5 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
0.1 | 0.2 | GO:0042346 | positive regulation of NF-kappaB import into nucleus(GO:0042346) |
0.1 | 0.2 | GO:0033033 | negative regulation of myeloid cell apoptotic process(GO:0033033) |
0.1 | 0.2 | GO:2000288 | positive regulation of myoblast proliferation(GO:2000288) |
0.1 | 0.1 | GO:0072240 | distal convoluted tubule development(GO:0072025) DCT cell differentiation(GO:0072069) metanephric distal convoluted tubule development(GO:0072221) metanephric distal tubule development(GO:0072235) metanephric DCT cell differentiation(GO:0072240) |
0.1 | 0.2 | GO:0010614 | negative regulation of cardiac muscle hypertrophy(GO:0010614) |
0.1 | 0.2 | GO:2000696 | regulation of epithelial cell differentiation involved in kidney development(GO:2000696) |
0.1 | 0.7 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
0.1 | 0.4 | GO:0006388 | RNA splicing, via endonucleolytic cleavage and ligation(GO:0000394) tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
0.1 | 0.1 | GO:0033184 | positive regulation of histone ubiquitination(GO:0033184) regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
0.1 | 0.2 | GO:0051970 | negative regulation of transmission of nerve impulse(GO:0051970) |
0.1 | 1.9 | GO:0045069 | regulation of viral genome replication(GO:0045069) |
0.1 | 0.3 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
0.1 | 0.2 | GO:0042256 | mature ribosome assembly(GO:0042256) |
0.1 | 1.9 | GO:0034446 | substrate adhesion-dependent cell spreading(GO:0034446) |
0.1 | 0.6 | GO:0051085 | chaperone mediated protein folding requiring cofactor(GO:0051085) |
0.1 | 0.1 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
0.1 | 0.7 | GO:0048268 | clathrin coat assembly(GO:0048268) |
0.1 | 0.1 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
0.1 | 0.1 | GO:1902004 | positive regulation of beta-amyloid formation(GO:1902004) positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
0.1 | 0.1 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
0.1 | 0.1 | GO:0035360 | positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
0.1 | 0.4 | GO:0036342 | post-anal tail morphogenesis(GO:0036342) |
0.1 | 0.7 | GO:0006198 | cAMP catabolic process(GO:0006198) |
0.1 | 0.2 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
0.1 | 0.1 | GO:0046066 | purine deoxyribonucleoside diphosphate metabolic process(GO:0009182) dGDP metabolic process(GO:0046066) |
0.1 | 0.4 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
0.1 | 0.4 | GO:1904355 | positive regulation of telomere capping(GO:1904355) |
0.1 | 0.1 | GO:0002326 | B cell lineage commitment(GO:0002326) |
0.1 | 0.1 | GO:0035864 | response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
0.1 | 0.1 | GO:0061047 | positive regulation of branching involved in lung morphogenesis(GO:0061047) |
0.1 | 0.1 | GO:0090069 | regulation of ribosome biogenesis(GO:0090069) negative regulation of ribosome biogenesis(GO:0090071) |
0.1 | 0.4 | GO:1901387 | positive regulation of voltage-gated calcium channel activity(GO:1901387) |
0.1 | 0.3 | GO:0032329 | serine transport(GO:0032329) |
0.1 | 0.7 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.1 | 0.3 | GO:0033363 | secretory granule organization(GO:0033363) |
0.1 | 0.6 | GO:0032781 | positive regulation of ATPase activity(GO:0032781) |
0.1 | 0.1 | GO:0008594 | photoreceptor cell morphogenesis(GO:0008594) |
0.1 | 0.2 | GO:2001258 | negative regulation of cation channel activity(GO:2001258) |
0.1 | 0.1 | GO:0010820 | positive regulation of T cell chemotaxis(GO:0010820) |
0.1 | 0.1 | GO:0051204 | protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:0001844) protein insertion into mitochondrial membrane(GO:0051204) |
0.1 | 0.1 | GO:0032789 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
0.1 | 0.5 | GO:0014823 | response to activity(GO:0014823) |
0.1 | 0.1 | GO:0035967 | cellular response to topologically incorrect protein(GO:0035967) |
0.1 | 0.6 | GO:0010259 | multicellular organism aging(GO:0010259) |
0.1 | 0.1 | GO:0042637 | catagen(GO:0042637) |
0.1 | 0.2 | GO:2000009 | negative regulation of protein localization to cell surface(GO:2000009) |
0.1 | 0.1 | GO:0043032 | positive regulation of macrophage activation(GO:0043032) |
0.1 | 0.2 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
0.1 | 0.1 | GO:2001012 | mesenchymal cell differentiation involved in kidney development(GO:0072161) mesenchymal cell differentiation involved in renal system development(GO:2001012) |
0.1 | 0.9 | GO:0007029 | endoplasmic reticulum organization(GO:0007029) |
0.1 | 0.1 | GO:0010909 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
0.1 | 0.1 | GO:0010832 | negative regulation of myotube differentiation(GO:0010832) |
0.1 | 0.1 | GO:0015705 | iodide transport(GO:0015705) |
0.1 | 0.7 | GO:0042269 | regulation of natural killer cell mediated cytotoxicity(GO:0042269) |
0.1 | 0.1 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
0.1 | 0.1 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
0.1 | 0.1 | GO:1902992 | negative regulation of amyloid precursor protein catabolic process(GO:1902992) |
0.1 | 1.1 | GO:2001014 | regulation of skeletal muscle cell differentiation(GO:2001014) |
0.1 | 0.6 | GO:0007588 | excretion(GO:0007588) |
0.1 | 0.3 | GO:0048385 | regulation of retinoic acid receptor signaling pathway(GO:0048385) |
0.1 | 0.1 | GO:0060676 | ureteric bud formation(GO:0060676) |
0.1 | 1.1 | GO:0042538 | hyperosmotic salinity response(GO:0042538) |
0.1 | 2.4 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
0.1 | 0.1 | GO:0071294 | cellular response to zinc ion(GO:0071294) |
0.1 | 0.8 | GO:0032611 | interleukin-1 beta production(GO:0032611) |
0.1 | 0.3 | GO:0015671 | oxygen transport(GO:0015671) |
0.1 | 0.1 | GO:0002331 | pre-B cell allelic exclusion(GO:0002331) |
0.1 | 0.9 | GO:0016180 | snRNA processing(GO:0016180) |
0.1 | 0.7 | GO:0051568 | histone H3-K4 methylation(GO:0051568) |
0.1 | 0.2 | GO:0045956 | positive regulation of calcium ion-dependent exocytosis(GO:0045956) |
0.1 | 0.1 | GO:0002335 | mature B cell differentiation(GO:0002335) |
0.1 | 0.5 | GO:0000578 | embryonic axis specification(GO:0000578) |
0.1 | 0.1 | GO:0044034 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
0.1 | 0.1 | GO:0015817 | histidine transport(GO:0015817) |
0.1 | 0.1 | GO:0051570 | regulation of histone H3-K9 methylation(GO:0051570) |
0.1 | 0.1 | GO:1900227 | positive regulation of NLRP3 inflammasome complex assembly(GO:1900227) |
0.1 | 0.1 | GO:0001661 | conditioned taste aversion(GO:0001661) |
0.1 | 0.8 | GO:0003009 | skeletal muscle contraction(GO:0003009) |
0.1 | 0.3 | GO:0045793 | positive regulation of cell size(GO:0045793) |
0.1 | 0.5 | GO:0051875 | pigment granule localization(GO:0051875) |
0.1 | 0.4 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
0.1 | 1.6 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
0.1 | 1.0 | GO:0048240 | sperm capacitation(GO:0048240) |
0.1 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
0.1 | 0.2 | GO:0008655 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
0.1 | 0.2 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
0.1 | 0.1 | GO:0031640 | killing of cells of other organism(GO:0031640) disruption of cells of other organism(GO:0044364) |
0.1 | 0.1 | GO:0005984 | disaccharide metabolic process(GO:0005984) |
0.1 | 0.1 | GO:0006824 | cobalt ion transport(GO:0006824) |
0.1 | 0.2 | GO:0048169 | regulation of long-term neuronal synaptic plasticity(GO:0048169) |
0.1 | 0.2 | GO:0032836 | glomerular basement membrane development(GO:0032836) |
0.1 | 0.1 | GO:0039694 | viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
0.1 | 0.1 | GO:0046959 | nonassociative learning(GO:0046958) habituation(GO:0046959) |
0.1 | 1.4 | GO:0006754 | ATP biosynthetic process(GO:0006754) |
0.1 | 0.1 | GO:0046884 | follicle-stimulating hormone secretion(GO:0046884) |
0.1 | 0.3 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
0.1 | 0.1 | GO:2001245 | regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
0.1 | 0.1 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
0.1 | 0.2 | GO:1900165 | negative regulation of interleukin-6 secretion(GO:1900165) |
0.1 | 0.2 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
0.1 | 0.1 | GO:0046882 | negative regulation of follicle-stimulating hormone secretion(GO:0046882) |
0.1 | 0.1 | GO:0070366 | regulation of hepatocyte differentiation(GO:0070366) |
0.1 | 0.1 | GO:0060468 | prevention of polyspermy(GO:0060468) |
0.1 | 0.1 | GO:0045823 | positive regulation of heart contraction(GO:0045823) |
0.1 | 0.1 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
0.1 | 0.2 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
0.1 | 0.5 | GO:0021696 | cerebellar cortex morphogenesis(GO:0021696) |
0.1 | 0.1 | GO:1900864 | mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
0.1 | 0.2 | GO:0050703 | interleukin-1 alpha secretion(GO:0050703) |
0.1 | 0.1 | GO:0008090 | retrograde axonal transport(GO:0008090) |
0.1 | 1.0 | GO:0050853 | B cell receptor signaling pathway(GO:0050853) |
0.1 | 0.1 | GO:0040009 | regulation of growth rate(GO:0040009) |
0.1 | 0.1 | GO:0001996 | positive regulation of heart rate by epinephrine-norepinephrine(GO:0001996) |
0.1 | 0.2 | GO:0033622 | integrin activation(GO:0033622) |
0.1 | 0.1 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
0.1 | 0.2 | GO:0048820 | hair follicle maturation(GO:0048820) |
0.1 | 0.1 | GO:0042424 | catechol-containing compound catabolic process(GO:0019614) catecholamine catabolic process(GO:0042424) |
0.1 | 0.1 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
0.1 | 0.5 | GO:0034063 | stress granule assembly(GO:0034063) |
0.1 | 0.1 | GO:0006658 | phosphatidylserine metabolic process(GO:0006658) |
0.1 | 0.4 | GO:0034643 | establishment of mitochondrion localization, microtubule-mediated(GO:0034643) mitochondrion transport along microtubule(GO:0047497) |
0.1 | 0.2 | GO:0060671 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
0.1 | 0.2 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
0.1 | 0.1 | GO:0006544 | glycine metabolic process(GO:0006544) |
0.1 | 0.1 | GO:1902808 | positive regulation of cell cycle G1/S phase transition(GO:1902808) |
0.1 | 0.2 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.1 | 0.2 | GO:0002360 | T cell lineage commitment(GO:0002360) |
0.1 | 0.2 | GO:0033227 | dsRNA transport(GO:0033227) |
0.1 | 0.1 | GO:0051547 | regulation of keratinocyte migration(GO:0051547) positive regulation of keratinocyte migration(GO:0051549) |
0.0 | 0.0 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.0 | 0.1 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
0.0 | 0.4 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
0.0 | 0.1 | GO:0045078 | regulation of interferon-gamma biosynthetic process(GO:0045072) positive regulation of interferon-gamma biosynthetic process(GO:0045078) |
0.0 | 0.0 | GO:0051354 | negative regulation of oxidoreductase activity(GO:0051354) |
0.0 | 0.2 | GO:0006910 | phagocytosis, recognition(GO:0006910) |
0.0 | 0.0 | GO:1902563 | regulation of neutrophil activation(GO:1902563) |
0.0 | 0.1 | GO:0010039 | response to iron ion(GO:0010039) |
0.0 | 0.0 | GO:0001774 | microglial cell activation(GO:0001774) |
0.0 | 0.1 | GO:2000738 | positive regulation of stem cell differentiation(GO:2000738) |
0.0 | 0.0 | GO:0043586 | tongue development(GO:0043586) |
0.0 | 0.0 | GO:0045876 | positive regulation of sister chromatid cohesion(GO:0045876) |
0.0 | 0.1 | GO:0060509 | Type I pneumocyte differentiation(GO:0060509) |
0.0 | 0.1 | GO:0048318 | axial mesoderm development(GO:0048318) |
0.0 | 0.2 | GO:0050931 | pigment cell differentiation(GO:0050931) |
0.0 | 0.0 | GO:2000774 | positive regulation of cell aging(GO:0090343) positive regulation of cellular senescence(GO:2000774) |
0.0 | 0.0 | GO:0034163 | regulation of toll-like receptor 9 signaling pathway(GO:0034163) positive regulation of toll-like receptor 9 signaling pathway(GO:0034165) |
0.0 | 0.1 | GO:0051901 | positive regulation of mitochondrial depolarization(GO:0051901) |
0.0 | 0.0 | GO:0071899 | regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
0.0 | 0.9 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
0.0 | 0.8 | GO:0006414 | translational elongation(GO:0006414) |
0.0 | 0.0 | GO:1903012 | positive regulation of bone development(GO:1903012) |
0.0 | 0.2 | GO:0008300 | isoprenoid catabolic process(GO:0008300) |
0.0 | 0.1 | GO:0070842 | aggresome assembly(GO:0070842) |
0.0 | 0.0 | GO:0070093 | negative regulation of glucagon secretion(GO:0070093) |
0.0 | 0.3 | GO:0060712 | spongiotrophoblast layer development(GO:0060712) |
0.0 | 0.1 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
0.0 | 0.7 | GO:0008299 | isoprenoid biosynthetic process(GO:0008299) |
0.0 | 0.0 | GO:0071313 | cellular response to caffeine(GO:0071313) cellular response to purine-containing compound(GO:0071415) |
0.0 | 0.6 | GO:0010107 | potassium ion import(GO:0010107) |
0.0 | 1.7 | GO:0000725 | double-strand break repair via homologous recombination(GO:0000724) recombinational repair(GO:0000725) |
0.0 | 0.0 | GO:0065001 | specification of axis polarity(GO:0065001) |
0.0 | 0.0 | GO:0032196 | transposition(GO:0032196) |
0.0 | 0.1 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
0.0 | 0.0 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
0.0 | 0.1 | GO:0002228 | natural killer cell mediated immunity(GO:0002228) |
0.0 | 0.2 | GO:0035330 | regulation of hippo signaling(GO:0035330) |
0.0 | 0.0 | GO:0051386 | regulation of neurotrophin TRK receptor signaling pathway(GO:0051386) |
0.0 | 1.3 | GO:0006506 | GPI anchor biosynthetic process(GO:0006506) |
0.0 | 0.0 | GO:2000510 | regulation of dendritic cell chemotaxis(GO:2000508) positive regulation of dendritic cell chemotaxis(GO:2000510) |
0.0 | 0.1 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
0.0 | 0.1 | GO:0009624 | response to nematode(GO:0009624) |
0.0 | 0.1 | GO:0002870 | lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
0.0 | 0.2 | GO:0043457 | regulation of cellular respiration(GO:0043457) |
0.0 | 0.4 | GO:0050802 | circadian sleep/wake cycle, sleep(GO:0050802) |
0.0 | 1.1 | GO:0030218 | erythrocyte differentiation(GO:0030218) |
0.0 | 0.2 | GO:0021535 | cell migration in hindbrain(GO:0021535) |
0.0 | 0.1 | GO:0030220 | platelet formation(GO:0030220) |
0.0 | 0.3 | GO:0007625 | grooming behavior(GO:0007625) |
0.0 | 0.2 | GO:0048563 | post-embryonic organ morphogenesis(GO:0048563) |
0.0 | 0.0 | GO:0002309 | T cell proliferation involved in immune response(GO:0002309) |
0.0 | 0.2 | GO:0070296 | sarcoplasmic reticulum calcium ion transport(GO:0070296) |
0.0 | 0.7 | GO:0019835 | cytolysis(GO:0019835) |
0.0 | 0.7 | GO:0030199 | collagen fibril organization(GO:0030199) |
0.0 | 0.2 | GO:0006656 | phosphatidylcholine biosynthetic process(GO:0006656) |
0.0 | 0.1 | GO:0042992 | negative regulation of transcription factor import into nucleus(GO:0042992) |
0.0 | 0.2 | GO:0007263 | nitric oxide mediated signal transduction(GO:0007263) |
0.0 | 0.5 | GO:0048266 | behavioral response to pain(GO:0048266) |
0.0 | 0.1 | GO:0045724 | positive regulation of cilium assembly(GO:0045724) |
0.0 | 0.1 | GO:0044778 | meiotic DNA integrity checkpoint(GO:0044778) |
0.0 | 1.1 | GO:0006888 | ER to Golgi vesicle-mediated transport(GO:0006888) |
0.0 | 0.4 | GO:0007190 | activation of adenylate cyclase activity(GO:0007190) |
0.0 | 0.0 | GO:0061370 | testosterone biosynthetic process(GO:0061370) |
0.0 | 0.0 | GO:0016233 | telomere capping(GO:0016233) |
0.0 | 0.4 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.0 | 0.1 | GO:0006449 | regulation of translational termination(GO:0006449) |
0.0 | 0.0 | GO:2001180 | negative regulation of interleukin-10 secretion(GO:2001180) |
0.0 | 0.2 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
0.0 | 0.0 | GO:0060453 | regulation of gastric acid secretion(GO:0060453) negative regulation of gastric acid secretion(GO:0060455) |
0.0 | 0.1 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
0.0 | 0.0 | GO:1901970 | positive regulation of mitotic sister chromatid separation(GO:1901970) |
0.0 | 0.1 | GO:0003161 | cardiac conduction system development(GO:0003161) |
0.0 | 0.0 | GO:1902896 | terminal web assembly(GO:1902896) |
0.0 | 0.1 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
0.0 | 0.1 | GO:0060371 | regulation of atrial cardiac muscle cell membrane depolarization(GO:0060371) |
0.0 | 0.8 | GO:0046839 | phospholipid dephosphorylation(GO:0046839) |
0.0 | 0.0 | GO:0086011 | membrane repolarization during action potential(GO:0086011) regulation of membrane repolarization during action potential(GO:0098903) |
0.0 | 0.4 | GO:0060325 | face morphogenesis(GO:0060325) |
0.0 | 0.1 | GO:0033688 | regulation of osteoblast proliferation(GO:0033688) |
0.0 | 0.2 | GO:0001909 | leukocyte mediated cytotoxicity(GO:0001909) |
0.0 | 0.3 | GO:0001829 | trophectodermal cell differentiation(GO:0001829) |
0.0 | 0.0 | GO:0061643 | chemorepulsion of axon(GO:0061643) |
0.0 | 0.1 | GO:0046541 | saliva secretion(GO:0046541) |
0.0 | 0.3 | GO:2000045 | regulation of G1/S transition of mitotic cell cycle(GO:2000045) |
0.0 | 0.1 | GO:0032026 | response to magnesium ion(GO:0032026) |
