Gene Symbol | Gene ID | Gene Info |
---|---|---|
Klf7
|
ENSMUSG00000025959.7 | Klf7 |
Gene | Promoter | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Klf7 | chr1_64121612_64121922 | 276 | 0.917036 | 0.97 | 1.4e-03 | Click! |
Klf7 | chr1_64119248_64119399 | 2159 | 0.317292 | -0.84 | 3.6e-02 | Click! |
Klf7 | chr1_64122217_64122406 | 29 | 0.978716 | 0.70 | 1.2e-01 | Click! |
Klf7 | chr1_64119942_64120457 | 1283 | 0.467033 | -0.68 | 1.4e-01 | Click! |
Klf7 | chr1_64121296_64121466 | 101 | 0.970467 | 0.67 | 1.5e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr15_82290409_82290560 | 2.24 |
Septin3 |
septin 3 |
6054 |
0.09 |
chr19_58441609_58442090 | 2.16 |
Gfra1 |
glial cell line derived neurotrophic factor family receptor alpha 1 |
12617 |
0.22 |
chr11_80453320_80453471 | 2.10 |
Psmd11 |
proteasome (prosome, macropain) 26S subunit, non-ATPase, 11 |
2973 |
0.25 |
chr10_75043802_75043953 | 2.03 |
Rab36 |
RAB36, member RAS oncogene family |
5654 |
0.16 |
chr7_143599041_143599206 | 2.02 |
Cars |
cysteinyl-tRNA synthetase |
558 |
0.5 |
chr2_154585359_154585533 | 2.01 |
E2f1 |
E2F transcription factor 1 |
15554 |
0.09 |
chr12_110381296_110381622 | 1.75 |
Gm47195 |
predicted gene, 47195 |
56074 |
0.08 |
chr17_79069907_79070126 | 1.74 |
Qpct |
glutaminyl-peptide cyclotransferase (glutaminyl cyclase) |
6986 |
0.18 |
chr4_148040579_148040753 | 1.62 |
Mthfr |
methylenetetrahydrofolate reductase |
144 |
0.9 |
chr6_71204222_71204852 | 1.60 |
Fabp1 |
fatty acid binding protein 1, liver |
4710 |
0.14 |
chr18_63901771_63901922 | 1.58 |
Gm19076 |
predicted gene, 19076 |
2815 |
0.29 |
chr18_60738849_60739016 | 1.56 |
Ndst1 |
N-deacetylase/N-sulfotransferase (heparan glucosaminyl) 1 |
5782 |
0.16 |
chr1_136462619_136462773 | 1.51 |
Kif14 |
kinesin family member 14 |
3647 |
0.18 |
chr6_128504617_128505108 | 1.50 |
Pzp |
PZP, alpha-2-macroglobulin like |
9639 |
0.09 |
chr11_89028954_89029121 | 1.48 |
Trim25 |
tripartite motif-containing 25 |
29661 |
0.09 |
chr12_21165332_21165492 | 1.46 |
Asap2 |
ArfGAP with SH3 domain, ankyrin repeat and PH domain 2 |
53458 |
0.11 |
chr9_63696778_63696929 | 1.45 |
Smad3 |
SMAD family member 3 |
15116 |
0.21 |
chr12_26356269_26356452 | 1.41 |
4930549C15Rik |
RIKEN cDNA 4930549C15 gene |
9643 |
0.19 |
chr1_155063987_155064316 | 1.36 |
Gm29282 |
predicted gene 29282 |
6972 |
0.17 |
chr7_99141254_99141466 | 1.33 |
Uvrag |
UV radiation resistance associated gene |
219 |
0.5 |
chrX_42148063_42148502 | 1.33 |
Stag2 |
stromal antigen 2 |
1035 |
0.46 |
chr2_172862507_172862658 | 1.32 |
Gm22773 |
predicted gene, 22773 |
1759 |
0.43 |
chr17_27717560_27717711 | 1.24 |
Spdef |
SAM pointed domain containing ets transcription factor |
84 |
0.95 |
chr16_22894241_22894429 | 1.23 |
Gm30505 |
predicted gene, 30505 |
51 |
0.86 |
chr2_69406819_69407032 | 1.23 |
Dhrs9 |
dehydrogenase/reductase (SDR family) member 9 |
26480 |
0.18 |
chr5_65436325_65436532 | 1.23 |
Ugdh |
UDP-glucose dehydrogenase |
479 |
0.64 |
chr11_115374164_115374514 | 1.23 |
Hid1 |
HID1 domain containing |
6583 |
0.09 |
chr9_70243258_70243430 | 1.22 |
Myo1e |
myosin IE |
35976 |
0.17 |
chr14_69690953_69691104 | 1.22 |
Mir6950 |
microRNA 6950 |
1220 |
0.34 |
chrX_101639875_101640041 | 1.22 |
Ogt |
O-linked N-acetylglucosamine (GlcNAc) transferase (UDP-N-acetylglucosamine:polypeptide-N-acetylglucosaminyl transferase) |
102 |
0.96 |
chr12_8329328_8329485 | 1.21 |
Gm48071 |
predicted gene, 48071 |
7311 |
0.15 |
chr10_95773583_95773977 | 1.20 |
4732465J04Rik |
RIKEN cDNA 4732465J04 gene |
5137 |
0.14 |
chr14_122107964_122108127 | 1.20 |
Tm9sf2 |
transmembrane 9 superfamily member 2 |
777 |
0.42 |
chr7_19149181_19149528 | 1.19 |
Qpctl |
glutaminyl-peptide cyclotransferase-like |
63 |
0.8 |
chr19_44009387_44009582 | 1.18 |
Cyp2c23 |
cytochrome P450, family 2, subfamily c, polypeptide 23 |
19715 |
0.13 |
chr15_89378952_89379124 | 1.17 |
Odf3b |
outer dense fiber of sperm tails 3B |
35 |
0.93 |
chr13_80885021_80885448 | 1.16 |
1700023H06Rik |
RIKEN cDNA 1700023H06 gene |
290 |
0.8 |
chr11_76912840_76912991 | 1.16 |
Tmigd1 |
transmembrane and immunoglobulin domain containing 1 |
8353 |
0.17 |
chr12_21163830_21164008 | 1.15 |
Asap2 |
ArfGAP with SH3 domain, ankyrin repeat and PH domain 2 |
51965 |
0.11 |
chr11_52268525_52268676 | 1.15 |
Tcf7 |
transcription factor 7, T cell specific |
6277 |
0.14 |
chr1_172312776_172313173 | 1.15 |
Igsf8 |
immunoglobulin superfamily, member 8 |
607 |
0.57 |
chr1_39192284_39192607 | 1.15 |
Npas2 |
neuronal PAS domain protein 2 |
1286 |
0.45 |
chr1_94469901_94470056 | 1.15 |
Gm7895 |
predicted gene 7895 |
91 |
0.98 |
chr9_102934367_102934734 | 1.14 |
Ryk |
receptor-like tyrosine kinase |
35995 |
0.13 |
chrX_103812694_103812845 | 1.12 |
Slc16a2 |
solute carrier family 16 (monocarboxylic acid transporters), member 2 |
9214 |
0.15 |
chr4_139798704_139798855 | 1.11 |
Pax7 |
paired box 7 |
34228 |
0.17 |
chr4_60659551_60660018 | 1.08 |
Mup11 |
major urinary protein 11 |
46 |
0.97 |
chr5_135995288_135995476 | 1.07 |
Dtx2 |
deltex 2, E3 ubiquitin ligase |
276 |
0.85 |
chr5_30887322_30887628 | 1.07 |
Agbl5 |
ATP/GTP binding protein-like 5 |
1219 |
0.25 |
chr1_72288032_72288192 | 1.06 |
Tmem169 |
transmembrane protein 169 |
3717 |
0.15 |
chr11_40694837_40695013 | 1.06 |
Mat2b |
methionine adenosyltransferase II, beta |
62 |
0.97 |
chr13_23551584_23551775 | 1.04 |
H4c6 |
H4 clustered histone 6 |
31 |
0.89 |
chr8_34455567_34455746 | 1.03 |
Gm45349 |
predicted gene 45349 |
17339 |
0.17 |
chr17_27968464_27968627 | 1.02 |
Gm15597 |
predicted gene 15597 |
3229 |
0.16 |
chr7_127477693_127477849 | 1.01 |
Fbrs |
fibrosin |
1428 |
0.16 |
chr8_83715060_83715219 | 1.01 |
Ddx39 |
DEAD (Asp-Glu-Ala-Asp) box polypeptide 39 |
38 |
0.96 |
chr7_129759867_129760041 | 1.01 |
Gm44778 |
predicted gene 44778 |
73092 |
0.1 |
chr6_115856128_115856300 | 1.01 |
Ift122 |
intraflagellar transport 122 |
2569 |
0.15 |
chr10_127289815_127290011 | 1.00 |
Gm4189 |
predicted gene 4189 |
811 |
0.21 |
chr7_111713963_111714114 | 1.00 |
Galnt18 |
polypeptide N-acetylgalactosaminyltransferase 18 |
65939 |
0.12 |
chr13_52035828_52035996 | 0.99 |
Gm37872 |
predicted gene, 37872 |
13985 |
0.21 |
chr10_85829643_85829823 | 0.97 |
Gm19624 |
predicted gene, 19624 |
9 |
0.75 |
chr2_51149087_51149248 | 0.97 |
Rnd3 |
Rho family GTPase 3 |
56 |
0.98 |
chr4_150018652_150018804 | 0.96 |
H6pd |
hexose-6-phosphate dehydrogenase (glucose 1-dehydrogenase) |
9705 |
0.14 |
chr2_93462882_93463070 | 0.95 |
Cd82 |
CD82 antigen |
30 |
0.97 |
chr11_53763584_53763766 | 0.95 |
Mir7671 |
microRNA 7671 |
21 |
0.96 |
chr11_51584565_51584756 | 0.94 |
Phykpl |
5-phosphohydroxy-L-lysine phospholyase |
97 |
0.95 |
chr10_3630860_3631040 | 0.94 |
Iyd |
iodotyrosine deiodinase |
90662 |
0.08 |
chr13_23683913_23684244 | 0.93 |
H2bc4 |
H2B clustered histone 4 |
121 |
0.45 |
chr15_31568768_31568949 | 0.93 |
Cmbl |
carboxymethylenebutenolidase-like (Pseudomonas) |
60 |
0.96 |
chr10_84706696_84707059 | 0.93 |
Rfx4 |
regulatory factor X, 4 (influences HLA class II expression) |
49185 |
0.12 |
chr5_142438545_142438696 | 0.92 |
Ap5z1 |
adaptor-related protein complex 5, zeta 1 subunit |
25324 |
0.16 |
chr5_118291975_118292126 | 0.92 |
Gm25076 |
predicted gene, 25076 |
25601 |
0.16 |
chr14_25487266_25487546 | 0.92 |
Gm47921 |
predicted gene, 47921 |
7352 |
0.14 |
chr1_179805888_179806058 | 0.90 |
Ahctf1 |
AT hook containing transcription factor 1 |
2293 |
0.28 |
chr5_116444755_116444907 | 0.90 |
Srrm4 |
serine/arginine repetitive matrix 4 |
2013 |
0.22 |
chr19_44029158_44029319 | 0.90 |
Cyp2c23 |
cytochrome P450, family 2, subfamily c, polypeptide 23 |
30 |
0.97 |
chr11_103106497_103106684 | 0.90 |
Acbd4 |
acyl-Coenzyme A binding domain containing 4 |
386 |
0.77 |
chr3_41572242_41572428 | 0.89 |
Jade1 |
jade family PHD finger 1 |
7415 |
0.16 |
chr6_23098041_23098398 | 0.89 |
Aass |
aminoadipate-semialdehyde synthase |
29361 |
0.14 |
chrX_164419546_164419736 | 0.89 |
Piga |
phosphatidylinositol glycan anchor biosynthesis, class A |
146 |
0.95 |
chr19_38419073_38419264 | 0.89 |
Slc35g1 |
solute carrier family 35, member G1 |
23127 |
0.14 |
chr9_70245178_70245559 | 0.89 |
Myo1e |
myosin IE |
38000 |
0.16 |
chr8_106338035_106338200 | 0.89 |
Smpd3 |
sphingomyelin phosphodiesterase 3, neutral |
129 |
0.96 |
chr13_23739723_23739881 | 0.89 |
H1f2 |
H1.2 linker histone, cluster member |
994 |
0.19 |
chr12_52314917_52315090 | 0.89 |
Gm47431 |
predicted gene, 47431 |
133122 |
0.04 |
chr14_20892049_20892245 | 0.88 |
Gm6128 |
predicted pseudogene 6128 |
35726 |
0.13 |
chr2_63580816_63581021 | 0.88 |
Gm23503 |
predicted gene, 23503 |
148724 |
0.05 |
chr11_107705851_107706026 | 0.88 |
Cacng1 |
calcium channel, voltage-dependent, gamma subunit 1 |
10584 |
0.17 |
chr8_10974242_10974398 | 0.87 |
Gm44956 |
predicted gene 44956 |
3506 |
0.15 |
chr3_94310992_94311165 | 0.87 |
Them4 |
thioesterase superfamily member 4 |
942 |
0.35 |
chr17_12380036_12380406 | 0.86 |
Plg |
plasminogen |
1562 |
0.34 |
chr4_150089053_150089361 | 0.86 |
Gpr157 |
G protein-coupled receptor 157 |
1842 |
0.21 |
chrX_36807819_36808219 | 0.85 |
Gm14549 |
predicted gene 14549 |
6752 |
0.13 |
chr10_83637415_83637787 | 0.85 |
Appl2 |
adaptor protein, phosphotyrosine interaction, PH domain and leucine zipper containing 2 |
158 |
0.96 |
chr6_56918145_56918313 | 0.83 |
Nt5c3 |
5'-nucleotidase, cytosolic III |
5495 |
0.13 |
chr4_12087876_12088163 | 0.82 |
Tmem67 |
transmembrane protein 67 |
12 |
0.95 |
chr11_19924205_19924473 | 0.82 |
Spred2 |
sprouty-related EVH1 domain containing 2 |
36 |
0.99 |
chr11_109494992_109495170 | 0.82 |
Gm22378 |
predicted gene, 22378 |
4743 |
0.15 |
chr8_22565295_22565620 | 0.81 |
Vdac3 |
voltage-dependent anion channel 3 |
20664 |
0.14 |
chr7_127745684_127745868 | 0.81 |
Fbxl19 |
F-box and leucine-rich repeat protein 19 |
6 |
0.94 |
chr4_44172816_44172976 | 0.81 |
Rnf38 |
ring finger protein 38 |
4557 |
0.2 |
chr5_33658354_33658511 | 0.81 |
Tmem129 |
transmembrane protein 129 |
16 |
0.6 |
chr18_38445764_38445915 | 0.81 |
Ndfip1 |
Nedd4 family interacting protein 1 |
1874 |
0.3 |
chrY_1286536_1286701 | 0.80 |
Ddx3y |
DEAD (Asp-Glu-Ala-Asp) box polypeptide 3, Y-linked |
11 |
0.97 |
chr8_125337571_125337768 | 0.80 |
Gm16237 |
predicted gene 16237 |
110346 |
0.06 |
chr17_24889106_24889404 | 0.80 |
Spsb3 |
splA/ryanodine receptor domain and SOCS box containing 3 |
1391 |
0.19 |
chr16_14004169_14004368 | 0.79 |
Gm15806 |
predicted gene 15806 |
7448 |
0.12 |
chr12_69447355_69447525 | 0.79 |
5830428M24Rik |
RIKEN cDNA 5830428M24 gene |
19952 |
0.14 |
chr2_4586318_4586682 | 0.79 |
Gm13179 |
predicted gene 13179 |
787 |
0.66 |
chr1_151498043_151498222 | 0.79 |
Gm36527 |
predicted gene, 36527 |
1453 |
0.27 |
chr2_125625154_125625332 | 0.79 |
Cep152 |
centrosomal protein 152 |
130 |
0.97 |
chr15_98953519_98953702 | 0.78 |
Gm49450 |
predicted gene, 49450 |
59 |
0.53 |
chr11_101231048_101231233 | 0.78 |
Ezh1 |
enhancer of zeste 1 polycomb repressive complex 2 subunit |
4677 |
0.09 |
chr10_71183397_71183774 | 0.78 |
C730027H18Rik |
RIKEN cDNA C730027H18 gene |
1533 |
0.26 |
chr11_94491071_94491235 | 0.78 |
Spata20 |
spermatogenesis associated 20 |
4974 |
0.13 |
chr7_46746526_46746682 | 0.77 |
Saa1 |
serum amyloid A 1 |
3624 |
0.1 |
chr17_45811998_45812149 | 0.77 |
Gm35692 |
predicted gene, 35692 |
10250 |
0.16 |
chr4_98922024_98922201 | 0.76 |
Usp1 |
ubiquitin specific peptidase 1 |
1698 |
0.36 |
chr19_46138051_46138212 | 0.76 |
Pitx3 |
paired-like homeodomain transcription factor 3 |
842 |
0.48 |
chr9_117717074_117717242 | 0.76 |
Rbms3 |
RNA binding motif, single stranded interacting protein |
87245 |
0.1 |
chr9_15562471_15562648 | 0.74 |
Deup1 |
deuterosome assembly protein 1 |
25530 |
0.14 |
chr7_35396851_35397006 | 0.74 |
Faap24 |
Fanconi anemia core complex associated protein 24 |
92 |
0.51 |
chr4_117342552_117342734 | 0.73 |
Rnf220 |
ring finger protein 220 |
32814 |
0.12 |
chr13_37943133_37943379 | 0.72 |
Rreb1 |
ras responsive element binding protein 1 |
3760 |
0.25 |
chr19_23135903_23136065 | 0.72 |
2410080I02Rik |
RIKEN cDNA 2410080I02 gene |
1084 |
0.46 |
chr18_38306714_38306870 | 0.72 |
Rnf14 |
ring finger protein 14 |
7040 |
0.11 |
chr9_114990473_114990649 | 0.72 |
Osbpl10 |
oxysterol binding protein-like 10 |
187 |
0.95 |
chr2_179177736_179177906 | 0.72 |
Gm14292 |
predicted gene 14292 |
396 |
0.91 |
chr4_132077572_132077723 | 0.72 |
Epb41 |
erythrocyte membrane protein band 4.1 |
2326 |
0.17 |
chr10_59402892_59403066 | 0.72 |
Pla2g12b |
phospholipase A2, group XIIB |
681 |
0.67 |
chr9_63749052_63749228 | 0.71 |
Smad3 |
SMAD family member 3 |
1937 |
0.39 |
chr10_86685801_86686017 | 0.71 |
1810014B01Rik |
RIKEN cDNA 1810014B01 gene |
20 |
0.93 |
chr16_90283288_90283658 | 0.71 |
Scaf4 |
SR-related CTD-associated factor 4 |
835 |
0.58 |
chr14_50931098_50931281 | 0.71 |
Pnp |
purine-nucleoside phosphorylase |
107 |
0.74 |
chr6_71824307_71824486 | 0.70 |
Mrpl35 |
mitochondrial ribosomal protein L35 |
586 |
0.6 |
chr4_125115758_125115923 | 0.70 |
Zc3h12a |
zinc finger CCCH type containing 12A |
6680 |
0.14 |
chr15_89196505_89196682 | 0.70 |
Dennd6b |
DENN/MADD domain containing 6B |
97 |
0.93 |
chr4_33247849_33248010 | 0.70 |
Pnrc1 |
proline-rich nuclear receptor coactivator 1 |
354 |
0.86 |
chr17_12975251_12975429 | 0.70 |
Wtap |
Wilms tumour 1-associating protein |
8133 |
0.09 |
chr9_59353144_59353316 | 0.70 |
Bbs4 |
Bardet-Biedl syndrome 4 (human) |
209 |
0.94 |
chr6_115880848_115881053 | 0.70 |
Ift122 |
intraflagellar transport 122 |
3683 |
0.15 |
chr11_101627513_101628017 | 0.70 |
Rdm1 |
RAD52 motif 1 |
177 |
0.69 |
chr4_48043381_48043595 | 0.70 |
Nr4a3 |
nuclear receptor subfamily 4, group A, member 3 |
1665 |
0.43 |
chr3_108900274_108900442 | 0.70 |
Prpf38b |
PRP38 pre-mRNA processing factor 38 (yeast) domain containing B |
5227 |
0.14 |
chr9_63702505_63702656 | 0.69 |
Smad3 |
SMAD family member 3 |
9389 |
0.23 |
chr17_14165600_14165769 | 0.69 |
Gm34510 |
predicted gene, 34510 |
38044 |
0.12 |
chr9_62344600_62344925 | 0.69 |
Anp32a |
acidic (leucine-rich) nuclear phosphoprotein 32 family, member A |
37 |
0.98 |
chr7_139400126_139400277 | 0.69 |
Inpp5a |
inositol polyphosphate-5-phosphatase A |
288 |
0.93 |
chr1_36264236_36264413 | 0.69 |
Neurl3 |
neuralized E3 ubiquitin protein ligase 3 |
9111 |
0.15 |
chr4_40854042_40854209 | 0.68 |
B4galt1 |
UDP-Gal:betaGlcNAc beta 1,4- galactosyltransferase, polypeptide 1 |
120 |
0.93 |
chr12_111814351_111814511 | 0.68 |
Zfyve21 |
zinc finger, FYVE domain containing 21 |
190 |
0.78 |
chr8_70538228_70538406 | 0.68 |
Ell |
elongation factor RNA polymerase II |
1140 |
0.27 |
chr3_122482421_122482595 | 0.67 |
Bcar3 |
breast cancer anti-estrogen resistance 3 |
1215 |
0.39 |
chr13_51847050_51847248 | 0.67 |
Gadd45g |
growth arrest and DNA-damage-inducible 45 gamma |
405 |
0.88 |
chr6_88729022_88729173 | 0.67 |
Gm26588 |
predicted gene, 26588 |
3237 |
0.16 |
chr5_99387632_99387845 | 0.67 |
Gm35394 |
predicted gene, 35394 |
113643 |
0.05 |
chr1_140183261_140183634 | 0.66 |
Cfh |
complement component factor h |
36 |
0.98 |
chr7_102441647_102441815 | 0.66 |
Rrm1 |
ribonucleotide reductase M1 |
36 |
0.95 |
chr2_144176663_144176841 | 0.66 |
Gm5535 |
predicted gene 5535 |
2334 |
0.25 |
chr10_42502096_42502264 | 0.66 |
Snx3 |
sorting nexin 3 |
110 |
0.97 |
