| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Myb
|
ENSMUSG00000019982.8 | myeloblastosis oncogene |
| CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|---|---|
| chr10_21158162_21158313 | Myb | 1592 | 0.301023 | -0.05 | 9.3e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr11_7203968_7204174 | 1.52 |
Igfbp1 |
insulin-like growth factor binding protein 1 |
6289 |
0.18 |
| chr10_84054746_84054912 | 1.34 |
Gm37908 |
predicted gene, 37908 |
6929 |
0.2 |
| chr5_8961694_8961940 | 1.21 |
Abcb4 |
ATP-binding cassette, sub-family B (MDR/TAP), member 4 |
3265 |
0.17 |
| chr9_65314578_65314742 | 1.01 |
Clpx |
caseinolytic mitochondrial matrix peptidase chaperone subunit |
4508 |
0.11 |
| chr10_80818984_80819169 | 0.98 |
Jsrp1 |
junctional sarcoplasmic reticulum protein 1 |
5578 |
0.07 |
| chr1_93146606_93146776 | 0.98 |
Agxt |
alanine-glyoxylate aminotransferase |
6812 |
0.13 |
| chr1_131969813_131969968 | 0.97 |
Slc45a3 |
solute carrier family 45, member 3 |
719 |
0.55 |
| chr13_43209141_43209440 | 0.97 |
Tbc1d7 |
TBC1 domain family, member 7 |
37789 |
0.16 |
| chr5_102511749_102511901 | 0.96 |
1700013M08Rik |
RIKEN cDNA 1700013M08 gene |
28536 |
0.2 |
| chr19_42602482_42602861 | 0.96 |
Loxl4 |
lysyl oxidase-like 4 |
650 |
0.71 |
| chr13_64315356_64315548 | 0.96 |
Prxl2c |
peroxiredoxin like 2C |
2742 |
0.14 |
| chr1_6214821_6214985 | 0.93 |
Rb1cc1 |
RB1-inducible coiled-coil 1 |
105 |
0.77 |
| chr17_27717560_27717711 | 0.91 |
Spdef |
SAM pointed domain containing ets transcription factor |
84 |
0.95 |
| chr2_71467270_71467440 | 0.90 |
Metap1d |
methionyl aminopeptidase type 1D (mitochondrial) |
13992 |
0.13 |
| chr10_69163418_69163662 | 0.90 |
Rhobtb1 |
Rho-related BTB domain containing 1 |
12106 |
0.16 |
| chr2_154590499_154590657 | 0.87 |
Pxmp4 |
peroxisomal membrane protein 4 |
13110 |
0.1 |
| chr11_95821388_95821573 | 0.86 |
Phospho1 |
phosphatase, orphan 1 |
3019 |
0.15 |
| chr4_148149526_148149677 | 0.86 |
Fbxo6 |
F-box protein 6 |
118 |
0.92 |
| chr1_180172318_180172469 | 0.85 |
Coq8a |
coenzyme Q8A |
6238 |
0.16 |
| chr7_44819003_44819183 | 0.85 |
Nup62 |
nucleoporin 62 |
656 |
0.42 |
| chr4_148215189_148215340 | 0.83 |
Disp3 |
dispatched RND transporter family member 3 |
45487 |
0.08 |
| chr5_8909226_8909377 | 0.83 |
Gm17936 |
predicted gene, 17936 |
3670 |
0.19 |
| chr12_21165332_21165492 | 0.83 |
Asap2 |
ArfGAP with SH3 domain, ankyrin repeat and PH domain 2 |
53458 |
0.11 |
| chr12_75820288_75820451 | 0.81 |
Syne2 |
spectrin repeat containing, nuclear envelope 2 |
2019 |
0.41 |
| chr2_27639730_27639910 | 0.78 |
Rxra |
retinoid X receptor alpha |
36620 |
0.17 |
| chr3_88149158_88149546 | 0.78 |
Mef2d |
myocyte enhancer factor 2D |
6778 |
0.11 |
| chr19_43971247_43971535 | 0.77 |
Cpn1 |
carboxypeptidase N, polypeptide 1 |
2698 |
0.21 |
| chr9_43467603_43467754 | 0.76 |
Gm28215 |
predicted gene 28215 |
1744 |
0.35 |
| chr5_8964466_8964675 | 0.76 |
Abcb4 |
ATP-binding cassette, sub-family B (MDR/TAP), member 4 |
6018 |
0.13 |
| chrX_105902281_105902436 | 0.76 |
Atrx |
ATRX, chromatin remodeler |
14535 |
0.17 |
| chr2_69414677_69414863 | 0.75 |
Dhrs9 |
dehydrogenase/reductase (SDR family) member 9 |
34325 |
0.16 |
| chr8_68955134_68955349 | 0.74 |
Gm45780 |
predicted gene 45780 |
4920 |
0.22 |
| chr3_65858505_65858674 | 0.74 |
Gm37131 |
predicted gene, 37131 |
6240 |
0.17 |
| chr9_63698782_63698955 | 0.73 |
Smad3 |
SMAD family member 3 |
13101 |
0.22 |
| chr2_154585055_154585223 | 0.72 |
E2f1 |
E2F transcription factor 1 |
15247 |
0.09 |
| chr4_60657362_60657536 | 0.72 |
Mup11 |
major urinary protein 11 |
2289 |
0.27 |
| chr8_94172420_94173095 | 0.71 |
Mt2 |
metallothionein 2 |
93 |
0.88 |
| chr10_18237308_18237472 | 0.71 |
Gm10827 |
predicted gene 10827 |
2024 |
0.26 |
| chr17_4611843_4612060 | 0.70 |
4930517M08Rik |
RIKEN cDNA 4930517M08 gene |
23027 |
0.24 |
| chr19_30093012_30093163 | 0.68 |
Uhrf2 |
ubiquitin-like, containing PHD and RING finger domains 2 |
1126 |
0.54 |
| chr15_101093133_101093317 | 0.68 |
Fignl2 |
fidgetin-like 2 |
14658 |
0.12 |
| chr2_163480327_163480478 | 0.67 |
Fitm2 |
fat storage-inducing transmembrane protein 2 |
7773 |
0.11 |
| chr4_60416791_60417110 | 0.67 |
Mup9 |
major urinary protein 9 |
3634 |
0.18 |
| chr11_94636935_94637155 | 0.67 |
Lrrc59 |
leucine rich repeat containing 59 |
7231 |
0.1 |
| chr1_36526034_36526242 | 0.67 |
Gm38033 |
predicted gene, 38033 |
2099 |
0.15 |
| chr4_61777209_61777633 | 0.67 |
Mup19 |
major urinary protein 19 |
4803 |
0.14 |
| chr7_112189160_112189328 | 0.66 |
Dkk3 |
dickkopf WNT signaling pathway inhibitor 3 |
30187 |
0.19 |
| chr6_116119166_116119329 | 0.65 |
Tmcc1 |
transmembrane and coiled coil domains 1 |
8853 |
0.16 |
| chr4_61590678_61590958 | 0.65 |
Mup17 |
major urinary protein 17 |
5053 |
0.19 |
| chr7_30360114_30360296 | 0.65 |
Lrfn3 |
leucine rich repeat and fibronectin type III domain containing 3 |
2567 |
0.1 |
| chr10_84418574_84418728 | 0.64 |
Nuak1 |
NUAK family, SNF1-like kinase, 1 |
21946 |
0.15 |
| chr2_32686321_32686486 | 0.63 |
Fpgs |
folylpolyglutamyl synthetase |
447 |
0.56 |
| chr17_29114031_29114182 | 0.62 |
Rab44 |
RAB44, member RAS oncogene family |
39 |
0.95 |
| chr1_119189619_119189770 | 0.62 |
Gm8321 |
predicted gene 8321 |
32108 |
0.17 |
| chr10_118761581_118761745 | 0.62 |
Gm47425 |
predicted gene, 47425 |
42235 |
0.11 |
| chr3_83031150_83032011 | 0.62 |
Fga |
fibrinogen alpha chain |
5365 |
0.15 |
| chr10_59205891_59206053 | 0.61 |
Gm23223 |
predicted gene, 23223 |
10273 |
0.15 |
| chr2_64986855_64987034 | 0.61 |
Grb14 |
growth factor receptor bound protein 14 |
11175 |
0.28 |
| chr10_7919779_7919947 | 0.60 |
Tab2 |
TGF-beta activated kinase 1/MAP3K7 binding protein 2 |
4397 |
0.23 |
| chr17_30590513_30590860 | 0.60 |
Gm50244 |
predicted gene, 50244 |
822 |
0.45 |
| chr11_109584777_109585134 | 0.60 |
Wipi1 |
WD repeat domain, phosphoinositide interacting 1 |
26477 |
0.13 |
| chr1_93137985_93138369 | 0.59 |
Agxt |
alanine-glyoxylate aminotransferase |
1702 |
0.26 |
| chr19_33099137_33099698 | 0.59 |
Gm29946 |
predicted gene, 29946 |
23230 |
0.18 |
| chr8_126662769_126663262 | 0.59 |
Irf2bp2 |
interferon regulatory factor 2 binding protein 2 |
69029 |
0.1 |
| chr17_56470948_56471107 | 0.59 |
Ptprs |
protein tyrosine phosphatase, receptor type, S |
3600 |
0.19 |
| chr19_47325702_47325853 | 0.58 |
Sh3pxd2a |
SH3 and PX domains 2A |
11026 |
0.18 |
| chr4_60217544_60217718 | 0.58 |
Mup8 |
major urinary protein 8 |
4949 |
0.2 |
| chr7_3145683_3146014 | 0.58 |
Gm29708 |
predicted gene, 29708 |
4143 |
0.09 |
| chr16_10965830_10965984 | 0.58 |
Gm26268 |
predicted gene, 26268 |
183 |
0.91 |
| chr8_11183553_11183933 | 0.58 |
Gm15418 |
predicted gene 15418 |
4012 |
0.2 |
| chr13_52711768_52711950 | 0.57 |
BB123696 |
expressed sequence BB123696 |
23749 |
0.25 |
| chr17_29093996_29094361 | 0.57 |
1700023B13Rik |
RIKEN cDNA 1700023B13 gene |
283 |
0.56 |
| chr1_119293038_119293189 | 0.57 |
Gm29456 |
predicted gene 29456 |
33720 |
0.15 |
| chr5_114796772_114796944 | 0.57 |
Ankrd13a |
ankyrin repeat domain 13a |
1115 |
0.31 |
| chr11_101376283_101376946 | 0.57 |
G6pc |
glucose-6-phosphatase, catalytic |
9053 |
0.06 |
| chr1_190119406_190119723 | 0.57 |
Gm28172 |
predicted gene 28172 |
49106 |
0.13 |
| chr4_150011693_150012053 | 0.57 |
H6pd |
hexose-6-phosphate dehydrogenase (glucose 1-dehydrogenase) |
2850 |
0.2 |
| chr4_145041587_145041938 | 0.57 |
Vps13d |
vacuolar protein sorting 13D |
9272 |
0.25 |
| chr4_60134689_60135008 | 0.57 |
Mup2 |
major urinary protein 2 |
5009 |
0.19 |
| chr3_50443598_50443859 | 0.56 |
Slc7a11 |
solute carrier family 7 (cationic amino acid transporter, y+ system), member 11 |
114 |
0.97 |
| chr2_74724645_74724796 | 0.56 |
Mir10b |
microRNA 10b |
1350 |
0.15 |
| chr6_99490073_99490224 | 0.56 |
Gm22328 |
predicted gene, 22328 |
5446 |
0.22 |
| chr17_5592858_5593167 | 0.56 |
Zdhhc14 |
zinc finger, DHHC domain containing 14 |
100455 |
0.06 |
| chr19_4194784_4194988 | 0.56 |
Ppp1ca |
protein phosphatase 1 catalytic subunit alpha |
237 |
0.73 |
| chr2_103824986_103825173 | 0.56 |
Gm13880 |
predicted gene 13880 |
5603 |
0.09 |
| chr4_145053276_145053464 | 0.56 |
Vps13d |
vacuolar protein sorting 13D |
773 |
0.73 |
| chr8_117324934_117325253 | 0.55 |
Cmip |
c-Maf inducing protein |
24077 |
0.22 |
| chr3_93556679_93556843 | 0.55 |
S100a10 |
S100 calcium binding protein A10 (calpactin) |
1598 |
0.27 |
| chr15_74785342_74785727 | 0.55 |
Gm17189 |
predicted gene 17189 |
1469 |
0.19 |
| chr5_151086750_151086901 | 0.55 |
Stard13 |
StAR-related lipid transfer (START) domain containing 13 |
2437 |
0.36 |
| chr17_28290145_28290326 | 0.55 |
Ppard |
peroxisome proliferator activator receptor delta |
3011 |
0.15 |
| chr14_70575919_70576089 | 0.54 |
Nudt18 |
nudix (nucleoside diphosphate linked moiety X)-type motif 18 |
1633 |
0.23 |
| chr6_99540166_99540323 | 0.54 |
Foxp1 |
forkhead box P1 |
17523 |
0.21 |
| chr6_97871724_97871885 | 0.54 |
Gm15531 |
predicted gene 15531 |
18735 |
0.23 |
| chr4_120101853_120102132 | 0.54 |
Hivep3 |
human immunodeficiency virus type I enhancer binding protein 3 |
7503 |
0.23 |
| chr6_145335751_145336059 | 0.53 |
Gm15707 |
predicted gene 15707 |
19297 |
0.11 |
| chr3_91463817_91463984 | 0.53 |
S100a7l2 |
S100 calcium binding protein A7 like 2 |
373097 |
0.01 |
| chr1_93540604_93540755 | 0.53 |
Gm37250 |
predicted gene, 37250 |
8864 |
0.15 |
| chr10_68465783_68466111 | 0.53 |
Cabcoco1 |
ciliary associated calcium binding coiled-coil 1 |
59820 |
0.13 |
| chr10_87860315_87860586 | 0.53 |
Igf1 |
insulin-like growth factor 1 |
156 |
0.96 |
| chr15_76598075_76598247 | 0.53 |
Cpsf1 |
cleavage and polyadenylation specific factor 1 |
69 |
0.92 |
| chr1_180021452_180021632 | 0.52 |
Gm38169 |
predicted gene, 38169 |
480 |
0.83 |
| chr15_101106063_101106227 | 0.52 |
Ankrd33 |
ankyrin repeat domain 33 |
9610 |
0.12 |
| chr10_79777048_79777199 | 0.52 |
Fstl3 |
follistatin-like 3 |
149 |
0.88 |
| chr12_111443408_111443817 | 0.52 |
Tnfaip2 |
tumor necrosis factor, alpha-induced protein 2 |
712 |
0.55 |
| chr14_30904635_30904800 | 0.52 |
Itih4 |
inter alpha-trypsin inhibitor, heavy chain 4 |
5556 |
0.12 |
| chr1_165772571_165772722 | 0.52 |
Creg1 |
cellular repressor of E1A-stimulated genes 1 |
3170 |
0.12 |
| chr12_24627702_24627853 | 0.52 |
Gm6969 |
predicted pseudogene 6969 |
11233 |
0.15 |
| chr17_29247915_29248086 | 0.51 |
Ppil1 |
peptidylprolyl isomerase (cyclophilin)-like 1 |
3995 |
0.12 |
| chr2_145740132_145740315 | 0.51 |
Gm11763 |
predicted gene 11763 |
38498 |
0.16 |
| chr15_96621805_96622214 | 0.51 |
Slc38a1 |
solute carrier family 38, member 1 |
19953 |
0.19 |
| chr5_144905134_144905285 | 0.51 |
Smurf1 |
SMAD specific E3 ubiquitin protein ligase 1 |
7215 |
0.16 |
| chr9_22305061_22305222 | 0.51 |
Zfp810 |
zinc finger protein 810 |
1827 |
0.17 |
| chr13_102874894_102875045 | 0.51 |
Mast4 |
microtubule associated serine/threonine kinase family member 4 |
30817 |
0.22 |
| chr4_63151085_63151285 | 0.50 |