0.0 | 0.3 | GO:0000038 | very long-chain fatty acid metabolic process(GO:0000038) |
0.0 | 0.3 | GO:0046931 | pore complex assembly(GO:0046931) |
0.0 | 0.1 | GO:0042487 | regulation of odontogenesis of dentin-containing tooth(GO:0042487) |
0.0 | 0.1 | GO:0001937 | negative regulation of endothelial cell proliferation(GO:0001937) |
0.0 | 0.0 | GO:0030223 | neutrophil differentiation(GO:0030223) |
0.0 | 0.4 | GO:0007062 | sister chromatid cohesion(GO:0007062) |
0.0 | 0.1 | GO:0030049 | muscle filament sliding(GO:0030049) |
0.0 | 0.0 | GO:0042996 | regulation of Golgi to plasma membrane protein transport(GO:0042996) |
0.0 | 0.1 | GO:0036462 | TRAIL-activated apoptotic signaling pathway(GO:0036462) |
0.0 | 0.0 | GO:2000035 | regulation of stem cell division(GO:2000035) |
0.0 | 0.6 | GO:1900047 | negative regulation of blood coagulation(GO:0030195) negative regulation of hemostasis(GO:1900047) |
0.0 | 0.0 | GO:0009068 | aspartate family amino acid catabolic process(GO:0009068) |
0.0 | 0.1 | GO:0045779 | negative regulation of bone resorption(GO:0045779) |
0.0 | 0.3 | GO:0090102 | cochlea development(GO:0090102) |
0.0 | 0.1 | GO:0044062 | regulation of excretion(GO:0044062) |
0.0 | 0.5 | GO:0009250 | glycogen biosynthetic process(GO:0005978) glucan biosynthetic process(GO:0009250) |
0.0 | 0.0 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
0.0 | 0.0 | GO:0051582 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
0.0 | 0.1 | GO:0003197 | endocardial cushion development(GO:0003197) |
0.0 | 0.2 | GO:0045762 | positive regulation of adenylate cyclase activity(GO:0045762) |
0.0 | 0.0 | GO:0045061 | thymic T cell selection(GO:0045061) |
0.0 | 0.0 | GO:0090148 | membrane fission(GO:0090148) |
0.0 | 0.1 | GO:0033004 | negative regulation of mast cell activation(GO:0033004) |
0.0 | 0.4 | GO:0030513 | positive regulation of BMP signaling pathway(GO:0030513) |
0.0 | 0.0 | GO:0060763 | mammary duct terminal end bud growth(GO:0060763) |
0.0 | 0.8 | GO:0055072 | iron ion homeostasis(GO:0055072) |
0.0 | 0.6 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
0.0 | 0.1 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.0 | 0.1 | GO:0050858 | negative regulation of antigen receptor-mediated signaling pathway(GO:0050858) |
0.0 | 0.1 | GO:0048011 | neurotrophin TRK receptor signaling pathway(GO:0048011) |
0.0 | 0.1 | GO:0060536 | cartilage morphogenesis(GO:0060536) |
0.0 | 0.0 | GO:0072608 | interleukin-10 secretion(GO:0072608) |
0.0 | 0.1 | GO:0061525 | hindgut development(GO:0061525) |
0.0 | 0.0 | GO:0060600 | dichotomous subdivision of an epithelial terminal unit(GO:0060600) |
0.0 | 0.1 | GO:0031017 | exocrine pancreas development(GO:0031017) |
0.0 | 0.5 | GO:0032467 | positive regulation of cytokinesis(GO:0032467) |
0.0 | 0.1 | GO:0052646 | alditol phosphate metabolic process(GO:0052646) |
0.0 | 0.2 | GO:0010738 | regulation of protein kinase A signaling(GO:0010738) |
0.0 | 0.1 | GO:0045059 | positive thymic T cell selection(GO:0045059) |
0.0 | 0.0 | GO:0043950 | positive regulation of cAMP-mediated signaling(GO:0043950) |
0.0 | 0.0 | GO:0071873 | response to norepinephrine(GO:0071873) |
0.0 | 0.2 | GO:0045577 | regulation of B cell differentiation(GO:0045577) |
0.0 | 0.9 | GO:0006418 | tRNA aminoacylation for protein translation(GO:0006418) |
0.0 | 0.1 | GO:0034633 | retinol transport(GO:0034633) isoprenoid transport(GO:0046864) terpenoid transport(GO:0046865) |
0.0 | 0.0 | GO:0061727 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
0.0 | 0.1 | GO:0006561 | proline biosynthetic process(GO:0006561) |
0.0 | 0.0 | GO:0072174 | metanephric tubule formation(GO:0072174) |
0.0 | 0.0 | GO:0002554 | serotonin secretion by platelet(GO:0002554) |
0.0 | 0.3 | GO:0043171 | peptide catabolic process(GO:0043171) |
0.0 | 0.0 | GO:0072318 | clathrin coat disassembly(GO:0072318) |
0.0 | 0.0 | GO:1900452 | regulation of long term synaptic depression(GO:1900452) |
0.0 | 0.0 | GO:2000860 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
0.0 | 0.0 | GO:0072497 | mesenchymal stem cell differentiation(GO:0072497) |
0.0 | 0.1 | GO:0010566 | regulation of ketone biosynthetic process(GO:0010566) |
0.0 | 0.0 | GO:0034374 | low-density lipoprotein particle remodeling(GO:0034374) |
0.0 | 0.1 | GO:2000278 | regulation of DNA biosynthetic process(GO:2000278) |
0.0 | 0.1 | GO:0010763 | positive regulation of fibroblast migration(GO:0010763) |
0.0 | 0.1 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
0.0 | 0.1 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
0.0 | 0.2 | GO:0044705 | mating behavior(GO:0007617) multi-organism reproductive behavior(GO:0044705) |
0.0 | 0.4 | GO:0009268 | response to pH(GO:0009268) |
0.0 | 0.1 | GO:0060081 | membrane hyperpolarization(GO:0060081) |
0.0 | 0.0 | GO:0048148 | behavioral response to cocaine(GO:0048148) |
0.0 | 0.0 | GO:0061548 | ganglion development(GO:0061548) |
0.0 | 0.0 | GO:0090274 | positive regulation of somatostatin secretion(GO:0090274) |
0.0 | 0.3 | GO:0045662 | negative regulation of myoblast differentiation(GO:0045662) |
0.0 | 0.0 | GO:0044331 | cell-cell adhesion mediated by cadherin(GO:0044331) |
0.0 | 0.0 | GO:2000520 | regulation of immunological synapse formation(GO:2000520) |
0.0 | 0.0 | GO:0010092 | specification of organ identity(GO:0010092) |
0.0 | 0.1 | GO:0046500 | S-adenosylmethionine metabolic process(GO:0046500) |
0.0 | 0.1 | GO:0099612 | protein localization to paranode region of axon(GO:0002175) protein localization to axon(GO:0099612) |
0.0 | 0.4 | GO:0034724 | DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
0.0 | 0.1 | GO:0002042 | cell migration involved in sprouting angiogenesis(GO:0002042) |
0.0 | 0.0 | GO:0060290 | transdifferentiation(GO:0060290) |
0.0 | 0.1 | GO:0043651 | linoleic acid metabolic process(GO:0043651) |
0.0 | 0.0 | GO:0033079 | immature T cell proliferation(GO:0033079) |
0.0 | 0.3 | GO:0007205 | protein kinase C-activating G-protein coupled receptor signaling pathway(GO:0007205) |
0.0 | 0.0 | GO:0042494 | detection of bacterial lipoprotein(GO:0042494) |
0.0 | 0.0 | GO:0051385 | response to mineralocorticoid(GO:0051385) |
0.0 | 0.1 | GO:0060346 | bone trabecula formation(GO:0060346) |
0.0 | 0.0 | GO:0060297 | regulation of sarcomere organization(GO:0060297) |
0.0 | 0.0 | GO:0016539 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
0.0 | 0.1 | GO:0051899 | membrane depolarization(GO:0051899) |
0.0 | 0.1 | GO:0051447 | negative regulation of meiotic cell cycle(GO:0051447) |
0.0 | 0.0 | GO:0019372 | lipoxygenase pathway(GO:0019372) |
0.0 | 0.2 | GO:0001825 | blastocyst formation(GO:0001825) |
0.0 | 0.0 | GO:1901381 | positive regulation of potassium ion transmembrane transport(GO:1901381) |
0.0 | 0.0 | GO:0032714 | negative regulation of interleukin-5 production(GO:0032714) |
0.0 | 0.4 | GO:0006306 | DNA alkylation(GO:0006305) DNA methylation(GO:0006306) |
0.0 | 0.1 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.0 | 0.0 | GO:0045110 | intermediate filament bundle assembly(GO:0045110) |
0.0 | 0.0 | GO:0060594 | mammary gland specification(GO:0060594) |
0.0 | 0.1 | GO:0007202 | activation of phospholipase C activity(GO:0007202) |
0.0 | 0.1 | GO:0035641 | locomotory exploration behavior(GO:0035641) |
0.0 | 0.0 | GO:0043383 | negative T cell selection(GO:0043383) |
0.0 | 0.3 | GO:0042596 | fear response(GO:0042596) |
0.0 | 0.1 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
0.0 | 0.2 | GO:0007342 | fusion of sperm to egg plasma membrane(GO:0007342) |
0.0 | 0.3 | GO:0086010 | membrane depolarization during action potential(GO:0086010) |
0.0 | 0.0 | GO:1905097 | regulation of guanyl-nucleotide exchange factor activity(GO:1905097) |
0.0 | 0.0 | GO:1902608 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
0.0 | 0.1 | GO:0015074 | DNA integration(GO:0015074) |
0.0 | 0.0 | GO:0052803 | imidazole-containing compound metabolic process(GO:0052803) |
0.0 | 0.1 | GO:2000273 | positive regulation of receptor activity(GO:2000273) |
0.0 | 0.2 | GO:0003016 | respiratory system process(GO:0003016) |
0.0 | 0.0 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
0.0 | 0.1 | GO:0034627 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process(GO:0034627) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
0.0 | 0.1 | GO:0030238 | male sex determination(GO:0030238) |
0.0 | 0.0 | GO:2000354 | regulation of ovarian follicle development(GO:2000354) |
0.0 | 0.0 | GO:0008355 | olfactory learning(GO:0008355) |
0.0 | 0.1 | GO:0090003 | regulation of establishment of protein localization to plasma membrane(GO:0090003) |
0.0 | 0.3 | GO:0007099 | centriole replication(GO:0007099) |
0.0 | 0.0 | GO:0001698 | gastrin-induced gastric acid secretion(GO:0001698) |
0.0 | 0.0 | GO:0010666 | positive regulation of striated muscle cell apoptotic process(GO:0010663) positive regulation of cardiac muscle cell apoptotic process(GO:0010666) |
0.0 | 0.0 | GO:0021859 | pyramidal neuron differentiation(GO:0021859) |
0.0 | 0.0 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
0.0 | 0.0 | GO:0009886 | post-embryonic morphogenesis(GO:0009886) |
0.0 | 0.2 | GO:0006383 | transcription from RNA polymerase III promoter(GO:0006383) |
0.0 | 0.0 | GO:1901163 | trophoblast cell migration(GO:0061450) regulation of trophoblast cell migration(GO:1901163) |
0.0 | 0.0 | GO:0002710 | negative regulation of T cell mediated immunity(GO:0002710) |
0.0 | 0.1 | GO:1901407 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
0.0 | 0.1 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.0 | 0.0 | GO:0016198 | axon choice point recognition(GO:0016198) |
0.0 | 0.1 | GO:0008616 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
0.0 | 0.0 | GO:0046416 | D-amino acid metabolic process(GO:0046416) |
0.0 | 0.0 | GO:0042636 | negative regulation of hair cycle(GO:0042636) |
0.0 | 0.1 | GO:0032824 | natural killer cell differentiation involved in immune response(GO:0002325) negative regulation of natural killer cell differentiation(GO:0032824) regulation of natural killer cell differentiation involved in immune response(GO:0032826) negative regulation of natural killer cell differentiation involved in immune response(GO:0032827) |
0.0 | 0.1 | GO:0098543 | detection of bacterium(GO:0016045) detection of other organism(GO:0098543) |
0.0 | 0.0 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
0.0 | 0.2 | GO:0030816 | positive regulation of cAMP metabolic process(GO:0030816) |
0.0 | 0.0 | GO:1902202 | regulation of hepatocyte growth factor receptor signaling pathway(GO:1902202) |
0.0 | 0.0 | GO:0060005 | vestibular reflex(GO:0060005) |
0.0 | 0.0 | GO:0038044 | transforming growth factor-beta secretion(GO:0038044) regulation of transforming growth factor-beta secretion(GO:2001201) |
0.0 | 0.0 | GO:1901374 | acetylcholine transport(GO:0015870) acetate ester transport(GO:1901374) |
0.0 | 0.1 | GO:0002862 | negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
0.0 | 0.7 | GO:0007338 | single fertilization(GO:0007338) |
0.0 | 0.0 | GO:0042533 | tumor necrosis factor biosynthetic process(GO:0042533) regulation of tumor necrosis factor biosynthetic process(GO:0042534) |
0.0 | 0.0 | GO:0072677 | eosinophil migration(GO:0072677) |
0.0 | 0.0 | GO:0036233 | glycine import(GO:0036233) |
0.0 | 0.0 | GO:0048625 | myoblast fate commitment(GO:0048625) |
0.0 | 0.1 | GO:0043403 | skeletal muscle tissue regeneration(GO:0043403) |
0.0 | 0.0 | GO:0032375 | negative regulation of sterol transport(GO:0032372) negative regulation of cholesterol transport(GO:0032375) |
0.0 | 0.0 | GO:0006562 | proline catabolic process(GO:0006562) |
0.0 | 0.1 | GO:0001756 | somitogenesis(GO:0001756) |
0.0 | 0.0 | GO:0048485 | sympathetic nervous system development(GO:0048485) |
0.0 | 0.0 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.0 | 0.1 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
0.0 | 0.1 | GO:0030539 | male genitalia development(GO:0030539) |
0.0 | 0.1 | GO:0006144 | purine nucleobase metabolic process(GO:0006144) |
0.0 | 0.0 | GO:0038065 | collagen-activated signaling pathway(GO:0038065) |
0.0 | 0.0 | GO:0044406 | adhesion of symbiont to host(GO:0044406) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.3 | 1.3 | GO:0044462 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
1.2 | 3.7 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
1.0 | 2.9 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.9 | 3.7 | GO:0035363 | histone locus body(GO:0035363) |
0.9 | 2.7 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.8 | 3.3 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
0.7 | 2.1 | GO:0000835 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) |
0.7 | 2.0 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
0.7 | 2.0 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
0.6 | 3.8 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
0.6 | 2.5 | GO:1990357 | terminal web(GO:1990357) |
0.6 | 0.6 | GO:0031514 | motile cilium(GO:0031514) |
0.6 | 2.4 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.6 | 1.8 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.6 | 3.9 | GO:0005577 | fibrinogen complex(GO:0005577) |
0.6 | 1.7 | GO:0000811 | GINS complex(GO:0000811) |
0.5 | 3.8 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.5 | 1.5 | GO:0043293 | apoptosome(GO:0043293) |
0.5 | 2.0 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
0.5 | 1.5 | GO:0005745 | m-AAA complex(GO:0005745) |
0.5 | 1.5 | GO:0097443 | sorting endosome(GO:0097443) |
0.5 | 0.5 | GO:0097648 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
0.5 | 1.4 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
0.5 | 1.4 | GO:0031417 | NatC complex(GO:0031417) |
0.5 | 2.4 | GO:0008091 | spectrin(GO:0008091) |
0.5 | 0.5 | GO:0035061 | interchromatin granule(GO:0035061) |
0.5 | 1.4 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.4 | 1.3 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.4 | 1.3 | GO:0035189 | Rb-E2F complex(GO:0035189) |
0.4 | 1.3 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.4 | 0.4 | GO:0071203 | WASH complex(GO:0071203) |
0.4 | 1.3 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.4 | 1.2 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
0.4 | 1.2 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.4 | 3.3 | GO:0034992 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
0.4 | 1.2 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
0.4 | 1.2 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
0.4 | 2.0 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.4 | 2.4 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
0.4 | 1.6 | GO:0044194 | cytolytic granule(GO:0044194) |
0.4 | 2.3 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
0.4 | 6.3 | GO:0097225 | sperm midpiece(GO:0097225) |
0.4 | 1.1 | GO:0017133 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
0.4 | 1.5 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.4 | 1.1 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
0.4 | 2.5 | GO:0030008 | TRAPP complex(GO:0030008) |
0.3 | 2.1 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
0.3 | 1.0 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
0.3 | 0.7 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.3 | 3.0 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.3 | 1.0 | GO:1990462 | omegasome(GO:1990462) |
0.3 | 1.0 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.3 | 0.6 | GO:0000109 | nucleotide-excision repair complex(GO:0000109) |
0.3 | 1.6 | GO:0044326 | dendritic spine neck(GO:0044326) |
0.3 | 0.3 | GO:0012505 | endomembrane system(GO:0012505) |
0.3 | 1.6 | GO:0005683 | U7 snRNP(GO:0005683) |
0.3 | 0.6 | GO:0032437 | cuticular plate(GO:0032437) |
0.3 | 2.5 | GO:0036157 | outer dynein arm(GO:0036157) |
0.3 | 0.9 | GO:0071141 | SMAD protein complex(GO:0071141) |
0.3 | 2.5 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.3 | 5.2 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
0.3 | 0.9 | GO:0097513 | myosin II filament(GO:0097513) |
0.3 | 2.1 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.3 | 1.2 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
0.3 | 0.9 | GO:0032010 | phagolysosome(GO:0032010) |
0.3 | 2.1 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
0.3 | 1.2 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
0.3 | 2.3 | GO:0061700 | GATOR2 complex(GO:0061700) |
0.3 | 0.6 | GO:0044354 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.3 | 0.6 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
0.3 | 1.1 | GO:0033061 | DNA recombinase mediator complex(GO:0033061) |
0.3 | 0.8 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
0.3 | 2.0 | GO:0000439 | core TFIIH complex(GO:0000439) |
0.3 | 3.1 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.3 | 1.1 | GO:1990696 | USH2 complex(GO:1990696) |
0.3 | 1.6 | GO:0043657 | host(GO:0018995) host cell part(GO:0033643) host cell(GO:0043657) |
0.3 | 0.8 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
0.3 | 0.5 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
0.3 | 2.1 | GO:0035631 | CD40 receptor complex(GO:0035631) |
0.3 | 2.1 | GO:0030056 | hemidesmosome(GO:0030056) |
0.3 | 1.3 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