chr9_114805245_114805584 | 0.66 |
Cmtm7 |
CKLF-like MARVEL transmembrane domain containing 7 |
23558 |
0.13 |
chr18_21174247_21174515 | 0.66 |
Gm6378 |
predicted pseudogene 6378 |
97272 |
0.06 |
chr6_72058409_72058766 | 0.66 |
Gm8952 |
predicted gene 8952 |
15566 |
0.12 |
chr8_120832109_120832260 | 0.66 |
Gm26878 |
predicted gene, 26878 |
48022 |
0.12 |
chr15_83704064_83704215 | 0.65 |
Scube1 |
signal peptide, CUB domain, EGF-like 1 |
20787 |
0.2 |
chr2_127410098_127410249 | 0.65 |
Gpat2 |
glycerol-3-phosphate acyltransferase 2, mitochondrial |
15026 |
0.14 |
chr4_137593986_137594147 | 0.65 |
Usp48 |
ubiquitin specific peptidase 48 |
74 |
0.97 |
chr10_80139371_80139556 | 0.65 |
Cbarp |
calcium channel, voltage-dependent, beta subunit associated regulatory protein |
98 |
0.88 |
chr12_54312657_54312848 | 0.65 |
Gm47552 |
predicted gene, 47552 |
4263 |
0.22 |
chr11_74830392_74830575 | 0.65 |
Mnt |
max binding protein |
437 |
0.75 |
chrX_169320375_169320533 | 0.64 |
Hccs |
holocytochrome c synthetase |
82 |
0.63 |
chr14_20885229_20885403 | 0.64 |
Gm6128 |
predicted pseudogene 6128 |
28895 |
0.14 |
chr18_64890683_64890860 | 0.64 |
Nedd4l |
neural precursor cell expressed, developmentally down-regulated gene 4-like |
278 |
0.9 |
chr8_121932352_121932562 | 0.64 |
Car5a |
carbonic anhydrase 5a, mitochondrial |
4983 |
0.11 |
chr2_50110237_50110423 | 0.64 |
Lypd6 |
LY6/PLAUR domain containing 6 |
18039 |
0.27 |
chr1_58712869_58713029 | 0.64 |
Cflar |
CASP8 and FADD-like apoptosis regulator |
345 |
0.82 |
chr12_29951176_29951331 | 0.64 |
Pxdn |
peroxidasin |
13203 |
0.25 |
chr4_133389168_133389363 | 0.63 |
Slc9a1 |
solute carrier family 9 (sodium/hydrogen exchanger), member 1 |
18621 |
0.13 |
chr6_99171970_99172133 | 0.63 |
Foxp1 |
forkhead box P1 |
9033 |
0.29 |
chr13_51401199_51401363 | 0.63 |
S1pr3 |
sphingosine-1-phosphate receptor 3 |
7358 |
0.2 |
chr7_141440668_141440830 | 0.63 |
Pidd1 |
p53 induced death domain protein 1 |
625 |
0.41 |
chrX_159817258_159817435 | 0.63 |
Sh3kbp1 |
SH3-domain kinase binding protein 1 |
23122 |
0.25 |
chr2_115520788_115520995 | 0.63 |
3110099E03Rik |
RIKEN cDNA 3110099E03 gene |
6853 |
0.25 |
chr1_134340348_134340501 | 0.63 |
Ppfia4 |
protein tyrosine phosphatase, receptor type, f polypeptide (PTPRF), interacting protein (liprin), alpha 4 |
7496 |
0.13 |
chr11_97884386_97884555 | 0.63 |
Gm11630 |
predicted gene 11630 |
124 |
0.73 |
chr5_65335695_65335868 | 0.63 |
Rfc1 |
replication factor C (activator 1) 1 |
111 |
0.95 |
chr4_44756482_44756646 | 0.63 |
Zcchc7 |
zinc finger, CCHC domain containing 7 |
4 |
0.97 |
chr6_121872993_121873786 | 0.62 |
Mug1 |
murinoglobulin 1 |
12188 |
0.19 |
chr8_34806517_34806668 | 0.62 |
Dusp4 |
dual specificity phosphatase 4 |
705 |
0.73 |
chr16_10545200_10545379 | 0.62 |
Clec16a |
C-type lectin domain family 16, member A |
50 |
0.97 |
chr19_8723277_8723444 | 0.62 |
Slc3a2 |
solute carrier family 3 (activators of dibasic and neutral amino acid transport), member 2 |
9 |
0.54 |
chr13_96983609_96983768 | 0.62 |
Gm48609 |
predicted gene, 48609 |
31611 |
0.12 |
chr12_82333592_82333979 | 0.62 |
Sipa1l1 |
signal-induced proliferation-associated 1 like 1 |
8482 |
0.29 |
chr7_84605820_84605991 | 0.62 |
Fah |
fumarylacetoacetate hydrolase |
1 |
0.97 |
chr8_126833896_126834272 | 0.62 |
A630001O12Rik |
RIKEN cDNA A630001O12 gene |
5149 |
0.24 |
chr15_57912022_57912182 | 0.61 |
Tbc1d31 |
TBC1 domain family, member 31 |
97 |
0.97 |
chr17_24251414_24251580 | 0.61 |
Ccnf |
cyclin F |
13 |
0.95 |
chr12_24593250_24593444 | 0.61 |
Grhl1 |
grainyhead like transcription factor 1 |
12598 |
0.17 |
chr4_155178360_155178562 | 0.61 |
Ski |
ski sarcoma viral oncogene homolog (avian) |
9835 |
0.18 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.7 | 2.1 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
0.5 | 1.6 | GO:0070827 | chromatin maintenance(GO:0070827) |
0.5 | 1.5 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
0.4 | 1.2 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
0.3 | 0.9 | GO:0097296 | activation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:0097296) |
0.3 | 1.5 | GO:0060480 | lung goblet cell differentiation(GO:0060480) |
0.3 | 0.8 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
0.2 | 0.7 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
0.2 | 0.6 | GO:0005984 | disaccharide metabolic process(GO:0005984) |
0.2 | 0.8 | GO:0060264 | regulation of respiratory burst involved in inflammatory response(GO:0060264) |
0.2 | 0.6 | GO:2000304 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
0.2 | 1.4 | GO:0060613 | fat pad development(GO:0060613) |
0.2 | 0.6 | GO:1903898 | negative regulation of PERK-mediated unfolded protein response(GO:1903898) |
0.2 | 0.5 | GO:0014732 | skeletal muscle atrophy(GO:0014732) |
0.2 | 0.7 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
0.2 | 0.4 | GO:0070384 | Harderian gland development(GO:0070384) |
0.2 | 0.3 | GO:0071233 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
0.2 | 0.9 | GO:0035166 | post-embryonic hemopoiesis(GO:0035166) |
0.2 | 0.5 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
0.2 | 0.5 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
0.2 | 0.5 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
0.2 | 0.8 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
0.2 | 0.7 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.2 | 0.3 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.2 | 0.5 | GO:2000302 | positive regulation of synaptic vesicle exocytosis(GO:2000302) |
0.2 | 0.6 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
0.2 | 0.5 | GO:0060825 | fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
0.2 | 0.6 | GO:0033132 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
0.1 | 0.4 | GO:0046208 | spermine catabolic process(GO:0046208) |
0.1 | 0.7 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
0.1 | 0.6 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
0.1 | 0.4 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
0.1 | 0.6 | GO:0045829 | negative regulation of isotype switching(GO:0045829) |
0.1 | 0.7 | GO:1903689 | regulation of wound healing, spreading of epidermal cells(GO:1903689) |
0.1 | 0.5 | GO:0010994 | regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
0.1 | 0.5 | GO:0030538 | embryonic genitalia morphogenesis(GO:0030538) |
0.1 | 0.5 | GO:0018916 | nitrobenzene metabolic process(GO:0018916) |
0.1 | 0.4 | GO:0090361 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
0.1 | 0.5 | GO:0042891 | antibiotic transport(GO:0042891) |
0.1 | 0.4 | GO:0060700 | regulation of ribonuclease activity(GO:0060700) |
0.1 | 0.5 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
0.1 | 0.4 | GO:0001306 | age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
0.1 | 0.4 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
0.1 | 0.6 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
0.1 | 0.9 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
0.1 | 0.4 | GO:0045415 | negative regulation of interleukin-8 biosynthetic process(GO:0045415) |
0.1 | 0.5 | GO:0009176 | pyrimidine deoxyribonucleoside monophosphate metabolic process(GO:0009176) |
0.1 | 1.1 | GO:0009263 | deoxyribonucleotide biosynthetic process(GO:0009263) |
0.1 | 0.4 | GO:0097212 | lysosomal membrane organization(GO:0097212) |
0.1 | 0.1 | GO:0009202 | deoxyribonucleoside triphosphate biosynthetic process(GO:0009202) |
0.1 | 0.6 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
0.1 | 0.5 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
0.1 | 0.2 | GO:0071898 | regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
0.1 | 0.8 | GO:0035590 | purinergic nucleotide receptor signaling pathway(GO:0035590) |
0.1 | 0.6 | GO:0014870 | response to inactivity(GO:0014854) response to muscle inactivity(GO:0014870) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
0.1 | 0.1 | GO:0035910 | ascending aorta development(GO:0035905) ascending aorta morphogenesis(GO:0035910) |
0.1 | 0.3 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
0.1 | 0.6 | GO:0006449 | regulation of translational termination(GO:0006449) |
0.1 | 0.2 | GO:1900825 | regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
0.1 | 1.3 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
0.1 | 0.5 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
0.1 | 0.5 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
0.1 | 0.7 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
0.1 | 0.3 | GO:0035771 | interleukin-4-mediated signaling pathway(GO:0035771) |
0.1 | 0.5 | GO:1905214 | regulation of mRNA binding(GO:1902415) regulation of RNA binding(GO:1905214) |
0.1 | 0.3 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
0.1 | 0.3 | GO:0015803 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.1 | 0.3 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
0.1 | 0.3 | GO:0032789 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
0.1 | 0.3 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
0.1 | 0.4 | GO:1900747 | negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) |
0.1 | 0.2 | GO:1904259 | regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904259) positive regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904261) basement membrane assembly involved in embryonic body morphogenesis(GO:2001197) |
0.1 | 0.5 | GO:1904667 | negative regulation of ubiquitin protein ligase activity(GO:1904667) |
0.1 | 0.6 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
0.1 | 0.3 | GO:0016095 | polyprenol catabolic process(GO:0016095) |
0.1 | 0.3 | GO:0035973 | aggrephagy(GO:0035973) |
0.1 | 0.2 | GO:0046449 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
0.1 | 0.5 | GO:1901524 | regulation of macromitophagy(GO:1901524) negative regulation of macromitophagy(GO:1901525) |
0.1 | 0.2 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
0.1 | 0.3 | GO:0090230 | regulation of centromere complex assembly(GO:0090230) |
0.1 | 0.6 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
0.1 | 0.3 | GO:0021586 | pons maturation(GO:0021586) |
0.1 | 0.3 | GO:1900623 | regulation of monocyte aggregation(GO:1900623) positive regulation of monocyte aggregation(GO:1900625) |
0.1 | 0.4 | GO:1904468 | negative regulation of tumor necrosis factor secretion(GO:1904468) |
0.1 | 0.3 | GO:0035935 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
0.1 | 0.5 | GO:1902373 | negative regulation of mRNA catabolic process(GO:1902373) |
0.1 | 0.6 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
0.1 | 0.6 | GO:0046606 | negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
0.1 | 0.4 | GO:0072675 | osteoclast fusion(GO:0072675) |
0.1 | 0.4 | GO:0046110 | xanthine catabolic process(GO:0009115) xanthine metabolic process(GO:0046110) |
0.1 | 0.6 | GO:0045654 | positive regulation of megakaryocyte differentiation(GO:0045654) |
0.1 | 0.3 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
0.1 | 0.2 | GO:1904502 | regulation of lipophagy(GO:1904502) positive regulation of lipophagy(GO:1904504) |
0.1 | 0.3 | GO:0015888 | thiamine transport(GO:0015888) |
0.1 | 0.2 | GO:0051665 | membrane raft localization(GO:0051665) |
0.1 | 0.4 | GO:0051572 | negative regulation of histone H3-K4 methylation(GO:0051572) |
0.1 | 0.3 | GO:0060397 | JAK-STAT cascade involved in growth hormone signaling pathway(GO:0060397) |
0.1 | 0.4 | GO:0010991 | negative regulation of SMAD protein complex assembly(GO:0010991) |
0.1 | 0.3 | GO:0021999 | neural plate anterior/posterior regionalization(GO:0021999) |
0.1 | 0.6 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
0.1 | 0.3 | GO:0007296 | vitellogenesis(GO:0007296) |
0.1 | 0.3 | GO:0009136 | purine nucleoside diphosphate biosynthetic process(GO:0009136) purine ribonucleoside diphosphate biosynthetic process(GO:0009180) |
0.1 | 1.0 | GO:0043248 | proteasome assembly(GO:0043248) |
0.1 | 0.5 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
0.1 | 0.2 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
0.1 | 0.2 | GO:0014873 | response to muscle activity involved in regulation of muscle adaptation(GO:0014873) |
0.1 | 0.2 | GO:0044800 | fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
0.1 | 0.2 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
0.1 | 0.3 | GO:0010273 | detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
0.1 | 0.6 | GO:0006851 | mitochondrial calcium ion transport(GO:0006851) |
0.1 | 0.3 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
0.1 | 0.2 | GO:0032439 | endosome localization(GO:0032439) |
0.1 | 1.0 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
0.1 | 0.2 | GO:0006046 | N-acetylglucosamine catabolic process(GO:0006046) |
0.1 | 0.5 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
0.1 | 0.3 | GO:0051919 | positive regulation of fibrinolysis(GO:0051919) |
0.1 | 0.8 | GO:0009226 | nucleotide-sugar biosynthetic process(GO:0009226) |
0.1 | 0.2 | GO:0010982 | regulation of high-density lipoprotein particle clearance(GO:0010982) |
0.1 | 0.4 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
0.1 | 0.9 | GO:0007097 | nuclear migration(GO:0007097) |
0.1 | 0.2 | GO:0060137 | maternal process involved in parturition(GO:0060137) |
0.1 | 0.4 | GO:0015722 | canalicular bile acid transport(GO:0015722) |
0.1 | 0.3 | GO:0046487 | glyoxylate metabolic process(GO:0046487) |
0.1 | 0.3 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
0.1 | 0.4 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.1 | 0.5 | GO:0045634 | regulation of melanocyte differentiation(GO:0045634) |
0.1 | 0.2 | GO:0071680 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
0.1 | 0.2 | GO:0014735 | regulation of muscle atrophy(GO:0014735) |
0.1 | 0.2 | GO:0032875 | regulation of DNA endoreduplication(GO:0032875) |
0.1 | 0.4 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
0.1 | 0.2 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.1 | 0.4 | GO:0000098 | sulfur amino acid catabolic process(GO:0000098) |
0.1 | 0.1 | GO:0060435 | bronchiole development(GO:0060435) |
0.1 | 0.2 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
0.1 | 0.1 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
0.1 | 0.2 | GO:0006015 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
0.1 | 0.3 | GO:0019230 | proprioception(GO:0019230) |
0.1 | 0.2 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
0.1 | 0.2 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
0.1 | 0.2 | GO:1903261 | regulation of serine phosphorylation of STAT3 protein(GO:1903261) |
0.1 | 0.6 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
0.1 | 0.1 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
0.1 | 0.2 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
0.1 | 0.3 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.1 | 0.3 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
0.1 | 0.3 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
0.1 | 0.2 | GO:0015746 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.1 | 0.3 | GO:0006573 | valine metabolic process(GO:0006573) |
0.1 | 0.1 | GO:2000705 | regulation of dense core granule biogenesis(GO:2000705) |
0.1 | 0.2 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
0.1 | 0.7 | GO:0006744 | ubiquinone biosynthetic process(GO:0006744) |
0.1 | 0.4 | GO:0060449 | bud elongation involved in lung branching(GO:0060449) |