Ambp |
alpha 1 microglobulin/bikunin precursor |
2988 |
0.23 |
| chr4_107218269_107218421 | 0.50 |
Ldlrad1 |
low density lipoprotein receptor class A domain containing 1 |
9165 |
0.12 |
| chr17_9663030_9663198 | 0.50 |
Pabpc6 |
poly(A) binding protein, cytoplasmic 6 |
6603 |
0.26 |
| chr13_30234959_30235130 | 0.50 |
Mboat1 |
membrane bound O-acyltransferase domain containing 1 |
3191 |
0.28 |
| chr19_23120450_23120606 | 0.50 |
2410080I02Rik |
RIKEN cDNA 2410080I02 gene |
14372 |
0.15 |
| chr5_117356682_117356871 | 0.49 |
Wsb2 |
WD repeat and SOCS box-containing 2 |
528 |
0.63 |
| chr4_138938882_138939039 | 0.49 |
Otud3 |
OTU domain containing 3 |
25015 |
0.12 |
| chr4_61298923_61299125 | 0.49 |
Mup14 |
major urinary protein 14 |
4341 |
0.22 |
| chr4_60577153_60577329 | 0.49 |
Mup10 |
major urinary protein 10 |
3856 |
0.17 |
| chr5_53031908_53032074 | 0.49 |
Slc34a2 |
solute carrier family 34 (sodium phosphate), member 2 |
6090 |
0.17 |
| chr8_88199324_88199484 | 0.49 |
Tent4b |
terminal nucleotidyltransferase 4B |
190 |
0.93 |
| chr10_67185588_67186325 | 0.49 |
Jmjd1c |
jumonji domain containing 1C |
203 |
0.95 |
| chr2_114097755_114097932 | 0.49 |
Aqr |
aquarius |
21344 |
0.15 |
| chr12_82935494_82935649 | 0.48 |
1700085C21Rik |
RIKEN cDNA 1700085C21 gene |
3584 |
0.28 |
| chr13_52902494_52902653 | 0.48 |
Auh |
AU RNA binding protein/enoyl-coenzyme A hydratase |
10373 |
0.24 |
| chr5_134735010_134735177 | 0.48 |
Eln |
elastin |
5987 |
0.15 |
| chr9_83882607_83882791 | 0.48 |
Gm36278 |
predicted gene, 36278 |
42323 |
0.11 |
| chr3_83045270_83045687 | 0.48 |
Fgb |
fibrinogen beta chain |
4385 |
0.16 |
| chr8_126776984_126777391 | 0.48 |
Gm45805 |
predicted gene 45805 |
18853 |
0.22 |
| chr6_87980501_87980658 | 0.48 |
Gm5577 |
predicted gene 5577 |
304 |
0.69 |
| chr11_31941447_31941609 | 0.48 |
4930524B15Rik |
RIKEN cDNA 4930524B15 gene |
24064 |
0.18 |
| chr8_10947777_10947942 | 0.47 |
Gm44955 |
predicted gene 44955 |
31 |
0.96 |
| chr10_41992198_41992354 | 0.47 |
Armc2 |
armadillo repeat containing 2 |
890 |
0.62 |
| chr1_9636419_9636585 | 0.47 |
Gm29520 |
predicted gene 29520 |
4080 |
0.16 |
| chr11_16753728_16753924 | 0.47 |
Egfr |
epidermal growth factor receptor |
1596 |
0.4 |
| chr15_74957727_74957996 | 0.47 |
Ly6e |
lymphocyte antigen 6 complex, locus E |
1306 |
0.24 |
| chr1_156075023_156075202 | 0.47 |
Tor1aip2 |
torsin A interacting protein 2 |
11899 |
0.17 |
| chr10_8092375_8092549 | 0.47 |
Gm48614 |
predicted gene, 48614 |
71170 |
0.1 |
| chr15_59278504_59278870 | 0.47 |
Gm36617 |
predicted gene, 36617 |
3291 |
0.21 |
| chr4_11090199_11090400 | 0.47 |
Ndufaf6 |
NADH:ubiquinone oxidoreductase complex assembly factor 6 |
14094 |
0.14 |
| chr14_30906842_30907058 | 0.47 |
Itih3 |
inter-alpha trypsin inhibitor, heavy chain 3 |
7179 |
0.11 |
| chr13_74363477_74363666 | 0.46 |
Lrrc14b |
leucine rich repeat containing 14B |
434 |
0.67 |
| chr6_129541459_129541610 | 0.46 |
Gm44243 |
predicted gene, 44243 |
1313 |
0.23 |
| chr5_9045319_9045483 | 0.46 |
Gm40264 |
predicted gene, 40264 |
10277 |
0.15 |
| chr4_118222144_118222304 | 0.46 |
Ptprf |
protein tyrosine phosphatase, receptor type, F |
4544 |
0.18 |
| chr14_34040936_34041093 | 0.46 |
Gm5460 |
predicted gene 5460 |
24 |
0.96 |
| chr7_24595819_24595970 | 0.46 |
Zfp575 |
zinc finger protein 575 |
8253 |
0.08 |
| chr14_95941349_95941500 | 0.45 |
Gm18885 |
predicted gene, 18885 |
8464 |
0.25 |
| chr15_88891458_88891614 | 0.45 |
Gm20621 |
predicted gene 20621 |
11 |
0.97 |
| chr10_68180235_68180400 | 0.45 |
Arid5b |
AT rich interactive domain 5B (MRF1-like) |
43691 |
0.17 |
| chr6_34873968_34874119 | 0.45 |
Tmem140 |
transmembrane protein 140 |
1329 |
0.3 |
| chr11_100887339_100887674 | 0.45 |
Stat3 |
signal transducer and activator of transcription 3 |
2806 |
0.19 |
| chr15_85969731_85970002 | 0.45 |
Celsr1 |
cadherin, EGF LAG seven-pass G-type receptor 1 |
8864 |
0.21 |
| chr5_52986306_52986524 | 0.45 |
Gm30301 |
predicted gene, 30301 |
4378 |
0.17 |
| chr9_62359816_62359967 | 0.45 |
Anp32a |
acidic (leucine-rich) nuclear phosphoprotein 32 family, member A |
7047 |
0.22 |
| chr1_91080362_91080749 | 0.45 |
Lrrfip1 |
leucine rich repeat (in FLII) interacting protein 1 |
26969 |
0.16 |
| chr18_24652431_24652590 | 0.45 |
Mocos |
molybdenum cofactor sulfurase |
1181 |
0.43 |
| chr5_120536757_120536917 | 0.44 |
Slc8b1 |
solute carrier family 8 (sodium/lithium/calcium exchanger), member B1 |
16058 |
0.1 |
| chr19_59588162_59588313 | 0.44 |
Gm18161 |
predicted gene, 18161 |
47786 |
0.13 |
| chrX_94122808_94122959 | 0.44 |
Zfx |
zinc finger protein X-linked |
17 |
0.98 |
| chr14_51009711_51009870 | 0.44 |
Rnase10 |
ribonuclease, RNase A family, 10 (non-active) |
1861 |
0.17 |
| chr5_65436325_65436532 | 0.44 |
Ugdh |
UDP-glucose dehydrogenase |
479 |
0.64 |
| chr9_95549938_95550125 | 0.44 |
Gm32281 |
predicted gene, 32281 |
4466 |
0.16 |
| chrX_101419042_101419230 | 0.44 |
Zmym3 |
zinc finger, MYM-type 3 |
662 |
0.61 |
| chr2_170267512_170267663 | 0.44 |
Gm14270 |
predicted gene 14270 |
17448 |
0.22 |
| chr18_35675407_35675578 | 0.44 |
Dnajc18 |
DnaJ heat shock protein family (Hsp40) member C18 |
11251 |
0.08 |
| chr14_31660786_31660937 | 0.43 |
Hacl1 |
2-hydroxyacyl-CoA lyase 1 |
19575 |
0.13 |
| chr18_20945531_20945682 | 0.43 |
Rnf125 |
ring finger protein 125 |
981 |
0.59 |
| chr11_54724432_54724596 | 0.43 |
Gm12227 |
predicted gene 12227 |
4163 |
0.17 |
| chr1_178315141_178315341 | 0.43 |
B230369F24Rik |
RIKEN cDNA B230369F24 gene |
3308 |
0.14 |
| chr7_137443562_137443713 | 0.43 |
Glrx3 |
glutaredoxin 3 |
5948 |
0.23 |
| chr9_21593299_21593482 | 0.43 |
Yipf2 |
Yip1 domain family, member 2 |
562 |
0.42 |
| chr3_83043035_83043461 | 0.43 |
Fgb |
fibrinogen beta chain |
6615 |
0.15 |
| chr12_76128998_76129152 | 0.43 |
Gm7862 |
predicted gene 7862 |
23552 |
0.15 |
| chr14_76845807_76845966 | 0.43 |
Gm48968 |
predicted gene, 48968 |
13065 |
0.19 |
| chr12_109975689_109975870 | 0.43 |
Gm34667 |
predicted gene, 34667 |
48094 |
0.07 |
| chr13_69583985_69584179 | 0.42 |
Srd5a1 |
steroid 5 alpha-reductase 1 |
10747 |
0.12 |
| chr2_170453954_170454173 | 0.42 |
Gm14269 |
predicted gene 14269 |
9756 |
0.15 |
| chr6_145340048_145340215 | 0.42 |
Gm15707 |
predicted gene 15707 |
23523 |
0.11 |
| chr7_99181688_99181877 | 0.42 |
Dgat2 |
diacylglycerol O-acyltransferase 2 |
895 |
0.48 |
| chr10_93506965_93507224 | 0.42 |
Hal |
histidine ammonia lyase |
5969 |
0.15 |
| chr16_23996083_23996368 | 0.42 |
Bcl6 |
B cell leukemia/lymphoma 6 |
7373 |
0.17 |
| chr17_35483918_35484112 | 0.42 |
H2-Q10 |
histocompatibility 2, Q region locus 10 |
13918 |
0.07 |
| chr13_100850060_100850211 | 0.41 |
Gm29502 |
predicted gene 29502 |
2702 |
0.2 |
| chr3_84257934_84258098 | 0.41 |
Trim2 |
tripartite motif-containing 2 |
1353 |
0.53 |
| chr2_71973774_71974045 | 0.41 |
Rapgef4 |
Rap guanine nucleotide exchange factor (GEF) 4 |
7331 |
0.19 |
| chr16_94693543_94693992 | 0.41 |
Gm41504 |
predicted gene, 41504 |
20136 |
0.16 |
| chr10_23815272_23815431 | 0.41 |
Slc18b1 |
solute carrier family 18, subfamily B, member 1 |
9136 |
0.12 |
| chr2_4154178_4154401 | 0.41 |
Frmd4a |
FERM domain containing 4A |
1417 |
0.29 |
| chr11_81374417_81374616 | 0.41 |
4930527B05Rik |
RIKEN cDNA 4930527B05 gene |
10497 |
0.3 |
| chr9_66285727_66286140 | 0.41 |
Dapk2 |
death-associated protein kinase 2 |
17559 |
0.2 |
| chr4_126091770_126091957 | 0.41 |
Oscp1 |
organic solute carrier partner 1 |
4184 |
0.13 |
| chr16_91782973_91783146 | 0.41 |
Itsn1 |
intersectin 1 (SH3 domain protein 1A) |
898 |
0.57 |
| chr3_75956327_75956498 | 0.40 |
Golim4 |
golgi integral membrane protein 4 |
238 |
0.58 |
| chr4_57320936_57321111 | 0.40 |
Ptpn3 |
protein tyrosine phosphatase, non-receptor type 3 |
19186 |
0.15 |
| chr12_51866430_51866601 | 0.40 |
Heatr5a |
HEAT repeat containing 5A |
22475 |
0.16 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.7 | GO:0045472 | response to ether(GO:0045472) |
| 0.2 | 0.7 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
| 0.2 | 0.9 | GO:0010273 | detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
| 0.2 | 1.0 | GO:0060480 | lung goblet cell differentiation(GO:0060480) |
| 0.2 | 0.6 | GO:0046439 | cysteine catabolic process(GO:0009093) L-cysteine catabolic process(GO:0019448) L-cysteine metabolic process(GO:0046439) |
| 0.2 | 0.9 | GO:0097466 | glycoprotein ERAD pathway(GO:0097466) response to glycoprotein(GO:1904587) |
| 0.2 | 0.5 | GO:0015772 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.1 | 0.7 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
| 0.1 | 0.4 | GO:1904193 | cholangiocyte apoptotic process(GO:1902488) regulation of cholangiocyte apoptotic process(GO:1904192) negative regulation of cholangiocyte apoptotic process(GO:1904193) |
| 0.1 | 0.5 | GO:0060397 | JAK-STAT cascade involved in growth hormone signaling pathway(GO:0060397) |
| 0.1 | 0.1 | GO:0097296 | activation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:0097296) |
| 0.1 | 0.5 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
| 0.1 | 0.3 | GO:0034184 | positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
| 0.1 | 0.3 | GO:0002019 | regulation of renal output by angiotensin(GO:0002019) |
| 0.1 | 0.3 | GO:2000646 | positive regulation of receptor catabolic process(GO:2000646) |
| 0.1 | 0.3 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
| 0.1 | 0.4 | GO:1903998 | regulation of eating behavior(GO:1903998) |
| 0.1 | 0.2 | GO:1902065 | response to L-glutamate(GO:1902065) |
| 0.1 | 0.3 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
| 0.1 | 0.3 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
| 0.1 | 0.1 | GO:0038086 | VEGF-activated platelet-derived growth factor receptor signaling pathway(GO:0038086) positive regulation of cell proliferation by VEGF-activated platelet derived growth factor receptor signaling pathway(GO:0038091) |
| 0.1 | 0.2 | GO:0019344 | cysteine biosynthetic process(GO:0019344) |
| 0.1 | 0.5 | GO:0051775 | response to redox state(GO:0051775) |
| 0.1 | 0.2 | GO:0046066 | purine deoxyribonucleoside diphosphate metabolic process(GO:0009182) dGDP metabolic process(GO:0046066) |
| 0.1 | 0.2 | GO:0038044 | transforming growth factor-beta secretion(GO:0038044) regulation of transforming growth factor-beta secretion(GO:2001201) |
| 0.1 | 0.3 | GO:1902512 | positive regulation of apoptotic DNA fragmentation(GO:1902512) positive regulation of DNA catabolic process(GO:1903626) |
| 0.1 | 0.2 | GO:0015819 | lysine transport(GO:0015819) |
| 0.1 | 0.5 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
| 0.1 | 0.2 | GO:0019464 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.1 | 0.3 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
| 0.1 | 0.2 | GO:0010909 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
| 0.1 | 0.4 | GO:0006642 | triglyceride mobilization(GO:0006642) |
| 0.1 | 0.5 | GO:0090308 | regulation of methylation-dependent chromatin silencing(GO:0090308) |