0.3 | 0.8 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.3 | 2.3 | GO:0031519 | PcG protein complex(GO:0031519) |
0.3 | 1.3 | GO:0031091 | platelet alpha granule(GO:0031091) |
0.3 | 1.8 | GO:0043219 | lateral loop(GO:0043219) |
0.3 | 0.8 | GO:0031523 | Myb complex(GO:0031523) |
0.3 | 2.0 | GO:0042405 | nuclear inclusion body(GO:0042405) |
0.3 | 1.0 | GO:0097452 | GAIT complex(GO:0097452) |
0.3 | 0.8 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
0.3 | 0.8 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
0.2 | 2.5 | GO:0031010 | ISWI-type complex(GO:0031010) |
0.2 | 1.7 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
0.2 | 3.4 | GO:0030914 | STAGA complex(GO:0030914) |
0.2 | 1.0 | GO:0070820 | tertiary granule(GO:0070820) |
0.2 | 0.5 | GO:0043204 | perikaryon(GO:0043204) |
0.2 | 1.2 | GO:0005638 | lamin filament(GO:0005638) |
0.2 | 0.2 | GO:0097440 | apical dendrite(GO:0097440) |
0.2 | 3.3 | GO:0042599 | lamellar body(GO:0042599) |
0.2 | 0.7 | GO:0031970 | organelle envelope lumen(GO:0031970) |
0.2 | 1.2 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
0.2 | 2.1 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
0.2 | 1.2 | GO:0070695 | FHF complex(GO:0070695) |
0.2 | 4.1 | GO:0031907 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
0.2 | 0.5 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.2 | 0.2 | GO:0044292 | dendrite terminus(GO:0044292) |
0.2 | 1.8 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
0.2 | 0.9 | GO:0072487 | MSL complex(GO:0072487) |
0.2 | 1.8 | GO:0001650 | fibrillar center(GO:0001650) |
0.2 | 1.1 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.2 | 1.8 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
0.2 | 0.7 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.2 | 1.5 | GO:0098563 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
0.2 | 1.1 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
0.2 | 5.6 | GO:0035861 | site of double-strand break(GO:0035861) |
0.2 | 0.6 | GO:1990393 | 3M complex(GO:1990393) |
0.2 | 0.8 | GO:0070876 | SOSS complex(GO:0070876) |
0.2 | 0.6 | GO:0035355 | Toll-like receptor 2-Toll-like receptor 6 protein complex(GO:0035355) |
0.2 | 4.2 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
0.2 | 2.9 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) |
0.2 | 2.3 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
0.2 | 0.8 | GO:0005955 | calcineurin complex(GO:0005955) |
0.2 | 0.2 | GO:0031231 | intrinsic component of peroxisomal membrane(GO:0031231) |
0.2 | 0.6 | GO:0036396 | MIS complex(GO:0036396) |
0.2 | 1.4 | GO:0005916 | fascia adherens(GO:0005916) |
0.2 | 1.4 | GO:0031931 | TORC1 complex(GO:0031931) |
0.2 | 1.0 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
0.2 | 0.6 | GO:0000802 | transverse filament(GO:0000802) |
0.2 | 0.6 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.2 | 2.4 | GO:0044453 | nuclear membrane part(GO:0044453) |
0.2 | 0.2 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
0.2 | 3.3 | GO:0031305 | integral component of mitochondrial inner membrane(GO:0031305) |
0.2 | 0.6 | GO:0071953 | elastic fiber(GO:0071953) |
0.2 | 1.0 | GO:0097433 | dense body(GO:0097433) |
0.2 | 0.4 | GO:0031968 | outer membrane(GO:0019867) organelle outer membrane(GO:0031968) |
0.2 | 0.8 | GO:0031262 | Ndc80 complex(GO:0031262) |
0.2 | 1.5 | GO:0000124 | SAGA complex(GO:0000124) |
0.2 | 2.1 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
0.2 | 1.0 | GO:0005927 | muscle tendon junction(GO:0005927) |
0.2 | 1.7 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
0.2 | 1.3 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
0.2 | 0.8 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
0.2 | 0.2 | GO:0005845 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.2 | 3.6 | GO:0045120 | pronucleus(GO:0045120) |
0.2 | 1.5 | GO:0030139 | endocytic vesicle(GO:0030139) |
0.2 | 1.8 | GO:0032039 | integrator complex(GO:0032039) |
0.2 | 0.7 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.2 | 0.5 | GO:0043259 | laminin-10 complex(GO:0043259) |
0.2 | 0.5 | GO:0097255 | R2TP complex(GO:0097255) |
0.2 | 1.6 | GO:0005869 | dynactin complex(GO:0005869) |
0.2 | 0.5 | GO:1990130 | Iml1 complex(GO:1990130) |
0.2 | 0.5 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
0.2 | 1.4 | GO:0016600 | flotillin complex(GO:0016600) |
0.2 | 0.5 | GO:0071797 | LUBAC complex(GO:0071797) |
0.2 | 1.1 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
0.2 | 0.4 | GO:0030893 | meiotic cohesin complex(GO:0030893) |
0.2 | 0.5 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.2 | 2.1 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.2 | 1.7 | GO:0031528 | microvillus membrane(GO:0031528) |
0.2 | 3.6 | GO:0008305 | integrin complex(GO:0008305) |
0.2 | 1.9 | GO:0042555 | MCM complex(GO:0042555) |
0.2 | 2.6 | GO:0043218 | compact myelin(GO:0043218) |
0.2 | 0.5 | GO:0044295 | axonal growth cone(GO:0044295) |
0.2 | 0.7 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
0.2 | 0.5 | GO:0071817 | MMXD complex(GO:0071817) |
0.2 | 0.5 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
0.2 | 0.5 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.2 | 1.8 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
0.2 | 1.1 | GO:0000788 | nuclear nucleosome(GO:0000788) |
0.2 | 1.1 | GO:0045179 | apical cortex(GO:0045179) |
0.2 | 1.3 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
0.2 | 0.8 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
0.2 | 0.6 | GO:0044299 | C-fiber(GO:0044299) |
0.2 | 1.1 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.2 | 0.2 | GO:0000125 | PCAF complex(GO:0000125) |
0.2 | 1.7 | GO:0045239 | tricarboxylic acid cycle enzyme complex(GO:0045239) |
0.2 | 2.8 | GO:0000242 | pericentriolar material(GO:0000242) |
0.2 | 0.6 | GO:1990131 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.2 | 0.6 | GO:0000243 | commitment complex(GO:0000243) |
0.2 | 4.2 | GO:0055038 | recycling endosome membrane(GO:0055038) |
0.2 | 0.5 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.2 | 0.2 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
0.2 | 1.1 | GO:0030054 | cell junction(GO:0030054) |
0.2 | 0.2 | GO:0031094 | platelet dense tubular network(GO:0031094) |
0.2 | 0.3 | GO:0030130 | clathrin coat of trans-Golgi network vesicle(GO:0030130) |
0.1 | 1.2 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.1 | 0.7 | GO:0046930 | pore complex(GO:0046930) |
0.1 | 0.7 | GO:0097422 | tubular endosome(GO:0097422) |
0.1 | 0.4 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
0.1 | 2.2 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.1 | 2.0 | GO:0071565 | nBAF complex(GO:0071565) |
0.1 | 2.9 | GO:0015030 | Cajal body(GO:0015030) |
0.1 | 5.7 | GO:0030864 | cortical actin cytoskeleton(GO:0030864) |
0.1 | 0.4 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.1 | 3.0 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.1 | 1.4 | GO:0032797 | SMN complex(GO:0032797) |
0.1 | 0.6 | GO:0042825 | TAP complex(GO:0042825) |
0.1 | 1.4 | GO:0001527 | microfibril(GO:0001527) |
0.1 | 0.1 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.1 | 5.3 | GO:0045171 | intercellular bridge(GO:0045171) |
0.1 | 0.4 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
0.1 | 1.2 | GO:0060077 | inhibitory synapse(GO:0060077) |
0.1 | 0.3 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.1 | 0.3 | GO:0070552 | BRISC complex(GO:0070552) |
0.1 | 0.3 | GO:0090533 | cation-transporting ATPase complex(GO:0090533) |
0.1 | 2.4 | GO:0030057 | desmosome(GO:0030057) |
0.1 | 1.2 | GO:0072546 | ER membrane protein complex(GO:0072546) |
0.1 | 2.8 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.1 | 4.4 | GO:0016592 | mediator complex(GO:0016592) |
0.1 | 0.8 | GO:0042582 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
0.1 | 0.5 | GO:0005688 | U6 snRNP(GO:0005688) |
0.1 | 0.8 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.1 | 0.4 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.1 | 0.4 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.1 | 37.4 | GO:0005667 | transcription factor complex(GO:0005667) |
0.1 | 0.6 | GO:0031415 | NatA complex(GO:0031415) |
0.1 | 0.3 | GO:0044393 | microspike(GO:0044393) |
0.1 | 0.3 | GO:0070531 | BRCA1-A complex(GO:0070531) |
0.1 | 0.1 | GO:0044294 | dendritic growth cone(GO:0044294) |
0.1 | 2.6 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.1 | 0.3 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
0.1 | 0.3 | GO:0097413 | Lewy body(GO:0097413) |
0.1 | 0.7 | GO:0016012 | sarcoglycan complex(GO:0016012) |
0.1 | 0.4 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.1 | 1.1 | GO:0033268 | node of Ranvier(GO:0033268) |
0.1 | 1.1 | GO:0042613 | MHC class II protein complex(GO:0042613) |
0.1 | 1.1 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
0.1 | 0.4 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
0.1 | 4.9 | GO:0000118 | histone deacetylase complex(GO:0000118) |
0.1 | 0.6 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.1 | 0.7 | GO:0001520 | outer dense fiber(GO:0001520) |
0.1 | 0.1 | GO:0020018 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
0.1 | 0.1 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.1 | 0.1 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
0.1 | 0.4 | GO:0044217 | other organism(GO:0044215) other organism cell(GO:0044216) other organism part(GO:0044217) |
0.1 | 11.1 | GO:0031234 | extrinsic component of cytoplasmic side of plasma membrane(GO:0031234) |
0.1 | 0.2 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.1 | 8.2 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
0.1 | 1.7 | GO:0043034 | costamere(GO:0043034) |
0.1 | 0.6 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
0.1 | 0.6 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.1 | 11.6 | GO:0043197 | dendritic spine(GO:0043197) |
0.1 | 0.3 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.1 | 2.4 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.1 | 0.2 | GO:0016460 | myosin II complex(GO:0016460) |
0.1 | 0.4 | GO:0005883 | neurofilament(GO:0005883) |
0.1 | 0.4 | GO:0048786 | presynaptic active zone(GO:0048786) |
0.1 | 0.5 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
0.1 | 1.5 | GO:0016328 | lateral plasma membrane(GO:0016328) |
0.1 | 0.2 | GO:0033263 | CORVET complex(GO:0033263) |
0.1 | 1.5 | GO:0002102 | podosome(GO:0002102) |
0.1 | 0.3 | GO:0043511 | inhibin complex(GO:0043511) |
0.1 | 0.2 | GO:0035838 | growing cell tip(GO:0035838) |
0.1 | 2.5 | GO:0032040 | small-subunit processome(GO:0032040) |
0.1 | 0.9 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.1 | 0.3 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
0.1 | 2.2 | GO:0022624 | proteasome accessory complex(GO:0022624) |
0.1 | 4.5 | GO:0034707 | chloride channel complex(GO:0034707) |
0.1 | 2.4 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
0.1 | 0.8 | GO:0032300 | mismatch repair complex(GO:0032300) |
0.1 | 3.1 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
0.1 | 1.6 | GO:0009898 | cytoplasmic side of plasma membrane(GO:0009898) |
0.1 | 0.3 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.1 | 0.2 | GO:0097427 | microtubule bundle(GO:0097427) |
0.1 | 0.6 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.1 | 0.5 | GO:0032592 | integral component of mitochondrial membrane(GO:0032592) |
0.1 | 0.7 | GO:0097539 | ciliary transition fiber(GO:0097539) |
0.1 | 1.5 | GO:0031902 | late endosome membrane(GO:0031902) |
0.1 | 2.1 | GO:0044291 | cell-cell contact zone(GO:0044291) |
0.1 | 0.6 | GO:0098642 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
0.1 | 2.0 | GO:0044298 | cell body membrane(GO:0044298) |
0.1 | 11.6 | GO:0060076 | excitatory synapse(GO:0060076) |
0.1 | 1.8 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
0.1 | 7.9 | GO:0072562 | blood microparticle(GO:0072562) |
0.1 | 0.3 | GO:0043194 | axon initial segment(GO:0043194) |
0.1 | 0.2 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.1 | 0.6 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.1 | 0.2 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.1 | 0.4 | GO:0045202 | synapse(GO:0045202) |
0.1 | 0.7 | GO:0030315 | T-tubule(GO:0030315) |
0.1 | 0.3 | GO:0043296 | apical junction complex(GO:0043296) |
0.1 | 0.9 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
0.1 | 1.2 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
0.1 | 4.1 | GO:0016605 | PML body(GO:0016605) |
0.1 | 0.4 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
0.1 | 3.1 | GO:0005844 | polysome(GO:0005844) |
0.1 | 0.8 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
0.1 | 0.7 | GO:0070652 | HAUS complex(GO:0070652) |
0.1 | 0.8 | GO:0031083 | BLOC-1 complex(GO:0031083) |
0.1 | 0.3 | GO:0071556 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) |
0.1 | 1.3 | GO:0005771 | multivesicular body(GO:0005771) |
0.1 | 0.8 | GO:0097431 | mitotic spindle pole(GO:0097431) |
0.1 | 0.2 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
0.1 | 2.9 | GO:0005905 | clathrin-coated pit(GO:0005905) |
0.1 | 0.2 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.1 | 0.5 | GO:0034464 | BBSome(GO:0034464) |
0.1 | 0.7 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
0.1 | 1.6 | GO:0005922 | connexon complex(GO:0005922) |
0.1 | 0.3 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
0.1 | 0.1 | GO:0010369 | chromocenter(GO:0010369) |
0.1 | 0.6 | GO:0009925 | basal plasma membrane(GO:0009925) |
0.1 | 2.7 | GO:0005776 | autophagosome(GO:0005776) |
0.1 | 2.6 | GO:0032587 | ruffle membrane(GO:0032587) |
0.1 | 1.0 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.1 | 0.6 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
0.1 | 15.2 | GO:0016324 | apical plasma membrane(GO:0016324) |
0.1 | 15.1 | GO:0009897 | external side of plasma membrane(GO:0009897) |
0.1 | 0.6 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.1 | 0.2 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.1 | 0.5 | GO:0032420 | stereocilium(GO:0032420) |
0.1 | 0.4 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
0.1 | 0.4 | GO:0033503 | HULC complex(GO:0033503) |
0.1 | 2.3 | GO:0005811 | lipid particle(GO:0005811) |
0.1 | 0.5 | GO:0000792 | heterochromatin(GO:0000792) |
0.1 | 0.1 | GO:0042575 | DNA polymerase complex(GO:0042575) |
0.1 | 0.8 | GO:0042588 | zymogen granule(GO:0042588) |
0.1 | 1.0 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
0.1 | 0.1 | GO:0031304 | intrinsic component of mitochondrial inner membrane(GO:0031304) |
0.1 | 3.4 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.1 | 0.1 | GO:0097342 | ripoptosome(GO:0097342) |
0.1 | 0.4 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.1 | 2.1 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
0.1 | 0.1 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
0.1 | 0.6 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
0.1 | 4.8 | GO:0016323 | basolateral plasma membrane(GO:0016323) |
0.1 | 0.1 | GO:1990635 | proximal dendrite(GO:1990635) |
0.1 | 0.9 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.1 | 0.6 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
0.1 | 0.9 | GO:0000502 | proteasome complex(GO:0000502) |
0.1 | 3.0 | GO:0031228 | intrinsic component of Golgi membrane(GO:0031228) |
0.1 | 0.3 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.1 | 0.6 | GO:0051233 | spindle midzone(GO:0051233) |
0.1 | 0.3 | GO:0031983 | vesicle lumen(GO:0031983) |
0.1 | 0.8 | GO:0030863 | cortical cytoskeleton(GO:0030863) |
0.1 | 2.5 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
0.1 | 0.5 | GO:0031209 | SCAR complex(GO:0031209) |
0.1 | 4.4 | GO:0031227 | intrinsic component of endoplasmic reticulum membrane(GO:0031227) |
0.1 | 4.2 | GO:0005777 | peroxisome(GO:0005777) microbody(GO:0042579) |
0.1 | 0.4 | GO:0032426 | stereocilium tip(GO:0032426) |
0.1 | 0.3 | GO:0005859 | muscle myosin complex(GO:0005859) |
0.1 | 0.2 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
0.1 | 1.1 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
0.1 | 0.1 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
0.1 | 0.5 | GO:0098827 | endoplasmic reticulum subcompartment(GO:0098827) |
0.1 | 1.4 | GO:0000795 | synaptonemal complex(GO:0000795) |
0.1 | 0.6 | GO:0060170 | ciliary membrane(GO:0060170) |
0.1 | 1.3 | GO:0045335 | phagocytic vesicle(GO:0045335) |
0.1 | 0.3 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.1 | 2.3 | GO:0043209 | myelin sheath(GO:0043209) |
0.1 | 0.1 | GO:0002142 | stereocilia ankle link complex(GO:0002142) |
0.1 | 0.8 | GO:0005903 | brush border(GO:0005903) |
0.1 | 1.9 | GO:0055037 | recycling endosome(GO:0055037) |
0.1 | 0.1 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
0.1 | 2.3 | GO:0098852 | lysosomal membrane(GO:0005765) lytic vacuole membrane(GO:0098852) |
0.1 | 0.6 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
0.1 | 0.2 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.1 | 0.3 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.1 | 2.2 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.1 | 0.2 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
0.1 | 0.4 | GO:0045178 | basal part of cell(GO:0045178) |
0.1 | 0.2 | GO:0031084 | BLOC-2 complex(GO:0031084) |
0.1 | 0.2 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.1 | 1.5 | GO:0005778 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
0.1 | 0.9 | GO:0030667 | secretory granule membrane(GO:0030667) |
0.1 | 0.4 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.1 | 0.5 | GO:0001673 | male germ cell nucleus(GO:0001673) |
0.0 | 0.1 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.0 | 0.2 | GO:0071547 | piP-body(GO:0071547) |
0.0 | 0.2 | GO:0044666 | MLL3/4 complex(GO:0044666) |
0.0 | 0.1 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
0.0 | 0.1 | GO:0043203 | axon hillock(GO:0043203) |
0.0 | 0.2 | GO:0043198 | dendritic shaft(GO:0043198) |
0.0 | 1.1 | GO:0005770 | late endosome(GO:0005770) |
0.0 | 0.1 | GO:0071437 | invadopodium(GO:0071437) |
0.0 | 2.0 | GO:0034705 | potassium channel complex(GO:0034705) |
0.0 | 1.6 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
0.0 | 0.1 | GO:0032433 | filopodium tip(GO:0032433) |
0.0 | 0.4 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
0.0 | 0.4 | GO:0036156 | inner dynein arm(GO:0036156) |
0.0 | 0.8 | GO:0031941 | filamentous actin(GO:0031941) |
0.0 | 0.2 | GO:0031143 | pseudopodium(GO:0031143) |
0.0 | 0.9 | GO:0097014 | axoneme(GO:0005930) ciliary plasm(GO:0097014) |
0.0 | 0.1 | GO:0030312 | external encapsulating structure(GO:0030312) |
0.0 | 0.6 | GO:0045177 | apical part of cell(GO:0045177) |
0.0 | 2.5 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
0.0 | 0.1 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
0.0 | 5.9 | GO:0030141 | secretory granule(GO:0030141) |
0.0 | 0.6 | GO:0016459 | myosin complex(GO:0016459) |
0.0 | 0.0 | GO:0000152 | nuclear ubiquitin ligase complex(GO:0000152) |
0.0 | 0.4 | GO:0097610 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
0.0 | 1.6 | GO:0016363 | nuclear matrix(GO:0016363) |
0.0 | 0.0 | GO:0030425 | dendrite(GO:0030425) |
0.0 | 0.9 | GO:0031201 | SNARE complex(GO:0031201) |
0.0 | 0.0 | GO:0030125 | clathrin vesicle coat(GO:0030125) |
0.0 | 29.9 | GO:0031226 | intrinsic component of plasma membrane(GO:0031226) |
0.0 | 0.1 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.0 | 0.2 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.0 | 0.3 | GO:0005732 | small nucleolar ribonucleoprotein complex(GO:0005732) |
0.0 | 0.2 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
0.0 | 0.2 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.0 | 0.2 | GO:0034709 | methylosome(GO:0034709) |
0.0 | 0.0 | GO:0042383 | sarcolemma(GO:0042383) |
0.0 | 0.2 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.0 | 38.3 | GO:0005654 | nucleoplasm(GO:0005654) |
0.0 | 1.4 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
0.0 | 3.5 | GO:0045111 | intermediate filament cytoskeleton(GO:0045111) |
0.0 | 1.4 | GO:0005923 | bicellular tight junction(GO:0005923) |
0.0 | 0.3 | GO:0036038 | MKS complex(GO:0036038) |
0.0 | 0.0 | GO:0005818 | aster(GO:0005818) |
0.0 | 0.2 | GO:0034385 | very-low-density lipoprotein particle(GO:0034361) triglyceride-rich lipoprotein particle(GO:0034385) |
0.0 | 4.2 | GO:0009986 | cell surface(GO:0009986) |
0.0 | 0.6 | GO:0005791 | rough endoplasmic reticulum(GO:0005791) |
0.0 | 0.0 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
0.0 | 0.2 | GO:0030175 | filopodium(GO:0030175) |
0.0 | 27.6 | GO:0005739 | mitochondrion(GO:0005739) |
0.0 | 0.1 | GO:0072557 | IPAF inflammasome complex(GO:0072557) |
0.0 | 0.1 | GO:0046581 | intercellular canaliculus(GO:0046581) |
0.0 | 0.0 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
0.0 | 0.2 | GO:0000783 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
0.0 | 0.1 | GO:0031252 | cell leading edge(GO:0031252) |
0.0 | 0.0 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.0 | 1.0 | GO:0072372 | primary cilium(GO:0072372) |
0.0 | 24.1 | GO:1903561 | extracellular vesicle(GO:1903561) |
0.0 | 0.0 | GO:0090665 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
0.0 | 0.0 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
0.0 | 0.1 | GO:0031430 | M band(GO:0031430) |
0.0 | 0.0 | GO:0042629 | mast cell granule(GO:0042629) |
0.0 | 0.0 | GO:0072534 | perineuronal net(GO:0072534) |
0.0 | 0.0 | GO:0031300 | intrinsic component of organelle membrane(GO:0031300) integral component of organelle membrane(GO:0031301) |
0.0 | 0.3 | GO:0005798 | Golgi-associated vesicle(GO:0005798) |
0.0 | 0.3 | GO:0043195 | terminal bouton(GO:0043195) |
0.0 | 0.0 | GO:0070852 | cell body fiber(GO:0070852) |
0.0 | 15.6 | GO:0005576 | extracellular region(GO:0005576) |
0.0 | 0.0 | GO:1990923 | PET complex(GO:1990923) |
0.0 | 1.3 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
0.0 | 0.1 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.0 | 0.0 | GO:0005921 | gap junction(GO:0005921) |
0.0 | 23.8 | GO:0016020 | membrane(GO:0016020) |
0.0 | 49.0 | GO:0005622 | intracellular(GO:0005622) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.3 | 5.2 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
1.2 | 6.2 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
1.1 | 3.3 | GO:0061513 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
1.0 | 8.4 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
1.0 | 3.0 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
1.0 | 2.9 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.9 | 2.8 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
0.9 | 3.6 | GO:0047105 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
0.9 | 2.6 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
0.8 | 2.5 | GO:0015182 | L-asparagine transmembrane transporter activity(GO:0015182) L-glutamine transmembrane transporter activity(GO:0015186) |
0.8 | 2.4 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.8 | 3.1 | GO:0019237 | centromeric DNA binding(GO:0019237) |
0.8 | 5.5 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
0.8 | 2.3 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
0.7 | 2.2 | GO:0004104 | cholinesterase activity(GO:0004104) |
0.7 | 2.2 | GO:0019961 | interferon binding(GO:0019961) |
0.7 | 2.1 | GO:0016823 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
0.7 | 1.4 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
0.7 | 2.1 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.7 | 4.2 | GO:0001727 | lipid kinase activity(GO:0001727) |
0.7 | 2.7 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.7 | 3.4 | GO:0030375 | thyroid hormone receptor coactivator activity(GO:0030375) |
0.7 | 3.4 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
0.7 | 2.0 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
0.7 | 3.3 | GO:0030151 | molybdenum ion binding(GO:0030151) |
0.7 | 0.7 | GO:0043849 | Ras palmitoyltransferase activity(GO:0043849) |
0.6 | 1.9 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.6 | 1.9 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
0.6 | 1.2 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
0.6 | 4.1 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.6 | 2.9 | GO:0047391 | alkylglycerophosphoethanolamine phosphodiesterase activity(GO:0047391) |
0.6 | 1.7 | GO:0042895 | antibiotic transporter activity(GO:0042895) |
0.6 | 2.3 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
0.6 | 2.9 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
0.6 | 0.6 | GO:0030291 | protein serine/threonine kinase inhibitor activity(GO:0030291) |
0.6 | 4.0 | GO:0019957 | C-C chemokine binding(GO:0019957) |
0.6 | 4.0 | GO:0008494 | translation activator activity(GO:0008494) |
0.6 | 3.4 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.6 | 1.7 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) |
0.6 | 1.7 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
0.5 | 3.3 | GO:0070891 | lipoteichoic acid binding(GO:0070891) |
0.5 | 0.5 | GO:0043546 | molybdopterin cofactor binding(GO:0043546) |
0.5 | 1.1 | GO:0016406 | carnitine O-acyltransferase activity(GO:0016406) |
0.5 | 1.6 | GO:1990188 | euchromatin binding(GO:1990188) |
0.5 | 3.2 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
0.5 | 8.9 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
0.5 | 1.6 | GO:0001032 | RNA polymerase III type 1 promoter DNA binding(GO:0001030) RNA polymerase III type 2 promoter DNA binding(GO:0001031) RNA polymerase III type 3 promoter DNA binding(GO:0001032) 5S rDNA binding(GO:0080084) |
0.5 | 2.0 | GO:0030984 | kininogen binding(GO:0030984) |
0.5 | 2.0 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.5 | 2.0 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.5 | 2.0 | GO:0008808 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) |
0.5 | 1.5 | GO:0015143 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
0.5 | 1.5 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
0.5 | 0.5 | GO:0051425 | PTB domain binding(GO:0051425) |
0.5 | 1.5 | GO:1990460 | leptin receptor binding(GO:1990460) |
0.5 | 1.5 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
0.5 | 3.4 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
0.5 | 2.4 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
0.5 | 0.5 | GO:0050815 | phosphoserine binding(GO:0050815) |
0.5 | 0.9 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
0.5 | 0.9 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
0.5 | 1.4 | GO:1990715 | mRNA CDS binding(GO:1990715) |
0.4 | 0.9 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
0.4 | 1.3 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
0.4 | 1.3 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
0.4 | 1.3 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
0.4 | 3.9 | GO:0001013 | RNA polymerase I regulatory region DNA binding(GO:0001013) |
0.4 | 1.7 | GO:0015232 | heme transporter activity(GO:0015232) |
0.4 | 0.8 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
0.4 | 2.5 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
0.4 | 2.1 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
0.4 | 1.2 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
0.4 | 1.2 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.4 | 2.0 | GO:0070051 | fibrinogen binding(GO:0070051) |
0.4 | 1.2 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.4 | 4.8 | GO:0051400 | BH domain binding(GO:0051400) |
0.4 | 1.6 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
0.4 | 1.2 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.4 | 1.2 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
0.4 | 1.2 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
0.4 | 1.2 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
0.4 | 3.2 | GO:0004779 | sulfate adenylyltransferase activity(GO:0004779) |
0.4 | 2.4 | GO:0003918 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.4 | 1.6 | GO:0010858 | calcium-dependent protein kinase regulator activity(GO:0010858) |
0.4 | 3.9 | GO:0070410 | co-SMAD binding(GO:0070410) |
0.4 | 1.2 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
0.4 | 4.3 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.4 | 1.2 | GO:0050693 | LBD domain binding(GO:0050693) |
0.4 | 1.5 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
0.4 | 1.9 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
0.4 | 1.1 | GO:0030519 | snoRNP binding(GO:0030519) |
0.4 | 1.5 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.4 | 1.1 | GO:0046979 | TAP1 binding(GO:0046978) TAP2 binding(GO:0046979) |
0.4 | 1.9 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
0.4 | 2.2 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) |
0.4 | 1.5 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.4 | 4.8 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.4 | 1.1 | GO:0004461 | lactose synthase activity(GO:0004461) |
0.4 | 3.7 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
0.4 | 1.5 | GO:0008934 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
0.4 | 0.7 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
0.4 | 0.7 | GO:0004065 | arylsulfatase activity(GO:0004065) |
0.4 | 2.9 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
0.4 | 1.5 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.4 | 1.1 | GO:0071209 | U7 snRNA binding(GO:0071209) |
0.4 | 1.1 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
0.4 | 1.1 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
0.4 | 1.4 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
0.4 | 2.1 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
0.4 | 1.1 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.4 | 1.1 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
0.4 | 1.1 | GO:0045340 | mercury ion binding(GO:0045340) |
0.4 | 2.5 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
0.4 | 0.7 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.3 | 0.7 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.3 | 0.7 | GO:0004376 | glycolipid mannosyltransferase activity(GO:0004376) |
0.3 | 2.7 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
0.3 | 1.7 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.3 | 2.7 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.3 | 1.0 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
0.3 | 1.7 | GO:0003933 | GTP cyclohydrolase activity(GO:0003933) |
0.3 | 0.3 | GO:0030235 | nitric-oxide synthase regulator activity(GO:0030235) |
0.3 | 1.3 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.3 | 1.0 | GO:0046404 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) |
0.3 | 1.0 | GO:0032557 | pyrimidine ribonucleotide binding(GO:0032557) |
0.3 | 0.6 | GO:0004772 | sterol O-acyltransferase activity(GO:0004772) |
0.3 | 1.6 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
0.3 | 0.3 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
0.3 | 3.5 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.3 | 1.3 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.3 | 1.3 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
0.3 | 1.9 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.3 | 0.9 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
0.3 | 2.8 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
0.3 | 0.3 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
0.3 | 0.3 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.3 | 1.9 | GO:0008297 | single-stranded DNA exodeoxyribonuclease activity(GO:0008297) |
0.3 | 0.9 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
0.3 | 0.9 | GO:0019770 | IgG receptor activity(GO:0019770) |
0.3 | 0.9 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
0.3 | 0.9 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
0.3 | 0.3 | GO:0004676 | 3-phosphoinositide-dependent protein kinase activity(GO:0004676) |
0.3 | 3.3 | GO:0034185 | apolipoprotein binding(GO:0034185) |
0.3 | 1.5 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) |
0.3 | 0.3 | GO:0019158 | fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
0.3 | 1.5 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
0.3 | 1.2 | GO:0004308 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
0.3 | 5.6 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.3 | 0.9 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
0.3 | 1.2 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.3 | 1.2 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
0.3 | 6.9 | GO:0016769 | transferase activity, transferring nitrogenous groups(GO:0016769) |
0.3 | 0.9 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
0.3 | 1.4 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
0.3 | 0.6 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
0.3 | 2.8 | GO:0044548 | S100 protein binding(GO:0044548) |
0.3 | 1.7 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.3 | 0.8 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
0.3 | 0.8 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.3 | 2.0 | GO:0102337 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
0.3 | 1.7 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) |
0.3 | 0.6 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.3 | 0.8 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.3 | 1.1 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
0.3 | 0.8 | GO:0004017 | adenylate kinase activity(GO:0004017) |
0.3 | 1.1 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
0.3 | 1.1 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
0.3 | 0.8 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
0.3 | 1.3 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
0.3 | 2.7 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
0.3 | 4.5 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
0.3 | 4.7 | GO:0017069 | snRNA binding(GO:0017069) |
0.3 | 1.0 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
0.3 | 0.5 | GO:0016312 | inositol bisphosphate phosphatase activity(GO:0016312) |
0.3 | 3.1 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
0.3 | 0.8 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
0.3 | 1.0 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
0.3 | 1.8 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
0.3 | 7.2 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
0.3 | 0.8 | GO:0017153 | sodium:dicarboxylate symporter activity(GO:0017153) |
0.3 | 1.0 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.3 | 1.0 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
0.3 | 1.3 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.3 | 0.5 | GO:0030274 | LIM domain binding(GO:0030274) |
0.3 | 2.3 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
0.3 | 0.8 | GO:0017116 | single-stranded DNA-dependent ATP-dependent DNA helicase activity(GO:0017116) |
0.3 | 2.0 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
0.2 | 1.5 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.2 | 4.2 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
0.2 | 2.7 | GO:0008432 | JUN kinase binding(GO:0008432) |
0.2 | 1.0 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
0.2 | 1.0 | GO:1990459 | transferrin receptor binding(GO:1990459) |
0.2 | 0.2 | GO:0046870 | cadmium ion binding(GO:0046870) |
0.2 | 1.9 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
0.2 | 1.2 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.2 | 0.2 | GO:0004583 | dolichyl-phosphate-glucose-glycolipid alpha-glucosyltransferase activity(GO:0004583) |
0.2 | 0.7 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
0.2 | 1.9 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
0.2 | 5.5 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.2 | 1.2 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
0.2 | 0.9 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.2 | 4.5 | GO:0030506 | ankyrin binding(GO:0030506) |
0.2 | 0.7 | GO:0008732 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
0.2 | 0.7 | GO:0055100 | adiponectin binding(GO:0055100) |
0.2 | 0.7 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
0.2 | 1.4 | GO:0032041 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
0.2 | 0.7 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
0.2 | 3.0 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
0.2 | 1.4 | GO:0003997 | acyl-CoA oxidase activity(GO:0003997) |
0.2 | 0.2 | GO:0019808 | polyamine binding(GO:0019808) |
0.2 | 2.1 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
0.2 | 3.0 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.2 | 2.1 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.2 | 0.7 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
0.2 | 2.5 | GO:0005542 | folic acid binding(GO:0005542) |
0.2 | 0.9 | GO:0031994 | insulin-like growth factor I binding(GO:0031994) |
0.2 | 0.7 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
0.2 | 0.2 | GO:0070538 | oleic acid binding(GO:0070538) |
0.2 | 12.3 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
0.2 | 1.3 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
0.2 | 1.3 | GO:0003680 | AT DNA binding(GO:0003680) |
0.2 | 0.7 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
0.2 | 2.6 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.2 | 0.9 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
0.2 | 0.7 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
0.2 | 1.5 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
0.2 | 1.1 | GO:0042609 | CD4 receptor binding(GO:0042609) |
0.2 | 0.6 | GO:0019103 | pyrimidine nucleotide binding(GO:0019103) |
0.2 | 0.2 | GO:0005536 | glucose binding(GO:0005536) |
0.2 | 1.5 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
0.2 | 0.4 | GO:0008192 | RNA guanylyltransferase activity(GO:0008192) |
0.2 | 3.6 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.2 | 2.7 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
0.2 | 0.2 | GO:0000009 | alpha-1,6-mannosyltransferase activity(GO:0000009) |
0.2 | 0.4 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
0.2 | 0.8 | GO:0050897 | cobalt ion binding(GO:0050897) |
0.2 | 2.1 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
0.2 | 0.4 | GO:0008271 | secondary active sulfate transmembrane transporter activity(GO:0008271) |
0.2 | 0.2 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) |
0.2 | 1.2 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
0.2 | 2.3 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
0.2 | 0.6 | GO:0035939 | microsatellite binding(GO:0035939) |
0.2 | 0.8 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
0.2 | 0.6 | GO:0033558 | protein deacetylase activity(GO:0033558) |
0.2 | 0.6 | GO:0047623 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
0.2 | 6.3 | GO:0005044 | scavenger receptor activity(GO:0005044) |
0.2 | 0.2 | GO:0045118 | azole transporter activity(GO:0045118) azole transmembrane transporter activity(GO:1901474) |
0.2 | 2.0 | GO:0015385 | sodium:proton antiporter activity(GO:0015385) potassium:proton antiporter activity(GO:0015386) |
0.2 | 0.8 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.2 | 0.6 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.2 | 2.0 | GO:0031996 | thioesterase binding(GO:0031996) |
0.2 | 0.2 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
0.2 | 0.8 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
0.2 | 0.2 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
0.2 | 4.1 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
0.2 | 0.4 | GO:0043559 | insulin binding(GO:0043559) |
0.2 | 1.2 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
0.2 | 0.8 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
0.2 | 0.6 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.2 | 0.6 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
0.2 | 3.4 | GO:0001848 | complement binding(GO:0001848) |
0.2 | 0.4 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
0.2 | 0.8 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.2 | 2.5 | GO:0004707 | MAP kinase activity(GO:0004707) |
0.2 | 0.2 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
0.2 | 1.9 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
0.2 | 0.4 | GO:0070840 | dynein complex binding(GO:0070840) |
0.2 | 1.3 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
0.2 | 1.3 | GO:0019992 | diacylglycerol binding(GO:0019992) |
0.2 | 0.6 | GO:0048406 | nerve growth factor binding(GO:0048406) |
0.2 | 2.2 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
0.2 | 0.2 | GO:0052743 | inositol tetrakisphosphate phosphatase activity(GO:0052743) |
0.2 | 2.4 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
0.2 | 0.2 | GO:0016937 | short-branched-chain-acyl-CoA dehydrogenase activity(GO:0016937) |
0.2 | 0.6 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
0.2 | 2.0 | GO:0015101 | organic cation transmembrane transporter activity(GO:0015101) |
0.2 | 0.2 | GO:0016726 | xanthine dehydrogenase activity(GO:0004854) oxidoreductase activity, acting on CH or CH2 groups, NAD or NADP as acceptor(GO:0016726) |
0.2 | 1.1 | GO:0019966 | interleukin-1 binding(GO:0019966) |
0.2 | 1.6 | GO:0070182 | DNA polymerase binding(GO:0070182) |
0.2 | 2.2 | GO:0016854 | racemase and epimerase activity(GO:0016854) |
0.2 | 3.6 | GO:0019825 | oxygen binding(GO:0019825) |
0.2 | 0.5 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
0.2 | 2.9 | GO:0030546 | receptor activator activity(GO:0030546) |
0.2 | 1.1 | GO:0017166 | vinculin binding(GO:0017166) |
0.2 | 0.9 | GO:0061134 | peptidase activator activity(GO:0016504) peptidase regulator activity(GO:0061134) |
0.2 | 1.4 | GO:0015194 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
0.2 | 0.5 | GO:0070061 | fructose binding(GO:0070061) |
0.2 | 3.7 | GO:0031369 | translation initiation factor binding(GO:0031369) |
0.2 | 0.5 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
0.2 | 2.3 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.2 | 0.7 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
0.2 | 0.5 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.2 | 0.7 | GO:0034902 | alkyl sulfatase activity(GO:0018741) endosulfan hemisulfate sulfatase activity(GO:0034889) endosulfan sulfate hydrolase activity(GO:0034902) |
0.2 | 0.9 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
0.2 | 0.9 | GO:0003988 | acetyl-CoA C-acyltransferase activity(GO:0003988) |
0.2 | 0.9 | GO:0035671 | enone reductase activity(GO:0035671) |
0.2 | 0.5 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
0.2 | 1.7 | GO:0009881 | photoreceptor activity(GO:0009881) |
0.2 | 2.0 | GO:0004622 | lysophospholipase activity(GO:0004622) |
0.2 | 0.5 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.2 | 2.4 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
0.2 | 0.3 | GO:0030492 | hemoglobin binding(GO:0030492) |
0.2 | 3.0 | GO:0031489 | myosin V binding(GO:0031489) |
0.2 | 3.2 | GO:0046875 | ephrin receptor binding(GO:0046875) |
0.2 | 0.5 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
0.2 | 0.5 | GO:0043237 | laminin-1 binding(GO:0043237) |
0.2 | 0.7 | GO:0034046 | poly(G) binding(GO:0034046) |
0.2 | 0.7 | GO:0031690 | adrenergic receptor binding(GO:0031690) |
0.2 | 1.0 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.2 | 0.2 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.2 | 0.7 | GO:0019763 | immunoglobulin receptor activity(GO:0019763) |
0.2 | 0.3 | GO:0034618 | arginine binding(GO:0034618) |
0.2 | 2.0 | GO:0015026 | coreceptor activity(GO:0015026) |
0.2 | 1.5 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.2 | 1.0 | GO:0034711 | inhibin binding(GO:0034711) |
0.2 | 0.3 | GO:0003720 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
0.2 | 0.6 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
0.2 | 0.6 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.2 | 0.2 | GO:0016721 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
0.2 | 0.8 | GO:0031419 | cobalamin binding(GO:0031419) |
0.2 | 1.1 | GO:0031432 | titin binding(GO:0031432) |
0.2 | 16.5 | GO:0017137 | Rab GTPase binding(GO:0017137) |
0.2 | 2.1 | GO:0001968 | fibronectin binding(GO:0001968) |
0.2 | 1.1 | GO:0018651 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
0.2 | 1.0 | GO:0018685 | alkane 1-monooxygenase activity(GO:0018685) |
0.2 | 0.3 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
0.2 | 0.6 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
0.2 | 2.4 | GO:0070412 | R-SMAD binding(GO:0070412) |
0.2 | 1.9 | GO:0043295 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
0.2 | 0.5 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
0.2 | 0.8 | GO:0008097 | 5S rRNA binding(GO:0008097) |
0.2 | 1.3 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.2 | 1.1 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
0.2 | 0.5 | GO:0051880 | G-quadruplex DNA binding(GO:0051880) |
0.2 | 1.5 | GO:0008061 | chitin binding(GO:0008061) |
0.2 | 1.2 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.2 | 0.2 | GO:0016751 | S-succinyltransferase activity(GO:0016751) |
0.2 | 0.6 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
0.2 | 1.5 | GO:0016918 | retinal binding(GO:0016918) |
0.2 | 0.8 | GO:0070991 | medium-chain-acyl-CoA dehydrogenase activity(GO:0070991) |
0.2 | 1.2 | GO:0016208 | AMP binding(GO:0016208) |
0.2 | 0.9 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
0.2 | 3.7 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
0.2 | 0.2 | GO:0015205 | purine nucleobase transmembrane transporter activity(GO:0005345) pyrimidine nucleobase transmembrane transporter activity(GO:0005350) nucleobase transmembrane transporter activity(GO:0015205) |
0.2 | 0.5 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
0.2 | 0.2 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
0.2 | 0.8 | GO:0046790 | virion binding(GO:0046790) |
0.1 | 0.4 | GO:0034452 | dynactin binding(GO:0034452) |
0.1 | 0.7 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.1 | 0.9 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
0.1 | 0.4 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
0.1 | 0.9 | GO:0008417 | fucosyltransferase activity(GO:0008417) |
0.1 | 0.7 | GO:0034979 | NAD-dependent protein deacetylase activity(GO:0034979) |
0.1 | 0.3 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.1 | 0.1 | GO:0004942 | anaphylatoxin receptor activity(GO:0004942) |
0.1 | 0.4 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.1 | 0.9 | GO:0050700 | CARD domain binding(GO:0050700) |
0.1 | 1.9 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
0.1 | 0.9 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
0.1 | 0.3 | GO:0036033 | mediator complex binding(GO:0036033) |
0.1 | 1.0 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.1 | 0.4 | GO:0016892 | endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
0.1 | 0.6 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.1 | 0.7 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
0.1 | 4.3 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
0.1 | 0.4 | GO:0004359 | glutaminase activity(GO:0004359) |
0.1 | 0.7 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
0.1 | 0.4 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
0.1 | 4.4 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) ubiquitin-like protein conjugating enzyme binding(GO:0044390) |
0.1 | 0.3 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
0.1 | 1.1 | GO:0052685 | 3-oxo-2-(2'-pentenyl)cyclopentane-1-octanoic acid CoA ligase activity(GO:0010435) 3-isopropenyl-6-oxoheptanoyl-CoA synthetase activity(GO:0018854) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA synthetase activity(GO:0018855) benzoyl acetate-CoA ligase activity(GO:0018856) 2,4-dichlorobenzoate-CoA ligase activity(GO:0018857) pivalate-CoA ligase activity(GO:0034783) cyclopropanecarboxylate-CoA ligase activity(GO:0034793) adipate-CoA ligase activity(GO:0034796) citronellyl-CoA ligase activity(GO:0034823) mentha-1,3-dione-CoA ligase activity(GO:0034841) thiophene-2-carboxylate-CoA ligase activity(GO:0034842) 2,4,4-trimethylpentanoate-CoA ligase activity(GO:0034865) cis-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034942) trans-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034943) branched-chain acyl-CoA synthetase (ADP-forming) activity(GO:0043759) aryl-CoA synthetase (ADP-forming) activity(GO:0043762) 3-hydroxypropionyl-CoA synthetase activity(GO:0043955) perillic acid:CoA ligase (ADP-forming) activity(GO:0052685) perillic acid:CoA ligase (AMP-forming) activity(GO:0052686) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (ADP-forming) activity(GO:0052687) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (AMP-forming) activity(GO:0052688) pristanate-CoA ligase activity(GO:0070251) malonyl-CoA synthetase activity(GO:0090409) |
0.1 | 1.0 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
0.1 | 0.3 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
0.1 | 0.7 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
0.1 | 1.7 | GO:0016594 | glycine binding(GO:0016594) |
0.1 | 0.4 | GO:0030957 | Tat protein binding(GO:0030957) |
0.1 | 0.4 | GO:0042289 | MHC class II protein binding(GO:0042289) |
0.1 | 1.0 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.1 | 0.3 | GO:0002054 | nucleobase binding(GO:0002054) purine nucleobase binding(GO:0002060) |
0.1 | 0.1 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
0.1 | 1.6 | GO:0019215 | intermediate filament binding(GO:0019215) |
0.1 | 3.3 | GO:0034594 | phosphatidylinositol trisphosphate phosphatase activity(GO:0034594) |
0.1 | 2.3 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
0.1 | 0.9 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
0.1 | 0.7 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.1 | 1.1 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
0.1 | 0.3 | GO:0090482 | vitamin transmembrane transporter activity(GO:0090482) |
0.1 | 0.7 | GO:0048156 | tau protein binding(GO:0048156) |
0.1 | 2.0 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
0.1 | 0.9 | GO:0050786 | RAGE receptor binding(GO:0050786) |
0.1 | 1.7 | GO:0016780 | phosphotransferase activity, for other substituted phosphate groups(GO:0016780) |
0.1 | 1.0 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
0.1 | 0.4 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
0.1 | 0.1 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.1 | 0.6 | GO:0070513 | death domain binding(GO:0070513) |
0.1 | 0.4 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.1 | 0.4 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.1 | 0.4 | GO:0050780 | dopamine receptor binding(GO:0050780) |
0.1 | 1.8 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
0.1 | 0.8 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.1 | 0.5 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.1 | 0.1 | GO:0016972 | thiol oxidase activity(GO:0016972) |
0.1 | 0.3 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
0.1 | 0.3 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
0.1 | 0.1 | GO:0016934 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
0.1 | 0.6 | GO:0008390 | testosterone 16-alpha-hydroxylase activity(GO:0008390) |
0.1 | 0.5 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.1 | 0.2 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
0.1 | 0.4 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
0.1 | 1.4 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
0.1 | 4.8 | GO:0000049 | tRNA binding(GO:0000049) |
0.1 | 1.4 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
0.1 | 0.2 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) |
0.1 | 0.5 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
0.1 | 1.6 | GO:0043621 | protein self-association(GO:0043621) |
0.1 | 1.0 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
0.1 | 0.4 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.1 | 2.4 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.1 | 0.8 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
0.1 | 0.5 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
0.1 | 0.4 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
0.1 | 0.5 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
0.1 | 2.6 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.1 | 0.1 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
0.1 | 0.6 | GO:0036122 | BMP binding(GO:0036122) |
0.1 | 2.2 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
0.1 | 0.4 | GO:1901612 | cardiolipin binding(GO:1901612) |
0.1 | 1.3 | GO:0001671 | ATPase activator activity(GO:0001671) |
0.1 | 1.0 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
0.1 | 0.3 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
0.1 | 0.1 | GO:0043199 | sulfate binding(GO:0043199) |
0.1 | 1.2 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
0.1 | 2.6 | GO:0030507 | spectrin binding(GO:0030507) |
0.1 | 0.1 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) |
0.1 | 0.2 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
0.1 | 2.2 | GO:0031593 | polyubiquitin binding(GO:0031593) |
0.1 | 0.8 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
0.1 | 1.1 | GO:0005522 | profilin binding(GO:0005522) |
0.1 | 0.2 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
0.1 | 15.5 | GO:0050839 | cell adhesion molecule binding(GO:0050839) |
0.1 | 1.0 | GO:0005003 | ephrin receptor activity(GO:0005003) |
0.1 | 0.6 | GO:0016894 | endodeoxyribonuclease activity, producing 3'-phosphomonoesters(GO:0016889) endonuclease activity, active with either ribo- or deoxyribonucleic acids and producing 3'-phosphomonoesters(GO:0016894) |
0.1 | 0.5 | GO:0017127 | cholesterol transporter activity(GO:0017127) |
0.1 | 0.2 | GO:0002046 | opsin binding(GO:0002046) |
0.1 | 0.2 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
0.1 | 3.7 | GO:0033613 | activating transcription factor binding(GO:0033613) |
0.1 | 0.2 | GO:0070034 | telomerase RNA binding(GO:0070034) |
0.1 | 0.3 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.1 | 0.8 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.1 | 0.6 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
0.1 | 0.6 | GO:0048256 | flap endonuclease activity(GO:0048256) |
0.1 | 0.1 | GO:0042834 | peptidoglycan binding(GO:0042834) |
0.1 | 0.4 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
0.1 | 1.0 | GO:0031386 | protein tag(GO:0031386) |
0.1 | 2.7 | GO:0051990 | (R)-2-hydroxyglutarate dehydrogenase activity(GO:0051990) |
0.1 | 0.2 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
0.1 | 0.5 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
0.1 | 0.6 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
0.1 | 0.1 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
0.1 | 1.5 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.1 | 0.3 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.1 | 0.3 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
0.1 | 0.2 | GO:0043842 | Kdo transferase activity(GO:0043842) |
0.1 | 0.1 | GO:0016415 | octanoyltransferase activity(GO:0016415) |
0.1 | 0.3 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
0.1 | 1.2 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
0.1 | 1.0 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
0.1 | 0.5 | GO:0030983 | mismatched DNA binding(GO:0030983) |
0.1 | 0.8 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.1 | 1.9 | GO:0070566 | adenylyltransferase activity(GO:0070566) |
0.1 | 0.9 | GO:0005436 | sodium:phosphate symporter activity(GO:0005436) |
0.1 | 1.3 | GO:0004190 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
0.1 | 0.6 | GO:0039706 | co-receptor binding(GO:0039706) |
0.1 | 2.6 | GO:0050699 | WW domain binding(GO:0050699) |
0.1 | 0.8 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
0.1 | 0.2 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
0.1 | 0.4 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
0.1 | 2.5 | GO:0003684 | damaged DNA binding(GO:0003684) |
0.1 | 1.1 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.1 | 0.6 | GO:0008378 | galactosyltransferase activity(GO:0008378) UDP-galactosyltransferase activity(GO:0035250) |
0.1 | 0.3 | GO:0004346 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
0.1 | 0.2 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
0.1 | 0.5 | GO:0016713 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced iron-sulfur protein as one donor, and incorporation of one atom of oxygen(GO:0016713) |
0.1 | 1.4 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
0.1 | 1.1 | GO:0032452 | histone demethylase activity(GO:0032452) |
0.1 | 0.5 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
0.1 | 0.1 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.1 | 0.3 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.1 | 0.4 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.1 | 1.3 | GO:0005243 | gap junction channel activity(GO:0005243) |
0.1 | 0.3 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
0.1 | 0.3 | GO:0046538 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
0.1 | 1.0 | GO:0031404 | chloride ion binding(GO:0031404) |
0.1 | 0.5 | GO:0004985 | opioid receptor activity(GO:0004985) |
0.1 | 0.7 | GO:0008329 | signaling pattern recognition receptor activity(GO:0008329) pattern recognition receptor activity(GO:0038187) |
0.1 | 0.3 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
0.1 | 0.3 | GO:0089720 | caspase binding(GO:0089720) |
0.1 | 0.3 | GO:0031433 | telethonin binding(GO:0031433) |
0.1 | 0.6 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.1 | 1.8 | GO:0004129 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.1 | 0.2 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
0.1 | 0.5 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.1 | 0.3 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
0.1 | 0.4 | GO:0043495 | protein anchor(GO:0043495) |
0.1 | 1.8 | GO:0005537 | mannose binding(GO:0005537) |
0.1 | 0.5 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
0.1 | 0.7 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.1 | 0.3 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
0.1 | 0.3 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
0.1 | 0.4 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
0.1 | 0.4 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
0.1 | 0.3 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
0.1 | 0.7 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
0.1 | 0.3 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
0.1 | 2.1 | GO:0019107 | myristoyltransferase activity(GO:0019107) |
0.1 | 0.7 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
0.1 | 0.5 | GO:0005223 | intracellular cGMP activated cation channel activity(GO:0005223) |
0.1 | 0.3 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
0.1 | 2.5 | GO:0035064 | methylated histone binding(GO:0035064) |
0.1 | 1.7 | GO:0004177 | aminopeptidase activity(GO:0004177) |
0.1 | 1.2 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
0.1 | 1.4 | GO:0018024 | histone-lysine N-methyltransferase activity(GO:0018024) |
0.1 | 0.3 | GO:0036310 | annealing helicase activity(GO:0036310) |
0.1 | 2.3 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
0.1 | 0.4 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.1 | 1.6 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.1 | 1.2 | GO:0005112 | Notch binding(GO:0005112) |
0.1 | 0.6 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.1 | 0.1 | GO:0023029 | MHC class Ib protein binding(GO:0023029) |
0.1 | 0.3 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
0.1 | 0.1 | GO:0019213 | deacetylase activity(GO:0019213) |
0.1 | 0.6 | GO:0042162 | telomeric DNA binding(GO:0042162) |
0.1 | 0.3 | GO:0005047 | signal recognition particle binding(GO:0005047) |
0.1 | 0.1 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.1 | 0.2 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
0.1 | 0.3 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
0.1 | 0.1 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
0.1 | 2.0 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.1 | 0.1 | GO:0086007 | voltage-gated calcium channel activity involved in cardiac muscle cell action potential(GO:0086007) voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
0.1 | 0.3 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.1 | 0.2 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
0.1 | 2.1 | GO:0000980 | RNA polymerase II distal enhancer sequence-specific DNA binding(GO:0000980) |
0.1 | 1.7 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
0.1 | 2.0 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.1 | 0.6 | GO:0031005 | filamin binding(GO:0031005) |
0.1 | 0.1 | GO:0019187 | beta-1,4-mannosyltransferase activity(GO:0019187) |
0.1 | 0.9 | GO:0016755 | transferase activity, transferring amino-acyl groups(GO:0016755) |
0.1 | 0.1 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
0.1 | 0.5 | GO:0019789 | SUMO transferase activity(GO:0019789) |
0.1 | 0.5 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
0.1 | 10.6 | GO:0005096 | GTPase activator activity(GO:0005096) |
0.1 | 0.4 | GO:0035251 | UDP-glucosyltransferase activity(GO:0035251) |
0.1 | 0.2 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.1 | 0.1 | GO:0015142 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.1 | 0.6 | GO:0004016 | adenylate cyclase activity(GO:0004016) |
0.1 | 0.7 | GO:0033170 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.1 | 0.6 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
0.1 | 0.1 | GO:0000700 | mismatch base pair DNA N-glycosylase activity(GO:0000700) purine-specific mismatch base pair DNA N-glycosylase activity(GO:0000701) single-strand selective uracil DNA N-glycosylase activity(GO:0017065) nicotinamide riboside hydrolase activity(GO:0070635) nicotinic acid riboside hydrolase activity(GO:0070636) deoxyribonucleoside 5'-monophosphate N-glycosidase activity(GO:0070694) |
0.1 | 0.1 | GO:0070324 | thyroid hormone binding(GO:0070324) |
0.1 | 1.5 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
0.1 | 1.8 | GO:0052770 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
0.1 | 0.5 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
0.1 | 0.4 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
0.1 | 0.6 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.1 | 0.3 | GO:0016936 | galactoside binding(GO:0016936) |
0.1 | 0.3 | GO:0003884 | D-amino-acid oxidase activity(GO:0003884) |
0.1 | 0.3 | GO:0000099 | sulfur amino acid transmembrane transporter activity(GO:0000099) |
0.1 | 0.7 | GO:0015106 | bicarbonate transmembrane transporter activity(GO:0015106) |
0.1 | 0.7 | GO:0008242 | omega peptidase activity(GO:0008242) |
0.1 | 0.7 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
0.1 | 1.4 | GO:0015485 | cholesterol binding(GO:0015485) |
0.1 | 0.2 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.1 | 0.1 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
0.1 | 0.2 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
0.1 | 0.1 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
0.1 | 0.3 | GO:0016595 | glutamate binding(GO:0016595) |
0.1 | 0.3 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
0.1 | 0.2 | GO:0030021 | extracellular matrix structural constituent conferring compression resistance(GO:0030021) structural constituent of tooth enamel(GO:0030345) |
0.1 | 1.0 | GO:0051540 | iron-sulfur cluster binding(GO:0051536) metal cluster binding(GO:0051540) |
0.1 | 0.6 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
0.1 | 0.5 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
0.1 | 0.2 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
0.1 | 0.3 | GO:0008932 | lytic endotransglycosylase activity(GO:0008932) |
0.1 | 1.2 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.1 | 1.0 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.1 | 0.3 | GO:0004966 | galanin receptor activity(GO:0004966) |
0.1 | 0.1 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
0.1 | 0.1 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.1 | 0.5 | GO:0031559 | oxidosqualene cyclase activity(GO:0031559) |
0.1 | 0.7 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
0.1 | 0.2 | GO:0004558 | alpha-1,4-glucosidase activity(GO:0004558) |
0.1 | 0.7 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
0.1 | 1.0 | GO:0051018 | protein kinase A binding(GO:0051018) |
0.1 | 0.3 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.1 | 0.2 | GO:0071723 | lipopeptide binding(GO:0071723) |
0.1 | 0.1 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
0.1 | 0.1 | GO:0055102 | lipase inhibitor activity(GO:0055102) |
0.1 | 0.8 | GO:0005504 | fatty acid binding(GO:0005504) |
0.1 | 6.7 | GO:0003714 | transcription corepressor activity(GO:0003714) |
0.1 | 0.5 | GO:0022829 | wide pore channel activity(GO:0022829) |
0.1 | 0.2 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
0.1 | 0.7 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
0.1 | 0.9 | GO:0000907 | sulfonate dioxygenase activity(GO:0000907) 2,4-dichlorophenoxyacetate alpha-ketoglutarate dioxygenase activity(GO:0018602) hypophosphite dioxygenase activity(GO:0034792) gibberellin 2-beta-dioxygenase activity(GO:0045543) C-19 gibberellin 2-beta-dioxygenase activity(GO:0052634) C-20 gibberellin 2-beta-dioxygenase activity(GO:0052635) |
0.1 | 0.5 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
0.1 | 1.3 | GO:0003730 | mRNA 3'-UTR binding(GO:0003730) |
0.1 | 1.6 | GO:0005254 | chloride channel activity(GO:0005254) |
0.1 | 0.4 | GO:0042056 | chemoattractant activity(GO:0042056) |
0.1 | 0.3 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
0.1 | 0.1 | GO:0051373 | FATZ binding(GO:0051373) |
0.1 | 0.7 | GO:0045182 | translation regulator activity(GO:0045182) |
0.1 | 0.2 | GO:0004945 | angiotensin type II receptor activity(GO:0004945) |
0.1 | 3.8 | GO:0008375 | acetylglucosaminyltransferase activity(GO:0008375) |
0.1 | 0.4 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.1 | 1.9 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
0.1 | 0.9 | GO:0005031 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
0.1 | 0.2 | GO:0001595 | angiotensin receptor activity(GO:0001595) |
0.1 | 1.3 | GO:0005109 | frizzled binding(GO:0005109) |
0.1 | 0.1 | GO:0004724 | magnesium-dependent protein serine/threonine phosphatase activity(GO:0004724) |
0.1 | 0.1 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
0.1 | 0.1 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
0.1 | 0.2 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.1 | 0.2 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
0.1 | 0.8 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
0.1 | 3.6 | GO:0008022 | protein C-terminus binding(GO:0008022) |
0.1 | 0.2 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
0.1 | 1.6 | GO:0005507 | copper ion binding(GO:0005507) |
0.1 | 5.8 | GO:0001227 | transcriptional repressor activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001227) |
0.1 | 0.3 | GO:0015299 | solute:proton antiporter activity(GO:0015299) |
0.1 | 0.4 | GO:0038191 | neuropilin binding(GO:0038191) |
0.1 | 1.0 | GO:0042165 | neurotransmitter binding(GO:0042165) |
0.1 | 0.3 | GO:0070990 | snRNP binding(GO:0070990) |
0.1 | 4.7 | GO:0005179 | hormone activity(GO:0005179) |
0.1 | 0.3 | GO:0016799 | hydrolase activity, hydrolyzing N-glycosyl compounds(GO:0016799) |
0.1 | 0.2 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
0.1 | 0.1 | GO:0034596 | phosphatidylinositol phosphate 4-phosphatase activity(GO:0034596) |
0.1 | 1.7 | GO:0044824 | integrase activity(GO:0008907) T/G mismatch-specific endonuclease activity(GO:0043765) retroviral integrase activity(GO:0044823) retroviral 3' processing activity(GO:0044824) |
0.0 | 1.1 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
0.0 | 0.1 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
0.0 | 1.3 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
0.0 | 1.1 | GO:0001104 | RNA polymerase II transcription cofactor activity(GO:0001104) |
0.0 | 0.1 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
0.0 | 1.4 | GO:0005249 | voltage-gated potassium channel activity(GO:0005249) |
0.0 | 0.3 | GO:0017147 | Wnt-protein binding(GO:0017147) |
0.0 | 0.1 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
0.0 | 2.4 | GO:0000149 | SNARE binding(GO:0000149) |
0.0 | 0.0 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.0 | 4.1 | GO:0019902 | phosphatase binding(GO:0019902) |
0.0 | 2.8 | GO:0004713 | protein tyrosine kinase activity(GO:0004713) |
0.0 | 0.5 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
0.0 | 0.7 | GO:0045502 | dynein binding(GO:0045502) |
0.0 | 0.1 | GO:1990239 | steroid hormone binding(GO:1990239) |
0.0 | 0.3 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
0.0 | 0.1 | GO:0008484 | sulfuric ester hydrolase activity(GO:0008484) |
0.0 | 0.3 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
0.0 | 0.4 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.0 | 0.2 | GO:0004370 | glycerol kinase activity(GO:0004370) |
0.0 | 0.3 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
0.0 | 0.1 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
0.0 | 0.1 | GO:0004645 | phosphorylase activity(GO:0004645) |
0.0 | 0.3 | GO:0016624 | oxidoreductase activity, acting on the aldehyde or oxo group of donors, disulfide as acceptor(GO:0016624) |
0.0 | 2.7 | GO:0030165 | PDZ domain binding(GO:0030165) |
0.0 | 0.5 | GO:0005158 | insulin receptor binding(GO:0005158) |
0.0 | 1.0 | GO:0019838 | growth factor binding(GO:0019838) |
0.0 | 0.0 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.0 | 2.4 | GO:0004197 | cysteine-type endopeptidase activity(GO:0004197) |
0.0 | 0.0 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.0 | 1.1 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
0.0 | 0.3 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
0.0 | 0.3 | GO:0005521 | lamin binding(GO:0005521) |
0.0 | 0.9 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
0.0 | 2.2 | GO:0003724 | RNA helicase activity(GO:0003724) ATP-dependent RNA helicase activity(GO:0004004) RNA-dependent ATPase activity(GO:0008186) |
0.0 | 0.2 | GO:0071949 | FAD binding(GO:0071949) |
0.0 | 0.4 | GO:0070717 | poly-purine tract binding(GO:0070717) |
0.0 | 0.3 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) |
0.0 | 0.4 | GO:0044466 | 2-oxoglutaryl-CoA thioesterase activity(GO:0034843) 2,4,4-trimethyl-3-oxopentanoyl-CoA thioesterase activity(GO:0034869) 3-isopropylbut-3-enoyl-CoA thioesterase activity(GO:0034946) glutaryl-CoA hydrolase activity(GO:0044466) |
0.0 | 0.0 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) |
0.0 | 0.3 | GO:0001158 | enhancer sequence-specific DNA binding(GO:0001158) |
0.0 | 0.2 | GO:0071614 | linoleic acid epoxygenase activity(GO:0071614) |
0.0 | 0.2 | GO:0102345 | 3-hydroxy-behenoyl-CoA dehydratase activity(GO:0102344) 3-hydroxy-lignoceroyl-CoA dehydratase activity(GO:0102345) |
0.0 | 0.1 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
0.0 | 0.3 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.0 | 0.2 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
0.0 | 0.1 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
0.0 | 0.2 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
0.0 | 0.3 | GO:0032451 | demethylase activity(GO:0032451) |
0.0 | 0.9 | GO:0048306 | calcium-dependent protein binding(GO:0048306) |
0.0 | 0.8 | GO:0043022 | ribosome binding(GO:0043022) |
0.0 | 0.1 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
0.0 | 0.1 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.0 | 3.9 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
0.0 | 0.7 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
0.0 | 1.6 | GO:0044325 | ion channel binding(GO:0044325) |
0.0 | 0.1 | GO:0033265 | choline binding(GO:0033265) |
0.0 | 0.1 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.0 | 0.1 | GO:0015645 | fatty acid ligase activity(GO:0015645) |
0.0 | 0.5 | GO:0017046 | peptide hormone binding(GO:0017046) |
0.0 | 0.0 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
0.0 | 0.1 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
0.0 | 2.6 | GO:0008514 | organic anion transmembrane transporter activity(GO:0008514) |
0.0 | 0.1 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
0.0 | 4.7 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
0.0 | 0.7 | GO:0005261 | cation channel activity(GO:0005261) |
0.0 | 0.3 | GO:0004549 | tRNA-specific ribonuclease activity(GO:0004549) |
0.0 | 0.7 | GO:0019707 | protein-cysteine S-acyltransferase activity(GO:0019707) |
0.0 | 0.0 | GO:0031701 | angiotensin receptor binding(GO:0031701) |
0.0 | 4.8 | GO:0046982 | protein heterodimerization activity(GO:0046982) |
0.0 | 0.3 | GO:0097110 | scaffold protein binding(GO:0097110) |
0.0 | 0.1 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.0 | 0.2 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.0 | 0.0 | GO:0071553 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
0.0 | 0.1 | GO:0017160 | Ral GTPase binding(GO:0017160) |
0.0 | 0.1 | GO:0008199 | ferric iron binding(GO:0008199) |
0.0 | 0.4 | GO:0004029 | aldehyde dehydrogenase (NAD) activity(GO:0004029) |
0.0 | 0.1 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
0.0 | 0.0 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
0.0 | 0.4 | GO:0004623 | phospholipase A2 activity(GO:0004623) |
0.0 | 0.2 | GO:0043531 | ADP binding(GO:0043531) |
0.0 | 0.1 | GO:0001642 | group III metabotropic glutamate receptor activity(GO:0001642) |
0.0 | 0.6 | GO:0043914 | NADPH:sulfur oxidoreductase activity(GO:0043914) |
0.0 | 6.1 | GO:0005525 | GTP binding(GO:0005525) |
0.0 | 0.1 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
0.0 | 0.2 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
0.0 | 3.1 | GO:0004857 | enzyme inhibitor activity(GO:0004857) |
0.0 | 0.1 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
0.0 | 0.0 | GO:0097016 | L27 domain binding(GO:0097016) |
0.0 | 0.0 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
0.0 | 0.1 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
0.0 | 0.9 | GO:0008146 | sulfotransferase activity(GO:0008146) |
0.0 | 0.2 | GO:0003796 | lysozyme activity(GO:0003796) |
0.0 | 0.1 | GO:0034584 | piRNA binding(GO:0034584) |
0.0 | 0.0 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
0.0 | 0.3 | GO:0042923 | neuropeptide binding(GO:0042923) |
0.0 | 0.1 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.0 | 0.0 | GO:0070492 | oligosaccharide binding(GO:0070492) |
0.0 | 0.0 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
0.0 | 0.7 | GO:0008083 | growth factor activity(GO:0008083) |
0.0 | 0.0 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
0.0 | 0.8 | GO:0008527 | taste receptor activity(GO:0008527) |
0.0 | 0.0 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.0 | 0.0 | GO:0016901 | oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
0.0 | 0.5 | GO:0016811 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amides(GO:0016811) |
0.0 | 0.2 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
0.0 | 0.3 | GO:0016701 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen(GO:0016701) |
0.0 | 0.0 | GO:0023023 | MHC protein complex binding(GO:0023023) |
0.0 | 0.0 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
0.0 | 0.0 | GO:0031402 | sodium ion binding(GO:0031402) |
0.0 | 0.4 | GO:0042826 | histone deacetylase binding(GO:0042826) |
0.0 | 0.1 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
0.0 | 0.0 | GO:0004967 | glucagon receptor activity(GO:0004967) |
0.0 | 0.0 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
0.0 | 0.0 | GO:0016151 | nickel cation binding(GO:0016151) |
0.0 | 0.1 | GO:0015204 | urea transmembrane transporter activity(GO:0015204) |
0.0 | 0.1 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
0.0 | 0.1 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
0.0 | 0.1 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.0 | 0.5 | GO:0061650 | ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
0.0 | 0.1 | GO:0019976 | interleukin-2 binding(GO:0019976) |
0.0 | 0.0 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
0.0 | 0.1 | GO:0016723 | oxidoreductase activity, oxidizing metal ions, NAD or NADP as acceptor(GO:0016723) |
0.0 | 1.3 | GO:0004175 | endopeptidase activity(GO:0004175) |
0.0 | 0.1 | GO:0019865 | immunoglobulin binding(GO:0019865) |
0.0 | 0.1 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
0.0 | 0.0 | GO:1990405 | protein antigen binding(GO:1990405) |
0.0 | 0.0 | GO:0043891 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
0.0 | 0.1 | GO:0001221 | transcription cofactor binding(GO:0001221) |
0.0 | 0.1 | GO:0004448 | isocitrate dehydrogenase activity(GO:0004448) |
0.0 | 0.1 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
0.0 | 0.0 | GO:0032190 | acrosin binding(GO:0032190) |
0.0 | 0.3 | GO:0050840 | extracellular matrix binding(GO:0050840) |
0.0 | 0.2 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.0 | 0.1 | GO:0043176 | amine binding(GO:0043176) |
0.0 | 1.2 | GO:0003712 | transcription cofactor activity(GO:0003712) |
0.0 | 0.2 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
0.0 | 0.1 | GO:0016849 | phosphorus-oxygen lyase activity(GO:0016849) |
0.0 | 0.2 | GO:0017025 | TBP-class protein binding(GO:0017025) |
0.0 | 0.6 | GO:0072509 | divalent inorganic cation transmembrane transporter activity(GO:0072509) |
0.0 | 0.1 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
0.0 | 0.1 | GO:0035240 | dopamine binding(GO:0035240) |
0.0 | 2.0 | GO:0005125 | cytokine activity(GO:0005125) |
0.0 | 0.2 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.0 | 3.2 | GO:0005509 | calcium ion binding(GO:0005509) |
0.0 | 0.0 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
0.0 | 0.2 | GO:0032947 | protein complex scaffold(GO:0032947) |
0.0 | 0.0 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
0.0 | 0.1 | GO:0051213 | dioxygenase activity(GO:0051213) |
0.0 | 0.2 | GO:0005186 | pheromone activity(GO:0005186) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.8 | 1.7 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.7 | 0.7 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
0.7 | 10.1 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.6 | 0.6 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.4 | 2.7 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
0.4 | 1.2 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.4 | 2.2 | ST STAT3 PATHWAY | STAT3 Pathway |
0.4 | 2.5 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.3 | 1.0 | PID ALK1 PATHWAY | ALK1 signaling events |
0.3 | 12.2 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
0.3 | 8.9 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.3 | 1.5 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
0.3 | 7.0 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
0.3 | 0.3 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.3 | 1.4 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
0.3 | 2.1 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
0.3 | 0.3 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
0.2 | 18.3 | PID CMYB PATHWAY | C-MYB transcription factor network |
0.2 | 8.6 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
0.2 | 5.2 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
0.2 | 11.8 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
0.2 | 2.7 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
0.2 | 0.4 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
0.2 | 3.7 | ST GA12 PATHWAY | G alpha 12 Pathway |
0.2 | 1.7 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.2 | 1.1 | PID ERBB4 PATHWAY | ErbB4 signaling events |
0.2 | 0.8 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
0.2 | 9.0 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
0.2 | 2.9 | PID ARF 3PATHWAY | Arf1 pathway |
0.2 | 2.7 | PID CD40 PATHWAY | CD40/CD40L signaling |
0.2 | 1.8 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
0.2 | 1.6 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
0.2 | 2.6 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.2 | 4.7 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
0.2 | 1.6 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.2 | 9.1 | PID NOTCH PATHWAY | Notch signaling pathway |
0.2 | 6.2 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.2 | 2.3 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.2 | 4.1 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.2 | 2.2 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.2 | 5.9 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.2 | 0.7 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
0.2 | 1.1 | PID FGF PATHWAY | FGF signaling pathway |
0.2 | 0.4 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.2 | 0.2 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.2 | 11.0 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
0.2 | 0.5 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.2 | 5.2 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
0.2 | 2.8 | PID REELIN PATHWAY | Reelin signaling pathway |
0.2 | 3.4 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
0.2 | 1.5 | PID IL3 PATHWAY | IL3-mediated signaling events |
0.2 | 14.6 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
0.2 | 0.5 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
0.2 | 1.7 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
0.2 | 2.3 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
0.2 | 0.8 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
0.2 | 1.8 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
0.2 | 3.1 | PID IL1 PATHWAY | IL1-mediated signaling events |
0.2 | 2.4 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.1 | 2.5 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.1 | 0.6 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
0.1 | 0.7 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
0.1 | 2.7 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.1 | 2.3 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
0.1 | 0.3 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
0.1 | 3.8 | PID IL12 2PATHWAY | IL12-mediated signaling events |
0.1 | 2.0 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
0.1 | 1.1 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.1 | 3.3 | PID LKB1 PATHWAY | LKB1 signaling events |
0.1 | 2.5 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
0.1 | 1.1 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
0.1 | 1.5 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
0.1 | 1.1 | PID EPHA FWDPATHWAY | EPHA forward signaling |
0.1 | 22.5 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
0.1 | 0.6 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.1 | 0.7 | PID CDC42 PATHWAY | CDC42 signaling events |
0.1 | 0.7 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.1 | 0.9 | PID IL23 PATHWAY | IL23-mediated signaling events |
0.1 | 0.2 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.1 | 3.8 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
0.1 | 0.8 | PID CONE PATHWAY | Visual signal transduction: Cones |
0.1 | 3.6 | PID FANCONI PATHWAY | Fanconi anemia pathway |
0.1 | 3.1 | PID BMP PATHWAY | BMP receptor signaling |
0.1 | 3.1 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.1 | 1.4 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
0.1 | 1.9 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
0.1 | 0.7 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
0.1 | 0.3 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
0.1 | 1.5 | PID INTEGRIN1 PATHWAY | Beta1 integrin cell surface interactions |
0.1 | 1.0 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
0.1 | 0.8 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.1 | 0.8 | PID ATM PATHWAY | ATM pathway |
0.1 | 1.8 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
0.1 | 0.2 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.1 | 1.0 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
0.1 | 0.5 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
0.1 | 0.3 | PID IL2 1PATHWAY | IL2-mediated signaling events |
0.1 | 0.2 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
0.1 | 1.9 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.1 | 0.1 | ST GA13 PATHWAY | G alpha 13 Pathway |
0.1 | 0.6 | PID PDGFRB PATHWAY | PDGFR-beta signaling pathway |
0.1 | 0.2 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
0.1 | 0.9 | PID RAS PATHWAY | Regulation of Ras family activation |
0.1 | 0.4 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
0.1 | 0.4 | PID IFNG PATHWAY | IFN-gamma pathway |
0.1 | 0.1 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.1 | 1.5 | PID PLK1 PATHWAY | PLK1 signaling events |
0.1 | 0.8 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
0.1 | 0.1 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.1 | 1.0 | PID RHOA PATHWAY | RhoA signaling pathway |
0.0 | 0.1 | PID S1P S1P2 PATHWAY | S1P2 pathway |
0.0 | 1.0 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
0.0 | 0.2 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
0.0 | 0.7 | PID P53 REGULATION PATHWAY | p53 pathway |
0.0 | 0.7 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
0.0 | 0.5 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.0 | 0.6 | PID FOXO PATHWAY | FoxO family signaling |
0.0 | 0.4 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
0.0 | 0.1 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
0.0 | 0.3 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
0.0 | 4.7 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
0.0 | 0.1 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
0.0 | 0.7 | PID RAC1 PATHWAY | RAC1 signaling pathway |
0.0 | 0.1 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
0.0 | 0.4 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
0.0 | 0.3 | PID INSULIN PATHWAY | Insulin Pathway |
0.0 | 0.3 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
0.0 | 0.4 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.0 | 3.1 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
0.0 | 0.2 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.0 | 0.1 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.0 | 0.1 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.0 | 0.1 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
0.0 | 0.1 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
0.0 | 0.2 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.1 | 2.2 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
1.1 | 1.1 | REACTOME FRS2 MEDIATED CASCADE | Genes involved in FRS2-mediated cascade |
0.9 | 1.7 | REACTOME INTEGRATION OF ENERGY METABOLISM | Genes involved in Integration of energy metabolism |
0.7 | 0.7 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
0.7 | 9.6 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.6 | 2.8 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.5 | 4.8 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.5 | 3.8 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
0.5 | 10.3 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
0.5 | 2.3 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.4 | 3.0 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.4 | 11.3 | REACTOME PIP3 ACTIVATES AKT SIGNALING | Genes involved in PIP3 activates AKT signaling |
0.4 | 8.3 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
0.4 | 1.2 | REACTOME P53 DEPENDENT G1 DNA DAMAGE RESPONSE | Genes involved in p53-Dependent G1 DNA Damage Response |
0.4 | 0.4 | REACTOME CDK MEDIATED PHOSPHORYLATION AND REMOVAL OF CDC6 | Genes involved in CDK-mediated phosphorylation and removal of Cdc6 |
0.4 | 3.5 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
0.4 | 9.6 | REACTOME INTEGRIN ALPHAIIB BETA3 SIGNALING | Genes involved in Integrin alphaIIb beta3 signaling |
0.4 | 3.0 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.4 | 1.8 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
0.4 | 1.1 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
0.4 | 3.5 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
0.3 | 4.8 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
0.3 | 5.5 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
0.3 | 2.8 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.3 | 0.3 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
0.3 | 7.5 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.3 | 3.8 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
0.3 | 0.9 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
0.3 | 4.0 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
0.3 | 1.2 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
0.3 | 3.9 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.3 | 6.2 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
0.3 | 6.5 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.3 | 0.3 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
0.3 | 7.5 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
0.3 | 4.0 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.3 | 0.8 | REACTOME G BETA GAMMA SIGNALLING THROUGH PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
0.3 | 9.9 | REACTOME INTERFERON GAMMA SIGNALING | Genes involved in Interferon gamma signaling |
0.3 | 3.6 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
0.3 | 1.1 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
0.3 | 7.5 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
0.2 | 2.0 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
0.2 | 1.0 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
0.2 | 0.2 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
0.2 | 2.1 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
0.2 | 6.2 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.2 | 1.2 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
0.2 | 6.9 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
0.2 | 0.9 | REACTOME APC CDC20 MEDIATED DEGRADATION OF NEK2A | Genes involved in APC-Cdc20 mediated degradation of Nek2A |
0.2 | 0.2 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.2 | 2.9 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
0.2 | 0.4 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
0.2 | 0.7 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
0.2 | 2.6 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
0.2 | 0.9 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
0.2 | 4.6 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.2 | 1.5 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
0.2 | 2.1 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
0.2 | 3.6 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
0.2 | 6.2 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
0.2 | 2.9 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.2 | 4.7 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
0.2 | 3.1 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
0.2 | 0.4 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
0.2 | 2.0 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.2 | 0.4 | REACTOME CTLA4 INHIBITORY SIGNALING | Genes involved in CTLA4 inhibitory signaling |
0.2 | 3.5 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
0.2 | 5.9 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
0.2 | 3.2 | REACTOME PYRUVATE METABOLISM | Genes involved in Pyruvate metabolism |
0.2 | 1.3 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
0.2 | 3.0 | REACTOME KERATAN SULFATE KERATIN METABOLISM | Genes involved in Keratan sulfate/keratin metabolism |
0.2 | 3.9 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
0.2 | 1.9 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.2 | 2.4 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
0.2 | 2.6 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
0.2 | 1.2 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
0.2 | 1.5 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.2 | 0.8 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
0.2 | 2.0 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.2 | 2.8 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
0.2 | 0.2 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
0.2 | 1.5 | REACTOME LIPOPROTEIN METABOLISM | Genes involved in Lipoprotein metabolism |
0.2 | 2.6 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
0.2 | 2.7 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
0.2 | 0.2 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
0.2 | 0.9 | REACTOME ACTIVATION OF GENES BY ATF4 | Genes involved in Activation of Genes by ATF4 |
0.2 | 3.1 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.2 | 1.2 | REACTOME OPSINS | Genes involved in Opsins |
0.2 | 0.9 | REACTOME TELOMERE MAINTENANCE | Genes involved in Telomere Maintenance |
0.1 | 0.4 | REACTOME SCFSKP2 MEDIATED DEGRADATION OF P27 P21 | Genes involved in SCF(Skp2)-mediated degradation of p27/p21 |
0.1 | 0.1 | REACTOME GASTRIN CREB SIGNALLING PATHWAY VIA PKC AND MAPK | Genes involved in Gastrin-CREB signalling pathway via PKC and MAPK |
0.1 | 2.4 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.1 | 1.5 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
0.1 | 0.4 | REACTOME P75NTR SIGNALS VIA NFKB | Genes involved in p75NTR signals via NF-kB |
0.1 | 1.4 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.1 | 2.8 | REACTOME PYRUVATE METABOLISM AND CITRIC ACID TCA CYCLE | Genes involved in Pyruvate metabolism and Citric Acid (TCA) cycle |
0.1 | 1.3 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
0.1 | 0.7 | REACTOME CYCLIN E ASSOCIATED EVENTS DURING G1 S TRANSITION | Genes involved in Cyclin E associated events during G1/S transition |
0.1 | 5.7 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
0.1 | 1.4 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.1 | 12.7 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
0.1 | 2.0 | REACTOME BOTULINUM NEUROTOXICITY | Genes involved in Botulinum neurotoxicity |
0.1 | 0.7 | REACTOME SIGNALING BY NOTCH2 | Genes involved in Signaling by NOTCH2 |
0.1 | 1.3 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.1 | 1.0 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 7ALPHA HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
0.1 | 1.2 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.1 | 0.1 | REACTOME NEGATIVE REGULATION OF FGFR SIGNALING | Genes involved in Negative regulation of FGFR signaling |
0.1 | 0.2 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
0.1 | 1.4 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.1 | 2.1 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
0.1 | 1.4 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.1 | 2.9 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
0.1 | 0.5 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
0.1 | 2.3 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.1 | 1.0 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
0.1 | 0.9 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
0.1 | 0.9 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
0.1 | 0.8 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
0.1 | 0.2 | REACTOME PRE NOTCH EXPRESSION AND PROCESSING | Genes involved in Pre-NOTCH Expression and Processing |
0.1 | 19.5 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
0.1 | 2.2 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.1 | 1.2 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
0.1 | 0.1 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF MITOTIC PROTEINS | Genes involved in APC/C:Cdc20 mediated degradation of mitotic proteins |
0.1 | 0.1 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
0.1 | 1.7 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.1 | 6.2 | REACTOME PPARA ACTIVATES GENE EXPRESSION | Genes involved in PPARA Activates Gene Expression |
0.1 | 0.8 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
0.1 | 0.7 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.1 | 3.6 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.1 | 1.3 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.1 | 3.1 | REACTOME METABOLISM OF STEROID HORMONES AND VITAMINS A AND D | Genes involved in Metabolism of steroid hormones and vitamins A and D |
0.1 | 0.1 | REACTOME CLASS I MHC MEDIATED ANTIGEN PROCESSING PRESENTATION | Genes involved in Class I MHC mediated antigen processing & presentation |
0.1 | 1.5 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.1 | 1.1 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
0.1 | 0.6 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
0.1 | 1.5 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
0.1 | 0.3 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
0.1 | 1.0 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.1 | 0.1 | REACTOME P53 INDEPENDENT G1 S DNA DAMAGE CHECKPOINT | Genes involved in p53-Independent G1/S DNA damage checkpoint |
0.1 | 0.5 | REACTOME REPAIR SYNTHESIS FOR GAP FILLING BY DNA POL IN TC NER | Genes involved in Repair synthesis for gap-filling by DNA polymerase in TC-NER |
0.1 | 7.8 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
0.1 | 1.1 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
0.1 | 2.6 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
0.1 | 2.9 | REACTOME GLYCEROPHOSPHOLIPID BIOSYNTHESIS | Genes involved in Glycerophospholipid biosynthesis |
0.1 | 2.4 | REACTOME REGULATION OF MRNA STABILITY BY PROTEINS THAT BIND AU RICH ELEMENTS | Genes involved in Regulation of mRNA Stability by Proteins that Bind AU-rich Elements |
0.1 | 0.6 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
0.1 | 0.9 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
0.1 | 0.6 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.1 | 0.7 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.1 | 0.5 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.1 | 0.4 | REACTOME RIG I MDA5 MEDIATED INDUCTION OF IFN ALPHA BETA PATHWAYS | Genes involved in RIG-I/MDA5 mediated induction of IFN-alpha/beta pathways |
0.1 | 0.4 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.1 | 3.2 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
0.1 | 0.4 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
0.1 | 0.2 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
0.1 | 0.1 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
0.1 | 0.6 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.1 | 1.3 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
0.1 | 0.1 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
0.1 | 0.3 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
0.1 | 2.6 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
0.1 | 0.7 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.1 | 0.5 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.1 | 0.9 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
0.1 | 1.5 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
0.1 | 0.5 | REACTOME ASSEMBLY OF THE PRE REPLICATIVE COMPLEX | Genes involved in Assembly of the pre-replicative complex |
0.1 | 1.6 | REACTOME TRANS GOLGI NETWORK VESICLE BUDDING | Genes involved in trans-Golgi Network Vesicle Budding |
0.1 | 3.1 | REACTOME CELL JUNCTION ORGANIZATION | Genes involved in Cell junction organization |
0.1 | 0.6 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.1 | 0.4 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
0.1 | 0.2 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
0.1 | 0.6 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
0.1 | 0.4 | REACTOME CELL SURFACE INTERACTIONS AT THE VASCULAR WALL | Genes involved in Cell surface interactions at the vascular wall |
0.1 | 0.7 | REACTOME NUCLEAR EVENTS KINASE AND TRANSCRIPTION FACTOR ACTIVATION | Genes involved in Nuclear Events (kinase and transcription factor activation) |
0.1 | 1.0 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
0.1 | 0.7 | REACTOME DOUBLE STRAND BREAK REPAIR | Genes involved in Double-Strand Break Repair |
0.1 | 0.7 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.0 | 0.1 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.0 | 0.1 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
0.0 | 1.1 | REACTOME THROMBOXANE SIGNALLING THROUGH TP RECEPTOR | Genes involved in Thromboxane signalling through TP receptor |
0.0 | 0.9 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
0.0 | 0.5 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
0.0 | 0.6 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
0.0 | 0.1 | REACTOME SIGNALING BY EGFR IN CANCER | Genes involved in Signaling by EGFR in Cancer |
0.0 | 0.6 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
0.0 | 0.6 | REACTOME INWARDLY RECTIFYING K CHANNELS | Genes involved in Inwardly rectifying K+ channels |
0.0 | 1.1 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
0.0 | 0.2 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
0.0 | 1.7 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
0.0 | 0.2 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF CAMKII | Genes involved in CREB phosphorylation through the activation of CaMKII |
0.0 | 0.2 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
0.0 | 0.6 | REACTOME TRANSPORT OF GLUCOSE AND OTHER SUGARS BILE SALTS AND ORGANIC ACIDS METAL IONS AND AMINE COMPOUNDS | Genes involved in Transport of glucose and other sugars, bile salts and organic acids, metal ions and amine compounds |
0.0 | 1.4 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
0.0 | 0.2 | REACTOME CD28 DEPENDENT PI3K AKT SIGNALING | Genes involved in CD28 dependent PI3K/Akt signaling |
0.0 | 0.2 | REACTOME UNFOLDED PROTEIN RESPONSE | Genes involved in Unfolded Protein Response |
0.0 | 0.3 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
0.0 | 2.5 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
0.0 | 1.2 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
0.0 | 0.0 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
0.0 | 0.1 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.0 | 0.5 | REACTOME REGULATION OF WATER BALANCE BY RENAL AQUAPORINS | Genes involved in Regulation of Water Balance by Renal Aquaporins |
0.0 | 0.0 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.0 | 0.2 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
0.0 | 0.4 | REACTOME GLUCAGON TYPE LIGAND RECEPTORS | Genes involved in Glucagon-type ligand receptors |
0.0 | 0.4 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
0.0 | 0.2 | REACTOME ACTIVATION OF ATR IN RESPONSE TO REPLICATION STRESS | Genes involved in Activation of ATR in response to replication stress |
0.0 | 0.1 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
0.0 | 0.0 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
0.0 | 1.5 | REACTOME G ALPHA I SIGNALLING EVENTS | Genes involved in G alpha (i) signalling events |
0.0 | 0.1 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
0.0 | 0.1 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
0.0 | 0.1 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
0.0 | 0.1 | REACTOME PHASE II CONJUGATION | Genes involved in Phase II conjugation |
0.0 | 0.0 | REACTOME GABA RECEPTOR ACTIVATION | Genes involved in GABA receptor activation |
0.0 | 0.2 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
0.0 | 0.1 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.0 | 0.0 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
0.0 | 0.1 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.0 | 0.1 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
0.0 | 0.0 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
0.0 | 0.4 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
0.0 | 0.2 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |