Gene Symbol | Gene ID | Gene Info |
---|---|---|
Maz
|
ENSMUSG00000030678.6 | Maz |
Zfp281
|
ENSMUSG00000041483.8 | Zfp281 |
Gene | Promoter | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Maz | chr7_127025082_127025245 | 31 | 0.908196 | -0.91 | 1.2e-02 | Click! |
Maz | chr7_127025510_127025786 | 516 | 0.458516 | -0.85 | 3.3e-02 | Click! |
Maz | chr7_127026221_127026402 | 141 | 0.841934 | -0.78 | 6.8e-02 | Click! |
Maz | chr7_127026716_127026881 | 226 | 0.745097 | -0.43 | 3.9e-01 | Click! |
Maz | chr7_127025259_127025457 | 226 | 0.761119 | -0.09 | 8.6e-01 | Click! |
Zfp281 | chr1_136625470_136625621 | 644 | 0.471751 | -0.80 | 5.5e-02 | Click! |
Zfp281 | chr1_136632944_136633348 | 8245 | 0.127035 | 0.75 | 8.5e-02 | Click! |
Zfp281 | chr1_136627419_136627612 | 2614 | 0.176990 | -0.68 | 1.4e-01 | Click! |
Zfp281 | chr1_136629461_136629624 | 4641 | 0.141114 | 0.67 | 1.4e-01 | Click! |
Zfp281 | chr1_136627715_136627903 | 2908 | 0.167550 | -0.62 | 1.9e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr11_98767109_98767369 | 7.32 |
Nr1d1 |
nuclear receptor subfamily 1, group D, member 1 |
3187 |
0.13 |
chr17_57199524_57200036 | 4.98 |
Tnfsf14 |
tumor necrosis factor (ligand) superfamily, member 14 |
5603 |
0.12 |
chr11_98767825_98767976 | 4.87 |
Nr1d1 |
nuclear receptor subfamily 1, group D, member 1 |
2526 |
0.15 |
chr11_98767399_98767584 | 4.62 |
Nr1d1 |
nuclear receptor subfamily 1, group D, member 1 |
2935 |
0.14 |
chr11_98766772_98767040 | 4.49 |
Nr1d1 |
nuclear receptor subfamily 1, group D, member 1 |
3520 |
0.12 |
chr8_119417171_119417322 | 3.46 |
Osgin1 |
oxidative stress induced growth inhibitor 1 |
16878 |
0.13 |
chr8_119445523_119446899 | 3.25 |
Necab2 |
N-terminal EF-hand calcium binding protein 2 |
508 |
0.74 |
chr15_7198920_7199078 | 3.11 |
Egflam |
EGF-like, fibronectin type III and laminin G domains |
24070 |
0.22 |
chr17_57200639_57201014 | 3.10 |
Tnfsf14 |
tumor necrosis factor (ligand) superfamily, member 14 |
6649 |
0.11 |
chr14_65299395_65299546 | 2.87 |
Gm48433 |
predicted gene, 48433 |
26861 |
0.13 |
chr7_127026907_127027653 | 2.77 |
Maz |
MYC-associated zinc finger protein (purine-binding transcription factor) |
243 |
0.69 |
chr7_27252126_27252620 | 2.52 |
Gm44641 |
predicted gene 44641 |
197 |
0.84 |
chr11_95032963_95033336 | 2.46 |
Gm11513 |
predicted gene 11513 |
390 |
0.76 |
chr5_120643717_120643868 | 2.44 |
Gm42657 |
predicted gene 42657 |
2171 |
0.14 |
chr10_79879613_79879900 | 2.33 |
Prtn3 |
proteinase 3 |
142 |
0.85 |
chr1_74807002_74807292 | 2.27 |
Wnt10a |
wingless-type MMTV integration site family, member 10A |
13784 |
0.11 |
chrX_77433202_77433456 | 2.23 |
Gm5937 |
predicted gene 5937 |
23257 |
0.22 |
chrX_42068446_42068784 | 2.15 |
Xiap |
X-linked inhibitor of apoptosis |
140 |
0.97 |
chr15_77150122_77150279 | 2.13 |
Rbfox2 |
RNA binding protein, fox-1 homolog (C. elegans) 2 |
3356 |
0.18 |
chr13_55211103_55211935 | 2.11 |
Nsd1 |
nuclear receptor-binding SET-domain protein 1 |
22 |
0.97 |
chr12_102788080_102788385 | 2.09 |
Gm47042 |
predicted gene, 47042 |
23520 |
0.08 |
chr8_119417331_119417482 | 2.01 |
Osgin1 |
oxidative stress induced growth inhibitor 1 |
16718 |
0.14 |
chr10_85102143_85102819 | 2.00 |
Fhl4 |
four and a half LIM domains 4 |
14 |
0.65 |
chr15_80159342_80159507 | 1.97 |
Mgat3 |
mannoside acetylglucosaminyltransferase 3 |
14297 |
0.11 |
chr19_29806024_29806429 | 1.96 |
9930021J03Rik |
RIKEN cDNA 9930021J03 gene |
237 |
0.69 |
chr1_72806058_72806277 | 1.94 |
Igfbp2 |
insulin-like growth factor binding protein 2 |
18336 |
0.2 |
chr11_16902164_16902468 | 1.93 |
Egfr |
epidermal growth factor receptor |
2869 |
0.27 |
chr1_88316276_88316427 | 1.93 |
Trpm8 |
transient receptor potential cation channel, subfamily M, member 8 |
2562 |
0.2 |
chr7_45705992_45706174 | 1.92 |
Dbp |
D site albumin promoter binding protein |
799 |
0.31 |
chr11_69416113_69416276 | 1.90 |
Kdm6b |
KDM1 lysine (K)-specific demethylase 6B |
2519 |
0.13 |
chr10_80152069_80152378 | 1.90 |
Midn |
midnolin |
985 |
0.31 |
chr19_41482156_41482948 | 1.88 |
Lcor |
ligand dependent nuclear receptor corepressor |
85 |
0.98 |
chr11_116615779_116616354 | 1.87 |
Rhbdf2 |
rhomboid 5 homolog 2 |
8134 |
0.1 |
chr3_89378414_89378785 | 1.86 |
Zbtb7b |
zinc finger and BTB domain containing 7B |
8590 |
0.06 |
chr15_102103646_102103840 | 1.86 |
Tns2 |
tensin 2 |
682 |
0.55 |
chr4_132260865_132261295 | 1.85 |
Gmeb1 |
glucocorticoid modulatory element binding protein 1 |
441 |
0.59 |
chr9_106452941_106453115 | 1.84 |
Gm28959 |
predicted gene 28959 |
110 |
0.68 |
chr1_153332770_153333177 | 1.83 |
Lamc1 |
laminin, gamma 1 |
187 |
0.94 |
chr3_105705277_105705434 | 1.76 |
Inka2 |
inka box actin regulator 2 |
103 |
0.95 |
chr3_41582417_41582568 | 1.76 |
Jade1 |
jade family PHD finger 1 |
1636 |
0.33 |
chr18_74805142_74805295 | 1.76 |
Acaa2 |
acetyl-Coenzyme A acyltransferase 2 (mitochondrial 3-oxoacyl-Coenzyme A thiolase) |
11835 |
0.15 |
chr9_8003649_8004083 | 1.73 |
Yap1 |
yes-associated protein 1 |
91 |
0.94 |
chr19_10101442_10101987 | 1.72 |
Fads2 |
fatty acid desaturase 2 |
32 |
0.97 |
chr11_98953496_98953709 | 1.69 |
Rara |
retinoic acid receptor, alpha |
6810 |
0.11 |
chr6_82763951_82764122 | 1.67 |
Gm17034 |
predicted gene 17034 |
246 |
0.9 |
chr6_120665412_120665778 | 1.65 |
Cecr2 |
CECR2, histone acetyl-lysine reader |
774 |
0.66 |
chr9_65084518_65084694 | 1.65 |
Dpp8 |
dipeptidylpeptidase 8 |
8858 |
0.14 |
chr7_25220574_25220762 | 1.65 |
Dedd2 |
death effector domain-containing DNA binding protein 2 |
53 |
0.89 |
chr3_8753511_8753662 | 1.63 |
Gm37647 |
predicted gene, 37647 |
6762 |
0.19 |
chr3_88950162_88950588 | 1.60 |
Dap3 |
death associated protein 3 |
39 |
0.75 |
chr3_89147597_89148051 | 1.59 |
Hcn3 |
hyperpolarization-activated, cyclic nucleotide-gated K+ 3 |
3390 |
0.09 |
chr17_5958348_5958506 | 1.58 |
Synj2 |
synaptojanin 2 |
17024 |
0.17 |
chr10_69910495_69910908 | 1.57 |
Ank3 |
ankyrin 3, epithelial |
4164 |
0.35 |
chr9_98424555_98424727 | 1.56 |
Rbp1 |
retinol binding protein 1, cellular |
1680 |
0.4 |
chr8_104340179_104340791 | 1.56 |
Cmtm3 |
CKLF-like MARVEL transmembrane domain containing 3 |
42 |
0.94 |
chr9_122713984_122714139 | 1.55 |
Gm47136 |
predicted gene, 47136 |
272 |
0.8 |
chr11_51640853_51641004 | 1.54 |
Rmnd5b |
required for meiotic nuclear division 5 homolog B |
5032 |
0.13 |
chr3_52101992_52102344 | 1.54 |
Maml3 |
mastermind like transcriptional coactivator 3 |
2908 |
0.2 |
chr10_81095473_81095680 | 1.52 |
Creb3l3 |
cAMP responsive element binding protein 3-like 3 |
3001 |
0.1 |
chr17_57200072_57200273 | 1.52 |
Tnfsf14 |
tumor necrosis factor (ligand) superfamily, member 14 |
5995 |
0.12 |
chr18_34511486_34511736 | 1.52 |
n-R5s24 |
nuclear encoded rRNA 5S 24 |
1874 |
0.27 |
chr5_138979896_138980396 | 1.50 |
Pdgfa |
platelet derived growth factor, alpha |
14135 |
0.17 |
chr7_45711383_45711838 | 1.48 |
Sphk2 |
sphingosine kinase 2 |
1833 |
0.12 |
chr1_155112239_155112390 | 1.48 |
Ier5 |
immediate early response 5 |
12678 |
0.14 |
chr11_53818731_53818912 | 1.48 |
Gm12216 |
predicted gene 12216 |
22946 |
0.11 |
chr9_74894770_74895613 | 1.47 |
Onecut1 |
one cut domain, family member 1 |
28707 |
0.13 |
chr5_74738458_74738660 | 1.47 |
Gm15985 |
predicted gene 15985 |
4108 |
0.2 |
chr2_29973635_29973786 | 1.45 |
Sptan1 |
spectrin alpha, non-erythrocytic 1 |
4670 |
0.13 |
chr2_152612307_152612458 | 1.44 |
Gm14163 |
predicted gene 14163 |
3208 |
0.1 |
chr16_91495595_91496056 | 1.44 |
Ifnar1 |
interferon (alpha and beta) receptor 1 |
3176 |
0.13 |
chr17_47988159_47988330 | 1.43 |
Gm14871 |
predicted gene 14871 |
15328 |
0.13 |
chr4_155316923_155317235 | 1.42 |
Prkcz |
protein kinase C, zeta |
15908 |
0.15 |
chr7_24610415_24610850 | 1.42 |
Phldb3 |
pleckstrin homology like domain, family B, member 3 |
131 |
0.91 |
chr11_3289571_3289722 | 1.42 |
Patz1 |
POZ (BTB) and AT hook containing zinc finger 1 |
347 |
0.8 |
chr1_86441878_86442276 | 1.41 |
Tex44 |
testis expressed 44 |
15748 |
0.11 |
chr10_21889511_21889671 | 1.41 |
Sgk1 |
serum/glucocorticoid regulated kinase 1 |
7222 |
0.18 |
chr9_71675857_71676008 | 1.41 |
Cgnl1 |
cingulin-like 1 |
27582 |
0.18 |
chr11_98795069_98795435 | 1.40 |
Msl1 |
male specific lethal 1 |
264 |
0.84 |
chr19_38120120_38120558 | 1.39 |
Rbp4 |
retinol binding protein 4, plasma |
4386 |
0.17 |
chr15_84853852_84854164 | 1.39 |
Phf21b |
PHD finger protein 21B |
1102 |
0.45 |
chr11_69980994_69981145 | 1.39 |
Ctdnep1 |
CTD nuclear envelope phosphatase 1 |
87 |
0.55 |
chr5_144255609_144256174 | 1.39 |
2900089D17Rik |
RIKEN cDNA 2900089D17 gene |
295 |
0.71 |
chr18_33437665_33437816 | 1.38 |
Nrep |
neuronal regeneration related protein |
25695 |
0.18 |
chr18_35829539_35830125 | 1.38 |
Cxxc5 |
CXXC finger 5 |
44 |
0.94 |
chr9_107676427_107676600 | 1.38 |
Gnat1 |
guanine nucleotide binding protein, alpha transducing 1 |
72 |
0.93 |
chr1_134556289_134556846 | 1.38 |
Kdm5b |
lysine (K)-specific demethylase 5B |
3604 |
0.15 |
chr7_36697808_36698005 | 1.37 |
Tshz3 |
teashirt zinc finger family member 3 |
212 |
0.9 |
chr10_127668046_127668306 | 1.37 |
Nab2 |
Ngfi-A binding protein 2 |
392 |
0.62 |
chr4_138510025_138510190 | 1.37 |
Camk2n1 |
calcium/calmodulin-dependent protein kinase II inhibitor 1 |
55793 |
0.09 |
chr2_170176271_170176422 | 1.36 |
Zfp217 |
zinc finger protein 217 |
28243 |
0.22 |
chr12_52503578_52503953 | 1.36 |
Arhgap5 |
Rho GTPase activating protein 5 |
207 |
0.94 |
chr4_117981622_117981822 | 1.36 |
9530034E10Rik |
RIKEN cDNA 9530034E10 gene |
6686 |
0.15 |
chr8_13648658_13649104 | 1.35 |
Rasa3 |
RAS p21 protein activator 3 |
28570 |
0.15 |
chr18_73572542_73572927 | 1.35 |
Mex3c |
mex3 RNA binding family member C |
310 |
0.9 |
chr4_131924003_131924348 | 1.35 |
Tmem200b |
transmembrane protein 200B |
2404 |
0.15 |
chr8_119416779_119416930 | 1.34 |
Osgin1 |
oxidative stress induced growth inhibitor 1 |
17270 |
0.13 |
chr11_75462092_75462507 | 1.33 |
Tlcd2 |
TLC domain containing 2 |
584 |
0.35 |
chr5_105700503_105701198 | 1.33 |
Lrrc8d |
leucine rich repeat containing 8D |
16 |
0.98 |
chr4_133753896_133754062 | 1.33 |
Arid1a |
AT rich interactive domain 1A (SWI-like) |
3 |
0.97 |
chr15_101266552_101266884 | 1.33 |
Nr4a1 |
nuclear receptor subfamily 4, group A, member 1 |
128 |
0.93 |
chr1_133908470_133908621 | 1.33 |
Optc |
opticin |
546 |
0.66 |
chr19_16132652_16132926 | 1.32 |
Gnaq |
guanine nucleotide binding protein, alpha q polypeptide |
42 |
0.98 |
chr6_145855716_145856207 | 1.29 |
Gm43909 |
predicted gene, 43909 |
7336 |
0.17 |
chr15_102240663_102241004 | 1.29 |
Rarg |
retinoic acid receptor, gamma |
2756 |
0.13 |
chr7_31008253_31008404 | 1.29 |
Fam187b |
family with sequence similarity 187, member B |
26458 |
0.06 |
chr17_24267169_24267481 | 1.29 |
Ccnf |
cyclin F |
15841 |
0.09 |
chr2_78868942_78869388 | 1.29 |
Ube2e3 |
ubiquitin-conjugating enzyme E2E 3 |
75 |
0.98 |
chr10_24227305_24227456 | 1.29 |
Moxd1 |
monooxygenase, DBH-like 1 |
3835 |
0.24 |
chr5_112242342_112242634 | 1.29 |
Cryba4 |
crystallin, beta A4 |
8674 |
0.11 |
chr7_68571726_68571877 | 1.28 |
Gm44887 |
predicted gene 44887 |
27053 |
0.18 |
chr9_35045000_35045333 | 1.28 |
St3gal4 |
ST3 beta-galactoside alpha-2,3-sialyltransferase 4 |
10628 |
0.18 |
chr4_154497558_154497782 | 1.28 |
Prdm16 |
PR domain containing 16 |
31095 |
0.16 |
chr1_10156105_10156276 | 1.28 |
Arfgef1 |
ADP-ribosylation factor guanine nucleotide-exchange factor 1(brefeldin A-inhibited) |
1660 |
0.36 |
chr3_90265438_90266011 | 1.27 |
Dennd4b |
DENN/MADD domain containing 4B |
539 |
0.55 |
chr3_41565496_41565829 | 1.27 |
Jade1 |
jade family PHD finger 1 |
742 |
0.56 |
chr19_10236152_10236493 | 1.26 |
Myrf |
myelin regulatory factor |
4282 |
0.13 |
chr1_87032318_87032489 | 1.26 |
Gm37447 |
predicted gene, 37447 |
4320 |
0.14 |
chr13_109485029_109485208 | 1.25 |
Pde4d |
phosphodiesterase 4D, cAMP specific |
42935 |
0.21 |
chr3_51340630_51340945 | 1.24 |
Elf2 |
E74-like factor 2 |
124 |
0.94 |
chr19_8228991_8229142 | 1.24 |
Slc22a29 |
solute carrier family 22. member 29 |
10166 |
0.16 |
chr7_26833022_26833239 | 1.24 |
Cyp2a5 |
cytochrome P450, family 2, subfamily a, polypeptide 5 |
2175 |
0.27 |
chr6_82041430_82042014 | 1.24 |
Eva1a |
eva-1 homolog A (C. elegans) |
34 |
0.97 |
chrX_13846465_13846885 | 1.24 |
Cask |
calcium/calmodulin-dependent serine protein kinase (MAGUK family) |
60 |
0.98 |
chr3_101805744_101805931 | 1.23 |
Mab21l3 |
mab-21-like 3 |
30386 |
0.17 |
chr11_117878584_117878761 | 1.23 |
Tha1 |
threonine aldolase 1 |
5191 |
0.11 |
chr11_59804844_59804999 | 1.22 |
Flcn |
folliculin |
4667 |
0.11 |
chr4_150825989_150826153 | 1.22 |
Gm13049 |
predicted gene 13049 |
338 |
0.86 |
chr5_139803654_139803817 | 1.22 |
Tmem184a |
transmembrane protein 184a |
4245 |
0.14 |
chr8_61316121_61316272 | 1.21 |
1700001D01Rik |
RIKEN cDNA 1700001D01 gene |
27324 |
0.16 |
chr2_119300835_119301028 | 1.20 |
Vps18 |
VPS18 CORVET/HOPS core subunit |
12144 |
0.1 |
chr19_58441609_58442090 | 1.20 |
Gfra1 |
glial cell line derived neurotrophic factor family receptor alpha 1 |
12617 |
0.22 |
chr11_98768600_98768751 | 1.19 |
Nr1d1 |
nuclear receptor subfamily 1, group D, member 1 |
1751 |
0.2 |
chr6_125089845_125090127 | 1.19 |
Chd4 |
chromodomain helicase DNA binding protein 4 |
5995 |
0.07 |
chr7_99565291_99565442 | 1.19 |
Gm44914 |
predicted gene 44914 |
5474 |
0.12 |
chr5_120481198_120481714 | 1.17 |
Gm15690 |
predicted gene 15690 |
553 |
0.54 |
chr5_108694583_108695258 | 1.17 |
Fgfrl1 |
fibroblast growth factor receptor-like 1 |
418 |
0.74 |
chr15_78928152_78928339 | 1.17 |
Lgals1 |
lectin, galactose binding, soluble 1 |
1519 |
0.18 |
chr11_109651379_109651664 | 1.16 |
Prkar1a |
protein kinase, cAMP dependent regulatory, type I, alpha |
600 |
0.7 |
chr7_70359312_70359799 | 1.16 |
Nr2f2 |
nuclear receptor subfamily 2, group F, member 2 |
340 |
0.81 |
chr16_93369696_93369958 | 1.16 |
Mir802 |
microRNA 802 |
107 |
0.95 |
chr11_69601181_69601332 | 1.16 |
Atp1b2 |
ATPase, Na+/K+ transporting, beta 2 polypeptide |
1485 |
0.15 |
chr2_170131433_170131598 | 1.16 |
Zfp217 |
zinc finger protein 217 |
295 |
0.94 |
chr18_61635416_61635697 | 1.16 |
Bvht |
braveheart long non-coding RNA |
3986 |
0.14 |
chr15_7201350_7201501 | 1.15 |
Egflam |
EGF-like, fibronectin type III and laminin G domains |
21644 |
0.23 |
chr10_80152981_80153757 | 1.15 |
Midn |
midnolin |
2131 |
0.14 |
chr5_125513468_125513619 | 1.15 |
Aacs |
acetoacetyl-CoA synthetase |
654 |
0.65 |
chr11_16867245_16867846 | 1.15 |
Egfr |
epidermal growth factor receptor |
10605 |
0.2 |
chr10_80150217_80150719 | 1.15 |
Midn |
midnolin |
11 |
0.94 |
chr4_141750511_141750715 | 1.15 |
Agmat |
agmatine ureohydrolase (agmatinase) |
3941 |
0.15 |
chr17_46052256_46052407 | 1.15 |
Vegfa |
vascular endothelial growth factor A |
19962 |
0.13 |
chr11_60196823_60197490 | 1.14 |
Mir6921 |
microRNA 6921 |
3461 |
0.14 |
chr10_108391097_108391248 | 1.14 |
Gm36283 |
predicted gene, 36283 |
26079 |
0.15 |
chr5_115240278_115240472 | 1.14 |
Pop5 |
processing of precursor 5, ribonuclease P/MRP family (S. cerevisiae) |
34 |
0.94 |
chr7_25074810_25074988 | 1.13 |
Zfp574 |
zinc finger protein 574 |
2253 |
0.18 |
chr6_31148380_31148897 | 1.13 |
Gm37728 |
predicted gene, 37728 |
1219 |
0.36 |
chr4_133813243_133813553 | 1.13 |
Gm12974 |
predicted gene 12974 |
3022 |
0.18 |
chr8_89042874_89043785 | 1.12 |
Sall1 |
spalt like transcription factor 1 |
833 |
0.68 |
chr4_82505575_82505973 | 1.12 |
Nfib |
nuclear factor I/B |
4 |
0.98 |
chr7_132555965_132556140 | 1.12 |
Oat |
ornithine aminotransferase |
19666 |
0.15 |
chr17_67989309_67989497 | 1.12 |
Arhgap28 |
Rho GTPase activating protein 28 |
14717 |
0.27 |
chr15_27466172_27467167 | 1.12 |
Ank |
progressive ankylosis |
8 |
0.97 |
chr6_145865476_145865643 | 1.12 |
Bhlhe41 |
basic helix-loop-helix family, member e41 |
1 |
0.97 |
chr8_83899541_83899927 | 1.12 |
Adgrl1 |
adhesion G protein-coupled receptor L1 |
371 |
0.78 |
chr2_102133077_102133241 | 1.11 |
Ldlrad3 |
low density lipoprotein receptor class A domain containing 3 |
4960 |
0.24 |
chr10_121310051_121310403 | 1.11 |
Tbc1d30 |
TBC1 domain family, member 30 |
962 |
0.5 |
chr18_61952910_61953069 | 1.10 |
Sh3tc2 |
SH3 domain and tetratricopeptide repeats 2 |
86 |
0.97 |
chrX_161717217_161717797 | 1.10 |
Rai2 |
retinoic acid induced 2 |
120 |
0.98 |
chr6_15777156_15777307 | 1.10 |
Gm43924 |
predicted gene, 43924 |
34092 |
0.18 |
chr4_141955373_141955574 | 1.09 |
Fhad1 |
forkhead-associated (FHA) phosphopeptide binding domain 1 |
1279 |
0.36 |
chr6_90678833_90678984 | 1.09 |
Gm24816 |
predicted gene, 24816 |
2612 |
0.21 |
chr12_98523998_98524365 | 1.08 |
Gm40893 |
predicted gene, 40893 |
337 |
0.87 |
chr7_29134824_29134975 | 1.08 |
Rasgrp4 |
RAS guanyl releasing protein 4 |
34 |
0.94 |
chr7_45705038_45705336 | 1.08 |
Dbp |
D site albumin promoter binding protein |
82 |
0.89 |
chr15_86185727_86186278 | 1.08 |
Cerk |
ceramide kinase |
139 |
0.68 |
chr11_98747337_98747676 | 1.08 |
Thra |
thyroid hormone receptor alpha |
3273 |
0.13 |
chr16_56075548_56075867 | 1.08 |
Senp7 |
SUMO1/sentrin specific peptidase 7 |
227 |
0.89 |
chr10_87787661_87787830 | 1.07 |
Igf1os |
insulin-like growth factor 1, opposite strand |
40617 |
0.16 |
chr4_101741736_101741946 | 1.06 |
Lepr |
leptin receptor |
24434 |
0.19 |
chr17_46028764_46028966 | 1.05 |
Vegfa |
vascular endothelial growth factor A |
2491 |
0.25 |
chr17_46857828_46858121 | 1.05 |
Bicral |
BRD4 interacting chromatin remodeling complex associated protein like |
508 |
0.74 |
chr5_129941480_129942081 | 1.05 |
Vkorc1l1 |
vitamin K epoxide reductase complex, subunit 1-like 1 |
190 |
0.89 |
chr5_122513930_122514081 | 1.05 |
Gm22965 |
predicted gene, 22965 |
7216 |
0.1 |
chr16_62853766_62853968 | 1.05 |
Pros1 |
protein S (alpha) |
440 |
0.81 |
chr15_67116134_67116328 | 1.05 |
St3gal1 |
ST3 beta-galactoside alpha-2,3-sialyltransferase 1 |
2239 |
0.39 |
chr11_50188709_50189126 | 1.05 |
Mrnip |
MRN complex interacting protein |
14010 |
0.1 |
chr3_95674330_95674510 | 1.04 |
Adamtsl4 |
ADAMTS-like 4 |
2731 |
0.15 |
chr19_38077879_38078207 | 1.04 |
Gm23300 |
predicted gene, 23300 |
6114 |
0.14 |
chr10_8518750_8519222 | 1.04 |
Ust |
uronyl-2-sulfotransferase |
161 |
0.97 |
chr1_63114164_63114568 | 1.04 |
Ino80d |
INO80 complex subunit D |
32 |
0.57 |
chr11_69997195_69997696 | 1.04 |
Phf23 |
PHD finger protein 23 |
336 |
0.66 |
chr13_36736119_36736534 | 1.04 |
Nrn1 |
neuritin 1 |
1195 |
0.44 |
chr5_63892501_63892652 | 1.04 |
0610040J01Rik |
RIKEN cDNA 0610040J01 gene |
15100 |
0.17 |
chr6_38810542_38810693 | 1.04 |
Hipk2 |
homeodomain interacting protein kinase 2 |
7729 |
0.25 |
chr4_126147563_126147761 | 1.04 |
Eva1b |
eva-1 homolog B (C. elegans) |
82 |
0.94 |
chr10_75835778_75835936 | 1.04 |
Gstt2 |
glutathione S-transferase, theta 2 |
976 |
0.36 |
chr18_81321681_81321954 | 1.04 |
Gm30192 |
predicted gene, 30192 |
57109 |
0.13 |
chr8_105325783_105326130 | 1.04 |
Lrrc29 |
leucine rich repeat containing 29 |
303 |
0.5 |
chr11_16862611_16863177 | 1.03 |
Egfr |
epidermal growth factor receptor |
15256 |
0.19 |
chr11_16870430_16870581 | 1.03 |
Egfr |
epidermal growth factor receptor |
7645 |
0.21 |
chr11_16859692_16859843 | 1.03 |
Egfr |
epidermal growth factor receptor |
18383 |
0.18 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.5 | 4.4 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
1.0 | 3.0 | GO:0045917 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
0.9 | 2.8 | GO:0006868 | glutamine transport(GO:0006868) |
0.9 | 2.8 | GO:0003419 | growth plate cartilage chondrocyte proliferation(GO:0003419) |
0.9 | 5.6 | GO:0010871 | negative regulation of receptor biosynthetic process(GO:0010871) |
0.8 | 2.4 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
0.8 | 3.2 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.8 | 3.9 | GO:0033132 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
0.7 | 2.2 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
0.7 | 2.2 | GO:0089700 | protein kinase D signaling(GO:0089700) |
0.7 | 2.7 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
0.7 | 2.0 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
0.6 | 2.6 | GO:0071286 | cellular response to magnesium ion(GO:0071286) |
0.6 | 1.9 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
0.6 | 1.9 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
0.6 | 2.4 | GO:0032776 | DNA methylation on cytosine within a CG sequence(GO:0010424) DNA methylation on cytosine(GO:0032776) |
0.6 | 4.2 | GO:0060509 | Type I pneumocyte differentiation(GO:0060509) |
0.6 | 1.8 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
0.6 | 1.7 | GO:0003347 | epicardial cell to mesenchymal cell transition(GO:0003347) |
0.5 | 2.6 | GO:0051342 | regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051342) |
0.5 | 3.1 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
0.5 | 1.0 | GO:0043553 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
0.5 | 2.0 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
0.5 | 1.4 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.5 | 1.4 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
0.5 | 1.4 | GO:0010728 | regulation of hydrogen peroxide biosynthetic process(GO:0010728) |
0.5 | 1.9 | GO:0060591 | chondroblast differentiation(GO:0060591) |
0.5 | 1.4 | GO:0072092 | ureteric bud invasion(GO:0072092) |
0.5 | 1.4 | GO:1904017 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
0.5 | 1.8 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
0.4 | 1.3 | GO:0016479 | negative regulation of transcription from RNA polymerase I promoter(GO:0016479) |
0.4 | 1.7 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
0.4 | 1.7 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.4 | 1.7 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
0.4 | 1.3 | GO:0044337 | canonical Wnt signaling pathway involved in positive regulation of apoptotic process(GO:0044337) |
0.4 | 1.7 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.4 | 1.3 | GO:0050975 | sensory perception of touch(GO:0050975) |
0.4 | 1.2 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
0.4 | 0.4 | GO:0070601 | centromeric sister chromatid cohesion(GO:0070601) |
0.4 | 1.2 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.4 | 1.2 | GO:1901475 | pyruvate transmembrane transport(GO:1901475) |
0.4 | 0.8 | GO:0061626 | pharyngeal arch artery morphogenesis(GO:0061626) |
0.4 | 2.0 | GO:0060696 | regulation of phospholipid catabolic process(GO:0060696) |
0.4 | 1.2 | GO:1901674 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
0.4 | 1.2 | GO:0060978 | angiogenesis involved in coronary vascular morphogenesis(GO:0060978) |
0.4 | 1.2 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
0.4 | 1.6 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.4 | 0.8 | GO:0032907 | transforming growth factor beta3 production(GO:0032907) regulation of transforming growth factor beta3 production(GO:0032910) |
0.4 | 2.3 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
0.4 | 0.4 | GO:1901671 | positive regulation of superoxide dismutase activity(GO:1901671) positive regulation of removal of superoxide radicals(GO:1904833) |
0.4 | 1.1 | GO:2000591 | cell migration involved in kidney development(GO:0035787) cell migration involved in metanephros development(GO:0035788) metanephric mesenchymal cell migration(GO:0035789) positive regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:0035793) regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:1900238) regulation of metanephric mesenchymal cell migration(GO:2000589) positive regulation of metanephric mesenchymal cell migration(GO:2000591) |
0.4 | 1.1 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
0.4 | 1.4 | GO:0060318 | definitive erythrocyte differentiation(GO:0060318) |
0.4 | 0.7 | GO:1902416 | positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
0.3 | 2.1 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
0.3 | 1.7 | GO:0038161 | prolactin signaling pathway(GO:0038161) |
0.3 | 2.8 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
0.3 | 1.4 | GO:0015822 | ornithine transport(GO:0015822) L-ornithine transmembrane transport(GO:1903352) |
0.3 | 0.7 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
0.3 | 0.3 | GO:1904398 | positive regulation of neuromuscular junction development(GO:1904398) |
0.3 | 1.7 | GO:0072257 | metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
0.3 | 1.3 | GO:0030538 | embryonic genitalia morphogenesis(GO:0030538) |
0.3 | 1.0 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
0.3 | 0.9 | GO:1902109 | negative regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902109) |
0.3 | 0.6 | GO:0070949 | regulation of neutrophil mediated cytotoxicity(GO:0070948) regulation of neutrophil mediated killing of symbiont cell(GO:0070949) |
0.3 | 2.4 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
0.3 | 1.2 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
0.3 | 0.9 | GO:0045048 | protein insertion into ER membrane(GO:0045048) tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
0.3 | 1.2 | GO:0071376 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
0.3 | 2.1 | GO:0045634 | regulation of melanocyte differentiation(GO:0045634) |
0.3 | 0.9 | GO:0050427 | 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
0.3 | 1.5 | GO:0071276 | cellular response to cadmium ion(GO:0071276) |
0.3 | 1.5 | GO:1903242 | regulation of cardiac muscle adaptation(GO:0010612) regulation of cardiac muscle hypertrophy in response to stress(GO:1903242) |
0.3 | 0.3 | GO:0046487 | glyoxylate metabolic process(GO:0046487) |
0.3 | 0.9 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
0.3 | 1.7 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
0.3 | 1.4 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
0.3 | 1.7 | GO:1902222 | L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
0.3 | 1.1 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
0.3 | 0.8 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) |
0.3 | 1.4 | GO:0060839 | endothelial cell fate commitment(GO:0060839) |
0.3 | 0.6 | GO:0046208 | spermine catabolic process(GO:0046208) |
0.3 | 0.8 | GO:0045585 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
0.3 | 1.6 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
0.3 | 1.1 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
0.3 | 0.8 | GO:0016344 | meiotic chromosome movement towards spindle pole(GO:0016344) |
0.3 | 1.6 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
0.3 | 0.5 | GO:0018992 | germ-line sex determination(GO:0018992) |
0.3 | 0.5 | GO:0021648 | vestibulocochlear nerve morphogenesis(GO:0021648) |
0.3 | 0.5 | GO:2000823 | regulation of androgen receptor activity(GO:2000823) |
0.3 | 1.1 | GO:0003166 | bundle of His development(GO:0003166) |
0.3 | 0.8 | GO:0060283 | negative regulation of oocyte development(GO:0060283) negative regulation of oocyte maturation(GO:1900194) |
0.3 | 0.8 | GO:2000523 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
0.3 | 0.8 | GO:0061010 | gall bladder development(GO:0061010) |
0.3 | 1.8 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
0.3 | 0.3 | GO:0072093 | metanephric renal vesicle formation(GO:0072093) |
0.3 | 1.3 | GO:0042699 | follicle-stimulating hormone signaling pathway(GO:0042699) |
0.3 | 1.3 | GO:1904424 | regulation of GTP binding(GO:1904424) |
0.3 | 1.8 | GO:0060613 | fat pad development(GO:0060613) |
0.3 | 0.8 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
0.3 | 1.0 | GO:0045091 | regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045091) |
0.3 | 1.0 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
0.3 | 1.3 | GO:1904996 | positive regulation of leukocyte adhesion to vascular endothelial cell(GO:1904996) |
0.3 | 0.5 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
0.3 | 0.5 | GO:0072718 | response to cisplatin(GO:0072718) |
0.2 | 1.5 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
0.2 | 0.7 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
0.2 | 0.7 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
0.2 | 0.7 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
0.2 | 1.0 | GO:0002159 | desmosome assembly(GO:0002159) |
0.2 | 0.7 | GO:0048208 | vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
0.2 | 2.6 | GO:1902285 | semaphorin-plexin signaling pathway involved in neuron projection guidance(GO:1902285) |
0.2 | 1.2 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.2 | 0.2 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
0.2 | 0.7 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
0.2 | 0.7 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.2 | 1.9 | GO:0071378 | growth hormone receptor signaling pathway(GO:0060396) cellular response to growth hormone stimulus(GO:0071378) |
0.2 | 1.2 | GO:1901628 | positive regulation of postsynaptic membrane organization(GO:1901628) |
0.2 | 0.7 | GO:0021776 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
0.2 | 0.5 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
0.2 | 0.9 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
0.2 | 1.4 | GO:0070327 | thyroid hormone transport(GO:0070327) |
0.2 | 0.5 | GO:0003180 | aortic valve development(GO:0003176) aortic valve morphogenesis(GO:0003180) |
0.2 | 0.9 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.2 | 0.9 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
0.2 | 0.7 | GO:0071288 | cellular response to mercury ion(GO:0071288) |
0.2 | 0.2 | GO:0035910 | ascending aorta development(GO:0035905) ascending aorta morphogenesis(GO:0035910) |
0.2 | 0.2 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
0.2 | 0.5 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.2 | 0.5 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
0.2 | 1.8 | GO:0039703 | viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
0.2 | 0.7 | GO:0036118 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
0.2 | 0.7 | GO:0048625 | myoblast fate commitment(GO:0048625) |
0.2 | 1.1 | GO:0033227 | dsRNA transport(GO:0033227) |
0.2 | 0.6 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
0.2 | 0.6 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
0.2 | 0.6 | GO:0060633 | negative regulation of transcription initiation from RNA polymerase II promoter(GO:0060633) negative regulation of DNA-templated transcription, initiation(GO:2000143) |
0.2 | 0.6 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.2 | 0.6 | GO:0070094 | positive regulation of glucagon secretion(GO:0070094) |
0.2 | 1.7 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.2 | 1.1 | GO:0072711 | response to hydroxyurea(GO:0072710) cellular response to hydroxyurea(GO:0072711) |
0.2 | 0.6 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
0.2 | 0.6 | GO:0048294 | negative regulation of isotype switching to IgE isotypes(GO:0048294) |
0.2 | 0.6 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
0.2 | 0.6 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
0.2 | 0.4 | GO:1903587 | regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903587) |
0.2 | 0.6 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
0.2 | 0.6 | GO:1900740 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
0.2 | 0.8 | GO:0003199 | endocardial cushion to mesenchymal transition involved in heart valve formation(GO:0003199) |
0.2 | 0.8 | GO:0033600 | negative regulation of mammary gland epithelial cell proliferation(GO:0033600) |
0.2 | 0.6 | GO:0061625 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
0.2 | 0.6 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
0.2 | 1.4 | GO:0001955 | blood vessel maturation(GO:0001955) |
0.2 | 0.8 | GO:0006000 | fructose metabolic process(GO:0006000) |
0.2 | 0.4 | GO:0072223 | metanephric glomerular mesangium development(GO:0072223) metanephric glomerular mesangial cell proliferation involved in metanephros development(GO:0072262) |
0.2 | 0.6 | GO:0019230 | proprioception(GO:0019230) |
0.2 | 0.6 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
0.2 | 0.8 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
0.2 | 0.8 | GO:0060510 | Type II pneumocyte differentiation(GO:0060510) |
0.2 | 1.2 | GO:0060710 | chorio-allantoic fusion(GO:0060710) |
0.2 | 1.9 | GO:0043374 | CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
0.2 | 0.6 | GO:0045113 | regulation of integrin biosynthetic process(GO:0045113) |
0.2 | 0.9 | GO:0009446 | putrescine biosynthetic process(GO:0009446) |
0.2 | 0.6 | GO:2001180 | negative regulation of interleukin-10 secretion(GO:2001180) |
0.2 | 0.9 | GO:0086042 | cardiac muscle cell-cardiac muscle cell adhesion(GO:0086042) |
0.2 | 2.2 | GO:0006047 | UDP-N-acetylglucosamine metabolic process(GO:0006047) |
0.2 | 0.2 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
0.2 | 0.9 | GO:0001767 | establishment of lymphocyte polarity(GO:0001767) establishment of T cell polarity(GO:0001768) |
0.2 | 1.8 | GO:0032494 | response to peptidoglycan(GO:0032494) |
0.2 | 0.4 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
0.2 | 0.2 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
0.2 | 0.4 | GO:0006600 | creatine metabolic process(GO:0006600) |
0.2 | 0.5 | GO:0071866 | regulation of apoptotic process in bone marrow(GO:0071865) negative regulation of apoptotic process in bone marrow(GO:0071866) |
0.2 | 0.4 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
0.2 | 2.1 | GO:0010832 | negative regulation of myotube differentiation(GO:0010832) |
0.2 | 0.5 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
0.2 | 0.9 | GO:0060023 | soft palate development(GO:0060023) |
0.2 | 0.4 | GO:1903061 | positive regulation of protein lipidation(GO:1903061) |
0.2 | 0.7 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
0.2 | 0.2 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
0.2 | 0.7 | GO:0016584 | nucleosome positioning(GO:0016584) |
0.2 | 0.5 | GO:0010273 | detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
0.2 | 0.2 | GO:1902988 | neurofibrillary tangle assembly(GO:1902988) regulation of neurofibrillary tangle assembly(GO:1902996) |
0.2 | 0.5 | GO:0034214 | protein hexamerization(GO:0034214) |
0.2 | 0.3 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
0.2 | 0.5 | GO:1903288 | regulation of potassium ion import(GO:1903286) positive regulation of potassium ion import(GO:1903288) |
0.2 | 0.5 | GO:0086017 | Purkinje myocyte action potential(GO:0086017) |
0.2 | 0.3 | GO:0032077 | positive regulation of deoxyribonuclease activity(GO:0032077) |
0.2 | 1.4 | GO:0035457 | cellular response to interferon-alpha(GO:0035457) |
0.2 | 0.5 | GO:0005984 | disaccharide metabolic process(GO:0005984) |
0.2 | 2.0 | GO:0035855 | megakaryocyte development(GO:0035855) |
0.2 | 0.7 | GO:0002326 | B cell lineage commitment(GO:0002326) |
0.2 | 0.7 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.2 | 0.5 | GO:0032354 | response to follicle-stimulating hormone(GO:0032354) cellular response to follicle-stimulating hormone stimulus(GO:0071372) |
0.2 | 0.2 | GO:0034380 | high-density lipoprotein particle assembly(GO:0034380) |
0.2 | 0.7 | GO:0098795 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
0.2 | 1.0 | GO:0010603 | regulation of cytoplasmic mRNA processing body assembly(GO:0010603) |
0.2 | 1.3 | GO:0060539 | diaphragm development(GO:0060539) |
0.2 | 0.5 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
0.2 | 1.2 | GO:0060347 | heart trabecula formation(GO:0060347) |
0.2 | 0.3 | GO:0010986 | positive regulation of lipoprotein particle clearance(GO:0010986) |
0.2 | 1.0 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
0.2 | 0.7 | GO:1903964 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.2 | 1.1 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
0.2 | 5.4 | GO:0043044 | ATP-dependent chromatin remodeling(GO:0043044) |
0.2 | 2.5 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
0.2 | 1.5 | GO:0090129 | positive regulation of synapse maturation(GO:0090129) |
0.2 | 0.8 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.2 | 0.8 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
0.2 | 0.3 | GO:0034197 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
0.2 | 0.5 | GO:0051182 | coenzyme transport(GO:0051182) |
0.2 | 1.3 | GO:0070914 | UV-damage excision repair(GO:0070914) |
0.2 | 0.6 | GO:0032986 | nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
0.2 | 0.5 | GO:0001692 | histamine metabolic process(GO:0001692) |
0.2 | 1.1 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
0.2 | 0.2 | GO:0032906 | transforming growth factor beta2 production(GO:0032906) regulation of transforming growth factor beta2 production(GO:0032909) |
0.2 | 0.6 | GO:0036072 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
0.2 | 0.6 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
0.2 | 1.3 | GO:0048194 | Golgi vesicle budding(GO:0048194) |
0.2 | 1.3 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
0.2 | 0.5 | GO:0097503 | sialylation(GO:0097503) |
0.2 | 0.5 | GO:0070368 | positive regulation of hepatocyte differentiation(GO:0070368) |
0.2 | 0.8 | GO:0006477 | protein sulfation(GO:0006477) |
0.2 | 0.3 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
0.2 | 1.1 | GO:0000103 | sulfate assimilation(GO:0000103) |
0.2 | 0.2 | GO:0006046 | N-acetylglucosamine catabolic process(GO:0006046) |
0.2 | 0.5 | GO:0048295 | positive regulation of isotype switching to IgE isotypes(GO:0048295) |
0.2 | 0.3 | GO:0090170 | MAPK import into nucleus(GO:0000189) regulation of Golgi inheritance(GO:0090170) |
0.2 | 0.3 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.2 | 0.5 | GO:0009080 | alanine catabolic process(GO:0006524) pyruvate family amino acid catabolic process(GO:0009080) |
0.2 | 0.5 | GO:0006114 | glycerol biosynthetic process(GO:0006114) |
0.2 | 0.3 | GO:0060687 | regulation of branching involved in prostate gland morphogenesis(GO:0060687) |
0.2 | 0.6 | GO:0042078 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
0.2 | 0.3 | GO:0010878 | cholesterol storage(GO:0010878) |
0.2 | 1.2 | GO:0032926 | negative regulation of activin receptor signaling pathway(GO:0032926) |
0.2 | 1.2 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
0.2 | 0.6 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
0.2 | 0.3 | GO:0034395 | regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
0.1 | 0.1 | GO:2001245 | regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
0.1 | 0.4 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
0.1 | 0.4 | GO:0050883 | musculoskeletal movement, spinal reflex action(GO:0050883) |
0.1 | 0.3 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
0.1 | 0.6 | GO:0007296 | vitellogenesis(GO:0007296) |
0.1 | 0.4 | GO:0002434 | immune complex clearance(GO:0002434) |
0.1 | 0.3 | GO:1901509 | regulation of endothelial tube morphogenesis(GO:1901509) |
0.1 | 0.4 | GO:0032346 | positive regulation of aldosterone metabolic process(GO:0032346) positive regulation of aldosterone biosynthetic process(GO:0032349) |
0.1 | 0.6 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
0.1 | 0.4 | GO:1901096 | regulation of autophagosome maturation(GO:1901096) |
0.1 | 0.3 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) |
0.1 | 0.4 | GO:0061535 | glutamate secretion, neurotransmission(GO:0061535) |
0.1 | 0.1 | GO:0032741 | regulation of interleukin-18 production(GO:0032661) positive regulation of interleukin-18 production(GO:0032741) |
0.1 | 1.3 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
0.1 | 0.9 | GO:0071318 | cellular response to ATP(GO:0071318) |
0.1 | 2.0 | GO:1900153 | regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
0.1 | 0.3 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
0.1 | 1.3 | GO:0045943 | positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
0.1 | 0.4 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
0.1 | 0.1 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
0.1 | 0.8 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
0.1 | 0.1 | GO:0090160 | Golgi to lysosome transport(GO:0090160) |
0.1 | 0.6 | GO:0072319 | vesicle uncoating(GO:0072319) |
0.1 | 0.6 | GO:1904738 | vascular associated smooth muscle cell migration(GO:1904738) regulation of vascular associated smooth muscle cell migration(GO:1904752) |
0.1 | 1.7 | GO:0070875 | positive regulation of glycogen metabolic process(GO:0070875) |
0.1 | 0.6 | GO:0044004 | killing by symbiont of host cells(GO:0001907) disruption by symbiont of host cell(GO:0044004) |
0.1 | 0.3 | GO:0034756 | regulation of iron ion transport(GO:0034756) |
0.1 | 0.7 | GO:1901026 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
0.1 | 0.4 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
0.1 | 0.3 | GO:1902075 | cellular response to salt(GO:1902075) |
0.1 | 0.7 | GO:0033625 | positive regulation of integrin activation(GO:0033625) |
0.1 | 1.6 | GO:2000251 | positive regulation of actin cytoskeleton reorganization(GO:2000251) |
0.1 | 0.4 | GO:0050955 | thermoception(GO:0050955) |
0.1 | 0.8 | GO:0010886 | positive regulation of cholesterol storage(GO:0010886) |
0.1 | 0.8 | GO:0006930 | substrate-dependent cell migration, cell extension(GO:0006930) |
0.1 | 0.5 | GO:0097460 | ferrous iron import into cell(GO:0097460) |
0.1 | 0.7 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
0.1 | 0.4 | GO:0060279 | positive regulation of ovulation(GO:0060279) |
0.1 | 0.4 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
0.1 | 1.1 | GO:0036003 | positive regulation of transcription from RNA polymerase II promoter in response to stress(GO:0036003) |
0.1 | 0.7 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
0.1 | 0.5 | GO:0090272 | negative regulation of fibroblast growth factor production(GO:0090272) |
0.1 | 0.1 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
0.1 | 0.7 | GO:0043619 | regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0043619) |
0.1 | 0.4 | GO:1904749 | regulation of protein localization to nucleolus(GO:1904749) positive regulation of protein localization to nucleolus(GO:1904751) |
0.1 | 0.7 | GO:0009249 | protein lipoylation(GO:0009249) |
0.1 | 0.1 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
0.1 | 0.1 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
0.1 | 0.3 | GO:0090091 | positive regulation of extracellular matrix disassembly(GO:0090091) |
0.1 | 2.2 | GO:0014850 | response to muscle activity(GO:0014850) |
0.1 | 0.1 | GO:0001555 | oocyte growth(GO:0001555) |
0.1 | 0.4 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
0.1 | 0.3 | GO:2000474 | regulation of opioid receptor signaling pathway(GO:2000474) |
0.1 | 0.3 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
0.1 | 0.4 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
0.1 | 0.1 | GO:0038086 | VEGF-activated platelet-derived growth factor receptor signaling pathway(GO:0038086) positive regulation of cell proliferation by VEGF-activated platelet derived growth factor receptor signaling pathway(GO:0038091) |
0.1 | 0.3 | GO:0045651 | positive regulation of macrophage differentiation(GO:0045651) |
0.1 | 1.0 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
0.1 | 0.6 | GO:0040016 | embryonic cleavage(GO:0040016) |
0.1 | 0.6 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
0.1 | 0.4 | GO:0023021 | termination of signal transduction(GO:0023021) |
0.1 | 0.5 | GO:0035627 | ceramide transport(GO:0035627) |
0.1 | 0.5 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
0.1 | 0.6 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
0.1 | 1.0 | GO:0006851 | mitochondrial calcium ion transport(GO:0006851) |
0.1 | 0.4 | GO:0010040 | response to iron(II) ion(GO:0010040) |
0.1 | 0.1 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
0.1 | 0.1 | GO:0010159 | specification of organ position(GO:0010159) |
0.1 | 0.5 | GO:0032914 | positive regulation of transforming growth factor beta1 production(GO:0032914) |
0.1 | 0.1 | GO:0003241 | growth involved in heart morphogenesis(GO:0003241) |
0.1 | 0.4 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.1 | 1.7 | GO:0006085 | acetyl-CoA biosynthetic process(GO:0006085) |
0.1 | 0.1 | GO:0032696 | negative regulation of interleukin-13 production(GO:0032696) |
0.1 | 0.9 | GO:0045654 | positive regulation of megakaryocyte differentiation(GO:0045654) |
0.1 | 0.7 | GO:0015919 | peroxisomal membrane transport(GO:0015919) protein import into peroxisome membrane(GO:0045046) |
0.1 | 0.9 | GO:0001542 | ovulation from ovarian follicle(GO:0001542) |
0.1 | 0.5 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.1 | 0.4 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
0.1 | 0.6 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
0.1 | 0.2 | GO:1903599 | positive regulation of mitophagy(GO:1903599) |
0.1 | 0.7 | GO:1901978 | positive regulation of cell cycle checkpoint(GO:1901978) |
0.1 | 0.6 | GO:0070417 | cellular response to cold(GO:0070417) |
0.1 | 0.4 | GO:0000101 | sulfur amino acid transport(GO:0000101) |
0.1 | 0.2 | GO:0048819 | regulation of hair follicle maturation(GO:0048819) |
0.1 | 0.7 | GO:0044539 | long-chain fatty acid import(GO:0044539) |
0.1 | 0.4 | GO:0003096 | renal sodium ion transport(GO:0003096) |
0.1 | 0.5 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
0.1 | 0.1 | GO:0001969 | activation of membrane attack complex(GO:0001905) regulation of activation of membrane attack complex(GO:0001969) |
0.1 | 0.4 | GO:0051088 | PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
0.1 | 0.4 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
0.1 | 0.2 | GO:2000587 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
0.1 | 0.8 | GO:0045075 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
0.1 | 0.4 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
0.1 | 0.4 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
0.1 | 0.2 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
0.1 | 1.2 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.1 | 0.6 | GO:0080009 | mRNA methylation(GO:0080009) |
0.1 | 0.5 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
0.1 | 0.1 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
0.1 | 0.6 | GO:0051503 | adenine nucleotide transport(GO:0051503) |
0.1 | 0.1 | GO:0071472 | cellular response to salt stress(GO:0071472) |
0.1 | 0.2 | GO:1902894 | negative regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902894) |
0.1 | 0.5 | GO:2000194 | regulation of female gonad development(GO:2000194) |
0.1 | 0.3 | GO:2001169 | regulation of ATP biosynthetic process(GO:2001169) |
0.1 | 0.7 | GO:0036344 | platelet morphogenesis(GO:0036344) |
0.1 | 0.1 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
0.1 | 0.8 | GO:0031507 | heterochromatin assembly(GO:0031507) |
0.1 | 0.9 | GO:0042416 | dopamine biosynthetic process(GO:0042416) |
0.1 | 0.3 | GO:0051126 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) negative regulation of actin nucleation(GO:0051126) |
0.1 | 0.8 | GO:0032516 | positive regulation of phosphoprotein phosphatase activity(GO:0032516) |
0.1 | 0.3 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
0.1 | 0.3 | GO:0000087 | mitotic M phase(GO:0000087) |
0.1 | 0.3 | GO:0061368 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
0.1 | 1.0 | GO:0097034 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
0.1 | 0.2 | GO:0071225 | cellular response to muramyl dipeptide(GO:0071225) |
0.1 | 0.1 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
0.1 | 0.2 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
0.1 | 0.5 | GO:0016075 | rRNA catabolic process(GO:0016075) |
0.1 | 0.7 | GO:0021859 | pyramidal neuron differentiation(GO:0021859) |
0.1 | 0.2 | GO:0090045 | positive regulation of deacetylase activity(GO:0090045) |
0.1 | 0.4 | GO:0006545 | glycine biosynthetic process(GO:0006545) |
0.1 | 0.1 | GO:1904688 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
0.1 | 0.3 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
0.1 | 0.1 | GO:2000465 | regulation of glycogen (starch) synthase activity(GO:2000465) |
0.1 | 2.6 | GO:0048240 | sperm capacitation(GO:0048240) |
0.1 | 1.1 | GO:0006349 | regulation of gene expression by genetic imprinting(GO:0006349) |
0.1 | 0.1 | GO:0060559 | positive regulation of vitamin metabolic process(GO:0046136) positive regulation of vitamin D biosynthetic process(GO:0060557) positive regulation of calcidiol 1-monooxygenase activity(GO:0060559) |
0.1 | 0.4 | GO:0045876 | positive regulation of sister chromatid cohesion(GO:0045876) |
0.1 | 0.3 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
0.1 | 0.6 | GO:0036120 | response to platelet-derived growth factor(GO:0036119) cellular response to platelet-derived growth factor stimulus(GO:0036120) |
0.1 | 0.7 | GO:0042511 | positive regulation of tyrosine phosphorylation of Stat1 protein(GO:0042511) |
0.1 | 0.2 | GO:1903416 | response to glycoside(GO:1903416) |
0.1 | 0.1 | GO:0030422 | production of siRNA involved in RNA interference(GO:0030422) |
0.1 | 1.8 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
0.1 | 1.1 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
0.1 | 1.1 | GO:0000042 | protein targeting to Golgi(GO:0000042) |
0.1 | 0.6 | GO:0048681 | negative regulation of axon regeneration(GO:0048681) |
0.1 | 0.1 | GO:1902369 | negative regulation of RNA catabolic process(GO:1902369) |
0.1 | 0.6 | GO:0060346 | bone trabecula formation(GO:0060346) |
0.1 | 0.1 | GO:0002019 | regulation of renal output by angiotensin(GO:0002019) |
0.1 | 0.1 | GO:0010759 | positive regulation of macrophage chemotaxis(GO:0010759) |
0.1 | 0.2 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
0.1 | 0.5 | GO:0046146 | tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
0.1 | 0.3 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
0.1 | 0.4 | GO:0072603 | interleukin-5 secretion(GO:0072603) interleukin-13 secretion(GO:0072611) regulation of interleukin-5 secretion(GO:2000662) positive regulation of interleukin-5 secretion(GO:2000664) regulation of interleukin-13 secretion(GO:2000665) positive regulation of interleukin-13 secretion(GO:2000667) |
0.1 | 0.2 | GO:0061153 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
0.1 | 0.1 | GO:0045404 | positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
0.1 | 0.4 | GO:0071243 | cellular response to arsenic-containing substance(GO:0071243) |
0.1 | 0.4 | GO:0046015 | regulation of transcription by glucose(GO:0046015) |
0.1 | 0.1 | GO:2000275 | regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
0.1 | 0.2 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
0.1 | 0.3 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
0.1 | 0.1 | GO:1901859 | negative regulation of mitochondrial DNA metabolic process(GO:1901859) |
0.1 | 2.2 | GO:0030521 | androgen receptor signaling pathway(GO:0030521) |
0.1 | 0.3 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
0.1 | 0.3 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
0.1 | 0.9 | GO:0042219 | cellular modified amino acid catabolic process(GO:0042219) |
0.1 | 0.3 | GO:0015888 | thiamine transport(GO:0015888) |
0.1 | 0.4 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
0.1 | 0.1 | GO:0071616 | thioester biosynthetic process(GO:0035384) acyl-CoA biosynthetic process(GO:0071616) |
0.1 | 0.6 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
0.1 | 0.7 | GO:0043249 | erythrocyte maturation(GO:0043249) |
0.1 | 0.2 | GO:0032621 | interleukin-18 production(GO:0032621) |
0.1 | 0.4 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
0.1 | 0.3 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) |
0.1 | 0.2 | GO:0060416 | response to growth hormone(GO:0060416) |
0.1 | 0.3 | GO:1900745 | positive regulation of p38MAPK cascade(GO:1900745) |
0.1 | 0.2 | GO:0051581 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
0.1 | 0.3 | GO:0010917 | negative regulation of mitochondrial membrane potential(GO:0010917) |
0.1 | 0.3 | GO:0060112 | generation of ovulation cycle rhythm(GO:0060112) |
0.1 | 0.1 | GO:0042536 | negative regulation of tumor necrosis factor biosynthetic process(GO:0042536) |
0.1 | 1.3 | GO:0045116 | protein neddylation(GO:0045116) |
0.1 | 0.1 | GO:0060842 | arterial endothelial cell differentiation(GO:0060842) |
0.1 | 0.3 | GO:0051987 | positive regulation of attachment of spindle microtubules to kinetochore(GO:0051987) |
0.1 | 0.3 | GO:0021590 | cerebellum maturation(GO:0021590) |
0.1 | 0.6 | GO:0018119 | peptidyl-cysteine S-nitrosylation(GO:0018119) |
0.1 | 0.6 | GO:0007343 | egg activation(GO:0007343) |
0.1 | 0.1 | GO:0051594 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
0.1 | 0.5 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
0.1 | 0.2 | GO:2000019 | negative regulation of male gonad development(GO:2000019) |
0.1 | 0.2 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
0.1 | 0.4 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
0.1 | 0.2 | GO:0042737 | drug catabolic process(GO:0042737) |
0.1 | 2.0 | GO:0016578 | histone deubiquitination(GO:0016578) |
0.1 | 0.6 | GO:0006265 | DNA topological change(GO:0006265) |
0.1 | 0.2 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
0.1 | 1.8 | GO:0070542 | response to fatty acid(GO:0070542) |
0.1 | 0.2 | GO:0019086 | late viral transcription(GO:0019086) |
0.1 | 0.2 | GO:0000965 | mitochondrial RNA 3'-end processing(GO:0000965) |
0.1 | 0.1 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
0.1 | 0.5 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
0.1 | 0.3 | GO:0042435 | indole-containing compound biosynthetic process(GO:0042435) |
0.1 | 0.3 | GO:0046083 | adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
0.1 | 0.2 | GO:2000705 | regulation of dense core granule biogenesis(GO:2000705) |
0.1 | 1.0 | GO:0035767 | endothelial cell chemotaxis(GO:0035767) |
0.1 | 1.6 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
0.1 | 0.3 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
0.1 | 0.4 | GO:0006983 | ER overload response(GO:0006983) |
0.1 | 0.4 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
0.1 | 0.4 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
0.1 | 0.2 | GO:0019532 | oxalate transport(GO:0019532) |
0.1 | 0.2 | GO:0000737 | DNA catabolic process, endonucleolytic(GO:0000737) |
0.1 | 0.2 | GO:0071374 | cellular response to parathyroid hormone stimulus(GO:0071374) |
0.1 | 0.2 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
0.1 | 0.3 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
0.1 | 0.3 | GO:0002386 | immune response in mucosal-associated lymphoid tissue(GO:0002386) |
0.1 | 0.3 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
0.1 | 0.7 | GO:2000505 | regulation of energy homeostasis(GO:2000505) |
0.1 | 0.7 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
0.1 | 0.1 | GO:0070340 | detection of bacterial lipopeptide(GO:0070340) |
0.1 | 1.0 | GO:0001893 | maternal placenta development(GO:0001893) |
0.1 | 0.2 | GO:0052490 | negative regulation by symbiont of host apoptotic process(GO:0033668) negative regulation by symbiont of host programmed cell death(GO:0052041) negative regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052490) |
0.1 | 0.1 | GO:0090135 | actin filament branching(GO:0090135) |
0.1 | 0.1 | GO:0042091 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
0.1 | 0.4 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
0.1 | 0.3 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
0.1 | 0.3 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
0.1 | 0.6 | GO:0033182 | regulation of histone ubiquitination(GO:0033182) |
0.1 | 0.3 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
0.1 | 0.1 | GO:0070487 | monocyte aggregation(GO:0070487) |
0.1 | 0.2 | GO:0000710 | meiotic mismatch repair(GO:0000710) |
0.1 | 0.1 | GO:0051305 | chromosome movement towards spindle pole(GO:0051305) |
0.1 | 0.1 | GO:0043366 | beta selection(GO:0043366) |
0.1 | 0.4 | GO:0043031 | negative regulation of macrophage activation(GO:0043031) |
0.1 | 0.3 | GO:0046125 | pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
0.1 | 0.3 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
0.1 | 0.3 | GO:1904707 | regulation of vascular smooth muscle cell proliferation(GO:1904705) positive regulation of vascular smooth muscle cell proliferation(GO:1904707) vascular smooth muscle cell proliferation(GO:1990874) |
0.1 | 0.6 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) |
0.1 | 0.8 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
0.1 | 0.6 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.1 | 1.8 | GO:0007205 | protein kinase C-activating G-protein coupled receptor signaling pathway(GO:0007205) |
0.1 | 0.2 | GO:1902563 | regulation of neutrophil activation(GO:1902563) |
0.1 | 0.3 | GO:0000050 | urea cycle(GO:0000050) |
0.1 | 0.3 | GO:0042908 | xenobiotic transport(GO:0042908) |
0.1 | 0.3 | GO:0033630 | positive regulation of cell adhesion mediated by integrin(GO:0033630) |
0.1 | 0.6 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
0.1 | 0.8 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
0.1 | 0.3 | GO:0045627 | positive regulation of T-helper 1 cell differentiation(GO:0045627) |
0.1 | 0.2 | GO:2000359 | regulation of binding of sperm to zona pellucida(GO:2000359) |
0.1 | 0.2 | GO:0045359 | positive regulation of interferon-beta biosynthetic process(GO:0045359) |
0.1 | 0.2 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
0.1 | 0.2 | GO:2000313 | fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
0.1 | 0.3 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
0.1 | 0.1 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
0.1 | 0.2 | GO:0000447 | endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
0.1 | 0.1 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
0.1 | 0.3 | GO:0045213 | neurotransmitter receptor metabolic process(GO:0045213) |
0.1 | 1.3 | GO:0032897 | negative regulation of viral transcription(GO:0032897) |
0.1 | 0.2 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
0.1 | 0.2 | GO:0035962 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
0.1 | 0.7 | GO:0001553 | luteinization(GO:0001553) |
0.1 | 0.2 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
0.1 | 0.1 | GO:0061092 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
0.1 | 0.2 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
0.1 | 0.6 | GO:0006084 | acetyl-CoA metabolic process(GO:0006084) |
0.1 | 0.1 | GO:0033240 | positive regulation of cellular amine metabolic process(GO:0033240) |
0.1 | 0.1 | GO:0042762 | regulation of sulfur metabolic process(GO:0042762) |
0.1 | 0.2 | GO:0045837 | negative regulation of membrane potential(GO:0045837) |
0.1 | 0.6 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
0.1 | 1.0 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
0.1 | 0.2 | GO:0033058 | directional locomotion(GO:0033058) |
0.1 | 0.2 | GO:1900368 | regulation of RNA interference(GO:1900368) |
0.1 | 0.2 | GO:1900271 | regulation of long-term synaptic potentiation(GO:1900271) |
0.1 | 0.2 | GO:0009223 | pyrimidine deoxyribonucleotide catabolic process(GO:0009223) |
0.1 | 0.5 | GO:0051984 | positive regulation of chromosome segregation(GO:0051984) |
0.1 | 0.2 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
0.1 | 1.0 | GO:0050860 | negative regulation of T cell receptor signaling pathway(GO:0050860) |
0.1 | 0.2 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
0.1 | 0.2 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
0.1 | 1.3 | GO:0045954 | positive regulation of natural killer cell mediated cytotoxicity(GO:0045954) |
0.1 | 0.3 | GO:0051549 | regulation of keratinocyte migration(GO:0051547) positive regulation of keratinocyte migration(GO:0051549) |
0.1 | 0.2 | GO:0010452 | histone H3-K36 methylation(GO:0010452) |
0.1 | 0.1 | GO:0036480 | neuron intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0036480) positive regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902177) regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903376) |
0.1 | 0.2 | GO:0034638 | phosphatidylcholine catabolic process(GO:0034638) |
0.1 | 0.2 | GO:0070777 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
0.1 | 0.2 | GO:0060648 | mammary gland bud morphogenesis(GO:0060648) |
0.1 | 0.1 | GO:0061577 | calcium ion transmembrane transport via high voltage-gated calcium channel(GO:0061577) |
0.1 | 0.1 | GO:1902913 | positive regulation of neuroepithelial cell differentiation(GO:1902913) |
0.1 | 0.8 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
0.1 | 0.4 | GO:0002016 | regulation of blood volume by renin-angiotensin(GO:0002016) brain renin-angiotensin system(GO:0002035) |
0.1 | 0.2 | GO:0061355 | Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) |
0.1 | 0.2 | GO:2001275 | positive regulation of glucose import in response to insulin stimulus(GO:2001275) |
0.1 | 0.1 | GO:0006522 | alanine metabolic process(GO:0006522) pyruvate family amino acid metabolic process(GO:0009078) L-alanine metabolic process(GO:0042851) |
0.1 | 0.2 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.1 | 0.2 | GO:0002525 | acute inflammatory response to non-antigenic stimulus(GO:0002525) |
0.1 | 0.3 | GO:0070995 | NADPH oxidation(GO:0070995) |
0.1 | 0.1 | GO:0018214 | protein carboxylation(GO:0018214) |
0.1 | 0.2 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.1 | 0.5 | GO:0042269 | regulation of natural killer cell mediated cytotoxicity(GO:0042269) |
0.1 | 0.2 | GO:0018343 | protein farnesylation(GO:0018343) |
0.1 | 0.2 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.1 | 0.2 | GO:2001273 | glucose import in response to insulin stimulus(GO:0044381) regulation of glucose import in response to insulin stimulus(GO:2001273) |
0.1 | 0.1 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
0.1 | 0.2 | GO:0071609 | chemokine (C-C motif) ligand 5 production(GO:0071609) |
0.1 | 0.4 | GO:0046070 | dGTP metabolic process(GO:0046070) |
0.1 | 0.2 | GO:0061684 | chaperone-mediated autophagy(GO:0061684) |
0.1 | 0.4 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
0.1 | 0.1 | GO:0002765 | immune response-inhibiting signal transduction(GO:0002765) |
0.1 | 0.4 | GO:0090042 | tubulin deacetylation(GO:0090042) |
0.1 | 0.1 | GO:2000599 | regulation of cyclin catabolic process(GO:2000598) negative regulation of cyclin catabolic process(GO:2000599) |
0.1 | 0.2 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.1 | 0.5 | GO:0032367 | intracellular cholesterol transport(GO:0032367) |
0.1 | 1.1 | GO:0006921 | cellular component disassembly involved in execution phase of apoptosis(GO:0006921) apoptotic nuclear changes(GO:0030262) |
0.1 | 0.1 | GO:1902566 | regulation of eosinophil degranulation(GO:0043309) regulation of eosinophil activation(GO:1902566) |
0.1 | 0.1 | GO:0034349 | glial cell apoptotic process(GO:0034349) |
0.1 | 0.3 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
0.1 | 0.2 | GO:0038202 | TORC1 signaling(GO:0038202) regulation of TORC1 signaling(GO:1903432) |
0.1 | 0.1 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
0.1 | 0.1 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
0.1 | 0.6 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
0.1 | 0.8 | GO:0042759 | long-chain fatty acid biosynthetic process(GO:0042759) |
0.1 | 0.2 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.1 | 0.1 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
0.1 | 0.4 | GO:0000301 | retrograde transport, vesicle recycling within Golgi(GO:0000301) |
0.1 | 0.1 | GO:0051890 | regulation of cardioblast differentiation(GO:0051890) |
0.1 | 0.1 | GO:1902896 | terminal web assembly(GO:1902896) |
0.1 | 0.2 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
0.1 | 0.1 | GO:0002589 | regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002589) |
0.1 | 0.2 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
0.1 | 0.2 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) |
0.1 | 0.2 | GO:0042891 | antibiotic transport(GO:0042891) |
0.1 | 0.3 | GO:0060216 | definitive hemopoiesis(GO:0060216) |
0.1 | 0.1 | GO:0045764 | positive regulation of cellular amino acid metabolic process(GO:0045764) |
0.1 | 0.1 | GO:0003192 | mitral valve formation(GO:0003192) |
0.1 | 0.1 | GO:0046499 | S-adenosylmethioninamine metabolic process(GO:0046499) |
0.1 | 0.8 | GO:0042149 | cellular response to glucose starvation(GO:0042149) |
0.1 | 0.1 | GO:1905098 | negative regulation of guanyl-nucleotide exchange factor activity(GO:1905098) |
0.1 | 0.3 | GO:1900118 | negative regulation of execution phase of apoptosis(GO:1900118) |
0.1 | 0.1 | GO:0000255 | allantoin metabolic process(GO:0000255) |
0.1 | 0.1 | GO:0045112 | integrin biosynthetic process(GO:0045112) |
0.1 | 0.1 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
0.1 | 0.1 | GO:0002432 | granuloma formation(GO:0002432) |
0.1 | 0.1 | GO:2000118 | regulation of sodium-dependent phosphate transport(GO:2000118) |
0.1 | 0.1 | GO:0010482 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
0.1 | 0.1 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
0.1 | 0.1 | GO:0001844 | protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:0001844) |
0.1 | 0.3 | GO:0033623 | regulation of integrin activation(GO:0033623) |
0.1 | 0.2 | GO:1903333 | negative regulation of protein refolding(GO:0061084) negative regulation of protein folding(GO:1903333) |
0.1 | 0.1 | GO:0002430 | complement receptor mediated signaling pathway(GO:0002430) |
0.1 | 0.1 | GO:0061046 | foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) regulation of branching involved in lung morphogenesis(GO:0061046) positive regulation of branching involved in lung morphogenesis(GO:0061047) |
0.1 | 0.3 | GO:0010668 | ectodermal cell differentiation(GO:0010668) |
0.1 | 0.2 | GO:0021764 | amygdala development(GO:0021764) |
0.1 | 0.2 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
0.1 | 0.1 | GO:0090187 | positive regulation of pancreatic juice secretion(GO:0090187) |
0.1 | 0.1 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) negative regulation of glycogen metabolic process(GO:0070874) |
0.1 | 0.3 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
0.1 | 0.2 | GO:0042505 | tyrosine phosphorylation of Stat6 protein(GO:0042505) regulation of tyrosine phosphorylation of Stat6 protein(GO:0042525) |
0.1 | 0.3 | GO:0010640 | regulation of platelet-derived growth factor receptor signaling pathway(GO:0010640) |
0.1 | 0.1 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
0.1 | 0.6 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
0.1 | 0.3 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.1 | 0.6 | GO:0019985 | translesion synthesis(GO:0019985) |
0.1 | 0.6 | GO:1990118 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
0.1 | 0.1 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
0.1 | 0.2 | GO:0061051 | positive regulation of cell growth involved in cardiac muscle cell development(GO:0061051) |
0.1 | 0.2 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
0.1 | 0.1 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
0.1 | 0.3 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
0.1 | 0.1 | GO:0043504 | mitochondrial DNA repair(GO:0043504) |
0.1 | 0.6 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
0.1 | 0.3 | GO:0001514 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
0.1 | 0.1 | GO:0018065 | protein-cofactor linkage(GO:0018065) |
0.1 | 0.5 | GO:0035162 | embryonic hemopoiesis(GO:0035162) |
0.1 | 0.2 | GO:1901533 | negative regulation of hematopoietic progenitor cell differentiation(GO:1901533) |
0.1 | 0.2 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
0.1 | 0.1 | GO:0008054 | negative regulation of cyclin-dependent protein serine/threonine kinase by cyclin degradation(GO:0008054) |
0.1 | 0.2 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.1 | 0.5 | GO:0071545 | inositol phosphate catabolic process(GO:0071545) |
0.1 | 0.1 | GO:0006271 | DNA strand elongation involved in DNA replication(GO:0006271) lagging strand elongation(GO:0006273) |
0.1 | 0.2 | GO:0070459 | prolactin secretion(GO:0070459) |
0.1 | 0.4 | GO:0061318 | renal filtration cell differentiation(GO:0061318) glomerular epithelium development(GO:0072010) glomerular visceral epithelial cell differentiation(GO:0072112) glomerular epithelial cell differentiation(GO:0072311) |
0.1 | 0.2 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
0.1 | 0.3 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.1 | 0.2 | GO:0043497 | regulation of protein heterodimerization activity(GO:0043497) |
0.1 | 0.3 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
0.1 | 0.1 | GO:2000857 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
0.1 | 0.2 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
0.1 | 0.1 | GO:0070262 | peptidyl-serine dephosphorylation(GO:0070262) |
0.1 | 0.3 | GO:0003093 | regulation of glomerular filtration(GO:0003093) |
0.1 | 0.5 | GO:0050774 | negative regulation of dendrite morphogenesis(GO:0050774) |
0.1 | 0.2 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
0.1 | 0.1 | GO:1990123 | L-glutamate(1-) import into cell(GO:1903802) L-glutamate import into cell(GO:1990123) |
0.1 | 0.5 | GO:0006699 | bile acid biosynthetic process(GO:0006699) |
0.1 | 0.2 | GO:0090031 | positive regulation of steroid hormone biosynthetic process(GO:0090031) |
0.1 | 0.2 | GO:0061469 | regulation of type B pancreatic cell proliferation(GO:0061469) |
0.1 | 0.1 | GO:0042160 | lipoprotein modification(GO:0042160) lipoprotein oxidation(GO:0042161) |
0.1 | 0.1 | GO:0015684 | ferrous iron transport(GO:0015684) |
0.1 | 0.1 | GO:0061738 | late endosomal microautophagy(GO:0061738) |
0.1 | 0.1 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.1 | 0.1 | GO:0002677 | negative regulation of chronic inflammatory response(GO:0002677) |
0.1 | 0.2 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
0.1 | 0.3 | GO:0034227 | tRNA thio-modification(GO:0034227) |
0.1 | 0.2 | GO:0006266 | DNA ligation(GO:0006266) |
0.1 | 0.1 | GO:1901529 | positive regulation of anion channel activity(GO:1901529) |
0.1 | 0.1 | GO:0021586 | pons maturation(GO:0021586) |
0.1 | 0.2 | GO:0035822 | meiotic gene conversion(GO:0006311) gene conversion(GO:0035822) |
0.1 | 0.2 | GO:0015889 | cobalamin transport(GO:0015889) |
0.1 | 0.1 | GO:0014744 | positive regulation of muscle adaptation(GO:0014744) |
0.1 | 0.2 | GO:1990928 | response to amino acid starvation(GO:1990928) |
0.1 | 1.3 | GO:0018279 | protein N-linked glycosylation via asparagine(GO:0018279) |
0.1 | 0.1 | GO:0032429 | regulation of phospholipase A2 activity(GO:0032429) |
0.1 | 0.1 | GO:1904417 | regulation of xenophagy(GO:1904415) positive regulation of xenophagy(GO:1904417) |
0.1 | 0.1 | GO:0007354 | zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
0.1 | 0.2 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
0.1 | 0.2 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.1 | 0.4 | GO:2000780 | negative regulation of double-strand break repair(GO:2000780) |
0.1 | 0.3 | GO:0015791 | polyol transport(GO:0015791) |
0.1 | 0.2 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
0.1 | 0.1 | GO:0034163 | regulation of toll-like receptor 9 signaling pathway(GO:0034163) |
0.1 | 0.3 | GO:0099625 | regulation of ventricular cardiac muscle cell membrane repolarization(GO:0060307) ventricular cardiac muscle cell membrane repolarization(GO:0099625) |
0.1 | 0.5 | GO:0019885 | antigen processing and presentation of endogenous peptide antigen via MHC class I(GO:0019885) |
0.1 | 0.2 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
0.1 | 0.1 | GO:0007386 | compartment pattern specification(GO:0007386) |
0.1 | 0.2 | GO:0070842 | aggresome assembly(GO:0070842) |
0.1 | 0.2 | GO:0032202 | telomere assembly(GO:0032202) |
0.1 | 0.1 | GO:0000957 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
0.1 | 0.2 | GO:1900363 | regulation of mRNA polyadenylation(GO:1900363) |
0.1 | 0.6 | GO:0006883 | cellular sodium ion homeostasis(GO:0006883) |
0.1 | 0.2 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
0.1 | 0.2 | GO:0009597 | detection of virus(GO:0009597) |
0.1 | 0.1 | GO:1902714 | negative regulation of interferon-gamma secretion(GO:1902714) |
0.1 | 0.1 | GO:1903977 | positive regulation of glial cell migration(GO:1903977) |
0.1 | 0.1 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
0.1 | 1.0 | GO:0042538 | hyperosmotic salinity response(GO:0042538) |
0.1 | 1.0 | GO:0016180 | snRNA processing(GO:0016180) |
0.1 | 0.2 | GO:0006551 | leucine metabolic process(GO:0006551) |
0.1 | 0.2 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
0.1 | 0.1 | GO:0006573 | valine metabolic process(GO:0006573) |
0.1 | 0.1 | GO:0048009 | insulin-like growth factor receptor signaling pathway(GO:0048009) |
0.1 | 0.4 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
0.1 | 0.1 | GO:0048597 | post-embryonic camera-type eye morphogenesis(GO:0048597) |
0.1 | 0.2 | GO:0043970 | histone H3-K9 acetylation(GO:0043970) |
0.1 | 0.5 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
0.1 | 0.5 | GO:0070189 | kynurenine metabolic process(GO:0070189) |
0.1 | 0.1 | GO:0034136 | negative regulation of toll-like receptor 2 signaling pathway(GO:0034136) |
0.1 | 0.1 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
0.1 | 0.3 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
0.1 | 0.1 | GO:2000304 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
0.1 | 0.5 | GO:0043206 | extracellular fibril organization(GO:0043206) |
0.1 | 1.5 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
0.1 | 0.3 | GO:0045324 | late endosome to vacuole transport(GO:0045324) |
0.1 | 0.2 | GO:0006172 | ADP biosynthetic process(GO:0006172) |
0.1 | 0.4 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
0.1 | 0.2 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
0.1 | 0.3 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
0.1 | 0.1 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
0.1 | 0.2 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
0.1 | 0.4 | GO:0071157 | negative regulation of cell cycle arrest(GO:0071157) |
0.1 | 0.2 | GO:0070102 | interleukin-6-mediated signaling pathway(GO:0070102) |
0.1 | 0.2 | GO:1902969 | mitotic DNA replication(GO:1902969) |
0.1 | 0.1 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
0.1 | 0.2 | GO:0071313 | cellular response to caffeine(GO:0071313) cellular response to purine-containing compound(GO:0071415) |
0.1 | 0.1 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
0.1 | 0.4 | GO:0048103 | somatic stem cell division(GO:0048103) |
0.1 | 0.1 | GO:0051105 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
0.1 | 0.3 | GO:0045332 | phospholipid translocation(GO:0045332) |
0.1 | 0.1 | GO:0035928 | rRNA import into mitochondrion(GO:0035928) |
0.1 | 0.1 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
0.1 | 0.4 | GO:0002087 | regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
0.1 | 0.1 | GO:0032364 | oxygen homeostasis(GO:0032364) |
0.1 | 0.2 | GO:0014028 | notochord formation(GO:0014028) |
0.1 | 1.1 | GO:0006491 | N-glycan processing(GO:0006491) |
0.1 | 0.1 | GO:0030910 | olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
0.1 | 0.8 | GO:0007026 | negative regulation of microtubule depolymerization(GO:0007026) |
0.1 | 0.2 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
0.1 | 0.2 | GO:0003417 | growth plate cartilage development(GO:0003417) |
0.0 | 0.2 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
0.0 | 0.3 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
0.0 | 0.0 | GO:0097527 | necroptotic signaling pathway(GO:0097527) |
0.0 | 0.2 | GO:1901341 | positive regulation of store-operated calcium channel activity(GO:1901341) |
0.0 | 0.1 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.0 | 0.3 | GO:0006108 | malate metabolic process(GO:0006108) |
0.0 | 0.3 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.0 | 0.4 | GO:0006531 | aspartate metabolic process(GO:0006531) |
0.0 | 0.0 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
0.0 | 0.2 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
0.0 | 0.2 | GO:0050872 | white fat cell differentiation(GO:0050872) |
0.0 | 0.2 | GO:0033567 | DNA replication, Okazaki fragment processing(GO:0033567) DNA replication, removal of RNA primer(GO:0043137) |
0.0 | 0.6 | GO:0048661 | positive regulation of smooth muscle cell proliferation(GO:0048661) |
0.0 | 0.1 | GO:0033029 | regulation of neutrophil apoptotic process(GO:0033029) |
0.0 | 0.1 | GO:0002215 | defense response to nematode(GO:0002215) |
0.0 | 0.1 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
0.0 | 0.3 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
0.0 | 0.1 | GO:0021999 | neural plate anterior/posterior regionalization(GO:0021999) |
0.0 | 0.1 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
0.0 | 0.4 | GO:0034776 | response to histamine(GO:0034776) cellular response to histamine(GO:0071420) |
0.0 | 0.1 | GO:0010446 | response to alkaline pH(GO:0010446) |
0.0 | 0.1 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
0.0 | 0.2 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.0 | 0.6 | GO:0032401 | establishment of melanosome localization(GO:0032401) |
0.0 | 1.0 | GO:0035329 | hippo signaling(GO:0035329) |
0.0 | 0.1 | GO:0019244 | lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
0.0 | 0.5 | GO:0034198 | cellular response to amino acid starvation(GO:0034198) |
0.0 | 0.0 | GO:0071639 | positive regulation of monocyte chemotactic protein-1 production(GO:0071639) |
0.0 | 0.1 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
0.0 | 0.4 | GO:0045086 | positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
0.0 | 0.2 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.0 | 0.1 | GO:0015820 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.0 | 0.0 | GO:0022616 | DNA strand elongation(GO:0022616) |
0.0 | 0.3 | GO:0051085 | chaperone mediated protein folding requiring cofactor(GO:0051085) |
0.0 | 0.1 | GO:0051031 | tRNA transport(GO:0051031) |
0.0 | 0.3 | GO:0048934 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
0.0 | 0.0 | GO:0035811 | negative regulation of urine volume(GO:0035811) |
0.0 | 0.2 | GO:0006044 | N-acetylglucosamine metabolic process(GO:0006044) |
0.0 | 0.0 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) |
0.0 | 0.0 | GO:0045590 | negative regulation of regulatory T cell differentiation(GO:0045590) |
0.0 | 0.0 | GO:0046838 | phosphorylated carbohydrate dephosphorylation(GO:0046838) |
0.0 | 0.2 | GO:0021984 | adenohypophysis development(GO:0021984) |
0.0 | 0.1 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
0.0 | 0.5 | GO:0006359 | regulation of transcription from RNA polymerase III promoter(GO:0006359) |
0.0 | 0.3 | GO:0006072 | glycerol-3-phosphate metabolic process(GO:0006072) |
0.0 | 0.1 | GO:0006553 | lysine metabolic process(GO:0006553) |
0.0 | 0.4 | GO:0060746 | parental behavior(GO:0060746) |
0.0 | 0.2 | GO:0035902 | response to immobilization stress(GO:0035902) |
0.0 | 0.1 | GO:2000321 | positive regulation of T-helper 17 cell differentiation(GO:2000321) |
0.0 | 0.1 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
0.0 | 0.1 | GO:1900451 | positive regulation of glutamate receptor signaling pathway(GO:1900451) positive regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000969) |
0.0 | 0.1 | GO:1904252 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
0.0 | 0.2 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
0.0 | 0.1 | GO:0003161 | cardiac conduction system development(GO:0003161) |
0.0 | 0.1 | GO:0090186 | regulation of pancreatic juice secretion(GO:0090186) negative regulation of pancreatic juice secretion(GO:0090188) |
0.0 | 0.7 | GO:0015988 | energy coupled proton transmembrane transport, against electrochemical gradient(GO:0015988) ATP hydrolysis coupled proton transport(GO:0015991) ATP hydrolysis coupled transmembrane transport(GO:0090662) |
0.0 | 0.6 | GO:0030970 | retrograde protein transport, ER to cytosol(GO:0030970) |
0.0 | 1.0 | GO:0045026 | plasma membrane fusion(GO:0045026) |
0.0 | 0.0 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.0 | 0.3 | GO:0097284 | hepatocyte apoptotic process(GO:0097284) |
0.0 | 0.3 | GO:0047497 | establishment of mitochondrion localization, microtubule-mediated(GO:0034643) mitochondrion transport along microtubule(GO:0047497) |
0.0 | 0.1 | GO:0038107 | nodal signaling pathway involved in determination of left/right asymmetry(GO:0038107) regulation of transcription from RNA polymerase II promoter involved in determination of left/right symmetry(GO:1900094) nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900164) |
0.0 | 0.0 | GO:0002884 | negative regulation of hypersensitivity(GO:0002884) |
0.0 | 0.1 | GO:0035934 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
0.0 | 0.7 | GO:0006783 | heme biosynthetic process(GO:0006783) |
0.0 | 0.0 | GO:1900157 | regulation of bone mineralization involved in bone maturation(GO:1900157) |
0.0 | 0.3 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
0.0 | 0.6 | GO:1901385 | regulation of voltage-gated calcium channel activity(GO:1901385) |
0.0 | 0.1 | GO:0055091 | phospholipid homeostasis(GO:0055091) |
0.0 | 0.0 | GO:0070070 | proton-transporting V-type ATPase complex assembly(GO:0070070) |
0.0 | 1.0 | GO:0048013 | ephrin receptor signaling pathway(GO:0048013) |
0.0 | 0.3 | GO:0070841 | inclusion body assembly(GO:0070841) |
0.0 | 0.3 | GO:0043516 | regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043516) |
0.0 | 0.0 | GO:0015819 | lysine transport(GO:0015819) |
0.0 | 0.1 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
0.0 | 0.0 | GO:0060700 | regulation of ribonuclease activity(GO:0060700) |
0.0 | 0.7 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
0.0 | 0.0 | GO:2000015 | regulation of determination of dorsal identity(GO:2000015) |
0.0 | 0.7 | GO:0046039 | GTP metabolic process(GO:0046039) |
0.0 | 0.8 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
0.0 | 0.2 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.0 | 0.3 | GO:1902116 | negative regulation of organelle assembly(GO:1902116) |
0.0 | 0.1 | GO:0030007 | cellular potassium ion homeostasis(GO:0030007) |
0.0 | 0.2 | GO:0001835 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
0.0 | 0.1 | GO:0045351 | type I interferon biosynthetic process(GO:0045351) |
0.0 | 0.1 | GO:0060155 | platelet dense granule organization(GO:0060155) |
0.0 | 2.4 | GO:1903955 | positive regulation of protein targeting to mitochondrion(GO:1903955) |
0.0 | 0.2 | GO:0007028 | cytoplasm organization(GO:0007028) |
0.0 | 0.1 | GO:0061055 | myotome development(GO:0061055) |
0.0 | 0.5 | GO:0034219 | carbohydrate transmembrane transport(GO:0034219) |
0.0 | 0.2 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
0.0 | 0.7 | GO:0042596 | fear response(GO:0042596) |
0.0 | 0.1 | GO:0009946 | proximal/distal axis specification(GO:0009946) |
0.0 | 0.2 | GO:0031033 | myosin filament organization(GO:0031033) |
0.0 | 0.0 | GO:0055026 | negative regulation of cardiac muscle tissue development(GO:0055026) |
0.0 | 0.1 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
0.0 | 0.2 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
0.0 | 0.1 | GO:0061101 | neuroendocrine cell differentiation(GO:0061101) |
0.0 | 0.6 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
0.0 | 0.1 | GO:0048014 | Tie signaling pathway(GO:0048014) |
0.0 | 0.4 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
0.0 | 0.1 | GO:1903011 | negative regulation of bone development(GO:1903011) |
0.0 | 0.1 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
0.0 | 0.0 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
0.0 | 0.2 | GO:0048251 | elastic fiber assembly(GO:0048251) |
0.0 | 0.0 | GO:0060426 | lung vasculature development(GO:0060426) |
0.0 | 0.2 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.0 | 0.0 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
0.0 | 0.1 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
0.0 | 0.2 | GO:0070172 | positive regulation of tooth mineralization(GO:0070172) |
0.0 | 0.2 | GO:0006020 | inositol metabolic process(GO:0006020) |
0.0 | 0.2 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
0.0 | 0.2 | GO:0051639 | actin filament network formation(GO:0051639) |
0.0 | 0.3 | GO:0035025 | positive regulation of Rho protein signal transduction(GO:0035025) |
0.0 | 0.1 | GO:0050746 | regulation of lipoprotein metabolic process(GO:0050746) |
0.0 | 0.1 | GO:0014717 | regulation of satellite cell activation involved in skeletal muscle regeneration(GO:0014717) satellite cell activation involved in skeletal muscle regeneration(GO:0014901) |
0.0 | 0.0 | GO:0014042 | positive regulation of neuron maturation(GO:0014042) |
0.0 | 0.1 | GO:0043247 | protection from non-homologous end joining at telomere(GO:0031848) telomere maintenance in response to DNA damage(GO:0043247) |
0.0 | 0.1 | GO:0045793 | positive regulation of cell size(GO:0045793) |
0.0 | 0.0 | GO:2000767 | positive regulation of cytoplasmic translation(GO:2000767) |
0.0 | 0.1 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.0 | 0.2 | GO:0072643 | interferon-gamma secretion(GO:0072643) |
0.0 | 0.1 | GO:1902033 | regulation of hematopoietic stem cell proliferation(GO:1902033) |
0.0 | 0.1 | GO:0015886 | heme transport(GO:0015886) |
0.0 | 0.3 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.0 | 0.2 | GO:0045909 | positive regulation of vasodilation(GO:0045909) |
0.0 | 0.1 | GO:0014824 | artery smooth muscle contraction(GO:0014824) |
0.0 | 0.1 | GO:0019262 | N-acetylneuraminate catabolic process(GO:0019262) |
0.0 | 0.0 | GO:1903894 | regulation of IRE1-mediated unfolded protein response(GO:1903894) |
0.0 | 0.0 | GO:0010749 | regulation of nitric oxide mediated signal transduction(GO:0010749) |
0.0 | 0.0 | GO:0051902 | negative regulation of mitochondrial depolarization(GO:0051902) negative regulation of membrane depolarization(GO:1904180) |
0.0 | 0.0 | GO:1901722 | regulation of cell proliferation involved in kidney development(GO:1901722) |
0.0 | 0.1 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
0.0 | 0.2 | GO:0032291 | central nervous system myelination(GO:0022010) axon ensheathment in central nervous system(GO:0032291) |
0.0 | 0.1 | GO:0002317 | plasma cell differentiation(GO:0002317) |
0.0 | 0.0 | GO:1903750 | regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903750) negative regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903751) |
0.0 | 0.1 | GO:0030091 | protein repair(GO:0030091) |
0.0 | 0.1 | GO:0019348 | dolichol metabolic process(GO:0019348) |
0.0 | 0.1 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
0.0 | 0.4 | GO:0016973 | poly(A)+ mRNA export from nucleus(GO:0016973) |
0.0 | 0.1 | GO:0010455 | positive regulation of cell fate commitment(GO:0010455) |
0.0 | 0.0 | GO:0002282 | microglial cell activation involved in immune response(GO:0002282) |
0.0 | 0.3 | GO:0003351 | epithelial cilium movement(GO:0003351) |
0.0 | 0.0 | GO:0035356 | cellular triglyceride homeostasis(GO:0035356) |
0.0 | 0.1 | GO:1903753 | negative regulation of p38MAPK cascade(GO:1903753) |
0.0 | 0.2 | GO:0051443 | positive regulation of ubiquitin-protein transferase activity(GO:0051443) |
0.0 | 0.0 | GO:0090399 | replicative senescence(GO:0090399) |
0.0 | 0.2 | GO:1904970 | brush border assembly(GO:1904970) |
0.0 | 0.4 | GO:0031163 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
0.0 | 0.2 | GO:0018377 | protein myristoylation(GO:0018377) |
0.0 | 0.2 | GO:0006301 | postreplication repair(GO:0006301) |
0.0 | 0.1 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
0.0 | 0.0 | GO:0060437 | lung growth(GO:0060437) |
0.0 | 0.1 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
0.0 | 0.0 | GO:0061511 | centriole elongation(GO:0061511) |
0.0 | 0.1 | GO:0032713 | negative regulation of interleukin-4 production(GO:0032713) |
0.0 | 0.2 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
0.0 | 0.0 | GO:0046685 | response to arsenic-containing substance(GO:0046685) |
0.0 | 0.2 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
0.0 | 0.0 | GO:0060594 | mammary gland specification(GO:0060594) |
0.0 | 0.2 | GO:0003298 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
0.0 | 0.1 | GO:1902475 | L-alpha-amino acid transmembrane transport(GO:1902475) |
0.0 | 0.1 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
0.0 | 0.0 | GO:1905097 | regulation of guanyl-nucleotide exchange factor activity(GO:1905097) |
0.0 | 0.1 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
0.0 | 0.2 | GO:0007625 | grooming behavior(GO:0007625) |
0.0 | 0.0 | GO:0035790 | platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
0.0 | 0.1 | GO:0046952 | ketone body catabolic process(GO:0046952) |
0.0 | 0.4 | GO:0007029 | endoplasmic reticulum organization(GO:0007029) |
0.0 | 0.5 | GO:0019369 | arachidonic acid metabolic process(GO:0019369) |
0.0 | 1.4 | GO:0010950 | positive regulation of endopeptidase activity(GO:0010950) |
0.0 | 0.3 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
0.0 | 0.0 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
0.0 | 0.1 | GO:0043923 | positive regulation by host of viral transcription(GO:0043923) |
0.0 | 0.3 | GO:0044406 | adhesion of symbiont to host(GO:0044406) |
0.0 | 0.0 | GO:0019372 | lipoxygenase pathway(GO:0019372) |
0.0 | 0.2 | GO:0019227 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
0.0 | 0.1 | GO:0015671 | oxygen transport(GO:0015671) |
0.0 | 0.2 | GO:0045899 | positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
0.0 | 0.3 | GO:0046579 | positive regulation of Ras protein signal transduction(GO:0046579) |
0.0 | 0.1 | GO:0097168 | mesenchymal stem cell proliferation(GO:0097168) |
0.0 | 0.1 | GO:0030421 | defecation(GO:0030421) |
0.0 | 0.3 | GO:0031648 | protein destabilization(GO:0031648) |
0.0 | 0.1 | GO:0044778 | meiotic DNA integrity checkpoint(GO:0044778) |
0.0 | 0.1 | GO:0045409 | negative regulation of interleukin-6 biosynthetic process(GO:0045409) |
0.0 | 0.2 | GO:0033561 | regulation of water loss via skin(GO:0033561) establishment of skin barrier(GO:0061436) |
0.0 | 0.2 | GO:0090314 | positive regulation of protein targeting to membrane(GO:0090314) |
0.0 | 0.1 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
0.0 | 0.2 | GO:0032835 | glomerulus development(GO:0032835) |
0.0 | 0.2 | GO:0019370 | leukotriene biosynthetic process(GO:0019370) |
0.0 | 0.1 | GO:0031440 | regulation of mRNA 3'-end processing(GO:0031440) |
0.0 | 0.0 | GO:0045064 | T-helper 2 cell differentiation(GO:0045064) |
0.0 | 0.0 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
0.0 | 0.2 | GO:0048169 | regulation of long-term neuronal synaptic plasticity(GO:0048169) |
0.0 | 0.0 | GO:0034391 | smooth muscle cell apoptotic process(GO:0034390) regulation of smooth muscle cell apoptotic process(GO:0034391) |
0.0 | 0.1 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
0.0 | 0.5 | GO:0086010 | membrane depolarization during action potential(GO:0086010) |
0.0 | 0.1 | GO:0043987 | histone H3-S10 phosphorylation(GO:0043987) |
0.0 | 0.1 | GO:0006824 | cobalt ion transport(GO:0006824) |
0.0 | 0.0 | GO:0015755 | fructose transport(GO:0015755) |
0.0 | 0.1 | GO:0045908 | negative regulation of vasodilation(GO:0045908) |
0.0 | 0.0 | GO:0048807 | female genitalia morphogenesis(GO:0048807) |
0.0 | 0.3 | GO:0043968 | histone H2A acetylation(GO:0043968) |
0.0 | 0.0 | GO:0034635 | glutathione transport(GO:0034635) tripeptide transport(GO:0042939) |
0.0 | 0.2 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
0.0 | 0.5 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
0.0 | 0.1 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
0.0 | 0.1 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
0.0 | 0.1 | GO:0042348 | regulation of NF-kappaB import into nucleus(GO:0042345) NF-kappaB import into nucleus(GO:0042348) |
0.0 | 0.1 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
0.0 | 0.1 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
0.0 | 0.2 | GO:0042159 | lipoprotein catabolic process(GO:0042159) |
0.0 | 0.0 | GO:1903012 | positive regulation of bone development(GO:1903012) |
0.0 | 0.0 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
0.0 | 0.0 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
0.0 | 0.1 | GO:0060044 | negative regulation of cardiac muscle cell proliferation(GO:0060044) |
0.0 | 0.1 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
0.0 | 0.1 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
0.0 | 0.1 | GO:0043650 | dicarboxylic acid biosynthetic process(GO:0043650) |
0.0 | 0.2 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
0.0 | 0.1 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.0 | 0.5 | GO:0035082 | axoneme assembly(GO:0035082) |
0.0 | 0.1 | GO:0021570 | rhombomere 4 development(GO:0021570) |
0.0 | 0.5 | GO:0030488 | tRNA methylation(GO:0030488) |
0.0 | 0.1 | GO:0010310 | regulation of hydrogen peroxide metabolic process(GO:0010310) |
0.0 | 0.2 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
0.0 | 0.0 | GO:0014016 | neuroblast differentiation(GO:0014016) |
0.0 | 0.1 | GO:0097084 | vascular smooth muscle cell development(GO:0097084) |
0.0 | 0.0 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
0.0 | 0.1 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
0.0 | 0.1 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
0.0 | 0.1 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
0.0 | 0.0 | GO:0061038 | uterus morphogenesis(GO:0061038) |
0.0 | 0.0 | GO:0003149 | membranous septum morphogenesis(GO:0003149) |
0.0 | 0.1 | GO:0046884 | follicle-stimulating hormone secretion(GO:0046884) |
0.0 | 0.0 | GO:0003171 | atrioventricular valve development(GO:0003171) |
0.0 | 0.0 | GO:0009068 | aspartate family amino acid catabolic process(GO:0009068) |
0.0 | 0.2 | GO:0061298 | retina vasculature development in camera-type eye(GO:0061298) |
0.0 | 0.1 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
0.0 | 0.0 | GO:0006680 | glucosylceramide catabolic process(GO:0006680) |
0.0 | 0.0 | GO:2000765 | regulation of cytoplasmic translation(GO:2000765) |
0.0 | 0.1 | GO:0007525 | somatic muscle development(GO:0007525) |
0.0 | 0.0 | GO:0035795 | negative regulation of mitochondrial membrane permeability(GO:0035795) |
0.0 | 0.0 | GO:0042126 | nitrate metabolic process(GO:0042126) nitrogen cycle metabolic process(GO:0071941) |
0.0 | 0.2 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
0.0 | 0.0 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
0.0 | 0.0 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
0.0 | 0.1 | GO:1902600 | hydrogen ion transmembrane transport(GO:1902600) |
0.0 | 0.1 | GO:0002911 | lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
0.0 | 0.1 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
0.0 | 0.1 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.0 | 0.0 | GO:0014889 | muscle atrophy(GO:0014889) |
0.0 | 0.1 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
0.0 | 0.1 | GO:0015879 | carnitine transport(GO:0015879) |
0.0 | 0.0 | GO:0042494 | detection of bacterial lipoprotein(GO:0042494) |
0.0 | 0.0 | GO:2001181 | positive regulation of interleukin-10 secretion(GO:2001181) |
0.0 | 0.1 | GO:0014741 | negative regulation of muscle hypertrophy(GO:0014741) |
0.0 | 0.0 | GO:0071847 | TNFSF11-mediated signaling pathway(GO:0071847) |
0.0 | 0.2 | GO:0051923 | sulfation(GO:0051923) |
0.0 | 0.1 | GO:0060012 | synaptic transmission, glycinergic(GO:0060012) |
0.0 | 0.0 | GO:0010715 | regulation of extracellular matrix disassembly(GO:0010715) |
0.0 | 0.2 | GO:1900037 | regulation of cellular response to hypoxia(GO:1900037) |
0.0 | 0.1 | GO:0031342 | negative regulation of cell killing(GO:0031342) |
0.0 | 0.0 | GO:0002155 | regulation of thyroid hormone mediated signaling pathway(GO:0002155) |
0.0 | 0.1 | GO:0007000 | nucleolus organization(GO:0007000) |
0.0 | 0.1 | GO:0007135 | meiosis II(GO:0007135) |
0.0 | 0.1 | GO:0060134 | prepulse inhibition(GO:0060134) |
0.0 | 0.1 | GO:0002063 | chondrocyte development(GO:0002063) |
0.0 | 0.1 | GO:0002828 | regulation of type 2 immune response(GO:0002828) |
0.0 | 0.0 | GO:0090594 | wound healing involved in inflammatory response(GO:0002246) connective tissue replacement involved in inflammatory response wound healing(GO:0002248) inflammatory response to wounding(GO:0090594) connective tissue replacement(GO:0097709) |
0.0 | 0.0 | GO:0009838 | abscission(GO:0009838) |
0.0 | 0.0 | GO:0010966 | regulation of phosphate transport(GO:0010966) |
0.0 | 0.0 | GO:0090148 | membrane fission(GO:0090148) |
0.0 | 0.0 | GO:0001661 | conditioned taste aversion(GO:0001661) |
0.0 | 0.0 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
0.0 | 0.0 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
0.0 | 0.1 | GO:0060947 | cardiac vascular smooth muscle cell differentiation(GO:0060947) |
0.0 | 0.1 | GO:1901522 | positive regulation of transcription from RNA polymerase II promoter involved in cellular response to chemical stimulus(GO:1901522) |
0.0 | 0.0 | GO:0002043 | blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:0002043) |
0.0 | 0.1 | GO:0042136 | neurotransmitter biosynthetic process(GO:0042136) |
0.0 | 0.0 | GO:0014029 | neural crest formation(GO:0014029) |
0.0 | 0.0 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
0.0 | 0.1 | GO:0006264 | mitochondrial DNA replication(GO:0006264) |
0.0 | 0.1 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
0.0 | 0.0 | GO:1902914 | regulation of protein polyubiquitination(GO:1902914) |
0.0 | 0.2 | GO:0006379 | mRNA cleavage(GO:0006379) |
0.0 | 0.1 | GO:0051415 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
0.0 | 0.2 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.0 | 0.0 | GO:0032471 | negative regulation of endoplasmic reticulum calcium ion concentration(GO:0032471) |
0.0 | 0.1 | GO:0042487 | regulation of odontogenesis of dentin-containing tooth(GO:0042487) |
0.0 | 0.3 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
0.0 | 0.0 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
0.0 | 1.0 | GO:0043123 | positive regulation of I-kappaB kinase/NF-kappaB signaling(GO:0043123) |
0.0 | 0.0 | GO:2000370 | positive regulation of clathrin-mediated endocytosis(GO:2000370) |
0.0 | 0.1 | GO:2000171 | negative regulation of dendrite development(GO:2000171) |
0.0 | 0.0 | GO:0006244 | pyrimidine nucleotide catabolic process(GO:0006244) |
0.0 | 0.1 | GO:0052055 | modulation by symbiont of host molecular function(GO:0052055) modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
0.0 | 0.1 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
0.0 | 0.2 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.0 | 0.1 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
0.0 | 0.0 | GO:0072608 | interleukin-10 secretion(GO:0072608) |
0.0 | 0.1 | GO:0042256 | mature ribosome assembly(GO:0042256) |
0.0 | 0.0 | GO:1903010 | regulation of bone development(GO:1903010) |
0.0 | 0.0 | GO:0044849 | estrous cycle(GO:0044849) |
0.0 | 0.1 | GO:1901984 | negative regulation of protein acetylation(GO:1901984) |
0.0 | 0.0 | GO:0030035 | microspike assembly(GO:0030035) |
0.0 | 0.0 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
0.0 | 0.0 | GO:0035106 | operant conditioning(GO:0035106) |
0.0 | 0.1 | GO:0045199 | maintenance of epithelial cell apical/basal polarity(GO:0045199) |
0.0 | 0.6 | GO:0000380 | alternative mRNA splicing, via spliceosome(GO:0000380) |
0.0 | 0.0 | GO:0046005 | positive regulation of circadian sleep/wake cycle, REM sleep(GO:0046005) |
0.0 | 0.1 | GO:0006308 | DNA catabolic process(GO:0006308) |
0.0 | 0.1 | GO:0070091 | glucagon secretion(GO:0070091) |
0.0 | 0.0 | GO:0061303 | cornea development in camera-type eye(GO:0061303) |
0.0 | 0.1 | GO:0051026 | chiasma assembly(GO:0051026) |
0.0 | 0.1 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.0 | 0.0 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
0.0 | 0.0 | GO:0046689 | response to mercury ion(GO:0046689) |
0.0 | 0.1 | GO:0045646 | regulation of erythrocyte differentiation(GO:0045646) |
0.0 | 0.1 | GO:0017062 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
0.0 | 0.0 | GO:0070535 | histone H2A K63-linked ubiquitination(GO:0070535) |
0.0 | 0.1 | GO:0032790 | ribosome disassembly(GO:0032790) |
0.0 | 0.1 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
0.0 | 0.0 | GO:1902534 | single-organism membrane invagination(GO:1902534) |
0.0 | 0.0 | GO:0051204 | protein insertion into mitochondrial membrane(GO:0051204) |
0.0 | 0.0 | GO:0001951 | intestinal D-glucose absorption(GO:0001951) |
0.0 | 0.3 | GO:0006953 | acute-phase response(GO:0006953) |
0.0 | 0.0 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
0.0 | 0.0 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
0.0 | 0.0 | GO:1901678 | iron coordination entity transport(GO:1901678) |
0.0 | 0.0 | GO:0032042 | mitochondrial DNA metabolic process(GO:0032042) |
0.0 | 0.0 | GO:0071371 | cellular response to gonadotropin stimulus(GO:0071371) |
0.0 | 0.3 | GO:0007062 | sister chromatid cohesion(GO:0007062) |
0.0 | 0.2 | GO:0010257 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.0 | 0.1 | GO:0038092 | nodal signaling pathway(GO:0038092) |
0.0 | 0.0 | GO:0000711 | meiotic DNA repair synthesis(GO:0000711) |
0.0 | 0.1 | GO:0045835 | negative regulation of meiotic nuclear division(GO:0045835) |
0.0 | 0.2 | GO:1990542 | mitochondrial transmembrane transport(GO:1990542) |
0.0 | 0.4 | GO:0002181 | cytoplasmic translation(GO:0002181) |
0.0 | 0.1 | GO:0042148 | strand invasion(GO:0042148) |
0.0 | 0.1 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
0.0 | 0.1 | GO:0035871 | protein K11-linked deubiquitination(GO:0035871) |
0.0 | 0.0 | GO:0010578 | regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010578) positive regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010579) |
0.0 | 0.2 | GO:0048536 | spleen development(GO:0048536) |
0.0 | 0.0 | GO:0031282 | regulation of guanylate cyclase activity(GO:0031282) |
0.0 | 0.0 | GO:0060177 | regulation of angiotensin metabolic process(GO:0060177) |
0.0 | 0.1 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
0.0 | 0.2 | GO:0005978 | glycogen biosynthetic process(GO:0005978) glucan biosynthetic process(GO:0009250) |
0.0 | 0.0 | GO:0032252 | secretory granule localization(GO:0032252) |
0.0 | 0.0 | GO:1900747 | negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) |
0.0 | 0.0 | GO:0007468 | regulation of rhodopsin gene expression(GO:0007468) |
0.0 | 0.0 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.0 | 0.0 | GO:0098763 | mitotic cell cycle phase(GO:0098763) |
0.0 | 0.1 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.0 | 0.1 | GO:0050482 | arachidonic acid secretion(GO:0050482) arachidonate transport(GO:1903963) |
0.0 | 0.2 | GO:0009225 | nucleotide-sugar metabolic process(GO:0009225) |
0.0 | 0.4 | GO:0051865 | protein autoubiquitination(GO:0051865) |
0.0 | 0.2 | GO:0035458 | cellular response to interferon-beta(GO:0035458) |
0.0 | 0.0 | GO:0019852 | L-ascorbic acid metabolic process(GO:0019852) |
0.0 | 0.1 | GO:0007379 | segment specification(GO:0007379) |
0.0 | 0.3 | GO:0015914 | phospholipid transport(GO:0015914) |
0.0 | 0.0 | GO:0042637 | catagen(GO:0042637) |
0.0 | 0.0 | GO:0051969 | regulation of transmission of nerve impulse(GO:0051969) |
0.0 | 0.0 | GO:0032224 | positive regulation of synaptic transmission, cholinergic(GO:0032224) |
0.0 | 0.1 | GO:0043153 | entrainment of circadian clock by photoperiod(GO:0043153) |
0.0 | 0.1 | GO:0060180 | female mating behavior(GO:0060180) |
0.0 | 0.1 | GO:0007603 | phototransduction, visible light(GO:0007603) |
0.0 | 0.4 | GO:0031424 | keratinization(GO:0031424) |
0.0 | 0.0 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
0.0 | 0.0 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
0.0 | 0.0 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
0.0 | 0.0 | GO:0051409 | response to nitrosative stress(GO:0051409) |
0.0 | 0.1 | GO:0015936 | coenzyme A metabolic process(GO:0015936) |
0.0 | 0.0 | GO:1900225 | regulation of NLRP3 inflammasome complex assembly(GO:1900225) |
0.0 | 0.2 | GO:0033120 | positive regulation of RNA splicing(GO:0033120) |
0.0 | 0.0 | GO:2000520 | regulation of immunological synapse formation(GO:2000520) |
0.0 | 0.0 | GO:0072106 | regulation of ureteric bud formation(GO:0072106) positive regulation of ureteric bud formation(GO:0072107) |
0.0 | 0.0 | GO:0060084 | synaptic transmission involved in micturition(GO:0060084) |
0.0 | 0.0 | GO:0036481 | intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:0036481) |
0.0 | 0.0 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.0 | 0.1 | GO:1990403 | embryonic brain development(GO:1990403) |
0.0 | 0.0 | GO:0034447 | very-low-density lipoprotein particle clearance(GO:0034447) |
0.0 | 0.0 | GO:1903261 | regulation of serine phosphorylation of STAT3 protein(GO:1903261) |
0.0 | 0.1 | GO:0044144 | regulation of growth of symbiont in host(GO:0044126) modulation of growth of symbiont involved in interaction with host(GO:0044144) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.5 | 4.6 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.7 | 2.7 | GO:0072487 | MSL complex(GO:0072487) |
0.6 | 1.7 | GO:0005606 | laminin-1 complex(GO:0005606) |
0.4 | 0.4 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
0.4 | 1.2 | GO:0097513 | myosin II filament(GO:0097513) |
0.4 | 2.5 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.4 | 1.4 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
0.3 | 1.0 | GO:0048179 | activin receptor complex(GO:0048179) |
0.3 | 1.3 | GO:0005955 | calcineurin complex(GO:0005955) |
0.3 | 0.9 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.3 | 0.9 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.3 | 2.9 | GO:0031010 | ISWI-type complex(GO:0031010) |
0.3 | 0.8 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.3 | 1.4 | GO:0097433 | dense body(GO:0097433) |
0.3 | 0.8 | GO:0032127 | dense core granule membrane(GO:0032127) |
0.3 | 0.8 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
0.3 | 2.3 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.2 | 2.9 | GO:0071564 | npBAF complex(GO:0071564) |
0.2 | 1.0 | GO:0097452 | GAIT complex(GO:0097452) |
0.2 | 0.5 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
0.2 | 0.9 | GO:0071203 | WASH complex(GO:0071203) |
0.2 | 0.7 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.2 | 0.6 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.2 | 1.5 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.2 | 2.3 | GO:0070852 | cell body fiber(GO:0070852) |
0.2 | 1.0 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.2 | 0.8 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.2 | 0.6 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
0.2 | 0.8 | GO:0042583 | chromaffin granule(GO:0042583) |
0.2 | 1.0 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.2 | 0.6 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.2 | 0.2 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.2 | 0.9 | GO:0044294 | dendritic growth cone(GO:0044294) |
0.2 | 1.5 | GO:0030056 | hemidesmosome(GO:0030056) |
0.2 | 0.6 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.2 | 0.7 | GO:0071141 | SMAD protein complex(GO:0071141) |
0.2 | 1.5 | GO:0031209 | SCAR complex(GO:0031209) |
0.2 | 1.4 | GO:0001650 | fibrillar center(GO:0001650) |
0.2 | 0.5 | GO:0036396 | MIS complex(GO:0036396) |
0.2 | 2.1 | GO:0098533 | ATPase dependent transmembrane transport complex(GO:0098533) |
0.2 | 0.9 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
0.2 | 1.0 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
0.2 | 1.5 | GO:0000124 | SAGA complex(GO:0000124) |
0.2 | 0.2 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.2 | 1.9 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.2 | 0.6 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.2 | 4.8 | GO:0000791 | euchromatin(GO:0000791) |
0.2 | 0.6 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
0.2 | 0.5 | GO:0031417 | NatC complex(GO:0031417) |
0.2 | 0.2 | GO:0038037 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
0.2 | 0.5 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
0.2 | 0.5 | GO:0020016 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
0.2 | 0.9 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.1 | 0.7 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.1 | 1.0 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.1 | 0.3 | GO:0032010 | phagolysosome(GO:0032010) |
0.1 | 0.6 | GO:0071817 | MMXD complex(GO:0071817) |
0.1 | 1.2 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.1 | 0.4 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
0.1 | 1.0 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.1 | 2.1 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.1 | 1.1 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.1 | 1.0 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.1 | 0.5 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
0.1 | 0.5 | GO:1990130 | Iml1 complex(GO:1990130) |
0.1 | 0.1 | GO:0005767 | secondary lysosome(GO:0005767) |
0.1 | 0.5 | GO:0002142 | stereocilia ankle link complex(GO:0002142) |
0.1 | 1.4 | GO:0032039 | integrator complex(GO:0032039) |
0.1 | 0.4 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.1 | 0.4 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.1 | 0.7 | GO:0016600 | flotillin complex(GO:0016600) |
0.1 | 0.1 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
0.1 | 0.4 | GO:0097443 | sorting endosome(GO:0097443) |
0.1 | 0.1 | GO:0035102 | PRC1 complex(GO:0035102) |
0.1 | 0.4 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.1 | 0.4 | GO:0033269 | internode region of axon(GO:0033269) |
0.1 | 0.4 | GO:0043219 | lateral loop(GO:0043219) |
0.1 | 0.7 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
0.1 | 0.7 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.1 | 0.6 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.1 | 0.4 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
0.1 | 0.6 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
0.1 | 0.3 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
0.1 | 0.2 | GO:0044393 | microspike(GO:0044393) |
0.1 | 0.2 | GO:0044194 | cytolytic granule(GO:0044194) |
0.1 | 0.3 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
0.1 | 1.2 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
0.1 | 0.3 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
0.1 | 0.3 | GO:0044299 | C-fiber(GO:0044299) |
0.1 | 0.3 | GO:0043293 | apoptosome(GO:0043293) |
0.1 | 1.1 | GO:0042405 | nuclear inclusion body(GO:0042405) |
0.1 | 0.6 | GO:0031415 | NatA complex(GO:0031415) |
0.1 | 0.4 | GO:0042825 | TAP complex(GO:0042825) |
0.1 | 0.3 | GO:0005827 | polar microtubule(GO:0005827) |
0.1 | 0.3 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
0.1 | 0.5 | GO:0097422 | tubular endosome(GO:0097422) |
0.1 | 0.3 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
0.1 | 3.6 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
0.1 | 0.9 | GO:0005916 | fascia adherens(GO:0005916) |
0.1 | 0.5 | GO:0043202 | lysosomal lumen(GO:0043202) |
0.1 | 7.0 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
0.1 | 0.3 | GO:1990635 | proximal dendrite(GO:1990635) |
0.1 | 1.1 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.1 | 0.1 | GO:0000439 | core TFIIH complex(GO:0000439) |
0.1 | 0.6 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.1 | 1.5 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.1 | 4.4 | GO:0044291 | cell-cell contact zone(GO:0044291) |
0.1 | 0.3 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
0.1 | 0.1 | GO:0000811 | GINS complex(GO:0000811) |
0.1 | 0.5 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
0.1 | 0.2 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
0.1 | 0.6 | GO:0031931 | TORC1 complex(GO:0031931) |
0.1 | 0.6 | GO:0033263 | CORVET complex(GO:0033263) |
0.1 | 0.4 | GO:0031262 | Ndc80 complex(GO:0031262) |
0.1 | 0.3 | GO:0044326 | dendritic spine neck(GO:0044326) |
0.1 | 0.3 | GO:0030125 | clathrin vesicle coat(GO:0030125) |
0.1 | 2.5 | GO:0000118 | histone deacetylase complex(GO:0000118) |
0.1 | 0.3 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
0.1 | 0.3 | GO:0036194 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
0.1 | 0.1 | GO:0005775 | vacuolar lumen(GO:0005775) |
0.1 | 0.7 | GO:0046581 | intercellular canaliculus(GO:0046581) |
0.1 | 0.2 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.1 | 1.0 | GO:0043196 | varicosity(GO:0043196) |
0.1 | 0.9 | GO:0031528 | microvillus membrane(GO:0031528) |
0.1 | 0.1 | GO:0005608 | laminin-3 complex(GO:0005608) |
0.1 | 0.5 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.1 | 0.2 | GO:1990357 | terminal web(GO:1990357) |
0.1 | 0.3 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
0.1 | 0.2 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
0.1 | 1.3 | GO:0005614 | interstitial matrix(GO:0005614) |
0.1 | 0.3 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.1 | 0.4 | GO:0000796 | condensin complex(GO:0000796) |
0.1 | 1.6 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
0.1 | 2.0 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
0.1 | 0.5 | GO:0019908 | nuclear cyclin-dependent protein kinase holoenzyme complex(GO:0019908) |
0.1 | 1.3 | GO:0031907 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
0.1 | 0.4 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
0.1 | 1.0 | GO:0060077 | inhibitory synapse(GO:0060077) |
0.1 | 0.1 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
0.1 | 0.5 | GO:0097470 | ribbon synapse(GO:0097470) |
0.1 | 1.1 | GO:0090665 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
0.1 | 0.1 | GO:0043511 | inhibin complex(GO:0043511) |
0.1 | 3.8 | GO:0016605 | PML body(GO:0016605) |
0.1 | 0.5 | GO:0020005 | symbiont-containing vacuole membrane(GO:0020005) |
0.1 | 0.2 | GO:0070876 | SOSS complex(GO:0070876) |
0.1 | 0.4 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
0.1 | 1.0 | GO:0031231 | intrinsic component of peroxisomal membrane(GO:0031231) |
0.1 | 0.5 | GO:0018995 | host(GO:0018995) host cell part(GO:0033643) host cell(GO:0043657) |
0.1 | 0.3 | GO:0044308 | axonal spine(GO:0044308) |
0.1 | 1.0 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.1 | 0.5 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.1 | 1.4 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.1 | 0.7 | GO:0030673 | axolemma(GO:0030673) |
0.1 | 6.0 | GO:0005923 | bicellular tight junction(GO:0005923) |
0.1 | 2.2 | GO:0016592 | mediator complex(GO:0016592) |
0.1 | 0.3 | GO:0042101 | T cell receptor complex(GO:0042101) |
0.1 | 0.2 | GO:0005745 | m-AAA complex(GO:0005745) |
0.1 | 1.6 | GO:0048786 | presynaptic active zone(GO:0048786) |
0.1 | 0.1 | GO:0070160 | occluding junction(GO:0070160) |
0.1 | 0.3 | GO:0071797 | LUBAC complex(GO:0071797) |
0.1 | 0.3 | GO:0089701 | U2AF(GO:0089701) |
0.1 | 0.3 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.1 | 0.1 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.1 | 0.6 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.1 | 0.5 | GO:0061700 | Seh1-associated complex(GO:0035859) GATOR2 complex(GO:0061700) |
0.1 | 0.6 | GO:1990391 | DNA repair complex(GO:1990391) |
0.1 | 0.2 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
0.1 | 0.2 | GO:0030870 | Mre11 complex(GO:0030870) |
0.1 | 0.2 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
0.1 | 0.2 | GO:0097255 | R2TP complex(GO:0097255) |
0.1 | 1.0 | GO:0005605 | basal lamina(GO:0005605) |
0.1 | 1.7 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
0.1 | 0.5 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.1 | 2.4 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
0.1 | 0.2 | GO:0071439 | clathrin complex(GO:0071439) |
0.1 | 0.3 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
0.1 | 0.2 | GO:0031298 | replication fork protection complex(GO:0031298) |
0.1 | 0.1 | GO:0015935 | small ribosomal subunit(GO:0015935) |
0.1 | 0.8 | GO:0031305 | integral component of mitochondrial inner membrane(GO:0031305) |
0.1 | 0.7 | GO:0034385 | very-low-density lipoprotein particle(GO:0034361) triglyceride-rich lipoprotein particle(GO:0034385) |
0.1 | 0.6 | GO:0030914 | STAGA complex(GO:0030914) |
0.1 | 0.2 | GO:0030285 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
0.1 | 0.2 | GO:0071942 | XPC complex(GO:0071942) |
0.1 | 0.3 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.1 | 0.2 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
0.1 | 0.2 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
0.1 | 0.2 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
0.1 | 2.5 | GO:0043197 | dendritic spine(GO:0043197) |
0.1 | 0.4 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.1 | 0.2 | GO:1990462 | omegasome(GO:1990462) |
0.1 | 0.4 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
0.0 | 1.2 | GO:0001772 | immunological synapse(GO:0001772) |
0.0 | 0.2 | GO:0071953 | elastic fiber(GO:0071953) |
0.0 | 0.3 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
0.0 | 0.0 | GO:0045293 | mRNA editing complex(GO:0045293) |
0.0 | 0.0 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
0.0 | 0.2 | GO:0005638 | lamin filament(GO:0005638) |
0.0 | 0.2 | GO:0070695 | FHF complex(GO:0070695) |
0.0 | 0.1 | GO:0000812 | Swr1 complex(GO:0000812) |
0.0 | 0.5 | GO:0001527 | microfibril(GO:0001527) |
0.0 | 0.2 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.0 | 0.3 | GO:0036157 | outer dynein arm(GO:0036157) |
0.0 | 0.5 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
0.0 | 0.1 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.0 | 0.4 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
0.0 | 0.6 | GO:0042599 | lamellar body(GO:0042599) |
0.0 | 0.2 | GO:0038201 | TORC2 complex(GO:0031932) TOR complex(GO:0038201) |
0.0 | 0.6 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.0 | 0.1 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.0 | 0.1 | GO:0031523 | Myb complex(GO:0031523) |
0.0 | 1.4 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.0 | 0.2 | GO:0032021 | NELF complex(GO:0032021) |
0.0 | 6.0 | GO:0014069 | postsynaptic density(GO:0014069) postsynaptic specialization(GO:0099572) |
0.0 | 0.5 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
0.0 | 1.3 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.0 | 0.4 | GO:0043034 | costamere(GO:0043034) |
0.0 | 0.1 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
0.0 | 0.3 | GO:0000243 | commitment complex(GO:0000243) |
0.0 | 0.1 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
0.0 | 1.4 | GO:0045171 | intercellular bridge(GO:0045171) |
0.0 | 6.2 | GO:0005759 | mitochondrial matrix(GO:0005759) |
0.0 | 0.5 | GO:0030057 | desmosome(GO:0030057) |
0.0 | 0.2 | GO:0097342 | ripoptosome(GO:0097342) |
0.0 | 0.1 | GO:0008091 | spectrin(GO:0008091) |
0.0 | 0.3 | GO:0034709 | methylosome(GO:0034709) |
0.0 | 0.1 | GO:0070545 | PeBoW complex(GO:0070545) |
0.0 | 0.8 | GO:0042734 | presynaptic membrane(GO:0042734) |
0.0 | 0.5 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
0.0 | 0.1 | GO:0097441 | basilar dendrite(GO:0097441) |
0.0 | 0.5 | GO:0031902 | late endosome membrane(GO:0031902) |
0.0 | 0.4 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
0.0 | 0.1 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
0.0 | 0.1 | GO:0055087 | Ski complex(GO:0055087) |
0.0 | 0.1 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.0 | 0.1 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
0.0 | 0.1 | GO:0044232 | organelle membrane contact site(GO:0044232) |
0.0 | 0.1 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.0 | 0.3 | GO:0090544 | BAF-type complex(GO:0090544) |
0.0 | 0.2 | GO:0001520 | outer dense fiber(GO:0001520) |
0.0 | 0.2 | GO:0042582 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
0.0 | 0.1 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
0.0 | 0.1 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
0.0 | 0.2 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.0 | 0.1 | GO:0035355 | Toll-like receptor 2-Toll-like receptor 6 protein complex(GO:0035355) |
0.0 | 0.2 | GO:0031045 | dense core granule(GO:0031045) |
0.0 | 0.2 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
0.0 | 0.1 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
0.0 | 0.3 | GO:0042555 | MCM complex(GO:0042555) |
0.0 | 0.2 | GO:0070652 | HAUS complex(GO:0070652) |
0.0 | 0.1 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
0.0 | 0.1 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
0.0 | 1.2 | GO:0031228 | intrinsic component of Golgi membrane(GO:0031228) |
0.0 | 0.1 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.0 | 0.0 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
0.0 | 0.2 | GO:0036156 | inner dynein arm(GO:0036156) |
0.0 | 0.1 | GO:0019815 | B cell receptor complex(GO:0019815) |
0.0 | 0.1 | GO:0005927 | muscle tendon junction(GO:0005927) |
0.0 | 0.1 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
0.0 | 0.3 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
0.0 | 0.1 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.0 | 0.2 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.0 | 0.2 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.0 | 0.1 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
0.0 | 0.1 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
0.0 | 0.1 | GO:0043220 | Schmidt-Lanterman incisure(GO:0043220) |
0.0 | 0.3 | GO:0016460 | myosin II complex(GO:0016460) |
0.0 | 0.4 | GO:0005922 | connexon complex(GO:0005922) |
0.0 | 0.4 | GO:0030686 | 90S preribosome(GO:0030686) |
0.0 | 0.3 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
0.0 | 1.6 | GO:0022626 | cytosolic ribosome(GO:0022626) |
0.0 | 0.5 | GO:0000786 | nucleosome(GO:0000786) DNA packaging complex(GO:0044815) |
0.0 | 0.0 | GO:0097451 | glial limiting end-foot(GO:0097451) |
0.0 | 0.2 | GO:0005869 | dynactin complex(GO:0005869) |
0.0 | 0.1 | GO:0034464 | BBSome(GO:0034464) |
0.0 | 0.0 | GO:0072534 | perineuronal net(GO:0072534) |
0.0 | 0.0 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.0 | 0.1 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.0 | 0.1 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
0.0 | 0.9 | GO:0030863 | cortical cytoskeleton(GO:0030863) |
0.0 | 0.8 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
0.0 | 0.0 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
0.0 | 0.2 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
0.0 | 0.0 | GO:1990745 | EARP complex(GO:1990745) |
0.0 | 0.6 | GO:0005905 | clathrin-coated pit(GO:0005905) |
0.0 | 0.1 | GO:0000938 | GARP complex(GO:0000938) |
0.0 | 0.3 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
0.0 | 0.1 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.0 | 0.1 | GO:0000800 | lateral element(GO:0000800) |
0.0 | 0.2 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.0 | 0.2 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
0.0 | 0.2 | GO:0097225 | sperm midpiece(GO:0097225) |
0.0 | 0.0 | GO:0098984 | neuron to neuron synapse(GO:0098984) |
0.0 | 5.0 | GO:0005667 | transcription factor complex(GO:0005667) |
0.0 | 0.3 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.0 | 0.1 | GO:0032009 | early phagosome(GO:0032009) |
0.0 | 0.1 | GO:0005732 | small nucleolar ribonucleoprotein complex(GO:0005732) |
0.0 | 0.1 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
0.0 | 0.1 | GO:0042613 | MHC class II protein complex(GO:0042613) |
0.0 | 0.1 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.0 | 0.4 | GO:0000123 | histone acetyltransferase complex(GO:0000123) |
0.0 | 0.6 | GO:0016459 | myosin complex(GO:0016459) |
0.0 | 0.7 | GO:0031526 | brush border membrane(GO:0031526) |
0.0 | 0.3 | GO:0035869 | ciliary transition zone(GO:0035869) |
0.0 | 0.5 | GO:0035097 | histone methyltransferase complex(GO:0035097) |
0.0 | 0.0 | GO:0042567 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
0.0 | 0.0 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
0.0 | 0.0 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
0.0 | 0.0 | GO:0000836 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) |
0.0 | 0.1 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
0.0 | 0.5 | GO:0016234 | inclusion body(GO:0016234) |
0.0 | 0.1 | GO:0031083 | BLOC-1 complex(GO:0031083) |
0.0 | 0.9 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
0.0 | 0.3 | GO:0048770 | melanosome(GO:0042470) pigment granule(GO:0048770) |
0.0 | 0.1 | GO:0060170 | ciliary membrane(GO:0060170) |
0.0 | 1.7 | GO:0045111 | intermediate filament cytoskeleton(GO:0045111) |
0.0 | 15.8 | GO:0005615 | extracellular space(GO:0005615) |
0.0 | 0.1 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
0.0 | 0.0 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
0.0 | 0.4 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
0.0 | 0.0 | GO:0005588 | collagen type V trimer(GO:0005588) |
0.0 | 0.0 | GO:0071014 | U2-type post-mRNA release spliceosomal complex(GO:0071008) post-mRNA release spliceosomal complex(GO:0071014) |
0.0 | 0.0 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
0.0 | 0.3 | GO:0001750 | photoreceptor outer segment(GO:0001750) |
0.0 | 0.1 | GO:0033391 | chromatoid body(GO:0033391) |
0.0 | 0.0 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.0 | 0.0 | GO:0005753 | mitochondrial proton-transporting ATP synthase complex(GO:0005753) |
0.0 | 3.2 | GO:0005730 | nucleolus(GO:0005730) |
0.0 | 11.6 | GO:0005654 | nucleoplasm(GO:0005654) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.0 | 6.0 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
0.9 | 2.7 | GO:0015182 | L-asparagine transmembrane transporter activity(GO:0015182) L-glutamine transmembrane transporter activity(GO:0015186) |
0.8 | 0.8 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
0.7 | 6.1 | GO:0016215 | acyl-CoA desaturase activity(GO:0016215) |
0.7 | 2.0 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
0.6 | 3.2 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.6 | 1.9 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
0.5 | 2.7 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.5 | 1.5 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
0.5 | 2.0 | GO:0010858 | calcium-dependent protein kinase regulator activity(GO:0010858) |
0.5 | 3.0 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
0.5 | 1.4 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
0.5 | 1.4 | GO:0015315 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
0.4 | 2.7 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
0.4 | 1.3 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
0.4 | 1.2 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.4 | 1.2 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
0.4 | 1.2 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.3 | 1.4 | GO:0033142 | progesterone receptor binding(GO:0033142) |
0.3 | 0.3 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.3 | 4.0 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.3 | 0.6 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
0.3 | 0.3 | GO:0030487 | inositol-4,5-bisphosphate 5-phosphatase activity(GO:0030487) |
0.3 | 0.9 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.3 | 0.9 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.3 | 1.5 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
0.3 | 1.2 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
0.3 | 1.8 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
0.3 | 0.9 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.3 | 1.5 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
0.3 | 0.3 | GO:0001224 | RNA polymerase II transcription cofactor binding(GO:0001224) |
0.3 | 0.3 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
0.3 | 1.1 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
0.3 | 1.4 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.3 | 4.6 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
0.3 | 1.1 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
0.3 | 0.8 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
0.3 | 1.6 | GO:0043426 | MRF binding(GO:0043426) |
0.3 | 1.1 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
0.3 | 0.8 | GO:0016823 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
0.3 | 1.5 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
0.3 | 1.8 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
0.3 | 3.3 | GO:0015643 | toxic substance binding(GO:0015643) |
0.3 | 1.0 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
0.2 | 1.0 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.2 | 1.2 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
0.2 | 0.7 | GO:0035939 | microsatellite binding(GO:0035939) |
0.2 | 1.4 | GO:0001727 | lipid kinase activity(GO:0001727) |
0.2 | 1.2 | GO:0050815 | phosphoserine binding(GO:0050815) |
0.2 | 3.1 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.2 | 1.7 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
0.2 | 1.2 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.2 | 0.2 | GO:0033695 | oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
0.2 | 1.0 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
0.2 | 1.9 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
0.2 | 0.7 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
0.2 | 0.9 | GO:0045340 | mercury ion binding(GO:0045340) |
0.2 | 2.3 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
0.2 | 0.7 | GO:0004365 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
0.2 | 2.5 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.2 | 0.7 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
0.2 | 2.9 | GO:0008432 | JUN kinase binding(GO:0008432) |
0.2 | 5.1 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
0.2 | 1.3 | GO:0003918 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.2 | 0.4 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
0.2 | 1.9 | GO:0001013 | RNA polymerase I regulatory region DNA binding(GO:0001013) |
0.2 | 1.7 | GO:0004779 | sulfate adenylyltransferase activity(GO:0004779) |
0.2 | 0.6 | GO:0004103 | choline kinase activity(GO:0004103) |
0.2 | 1.1 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.2 | 4.0 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.2 | 0.6 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
0.2 | 1.6 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
0.2 | 0.6 | GO:1901612 | cardiolipin binding(GO:1901612) |
0.2 | 1.2 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
0.2 | 1.2 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
0.2 | 0.6 | GO:0030284 | estrogen receptor activity(GO:0030284) |
0.2 | 1.0 | GO:0043559 | insulin binding(GO:0043559) |
0.2 | 0.8 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
0.2 | 0.6 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.2 | 0.6 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.2 | 0.2 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
0.2 | 0.6 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
0.2 | 0.5 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
0.2 | 0.5 | GO:0038100 | nodal binding(GO:0038100) |
0.2 | 1.5 | GO:0032041 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
0.2 | 0.4 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
0.2 | 0.5 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.2 | 0.5 | GO:0008495 | 4-hydroxybenzoate octaprenyltransferase activity(GO:0008412) protoheme IX farnesyltransferase activity(GO:0008495) (S)-2,3-di-O-geranylgeranylglyceryl phosphate synthase activity(GO:0043888) cadaverine aminopropyltransferase activity(GO:0043918) agmatine aminopropyltransferase activity(GO:0043919) 1,4-dihydroxy-2-naphthoate octaprenyltransferase activity(GO:0046428) trans-pentaprenyltranstransferase activity(GO:0048045) ATP dimethylallyltransferase activity(GO:0052622) ADP dimethylallyltransferase activity(GO:0052623) |
0.2 | 0.5 | GO:0030350 | iron-responsive element binding(GO:0030350) |
0.2 | 0.9 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.2 | 1.4 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
0.2 | 2.4 | GO:0016918 | retinal binding(GO:0016918) |
0.2 | 1.0 | GO:0030274 | LIM domain binding(GO:0030274) |
0.2 | 1.4 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
0.2 | 0.7 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.2 | 0.5 | GO:0097001 | ceramide binding(GO:0097001) |
0.2 | 1.2 | GO:0008494 | translation activator activity(GO:0008494) |
0.2 | 1.0 | GO:0043495 | protein anchor(GO:0043495) |
0.2 | 0.5 | GO:0004461 | lactose synthase activity(GO:0004461) |
0.2 | 0.3 | GO:0010861 | thyroid hormone receptor activator activity(GO:0010861) |
0.2 | 0.5 | GO:0042731 | PH domain binding(GO:0042731) |
0.2 | 0.6 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.2 | 1.6 | GO:0017127 | cholesterol transporter activity(GO:0017127) |
0.2 | 0.6 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
0.2 | 0.8 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.2 | 1.4 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
0.2 | 0.5 | GO:0030519 | snoRNP binding(GO:0030519) |
0.2 | 1.1 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
0.2 | 3.1 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
0.2 | 0.6 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
0.2 | 0.5 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.2 | 0.3 | GO:0016901 | oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
0.2 | 0.3 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) |
0.2 | 0.8 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
0.1 | 0.6 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.1 | 1.0 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
0.1 | 4.0 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
0.1 | 0.7 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
0.1 | 0.7 | GO:0090482 | vitamin transmembrane transporter activity(GO:0090482) |
0.1 | 0.4 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.1 | 0.4 | GO:0051434 | BH3 domain binding(GO:0051434) |
0.1 | 0.4 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.1 | 1.0 | GO:1990459 | transferrin receptor binding(GO:1990459) |
0.1 | 0.6 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
0.1 | 0.3 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
0.1 | 3.4 | GO:0043812 | phosphatidylinositol-4-phosphate phosphatase activity(GO:0043812) |
0.1 | 2.1 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.1 | 1.1 | GO:0038191 | neuropilin binding(GO:0038191) |
0.1 | 0.4 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
0.1 | 1.4 | GO:0070700 | BMP receptor binding(GO:0070700) |
0.1 | 0.4 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.1 | 0.4 | GO:0008732 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
0.1 | 2.9 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
0.1 | 0.3 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
0.1 | 0.5 | GO:0047238 | glucuronosyl-N-acetylgalactosaminyl-proteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047238) |
0.1 | 0.8 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.1 | 0.4 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
0.1 | 0.5 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.1 | 0.3 | GO:0017108 | 5'-flap endonuclease activity(GO:0017108) |
0.1 | 0.4 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
0.1 | 0.3 | GO:0031852 | mu-type opioid receptor binding(GO:0031852) |
0.1 | 0.4 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
0.1 | 0.4 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
0.1 | 1.0 | GO:0017166 | vinculin binding(GO:0017166) |
0.1 | 0.6 | GO:0030957 | Tat protein binding(GO:0030957) |
0.1 | 0.5 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.1 | 0.1 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.1 | 0.4 | GO:0019961 | interferon binding(GO:0019961) |
0.1 | 0.9 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
0.1 | 0.6 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
0.1 | 0.5 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.1 | 0.6 | GO:0005024 | transforming growth factor beta-activated receptor activity(GO:0005024) |
0.1 | 0.4 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
0.1 | 0.1 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
0.1 | 0.3 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
0.1 | 1.8 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.1 | 0.5 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
0.1 | 0.6 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
0.1 | 0.8 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
0.1 | 0.2 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.1 | 0.4 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
0.1 | 0.4 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
0.1 | 0.9 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.1 | 1.3 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.1 | 0.4 | GO:0015199 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
0.1 | 0.4 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
0.1 | 0.4 | GO:0004528 | phosphodiesterase I activity(GO:0004528) |
0.1 | 2.8 | GO:0001104 | RNA polymerase II transcription cofactor activity(GO:0001104) |
0.1 | 1.7 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
0.1 | 0.4 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
0.1 | 0.4 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.1 | 0.5 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
0.1 | 0.5 | GO:0071253 | connexin binding(GO:0071253) |
0.1 | 2.0 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.1 | 0.7 | GO:0036122 | BMP binding(GO:0036122) |
0.1 | 0.3 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.1 | 0.8 | GO:0070410 | co-SMAD binding(GO:0070410) |
0.1 | 0.1 | GO:0050051 | leukotriene-B4 20-monooxygenase activity(GO:0050051) |
0.1 | 0.4 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.1 | 0.5 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.1 | 1.0 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
0.1 | 0.4 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.1 | 0.3 | GO:0032139 | dinucleotide insertion or deletion binding(GO:0032139) |
0.1 | 0.6 | GO:0005113 | patched binding(GO:0005113) |
0.1 | 0.3 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
0.1 | 0.1 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
0.1 | 0.7 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
0.1 | 0.8 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
0.1 | 0.5 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) |
0.1 | 0.5 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
0.1 | 0.1 | GO:0008905 | mannose-phosphate guanylyltransferase activity(GO:0008905) |
0.1 | 0.4 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
0.1 | 0.4 | GO:0015232 | heme transporter activity(GO:0015232) |
0.1 | 0.4 | GO:0019145 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
0.1 | 0.3 | GO:0031996 | thioesterase binding(GO:0031996) |
0.1 | 0.6 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.1 | 0.7 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
0.1 | 0.8 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
0.1 | 1.4 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
0.1 | 1.2 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.1 | 0.3 | GO:0036137 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
0.1 | 0.3 | GO:0046979 | TAP1 binding(GO:0046978) TAP2 binding(GO:0046979) |
0.1 | 2.3 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
0.1 | 0.8 | GO:0015386 | sodium:proton antiporter activity(GO:0015385) potassium:proton antiporter activity(GO:0015386) |
0.1 | 0.9 | GO:0019203 | carbohydrate phosphatase activity(GO:0019203) sugar-phosphatase activity(GO:0050308) |
0.1 | 1.0 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
0.1 | 0.8 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.1 | 0.9 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
0.1 | 0.1 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) |
0.1 | 1.2 | GO:0048038 | quinone binding(GO:0048038) |
0.1 | 0.4 | GO:0000099 | sulfur amino acid transmembrane transporter activity(GO:0000099) |
0.1 | 0.5 | GO:0034452 | dynactin binding(GO:0034452) |
0.1 | 0.3 | GO:0008107 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
0.1 | 0.3 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
0.1 | 1.0 | GO:0044548 | S100 protein binding(GO:0044548) |
0.1 | 0.3 | GO:0071553 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
0.1 | 0.3 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
0.1 | 0.2 | GO:0019237 | centromeric DNA binding(GO:0019237) |
0.1 | 0.2 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
0.1 | 0.3 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.1 | 0.1 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
0.1 | 0.4 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
0.1 | 0.3 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
0.1 | 0.5 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
0.1 | 0.1 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
0.1 | 1.5 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
0.1 | 3.7 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
0.1 | 0.7 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.1 | 0.5 | GO:0055102 | lipase inhibitor activity(GO:0055102) |
0.1 | 0.9 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
0.1 | 0.7 | GO:0005003 | ephrin receptor activity(GO:0005003) |
0.1 | 0.2 | GO:0034596 | phosphatidylinositol phosphate 4-phosphatase activity(GO:0034596) |
0.1 | 0.2 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
0.1 | 0.2 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
0.1 | 0.3 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.1 | 0.1 | GO:0050145 | uridylate kinase activity(GO:0009041) nucleoside phosphate kinase activity(GO:0050145) |
0.1 | 1.0 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
0.1 | 0.2 | GO:0043546 | molybdopterin cofactor binding(GO:0043546) |
0.1 | 3.6 | GO:0008392 | arachidonic acid epoxygenase activity(GO:0008392) |
0.1 | 0.3 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
0.1 | 0.4 | GO:0035671 | enone reductase activity(GO:0035671) |
0.1 | 3.1 | GO:0000049 | tRNA binding(GO:0000049) |
0.1 | 0.2 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
0.1 | 0.6 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) |
0.1 | 0.5 | GO:0019957 | C-C chemokine binding(GO:0019957) |
0.1 | 0.1 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
0.1 | 0.2 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
0.1 | 0.6 | GO:0016889 | endodeoxyribonuclease activity, producing 3'-phosphomonoesters(GO:0016889) |
0.1 | 0.5 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
0.1 | 0.4 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.1 | 0.1 | GO:0030352 | inositol-1,3,4,5,6-pentakisphosphate 3-phosphatase activity(GO:0030351) inositol-1,4,5,6-tetrakisphosphate 6-phosphatase activity(GO:0030352) inositol pentakisphosphate phosphatase activity(GO:0052827) |
0.1 | 0.1 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
0.1 | 0.6 | GO:0005522 | profilin binding(GO:0005522) |
0.1 | 0.6 | GO:0008301 | DNA binding, bending(GO:0008301) |
0.1 | 0.7 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) |
0.1 | 0.4 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
0.1 | 0.2 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
0.1 | 0.1 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) |
0.1 | 0.6 | GO:0000400 | four-way junction DNA binding(GO:0000400) |
0.1 | 0.6 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
0.1 | 0.3 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.1 | 0.2 | GO:1990190 | peptide-serine-N-acetyltransferase activity(GO:1990189) peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
0.1 | 2.2 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
0.1 | 0.3 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.1 | 0.2 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.1 | 0.4 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
0.1 | 0.6 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.1 | 0.4 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.1 | 0.7 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.1 | 0.1 | GO:0031559 | oxidosqualene cyclase activity(GO:0031559) |
0.1 | 0.3 | GO:0032184 | SUMO polymer binding(GO:0032184) |
0.1 | 0.2 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.1 | 0.7 | GO:0031404 | chloride ion binding(GO:0031404) |
0.1 | 0.5 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
0.1 | 0.6 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
0.1 | 0.3 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
0.1 | 1.7 | GO:0015485 | cholesterol binding(GO:0015485) |
0.1 | 0.3 | GO:0030228 | lipoprotein particle receptor activity(GO:0030228) |
0.1 | 0.5 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
0.1 | 0.2 | GO:0080130 | L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
0.1 | 0.1 | GO:0015248 | sterol transporter activity(GO:0015248) |
0.1 | 0.3 | GO:0005047 | signal recognition particle binding(GO:0005047) |
0.1 | 0.2 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
0.1 | 0.2 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.1 | 0.6 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
0.1 | 0.2 | GO:0008934 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
0.1 | 0.1 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.1 | 1.0 | GO:0004029 | aldehyde dehydrogenase (NAD) activity(GO:0004029) |
0.1 | 1.0 | GO:0030247 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
0.1 | 0.2 | GO:1901702 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
0.1 | 2.8 | GO:0035064 | methylated histone binding(GO:0035064) |
0.1 | 1.1 | GO:0003785 | actin monomer binding(GO:0003785) |
0.1 | 0.2 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
0.1 | 0.3 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.1 | 2.0 | GO:0004027 | alcohol sulfotransferase activity(GO:0004027) |
0.1 | 0.6 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
0.1 | 0.2 | GO:0004942 | anaphylatoxin receptor activity(GO:0004942) |
0.1 | 0.2 | GO:0002046 | opsin binding(GO:0002046) |
0.1 | 0.2 | GO:0015216 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) |
0.1 | 0.1 | GO:0003896 | DNA primase activity(GO:0003896) |
0.1 | 1.1 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
0.1 | 0.7 | GO:0042608 | T cell receptor binding(GO:0042608) |
0.1 | 0.3 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.1 | 0.6 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
0.1 | 0.1 | GO:0019103 | pyrimidine nucleotide binding(GO:0019103) |
0.1 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.1 | 0.3 | GO:0004457 | lactate dehydrogenase activity(GO:0004457) |
0.1 | 0.4 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
0.1 | 0.3 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
0.1 | 0.4 | GO:0016443 | bidentate ribonuclease III activity(GO:0016443) |
0.1 | 0.4 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
0.1 | 1.4 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
0.1 | 0.2 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.1 | 0.3 | GO:0008199 | ferric iron binding(GO:0008199) |
0.1 | 0.2 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
0.1 | 0.2 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
0.1 | 0.2 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
0.1 | 0.5 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
0.1 | 0.2 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
0.1 | 0.3 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
0.1 | 0.1 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
0.1 | 0.2 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
0.1 | 0.1 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
0.1 | 0.2 | GO:0019211 | phosphatase activator activity(GO:0019211) |
0.1 | 0.1 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
0.1 | 0.1 | GO:0004065 | arylsulfatase activity(GO:0004065) |
0.1 | 0.2 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
0.1 | 0.8 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
0.1 | 0.2 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
0.1 | 0.3 | GO:0004931 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.1 | 0.3 | GO:0031419 | cobalamin binding(GO:0031419) |
0.1 | 1.6 | GO:0005044 | scavenger receptor activity(GO:0005044) |
0.1 | 1.0 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
0.1 | 7.2 | GO:0001227 | transcriptional repressor activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001227) |
0.1 | 0.7 | GO:0016712 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced flavin or flavoprotein as one donor, and incorporation of one atom of oxygen(GO:0016712) |
0.1 | 0.2 | GO:0071723 | lipopeptide binding(GO:0071723) |
0.1 | 0.6 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
0.1 | 0.4 | GO:0036310 | annealing helicase activity(GO:0036310) |
0.1 | 0.2 | GO:0004096 | catalase activity(GO:0004096) |
0.1 | 0.2 | GO:0030955 | potassium ion binding(GO:0030955) |
0.1 | 0.1 | GO:0030619 | U1 snRNA binding(GO:0030619) |
0.1 | 0.3 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
0.1 | 0.4 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
0.1 | 0.2 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.1 | 0.2 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
0.1 | 0.2 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.1 | 0.1 | GO:0004104 | cholinesterase activity(GO:0004104) |
0.1 | 0.1 | GO:0032357 | oxidized DNA binding(GO:0032356) oxidized purine DNA binding(GO:0032357) |
0.1 | 0.2 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
0.0 | 0.4 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.0 | 0.0 | GO:0035877 | death effector domain binding(GO:0035877) |
0.0 | 0.1 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.0 | 0.1 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.0 | 0.3 | GO:0005283 | sodium:amino acid symporter activity(GO:0005283) |
0.0 | 0.3 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
0.0 | 0.2 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.0 | 0.2 | GO:0052758 | 4-methyloctanoyl-CoA dehydrogenase activity(GO:0034580) naphthyl-2-methyl-succinyl-CoA dehydrogenase activity(GO:0034845) 2-methylhexanoyl-CoA dehydrogenase activity(GO:0034916) propionyl-CoA dehydrogenase activity(GO:0043820) thiol-driven fumarate reductase activity(GO:0043830) coenzyme F420-dependent 2,4,6-trinitrophenol reductase activity(GO:0052758) coenzyme F420-dependent 2,4,6-trinitrophenol hydride reductase activity(GO:0052759) coenzyme F420-dependent 2,4-dinitrophenol reductase activity(GO:0052760) |
0.0 | 0.6 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
0.0 | 0.7 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
0.0 | 0.2 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.0 | 0.8 | GO:0008483 | transaminase activity(GO:0008483) |
0.0 | 1.0 | GO:0016799 | hydrolase activity, hydrolyzing N-glycosyl compounds(GO:0016799) |
0.0 | 0.0 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
0.0 | 0.3 | GO:0043274 | phospholipase binding(GO:0043274) |
0.0 | 0.4 | GO:0031690 | adrenergic receptor binding(GO:0031690) |
0.0 | 0.1 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
0.0 | 0.1 | GO:0008297 | single-stranded DNA exodeoxyribonuclease activity(GO:0008297) |
0.0 | 0.5 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.0 | 1.0 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.0 | 0.3 | GO:0005223 | intracellular cGMP activated cation channel activity(GO:0005223) |
0.0 | 0.6 | GO:0005355 | glucose transmembrane transporter activity(GO:0005355) |
0.0 | 0.2 | GO:0045545 | syndecan binding(GO:0045545) |
0.0 | 0.1 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
0.0 | 0.2 | GO:0008430 | selenium binding(GO:0008430) |
0.0 | 0.2 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
0.0 | 0.3 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.0 | 0.6 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
0.0 | 0.4 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
0.0 | 0.3 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
0.0 | 0.2 | GO:0042289 | MHC class II protein binding(GO:0042289) |
0.0 | 0.3 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.0 | 0.1 | GO:0008390 | testosterone 16-alpha-hydroxylase activity(GO:0008390) |
0.0 | 0.2 | GO:0003884 | D-amino-acid oxidase activity(GO:0003884) |
0.0 | 0.1 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
0.0 | 1.4 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
0.0 | 0.4 | GO:0034185 | apolipoprotein binding(GO:0034185) |
0.0 | 0.0 | GO:0015181 | arginine transmembrane transporter activity(GO:0015181) L-lysine transmembrane transporter activity(GO:0015189) |
0.0 | 1.0 | GO:0018024 | histone-lysine N-methyltransferase activity(GO:0018024) |
0.0 | 0.9 | GO:0042605 | peptide antigen binding(GO:0042605) |
0.0 | 0.2 | GO:0070513 | death domain binding(GO:0070513) |
0.0 | 0.2 | GO:0005536 | glucose binding(GO:0005536) |
0.0 | 0.9 | GO:0036002 | pre-mRNA binding(GO:0036002) |
0.0 | 0.7 | GO:0005158 | insulin receptor binding(GO:0005158) |
0.0 | 0.0 | GO:0008796 | bis(5'-nucleosyl)-tetraphosphatase activity(GO:0008796) |
0.0 | 0.1 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
0.0 | 0.2 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
0.0 | 0.2 | GO:0008308 | voltage-gated anion channel activity(GO:0008308) |
0.0 | 0.0 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.0 | 0.2 | GO:0004673 | protein histidine kinase activity(GO:0004673) |
0.0 | 0.1 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.0 | 0.2 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.0 | 0.1 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
0.0 | 0.4 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.0 | 0.5 | GO:1901682 | sulfur compound transmembrane transporter activity(GO:1901682) |
0.0 | 0.2 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
0.0 | 0.4 | GO:0070402 | NADPH binding(GO:0070402) |
0.0 | 0.4 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
0.0 | 0.2 | GO:0038024 | cargo receptor activity(GO:0038024) |
0.0 | 1.0 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
0.0 | 1.1 | GO:0019212 | phosphatase inhibitor activity(GO:0019212) |
0.0 | 0.1 | GO:0001642 | group III metabotropic glutamate receptor activity(GO:0001642) |
0.0 | 0.1 | GO:0031686 | A1 adenosine receptor binding(GO:0031686) |
0.0 | 0.9 | GO:0050699 | WW domain binding(GO:0050699) |
0.0 | 0.0 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
0.0 | 0.3 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
0.0 | 0.3 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
0.0 | 0.2 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
0.0 | 0.1 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.0 | 0.1 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
0.0 | 0.1 | GO:0042895 | antibiotic transporter activity(GO:0042895) |
0.0 | 0.1 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
0.0 | 0.1 | GO:0000980 | RNA polymerase II distal enhancer sequence-specific DNA binding(GO:0000980) |
0.0 | 0.1 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.0 | 0.0 | GO:0051373 | FATZ binding(GO:0051373) |
0.0 | 0.7 | GO:0031369 | translation initiation factor binding(GO:0031369) |
0.0 | 0.2 | GO:1990405 | protein antigen binding(GO:1990405) |
0.0 | 0.1 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
0.0 | 0.1 | GO:0002060 | purine nucleobase binding(GO:0002060) |
0.0 | 0.6 | GO:0030552 | cAMP binding(GO:0030552) |
0.0 | 0.4 | GO:0005542 | folic acid binding(GO:0005542) |
0.0 | 0.1 | GO:0043141 | ATP-dependent 5'-3' DNA helicase activity(GO:0043141) |
0.0 | 0.6 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
0.0 | 0.6 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
0.0 | 0.2 | GO:0015204 | urea transmembrane transporter activity(GO:0015204) |
0.0 | 0.4 | GO:0005243 | gap junction channel activity(GO:0005243) |
0.0 | 0.8 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
0.0 | 0.4 | GO:0016854 | racemase and epimerase activity(GO:0016854) |
0.0 | 0.1 | GO:0004370 | glycerol kinase activity(GO:0004370) |
0.0 | 0.9 | GO:0008536 | Ran GTPase binding(GO:0008536) |
0.0 | 0.0 | GO:0070324 | thyroid hormone binding(GO:0070324) |
0.0 | 0.2 | GO:0033691 | sialic acid binding(GO:0033691) |
0.0 | 0.2 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.0 | 0.3 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
0.0 | 0.1 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
0.0 | 5.1 | GO:0000978 | RNA polymerase II core promoter proximal region sequence-specific DNA binding(GO:0000978) |
0.0 | 1.7 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
0.0 | 0.1 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
0.0 | 0.1 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.0 | 0.0 | GO:0032190 | acrosin binding(GO:0032190) |
0.0 | 0.3 | GO:0001972 | retinoic acid binding(GO:0001972) |
0.0 | 0.1 | GO:0070699 | type II activin receptor binding(GO:0070699) |
0.0 | 0.1 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
0.0 | 0.0 | GO:0033612 | receptor serine/threonine kinase binding(GO:0033612) |
0.0 | 0.1 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
0.0 | 0.6 | GO:0036442 | hydrogen-exporting ATPase activity(GO:0036442) |
0.0 | 0.4 | GO:0001968 | fibronectin binding(GO:0001968) |
0.0 | 0.4 | GO:0022841 | leak channel activity(GO:0022840) potassium ion leak channel activity(GO:0022841) narrow pore channel activity(GO:0022842) |
0.0 | 0.5 | GO:0046875 | ephrin receptor binding(GO:0046875) |
0.0 | 0.2 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.0 | 0.2 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
0.0 | 0.7 | GO:0003684 | damaged DNA binding(GO:0003684) |
0.0 | 0.1 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
0.0 | 0.5 | GO:0017025 | TBP-class protein binding(GO:0017025) |
0.0 | 0.2 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
0.0 | 0.1 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
0.0 | 2.8 | GO:0005085 | guanyl-nucleotide exchange factor activity(GO:0005085) |
0.0 | 0.1 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
0.0 | 0.1 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
0.0 | 0.1 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
0.0 | 0.1 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
0.0 | 0.1 | GO:0030275 | LRR domain binding(GO:0030275) |
0.0 | 0.2 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.0 | 1.2 | GO:0030276 | clathrin binding(GO:0030276) |
0.0 | 0.1 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
0.0 | 0.2 | GO:0016502 | purinergic nucleotide receptor activity(GO:0001614) nucleotide receptor activity(GO:0016502) |
0.0 | 0.1 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.0 | 4.9 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.0 | 0.1 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.0 | 0.3 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.0 | 0.1 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
0.0 | 0.1 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
0.0 | 0.0 | GO:1904680 | peptide transmembrane transporter activity(GO:1904680) |
0.0 | 0.0 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.0 | 0.0 | GO:0017099 | very-long-chain-acyl-CoA dehydrogenase activity(GO:0017099) |
0.0 | 0.1 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
0.0 | 0.2 | GO:0008327 | methyl-CpG binding(GO:0008327) |
0.0 | 0.2 | GO:0070034 | telomerase RNA binding(GO:0070034) |
0.0 | 0.4 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
0.0 | 0.1 | GO:0098811 | transcriptional activator activity, RNA polymerase II transcription factor binding(GO:0001190) transcriptional repressor activity, RNA polymerase II activating transcription factor binding(GO:0098811) |
0.0 | 0.3 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
0.0 | 0.0 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
0.0 | 0.3 | GO:0005521 | lamin binding(GO:0005521) |
0.0 | 0.3 | GO:0052813 | phosphatidylinositol bisphosphate kinase activity(GO:0052813) |
0.0 | 0.2 | GO:0036222 | XTP diphosphatase activity(GO:0036222) |
0.0 | 0.6 | GO:0004869 | cysteine-type endopeptidase inhibitor activity(GO:0004869) |
0.0 | 2.9 | GO:0050839 | cell adhesion molecule binding(GO:0050839) |
0.0 | 0.1 | GO:0070888 | E-box binding(GO:0070888) |
0.0 | 0.9 | GO:0008527 | taste receptor activity(GO:0008527) |
0.0 | 0.4 | GO:0004697 | protein kinase C activity(GO:0004697) |
0.0 | 0.0 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.0 | 0.0 | GO:0034594 | phosphatidylinositol trisphosphate phosphatase activity(GO:0034594) |
0.0 | 0.1 | GO:0102344 | 3-hydroxy-behenoyl-CoA dehydratase activity(GO:0102344) 3-hydroxy-lignoceroyl-CoA dehydratase activity(GO:0102345) |
0.0 | 0.1 | GO:0043842 | Kdo transferase activity(GO:0043842) |
0.0 | 0.2 | GO:0030506 | ankyrin binding(GO:0030506) |
0.0 | 0.0 | GO:0016882 | cyclo-ligase activity(GO:0016882) |
0.0 | 0.7 | GO:0001077 | transcriptional activator activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001077) |
0.0 | 0.0 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
0.0 | 0.0 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
0.0 | 0.1 | GO:0050681 | androgen receptor binding(GO:0050681) |
0.0 | 0.0 | GO:0043199 | sulfate binding(GO:0043199) |
0.0 | 0.0 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.0 | 0.1 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.0 | 0.2 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
0.0 | 0.0 | GO:0030881 | beta-2-microglobulin binding(GO:0030881) |
0.0 | 0.1 | GO:0003720 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
0.0 | 0.1 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.0 | 0.1 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
0.0 | 0.1 | GO:0016997 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
0.0 | 0.0 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
0.0 | 0.2 | GO:0034843 | 2-oxoglutaryl-CoA thioesterase activity(GO:0034843) 2,4,4-trimethyl-3-oxopentanoyl-CoA thioesterase activity(GO:0034869) 3-isopropylbut-3-enoyl-CoA thioesterase activity(GO:0034946) glutaryl-CoA hydrolase activity(GO:0044466) |
0.0 | 0.0 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
0.0 | 0.0 | GO:0003696 | satellite DNA binding(GO:0003696) |
0.0 | 0.3 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
0.0 | 0.1 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.0 | 0.1 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
0.0 | 0.0 | GO:0001032 | RNA polymerase III type 1 promoter DNA binding(GO:0001030) RNA polymerase III type 2 promoter DNA binding(GO:0001031) RNA polymerase III type 3 promoter DNA binding(GO:0001032) 5S rDNA binding(GO:0080084) |
0.0 | 0.1 | GO:0031490 | chromatin DNA binding(GO:0031490) |
0.0 | 0.1 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
0.0 | 0.1 | GO:0043422 | protein kinase B binding(GO:0043422) |
0.0 | 1.4 | GO:0003713 | transcription coactivator activity(GO:0003713) |
0.0 | 0.1 | GO:0050786 | RAGE receptor binding(GO:0050786) |
0.0 | 0.2 | GO:0016755 | transferase activity, transferring amino-acyl groups(GO:0016755) |
0.0 | 0.1 | GO:0004016 | adenylate cyclase activity(GO:0004016) |
0.0 | 0.0 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
0.0 | 0.3 | GO:0030332 | cyclin binding(GO:0030332) |
0.0 | 0.5 | GO:0005080 | protein kinase C binding(GO:0005080) |
0.0 | 0.1 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
0.0 | 0.9 | GO:0004860 | protein kinase inhibitor activity(GO:0004860) |
0.0 | 0.1 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.0 | 0.1 | GO:0034416 | bisphosphoglycerate 2-phosphatase activity(GO:0004083) bisphosphoglycerate phosphatase activity(GO:0034416) |
0.0 | 0.4 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.0 | 0.1 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.0 | 0.2 | GO:0015298 | solute:cation antiporter activity(GO:0015298) |
0.0 | 0.0 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
0.0 | 0.3 | GO:0043531 | ADP binding(GO:0043531) |
0.0 | 0.4 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
0.0 | 0.0 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.0 | 0.2 | GO:0008061 | chitin binding(GO:0008061) |
0.0 | 0.2 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
0.0 | 1.1 | GO:0003714 | transcription corepressor activity(GO:0003714) |
0.0 | 2.7 | GO:0005096 | GTPase activator activity(GO:0005096) |
0.0 | 0.0 | GO:1901611 | phosphatidylglycerol binding(GO:1901611) |
0.0 | 0.0 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
0.0 | 0.0 | GO:0008296 | 3'-5'-exodeoxyribonuclease activity(GO:0008296) |
0.0 | 0.1 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.0 | 0.0 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
0.0 | 0.3 | GO:0070566 | adenylyltransferase activity(GO:0070566) |
0.0 | 0.0 | GO:0038064 | collagen receptor activity(GO:0038064) |
0.0 | 0.0 | GO:0035586 | purinergic receptor activity(GO:0035586) |
0.0 | 0.2 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
0.0 | 0.0 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
0.0 | 0.1 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.0 | 0.0 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.0 | 0.1 | GO:0016679 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.0 | 0.2 | GO:0005035 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
0.0 | 0.2 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
0.0 | 0.1 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
0.0 | 2.1 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
0.0 | 0.1 | GO:0005344 | oxygen transporter activity(GO:0005344) |
0.0 | 0.1 | GO:0003796 | lysozyme activity(GO:0003796) |
0.0 | 0.0 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
0.0 | 0.0 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
0.0 | 0.1 | GO:0050664 | oxidoreductase activity, acting on NAD(P)H, oxygen as acceptor(GO:0050664) |
0.0 | 0.1 | GO:0004601 | peroxidase activity(GO:0004601) |
0.0 | 0.9 | GO:0019902 | phosphatase binding(GO:0019902) |
0.0 | 0.1 | GO:0030546 | receptor activator activity(GO:0030546) |
0.0 | 0.0 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
0.0 | 0.0 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
0.0 | 0.1 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
0.0 | 0.0 | GO:0008020 | G-protein coupled photoreceptor activity(GO:0008020) |
0.0 | 0.0 | GO:0008502 | melatonin receptor activity(GO:0008502) |
0.0 | 0.1 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.0 | 0.0 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
0.0 | 0.5 | GO:0051087 | chaperone binding(GO:0051087) |
0.0 | 0.0 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
0.0 | 0.1 | GO:0019825 | oxygen binding(GO:0019825) |
0.0 | 0.0 | GO:0015185 | gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 7.1 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.3 | 4.8 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.3 | 4.9 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.3 | 0.3 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
0.3 | 0.8 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.3 | 6.4 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.2 | 0.7 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.2 | 0.3 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
0.2 | 3.6 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
0.2 | 2.4 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.2 | 1.5 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.2 | 0.9 | ST STAT3 PATHWAY | STAT3 Pathway |
0.2 | 6.3 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
0.1 | 3.5 | PID EPO PATHWAY | EPO signaling pathway |
0.1 | 3.5 | PID S1P S1P2 PATHWAY | S1P2 pathway |
0.1 | 4.0 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
0.1 | 3.0 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.1 | 10.5 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
0.1 | 1.5 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.1 | 5.0 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
0.1 | 0.3 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.1 | 2.9 | PID RAS PATHWAY | Regulation of Ras family activation |
0.1 | 1.2 | PID ALK2 PATHWAY | ALK2 signaling events |
0.1 | 0.4 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
0.1 | 0.5 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
0.1 | 8.1 | PID CMYB PATHWAY | C-MYB transcription factor network |
0.1 | 1.3 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.1 | 2.6 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
0.1 | 0.8 | ST INTEGRIN SIGNALING PATHWAY | Integrin Signaling Pathway |
0.1 | 0.1 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
0.1 | 1.5 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.1 | 0.1 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
0.1 | 3.0 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
0.1 | 0.3 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.1 | 0.7 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.1 | 0.7 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.1 | 2.4 | PID ERBB4 PATHWAY | ErbB4 signaling events |
0.1 | 0.8 | PID CONE PATHWAY | Visual signal transduction: Cones |
0.1 | 0.5 | PID IL2 1PATHWAY | IL2-mediated signaling events |
0.1 | 1.1 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.1 | 0.3 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.1 | 0.3 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
0.1 | 0.6 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
0.1 | 0.2 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.1 | 0.8 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.1 | 2.8 | PID PLK1 PATHWAY | PLK1 signaling events |
0.1 | 1.5 | PID BCR 5PATHWAY | BCR signaling pathway |
0.1 | 0.9 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.1 | 1.6 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
0.1 | 0.4 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
0.1 | 2.5 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
0.1 | 0.1 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.1 | 0.8 | PID REELIN PATHWAY | Reelin signaling pathway |
0.1 | 0.5 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
0.1 | 1.2 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
0.1 | 1.4 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
0.1 | 2.6 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
0.1 | 0.1 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
0.1 | 0.5 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.1 | 0.1 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.1 | 0.1 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
0.1 | 0.1 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.1 | 0.1 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
0.1 | 0.2 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
0.1 | 0.1 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.1 | 0.9 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
0.1 | 0.8 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
0.1 | 0.5 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
0.1 | 1.7 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
0.1 | 0.1 | PID SHP2 PATHWAY | SHP2 signaling |
0.1 | 0.9 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
0.1 | 1.1 | PID EPHA FWDPATHWAY | EPHA forward signaling |
0.1 | 0.2 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
0.1 | 0.9 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
0.1 | 0.6 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
0.1 | 0.3 | PID MYC PATHWAY | C-MYC pathway |
0.0 | 0.6 | PID IL23 PATHWAY | IL23-mediated signaling events |
0.0 | 1.4 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.0 | 0.4 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
0.0 | 0.6 | PID ARF 3PATHWAY | Arf1 pathway |
0.0 | 1.3 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
0.0 | 0.3 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.0 | 1.4 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.0 | 0.3 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.0 | 0.7 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
0.0 | 6.4 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
0.0 | 0.4 | PID FOXO PATHWAY | FoxO family signaling |
0.0 | 0.7 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
0.0 | 0.6 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
0.0 | 0.4 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.0 | 0.5 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
0.0 | 0.2 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.0 | 0.1 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
0.0 | 0.3 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
0.0 | 1.5 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
0.0 | 1.1 | PID NOTCH PATHWAY | Notch signaling pathway |
0.0 | 0.3 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
0.0 | 0.2 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
0.0 | 0.1 | PID IL27 PATHWAY | IL27-mediated signaling events |
0.0 | 0.0 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
0.0 | 0.2 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
0.0 | 0.5 | PID ATM PATHWAY | ATM pathway |
0.0 | 0.1 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
0.0 | 0.5 | PID FGF PATHWAY | FGF signaling pathway |
0.0 | 0.2 | PID ENDOTHELIN PATHWAY | Endothelins |
0.0 | 0.1 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
0.0 | 0.1 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
0.0 | 0.3 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.0 | 0.2 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
0.0 | 0.2 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
0.0 | 0.1 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
0.0 | 0.1 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.0 | 0.2 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
0.0 | 0.2 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.0 | 0.1 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
0.0 | 0.1 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
0.0 | 0.3 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
0.0 | 3.7 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
0.0 | 0.1 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
0.0 | 0.1 | PID INTEGRIN1 PATHWAY | Beta1 integrin cell surface interactions |
0.0 | 0.0 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
0.0 | 1.8 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
0.0 | 0.1 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.0 | 0.1 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
0.0 | 0.3 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.0 | 0.1 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.0 | 0.2 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.0 | 0.1 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
0.0 | 0.1 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
0.0 | 0.2 | PID ATR PATHWAY | ATR signaling pathway |
0.0 | 0.1 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.6 | 1.1 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
0.4 | 4.4 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.4 | 11.8 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.3 | 1.7 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.3 | 6.5 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
0.3 | 1.5 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
0.3 | 2.9 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
0.3 | 4.9 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.3 | 0.8 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
0.3 | 4.6 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
0.3 | 2.0 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.3 | 2.3 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
0.3 | 0.5 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
0.2 | 3.9 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
0.2 | 1.3 | REACTOME ADP SIGNALLING THROUGH P2RY1 | Genes involved in ADP signalling through P2Y purinoceptor 1 |
0.2 | 0.4 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
0.2 | 4.2 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
0.2 | 0.2 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
0.2 | 1.7 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
0.2 | 0.7 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.2 | 0.2 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
0.2 | 1.3 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
0.2 | 1.4 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.2 | 2.2 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.1 | 3.4 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.1 | 1.5 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.1 | 0.7 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.1 | 3.3 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
0.1 | 1.8 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
0.1 | 1.5 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
0.1 | 0.3 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
0.1 | 0.7 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
0.1 | 1.1 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
0.1 | 2.4 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
0.1 | 1.2 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.1 | 3.9 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
0.1 | 0.1 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
0.1 | 1.8 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
0.1 | 1.3 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.1 | 2.4 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.1 | 3.1 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.1 | 0.5 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
0.1 | 1.0 | REACTOME ERK MAPK TARGETS | Genes involved in ERK/MAPK targets |
0.1 | 2.5 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
0.1 | 2.0 | REACTOME INTEGRIN ALPHAIIB BETA3 SIGNALING | Genes involved in Integrin alphaIIb beta3 signaling |
0.1 | 2.1 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
0.1 | 0.6 | REACTOME DOWNSTREAM SIGNALING EVENTS OF B CELL RECEPTOR BCR | Genes involved in Downstream Signaling Events Of B Cell Receptor (BCR) |
0.1 | 0.2 | REACTOME SCFSKP2 MEDIATED DEGRADATION OF P27 P21 | Genes involved in SCF(Skp2)-mediated degradation of p27/p21 |
0.1 | 1.3 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.1 | 1.3 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
0.1 | 2.4 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
0.1 | 0.1 | REACTOME FRS2 MEDIATED CASCADE | Genes involved in FRS2-mediated cascade |
0.1 | 0.4 | REACTOME G BETA GAMMA SIGNALLING THROUGH PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
0.1 | 1.3 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
0.1 | 3.1 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
0.1 | 0.9 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
0.1 | 1.9 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
0.1 | 0.3 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.1 | 1.5 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
0.1 | 0.6 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
0.1 | 0.2 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
0.1 | 2.5 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.1 | 0.5 | REACTOME NRIF SIGNALS CELL DEATH FROM THE NUCLEUS | Genes involved in NRIF signals cell death from the nucleus |
0.1 | 1.9 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
0.1 | 0.6 | REACTOME CYCLIN E ASSOCIATED EVENTS DURING G1 S TRANSITION | Genes involved in Cyclin E associated events during G1/S transition |
0.1 | 1.7 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
0.1 | 1.5 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
0.1 | 1.3 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.1 | 1.7 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
0.1 | 0.6 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
0.1 | 0.6 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
0.1 | 2.2 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
0.1 | 0.6 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
0.1 | 2.6 | REACTOME INTERFERON GAMMA SIGNALING | Genes involved in Interferon gamma signaling |
0.1 | 1.6 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
0.1 | 0.8 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.1 | 0.1 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
0.1 | 1.6 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
0.1 | 0.7 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
0.1 | 0.4 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
0.1 | 1.2 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
0.1 | 0.1 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
0.1 | 0.7 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
0.1 | 1.1 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
0.1 | 2.8 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.1 | 0.5 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.1 | 1.4 | REACTOME ACTIVATION OF GENES BY ATF4 | Genes involved in Activation of Genes by ATF4 |
0.1 | 0.1 | REACTOME REGULATION OF GLUCOKINASE BY GLUCOKINASE REGULATORY PROTEIN | Genes involved in Regulation of Glucokinase by Glucokinase Regulatory Protein |
0.1 | 0.1 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
0.1 | 0.5 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.1 | 0.1 | REACTOME CELL DEATH SIGNALLING VIA NRAGE NRIF AND NADE | Genes involved in Cell death signalling via NRAGE, NRIF and NADE |
0.1 | 0.6 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
0.1 | 0.8 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.1 | 0.2 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.1 | 2.3 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.1 | 0.6 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
0.1 | 0.7 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
0.1 | 0.2 | REACTOME ACTIVATION OF CHAPERONES BY ATF6 ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
0.1 | 0.3 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
0.1 | 0.1 | REACTOME KERATAN SULFATE KERATIN METABOLISM | Genes involved in Keratan sulfate/keratin metabolism |
0.1 | 0.1 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.1 | 0.2 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
0.1 | 0.1 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
0.1 | 0.6 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
0.1 | 0.5 | REACTOME LIPOPROTEIN METABOLISM | Genes involved in Lipoprotein metabolism |
0.1 | 0.1 | REACTOME UNFOLDED PROTEIN RESPONSE | Genes involved in Unfolded Protein Response |
0.1 | 0.4 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
0.1 | 2.5 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
0.1 | 2.4 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
0.1 | 0.6 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
0.1 | 0.5 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
0.1 | 1.4 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.0 | 0.1 | REACTOME TRANSPORT OF MATURE TRANSCRIPT TO CYTOPLASM | Genes involved in Transport of Mature Transcript to Cytoplasm |
0.0 | 0.8 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
0.0 | 0.6 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
0.0 | 0.2 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
0.0 | 0.2 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
0.0 | 0.6 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.0 | 0.5 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.0 | 0.0 | REACTOME CTLA4 INHIBITORY SIGNALING | Genes involved in CTLA4 inhibitory signaling |
0.0 | 0.7 | REACTOME CHONDROITIN SULFATE DERMATAN SULFATE METABOLISM | Genes involved in Chondroitin sulfate/dermatan sulfate metabolism |
0.0 | 0.2 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
0.0 | 2.9 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
0.0 | 0.2 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
0.0 | 0.7 | REACTOME RNA POL I TRANSCRIPTION | Genes involved in RNA Polymerase I Transcription |
0.0 | 1.5 | REACTOME PI METABOLISM | Genes involved in PI Metabolism |
0.0 | 0.0 | REACTOME POST NMDA RECEPTOR ACTIVATION EVENTS | Genes involved in Post NMDA receptor activation events |
0.0 | 0.0 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.0 | 0.1 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
0.0 | 1.8 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
0.0 | 0.4 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
0.0 | 0.4 | REACTOME TGF BETA RECEPTOR SIGNALING ACTIVATES SMADS | Genes involved in TGF-beta receptor signaling activates SMADs |
0.0 | 0.3 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
0.0 | 0.6 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.0 | 0.7 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
0.0 | 0.1 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
0.0 | 1.8 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
0.0 | 0.7 | REACTOME PI3K AKT ACTIVATION | Genes involved in PI3K/AKT activation |
0.0 | 0.1 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
0.0 | 1.0 | REACTOME METABOLISM OF STEROID HORMONES AND VITAMINS A AND D | Genes involved in Metabolism of steroid hormones and vitamins A and D |
0.0 | 0.7 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.0 | 0.6 | REACTOME L1CAM INTERACTIONS | Genes involved in L1CAM interactions |
0.0 | 0.2 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
0.0 | 0.3 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
0.0 | 0.4 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
0.0 | 0.3 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.0 | 0.1 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
0.0 | 0.4 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
0.0 | 0.3 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.0 | 3.0 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
0.0 | 0.1 | REACTOME INHIBITION OF THE PROTEOLYTIC ACTIVITY OF APC C REQUIRED FOR THE ONSET OF ANAPHASE BY MITOTIC SPINDLE CHECKPOINT COMPONENTS | Genes involved in Inhibition of the proteolytic activity of APC/C required for the onset of anaphase by mitotic spindle checkpoint components |
0.0 | 0.3 | REACTOME ANTIGEN PROCESSING CROSS PRESENTATION | Genes involved in Antigen processing-Cross presentation |
0.0 | 0.7 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
0.0 | 0.2 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.0 | 0.3 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.0 | 0.1 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
0.0 | 0.1 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
0.0 | 0.4 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
0.0 | 0.4 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
0.0 | 0.7 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
0.0 | 0.0 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
0.0 | 0.3 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.0 | 0.0 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
0.0 | 0.1 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.0 | 0.3 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
0.0 | 0.0 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.0 | 0.2 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.0 | 0.9 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
0.0 | 0.2 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
0.0 | 0.0 | REACTOME OPIOID SIGNALLING | Genes involved in Opioid Signalling |
0.0 | 0.8 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
0.0 | 0.3 | REACTOME AMYLOIDS | Genes involved in Amyloids |
0.0 | 0.4 | REACTOME PYRUVATE METABOLISM AND CITRIC ACID TCA CYCLE | Genes involved in Pyruvate metabolism and Citric Acid (TCA) cycle |
0.0 | 0.1 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.0 | 0.2 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
0.0 | 0.1 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
0.0 | 0.1 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
0.0 | 2.3 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
0.0 | 0.1 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
0.0 | 0.6 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
0.0 | 0.0 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
0.0 | 0.1 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
0.0 | 0.1 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.0 | 0.0 | REACTOME SCF BETA TRCP MEDIATED DEGRADATION OF EMI1 | Genes involved in SCF-beta-TrCP mediated degradation of Emi1 |
0.0 | 0.1 | REACTOME PI 3K CASCADE | Genes involved in PI-3K cascade |
0.0 | 0.4 | REACTOME CHROMOSOME MAINTENANCE | Genes involved in Chromosome Maintenance |
0.0 | 0.1 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
0.0 | 0.2 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
0.0 | 0.2 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
0.0 | 0.2 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.0 | 0.1 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
0.0 | 0.3 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
0.0 | 0.0 | REACTOME SEMA4D IN SEMAPHORIN SIGNALING | Genes involved in Sema4D in semaphorin signaling |
0.0 | 0.1 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
0.0 | 0.0 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.0 | 0.1 | REACTOME OPSINS | Genes involved in Opsins |