| 0.1 | 0.4 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
| 0.1 | 0.4 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.1 | 0.4 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
| 0.1 | 0.5 | GO:0099515 | actin filament-based transport(GO:0099515) |
| 0.1 | 0.2 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.1 | 0.3 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 0.1 | 0.2 | GO:0051791 | medium-chain fatty acid metabolic process(GO:0051791) |
| 0.1 | 0.4 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
| 0.1 | 0.2 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.1 | 0.2 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
| 0.1 | 0.2 | GO:0071442 | positive regulation of histone H3-K14 acetylation(GO:0071442) |
| 0.1 | 0.6 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
| 0.1 | 0.4 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
| 0.1 | 0.2 | GO:0006768 | biotin metabolic process(GO:0006768) |
| 0.1 | 0.3 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
| 0.1 | 0.1 | GO:0090361 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.1 | 0.2 | GO:1901874 | regulation of post-translational protein modification(GO:1901873) negative regulation of post-translational protein modification(GO:1901874) |
| 0.1 | 0.6 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.1 | 0.1 | GO:0003223 | ventricular compact myocardium morphogenesis(GO:0003223) |
| 0.1 | 0.2 | GO:0010901 | regulation of very-low-density lipoprotein particle remodeling(GO:0010901) |
| 0.1 | 0.2 | GO:2000065 | negative regulation of aldosterone metabolic process(GO:0032345) negative regulation of aldosterone biosynthetic process(GO:0032348) negative regulation of cortisol biosynthetic process(GO:2000065) |
| 0.1 | 0.3 | GO:0072378 | blood coagulation, fibrin clot formation(GO:0072378) |
| 0.1 | 0.1 | GO:0070350 | white fat cell proliferation(GO:0070343) regulation of white fat cell proliferation(GO:0070350) |
| 0.1 | 0.2 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
| 0.1 | 0.3 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
| 0.1 | 0.1 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
| 0.1 | 0.1 | GO:0048162 | preantral ovarian follicle growth(GO:0001546) multi-layer follicle stage(GO:0048162) |
| 0.1 | 0.3 | GO:0072675 | osteoclast fusion(GO:0072675) |
| 0.0 | 0.1 | GO:0034182 | regulation of maintenance of sister chromatid cohesion(GO:0034091) regulation of maintenance of mitotic sister chromatid cohesion(GO:0034182) |
| 0.0 | 0.2 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
| 0.0 | 0.2 | GO:0052428 | negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
| 0.0 | 0.1 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
| 0.0 | 0.3 | GO:0060613 | fat pad development(GO:0060613) |
| 0.0 | 0.2 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
| 0.0 | 0.3 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
| 0.0 | 0.2 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.0 | 0.2 | GO:0060903 | positive regulation of meiosis I(GO:0060903) |
| 0.0 | 0.1 | GO:1903238 | positive regulation of leukocyte tethering or rolling(GO:1903238) |
| 0.0 | 0.0 | GO:0035280 | miRNA loading onto RISC involved in gene silencing by miRNA(GO:0035280) |
| 0.0 | 0.3 | GO:0045634 | regulation of melanocyte differentiation(GO:0045634) |
| 0.0 | 0.1 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
| 0.0 | 0.5 | GO:0009396 | folic acid-containing compound biosynthetic process(GO:0009396) |
| 0.0 | 0.3 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
| 0.0 | 0.3 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
| 0.0 | 0.2 | GO:0009115 | xanthine catabolic process(GO:0009115) |
| 0.0 | 0.1 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
| 0.0 | 0.1 | GO:2000698 | positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) |
| 0.0 | 0.3 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
| 0.0 | 0.2 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
| 0.0 | 0.1 | GO:0048294 | negative regulation of isotype switching to IgE isotypes(GO:0048294) |
| 0.0 | 0.2 | GO:0060978 | angiogenesis involved in coronary vascular morphogenesis(GO:0060978) |
| 0.0 | 0.3 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
| 0.0 | 0.2 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.0 | 0.1 | GO:0060729 | intestinal epithelial structure maintenance(GO:0060729) |
| 0.0 | 0.1 | GO:0050904 | diapedesis(GO:0050904) |
| 0.0 | 0.1 | GO:0009804 | coumarin metabolic process(GO:0009804) |
| 0.0 | 0.5 | GO:0021702 | cerebellar Purkinje cell differentiation(GO:0021702) |
| 0.0 | 0.3 | GO:0071501 | response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
| 0.0 | 0.3 | GO:0042118 | endothelial cell activation(GO:0042118) |
| 0.0 | 0.3 | GO:2000394 | positive regulation of lamellipodium morphogenesis(GO:2000394) |
| 0.0 | 0.1 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
| 0.0 | 0.1 | GO:0060671 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.0 | 0.5 | GO:0015727 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 0.0 | 0.0 | GO:0044362 | modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) |
| 0.0 | 0.2 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
| 0.0 | 0.2 | GO:0006548 | histidine metabolic process(GO:0006547) histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
| 0.0 | 0.1 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
| 0.0 | 0.2 | GO:0032324 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
| 0.0 | 0.1 | GO:0045626 | negative regulation of T-helper 1 cell differentiation(GO:0045626) |
| 0.0 | 0.1 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
| 0.0 | 0.2 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
| 0.0 | 0.2 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.1 | GO:0070384 | Harderian gland development(GO:0070384) |
| 0.0 | 0.2 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
| 0.0 | 0.1 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.0 | 0.4 | GO:0042640 | anagen(GO:0042640) |
| 0.0 | 0.2 | GO:0045836 | positive regulation of meiotic nuclear division(GO:0045836) |
| 0.0 | 0.1 | GO:0032430 | positive regulation of phospholipase A2 activity(GO:0032430) |
| 0.0 | 0.1 | GO:0070900 | mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
| 0.0 | 0.1 | GO:0034454 | microtubule anchoring at centrosome(GO:0034454) |
| 0.0 | 0.1 | GO:0009212 | dTTP biosynthetic process(GO:0006235) pyrimidine deoxyribonucleoside triphosphate biosynthetic process(GO:0009212) dTTP metabolic process(GO:0046075) |
| 0.0 | 0.1 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
| 0.0 | 0.1 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.0 | 0.6 | GO:0070208 | protein heterotrimerization(GO:0070208) |
| 0.0 | 0.2 | GO:0019367 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.0 | 0.3 | GO:0046415 | urate metabolic process(GO:0046415) |
| 0.0 | 0.2 | GO:0043102 | amino acid salvage(GO:0043102) L-methionine biosynthetic process(GO:0071265) L-methionine salvage(GO:0071267) |
| 0.0 | 0.1 | GO:0034372 | very-low-density lipoprotein particle remodeling(GO:0034372) |
| 0.0 | 0.1 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
| 0.0 | 0.3 | GO:0086036 | regulation of cardiac muscle cell membrane potential(GO:0086036) |
| 0.0 | 0.3 | GO:0071493 | cellular response to UV-B(GO:0071493) |
| 0.0 | 0.0 | GO:0061205 | paramesonephric duct development(GO:0061205) |
| 0.0 | 0.1 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
| 0.0 | 0.1 | GO:0000097 | sulfur amino acid biosynthetic process(GO:0000097) |
| 0.0 | 0.1 | GO:0009436 | glyoxylate catabolic process(GO:0009436) |
| 0.0 | 0.1 | GO:0090148 | membrane fission(GO:0090148) |
| 0.0 | 0.1 | GO:0080154 | regulation of fertilization(GO:0080154) |
| 0.0 | 0.1 | GO:1903026 | negative regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903026) |
| 0.0 | 0.1 | GO:0048293 | isotype switching to IgE isotypes(GO:0048289) regulation of isotype switching to IgE isotypes(GO:0048293) positive regulation of isotype switching to IgE isotypes(GO:0048295) |
| 0.0 | 0.1 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
| 0.0 | 0.3 | GO:0032926 | negative regulation of activin receptor signaling pathway(GO:0032926) |
| 0.0 | 0.4 | GO:0045793 | positive regulation of cell size(GO:0045793) |
| 0.0 | 0.1 | GO:0051572 | negative regulation of histone H3-K4 methylation(GO:0051572) |
| 0.0 | 0.1 | GO:0048478 | replication fork protection(GO:0048478) |
| 0.0 | 0.1 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
| 0.0 | 0.1 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
| 0.0 | 0.1 | GO:0048003 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
| 0.0 | 0.1 | GO:0051344 | negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
| 0.0 | 0.6 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
| 0.0 | 0.2 | GO:0070309 | lens fiber cell morphogenesis(GO:0070309) |
| 0.0 | 0.1 | GO:0072282 | metanephric nephron tubule morphogenesis(GO:0072282) |
| 0.0 | 0.1 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
| 0.0 | 0.2 | GO:0042905 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 0.0 | 0.1 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
| 0.0 | 0.4 | GO:0060746 | parental behavior(GO:0060746) |
| 0.0 | 0.0 | GO:0072095 | regulation of branch elongation involved in ureteric bud branching(GO:0072095) |
| 0.0 | 0.1 | GO:0006551 | leucine metabolic process(GO:0006551) |
| 0.0 | 0.2 | GO:0045792 | negative regulation of cell size(GO:0045792) |
| 0.0 | 0.1 | GO:1903236 | regulation of leukocyte tethering or rolling(GO:1903236) negative regulation of leukocyte tethering or rolling(GO:1903237) |
| 0.0 | 0.2 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
| 0.0 | 0.1 | GO:0035166 | post-embryonic hemopoiesis(GO:0035166) |
| 0.0 | 0.5 | GO:0002089 | lens morphogenesis in camera-type eye(GO:0002089) |
| 0.0 | 0.4 | GO:0030318 | melanocyte differentiation(GO:0030318) |
| 0.0 | 0.1 | GO:0001302 | replicative cell aging(GO:0001302) |
| 0.0 | 0.1 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
| 0.0 | 0.1 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
| 0.0 | 0.2 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
| 0.0 | 0.1 | GO:0000492 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
| 0.0 | 0.1 | GO:0070813 | hydrogen sulfide metabolic process(GO:0070813) |
| 0.0 | 0.0 | GO:0009750 | response to fructose(GO:0009750) cellular response to fructose stimulus(GO:0071332) |
| 0.0 | 0.1 | GO:1901668 | regulation of superoxide dismutase activity(GO:1901668) |
| 0.0 | 0.1 | GO:0046337 | phosphatidylethanolamine metabolic process(GO:0046337) |
| 0.0 | 0.1 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.0 | 0.1 | GO:0051919 | positive regulation of fibrinolysis(GO:0051919) |
| 0.0 | 0.0 | GO:1902430 | negative regulation of beta-amyloid formation(GO:1902430) |
| 0.0 | 0.1 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
| 0.0 | 0.1 | GO:0097503 | sialylation(GO:0097503) |
| 0.0 | 0.1 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
| 0.0 | 0.2 | GO:0001765 | membrane raft assembly(GO:0001765) |
| 0.0 | 0.1 | GO:0032747 | positive regulation of interleukin-23 production(GO:0032747) |
| 0.0 | 0.1 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
| 0.0 | 0.3 | GO:2000060 | positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
| 0.0 | 0.1 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
| 0.0 | 0.1 | GO:1904124 | microglial cell migration(GO:1904124) regulation of microglial cell migration(GO:1904139) |
| 0.0 | 0.1 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
| 0.0 | 0.2 | GO:0060056 | mammary gland involution(GO:0060056) |
| 0.0 | 0.1 | GO:2000002 | negative regulation of DNA damage checkpoint(GO:2000002) |
| 0.0 | 0.1 | GO:0032201 | telomere maintenance via semi-conservative replication(GO:0032201) |
| 0.0 | 0.1 | GO:0032463 | negative regulation of protein homooligomerization(GO:0032463) |
| 0.0 | 0.1 | GO:0003344 | pericardium morphogenesis(GO:0003344) |
| 0.0 | 0.3 | GO:0019985 | translesion synthesis(GO:0019985) |
| 0.0 | 0.2 | GO:0051764 | actin crosslink formation(GO:0051764) |
| 0.0 | 0.1 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
| 0.0 | 0.1 | GO:0071899 | regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
| 0.0 | 0.3 | GO:0051601 | exocyst localization(GO:0051601) |
| 0.0 | 0.1 | GO:0072300 | positive regulation of metanephric glomerulus development(GO:0072300) |
| 0.0 | 0.1 | GO:0002072 | optic cup morphogenesis involved in camera-type eye development(GO:0002072) |
| 0.0 | 0.1 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
| 0.0 | 0.3 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
| 0.0 | 0.1 | GO:0048207 | vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
| 0.0 | 0.2 | GO:0071420 | cellular response to histamine(GO:0071420) |
| 0.0 | 0.1 | GO:0007525 | somatic muscle development(GO:0007525) |
| 0.0 | 0.1 | GO:0060268 | negative regulation of respiratory burst(GO:0060268) |
| 0.0 | 0.2 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
| 0.0 | 0.3 | GO:0046548 | retinal rod cell development(GO:0046548) |
| 0.0 | 0.2 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.0 | 0.2 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
| 0.0 | 0.2 | GO:0051895 | negative regulation of focal adhesion assembly(GO:0051895) |
| 0.0 | 0.1 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
| 0.0 | 0.2 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.0 | 0.0 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
| 0.0 | 0.1 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
| 0.0 | 0.1 | GO:0035630 | bone mineralization involved in bone maturation(GO:0035630) |
| 0.0 | 0.0 | GO:0048696 | regulation of collateral sprouting in absence of injury(GO:0048696) |
| 0.0 | 0.1 | GO:0008582 | regulation of synaptic growth at neuromuscular junction(GO:0008582) |
| 0.0 | 0.1 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
| 0.0 | 0.1 | GO:0010940 | positive regulation of necrotic cell death(GO:0010940) |
| 0.0 | 0.0 | GO:0097242 | beta-amyloid clearance(GO:0097242) |
| 0.0 | 0.2 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.0 | 0.1 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.0 | 0.8 | GO:0033141 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
| 0.0 | 0.1 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.0 | 0.1 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
| 0.0 | 0.0 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.0 | 0.0 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
| 0.0 | 0.0 | GO:0001306 | age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
| 0.0 | 0.2 | GO:2000678 | negative regulation of transcription regulatory region DNA binding(GO:2000678) |
| 0.0 | 0.1 | GO:0010694 | positive regulation of alkaline phosphatase activity(GO:0010694) |
| 0.0 | 0.2 | GO:0006020 | inositol metabolic process(GO:0006020) |
| 0.0 | 0.4 | GO:0051642 | centrosome localization(GO:0051642) |
| 0.0 | 0.1 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
| 0.0 | 0.2 | GO:0042501 | serine phosphorylation of STAT protein(GO:0042501) |
| 0.0 | 0.0 | GO:0014045 | establishment of endothelial blood-brain barrier(GO:0014045) |
| 0.0 | 0.2 | GO:0030432 | peristalsis(GO:0030432) |
| 0.0 | 0.0 | GO:1900242 | regulation of synaptic vesicle endocytosis(GO:1900242) |
| 0.0 | 0.0 | GO:0045541 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
| 0.0 | 0.1 | GO:0051410 | detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
| 0.0 | 0.0 | GO:0019184 | nonribosomal peptide biosynthetic process(GO:0019184) |
| 0.0 | 0.1 | GO:1904707 | positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
| 0.0 | 0.1 | GO:0071286 | cellular response to magnesium ion(GO:0071286) |
| 0.0 | 0.1 | GO:0002317 | plasma cell differentiation(GO:0002317) |
| 0.0 | 0.0 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 0.0 | 0.1 | GO:0044851 | hair cycle phase(GO:0044851) |
| 0.0 | 0.2 | GO:0042984 | amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
| 0.0 | 0.1 | GO:0015817 | histidine transport(GO:0015817) |
| 0.0 | 0.1 | GO:0033499 | galactose catabolic process via UDP-galactose(GO:0033499) glycolytic process from galactose(GO:0061623) |
| 0.0 | 0.0 | GO:0090343 | positive regulation of cell aging(GO:0090343) |
| 0.0 | 0.0 | GO:1902416 | positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
| 0.0 | 0.1 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
| 0.0 | 0.1 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 0.0 | 0.1 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
| 0.0 | 0.0 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
| 0.0 | 0.0 | GO:0010911 | regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) |
| 0.0 | 0.1 | GO:0009826 | unidimensional cell growth(GO:0009826) |
| 0.0 | 0.1 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.0 | 0.1 | GO:0019532 | oxalate transport(GO:0019532) |
| 0.0 | 0.1 | GO:1900113 | negative regulation of histone H3-K9 trimethylation(GO:1900113) |
| 0.0 | 0.3 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
| 0.0 | 0.4 | GO:0006829 | zinc II ion transport(GO:0006829) |
| 0.0 | 0.1 | GO:0008354 | germ cell migration(GO:0008354) |
| 0.0 | 0.0 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
| 0.0 | 0.0 | GO:0048936 | peripheral nervous system neuron axonogenesis(GO:0048936) |
| 0.0 | 0.0 | GO:1990314 | cellular response to insulin-like growth factor stimulus(GO:1990314) |
| 0.0 | 0.2 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
| 0.0 | 0.0 | GO:0043366 | beta selection(GO:0043366) |
| 0.0 | 0.2 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.0 | 0.1 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
| 0.0 | 0.1 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
| 0.0 | 0.1 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
| 0.0 | 0.0 | GO:0006534 | cysteine metabolic process(GO:0006534) |
| 0.0 | 0.1 | GO:0030422 | production of siRNA involved in RNA interference(GO:0030422) |
| 0.0 | 0.0 | GO:0018894 | dibenzo-p-dioxin metabolic process(GO:0018894) |
| 0.0 | 0.0 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
| 0.0 | 0.2 | GO:0070234 | positive regulation of T cell apoptotic process(GO:0070234) |
| 0.0 | 0.1 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
| 0.0 | 0.1 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.0 | 0.0 | GO:0071335 | hair follicle cell proliferation(GO:0071335) regulation of hair follicle cell proliferation(GO:0071336) |
| 0.0 | 0.2 | GO:2000677 | regulation of transcription regulatory region DNA binding(GO:2000677) |
| 0.0 | 0.1 | GO:0051799 | negative regulation of hair follicle development(GO:0051799) |
| 0.0 | 0.2 | GO:0050995 | negative regulation of lipid catabolic process(GO:0050995) |
| 0.0 | 0.1 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
| 0.0 | 0.0 | GO:0006393 | termination of mitochondrial transcription(GO:0006393) |
| 0.0 | 0.0 | GO:0072205 | metanephric collecting duct development(GO:0072205) |
| 0.0 | 0.1 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
| 0.0 | 0.1 | GO:0051970 | negative regulation of transmission of nerve impulse(GO:0051970) |
| 0.0 | 0.0 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.0 | 0.0 | GO:0070671 | response to interleukin-12(GO:0070671) |
| 0.0 | 0.1 | GO:0043562 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.0 | 0.1 | GO:0045820 | negative regulation of glycolytic process(GO:0045820) |
| 0.0 | 0.2 | GO:0071218 | cellular response to misfolded protein(GO:0071218) |
| 0.0 | 0.0 | GO:0060948 | cardiac vascular smooth muscle cell development(GO:0060948) |
| 0.0 | 0.3 | GO:0006098 | pentose-phosphate shunt(GO:0006098) |
| 0.0 | 0.2 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.0 | 0.1 | GO:0071225 | cellular response to muramyl dipeptide(GO:0071225) |
| 0.0 | 0.1 | GO:0071233 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
| 0.0 | 0.3 | GO:0001893 | maternal placenta development(GO:0001893) |
| 0.0 | 0.2 | GO:0031998 | regulation of fatty acid beta-oxidation(GO:0031998) |
| 0.0 | 0.1 | GO:0051697 | protein delipidation(GO:0051697) |
| 0.0 | 0.0 | GO:0045869 | negative regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045869) |
| 0.0 | 0.1 | GO:0044849 | estrous cycle(GO:0044849) |
| 0.0 | 0.1 | GO:0061038 | uterus morphogenesis(GO:0061038) |
| 0.0 | 0.1 | GO:0070589 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) |
| 0.0 | 0.1 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
| 0.0 | 0.1 | GO:0071922 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
| 0.0 | 0.0 | GO:0030397 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
| 0.0 | 0.0 | GO:0071502 | cellular response to temperature stimulus(GO:0071502) |
| 0.0 | 0.1 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
| 0.0 | 0.0 | GO:1900086 | positive regulation of peptidyl-tyrosine autophosphorylation(GO:1900086) |
| 0.0 | 0.1 | GO:0001553 | luteinization(GO:0001553) |
| 0.0 | 0.1 | GO:0046322 | negative regulation of fatty acid oxidation(GO:0046322) |
| 0.0 | 0.0 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
| 0.0 | 0.0 | GO:0043622 | cortical microtubule organization(GO:0043622) |
| 0.0 | 0.1 | GO:0090051 | negative regulation of cell migration involved in sprouting angiogenesis(GO:0090051) |
| 0.0 | 0.1 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
| 0.0 | 0.0 | GO:0038095 | Fc-epsilon receptor signaling pathway(GO:0038095) |
| 0.0 | 0.0 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
| 0.0 | 0.0 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
| 0.0 | 0.1 | GO:0072673 | lamellipodium morphogenesis(GO:0072673) |
| 0.0 | 0.1 | GO:0045176 | apical protein localization(GO:0045176) |
| 0.0 | 0.2 | GO:0042415 | norepinephrine metabolic process(GO:0042415) |
| 0.0 | 0.6 | GO:0006749 | glutathione metabolic process(GO:0006749) |
| 0.0 | 0.2 | GO:0033275 | actin-myosin filament sliding(GO:0033275) |
| 0.0 | 0.0 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 0.0 | 0.1 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
| 0.0 | 0.1 | GO:1903019 | negative regulation of glycoprotein metabolic process(GO:1903019) |
| 0.0 | 0.0 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
| 0.0 | 0.0 | GO:0035624 | receptor transactivation(GO:0035624) epidermal growth factor-activated receptor transactivation by G-protein coupled receptor signaling pathway(GO:0035625) |
| 0.0 | 0.1 | GO:0021999 | neural plate anterior/posterior regionalization(GO:0021999) |
| 0.0 | 0.1 | GO:0002220 | innate immune response activating cell surface receptor signaling pathway(GO:0002220) |
| 0.0 | 0.0 | GO:0010990 | regulation of SMAD protein complex assembly(GO:0010990) |
| 0.0 | 0.1 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.0 | 0.0 | GO:0090403 | oxidative stress-induced premature senescence(GO:0090403) |
| 0.0 | 0.0 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
| 0.0 | 0.1 | GO:0043320 | natural killer cell degranulation(GO:0043320) |
| 0.0 | 0.0 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 0.0 | 0.0 | GO:0045590 | negative regulation of regulatory T cell differentiation(GO:0045590) |
| 0.0 | 0.3 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.0 | 0.0 | GO:0061588 | calcium activated phospholipid scrambling(GO:0061588) calcium activated phosphatidylcholine scrambling(GO:0061590) calcium activated galactosylceramide scrambling(GO:0061591) |
| 0.0 | 0.1 | GO:0015838 | amino-acid betaine transport(GO:0015838) |
| 0.0 | 0.1 | GO:0043518 | negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
| 0.0 | 0.1 | GO:0070423 | nucleotide-binding oligomerization domain containing signaling pathway(GO:0070423) nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070431) |
| 0.0 | 0.0 | GO:0002877 | regulation of acute inflammatory response to non-antigenic stimulus(GO:0002877) |
| 0.0 | 0.0 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
| 0.0 | 0.1 | GO:0032049 | cardiolipin biosynthetic process(GO:0032049) |
| 0.0 | 0.0 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
| 0.0 | 0.1 | GO:0035988 | chondrocyte proliferation(GO:0035988) |
| 0.0 | 0.0 | GO:0097384 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) cellular lipid biosynthetic process(GO:0097384) ether biosynthetic process(GO:1901503) |
| 0.0 | 0.1 | GO:0046618 | drug export(GO:0046618) |
| 0.0 | 0.1 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
| 0.0 | 0.0 | GO:1904502 | lipophagy(GO:0061724) regulation of lipophagy(GO:1904502) positive regulation of lipophagy(GO:1904504) |
| 0.0 | 0.4 | GO:0001562 | response to protozoan(GO:0001562) |
| 0.0 | 0.1 | GO:0061000 | negative regulation of dendritic spine development(GO:0061000) |
| 0.0 | 0.0 | GO:0001807 | regulation of type IV hypersensitivity(GO:0001807) |
| 0.0 | 0.0 | GO:0021776 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
| 0.0 | 0.2 | GO:0007190 | activation of adenylate cyclase activity(GO:0007190) |
| 0.0 | 0.1 | GO:0060710 | chorio-allantoic fusion(GO:0060710) |
| 0.0 | 0.0 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
| 0.0 | 0.2 | GO:0097186 | amelogenesis(GO:0097186) |
| 0.0 | 0.0 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
| 0.0 | 0.2 | GO:0009226 | nucleotide-sugar biosynthetic process(GO:0009226) |
| 0.0 | 0.1 | GO:0015884 | folic acid transport(GO:0015884) |
| 0.0 | 0.0 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.0 | 0.0 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
| 0.0 | 0.2 | GO:0035278 | miRNA mediated inhibition of translation(GO:0035278) |
| 0.0 | 0.0 | GO:0032661 | regulation of interleukin-18 production(GO:0032661) |
| 0.0 | 0.0 | GO:0032788 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
| 0.0 | 0.0 | GO:0051549 | regulation of keratinocyte migration(GO:0051547) positive regulation of keratinocyte migration(GO:0051549) |
| 0.0 | 0.0 | GO:0046490 | isopentenyl diphosphate metabolic process(GO:0046490) |
| 0.0 | 0.0 | GO:0051136 | regulation of NK T cell differentiation(GO:0051136) positive regulation of NK T cell differentiation(GO:0051138) |
| 0.0 | 0.1 | GO:0002329 | pre-B cell differentiation(GO:0002329) |
| 0.0 | 0.1 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.0 | 0.0 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
| 0.0 | 0.0 | GO:0032596 | protein transport into membrane raft(GO:0032596) |
| 0.0 | 0.1 | GO:0046133 | pyrimidine ribonucleoside catabolic process(GO:0046133) |
| 0.0 | 0.0 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
| 0.0 | 0.1 | GO:0048268 | clathrin coat assembly(GO:0048268) |
| 0.0 | 0.1 | GO:0061370 | testosterone biosynthetic process(GO:0061370) |
| 0.0 | 0.0 | GO:0097168 | mesenchymal stem cell proliferation(GO:0097168) |
| 0.0 | 0.0 | GO:0042023 | regulation of DNA endoreduplication(GO:0032875) DNA endoreduplication(GO:0042023) |
| 0.0 | 0.1 | GO:0007184 | SMAD protein import into nucleus(GO:0007184) |
| 0.0 | 0.1 | GO:0050779 | RNA destabilization(GO:0050779) |
| 0.0 | 0.0 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
| 0.0 | 0.1 | GO:0021683 | cerebellar granular layer morphogenesis(GO:0021683) |
| 0.0 | 0.0 | GO:0021773 | striatal medium spiny neuron differentiation(GO:0021773) |
| 0.0 | 0.1 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
| 0.0 | 0.0 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.0 | 0.0 | GO:0019087 | transformation of host cell by virus(GO:0019087) |
| 0.0 | 0.0 | GO:0032594 | protein transport within lipid bilayer(GO:0032594) |
| 0.0 | 0.1 | GO:0035902 | response to immobilization stress(GO:0035902) |
| 0.0 | 0.1 | GO:1900619 | acetylcholine metabolic process(GO:0008291) acetate ester metabolic process(GO:1900619) |
| 0.0 | 0.1 | GO:0019370 | leukotriene biosynthetic process(GO:0019370) |
| 0.0 | 0.0 | GO:0036514 | dopaminergic neuron axon guidance(GO:0036514) planar cell polarity pathway involved in axon guidance(GO:1904938) |
| 0.0 | 0.0 | GO:0015888 | thiamine transport(GO:0015888) |
| 0.0 | 0.0 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
| 0.0 | 0.0 | GO:1902475 | L-alpha-amino acid transmembrane transport(GO:1902475) |
| 0.0 | 0.1 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.0 | 0.0 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.0 | 0.0 | GO:0048934 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.0 | 0.0 | GO:0033689 | negative regulation of osteoblast proliferation(GO:0033689) |
| 0.0 | 0.1 | GO:0046543 | development of secondary female sexual characteristics(GO:0046543) |
| 0.0 | 0.0 | GO:0015746 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
| 0.0 | 0.0 | GO:0006501 | C-terminal protein lipidation(GO:0006501) |
| 0.0 | 0.0 | GO:1901679 | nucleotide transmembrane transport(GO:1901679) |
| 0.0 | 0.0 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
| 0.0 | 0.1 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
| 0.0 | 0.0 | GO:0010796 | regulation of multivesicular body size(GO:0010796) |
| 0.0 | 0.2 | GO:0036075 | endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
| 0.0 | 0.0 | GO:0051088 | monocyte activation(GO:0042117) PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
| 0.0 | 0.2 | GO:0007205 | protein kinase C-activating G-protein coupled receptor signaling pathway(GO:0007205) |
| 0.0 | 0.7 | GO:0031532 | actin cytoskeleton reorganization(GO:0031532) |
| 0.0 | 0.0 | GO:0048069 | eye pigmentation(GO:0048069) |
| 0.0 | 0.0 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 0.0 | 0.0 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
| 0.0 | 0.0 | GO:0061052 | negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
| 0.0 | 0.0 | GO:2001046 | positive regulation of integrin-mediated signaling pathway(GO:2001046) |
| 0.0 | 0.1 | GO:1904668 | positive regulation of ubiquitin protein ligase activity(GO:1904668) |
| 0.0 | 0.0 | GO:0007063 | regulation of sister chromatid cohesion(GO:0007063) |
| 0.0 | 0.0 | GO:0021570 | rhombomere 4 development(GO:0021570) |
| 0.0 | 0.0 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 0.0 | 0.0 | GO:0010166 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
| 0.0 | 0.2 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.0 | 0.0 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
| 0.0 | 0.2 | GO:0070873 | regulation of glycogen metabolic process(GO:0070873) |
| 0.0 | 0.0 | GO:0018992 | germ-line sex determination(GO:0018992) |
| 0.0 | 0.1 | GO:2001214 | positive regulation of vasculogenesis(GO:2001214) |
| 0.0 | 0.0 | GO:1904431 | positive regulation of t-circle formation(GO:1904431) |
| 0.0 | 0.0 | GO:0031947 | negative regulation of glucocorticoid metabolic process(GO:0031944) negative regulation of glucocorticoid biosynthetic process(GO:0031947) |
| 0.0 | 0.0 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
| 0.0 | 0.0 | GO:0035790 | platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
| 0.0 | 0.0 | GO:0046882 | negative regulation of follicle-stimulating hormone secretion(GO:0046882) |
| 0.0 | 0.0 | GO:0034080 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.0 | 0.1 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
| 0.0 | 0.1 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
| 0.0 | 0.1 | GO:0016056 | rhodopsin mediated signaling pathway(GO:0016056) |
| 0.0 | 0.0 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.0 | 0.0 | GO:0090383 | phagosome acidification(GO:0090383) |
| 0.0 | 0.0 | GO:0035404 | histone-serine phosphorylation(GO:0035404) |
| 0.0 | 0.0 | GO:1900112 | regulation of histone H3-K9 trimethylation(GO:1900112) |
| 0.0 | 0.1 | GO:0002281 | macrophage activation involved in immune response(GO:0002281) |
| 0.0 | 0.1 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.0 | 0.1 | GO:0043922 | negative regulation by host of viral transcription(GO:0043922) |
| 0.0 | 0.0 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
| 0.0 | 0.0 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
| 0.0 | 0.0 | GO:0008594 | photoreceptor cell morphogenesis(GO:0008594) |
| 0.0 | 0.1 | GO:0002082 | regulation of oxidative phosphorylation(GO:0002082) |
| 0.0 | 0.1 | GO:0045724 | positive regulation of cilium assembly(GO:0045724) |
| 0.0 | 0.0 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
| 0.0 | 0.1 | GO:0021930 | cell proliferation in external granule layer(GO:0021924) cerebellar granule cell precursor proliferation(GO:0021930) |
| 0.0 | 0.1 | GO:0030913 | paranodal junction assembly(GO:0030913) |
| 0.0 | 0.3 | GO:0048041 | cell-substrate adherens junction assembly(GO:0007045) focal adhesion assembly(GO:0048041) |
| 0.0 | 0.0 | GO:1903391 | regulation of adherens junction organization(GO:1903391) |
| 0.0 | 0.1 | GO:0050884 | neuromuscular process controlling posture(GO:0050884) |
| 0.0 | 0.2 | GO:0032781 | positive regulation of ATPase activity(GO:0032781) |
| 0.0 | 0.1 | GO:0097120 | receptor localization to synapse(GO:0097120) |
| 0.0 | 0.0 | GO:0001781 | neutrophil apoptotic process(GO:0001781) regulation of neutrophil apoptotic process(GO:0033029) negative regulation of neutrophil apoptotic process(GO:0033030) |
| 0.0 | 0.1 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.0 | 0.0 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.8 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
| 0.2 | 0.6 | GO:0035061 | interchromatin granule(GO:0035061) |
| 0.2 | 0.7 | GO:0016942 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
| 0.2 | 0.7 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.1 | 0.4 | GO:0097443 | sorting endosome(GO:0097443) |
| 0.1 | 0.9 | GO:0005577 | fibrinogen complex(GO:0005577) |
| 0.1 | 0.4 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
| 0.1 | 0.3 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
| 0.1 | 0.4 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.1 | 0.3 | GO:0031084 | BLOC-2 complex(GO:0031084) |
| 0.1 | 0.8 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.1 | 0.4 | GO:0031258 | lamellipodium membrane(GO:0031258) |
| 0.1 | 0.3 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.1 | 0.1 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
| 0.1 | 0.3 | GO:0016461 | unconventional myosin complex(GO:0016461) |
| 0.1 | 0.3 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.1 | 0.2 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
| 0.0 | 0.1 | GO:0035189 | Rb-E2F complex(GO:0035189) |
| 0.0 | 0.1 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
| 0.0 | 0.3 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
| 0.0 | 0.4 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
| 0.0 | 0.1 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
| 0.0 | 0.2 | GO:0071141 | SMAD protein complex(GO:0071141) |
| 0.0 | 0.2 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.0 | 0.2 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
| 0.0 | 0.1 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
| 0.0 | 0.1 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.0 | 0.2 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.0 | 0.2 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.0 | 0.1 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.0 | 0.1 | GO:0000125 | PCAF complex(GO:0000125) |
| 0.0 | 0.1 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
| 0.0 | 0.2 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.0 | 0.1 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
| 0.0 | 0.1 | GO:1990246 | uniplex complex(GO:1990246) |
| 0.0 | 0.1 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.0 | 0.6 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.0 | 0.1 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.0 | 0.2 | GO:0016012 | sarcoglycan complex(GO:0016012) |
| 0.0 | 0.1 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
| 0.0 | 0.1 | GO:0042627 | chylomicron(GO:0042627) |
| 0.0 | 0.2 | GO:0032584 | growth cone membrane(GO:0032584) |
| 0.0 | 0.3 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
| 0.0 | 0.2 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
| 0.0 | 0.1 | GO:0071953 | elastic fiber(GO:0071953) |
| 0.0 | 0.3 | GO:0000145 | exocyst(GO:0000145) |
| 0.0 | 0.3 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
| 0.0 | 0.1 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
| 0.0 | 0.1 | GO:0005683 | U7 snRNP(GO:0005683) |
| 0.0 | 0.1 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
| 0.0 | 0.1 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 0.0 | 0.1 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.0 | 0.3 | GO:0033391 | chromatoid body(GO:0033391) |
| 0.0 | 0.1 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.0 | 0.1 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
| 0.0 | 0.0 | GO:0032127 | dense core granule membrane(GO:0032127) |
| 0.0 | 0.1 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
| 0.0 | 0.1 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
| 0.0 | 0.1 | GO:0032437 | cuticular plate(GO:0032437) |
| 0.0 | 0.1 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
| 0.0 | 0.1 | GO:0005883 | neurofilament(GO:0005883) |
| 0.0 | 0.1 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.0 | 0.5 | GO:0016235 | aggresome(GO:0016235) |
| 0.0 | 0.1 | GO:0097651 | phosphatidylinositol 3-kinase complex, class I(GO:0097651) |
| 0.0 | 0.1 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.0 | 0.2 | GO:0030663 | COPI-coated vesicle membrane(GO:0030663) |
| 0.0 | 0.1 | GO:0070820 | tertiary granule(GO:0070820) |
| 0.0 | 0.1 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
| 0.0 | 0.1 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.0 | 0.5 | GO:0005720 | nuclear heterochromatin(GO:0005720) |
| 0.0 | 0.1 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
| 0.0 | 0.1 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
| 0.0 | 0.1 | GO:0043083 | synaptic cleft(GO:0043083) |
| 0.0 | 0.1 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
| 0.0 | 0.4 | GO:0055038 | recycling endosome membrane(GO:0055038) |
| 0.0 | 0.0 | GO:0097452 | GAIT complex(GO:0097452) |
| 0.0 | 0.0 | GO:0097425 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
| 0.0 | 0.3 | GO:0030057 | desmosome(GO:0030057) |
| 0.0 | 0.2 | GO:0090533 | cation-transporting ATPase complex(GO:0090533) |
| 0.0 | 0.1 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
| 0.0 | 0.0 | GO:0055087 | Ski complex(GO:0055087) |
| 0.0 | 0.3 | GO:0002102 | podosome(GO:0002102) |
| 0.0 | 0.1 | GO:0000805 | X chromosome(GO:0000805) |
| 0.0 | 0.1 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
| 0.0 | 0.1 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
| 0.0 | 0.1 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
| 0.0 | 0.2 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
| 0.0 | 0.1 | GO:0031502 | dolichyl-phosphate-mannose-protein mannosyltransferase complex(GO:0031502) |
| 0.0 | 0.1 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
| 0.0 | 0.1 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 0.0 | 0.2 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
| 0.0 | 0.6 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
| 0.0 | 0.1 | GO:0072487 | MSL complex(GO:0072487) |
| 0.0 | 0.2 | GO:0000242 | pericentriolar material(GO:0000242) |
| 0.0 | 0.1 | GO:0017119 | Golgi transport complex(GO:0017119) |
| 0.0 | 0.1 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.0 | 0.5 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.0 | 0.1 | GO:0043194 | axon initial segment(GO:0043194) |
| 0.0 | 0.1 | GO:0042101 | T cell receptor complex(GO:0042101) |
| 0.0 | 0.0 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
| 0.0 | 0.1 | GO:0022624 | proteasome accessory complex(GO:0022624) |
| 0.0 | 0.1 | GO:0097539 | ciliary transition fiber(GO:0097539) |
| 0.0 | 0.0 | GO:1990923 | PET complex(GO:1990923) |
| 0.0 | 0.1 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
| 0.0 | 0.0 | GO:0005879 | axonemal microtubule(GO:0005879) |
| 0.0 | 0.0 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
| 0.0 | 0.1 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
| 0.0 | 0.5 | GO:0030864 | cortical actin cytoskeleton(GO:0030864) |
| 0.0 | 0.0 | GO:0071797 | LUBAC complex(GO:0071797) |
| 0.0 | 0.8 | GO:0005791 | rough endoplasmic reticulum(GO:0005791) |
| 0.0 | 0.4 | GO:0005844 | polysome(GO:0005844) |
| 0.0 | 0.1 | GO:0060091 | kinocilium(GO:0060091) |
| 0.0 | 0.0 | GO:0005610 | laminin-5 complex(GO:0005610) |
| 0.0 | 0.1 | GO:0045275 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
| 0.0 | 0.0 | GO:0044354 | pinosome(GO:0044352) macropinosome(GO:0044354) |
| 0.0 | 0.1 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
| 0.0 | 0.0 | GO:0070545 | PeBoW complex(GO:0070545) |
| 0.0 | 0.4 | GO:0031985 | Golgi cisterna(GO:0031985) |
| 0.0 | 0.0 | GO:0044326 | dendritic spine neck(GO:0044326) |
| 0.0 | 0.0 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.0 | 0.2 | GO:0005782 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 0.8 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
| 0.2 | 0.7 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
| 0.2 | 0.5 | GO:0008506 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.2 | 0.5 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
| 0.1 | 0.4 | GO:0004103 | choline kinase activity(GO:0004103) |
| 0.1 | 0.3 | GO:0050692 | DBD domain binding(GO:0050692) |
| 0.1 | 0.3 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
| 0.1 | 0.3 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
| 0.1 | 0.4 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
| 0.1 | 0.3 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
| 0.1 | 0.5 | GO:0000099 | sulfur amino acid transmembrane transporter activity(GO:0000099) |
| 0.1 | 0.7 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
| 0.1 | 0.5 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
| 0.1 | 0.6 | GO:0008297 | single-stranded DNA exodeoxyribonuclease activity(GO:0008297) |
| 0.1 | 0.4 | GO:0051425 | PTB domain binding(GO:0051425) |
| 0.1 | 0.3 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
| 0.1 | 0.5 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 0.1 | 0.4 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
| 0.1 | 0.4 | GO:0030151 | molybdenum ion binding(GO:0030151) |
| 0.1 | 0.1 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
| 0.1 | 0.2 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
| 0.1 | 0.5 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.1 | 0.2 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
| 0.1 | 0.3 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| 0.1 | 0.6 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.1 | 0.2 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
| 0.1 | 0.3 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
| 0.1 | 0.2 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
| 0.1 | 0.4 | GO:0001727 | lipid kinase activity(GO:0001727) |
| 0.1 | 0.3 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.1 | 0.6 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
| 0.1 | 0.2 | GO:0043842 | Kdo transferase activity(GO:0043842) |
| 0.1 | 0.5 | GO:0031386 | protein tag(GO:0031386) |
| 0.1 | 0.4 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.0 | 0.2 | GO:0015189 | arginine transmembrane transporter activity(GO:0015181) L-lysine transmembrane transporter activity(GO:0015189) |
| 0.0 | 0.1 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
| 0.0 | 0.4 | GO:0015321 | sodium-dependent phosphate transmembrane transporter activity(GO:0015321) |
| 0.0 | 0.2 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 0.0 | 0.2 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 0.0 | 0.1 | GO:0019862 | IgA binding(GO:0019862) |
| 0.0 | 0.2 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
| 0.0 | 0.5 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
| 0.0 | 0.3 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.0 | 0.2 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
| 0.0 | 0.1 | GO:0045340 | mercury ion binding(GO:0045340) |
| 0.0 | 0.3 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.0 | 0.3 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
| 0.0 | 0.2 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
| 0.0 | 0.3 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.0 | 0.1 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.0 | 0.2 | GO:0035473 | lipase binding(GO:0035473) |
| 0.0 | 0.3 | GO:0019763 | immunoglobulin receptor activity(GO:0019763) |
| 0.0 | 0.2 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
| 0.0 | 0.2 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
| 0.0 | 0.2 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
| 0.0 | 0.1 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
| 0.0 | 0.1 | GO:0045503 | dynein light chain binding(GO:0045503) |
| 0.0 | 0.6 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
| 0.0 | 0.2 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
| 0.0 | 0.2 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
| 0.0 | 0.2 | GO:0102336 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.0 | 0.1 | GO:0004346 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
| 0.0 | 0.2 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
| 0.0 | 0.3 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
| 0.0 | 0.2 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) |
| 0.0 | 0.2 | GO:0008390 | testosterone 16-alpha-hydroxylase activity(GO:0008390) |
| 0.0 | 0.1 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.0 | 0.2 | GO:0047391 | alkylglycerophosphoethanolamine phosphodiesterase activity(GO:0047391) |
| 0.0 | 0.3 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
| 0.0 | 0.1 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
| 0.0 | 0.1 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 0.0 | 0.1 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 0.0 | 0.1 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
| 0.0 | 0.0 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
| 0.0 | 0.1 | GO:0015226 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
| 0.0 | 0.5 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
| 0.0 | 0.1 | GO:0098748 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
| 0.0 | 0.1 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
| 0.0 | 0.3 | GO:0048185 | activin binding(GO:0048185) |
| 0.0 | 0.2 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
| 0.0 | 0.1 | GO:0047105 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
| 0.0 | 0.1 | GO:0071209 | U7 snRNA binding(GO:0071209) |
| 0.0 | 0.1 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.0 | 0.3 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.0 | 0.1 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
| 0.0 | 0.1 | GO:0016530 | metallochaperone activity(GO:0016530) |
| 0.0 | 0.1 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
| 0.0 | 0.5 | GO:0017025 | TBP-class protein binding(GO:0017025) |
| 0.0 | 0.1 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
| 0.0 | 0.1 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
| 0.0 | 0.2 | GO:0019865 | immunoglobulin binding(GO:0019865) |
| 0.0 | 0.2 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
| 0.0 | 0.1 | GO:0030984 | kininogen binding(GO:0030984) |
| 0.0 | 0.1 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
| 0.0 | 0.2 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
| 0.0 | 0.1 | GO:0003933 | GTP cyclohydrolase activity(GO:0003933) |
| 0.0 | 0.1 | GO:0071253 | connexin binding(GO:0071253) |
| 0.0 | 0.3 | GO:0003993 | acid phosphatase activity(GO:0003993) |
| 0.0 | 0.1 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
| 0.0 | 0.1 | GO:0019961 | interferon binding(GO:0019961) |
| 0.0 | 0.1 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
| 0.0 | 0.1 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
| 0.0 | 0.8 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
| 0.0 | 0.1 | GO:0004854 | xanthine dehydrogenase activity(GO:0004854) oxidoreductase activity, acting on CH or CH2 groups, NAD or NADP as acceptor(GO:0016726) |
| 0.0 | 0.1 | GO:0031720 | haptoglobin binding(GO:0031720) |
| 0.0 | 0.2 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
| 0.0 | 0.1 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
| 0.0 | 0.1 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
| 0.0 | 0.0 | GO:0032452 | histone demethylase activity(GO:0032452) |
| 0.0 | 0.3 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.0 | 0.1 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
| 0.0 | 0.0 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
| 0.0 | 0.1 | GO:0005534 | galactose binding(GO:0005534) |
| 0.0 | 0.5 | GO:0008483 | transaminase activity(GO:0008483) |
| 0.0 | 0.5 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.0 | 0.1 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.0 | 0.1 | GO:0005290 | L-histidine transmembrane transporter activity(GO:0005290) |
| 0.0 | 0.1 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
| 0.0 | 0.1 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
| 0.0 | 0.1 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
| 0.0 | 0.1 | GO:1990715 | mRNA CDS binding(GO:1990715) |
| 0.0 | 0.1 | GO:0016018 | cyclosporin A binding(GO:0016018) |
| 0.0 | 0.4 | GO:0090484 | drug transporter activity(GO:0090484) |
| 0.0 | 0.3 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
| 0.0 | 0.1 | GO:0034902 | alkyl sulfatase activity(GO:0018741) endosulfan hemisulfate sulfatase activity(GO:0034889) endosulfan sulfate hydrolase activity(GO:0034902) |
| 0.0 | 0.1 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
| 0.0 | 0.2 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
| 0.0 | 0.1 | GO:0008020 | G-protein coupled photoreceptor activity(GO:0008020) |
| 0.0 | 0.1 | GO:0004457 | lactate dehydrogenase activity(GO:0004457) |
| 0.0 | 0.1 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
| 0.0 | 0.3 | GO:0004622 | lysophospholipase activity(GO:0004622) |
| 0.0 | 0.1 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
| 0.0 | 0.2 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
| 0.0 | 0.1 | GO:0008808 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) |
| 0.0 | 0.4 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.0 | 0.1 | GO:0019808 | polyamine binding(GO:0019808) |
| 0.0 | 0.1 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
| 0.0 | 0.1 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
| 0.0 | 0.2 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
| 0.0 | 0.2 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
| 0.0 | 0.5 | GO:0000907 | sulfonate dioxygenase activity(GO:0000907) 2,4-dichlorophenoxyacetate alpha-ketoglutarate dioxygenase activity(GO:0018602) hypophosphite dioxygenase activity(GO:0034792) gibberellin 2-beta-dioxygenase activity(GO:0045543) C-19 gibberellin 2-beta-dioxygenase activity(GO:0052634) C-20 gibberellin 2-beta-dioxygenase activity(GO:0052635) |
| 0.0 | 0.3 | GO:0001671 | ATPase activator activity(GO:0001671) |
| 0.0 | 0.1 | GO:0019238 | cyclohydrolase activity(GO:0019238) |
| 0.0 | 0.1 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
| 0.0 | 0.1 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.0 | 0.0 | GO:0005024 | transforming growth factor beta-activated receptor activity(GO:0005024) |
| 0.0 | 0.1 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
| 0.0 | 0.2 | GO:0004017 | adenylate kinase activity(GO:0004017) |
| 0.0 | 0.1 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
| 0.0 | 0.2 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
| 0.0 | 0.1 | GO:0052833 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
| 0.0 | 0.3 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
| 0.0 | 0.3 | GO:0016638 | oxidoreductase activity, acting on the CH-NH2 group of donors(GO:0016638) |
| 0.0 | 0.3 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 0.0 | 0.1 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
| 0.0 | 0.1 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
| 0.0 | 0.1 | GO:0070411 | I-SMAD binding(GO:0070411) |
| 0.0 | 0.1 | GO:0008502 | melatonin receptor activity(GO:0008502) |
| 0.0 | 0.2 | GO:0031402 | sodium ion binding(GO:0031402) |
| 0.0 | 0.0 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) |
| 0.0 | 0.1 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
| 0.0 | 0.1 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
| 0.0 | 0.1 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
| 0.0 | 0.1 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.0 | 0.2 | GO:0015106 | bicarbonate transmembrane transporter activity(GO:0015106) |
| 0.0 | 0.0 | GO:2001070 | starch binding(GO:2001070) |
| 0.0 | 0.0 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
| 0.0 | 0.0 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
| 0.0 | 0.0 | GO:0047751 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) cholestenone 5-alpha-reductase activity(GO:0047751) |
| 0.0 | 0.0 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 0.0 | 0.1 | GO:1990254 | keratin filament binding(GO:1990254) |
| 0.0 | 0.0 | GO:0043891 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
| 0.0 | 0.1 | GO:0050897 | cobalt ion binding(GO:0050897) |
| 0.0 | 0.2 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
| 0.0 | 0.1 | GO:0019215 | intermediate filament binding(GO:0019215) |
| 0.0 | 0.1 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 0.0 | 0.1 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.0 | 0.1 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.0 | 0.0 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
| 0.0 | 0.1 | GO:0003988 | acetyl-CoA C-acyltransferase activity(GO:0003988) |
| 0.0 | 0.1 | GO:0019201 | nucleotide kinase activity(GO:0019201) |
| 0.0 | 0.2 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.0 | 0.1 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) |
| 0.0 | 0.0 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.0 | 0.1 | GO:0031849 | olfactory receptor binding(GO:0031849) |
| 0.0 | 0.3 | GO:0034596 | phosphatidylinositol phosphate 4-phosphatase activity(GO:0034596) |
| 0.0 | 0.0 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
| 0.0 | 0.2 | GO:0017160 | Ral GTPase binding(GO:0017160) |
| 0.0 | 0.0 | GO:0046573 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
| 0.0 | 0.0 | GO:0001224 | RNA polymerase II transcription cofactor binding(GO:0001224) |
| 0.0 | 0.5 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
| 0.0 | 0.2 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
| 0.0 | 0.4 | GO:0046875 | ephrin receptor binding(GO:0046875) |
| 0.0 | 0.1 | GO:0018642 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
| 0.0 | 0.0 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
| 0.0 | 0.2 | GO:0015026 | coreceptor activity(GO:0015026) |
| 0.0 | 0.1 | GO:0008193 | tRNA guanylyltransferase activity(GO:0008193) |
| 0.0 | 0.2 | GO:0016662 | oxidoreductase activity, acting on other nitrogenous compounds as donors, cytochrome as acceptor(GO:0016662) |
| 0.0 | 0.0 | GO:0036033 | mediator complex binding(GO:0036033) |
| 0.0 | 0.3 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
| 0.0 | 0.1 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
| 0.0 | 0.1 | GO:0031994 | insulin-like growth factor I binding(GO:0031994) |
| 0.0 | 0.1 | GO:0070728 | leucine binding(GO:0070728) |
| 0.0 | 0.0 | GO:0038100 | nodal binding(GO:0038100) |
| 0.0 | 0.1 | GO:0030492 | hemoglobin binding(GO:0030492) |
| 0.0 | 0.1 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
| 0.0 | 0.0 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
| 0.0 | 0.1 | GO:0003997 | acyl-CoA oxidase activity(GO:0003997) |
| 0.0 | 0.2 | GO:0031418 | L-ascorbic acid binding(GO:0031418) |
| 0.0 | 0.1 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
| 0.0 | 0.1 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
| 0.0 | 0.3 | GO:0045296 | cadherin binding(GO:0045296) |
| 0.0 | 0.2 | GO:0003995 | acyl-CoA dehydrogenase activity(GO:0003995) |
| 0.0 | 0.0 | GO:0004967 | glucagon receptor activity(GO:0004967) |
| 0.0 | 0.2 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
| 0.0 | 0.1 | GO:0018685 | alkane 1-monooxygenase activity(GO:0018685) |
| 0.0 | 0.1 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
| 0.0 | 0.0 | GO:0019002 | GMP binding(GO:0019002) |
| 0.0 | 0.0 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
| 0.0 | 0.1 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
| 0.0 | 0.0 | GO:0003840 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
| 0.0 | 0.3 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.0 | 0.0 | GO:0004966 | galanin receptor activity(GO:0004966) |
| 0.0 | 0.1 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.0 | 0.1 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.0 | 0.1 | GO:0030881 | beta-2-microglobulin binding(GO:0030881) |
| 0.0 | 0.0 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
| 0.0 | 0.0 | GO:0043426 | MRF binding(GO:0043426) |
| 0.0 | 0.1 | GO:0050649 | testosterone 6-beta-hydroxylase activity(GO:0050649) |
| 0.0 | 0.1 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.0 | 0.1 | GO:0032041 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
| 0.0 | 0.1 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 0.0 | 0.0 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.0 | 0.0 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
| 0.0 | 0.0 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
| 0.0 | 0.4 | GO:0031593 | polyubiquitin binding(GO:0031593) |
| 0.0 | 0.0 | GO:0070996 | type 1 melanocortin receptor binding(GO:0070996) |
| 0.0 | 0.0 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.0 | 0.1 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
| 0.0 | 0.2 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
| 0.0 | 0.1 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
| 0.0 | 0.0 | GO:0050816 | phosphothreonine binding(GO:0050816) |
| 0.0 | 0.1 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
| 0.0 | 0.0 | GO:0033677 | DNA/RNA helicase activity(GO:0033677) |
| 0.0 | 0.1 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.0 | 0.1 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.0 | 0.4 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
| 0.0 | 0.1 | GO:0015491 | cation:cation antiporter activity(GO:0015491) |
| 0.0 | 0.0 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
| 0.0 | 0.0 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
| 0.0 | 0.1 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
| 0.0 | 0.0 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
| 0.0 | 0.0 | GO:1901612 | cardiolipin binding(GO:1901612) |
| 0.0 | 0.0 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
| 0.0 | 0.2 | GO:0016702 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of two atoms of oxygen(GO:0016702) |
| 0.0 | 0.1 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.0 | 0.4 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.0 | 0.1 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.0 | 0.3 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.0 | 0.7 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
| 0.0 | 0.3 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.0 | 0.7 | PID IGF1 PATHWAY | IGF1 pathway |
| 0.0 | 0.0 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
| 0.0 | 0.0 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.0 | 0.9 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
| 0.0 | 0.3 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.0 | 0.1 | ST STAT3 PATHWAY | STAT3 Pathway |
| 0.0 | 0.2 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
| 0.0 | 0.1 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
| 0.0 | 0.4 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
| 0.0 | 0.4 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
| 0.0 | 0.1 | PID FGF PATHWAY | FGF signaling pathway |
| 0.0 | 0.3 | PID MYC PATHWAY | C-MYC pathway |
| 0.0 | 0.7 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 0.0 | 0.2 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.0 | 0.3 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.0 | 0.0 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
| 0.0 | 0.2 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.0 | 0.4 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
| 0.0 | 0.5 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
| 0.0 | 0.3 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
| 0.0 | 0.1 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.0 | 0.1 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
| 0.0 | 0.1 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
| 0.0 | 0.2 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.0 | 0.4 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.0 | 0.2 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
| 0.0 | 0.1 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 0.0 | 0.2 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
| 0.0 | 0.2 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.0 | 0.4 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
| 0.0 | 0.2 | PID ATM PATHWAY | ATM pathway |
| 0.0 | 0.1 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
| 0.0 | 0.4 | PID CDC42 PATHWAY | CDC42 signaling events |
| 0.0 | 0.1 | PID ENDOTHELIN PATHWAY | Endothelins |
| 0.0 | 0.1 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 0.0 | 0.3 | PID ATR PATHWAY | ATR signaling pathway |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 0.9 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
| 0.1 | 0.7 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.1 | 0.2 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
| 0.1 | 0.5 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.0 | 1.1 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
| 0.0 | 0.9 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
| 0.0 | 0.1 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
| 0.0 | 0.0 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
| 0.0 | 0.8 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 0.0 | 0.2 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
| 0.0 | 0.8 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.0 | 0.2 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.0 | 0.5 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.0 | 0.1 | REACTOME REGULATION OF MRNA STABILITY BY PROTEINS THAT BIND AU RICH ELEMENTS | Genes involved in Regulation of mRNA Stability by Proteins that Bind AU-rich Elements |
| 0.0 | 0.1 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
| 0.0 | 0.6 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
| 0.0 | 0.7 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
| 0.0 | 0.3 | REACTOME TRAF6 MEDIATED INDUCTION OF TAK1 COMPLEX | Genes involved in TRAF6 mediated induction of TAK1 complex |
| 0.0 | 0.3 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.0 | 0.7 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.0 | 0.3 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
| 0.0 | 0.5 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.0 | 0.3 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
| 0.0 | 0.4 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF CYCLIN B | Genes involved in APC/C:Cdc20 mediated degradation of Cyclin B |
| 0.0 | 0.3 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
| 0.0 | 0.1 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.0 | 0.2 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
| 0.0 | 0.3 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.0 | 0.3 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
| 0.0 | 0.2 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
| 0.0 | 0.6 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
| 0.0 | 0.1 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.0 | 0.3 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
| 0.0 | 0.1 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
| 0.0 | 0.1 | REACTOME OPSINS | Genes involved in Opsins |
| 0.0 | 0.2 | REACTOME ADENYLATE CYCLASE ACTIVATING PATHWAY | Genes involved in Adenylate cyclase activating pathway |
| 0.0 | 0.0 | REACTOME P53 DEPENDENT G1 DNA DAMAGE RESPONSE | Genes involved in p53-Dependent G1 DNA Damage Response |
| 0.0 | 0.1 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
| 0.0 | 0.1 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
| 0.0 | 0.1 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
| 0.0 | 0.2 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.0 | 0.1 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.0 | 0.0 | REACTOME P53 INDEPENDENT G1 S DNA DAMAGE CHECKPOINT | Genes involved in p53-Independent G1/S DNA damage checkpoint |
| 0.0 | 0.2 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
| 0.0 | 0.1 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.0 | 0.0 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
| 0.0 | 0.0 | REACTOME SCFSKP2 MEDIATED DEGRADATION OF P27 P21 | Genes involved in SCF(Skp2)-mediated degradation of p27/p21 |
| 0.0 | 0.3 | REACTOME TRANSPORT OF MATURE TRANSCRIPT TO CYTOPLASM | Genes involved in Transport of Mature Transcript to Cytoplasm |
| 0.0 | 0.3 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 0.0 | 0.5 | REACTOME IL 2 SIGNALING | Genes involved in Interleukin-2 signaling |
| 0.0 | 0.2 | REACTOME REPAIR SYNTHESIS FOR GAP FILLING BY DNA POL IN TC NER | Genes involved in Repair synthesis for gap-filling by DNA polymerase in TC-NER |
| 0.0 | 0.2 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
| 0.0 | 0.1 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
| 0.0 | 0.1 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
| 0.0 | 0.5 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 0.0 | 0.1 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.0 | 0.1 | REACTOME ACYL CHAIN REMODELLING OF PE | Genes involved in Acyl chain remodelling of PE |