0.1 | 0.2 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
0.1 | 0.2 | GO:0033136 | serine phosphorylation of STAT3 protein(GO:0033136) |
0.1 | 0.2 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.1 | 0.2 | GO:1901896 | positive regulation of calcium-transporting ATPase activity(GO:1901896) |
0.1 | 0.2 | GO:1902774 | late endosome to lysosome transport(GO:1902774) |
0.1 | 0.5 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
0.1 | 0.2 | GO:0035425 | autocrine signaling(GO:0035425) |
0.1 | 0.2 | GO:2000645 | negative regulation of receptor catabolic process(GO:2000645) |
0.1 | 0.3 | GO:1903026 | negative regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903026) |
0.1 | 0.4 | GO:0048242 | epinephrine transport(GO:0048241) epinephrine secretion(GO:0048242) |
0.1 | 0.2 | GO:0051771 | negative regulation of nitric-oxide synthase biosynthetic process(GO:0051771) |
0.1 | 0.4 | GO:0048702 | embryonic neurocranium morphogenesis(GO:0048702) |
0.1 | 0.3 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
0.1 | 0.1 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
0.1 | 0.2 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
0.1 | 0.7 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
0.1 | 0.4 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
0.1 | 0.1 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
0.1 | 0.2 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.1 | 0.2 | GO:0001514 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
0.1 | 0.1 | GO:2000619 | negative regulation of histone H4-K16 acetylation(GO:2000619) |
0.1 | 0.2 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
0.1 | 0.2 | GO:1902177 | positive regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902177) |
0.1 | 0.4 | GO:0051775 | response to redox state(GO:0051775) |
0.1 | 0.2 | GO:0071830 | chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
0.1 | 0.1 | GO:0008228 | opsonization(GO:0008228) |
0.1 | 0.2 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.1 | 0.3 | GO:0016081 | synaptic vesicle docking(GO:0016081) |
0.1 | 0.5 | GO:0006183 | GTP biosynthetic process(GO:0006183) |
0.1 | 0.3 | GO:0006116 | NADH oxidation(GO:0006116) |
0.1 | 0.3 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
0.1 | 0.2 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.1 | 0.2 | GO:1904707 | positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
0.1 | 0.2 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
0.1 | 0.2 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
0.1 | 0.2 | GO:0010040 | response to iron(II) ion(GO:0010040) |
0.1 | 0.2 | GO:0001845 | phagolysosome assembly(GO:0001845) |
0.1 | 0.1 | GO:0070375 | ERK5 cascade(GO:0070375) |
0.1 | 0.2 | GO:0040031 | snRNA modification(GO:0040031) |
0.1 | 0.1 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
0.1 | 0.2 | GO:0035625 | receptor transactivation(GO:0035624) epidermal growth factor-activated receptor transactivation by G-protein coupled receptor signaling pathway(GO:0035625) |
0.1 | 0.2 | GO:0051126 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) negative regulation of actin nucleation(GO:0051126) |
0.1 | 0.1 | GO:0045200 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
0.1 | 0.3 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
0.1 | 0.2 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
0.1 | 0.3 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.1 | 0.2 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
0.1 | 0.2 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.1 | 0.1 | GO:0072402 | response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) response to intra-S DNA damage checkpoint signaling(GO:0072429) |
0.1 | 0.4 | GO:0018119 | peptidyl-cysteine S-nitrosylation(GO:0018119) |
0.1 | 0.3 | GO:1901660 | calcium ion export(GO:1901660) |
0.1 | 0.2 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
0.1 | 0.1 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
0.1 | 0.5 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
0.1 | 0.2 | GO:0030576 | Cajal body organization(GO:0030576) |
0.1 | 0.1 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
0.1 | 0.2 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
0.1 | 0.2 | GO:0008655 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
0.0 | 0.1 | GO:0032914 | positive regulation of transforming growth factor beta1 production(GO:0032914) |
0.0 | 0.4 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.0 | 2.1 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
0.0 | 0.1 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
0.0 | 0.2 | GO:0002606 | positive regulation of dendritic cell antigen processing and presentation(GO:0002606) |
0.0 | 0.3 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
0.0 | 0.1 | GO:0001712 | ectodermal cell fate commitment(GO:0001712) |
0.0 | 0.1 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
0.0 | 0.0 | GO:0090324 | negative regulation of oxidative phosphorylation(GO:0090324) |
0.0 | 0.2 | GO:0000820 | regulation of glutamine family amino acid metabolic process(GO:0000820) |
0.0 | 0.5 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
0.0 | 0.0 | GO:1904431 | positive regulation of t-circle formation(GO:1904431) |
0.0 | 0.6 | GO:0044130 | negative regulation of growth of symbiont in host(GO:0044130) negative regulation of growth of symbiont involved in interaction with host(GO:0044146) |
0.0 | 0.4 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
0.0 | 0.2 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
0.0 | 0.2 | GO:2000394 | positive regulation of lamellipodium morphogenesis(GO:2000394) |
0.0 | 0.2 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
0.0 | 0.1 | GO:0043382 | regulation of memory T cell differentiation(GO:0043380) positive regulation of memory T cell differentiation(GO:0043382) |
0.0 | 0.3 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.0 | 0.2 | GO:0052055 | modulation by symbiont of host molecular function(GO:0052055) |
0.0 | 0.2 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
0.0 | 0.6 | GO:0006349 | regulation of gene expression by genetic imprinting(GO:0006349) |
0.0 | 0.3 | GO:0051639 | actin filament network formation(GO:0051639) |
0.0 | 0.1 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
0.0 | 0.4 | GO:0006977 | DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) |
0.0 | 0.2 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.0 | 0.1 | GO:2000589 | cell migration involved in metanephros development(GO:0035788) metanephric mesenchymal cell migration(GO:0035789) positive regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:0035793) regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:1900238) regulation of metanephric mesenchymal cell migration(GO:2000589) positive regulation of metanephric mesenchymal cell migration(GO:2000591) |
0.0 | 0.3 | GO:0015871 | choline transport(GO:0015871) |
0.0 | 0.1 | GO:0009826 | unidimensional cell growth(GO:0009826) |
0.0 | 0.1 | GO:0034395 | regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
0.0 | 0.3 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
0.0 | 0.1 | GO:0044598 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.0 | 0.2 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
0.0 | 0.4 | GO:0045945 | positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
0.0 | 0.4 | GO:0046855 | inositol phosphate dephosphorylation(GO:0046855) |
0.0 | 0.3 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
0.0 | 0.0 | GO:0043379 | memory T cell differentiation(GO:0043379) |
0.0 | 0.6 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) |
0.0 | 0.3 | GO:0000212 | meiotic spindle organization(GO:0000212) |
0.0 | 0.1 | GO:0060331 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
0.0 | 0.2 | GO:0060339 | negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
0.0 | 0.9 | GO:0070328 | acylglycerol homeostasis(GO:0055090) triglyceride homeostasis(GO:0070328) |
0.0 | 0.2 | GO:0019695 | choline metabolic process(GO:0019695) |
0.0 | 0.2 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
0.0 | 0.1 | GO:0061623 | galactose catabolic process via UDP-galactose(GO:0033499) glycolytic process from galactose(GO:0061623) |
0.0 | 0.3 | GO:0000729 | DNA double-strand break processing(GO:0000729) |
0.0 | 0.0 | GO:1990314 | cellular response to insulin-like growth factor stimulus(GO:1990314) |
0.0 | 0.3 | GO:0046599 | regulation of centriole replication(GO:0046599) |
0.0 | 0.0 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
0.0 | 0.1 | GO:2000857 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
0.0 | 0.4 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
0.0 | 0.2 | GO:0006548 | histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
0.0 | 0.1 | GO:0070831 | basement membrane assembly(GO:0070831) |
0.0 | 0.2 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
0.0 | 0.1 | GO:0002934 | desmosome organization(GO:0002934) |
0.0 | 0.1 | GO:0035992 | tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
0.0 | 0.4 | GO:0048199 | vesicle targeting, to, from or within Golgi(GO:0048199) |
0.0 | 0.2 | GO:0035999 | tetrahydrofolate interconversion(GO:0035999) |
0.0 | 0.1 | GO:0060623 | regulation of chromosome condensation(GO:0060623) |
0.0 | 0.2 | GO:0035608 | protein deglutamylation(GO:0035608) |
0.0 | 0.2 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
0.0 | 0.1 | GO:0019262 | N-acetylneuraminate catabolic process(GO:0019262) |
0.0 | 0.3 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
0.0 | 0.2 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
0.0 | 0.1 | GO:0009750 | response to fructose(GO:0009750) cellular response to fructose stimulus(GO:0071332) |
0.0 | 0.1 | GO:0035962 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
0.0 | 0.1 | GO:0034165 | regulation of toll-like receptor 9 signaling pathway(GO:0034163) positive regulation of toll-like receptor 9 signaling pathway(GO:0034165) |
0.0 | 0.0 | GO:1902548 | negative regulation of cellular response to vascular endothelial growth factor stimulus(GO:1902548) |
0.0 | 0.1 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
0.0 | 0.1 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
0.0 | 0.2 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
0.0 | 0.2 | GO:1904668 | positive regulation of ubiquitin protein ligase activity(GO:1904668) |
0.0 | 0.9 | GO:0002089 | lens morphogenesis in camera-type eye(GO:0002089) |
0.0 | 0.1 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
0.0 | 0.2 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
0.0 | 0.6 | GO:0001893 | maternal placenta development(GO:0001893) |
0.0 | 0.1 | GO:0018158 | protein oxidation(GO:0018158) |
0.0 | 0.1 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
0.0 | 0.0 | GO:0033483 | gas homeostasis(GO:0033483) |
0.0 | 0.1 | GO:0051611 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
0.0 | 0.1 | GO:0009414 | response to water deprivation(GO:0009414) |
0.0 | 0.2 | GO:0015791 | polyol transport(GO:0015791) |
0.0 | 0.1 | GO:0033184 | positive regulation of histone ubiquitination(GO:0033184) |
0.0 | 0.3 | GO:0032790 | ribosome disassembly(GO:0032790) |
0.0 | 0.0 | GO:0001951 | intestinal D-glucose absorption(GO:0001951) |
0.0 | 0.4 | GO:0009143 | nucleoside triphosphate catabolic process(GO:0009143) |
0.0 | 0.1 | GO:0031443 | fast-twitch skeletal muscle fiber contraction(GO:0031443) |
0.0 | 0.0 | GO:1900084 | regulation of peptidyl-tyrosine autophosphorylation(GO:1900084) |
0.0 | 0.1 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.0 | 0.1 | GO:0036005 | response to macrophage colony-stimulating factor(GO:0036005) cellular response to macrophage colony-stimulating factor stimulus(GO:0036006) |
0.0 | 0.2 | GO:0048539 | bone marrow development(GO:0048539) |
0.0 | 0.2 | GO:1902916 | positive regulation of protein polyubiquitination(GO:1902916) |
0.0 | 0.1 | GO:0038108 | negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) |
0.0 | 0.0 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
0.0 | 0.1 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
0.0 | 0.0 | GO:0097168 | mesenchymal stem cell proliferation(GO:0097168) |
0.0 | 0.2 | GO:1902033 | regulation of hematopoietic stem cell proliferation(GO:1902033) |
0.0 | 0.0 | GO:0006113 | fermentation(GO:0006113) glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
0.0 | 0.1 | GO:0035814 | negative regulation of renal sodium excretion(GO:0035814) |
0.0 | 0.1 | GO:0042699 | follicle-stimulating hormone signaling pathway(GO:0042699) |
0.0 | 0.0 | GO:0036493 | positive regulation of translation in response to endoplasmic reticulum stress(GO:0036493) |
0.0 | 0.2 | GO:0050872 | white fat cell differentiation(GO:0050872) |
0.0 | 0.3 | GO:0031507 | heterochromatin assembly(GO:0031507) |
0.0 | 0.1 | GO:1900619 | acetylcholine metabolic process(GO:0008291) acetate ester metabolic process(GO:1900619) |
0.0 | 0.2 | GO:0097264 | self proteolysis(GO:0097264) |
0.0 | 0.1 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
0.0 | 0.1 | GO:0010886 | positive regulation of cholesterol storage(GO:0010886) |
0.0 | 0.1 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
0.0 | 0.1 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
0.0 | 0.3 | GO:0035988 | chondrocyte proliferation(GO:0035988) |
0.0 | 0.1 | GO:0051182 | coenzyme transport(GO:0051182) |
0.0 | 0.0 | GO:0071545 | inositol phosphate catabolic process(GO:0071545) |
0.0 | 0.2 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
0.0 | 0.1 | GO:0045914 | negative regulation of catecholamine metabolic process(GO:0045914) negative regulation of dopamine metabolic process(GO:0045963) |
0.0 | 0.1 | GO:0030300 | regulation of intestinal cholesterol absorption(GO:0030300) |
0.0 | 0.1 | GO:1902956 | regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902956) |
0.0 | 0.0 | GO:0015755 | fructose transport(GO:0015755) |
0.0 | 0.1 | GO:0071679 | commissural neuron axon guidance(GO:0071679) |
0.0 | 0.1 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.0 | 0.2 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
0.0 | 0.1 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
0.0 | 0.1 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
0.0 | 0.1 | GO:0045794 | negative regulation of cell volume(GO:0045794) |
0.0 | 0.1 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
0.0 | 0.0 | GO:0070487 | hyaluranon cable assembly(GO:0036118) monocyte aggregation(GO:0070487) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
0.0 | 0.1 | GO:0071609 | chemokine (C-C motif) ligand 5 production(GO:0071609) |
0.0 | 0.1 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
0.0 | 0.1 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.0 | 0.1 | GO:0019346 | homoserine metabolic process(GO:0009092) transsulfuration(GO:0019346) |
0.0 | 0.0 | GO:0036015 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
0.0 | 0.2 | GO:0006501 | C-terminal protein lipidation(GO:0006501) |
0.0 | 0.1 | GO:0003149 | membranous septum morphogenesis(GO:0003149) |
0.0 | 0.2 | GO:0097012 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) response to granulocyte macrophage colony-stimulating factor(GO:0097012) |
0.0 | 0.1 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
0.0 | 0.1 | GO:2000599 | regulation of cyclin catabolic process(GO:2000598) negative regulation of cyclin catabolic process(GO:2000599) |
0.0 | 0.5 | GO:0097320 | membrane tubulation(GO:0097320) |
0.0 | 0.6 | GO:0031648 | protein destabilization(GO:0031648) |
0.0 | 0.1 | GO:0018992 | germ-line sex determination(GO:0018992) |
0.0 | 0.0 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
0.0 | 0.0 | GO:0048807 | female genitalia morphogenesis(GO:0048807) |
0.0 | 0.0 | GO:0048295 | positive regulation of isotype switching to IgE isotypes(GO:0048295) |
0.0 | 0.1 | GO:0042136 | neurotransmitter biosynthetic process(GO:0042136) |
0.0 | 1.3 | GO:0006418 | tRNA aminoacylation for protein translation(GO:0006418) |
0.0 | 0.3 | GO:0070914 | UV-damage excision repair(GO:0070914) |
0.0 | 0.4 | GO:0006884 | cell volume homeostasis(GO:0006884) |
0.0 | 0.1 | GO:0048133 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
0.0 | 0.2 | GO:0045741 | positive regulation of epidermal growth factor-activated receptor activity(GO:0045741) |
0.0 | 0.7 | GO:0045737 | positive regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045737) |
0.0 | 0.3 | GO:0030502 | negative regulation of bone mineralization(GO:0030502) |
0.0 | 0.1 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
0.0 | 0.0 | GO:1903147 | negative regulation of mitophagy(GO:1903147) |
0.0 | 0.1 | GO:0032058 | positive regulation of translation in response to stress(GO:0032056) positive regulation of translational initiation in response to stress(GO:0032058) |
0.0 | 0.2 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
0.0 | 0.3 | GO:0097034 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
0.0 | 0.1 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
0.0 | 0.3 | GO:1903140 | regulation of endothelial cell development(GO:1901550) regulation of establishment of endothelial barrier(GO:1903140) |
0.0 | 0.3 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) |
0.0 | 0.0 | GO:0060584 | regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
0.0 | 0.1 | GO:0038171 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
0.0 | 0.3 | GO:0031167 | rRNA methylation(GO:0031167) |
0.0 | 0.1 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.0 | 0.3 | GO:0033235 | positive regulation of protein sumoylation(GO:0033235) |
0.0 | 0.3 | GO:0035994 | response to muscle stretch(GO:0035994) |
0.0 | 0.1 | GO:0050955 | thermoception(GO:0050955) |
0.0 | 0.1 | GO:0034116 | positive regulation of heterotypic cell-cell adhesion(GO:0034116) |
0.0 | 0.1 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
0.0 | 0.2 | GO:0051418 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
0.0 | 0.1 | GO:2000416 | regulation of eosinophil migration(GO:2000416) positive regulation of eosinophil migration(GO:2000418) |
0.0 | 0.1 | GO:0036216 | response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
0.0 | 0.1 | GO:0002069 | columnar/cuboidal epithelial cell maturation(GO:0002069) |
0.0 | 0.0 | GO:2000383 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
0.0 | 0.2 | GO:0031269 | pseudopodium assembly(GO:0031269) |
0.0 | 0.6 | GO:0006921 | cellular component disassembly involved in execution phase of apoptosis(GO:0006921) apoptotic nuclear changes(GO:0030262) |
0.0 | 0.2 | GO:0042904 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
0.0 | 0.1 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
0.0 | 0.5 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
0.0 | 0.8 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
0.0 | 0.1 | GO:0050703 | interleukin-1 alpha secretion(GO:0050703) |
0.0 | 0.0 | GO:0010534 | regulation of activation of JAK2 kinase activity(GO:0010534) |
0.0 | 0.1 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
0.0 | 0.0 | GO:0042536 | negative regulation of tumor necrosis factor biosynthetic process(GO:0042536) |
0.0 | 0.2 | GO:0046185 | aldehyde catabolic process(GO:0046185) |
0.0 | 0.1 | GO:0031296 | B cell costimulation(GO:0031296) |
0.0 | 0.5 | GO:0042753 | positive regulation of circadian rhythm(GO:0042753) |
0.0 | 0.3 | GO:0035584 | calcium-mediated signaling using intracellular calcium source(GO:0035584) |
0.0 | 0.2 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
0.0 | 0.1 | GO:2000474 | regulation of opioid receptor signaling pathway(GO:2000474) |
0.0 | 0.2 | GO:1901889 | negative regulation of focal adhesion assembly(GO:0051895) negative regulation of cell junction assembly(GO:1901889) |
0.0 | 0.1 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
0.0 | 0.1 | GO:0090031 | positive regulation of steroid hormone biosynthetic process(GO:0090031) |
0.0 | 0.1 | GO:0045404 | positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
0.0 | 0.3 | GO:0045063 | T-helper 1 cell differentiation(GO:0045063) |
0.0 | 0.2 | GO:0007343 | egg activation(GO:0007343) |
0.0 | 0.2 | GO:0014883 | transition between fast and slow fiber(GO:0014883) |
0.0 | 0.1 | GO:0033602 | negative regulation of dopamine secretion(GO:0033602) |
0.0 | 0.2 | GO:0006105 | succinate metabolic process(GO:0006105) |
0.0 | 0.2 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
0.0 | 0.1 | GO:0072282 | metanephric nephron tubule morphogenesis(GO:0072282) |
0.0 | 0.2 | GO:0016926 | protein desumoylation(GO:0016926) |
0.0 | 0.1 | GO:0044778 | meiotic DNA integrity checkpoint(GO:0044778) |
0.0 | 0.1 | GO:0010694 | positive regulation of alkaline phosphatase activity(GO:0010694) |
0.0 | 0.2 | GO:0030953 | astral microtubule organization(GO:0030953) |
0.0 | 0.1 | GO:0001828 | inner cell mass cell fate commitment(GO:0001827) inner cell mass cellular morphogenesis(GO:0001828) |
0.0 | 0.5 | GO:0007205 | protein kinase C-activating G-protein coupled receptor signaling pathway(GO:0007205) |
0.0 | 0.3 | GO:0002710 | negative regulation of T cell mediated immunity(GO:0002710) |
0.0 | 0.1 | GO:0051790 | short-chain fatty acid biosynthetic process(GO:0051790) |
0.0 | 0.1 | GO:1903977 | positive regulation of glial cell migration(GO:1903977) |
0.0 | 0.1 | GO:0090206 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
0.0 | 0.1 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
0.0 | 0.1 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
0.0 | 0.1 | GO:1900113 | regulation of histone H3-K9 trimethylation(GO:1900112) negative regulation of histone H3-K9 trimethylation(GO:1900113) |
0.0 | 0.0 | GO:0070368 | positive regulation of hepatocyte differentiation(GO:0070368) |
0.0 | 0.1 | GO:0071318 | cellular response to ATP(GO:0071318) |
0.0 | 0.0 | GO:0071872 | response to epinephrine(GO:0071871) cellular response to epinephrine stimulus(GO:0071872) |
0.0 | 0.1 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
0.0 | 0.1 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
0.0 | 0.4 | GO:0030865 | cortical cytoskeleton organization(GO:0030865) |
0.0 | 0.0 | GO:0016259 | selenocysteine metabolic process(GO:0016259) |
0.0 | 0.0 | GO:0043578 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
0.0 | 0.1 | GO:0070327 | thyroid hormone transport(GO:0070327) |
0.0 | 0.1 | GO:0019249 | lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
0.0 | 0.0 | GO:0097694 | establishment of RNA localization to telomere(GO:0097694) |
0.0 | 0.2 | GO:0045954 | positive regulation of natural killer cell mediated cytotoxicity(GO:0045954) |
0.0 | 0.1 | GO:0070861 | regulation of protein exit from endoplasmic reticulum(GO:0070861) |
0.0 | 0.1 | GO:0045348 | positive regulation of MHC class II biosynthetic process(GO:0045348) |
0.0 | 0.3 | GO:0034260 | negative regulation of GTPase activity(GO:0034260) |
0.0 | 0.0 | GO:1901663 | quinone biosynthetic process(GO:1901663) |
0.0 | 0.1 | GO:0006072 | glycerol-3-phosphate metabolic process(GO:0006072) |
0.0 | 0.1 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
0.0 | 0.1 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
0.0 | 0.0 | GO:0055098 | response to low-density lipoprotein particle(GO:0055098) |
0.0 | 0.0 | GO:0003419 | growth plate cartilage chondrocyte proliferation(GO:0003419) |
0.0 | 0.1 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
0.0 | 0.1 | GO:0007220 | Notch receptor processing(GO:0007220) |
0.0 | 0.1 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
0.0 | 0.1 | GO:0071481 | cellular response to X-ray(GO:0071481) |
0.0 | 0.0 | GO:0009804 | coumarin metabolic process(GO:0009804) |
0.0 | 0.1 | GO:0014022 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
0.0 | 0.2 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
0.0 | 0.0 | GO:0032898 | neurotrophin production(GO:0032898) |
0.0 | 0.1 | GO:0016137 | glycoside metabolic process(GO:0016137) |
0.0 | 0.2 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
0.0 | 0.1 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.0 | 0.1 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
0.0 | 0.1 | GO:0030311 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.0 | 0.0 | GO:0003223 | ventricular compact myocardium morphogenesis(GO:0003223) |
0.0 | 0.0 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
0.0 | 0.1 | GO:0060033 | anatomical structure regression(GO:0060033) |
0.0 | 0.0 | GO:2001269 | positive regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001269) |
0.0 | 0.4 | GO:0019835 | cytolysis(GO:0019835) |
0.0 | 0.1 | GO:0061052 | negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
0.0 | 0.3 | GO:0043968 | histone H2A acetylation(GO:0043968) |
0.0 | 0.1 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
0.0 | 0.1 | GO:0030091 | protein repair(GO:0030091) |
0.0 | 0.1 | GO:0010042 | response to manganese ion(GO:0010042) |
0.0 | 0.3 | GO:0002360 | T cell lineage commitment(GO:0002360) |
0.0 | 0.0 | GO:0071816 | protein insertion into ER membrane(GO:0045048) tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
0.0 | 0.1 | GO:0006047 | UDP-N-acetylglucosamine metabolic process(GO:0006047) |
0.0 | 0.1 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.0 | 0.1 | GO:0060900 | embryonic camera-type eye formation(GO:0060900) |
0.0 | 0.4 | GO:0007130 | synaptonemal complex assembly(GO:0007130) |
0.0 | 0.0 | GO:0006743 | ubiquinone metabolic process(GO:0006743) |
0.0 | 0.1 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.0 | 0.1 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
0.0 | 0.1 | GO:0002347 | response to tumor cell(GO:0002347) |
0.0 | 0.1 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
0.0 | 0.2 | GO:0006907 | pinocytosis(GO:0006907) |
0.0 | 0.1 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
0.0 | 0.2 | GO:0060307 | regulation of ventricular cardiac muscle cell membrane repolarization(GO:0060307) ventricular cardiac muscle cell membrane repolarization(GO:0099625) |
0.0 | 0.1 | GO:2001214 | positive regulation of vasculogenesis(GO:2001214) |
0.0 | 0.4 | GO:0018208 | peptidyl-proline modification(GO:0018208) |
0.0 | 0.0 | GO:2000525 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
0.0 | 0.0 | GO:0002536 | respiratory burst involved in inflammatory response(GO:0002536) |
0.0 | 0.1 | GO:0006555 | methionine metabolic process(GO:0006555) |
0.0 | 0.1 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
0.0 | 0.0 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
0.0 | 0.1 | GO:1903797 | regulation of inorganic anion transmembrane transport(GO:1903795) positive regulation of inorganic anion transmembrane transport(GO:1903797) |
0.0 | 0.0 | GO:0021943 | formation of radial glial scaffolds(GO:0021943) |
0.0 | 0.1 | GO:2000359 | regulation of binding of sperm to zona pellucida(GO:2000359) |
0.0 | 0.0 | GO:0035697 | CD8-positive, alpha-beta T cell extravasation(GO:0035697) regulation of CD8-positive, alpha-beta T cell extravasation(GO:2000449) |
0.0 | 0.3 | GO:0032012 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.0 | 0.3 | GO:0002021 | response to dietary excess(GO:0002021) |
0.0 | 0.0 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
0.0 | 0.0 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
0.0 | 0.0 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
0.0 | 0.0 | GO:1903061 | positive regulation of protein lipidation(GO:1903061) |
0.0 | 0.3 | GO:0035384 | thioester biosynthetic process(GO:0035384) acyl-CoA biosynthetic process(GO:0071616) |
0.0 | 0.1 | GO:0030224 | monocyte differentiation(GO:0030224) |
0.0 | 0.0 | GO:0071288 | cellular response to mercury ion(GO:0071288) |
0.0 | 0.1 | GO:0002175 | protein localization to paranode region of axon(GO:0002175) |
0.0 | 0.1 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
0.0 | 0.1 | GO:0035330 | regulation of hippo signaling(GO:0035330) |
0.0 | 0.1 | GO:0021764 | amygdala development(GO:0021764) |
0.0 | 0.0 | GO:0002432 | granuloma formation(GO:0002432) |
0.0 | 0.0 | GO:1903238 | positive regulation of leukocyte tethering or rolling(GO:1903238) |
0.0 | 0.0 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
0.0 | 0.3 | GO:0035987 | endodermal cell differentiation(GO:0035987) |
0.0 | 0.1 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
0.0 | 0.1 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
0.0 | 0.0 | GO:0050904 | diapedesis(GO:0050904) |
0.0 | 0.0 | GO:0060125 | negative regulation of growth hormone secretion(GO:0060125) |
0.0 | 0.1 | GO:0061684 | chaperone-mediated autophagy(GO:0061684) |
0.0 | 0.0 | GO:0016102 | retinoic acid biosynthetic process(GO:0002138) diterpenoid biosynthetic process(GO:0016102) |
0.0 | 0.0 | GO:2000520 | regulation of immunological synapse formation(GO:2000520) |
0.0 | 0.0 | GO:0061511 | centriole elongation(GO:0061511) |
0.0 | 0.1 | GO:0016056 | rhodopsin mediated signaling pathway(GO:0016056) |
0.0 | 0.0 | GO:0021938 | smoothened signaling pathway involved in regulation of cerebellar granule cell precursor cell proliferation(GO:0021938) |
0.0 | 0.1 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
0.0 | 0.1 | GO:0021707 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
0.0 | 0.1 | GO:0036010 | protein localization to endosome(GO:0036010) |
0.0 | 0.1 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
0.0 | 0.1 | GO:0007028 | cytoplasm organization(GO:0007028) |
0.0 | 0.0 | GO:0009106 | lipoate metabolic process(GO:0009106) |
0.0 | 0.0 | GO:0009219 | pyrimidine deoxyribonucleotide metabolic process(GO:0009219) |
0.0 | 0.0 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
0.0 | 0.1 | GO:0006098 | pentose-phosphate shunt(GO:0006098) |
0.0 | 0.0 | GO:0034370 | triglyceride-rich lipoprotein particle remodeling(GO:0034370) |
0.0 | 0.0 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
0.0 | 0.1 | GO:0018231 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
0.0 | 0.0 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
0.0 | 0.0 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
0.0 | 0.1 | GO:0032620 | interleukin-17 production(GO:0032620) |
0.0 | 0.0 | GO:0035630 | bone mineralization involved in bone maturation(GO:0035630) |
0.0 | 0.1 | GO:0006020 | inositol metabolic process(GO:0006020) |
0.0 | 0.0 | GO:0008215 | spermine metabolic process(GO:0008215) |
0.0 | 0.0 | GO:0090158 | endoplasmic reticulum membrane organization(GO:0090158) positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
0.0 | 0.0 | GO:0090598 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
0.0 | 0.0 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
0.0 | 0.1 | GO:1900037 | regulation of cellular response to hypoxia(GO:1900037) |
0.0 | 0.1 | GO:0003096 | renal sodium ion transport(GO:0003096) |
0.0 | 0.0 | GO:0061074 | regulation of neural retina development(GO:0061074) |
0.0 | 0.1 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
0.0 | 0.0 | GO:0002317 | plasma cell differentiation(GO:0002317) |
0.0 | 0.3 | GO:0050850 | positive regulation of calcium-mediated signaling(GO:0050850) |
0.0 | 0.2 | GO:0071353 | cellular response to interleukin-4(GO:0071353) |
0.0 | 0.1 | GO:0043046 | DNA methylation involved in gamete generation(GO:0043046) |
0.0 | 0.0 | GO:0036089 | cleavage furrow formation(GO:0036089) |
0.0 | 0.2 | GO:0002076 | osteoblast development(GO:0002076) |
0.0 | 0.3 | GO:0015701 | bicarbonate transport(GO:0015701) |
0.0 | 0.0 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
0.0 | 0.0 | GO:0072718 | response to cisplatin(GO:0072718) |
0.0 | 0.0 | GO:0061156 | pulmonary artery morphogenesis(GO:0061156) |
0.0 | 0.0 | GO:0046083 | adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
0.0 | 0.0 | GO:0002913 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
0.0 | 0.2 | GO:0042407 | cristae formation(GO:0042407) |
0.0 | 0.1 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.0 | 0.3 | GO:0030970 | retrograde protein transport, ER to cytosol(GO:0030970) |
0.0 | 0.1 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
0.0 | 0.1 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
0.0 | 0.0 | GO:2000510 | positive regulation of dendritic cell chemotaxis(GO:2000510) |
0.0 | 0.0 | GO:0033058 | directional locomotion(GO:0033058) |
0.0 | 0.1 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
0.0 | 0.1 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
0.0 | 0.1 | GO:0060920 | cardiac pacemaker cell differentiation(GO:0060920) cardiac pacemaker cell development(GO:0060926) |
0.0 | 0.0 | GO:0051156 | glucose 6-phosphate metabolic process(GO:0051156) |
0.0 | 0.1 | GO:0021637 | trigeminal nerve morphogenesis(GO:0021636) trigeminal nerve structural organization(GO:0021637) |
0.0 | 0.3 | GO:0048025 | negative regulation of mRNA splicing, via spliceosome(GO:0048025) |
0.0 | 0.1 | GO:1902235 | regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902235) |
0.0 | 0.0 | GO:0018377 | protein myristoylation(GO:0018377) |
0.0 | 0.1 | GO:0021860 | pyramidal neuron development(GO:0021860) |
0.0 | 0.1 | GO:0072673 | lamellipodium morphogenesis(GO:0072673) |
0.0 | 0.0 | GO:1903551 | regulation of extracellular exosome assembly(GO:1903551) |
0.0 | 0.0 | GO:0060672 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
0.0 | 0.1 | GO:0032967 | positive regulation of collagen biosynthetic process(GO:0032967) |
0.0 | 0.1 | GO:0031017 | exocrine pancreas development(GO:0031017) |
0.0 | 0.3 | GO:0045739 | positive regulation of DNA repair(GO:0045739) |
0.0 | 0.7 | GO:0007229 | integrin-mediated signaling pathway(GO:0007229) |
0.0 | 0.0 | GO:0032308 | positive regulation of prostaglandin secretion(GO:0032308) |
0.0 | 0.0 | GO:0061038 | uterus morphogenesis(GO:0061038) |
0.0 | 0.0 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
0.0 | 0.0 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
0.0 | 0.1 | GO:0097341 | inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
0.0 | 0.0 | GO:0032831 | positive regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032831) |
0.0 | 0.0 | GO:0070268 | cornification(GO:0070268) |
0.0 | 0.0 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.0 | 0.2 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
0.0 | 0.0 | GO:0060594 | mammary gland specification(GO:0060594) |
0.0 | 0.0 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
0.0 | 0.1 | GO:0001771 | immunological synapse formation(GO:0001771) |
0.0 | 0.1 | GO:0042744 | hydrogen peroxide catabolic process(GO:0042744) |
0.0 | 0.0 | GO:0006228 | UTP biosynthetic process(GO:0006228) |
0.0 | 0.0 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
0.0 | 0.0 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.0 | 0.0 | GO:0019042 | viral latency(GO:0019042) |
0.0 | 0.0 | GO:0045579 | positive regulation of B cell differentiation(GO:0045579) |
0.0 | 0.0 | GO:0010481 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
0.0 | 0.1 | GO:0007143 | female meiotic division(GO:0007143) |
0.0 | 0.0 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
0.0 | 0.0 | GO:2001171 | positive regulation of ATP biosynthetic process(GO:2001171) |
0.0 | 0.1 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
0.0 | 0.0 | GO:0038003 | opioid receptor signaling pathway(GO:0038003) |
0.0 | 0.1 | GO:0042984 | amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
0.0 | 0.1 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
0.0 | 0.0 | GO:0035262 | gonad morphogenesis(GO:0035262) |
0.0 | 0.1 | GO:0030511 | positive regulation of transforming growth factor beta receptor signaling pathway(GO:0030511) positive regulation of cellular response to transforming growth factor beta stimulus(GO:1903846) |
0.0 | 0.1 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
0.0 | 0.0 | GO:0043328 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
0.0 | 0.0 | GO:0051231 | spindle elongation(GO:0051231) |
0.0 | 0.1 | GO:0000103 | sulfate assimilation(GO:0000103) |
0.0 | 0.0 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
0.0 | 0.0 | GO:0014827 | intestine smooth muscle contraction(GO:0014827) |
0.0 | 0.1 | GO:0009067 | aspartate family amino acid biosynthetic process(GO:0009067) |
0.0 | 0.3 | GO:1900449 | regulation of glutamate receptor signaling pathway(GO:1900449) |
0.0 | 0.1 | GO:0006027 | glycosaminoglycan catabolic process(GO:0006027) |
0.0 | 0.2 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
0.0 | 0.1 | GO:0001710 | mesodermal cell fate commitment(GO:0001710) |
0.0 | 0.1 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
0.0 | 0.0 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
0.0 | 0.0 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
0.0 | 0.1 | GO:0006517 | protein deglycosylation(GO:0006517) |
0.0 | 0.1 | GO:0061318 | renal filtration cell differentiation(GO:0061318) glomerular epithelium development(GO:0072010) glomerular visceral epithelial cell differentiation(GO:0072112) glomerular epithelial cell differentiation(GO:0072311) |
0.0 | 0.1 | GO:0030157 | pancreatic juice secretion(GO:0030157) |
0.0 | 0.0 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
0.0 | 0.0 | GO:0090129 | positive regulation of synapse maturation(GO:0090129) |
0.0 | 0.1 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
0.0 | 0.0 | GO:0071243 | cellular response to arsenic-containing substance(GO:0071243) |
0.0 | 0.0 | GO:0098903 | regulation of membrane repolarization during action potential(GO:0098903) |
0.0 | 0.1 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
0.0 | 0.0 | GO:0070293 | renal absorption(GO:0070293) |
0.0 | 0.1 | GO:1902031 | regulation of NADP metabolic process(GO:1902031) |
0.0 | 0.1 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
0.0 | 0.3 | GO:0000380 | alternative mRNA splicing, via spliceosome(GO:0000380) |
0.0 | 0.0 | GO:0042473 | outer ear morphogenesis(GO:0042473) |
0.0 | 0.0 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
0.0 | 0.0 | GO:0070193 | synaptonemal complex organization(GO:0070193) |
0.0 | 0.0 | GO:0070947 | neutrophil mediated killing of fungus(GO:0070947) |
0.0 | 0.1 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
0.0 | 0.0 | GO:0009138 | pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
0.0 | 0.0 | GO:0002525 | acute inflammatory response to non-antigenic stimulus(GO:0002525) |
0.0 | 0.1 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
0.0 | 0.1 | GO:0033630 | positive regulation of cell adhesion mediated by integrin(GO:0033630) |
0.0 | 0.0 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
0.0 | 0.1 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
0.0 | 0.0 | GO:0009946 | proximal/distal axis specification(GO:0009946) |
0.0 | 0.0 | GO:1990123 | L-glutamate(1-) import into cell(GO:1903802) L-glutamate import into cell(GO:1990123) |
0.0 | 0.2 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
0.0 | 0.0 | GO:0010796 | regulation of multivesicular body size(GO:0010796) |
0.0 | 0.1 | GO:0060211 | regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
0.0 | 0.0 | GO:0090403 | oxidative stress-induced premature senescence(GO:0090403) |
0.0 | 0.3 | GO:0015909 | long-chain fatty acid transport(GO:0015909) |
0.0 | 0.0 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
0.0 | 0.0 | GO:0044387 | negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
0.0 | 0.0 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
0.0 | 0.0 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
0.0 | 0.0 | GO:0033119 | negative regulation of RNA splicing(GO:0033119) |
0.0 | 0.0 | GO:0060100 | positive regulation of phagocytosis, engulfment(GO:0060100) positive regulation of membrane invagination(GO:1905155) |
0.0 | 0.0 | GO:0042091 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
0.0 | 0.0 | GO:0070586 | cell-cell adhesion involved in gastrulation(GO:0070586) |
0.0 | 0.0 | GO:0017014 | protein nitrosylation(GO:0017014) |
0.0 | 0.1 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
0.0 | 0.0 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
0.0 | 0.1 | GO:0051382 | kinetochore assembly(GO:0051382) |
0.0 | 0.0 | GO:0006407 | rRNA export from nucleus(GO:0006407) |
0.0 | 0.0 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
0.0 | 0.1 | GO:0030575 | nuclear body organization(GO:0030575) |
0.0 | 0.0 | GO:1901874 | regulation of post-translational protein modification(GO:1901873) negative regulation of post-translational protein modification(GO:1901874) |
0.0 | 0.1 | GO:2000018 | regulation of male gonad development(GO:2000018) |
0.0 | 0.1 | GO:0040033 | negative regulation of translation, ncRNA-mediated(GO:0040033) regulation of translation, ncRNA-mediated(GO:0045974) |
0.0 | 0.1 | GO:1903859 | regulation of dendrite extension(GO:1903859) positive regulation of dendrite extension(GO:1903861) |
0.0 | 0.2 | GO:0006953 | acute-phase response(GO:0006953) |
0.0 | 0.1 | GO:0045793 | positive regulation of cell size(GO:0045793) |
0.0 | 0.0 | GO:0000237 | leptotene(GO:0000237) |
0.0 | 0.0 | GO:0034587 | piRNA metabolic process(GO:0034587) |
0.0 | 0.0 | GO:0030421 | defecation(GO:0030421) |
0.0 | 0.0 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
0.0 | 0.0 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
0.0 | 0.1 | GO:0001913 | T cell mediated cytotoxicity(GO:0001913) |
0.0 | 0.0 | GO:0032714 | negative regulation of interleukin-13 production(GO:0032696) negative regulation of interleukin-5 production(GO:0032714) |
0.0 | 0.2 | GO:0060325 | face morphogenesis(GO:0060325) |
0.0 | 0.1 | GO:0050957 | equilibrioception(GO:0050957) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 0.8 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
0.2 | 0.9 | GO:0071141 | SMAD protein complex(GO:0071141) |
0.2 | 0.7 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
0.2 | 0.5 | GO:0097443 | sorting endosome(GO:0097443) |
0.2 | 0.5 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.2 | 0.7 | GO:0098536 | deuterosome(GO:0098536) |
0.2 | 1.1 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.2 | 1.1 | GO:0032009 | early phagosome(GO:0032009) |
0.2 | 0.6 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
0.1 | 0.7 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
0.1 | 0.4 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
0.1 | 0.4 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.1 | 0.8 | GO:0030312 | external encapsulating structure(GO:0030312) |
0.1 | 1.0 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.1 | 0.9 | GO:0034464 | BBSome(GO:0034464) |
0.1 | 0.3 | GO:0016939 | kinesin II complex(GO:0016939) |
0.1 | 0.5 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
0.1 | 0.3 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
0.1 | 0.3 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
0.1 | 0.3 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.1 | 0.6 | GO:0000801 | central element(GO:0000801) |
0.1 | 0.3 | GO:0097452 | GAIT complex(GO:0097452) |
0.1 | 0.3 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
0.1 | 0.3 | GO:0035838 | growing cell tip(GO:0035838) |
0.1 | 0.7 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.1 | 0.6 | GO:0005688 | U6 snRNP(GO:0005688) |
0.1 | 0.7 | GO:0045179 | apical cortex(GO:0045179) |
0.1 | 0.1 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
0.1 | 0.3 | GO:0032021 | NELF complex(GO:0032021) |
0.1 | 0.3 | GO:0042567 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
0.1 | 0.9 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
0.1 | 0.6 | GO:0000812 | Swr1 complex(GO:0000812) |
0.1 | 0.6 | GO:0017059 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
0.1 | 0.3 | GO:0045298 | tubulin complex(GO:0045298) |
0.1 | 1.0 | GO:0046930 | pore complex(GO:0046930) |
0.1 | 0.2 | GO:0035189 | Rb-E2F complex(GO:0035189) |
0.1 | 0.2 | GO:0070552 | BRISC complex(GO:0070552) |
0.1 | 0.4 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.1 | 0.2 | GO:1990246 | uniplex complex(GO:1990246) |
0.1 | 0.4 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
0.1 | 0.7 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.1 | 0.3 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.1 | 0.2 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
0.1 | 0.2 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
0.1 | 0.7 | GO:0016580 | Sin3 complex(GO:0016580) |
0.1 | 0.4 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.1 | 0.2 | GO:0071817 | MMXD complex(GO:0071817) |
0.1 | 0.6 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.1 | 0.2 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
0.1 | 0.2 | GO:0032010 | phagolysosome(GO:0032010) |
0.0 | 0.3 | GO:0005577 | fibrinogen complex(GO:0005577) |
0.0 | 0.3 | GO:0000347 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
0.0 | 0.7 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
0.0 | 2.4 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.0 | 0.1 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
0.0 | 0.2 | GO:0035363 | histone locus body(GO:0035363) |
0.0 | 0.2 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.0 | 0.1 | GO:0005879 | axonemal microtubule(GO:0005879) |
0.0 | 0.2 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.0 | 0.4 | GO:0097539 | ciliary transition fiber(GO:0097539) |
0.0 | 0.4 | GO:0090576 | RNA polymerase III transcription factor complex(GO:0090576) |
0.0 | 0.4 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.0 | 0.3 | GO:0042382 | paraspeckles(GO:0042382) |
0.0 | 0.8 | GO:0030904 | retromer complex(GO:0030904) |
0.0 | 0.1 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.0 | 0.3 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.0 | 0.4 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
0.0 | 0.3 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
0.0 | 0.1 | GO:0097513 | myosin II filament(GO:0097513) |
0.0 | 0.2 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
0.0 | 0.1 | GO:0036195 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
0.0 | 1.0 | GO:0031941 | filamentous actin(GO:0031941) |
0.0 | 0.1 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
0.0 | 0.2 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.0 | 0.1 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
0.0 | 0.1 | GO:0035355 | Toll-like receptor 2-Toll-like receptor 6 protein complex(GO:0035355) |
0.0 | 0.5 | GO:0033391 | chromatoid body(GO:0033391) |
0.0 | 0.3 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.0 | 0.4 | GO:0031229 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
0.0 | 0.4 | GO:0031083 | BLOC-1 complex(GO:0031083) |
0.0 | 0.9 | GO:0051233 | spindle midzone(GO:0051233) |
0.0 | 0.2 | GO:0043202 | lysosomal lumen(GO:0043202) |
0.0 | 1.4 | GO:0000118 | histone deacetylase complex(GO:0000118) |
0.0 | 0.1 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.0 | 0.2 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.0 | 0.1 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
0.0 | 0.1 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.0 | 0.2 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.0 | 0.3 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.0 | 0.4 | GO:0005838 | proteasome regulatory particle(GO:0005838) |
0.0 | 0.6 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.0 | 0.2 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
0.0 | 0.1 | GO:0000811 | GINS complex(GO:0000811) |
0.0 | 0.2 | GO:0000923 | equatorial microtubule organizing center(GO:0000923) |
0.0 | 0.0 | GO:0000235 | astral microtubule(GO:0000235) |
0.0 | 0.1 | GO:0001674 | female germ cell nucleus(GO:0001674) |
0.0 | 0.5 | GO:0030057 | desmosome(GO:0030057) |
0.0 | 0.4 | GO:0045120 | pronucleus(GO:0045120) |
0.0 | 0.2 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
0.0 | 0.1 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
0.0 | 0.1 | GO:0005683 | U7 snRNP(GO:0005683) |
0.0 | 0.4 | GO:0033270 | paranode region of axon(GO:0033270) |
0.0 | 0.6 | GO:0042588 | zymogen granule(GO:0042588) |
0.0 | 0.1 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
0.0 | 0.3 | GO:0016600 | flotillin complex(GO:0016600) |
0.0 | 0.1 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.0 | 0.3 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
0.0 | 0.1 | GO:0000322 | storage vacuole(GO:0000322) |
0.0 | 0.2 | GO:0070938 | contractile ring(GO:0070938) |
0.0 | 0.1 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
0.0 | 0.1 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.0 | 0.0 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.0 | 0.1 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
0.0 | 0.1 | GO:0044327 | dendritic spine head(GO:0044327) |
0.0 | 0.6 | GO:0055038 | recycling endosome membrane(GO:0055038) |
0.0 | 0.2 | GO:0032591 | dendritic spine membrane(GO:0032591) |
0.0 | 0.1 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.0 | 0.2 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.0 | 0.1 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
0.0 | 0.3 | GO:0035371 | microtubule plus-end(GO:0035371) |
0.0 | 0.7 | GO:0072686 | mitotic spindle(GO:0072686) |
0.0 | 0.1 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.0 | 0.2 | GO:0030126 | COPI vesicle coat(GO:0030126) |
0.0 | 0.7 | GO:0060170 | ciliary membrane(GO:0060170) |
0.0 | 0.2 | GO:0031931 | TORC1 complex(GO:0031931) |
0.0 | 0.2 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
0.0 | 0.4 | GO:0032590 | dendrite membrane(GO:0032590) |
0.0 | 0.1 | GO:0031262 | Ndc80 complex(GO:0031262) |
0.0 | 0.1 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
0.0 | 0.5 | GO:0015030 | Cajal body(GO:0015030) |
0.0 | 0.1 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.0 | 0.1 | GO:0031084 | BLOC-2 complex(GO:0031084) |
0.0 | 0.0 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.0 | 0.1 | GO:0070695 | FHF complex(GO:0070695) |
0.0 | 0.1 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.0 | 0.1 | GO:0072687 | meiotic spindle(GO:0072687) |
0.0 | 0.1 | GO:0010369 | chromocenter(GO:0010369) |
0.0 | 0.1 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.0 | 0.1 | GO:0005642 | annulate lamellae(GO:0005642) |
0.0 | 0.2 | GO:0005682 | U5 snRNP(GO:0005682) |
0.0 | 0.0 | GO:0033010 | paranodal junction(GO:0033010) |
0.0 | 0.5 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
0.0 | 0.1 | GO:0000796 | condensin complex(GO:0000796) |
0.0 | 0.1 | GO:0042405 | nuclear inclusion body(GO:0042405) |
0.0 | 0.2 | GO:0098533 | ATPase dependent transmembrane transport complex(GO:0098533) |
0.0 | 1.1 | GO:0042641 | actomyosin(GO:0042641) |
0.0 | 0.1 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
0.0 | 0.1 | GO:0098553 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) |
0.0 | 0.1 | GO:0016272 | prefoldin complex(GO:0016272) |
0.0 | 0.2 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
0.0 | 0.2 | GO:0032039 | integrator complex(GO:0032039) |
0.0 | 0.1 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.0 | 0.0 | GO:0044308 | axonal spine(GO:0044308) |
0.0 | 0.1 | GO:1904115 | axon cytoplasm(GO:1904115) |
0.0 | 0.1 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
0.0 | 0.7 | GO:0030173 | integral component of Golgi membrane(GO:0030173) intrinsic component of Golgi membrane(GO:0031228) |
0.0 | 0.0 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
0.0 | 0.1 | GO:0071547 | piP-body(GO:0071547) |
0.0 | 0.1 | GO:0005869 | dynactin complex(GO:0005869) |
0.0 | 0.2 | GO:0046581 | intercellular canaliculus(GO:0046581) |
0.0 | 0.3 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
0.0 | 0.3 | GO:0005719 | nuclear euchromatin(GO:0005719) |
0.0 | 0.1 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
0.0 | 0.1 | GO:0032426 | stereocilium tip(GO:0032426) |
0.0 | 0.0 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
0.0 | 0.1 | GO:0032433 | filopodium tip(GO:0032433) |
0.0 | 0.2 | GO:0060077 | inhibitory synapse(GO:0060077) |
0.0 | 0.0 | GO:0019815 | B cell receptor complex(GO:0019815) |
0.0 | 0.1 | GO:0005796 | Golgi lumen(GO:0005796) |
0.0 | 0.7 | GO:0000502 | proteasome complex(GO:0000502) |
0.0 | 0.1 | GO:0034719 | SMN complex(GO:0032797) SMN-Sm protein complex(GO:0034719) |
0.0 | 0.0 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
0.0 | 0.1 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
0.0 | 0.1 | GO:0042582 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
0.0 | 0.0 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.0 | 0.0 | GO:0090543 | Flemming body(GO:0090543) |
0.0 | 0.8 | GO:0055037 | recycling endosome(GO:0055037) |
0.0 | 0.0 | GO:0097413 | Lewy body(GO:0097413) |
0.0 | 0.0 | GO:0072534 | perineuronal net(GO:0072534) |
0.0 | 0.1 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
0.0 | 0.1 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
0.0 | 0.9 | GO:0030139 | endocytic vesicle(GO:0030139) |
0.0 | 0.0 | GO:1990357 | terminal web(GO:1990357) |
0.0 | 0.1 | GO:0061617 | MICOS complex(GO:0061617) |
0.0 | 0.0 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
0.0 | 0.0 | GO:0043259 | laminin-10 complex(GO:0043259) |
0.0 | 0.2 | GO:0035861 | site of double-strand break(GO:0035861) |
0.0 | 0.1 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.0 | 0.1 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
0.0 | 0.1 | GO:0042575 | DNA polymerase complex(GO:0042575) |
0.0 | 0.4 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
0.0 | 0.4 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
0.0 | 0.1 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
0.0 | 0.1 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.0 | 0.1 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.0 | 0.0 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
0.0 | 0.0 | GO:0044194 | cytolytic granule(GO:0044194) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 1.2 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
0.3 | 0.8 | GO:0016728 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
0.2 | 0.7 | GO:1990460 | leptin receptor binding(GO:1990460) |
0.2 | 0.7 | GO:0016822 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
0.2 | 0.7 | GO:0004461 | lactose synthase activity(GO:0004461) |
0.2 | 0.8 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.2 | 1.4 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.2 | 0.5 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.2 | 0.6 | GO:0042731 | PH domain binding(GO:0042731) |
0.2 | 1.1 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
0.2 | 0.6 | GO:0002060 | purine nucleobase binding(GO:0002060) |
0.1 | 0.4 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
0.1 | 0.4 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.1 | 0.4 | GO:0070905 | serine binding(GO:0070905) |
0.1 | 0.4 | GO:0042895 | antibiotic transporter activity(GO:0042895) |
0.1 | 0.4 | GO:0004365 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
0.1 | 0.4 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.1 | 0.4 | GO:0070137 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
0.1 | 0.8 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
0.1 | 0.4 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
0.1 | 0.6 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
0.1 | 0.7 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
0.1 | 0.4 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.1 | 0.1 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
0.1 | 0.2 | GO:1990715 | mRNA CDS binding(GO:1990715) |
0.1 | 0.6 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
0.1 | 0.7 | GO:0015288 | porin activity(GO:0015288) |
0.1 | 0.7 | GO:0034452 | dynactin binding(GO:0034452) |
0.1 | 0.3 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.1 | 0.3 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
0.1 | 0.5 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
0.1 | 0.7 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
0.1 | 0.3 | GO:0005350 | purine nucleobase transmembrane transporter activity(GO:0005345) pyrimidine nucleobase transmembrane transporter activity(GO:0005350) nucleobase transmembrane transporter activity(GO:0015205) |
0.1 | 0.5 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
0.1 | 1.6 | GO:0016755 | transferase activity, transferring amino-acyl groups(GO:0016755) |
0.1 | 0.4 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.1 | 0.6 | GO:0004931 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.1 | 0.3 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
0.1 | 0.3 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.1 | 0.6 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
0.1 | 0.3 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
0.1 | 0.3 | GO:0030350 | iron-responsive element binding(GO:0030350) |
0.1 | 0.1 | GO:0051990 | (R)-2-hydroxyglutarate dehydrogenase activity(GO:0051990) |
0.1 | 0.1 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
0.1 | 1.4 | GO:0016646 | oxidoreductase activity, acting on the CH-NH group of donors, NAD or NADP as acceptor(GO:0016646) |
0.1 | 0.2 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
0.1 | 0.2 | GO:0031686 | A1 adenosine receptor binding(GO:0031686) |
0.1 | 0.2 | GO:0035175 | histone kinase activity (H3-S10 specific)(GO:0035175) |
0.1 | 0.2 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
0.1 | 0.2 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
0.1 | 1.1 | GO:0019215 | intermediate filament binding(GO:0019215) |
0.1 | 0.2 | GO:0047751 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) cholestenone 5-alpha-reductase activity(GO:0047751) |
0.1 | 0.3 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.1 | 0.3 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.1 | 0.4 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
0.1 | 0.4 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
0.1 | 0.6 | GO:0017070 | U6 snRNA binding(GO:0017070) |
0.1 | 0.2 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.1 | 0.8 | GO:0017166 | vinculin binding(GO:0017166) |
0.1 | 0.6 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
0.1 | 0.4 | GO:0070891 | lipoteichoic acid binding(GO:0070891) |
0.1 | 0.2 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
0.1 | 0.4 | GO:0004854 | xanthine dehydrogenase activity(GO:0004854) oxidoreductase activity, acting on CH or CH2 groups, NAD or NADP as acceptor(GO:0016726) |
0.1 | 0.4 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
0.1 | 0.2 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
0.1 | 0.6 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.1 | 0.3 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.1 | 0.3 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
0.1 | 0.4 | GO:0032184 | SUMO polymer binding(GO:0032184) |
0.1 | 0.2 | GO:0015119 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
0.1 | 0.7 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
0.1 | 0.3 | GO:0071253 | connexin binding(GO:0071253) |
0.1 | 0.3 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
0.1 | 0.2 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
0.1 | 0.2 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.1 | 0.3 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
0.1 | 0.3 | GO:0017108 | 5'-flap endonuclease activity(GO:0017108) |
0.1 | 0.2 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
0.1 | 0.2 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) |
0.1 | 0.2 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
0.1 | 0.2 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.1 | 0.4 | GO:0001727 | lipid kinase activity(GO:0001727) |
0.1 | 0.2 | GO:0000182 | rDNA binding(GO:0000182) |
0.1 | 0.3 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
0.1 | 0.7 | GO:0031005 | filamin binding(GO:0031005) |
0.1 | 1.1 | GO:0031489 | myosin V binding(GO:0031489) |
0.1 | 0.2 | GO:0004104 | cholinesterase activity(GO:0004104) |
0.1 | 0.7 | GO:0001846 | opsonin binding(GO:0001846) |
0.1 | 0.2 | GO:1901612 | cardiolipin binding(GO:1901612) |
0.1 | 0.3 | GO:0032052 | bile acid binding(GO:0032052) |
0.1 | 0.2 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.1 | 0.3 | GO:0008297 | single-stranded DNA exodeoxyribonuclease activity(GO:0008297) |
0.1 | 0.9 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.1 | 0.2 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
0.1 | 0.2 | GO:0004849 | uridine kinase activity(GO:0004849) |
0.1 | 0.2 | GO:0052622 | 4-hydroxybenzoate octaprenyltransferase activity(GO:0008412) protoheme IX farnesyltransferase activity(GO:0008495) (S)-2,3-di-O-geranylgeranylglyceryl phosphate synthase activity(GO:0043888) cadaverine aminopropyltransferase activity(GO:0043918) agmatine aminopropyltransferase activity(GO:0043919) 1,4-dihydroxy-2-naphthoate octaprenyltransferase activity(GO:0046428) trans-pentaprenyltranstransferase activity(GO:0048045) ATP dimethylallyltransferase activity(GO:0052622) ADP dimethylallyltransferase activity(GO:0052623) |
0.0 | 0.1 | GO:0019145 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
0.0 | 0.1 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
0.0 | 0.0 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
0.0 | 0.2 | GO:0043515 | kinetochore binding(GO:0043515) |
0.0 | 0.1 | GO:0048256 | flap endonuclease activity(GO:0048256) |
0.0 | 0.4 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
0.0 | 0.5 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
0.0 | 0.2 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
0.0 | 0.1 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
0.0 | 0.2 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.0 | 0.3 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
0.0 | 0.6 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
0.0 | 0.1 | GO:0009041 | uridylate kinase activity(GO:0009041) |
0.0 | 0.1 | GO:0045503 | dynein light chain binding(GO:0045503) |
0.0 | 0.2 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.0 | 0.2 | GO:0005329 | dopamine transmembrane transporter activity(GO:0005329) |
0.0 | 0.8 | GO:0017025 | TBP-class protein binding(GO:0017025) |
0.0 | 0.8 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
0.0 | 0.2 | GO:0036310 | annealing helicase activity(GO:0036310) |
0.0 | 0.3 | GO:0043140 | ATP-dependent 3'-5' DNA helicase activity(GO:0043140) |
0.0 | 0.3 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
0.0 | 0.0 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.0 | 0.9 | GO:0008483 | transaminase activity(GO:0008483) |
0.0 | 0.1 | GO:0090482 | vitamin transmembrane transporter activity(GO:0090482) |
0.0 | 0.1 | GO:0017116 | single-stranded DNA-dependent ATP-dependent DNA helicase activity(GO:0017116) |
0.0 | 0.3 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
0.0 | 0.5 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
0.0 | 0.1 | GO:0055100 | adiponectin binding(GO:0055100) |
0.0 | 0.4 | GO:0070182 | DNA polymerase binding(GO:0070182) |
0.0 | 0.0 | GO:0030487 | inositol-4,5-bisphosphate 5-phosphatase activity(GO:0030487) |
0.0 | 0.1 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
0.0 | 0.0 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) |
0.0 | 0.2 | GO:0050815 | phosphoserine binding(GO:0050815) |
0.0 | 0.1 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.0 | 0.3 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.0 | 0.1 | GO:0052744 | phosphatidylinositol monophosphate phosphatase activity(GO:0052744) |
0.0 | 2.2 | GO:0008186 | ATP-dependent RNA helicase activity(GO:0004004) RNA-dependent ATPase activity(GO:0008186) |
0.0 | 0.6 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
0.0 | 0.1 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
0.0 | 0.2 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
0.0 | 0.1 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
0.0 | 0.2 | GO:0034902 | alkyl sulfatase activity(GO:0018741) endosulfan hemisulfate sulfatase activity(GO:0034889) endosulfan sulfate hydrolase activity(GO:0034902) |
0.0 | 0.1 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
0.0 | 0.2 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
0.0 | 0.3 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
0.0 | 0.2 | GO:0019992 | diacylglycerol binding(GO:0019992) |
0.0 | 0.9 | GO:0045296 | cadherin binding(GO:0045296) |
0.0 | 0.1 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
0.0 | 0.3 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.0 | 0.1 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.0 | 0.1 | GO:0002046 | opsin binding(GO:0002046) |
0.0 | 0.1 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
0.0 | 0.7 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
0.0 | 0.1 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.0 | 0.2 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
0.0 | 0.1 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
0.0 | 0.9 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
0.0 | 0.1 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
0.0 | 0.1 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
0.0 | 0.2 | GO:0031419 | cobalamin binding(GO:0031419) |
0.0 | 0.9 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
0.0 | 0.1 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
0.0 | 0.2 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
0.0 | 0.1 | GO:0005534 | galactose binding(GO:0005534) |
0.0 | 0.2 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.0 | 0.2 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.0 | 0.1 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.0 | 0.1 | GO:0042289 | MHC class II protein binding(GO:0042289) |
0.0 | 0.1 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
0.0 | 1.2 | GO:0004812 | aminoacyl-tRNA ligase activity(GO:0004812) |
0.0 | 0.6 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.0 | 0.2 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
0.0 | 0.1 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
0.0 | 0.2 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
0.0 | 0.1 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
0.0 | 0.2 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
0.0 | 0.1 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
0.0 | 0.1 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) |
0.0 | 0.1 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
0.0 | 0.8 | GO:0050699 | WW domain binding(GO:0050699) |
0.0 | 0.3 | GO:0005542 | folic acid binding(GO:0005542) |
0.0 | 0.1 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
0.0 | 0.3 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
0.0 | 0.1 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
0.0 | 0.3 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
0.0 | 0.0 | GO:0097617 | annealing activity(GO:0097617) |
0.0 | 0.4 | GO:0042608 | T cell receptor binding(GO:0042608) |
0.0 | 0.6 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.0 | 0.1 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
0.0 | 0.1 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
0.0 | 0.3 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
0.0 | 0.1 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
0.0 | 0.5 | GO:0070412 | R-SMAD binding(GO:0070412) |
0.0 | 0.2 | GO:0015651 | quaternary ammonium group transmembrane transporter activity(GO:0015651) |
0.0 | 0.4 | GO:0050681 | androgen receptor binding(GO:0050681) |
0.0 | 0.1 | GO:0086007 | voltage-gated calcium channel activity involved in cardiac muscle cell action potential(GO:0086007) |
0.0 | 0.6 | GO:0004623 | phospholipase A2 activity(GO:0004623) |
0.0 | 0.1 | GO:0043237 | laminin-1 binding(GO:0043237) |
0.0 | 0.5 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
0.0 | 0.5 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
0.0 | 0.1 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
0.0 | 0.2 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.0 | 0.1 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
0.0 | 0.7 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
0.0 | 0.5 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
0.0 | 0.8 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
0.0 | 2.5 | GO:0047485 | protein N-terminus binding(GO:0047485) |
0.0 | 0.1 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.0 | 0.1 | GO:0016004 | phospholipase activator activity(GO:0016004) |
0.0 | 0.1 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
0.0 | 0.0 | GO:0051430 | corticotropin-releasing hormone receptor 1 binding(GO:0051430) |
0.0 | 0.1 | GO:0046977 | TAP binding(GO:0046977) TAP1 binding(GO:0046978) TAP2 binding(GO:0046979) |
0.0 | 0.2 | GO:0008494 | translation activator activity(GO:0008494) |
0.0 | 0.1 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
0.0 | 0.3 | GO:0010181 | FMN binding(GO:0010181) |
0.0 | 0.1 | GO:0017040 | ceramidase activity(GO:0017040) |
0.0 | 0.2 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
0.0 | 1.2 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
0.0 | 0.2 | GO:0008020 | G-protein coupled photoreceptor activity(GO:0008020) |
0.0 | 0.0 | GO:0004661 | protein geranylgeranyltransferase activity(GO:0004661) |
0.0 | 0.1 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
0.0 | 0.0 | GO:0001226 | RNA polymerase II transcription corepressor binding(GO:0001226) |
0.0 | 0.1 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
0.0 | 0.1 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.0 | 0.1 | GO:0017127 | cholesterol transporter activity(GO:0017127) |
0.0 | 0.3 | GO:0051400 | BH domain binding(GO:0051400) |
0.0 | 0.0 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
0.0 | 0.1 | GO:0050051 | leukotriene-B4 20-monooxygenase activity(GO:0050051) |
0.0 | 0.1 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
0.0 | 0.0 | GO:0030619 | U1 snRNA binding(GO:0030619) |
0.0 | 0.0 | GO:0070698 | type I activin receptor binding(GO:0070698) |
0.0 | 0.3 | GO:0034185 | apolipoprotein binding(GO:0034185) |
0.0 | 0.1 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
0.0 | 0.1 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
0.0 | 0.6 | GO:0004364 | glutathione transferase activity(GO:0004364) |
0.0 | 0.1 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.0 | 0.3 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.0 | 0.0 | GO:0070051 | fibrinogen binding(GO:0070051) |
0.0 | 0.1 | GO:0008390 | testosterone 16-alpha-hydroxylase activity(GO:0008390) |
0.0 | 0.1 | GO:0008948 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) oxaloacetate decarboxylase activity(GO:0008948) |
0.0 | 0.1 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
0.0 | 0.2 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
0.0 | 0.3 | GO:0004697 | protein kinase C activity(GO:0004697) |
0.0 | 0.1 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
0.0 | 0.1 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
0.0 | 0.1 | GO:0019808 | polyamine binding(GO:0019808) |
0.0 | 0.1 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.0 | 0.1 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
0.0 | 0.1 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.0 | 0.0 | GO:1990188 | euchromatin binding(GO:1990188) |
0.0 | 0.0 | GO:0030519 | snoRNP binding(GO:0030519) |
0.0 | 0.1 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
0.0 | 0.2 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
0.0 | 0.1 | GO:0016937 | short-branched-chain-acyl-CoA dehydrogenase activity(GO:0016937) |
0.0 | 0.1 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.0 | 0.1 | GO:0031705 | bombesin receptor binding(GO:0031705) |
0.0 | 0.2 | GO:0016662 | oxidoreductase activity, acting on other nitrogenous compounds as donors, cytochrome as acceptor(GO:0016662) |
0.0 | 0.1 | GO:0001013 | RNA polymerase I regulatory region DNA binding(GO:0001013) |
0.0 | 0.0 | GO:0097001 | ceramide binding(GO:0097001) |
0.0 | 0.1 | GO:0015106 | bicarbonate transmembrane transporter activity(GO:0015106) |
0.0 | 0.1 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.0 | 0.0 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
0.0 | 0.1 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
0.0 | 0.1 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
0.0 | 0.1 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
0.0 | 0.1 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
0.0 | 0.1 | GO:0033695 | oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
0.0 | 0.1 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
0.0 | 0.1 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
0.0 | 0.2 | GO:0004017 | adenylate kinase activity(GO:0004017) |
0.0 | 0.1 | GO:0016530 | metallochaperone activity(GO:0016530) |
0.0 | 0.1 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.0 | 0.1 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.0 | 0.1 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.0 | 0.2 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.0 | 0.2 | GO:0008143 | poly(A) binding(GO:0008143) |
0.0 | 0.0 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
0.0 | 0.1 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
0.0 | 0.2 | GO:0004707 | MAP kinase activity(GO:0004707) |
0.0 | 0.1 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
0.0 | 0.1 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
0.0 | 0.6 | GO:0003730 | mRNA 3'-UTR binding(GO:0003730) |
0.0 | 0.1 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.0 | 0.1 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
0.0 | 0.0 | GO:0046848 | hydroxyapatite binding(GO:0046848) |
0.0 | 0.0 | GO:0032557 | pyrimidine ribonucleotide binding(GO:0032557) |
0.0 | 1.2 | GO:0005178 | integrin binding(GO:0005178) |
0.0 | 0.5 | GO:0004448 | isocitrate dehydrogenase activity(GO:0004448) |
0.0 | 0.1 | GO:1990446 | U1 snRNP binding(GO:1990446) |
0.0 | 0.2 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
0.0 | 0.1 | GO:0001848 | complement binding(GO:0001848) |
0.0 | 0.0 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.0 | 0.2 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
0.0 | 0.0 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
0.0 | 0.0 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
0.0 | 0.4 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
0.0 | 0.2 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
0.0 | 0.3 | GO:0033558 | protein deacetylase activity(GO:0033558) |
0.0 | 0.2 | GO:0051861 | glycolipid binding(GO:0051861) |
0.0 | 0.0 | GO:0004346 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
0.0 | 0.1 | GO:0005436 | sodium:phosphate symporter activity(GO:0005436) |
0.0 | 0.0 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
0.0 | 0.3 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.0 | 0.1 | GO:0004985 | opioid receptor activity(GO:0004985) |
0.0 | 0.1 | GO:0016679 | oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) |
0.0 | 0.1 | GO:0005499 | vitamin D binding(GO:0005499) |
0.0 | 0.1 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
0.0 | 0.2 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
0.0 | 0.1 | GO:0070324 | thyroid hormone binding(GO:0070324) |
0.0 | 0.2 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
0.0 | 0.1 | GO:0008410 | CoA-transferase activity(GO:0008410) |
0.0 | 0.2 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
0.0 | 0.1 | GO:0004622 | lysophospholipase activity(GO:0004622) |
0.0 | 0.1 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
0.0 | 0.1 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
0.0 | 0.1 | GO:0016721 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
0.0 | 0.0 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.0 | 0.0 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
0.0 | 0.1 | GO:0001671 | ATPase activator activity(GO:0001671) |
0.0 | 0.1 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
0.0 | 0.0 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
0.0 | 0.0 | GO:0004676 | 3-phosphoinositide-dependent protein kinase activity(GO:0004676) |
0.0 | 0.3 | GO:0042605 | peptide antigen binding(GO:0042605) |
0.0 | 0.0 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
0.0 | 0.0 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
0.0 | 0.1 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
0.0 | 0.1 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
0.0 | 0.0 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
0.0 | 0.1 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
0.0 | 0.0 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.0 | 0.1 | GO:0102344 | 3-hydroxy-behenoyl-CoA dehydratase activity(GO:0102344) 3-hydroxy-lignoceroyl-CoA dehydratase activity(GO:0102345) |
0.0 | 0.0 | GO:0035877 | death effector domain binding(GO:0035877) |
0.0 | 0.1 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
0.0 | 0.1 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
0.0 | 0.0 | GO:0004065 | arylsulfatase activity(GO:0004065) |
0.0 | 0.4 | GO:0003755 | peptidyl-prolyl cis-trans isomerase activity(GO:0003755) |
0.0 | 0.0 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.0 | 0.0 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.0 | 0.0 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
0.0 | 0.3 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
0.0 | 0.2 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
0.0 | 0.0 | GO:0018685 | alkane 1-monooxygenase activity(GO:0018685) |
0.0 | 0.3 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
0.0 | 0.0 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
0.0 | 0.0 | GO:0003985 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
0.0 | 0.0 | GO:0004096 | catalase activity(GO:0004096) |
0.0 | 0.0 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
0.0 | 0.0 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
0.0 | 0.3 | GO:0048487 | beta-tubulin binding(GO:0048487) |
0.0 | 0.1 | GO:0031690 | adrenergic receptor binding(GO:0031690) |
0.0 | 0.0 | GO:0008504 | monoamine transmembrane transporter activity(GO:0008504) |
0.0 | 0.1 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
0.0 | 0.1 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
0.0 | 0.1 | GO:0015036 | disulfide oxidoreductase activity(GO:0015036) |
0.0 | 0.1 | GO:0033691 | sialic acid binding(GO:0033691) |
0.0 | 0.2 | GO:0016684 | oxidoreductase activity, acting on peroxide as acceptor(GO:0016684) |
0.0 | 0.4 | GO:0050839 | cell adhesion molecule binding(GO:0050839) |
0.0 | 0.1 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
0.0 | 0.2 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
0.0 | 0.1 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) |
0.0 | 0.1 | GO:0005123 | death receptor binding(GO:0005123) |
0.0 | 0.0 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
0.0 | 0.2 | GO:0016765 | transferase activity, transferring alkyl or aryl (other than methyl) groups(GO:0016765) |
0.0 | 0.1 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
0.0 | 0.0 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
0.0 | 0.0 | GO:0019959 | interleukin-8 binding(GO:0019959) |
0.0 | 0.0 | GO:0004942 | anaphylatoxin receptor activity(GO:0004942) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 0.3 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
0.1 | 1.2 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.1 | 0.8 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
0.1 | 0.1 | PID INSULIN PATHWAY | Insulin Pathway |
0.1 | 0.3 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.1 | 0.1 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
0.1 | 0.1 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
0.0 | 1.3 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
0.0 | 0.4 | ST STAT3 PATHWAY | STAT3 Pathway |
0.0 | 2.4 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
0.0 | 0.7 | PID AURORA A PATHWAY | Aurora A signaling |
0.0 | 1.2 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
0.0 | 0.4 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.0 | 1.8 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
0.0 | 0.9 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.0 | 0.9 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.0 | 0.1 | PID S1P S1P1 PATHWAY | S1P1 pathway |
0.0 | 0.1 | PID EPO PATHWAY | EPO signaling pathway |
0.0 | 0.6 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
0.0 | 0.4 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.0 | 0.4 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
0.0 | 1.3 | PID PLK1 PATHWAY | PLK1 signaling events |
0.0 | 0.2 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.0 | 0.6 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
0.0 | 1.7 | PID CMYB PATHWAY | C-MYB transcription factor network |
0.0 | 0.4 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.0 | 1.4 | PID P73PATHWAY | p73 transcription factor network |
0.0 | 0.1 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
0.0 | 0.3 | ST GA12 PATHWAY | G alpha 12 Pathway |
0.0 | 0.6 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
0.0 | 0.1 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
0.0 | 1.5 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
0.0 | 1.1 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
0.0 | 0.6 | PID ARF6 PATHWAY | Arf6 signaling events |
0.0 | 0.1 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
0.0 | 0.6 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
0.0 | 0.4 | PID REELIN PATHWAY | Reelin signaling pathway |
0.0 | 0.2 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.0 | 0.8 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.0 | 0.2 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.0 | 0.4 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
0.0 | 0.6 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
0.0 | 0.1 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.0 | 0.3 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
0.0 | 0.1 | PID FOXO PATHWAY | FoxO family signaling |
0.0 | 0.4 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
0.0 | 0.4 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
0.0 | 0.2 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
0.0 | 0.6 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
0.0 | 0.0 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
0.0 | 0.4 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
0.0 | 0.3 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
0.0 | 0.2 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.0 | 0.4 | PID AP1 PATHWAY | AP-1 transcription factor network |
0.0 | 0.3 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
0.0 | 0.3 | PID ATR PATHWAY | ATR signaling pathway |
0.0 | 0.4 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
0.0 | 0.1 | PID MYC PATHWAY | C-MYC pathway |
0.0 | 0.1 | PID IFNG PATHWAY | IFN-gamma pathway |
0.0 | 0.2 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.0 | 0.1 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
0.0 | 0.2 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
0.0 | 0.0 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
0.0 | 0.2 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.0 | 0.4 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
0.0 | 0.1 | PID TNF PATHWAY | TNF receptor signaling pathway |
0.0 | 0.0 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.0 | 0.1 | ST ADRENERGIC | Adrenergic Pathway |
0.0 | 0.5 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
0.0 | 0.1 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.0 | 0.2 | PID FANCONI PATHWAY | Fanconi anemia pathway |
0.0 | 0.2 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
0.0 | 0.2 | PID RAS PATHWAY | Regulation of Ras family activation |
0.0 | 0.3 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.0 | 0.0 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
0.0 | 0.1 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
0.0 | 0.0 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
0.0 | 0.6 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
0.0 | 0.2 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 0.8 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
0.1 | 0.8 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
0.1 | 0.8 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
0.1 | 0.8 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.1 | 1.4 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.1 | 2.0 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.1 | 0.1 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
0.1 | 1.2 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
0.1 | 0.4 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
0.1 | 1.6 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
0.1 | 1.3 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
0.1 | 0.3 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
0.1 | 0.6 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
0.1 | 1.1 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.1 | 0.7 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
0.1 | 0.6 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.1 | 0.7 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
0.1 | 0.5 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
0.1 | 1.2 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
0.1 | 0.8 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
0.1 | 0.5 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
0.0 | 0.2 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
0.0 | 0.9 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.0 | 0.1 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
0.0 | 0.6 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.0 | 2.1 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
0.0 | 1.0 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
0.0 | 0.3 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
0.0 | 0.2 | REACTOME REGULATION OF INSULIN SECRETION | Genes involved in Regulation of Insulin Secretion |
0.0 | 0.3 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.0 | 0.5 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
0.0 | 0.7 | REACTOME TRNA AMINOACYLATION | Genes involved in tRNA Aminoacylation |
0.0 | 0.4 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
0.0 | 0.3 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.0 | 1.0 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
0.0 | 0.4 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.0 | 0.2 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
0.0 | 0.5 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
0.0 | 0.2 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.0 | 0.5 | REACTOME P130CAS LINKAGE TO MAPK SIGNALING FOR INTEGRINS | Genes involved in p130Cas linkage to MAPK signaling for integrins |
0.0 | 0.0 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
0.0 | 1.5 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
0.0 | 0.9 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.0 | 0.3 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.0 | 0.3 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
0.0 | 0.5 | REACTOME INHIBITION OF THE PROTEOLYTIC ACTIVITY OF APC C REQUIRED FOR THE ONSET OF ANAPHASE BY MITOTIC SPINDLE CHECKPOINT COMPONENTS | Genes involved in Inhibition of the proteolytic activity of APC/C required for the onset of anaphase by mitotic spindle checkpoint components |
0.0 | 0.0 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
0.0 | 0.4 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.0 | 0.5 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
0.0 | 0.1 | REACTOME AQUAPORIN MEDIATED TRANSPORT | Genes involved in Aquaporin-mediated transport |
0.0 | 0.0 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
0.0 | 0.6 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
0.0 | 0.2 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
0.0 | 0.6 | REACTOME INTERFERON GAMMA SIGNALING | Genes involved in Interferon gamma signaling |
0.0 | 0.4 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
0.0 | 0.1 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.0 | 0.1 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
0.0 | 0.5 | REACTOME AMYLOIDS | Genes involved in Amyloids |
0.0 | 0.2 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.0 | 0.1 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
0.0 | 0.3 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
0.0 | 0.5 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
0.0 | 0.3 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
0.0 | 0.4 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.0 | 0.2 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
0.0 | 0.2 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.0 | 0.2 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
0.0 | 0.2 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
0.0 | 0.2 | REACTOME OPSINS | Genes involved in Opsins |
0.0 | 0.1 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
0.0 | 2.6 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
0.0 | 0.2 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.0 | 0.2 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
0.0 | 0.1 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
0.0 | 0.3 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.0 | 0.2 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
0.0 | 0.2 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
0.0 | 0.5 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
0.0 | 0.4 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
0.0 | 0.2 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
0.0 | 0.2 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
0.0 | 0.3 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
0.0 | 0.4 | REACTOME PROCESSING OF CAPPED INTRONLESS PRE MRNA | Genes involved in Processing of Capped Intronless Pre-mRNA |
0.0 | 0.1 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
0.0 | 0.1 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
0.0 | 0.3 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
0.0 | 0.4 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
0.0 | 0.1 | REACTOME DOWNSTREAM SIGNAL TRANSDUCTION | Genes involved in Downstream signal transduction |
0.0 | 0.1 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.0 | 0.0 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
0.0 | 0.2 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
0.0 | 0.2 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
0.0 | 0.2 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.0 | 0.2 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
0.0 | 0.0 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.0 | 0.4 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
0.0 | 0.3 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.0 | 0.5 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
0.0 | 0.3 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.0 | 0.0 | REACTOME ARMS MEDIATED ACTIVATION | Genes involved in ARMS-mediated activation |
0.0 | 1.2 | REACTOME LATE PHASE OF HIV LIFE CYCLE | Genes involved in Late Phase of HIV Life Cycle |
0.0 | 0.2 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
0.0 | 0.7 | REACTOME RESPONSE TO ELEVATED PLATELET CYTOSOLIC CA2 | Genes involved in Response to elevated platelet cytosolic Ca2+ |
0.0 | 0.3 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.0 | 0.1 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
0.0 | 0.4 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
0.0 | 0.3 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
0.0 | 0.1 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.0 | 0.1 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.0 | 0.2 | REACTOME ERK MAPK TARGETS | Genes involved in ERK/MAPK targets |
0.0 | 0.3 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.0 | 0.1 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.0 | 0.1 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
0.0 | 0.1 | REACTOME PYRUVATE METABOLISM | Genes involved in Pyruvate metabolism |
0.0 | 0.1 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
0.0 | 0.1 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.0 | 0.1 | REACTOME CHROMOSOME MAINTENANCE | Genes involved in Chromosome Maintenance |
0.0 | 0.0 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |