Gene Symbol | Gene ID | Gene Info |
---|---|---|
Nfatc2
|
ENSMUSG00000027544.10 | Nfatc2 |
Gene | Promoter | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Nfatc2 | chr2_168541333_168541507 | 10856 | 0.242740 | 0.70 | 1.2e-01 | Click! |
Nfatc2 | chr2_168524880_168525160 | 27256 | 0.200599 | -0.58 | 2.2e-01 | Click! |
Nfatc2 | chr2_168532141_168532299 | 20056 | 0.220017 | -0.45 | 3.7e-01 | Click! |
Nfatc2 | chr2_168518274_168518450 | 33914 | 0.181468 | -0.37 | 4.7e-01 | Click! |
Nfatc2 | chr2_168587297_168587448 | 2819 | 0.312861 | -0.35 | 4.9e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr12_104088559_104088873 | 3.07 |
Serpina4-ps1 |
serine (or cysteine) peptidase inhibitor, clade A, member 4, pseudogene 1 |
8067 |
0.1 |
chr17_46439501_46439689 | 2.29 |
Gm5093 |
predicted gene 5093 |
502 |
0.57 |
chr7_97411671_97412103 | 2.13 |
Thrsp |
thyroid hormone responsive |
5632 |
0.13 |
chrY_90740044_90740606 | 2.12 |
Mid1-ps1 |
midline 1, pseudogene 1 |
12732 |
0.18 |
chr5_149616281_149616432 | 1.73 |
Hsph1 |
heat shock 105kDa/110kDa protein 1 |
2817 |
0.21 |
chr8_9501766_9501947 | 1.68 |
4930435N07Rik |
RIKEN cDNA 4930435N07 gene |
42764 |
0.13 |
chr11_101342858_101343022 | 1.52 |
Gm28156 |
predicted gene 28156 |
4999 |
0.06 |
chr18_33437665_33437816 | 1.51 |
Nrep |
neuronal regeneration related protein |
25695 |
0.18 |
chr12_104084891_104085073 | 1.51 |
Serpina4-ps1 |
serine (or cysteine) peptidase inhibitor, clade A, member 4, pseudogene 1 |
4333 |
0.12 |
chr16_41161594_41161767 | 1.48 |
Gm26381 |
predicted gene, 26381 |
56065 |
0.15 |
chr11_16856758_16857153 | 1.43 |
Egfr |
epidermal growth factor receptor |
21195 |
0.18 |
chr19_40146515_40146666 | 1.39 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
40696 |
0.11 |
chr7_26951142_26951507 | 1.37 |
Cyp2a22 |
cytochrome P450, family 2, subfamily a, polypeptide 22 |
11940 |
0.14 |
chr12_103991999_103992602 | 1.34 |
Serpina11 |
serine (or cysteine) peptidase inhibitor, clade A (alpha-1 antiproteinase, antitrypsin), member 11 |
2343 |
0.16 |
chr17_83069993_83070341 | 1.24 |
Gm29052 |
predicted gene 29052 |
1262 |
0.48 |
chr9_74881023_74881569 | 1.22 |
Onecut1 |
one cut domain, family member 1 |
14812 |
0.15 |
chr9_74891211_74891440 | 1.20 |
Onecut1 |
one cut domain, family member 1 |
24841 |
0.14 |
chr12_104342354_104343298 | 1.19 |
Serpina3k |
serine (or cysteine) peptidase inhibitor, clade A, member 3K |
4340 |
0.13 |
chr2_8123996_8124147 | 1.18 |
Gm13254 |
predicted gene 13254 |
23794 |
0.29 |
chr11_16828832_16828991 | 1.18 |
Egfros |
epidermal growth factor receptor, opposite strand |
1791 |
0.4 |
chr17_6959037_6959229 | 1.17 |
Tagap1 |
T cell activation GTPase activating protein 1 |
2023 |
0.21 |
chr13_16574847_16575001 | 1.17 |
Gm48497 |
predicted gene, 48497 |
41103 |
0.17 |
chr11_111269853_111270023 | 1.16 |
Gm11675 |
predicted gene 11675 |
6162 |
0.34 |
chr1_73036643_73036816 | 1.13 |
1700027A15Rik |
RIKEN cDNA 1700027A15 gene |
12160 |
0.22 |
chr16_87627804_87628113 | 1.12 |
Gm22808 |
predicted gene, 22808 |
6838 |
0.21 |
chr4_35916085_35916245 | 1.12 |
Lingo2 |
leucine rich repeat and Ig domain containing 2 |
70961 |
0.13 |
chr19_40174636_40174787 | 1.12 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
12575 |
0.15 |
chr10_91321221_91321411 | 1.11 |
Gm47082 |
predicted gene, 47082 |
10971 |
0.22 |
chr7_121802332_121802546 | 1.10 |
Gm44740 |
predicted gene 44740 |
36626 |
0.13 |
chr9_74888354_74888522 | 1.10 |
Onecut1 |
one cut domain, family member 1 |
21954 |
0.14 |
chr18_7657901_7658087 | 1.10 |
Mpp7 |
membrane protein, palmitoylated 7 (MAGUK p55 subfamily member 7) |
31128 |
0.17 |
chr13_31511172_31511336 | 1.09 |
Foxq1 |
forkhead box Q1 |
44880 |
0.1 |
chr1_186326005_186326156 | 1.08 |
Gm37491 |
predicted gene, 37491 |
21235 |
0.25 |
chr5_30551378_30551537 | 1.06 |
Cib4 |
calcium and integrin binding family member 4 |
5621 |
0.14 |
chr1_10156105_10156276 | 1.05 |
Arfgef1 |
ADP-ribosylation factor guanine nucleotide-exchange factor 1(brefeldin A-inhibited) |
1660 |
0.36 |
chr19_40174897_40175092 | 1.03 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
12292 |
0.15 |
chr8_127112512_127112692 | 1.02 |
Pard3 |
par-3 family cell polarity regulator |
39362 |
0.16 |
chr15_59195501_59195712 | 1.02 |
Rpl7-ps8 |
ribosomal protein L7, pseudogene 8 |
15302 |
0.19 |
chr10_4605740_4606032 | 1.02 |
Esr1 |
estrogen receptor 1 (alpha) |
5707 |
0.24 |
chr7_113935146_113935310 | 0.99 |
Gm45615 |
predicted gene 45615 |
151670 |
0.04 |
chr13_37790260_37790434 | 0.99 |
Gm46411 |
predicted gene, 46411 |
9443 |
0.15 |
chr2_42022610_42022815 | 0.99 |
Gm13461 |
predicted gene 13461 |
33883 |
0.23 |
chr12_104081605_104081762 | 0.98 |
Serpina4-ps1 |
serine (or cysteine) peptidase inhibitor, clade A, member 4, pseudogene 1 |
1034 |
0.36 |
chr19_26823384_26823535 | 0.97 |
4931403E22Rik |
RIKEN cDNA 4931403E22 gene |
448 |
0.84 |
chr11_16836119_16836554 | 0.95 |
Egfros |
epidermal growth factor receptor, opposite strand |
5634 |
0.23 |
chr1_88048809_88049389 | 0.94 |
Ugt1a10 |
UDP glycosyltransferase 1 family, polypeptide A10 |
6289 |
0.08 |
chr8_5030377_5030626 | 0.93 |
n-R5s93 |
nuclear encoded rRNA 5S 93 |
38876 |
0.14 |
chr3_116967695_116967849 | 0.93 |
4930455H04Rik |
RIKEN cDNA 4930455H04 gene |
495 |
0.62 |
chr6_93669779_93669930 | 0.92 |
Gm7812 |
predicted gene 7812 |
19629 |
0.25 |
chr7_28322083_28322289 | 0.92 |
Supt5 |
suppressor of Ty 5, DSIF elongation factor subunit |
3394 |
0.1 |
chr14_103463834_103464050 | 0.91 |
Gm34907 |
predicted gene, 34907 |
23 |
0.98 |
chr6_127325112_127325283 | 0.91 |
Gm42458 |
predicted gene 42458 |
660 |
0.6 |
chr14_76800394_76800719 | 0.90 |
Gm30246 |
predicted gene, 30246 |
19729 |
0.17 |
chr18_7657709_7657860 | 0.90 |
Mpp7 |
membrane protein, palmitoylated 7 (MAGUK p55 subfamily member 7) |
30918 |
0.17 |
chr11_120813788_120814608 | 0.89 |
Fasn |
fatty acid synthase |
1257 |
0.26 |
chr1_186358132_186358570 | 0.89 |
Gm37491 |
predicted gene, 37491 |
11036 |
0.28 |
chr19_44405361_44405580 | 0.89 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
1220 |
0.39 |
chr11_16589377_16589551 | 0.88 |
Gm12663 |
predicted gene 12663 |
46602 |
0.12 |
chr3_18137155_18137306 | 0.88 |
Gm23686 |
predicted gene, 23686 |
40395 |
0.15 |
chr19_44399974_44400175 | 0.87 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
6616 |
0.15 |
chr6_38769722_38769895 | 0.87 |
Hipk2 |
homeodomain interacting protein kinase 2 |
26548 |
0.2 |
chr10_75873468_75873620 | 0.85 |
Gm47744 |
predicted gene, 47744 |
1887 |
0.18 |
chr6_136954835_136955023 | 0.84 |
Pde6h |
phosphodiesterase 6H, cGMP-specific, cone, gamma |
396 |
0.8 |
chr3_138228669_138228867 | 0.84 |
Adh7 |
alcohol dehydrogenase 7 (class IV), mu or sigma polypeptide |
717 |
0.56 |
chr2_85351619_85351794 | 0.84 |
Olfr988 |
olfactory receptor 988 |
2294 |
0.18 |
chr2_35184678_35184843 | 0.84 |
Rab14 |
RAB14, member RAS oncogene family |
612 |
0.69 |
chr5_90469569_90469759 | 0.84 |
Alb |
albumin |
6964 |
0.16 |
chr11_120804472_120804662 | 0.84 |
Fasn |
fatty acid synthase |
4038 |
0.1 |
chr17_12722774_12722984 | 0.83 |
Airn |
antisense Igf2r RNA |
18432 |
0.13 |
chr5_63953993_63954144 | 0.83 |
Rell1 |
RELT-like 1 |
14755 |
0.15 |
chr11_16887041_16887459 | 0.83 |
Egfr |
epidermal growth factor receptor |
9100 |
0.2 |
chr4_122945294_122945445 | 0.82 |
Mfsd2a |
major facilitator superfamily domain containing 2A |
14621 |
0.13 |
chr13_46153447_46153609 | 0.81 |
Gm10113 |
predicted gene 10113 |
37518 |
0.19 |
chr18_12736344_12736565 | 0.81 |
Ttc39c |
tetratricopeptide repeat domain 39C |
1749 |
0.26 |
chr8_77477761_77477925 | 0.81 |
0610038B21Rik |
RIKEN cDNA 0610038B21 gene |
39213 |
0.12 |
chr1_50806813_50807031 | 0.80 |
Gm28321 |
predicted gene 28321 |
8453 |
0.28 |
chr5_43310353_43310569 | 0.80 |
Gm43020 |
predicted gene 43020 |
44798 |
0.11 |
chr14_86346221_86346400 | 0.79 |
Gm4350 |
predicted gene 4350 |
26025 |
0.13 |
chr5_150912722_150912905 | 0.79 |
Gm43298 |
predicted gene 43298 |
30171 |
0.16 |
chr11_120814981_120815132 | 0.79 |
Fasn |
fatty acid synthase |
399 |
0.71 |
chrX_151708292_151708443 | 0.79 |
Gm15151 |
predicted gene 15151 |
49826 |
0.09 |
chr9_74886698_74886917 | 0.79 |
Onecut1 |
one cut domain, family member 1 |
20323 |
0.14 |
chr8_33950546_33950701 | 0.78 |
Rbpms |
RNA binding protein gene with multiple splicing |
20760 |
0.14 |
chr2_112595326_112595515 | 0.78 |
Gm44374 |
predicted gene, 44374 |
18610 |
0.17 |
chr8_115830386_115830552 | 0.77 |
Maf |
avian musculoaponeurotic fibrosarcoma oncogene homolog |
122675 |
0.06 |
chr1_86885683_86885835 | 0.77 |
Gm38021 |
predicted gene, 38021 |
7814 |
0.11 |
chr9_74331308_74331508 | 0.77 |
Gm24141 |
predicted gene, 24141 |
31202 |
0.18 |
chr3_18156058_18156209 | 0.77 |
Gm23686 |
predicted gene, 23686 |
21492 |
0.21 |
chr13_80897093_80897522 | 0.77 |
Arrdc3 |
arrestin domain containing 3 |
6789 |
0.17 |
chr6_142451263_142451444 | 0.76 |
Gys2 |
glycogen synthase 2 |
21756 |
0.15 |
chr7_26838778_26838929 | 0.76 |
Cyp2a5 |
cytochrome P450, family 2, subfamily a, polypeptide 5 |
1615 |
0.34 |
chr2_42022364_42022535 | 0.76 |
Gm13461 |
predicted gene 13461 |
33620 |
0.23 |
chr4_65080374_65080537 | 0.76 |
Pappa |
pregnancy-associated plasma protein A |
43719 |
0.19 |
chr15_10200971_10201518 | 0.76 |
Prlr |
prolactin receptor |
12221 |
0.28 |
chr7_64400134_64400307 | 0.76 |
Mcee |
methylmalonyl CoA epimerase |
7445 |
0.15 |
chr11_16867245_16867846 | 0.75 |
Egfr |
epidermal growth factor receptor |
10605 |
0.2 |
chr11_16872158_16872405 | 0.75 |
Egfr |
epidermal growth factor receptor |
5869 |
0.22 |
chr19_37074801_37074963 | 0.75 |
Gm22714 |
predicted gene, 22714 |
74280 |
0.08 |
chr9_14045065_14045224 | 0.74 |
1700019J19Rik |
RIKEN cDNA 1700019J19 gene |
44476 |
0.14 |
chr4_103933550_103933744 | 0.74 |
Gm12719 |
predicted gene 12719 |
5894 |
0.25 |
chr2_177501179_177501579 | 0.74 |
Gm14403 |
predicted gene 14403 |
3064 |
0.22 |
chr1_67226033_67227036 | 0.74 |
Gm15668 |
predicted gene 15668 |
22666 |
0.2 |
chr11_11945884_11946107 | 0.73 |
Grb10 |
growth factor receptor bound protein 10 |
335 |
0.89 |
chr3_18133555_18133706 | 0.73 |
Gm23686 |
predicted gene, 23686 |
43995 |
0.14 |
chr5_81885152_81885330 | 0.73 |
2900064F13Rik |
RIKEN cDNA 2900064F13 gene |
58425 |
0.14 |
chr19_40181161_40181312 | 0.72 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
6050 |
0.17 |
chr19_39290932_39291221 | 0.72 |
Cyp2c29 |
cytochrome P450, family 2, subfamily c, polypeptide 29 |
4002 |
0.26 |
chr2_58783629_58783834 | 0.72 |
Upp2 |
uridine phosphorylase 2 |
18406 |
0.19 |
chr12_3647979_3648147 | 0.72 |
Dtnb |
dystrobrevin, beta |
15141 |
0.21 |
chr1_58945674_58946262 | 0.71 |
Trak2 |
trafficking protein, kinesin binding 2 |
369 |
0.84 |
chr16_43298296_43298498 | 0.71 |
Gm37946 |
predicted gene, 37946 |
9884 |
0.19 |
chr10_81412487_81412833 | 0.71 |
Gm16104 |
predicted gene 16104 |
3085 |
0.08 |
chr4_135649660_135649811 | 0.71 |
1700029M20Rik |
RIKEN cDNA 1700029M20 gene |
22482 |
0.13 |
chr4_63229865_63230144 | 0.70 |
Col27a1 |
collagen, type XXVII, alpha 1 |
4282 |
0.2 |
chr15_3476268_3476419 | 0.70 |
Ghr |
growth hormone receptor |
4699 |
0.32 |
chr5_25227061_25227222 | 0.70 |
E130116L18Rik |
RIKEN cDNA E130116L18 gene |
3988 |
0.18 |
chr19_40165502_40165757 | 0.70 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
21657 |
0.14 |
chr2_58763845_58764139 | 0.70 |
Upp2 |
uridine phosphorylase 2 |
1333 |
0.47 |
chr11_16817054_16817205 | 0.69 |
Egfros |
epidermal growth factor receptor, opposite strand |
13573 |
0.21 |
chr4_139585190_139585481 | 0.69 |
Gm25571 |
predicted gene, 25571 |
3642 |
0.18 |
chr10_31956696_31956848 | 0.68 |
Gm18189 |
predicted gene, 18189 |
16897 |
0.27 |
chr10_4605446_4605660 | 0.68 |
Esr1 |
estrogen receptor 1 (alpha) |
6040 |
0.23 |
chr9_121881807_121881992 | 0.68 |
Gm47113 |
predicted gene, 47113 |
12403 |
0.08 |
chr17_51543771_51543951 | 0.67 |
Gm31143 |
predicted gene, 31143 |
9003 |
0.25 |
chr5_33465411_33465562 | 0.67 |
Gm43851 |
predicted gene 43851 |
28022 |
0.15 |
chr4_63216606_63216811 | 0.67 |
Col27a1 |
collagen, type XXVII, alpha 1 |
1273 |
0.43 |
chr19_44394517_44394772 | 0.67 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
12046 |
0.14 |
chr15_62204050_62204201 | 0.67 |
Pvt1 |
Pvt1 oncogene |
14098 |
0.23 |
chr1_67132947_67133268 | 0.67 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
10081 |
0.24 |
chr2_58773911_58774203 | 0.66 |
Upp2 |
uridine phosphorylase 2 |
8732 |
0.21 |
chr19_4317291_4317502 | 0.66 |
Kdm2a |
lysine (K)-specific demethylase 2A |
5152 |
0.11 |
chr17_8167416_8167705 | 0.66 |
Fgfr1op |
Fgfr1 oncogene partner |
2020 |
0.26 |
chr3_129526989_129527140 | 0.66 |
Gm35986 |
predicted gene, 35986 |
5045 |
0.17 |
chr5_151018980_151019139 | 0.66 |
Gm8675 |
predicted gene 8675 |
9758 |
0.23 |
chr11_12296637_12296788 | 0.65 |
Gm12002 |
predicted gene 12002 |
17802 |
0.26 |
chr11_11946176_11946345 | 0.65 |
Grb10 |
growth factor receptor bound protein 10 |
70 |
0.98 |
chr4_105178541_105178692 | 0.65 |
Plpp3 |
phospholipid phosphatase 3 |
21269 |
0.25 |
chr19_21625734_21625885 | 0.65 |
1110059E24Rik |
RIKEN cDNA 1110059E24 gene |
4959 |
0.24 |
chr11_16767286_16767565 | 0.65 |
Egfr |
epidermal growth factor receptor |
15195 |
0.19 |
chr8_23031563_23031855 | 0.65 |
Ank1 |
ankyrin 1, erythroid |
3390 |
0.23 |
chr13_112902308_112902475 | 0.65 |
Mtrex |
Mtr4 exosome RNA helicase |
15283 |
0.12 |
chr12_104346326_104346873 | 0.65 |
Serpina3k |
serine (or cysteine) peptidase inhibitor, clade A, member 3K |
8113 |
0.12 |
chr6_52606460_52606970 | 0.65 |
Gm44434 |
predicted gene, 44434 |
3470 |
0.19 |
chrX_85734354_85734533 | 0.64 |
Gk |
glycerol kinase |
3167 |
0.2 |
chr11_6158649_6158802 | 0.64 |
Rps15a-ps6 |
ribosomal protein S15A, pseudogene 6 |
14311 |
0.13 |
chr8_93180612_93180763 | 0.64 |
Ces1d |
carboxylesterase 1D |
5398 |
0.15 |
chr3_94714166_94714364 | 0.64 |
Selenbp2 |
selenium binding protein 2 |
20606 |
0.1 |
chr15_89477983_89478134 | 0.64 |
C230037L18Rik |
RIKEN cDNA C230037L18 gene |
319 |
0.63 |
chr6_55171107_55171477 | 0.63 |
Inmt |
indolethylamine N-methyltransferase |
3722 |
0.2 |
chr2_160665583_160665820 | 0.63 |
Top1 |
topoisomerase (DNA) I |
4432 |
0.21 |
chr2_58786565_58786718 | 0.63 |
Upp2 |
uridine phosphorylase 2 |
21316 |
0.19 |
chr15_7135984_7136307 | 0.63 |
Lifr |
LIF receptor alpha |
4397 |
0.32 |
chr3_10022522_10022722 | 0.63 |
Gm38335 |
predicted gene, 38335 |
2917 |
0.22 |
chr3_152762447_152762598 | 0.62 |
Pigk |
phosphatidylinositol glycan anchor biosynthesis, class K |
859 |
0.63 |
chr4_122935638_122935854 | 0.62 |
Gm12891 |
predicted gene 12891 |
9913 |
0.14 |
chr19_44404613_44404820 | 0.62 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
1974 |
0.26 |
chr1_162987339_162987541 | 0.62 |
Fmo3 |
flavin containing monooxygenase 3 |
2912 |
0.22 |
chr11_16808519_16808674 | 0.62 |
Egfros |
epidermal growth factor receptor, opposite strand |
22106 |
0.19 |
chr8_9027955_9028106 | 0.62 |
Gm44515 |
predicted gene 44515 |
95331 |
0.06 |
chr12_69419094_69419426 | 0.62 |
Gm9887 |
predicted gene 9887 |
46792 |
0.08 |
chr15_60192024_60192195 | 0.62 |
Gm2682 |
predicted gene 2682 |
4701 |
0.29 |
chr16_43297384_43297535 | 0.62 |
Gm37946 |
predicted gene, 37946 |
10822 |
0.18 |
chr6_108282092_108282442 | 0.62 |
Itpr1 |
inositol 1,4,5-trisphosphate receptor 1 |
29309 |
0.22 |
chr3_142458835_142459002 | 0.61 |
Gbp5 |
guanylate binding protein 5 |
35060 |
0.15 |
chr5_70202648_70202815 | 0.61 |
Gm23067 |
predicted gene, 23067 |
15885 |
0.3 |
chr15_61098917_61099257 | 0.61 |
Gm38563 |
predicted gene, 38563 |
58782 |
0.13 |
chr10_111314954_111315105 | 0.61 |
Bbs10 |
Bardet-Biedl syndrome 10 (human) |
16350 |
0.18 |
chr12_103996630_103996801 | 0.61 |
Gm28577 |
predicted gene 28577 |
136 |
0.92 |
chr8_36213236_36213387 | 0.61 |
Gm35520 |
predicted gene, 35520 |
24939 |
0.14 |
chr6_67441579_67441755 | 0.61 |
Gm44083 |
predicted gene, 44083 |
23616 |
0.11 |
chr1_127899545_127899941 | 0.61 |
Rab3gap1 |
RAB3 GTPase activating protein subunit 1 |
1170 |
0.47 |
chr7_131449022_131449191 | 0.61 |
Gm18600 |
predicted gene, 18600 |
7906 |
0.1 |
chr19_57257831_57258014 | 0.61 |
4930449E18Rik |
RIKEN cDNA 4930449E18 gene |
16038 |
0.18 |
chrX_98205931_98206095 | 0.61 |
Ar |
androgen receptor |
57244 |
0.16 |
chr14_60413760_60413920 | 0.60 |
Gm6066 |
predicted gene 6066 |
28139 |
0.17 |
chr9_74882325_74882476 | 0.60 |
Onecut1 |
one cut domain, family member 1 |
15916 |
0.15 |
chr9_74889175_74889364 | 0.60 |
Onecut1 |
one cut domain, family member 1 |
22785 |
0.14 |
chr1_93229248_93229401 | 0.60 |
Sned1 |
sushi, nidogen and EGF-like domains 1 |
6517 |
0.14 |
chrX_59508043_59508206 | 0.60 |
Fgf13 |
fibroblast growth factor 13 |
59348 |
0.16 |
chr13_119389151_119389302 | 0.60 |
Nnt |
nicotinamide nucleotide transhydrogenase |
19726 |
0.17 |
chr14_20115856_20116036 | 0.60 |
Saysd1 |
SAYSVFN motif domain containing 1 |
22588 |
0.14 |
chr4_82874870_82875072 | 0.59 |
Cer1 |
cerberus 1, DAN family BMP antagonist |
10177 |
0.2 |
chr13_82200839_82201017 | 0.59 |
Gm48155 |
predicted gene, 48155 |
111171 |
0.07 |
chr9_74884431_74884582 | 0.59 |
Onecut1 |
one cut domain, family member 1 |
18022 |
0.15 |
chr1_174900896_174901097 | 0.59 |
Grem2 |
gremlin 2, DAN family BMP antagonist |
20823 |
0.27 |
chr3_121643612_121643813 | 0.59 |
A730020M07Rik |
RIKEN cDNA A730020M07 gene |
227 |
0.92 |
chr7_107574446_107574681 | 0.59 |
Olfml1 |
olfactomedin-like 1 |
6797 |
0.16 |
chr3_129298481_129298819 | 0.59 |
Enpep |
glutamyl aminopeptidase |
10384 |
0.16 |
chr1_77279465_77279665 | 0.59 |
Epha4 |
Eph receptor A4 |
98042 |
0.08 |
chr7_27252126_27252620 | 0.59 |
Gm44641 |
predicted gene 44641 |
197 |
0.84 |
chr1_192812225_192812480 | 0.59 |
Gm38360 |
predicted gene, 38360 |
8775 |
0.14 |
chr3_97651056_97651341 | 0.59 |
Prkab2 |
protein kinase, AMP-activated, beta 2 non-catalytic subunit |
6995 |
0.14 |
chr19_7633313_7633464 | 0.59 |
Plaat5 |
phospholipase A and acyltransferase 5 |
20783 |
0.12 |
chr6_149169218_149169449 | 0.59 |
Amn1 |
antagonist of mitotic exit network 1 |
4038 |
0.17 |
chr5_125492454_125492640 | 0.59 |
Gm27551 |
predicted gene, 27551 |
13170 |
0.13 |
chr5_49059987_49060169 | 0.59 |
Gm43047 |
predicted gene 43047 |
9925 |
0.1 |
chr19_40184875_40185171 | 0.58 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
2263 |
0.24 |
chr11_16841273_16841607 | 0.58 |
Egfros |
epidermal growth factor receptor, opposite strand |
10738 |
0.21 |
chrX_111626357_111626522 | 0.58 |
Gm7340 |
predicted gene 7340 |
54740 |
0.14 |
chr5_99474871_99475183 | 0.58 |
Gm35172 |
predicted gene, 35172 |
33362 |
0.17 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.9 | 5.8 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
0.6 | 2.6 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.6 | 3.3 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
0.5 | 1.6 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
0.5 | 2.0 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
0.5 | 1.5 | GO:0006068 | ethanol catabolic process(GO:0006068) |
0.5 | 1.4 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
0.4 | 1.2 | GO:0060523 | prostate epithelial cord elongation(GO:0060523) |
0.4 | 0.7 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
0.4 | 1.8 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
0.3 | 1.0 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
0.3 | 0.9 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
0.3 | 0.9 | GO:0006001 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
0.3 | 0.9 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
0.3 | 0.3 | GO:0070672 | response to interleukin-15(GO:0070672) |
0.3 | 0.8 | GO:0089700 | protein kinase D signaling(GO:0089700) |
0.3 | 1.4 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
0.3 | 1.1 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
0.3 | 0.8 | GO:0034310 | primary alcohol catabolic process(GO:0034310) |
0.3 | 0.8 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
0.2 | 2.7 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.2 | 7.1 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
0.2 | 0.7 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
0.2 | 0.7 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.2 | 0.9 | GO:0072338 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
0.2 | 0.7 | GO:0034287 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
0.2 | 0.4 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
0.2 | 0.6 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
0.2 | 0.6 | GO:0032489 | regulation of Cdc42 protein signal transduction(GO:0032489) |
0.2 | 0.6 | GO:0021699 | cerebellar cortex maturation(GO:0021699) |
0.2 | 0.4 | GO:0070447 | positive regulation of oligodendrocyte progenitor proliferation(GO:0070447) |
0.2 | 0.5 | GO:1900045 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
0.2 | 0.5 | GO:0061366 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
0.2 | 0.7 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
0.2 | 0.5 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
0.2 | 0.5 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
0.2 | 0.5 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
0.2 | 0.5 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
0.2 | 1.3 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
0.2 | 0.7 | GO:1990414 | replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
0.2 | 0.3 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
0.2 | 0.5 | GO:0071879 | positive regulation of adrenergic receptor signaling pathway(GO:0071879) |
0.2 | 0.3 | GO:1903751 | regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903750) negative regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903751) |
0.2 | 0.5 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
0.2 | 1.0 | GO:0021960 | anterior commissure morphogenesis(GO:0021960) |
0.2 | 0.5 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
0.1 | 1.3 | GO:0052697 | xenobiotic glucuronidation(GO:0052697) |
0.1 | 0.4 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
0.1 | 0.4 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
0.1 | 0.7 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) |
0.1 | 0.6 | GO:0045764 | positive regulation of cellular amino acid metabolic process(GO:0045764) |
0.1 | 0.3 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
0.1 | 1.1 | GO:0060020 | Bergmann glial cell differentiation(GO:0060020) |
0.1 | 0.4 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.1 | 2.9 | GO:0071353 | cellular response to interleukin-4(GO:0071353) |
0.1 | 0.1 | GO:0021564 | vagus nerve development(GO:0021564) |
0.1 | 0.4 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.1 | 1.6 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.1 | 0.7 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
0.1 | 0.4 | GO:0071926 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
0.1 | 0.9 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.1 | 0.5 | GO:0003383 | apical constriction(GO:0003383) |
0.1 | 0.4 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.1 | 0.4 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
0.1 | 0.1 | GO:0019065 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
0.1 | 0.5 | GO:0044004 | killing by symbiont of host cells(GO:0001907) disruption by symbiont of host cell(GO:0044004) |
0.1 | 0.4 | GO:0031087 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.1 | 0.3 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
0.1 | 0.4 | GO:1901475 | pyruvate transmembrane transport(GO:1901475) |
0.1 | 0.5 | GO:0071286 | cellular response to magnesium ion(GO:0071286) |
0.1 | 0.4 | GO:0006868 | glutamine transport(GO:0006868) |
0.1 | 0.4 | GO:0044337 | canonical Wnt signaling pathway involved in positive regulation of apoptotic process(GO:0044337) |
0.1 | 0.4 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
0.1 | 0.6 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.1 | 0.1 | GO:0008050 | female courtship behavior(GO:0008050) |
0.1 | 1.3 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
0.1 | 0.2 | GO:0036023 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) |
0.1 | 0.2 | GO:0060847 | endothelial cell fate specification(GO:0060847) |
0.1 | 0.2 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
0.1 | 0.3 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
0.1 | 0.5 | GO:0031585 | regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031585) |
0.1 | 0.8 | GO:0045908 | negative regulation of vasodilation(GO:0045908) |
0.1 | 0.3 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
0.1 | 0.9 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
0.1 | 0.3 | GO:0045726 | positive regulation of integrin biosynthetic process(GO:0045726) |
0.1 | 0.4 | GO:0039533 | regulation of MDA-5 signaling pathway(GO:0039533) |
0.1 | 0.3 | GO:0042706 | eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
0.1 | 0.4 | GO:0032304 | negative regulation of icosanoid secretion(GO:0032304) |
0.1 | 0.3 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
0.1 | 0.1 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
0.1 | 0.3 | GO:0035283 | central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
0.1 | 0.2 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
0.1 | 0.9 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.1 | 0.5 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
0.1 | 0.1 | GO:1903376 | neuron intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0036480) regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903376) |
0.1 | 0.2 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
0.1 | 0.2 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
0.1 | 0.1 | GO:0035973 | aggrephagy(GO:0035973) |
0.1 | 0.6 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
0.1 | 0.5 | GO:0032237 | activation of store-operated calcium channel activity(GO:0032237) |
0.1 | 0.8 | GO:0006707 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
0.1 | 0.2 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
0.1 | 0.3 | GO:1902966 | regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
0.1 | 0.1 | GO:2000670 | positive regulation of dendritic cell apoptotic process(GO:2000670) |
0.1 | 0.4 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
0.1 | 0.6 | GO:0060613 | fat pad development(GO:0060613) |
0.1 | 0.2 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
0.1 | 0.2 | GO:0071799 | response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
0.1 | 0.3 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.1 | 0.1 | GO:0045196 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
0.1 | 0.4 | GO:0035865 | response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
0.1 | 0.5 | GO:0021780 | oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
0.1 | 0.6 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.1 | 0.3 | GO:0086023 | adrenergic receptor signaling pathway involved in heart process(GO:0086023) |
0.1 | 0.5 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
0.1 | 0.3 | GO:0034196 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
0.1 | 0.3 | GO:0006000 | fructose metabolic process(GO:0006000) |
0.1 | 0.5 | GO:0070836 | caveola assembly(GO:0070836) |
0.1 | 0.2 | GO:0003223 | ventricular compact myocardium morphogenesis(GO:0003223) |
0.1 | 0.2 | GO:1905049 | negative regulation of metalloendopeptidase activity(GO:1904684) negative regulation of metallopeptidase activity(GO:1905049) |
0.1 | 0.4 | GO:1901339 | regulation of store-operated calcium channel activity(GO:1901339) |
0.1 | 0.2 | GO:0010908 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
0.1 | 0.7 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
0.1 | 0.4 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
0.1 | 0.2 | GO:1903121 | regulation of TRAIL-activated apoptotic signaling pathway(GO:1903121) positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
0.1 | 0.2 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
0.1 | 0.3 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
0.1 | 0.3 | GO:0030647 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.1 | 0.2 | GO:0051611 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
0.1 | 0.2 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
0.1 | 0.3 | GO:0035523 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
0.1 | 0.7 | GO:0045176 | apical protein localization(GO:0045176) |
0.1 | 0.1 | GO:0002339 | B cell selection(GO:0002339) |
0.1 | 0.4 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
0.1 | 0.4 | GO:0036089 | cleavage furrow formation(GO:0036089) |
0.1 | 0.2 | GO:0050713 | negative regulation of interleukin-1 beta secretion(GO:0050713) |
0.1 | 0.3 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
0.1 | 0.3 | GO:0000960 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
0.1 | 0.4 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
0.1 | 0.3 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
0.1 | 0.2 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
0.1 | 0.1 | GO:0097167 | circadian regulation of translation(GO:0097167) |
0.1 | 0.1 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
0.1 | 0.2 | GO:0060468 | prevention of polyspermy(GO:0060468) |
0.1 | 0.3 | GO:1903599 | positive regulation of mitophagy(GO:1903599) |
0.1 | 0.3 | GO:0007343 | egg activation(GO:0007343) |
0.1 | 0.1 | GO:0060318 | definitive erythrocyte differentiation(GO:0060318) |
0.1 | 0.5 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.1 | 0.3 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
0.1 | 0.2 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.1 | 0.5 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
0.1 | 0.1 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
0.1 | 0.2 | GO:0045074 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
0.1 | 0.4 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
0.1 | 0.2 | GO:2000259 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
0.1 | 0.2 | GO:0039689 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
0.1 | 0.2 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
0.1 | 0.1 | GO:0032201 | telomere maintenance via semi-conservative replication(GO:0032201) mitotic telomere maintenance via semi-conservative replication(GO:1902990) |
0.1 | 0.1 | GO:0032727 | positive regulation of interferon-alpha production(GO:0032727) |
0.1 | 0.4 | GO:1902221 | L-phenylalanine metabolic process(GO:0006558) L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
0.1 | 0.4 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
0.1 | 1.9 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
0.1 | 0.3 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
0.1 | 0.3 | GO:0030578 | PML body organization(GO:0030578) |
0.1 | 0.1 | GO:0046083 | adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
0.1 | 0.2 | GO:1900044 | regulation of protein K63-linked ubiquitination(GO:1900044) |
0.1 | 0.1 | GO:0019747 | regulation of isoprenoid metabolic process(GO:0019747) |
0.1 | 0.1 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
0.1 | 0.1 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.1 | 0.1 | GO:0010040 | response to iron(II) ion(GO:0010040) |
0.1 | 0.2 | GO:1903799 | negative regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903799) |
0.1 | 0.3 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
0.1 | 0.3 | GO:0010519 | negative regulation of phospholipase activity(GO:0010519) |
0.1 | 0.4 | GO:0060023 | soft palate development(GO:0060023) |
0.1 | 0.4 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
0.1 | 0.1 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
0.1 | 0.1 | GO:1901857 | positive regulation of cellular respiration(GO:1901857) |
0.1 | 0.1 | GO:2000823 | regulation of androgen receptor activity(GO:2000823) |
0.1 | 0.1 | GO:0006808 | regulation of nitrogen utilization(GO:0006808) |
0.1 | 0.1 | GO:0021823 | cerebral cortex tangential migration using cell-cell interactions(GO:0021823) postnatal olfactory bulb interneuron migration(GO:0021827) |
0.1 | 0.3 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
0.1 | 0.3 | GO:0090206 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
0.1 | 0.2 | GO:0046952 | ketone body catabolic process(GO:0046952) |
0.1 | 0.1 | GO:0071072 | negative regulation of phospholipid biosynthetic process(GO:0071072) |
0.1 | 0.1 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.1 | 0.5 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
0.1 | 0.3 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
0.1 | 0.1 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
0.1 | 0.3 | GO:0045901 | positive regulation of translational elongation(GO:0045901) |
0.1 | 0.2 | GO:0042695 | thelarche(GO:0042695) mammary gland branching involved in thelarche(GO:0060744) |
0.1 | 0.1 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
0.1 | 0.3 | GO:1904751 | regulation of protein localization to nucleolus(GO:1904749) positive regulation of protein localization to nucleolus(GO:1904751) |
0.1 | 0.2 | GO:1904017 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
0.1 | 0.3 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
0.1 | 0.3 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
0.1 | 0.6 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
0.1 | 0.3 | GO:0051295 | establishment of meiotic spindle localization(GO:0051295) |
0.1 | 0.1 | GO:2000705 | regulation of dense core granule biogenesis(GO:2000705) |
0.1 | 0.1 | GO:0033629 | negative regulation of cell adhesion mediated by integrin(GO:0033629) |
0.1 | 0.2 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
0.1 | 0.3 | GO:0032817 | regulation of natural killer cell proliferation(GO:0032817) |
0.1 | 0.2 | GO:1900425 | negative regulation of defense response to bacterium(GO:1900425) |
0.1 | 1.4 | GO:0019432 | triglyceride biosynthetic process(GO:0019432) |
0.1 | 0.1 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
0.1 | 0.4 | GO:0090188 | negative regulation of pancreatic juice secretion(GO:0090188) |
0.1 | 2.3 | GO:0048536 | spleen development(GO:0048536) |
0.1 | 0.1 | GO:0035054 | embryonic heart tube anterior/posterior pattern specification(GO:0035054) |
0.1 | 0.2 | GO:0046208 | spermine catabolic process(GO:0046208) |
0.1 | 0.7 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
0.1 | 0.1 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
0.1 | 0.4 | GO:0035459 | cargo loading into vesicle(GO:0035459) |
0.1 | 0.1 | GO:1902177 | positive regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902177) |
0.1 | 0.1 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
0.1 | 0.2 | GO:0003180 | aortic valve development(GO:0003176) aortic valve morphogenesis(GO:0003180) |
0.1 | 0.2 | GO:0009173 | UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
0.1 | 0.1 | GO:0018197 | peptidyl-aspartic acid modification(GO:0018197) |
0.1 | 0.4 | GO:0060148 | positive regulation of posttranscriptional gene silencing(GO:0060148) |
0.1 | 0.6 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.1 | 0.1 | GO:0072205 | metanephric collecting duct development(GO:0072205) |
0.1 | 0.3 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
0.1 | 0.5 | GO:0042759 | long-chain fatty acid biosynthetic process(GO:0042759) |
0.1 | 0.1 | GO:0072361 | regulation of glycolytic process by regulation of transcription from RNA polymerase II promoter(GO:0072361) |
0.1 | 0.2 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
0.1 | 0.2 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
0.1 | 0.5 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
0.1 | 0.5 | GO:0060546 | negative regulation of necroptotic process(GO:0060546) |
0.1 | 0.9 | GO:0045745 | positive regulation of G-protein coupled receptor protein signaling pathway(GO:0045745) |
0.1 | 0.1 | GO:0010871 | negative regulation of receptor biosynthetic process(GO:0010871) |
0.1 | 0.1 | GO:0048143 | astrocyte activation(GO:0048143) |
0.1 | 0.1 | GO:0045113 | regulation of integrin biosynthetic process(GO:0045113) |
0.1 | 0.1 | GO:1902953 | positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
0.1 | 0.2 | GO:1900739 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
0.1 | 0.3 | GO:0032278 | positive regulation of gonadotropin secretion(GO:0032278) |
0.1 | 0.2 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
0.1 | 0.1 | GO:0051025 | negative regulation of immunoglobulin secretion(GO:0051025) |
0.1 | 0.2 | GO:0046005 | positive regulation of circadian sleep/wake cycle, REM sleep(GO:0046005) |
0.1 | 0.2 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
0.1 | 0.2 | GO:0016584 | nucleosome positioning(GO:0016584) |
0.1 | 0.6 | GO:0017144 | drug metabolic process(GO:0017144) |
0.1 | 0.1 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) |
0.1 | 0.3 | GO:0033227 | dsRNA transport(GO:0033227) |
0.1 | 0.2 | GO:1903298 | regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903297) negative regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903298) |
0.1 | 0.1 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
0.1 | 0.1 | GO:0071918 | urea transmembrane transport(GO:0071918) |
0.1 | 0.2 | GO:0015819 | lysine transport(GO:0015819) |
0.1 | 0.8 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
0.1 | 0.1 | GO:0015705 | iodide transport(GO:0015705) |
0.1 | 0.2 | GO:0035627 | ceramide transport(GO:0035627) |
0.1 | 0.3 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
0.1 | 0.3 | GO:0070995 | NADPH oxidation(GO:0070995) |
0.1 | 0.3 | GO:0009188 | ribonucleoside diphosphate biosynthetic process(GO:0009188) |
0.1 | 0.2 | GO:0001880 | Mullerian duct regression(GO:0001880) |
0.1 | 0.6 | GO:0051194 | positive regulation of glycolytic process(GO:0045821) positive regulation of cofactor metabolic process(GO:0051194) positive regulation of coenzyme metabolic process(GO:0051197) |
0.1 | 0.5 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
0.1 | 0.1 | GO:1900368 | regulation of RNA interference(GO:1900368) |
0.1 | 0.4 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
0.1 | 0.2 | GO:0098700 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
0.1 | 0.2 | GO:2000425 | regulation of apoptotic cell clearance(GO:2000425) |
0.1 | 0.3 | GO:0001547 | antral ovarian follicle growth(GO:0001547) |
0.1 | 0.2 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.1 | 0.1 | GO:0046037 | GMP metabolic process(GO:0046037) |
0.1 | 0.1 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
0.0 | 0.1 | GO:0036015 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
0.0 | 0.2 | GO:0010624 | regulation of Schwann cell proliferation(GO:0010624) negative regulation of Schwann cell proliferation(GO:0010626) |
0.0 | 0.1 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
0.0 | 0.1 | GO:1902065 | response to L-glutamate(GO:1902065) |
0.0 | 0.2 | GO:0000103 | sulfate assimilation(GO:0000103) |
0.0 | 0.0 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
0.0 | 0.2 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
0.0 | 0.7 | GO:0032011 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.0 | 0.3 | GO:0010801 | negative regulation of peptidyl-threonine phosphorylation(GO:0010801) |
0.0 | 0.1 | GO:0035582 | sequestering of BMP in extracellular matrix(GO:0035582) |
0.0 | 1.3 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
0.0 | 0.1 | GO:0006015 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
0.0 | 0.1 | GO:0046882 | negative regulation of follicle-stimulating hormone secretion(GO:0046882) |
0.0 | 0.2 | GO:0035814 | negative regulation of renal sodium excretion(GO:0035814) |
0.0 | 0.2 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
0.0 | 0.2 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
0.0 | 0.1 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
0.0 | 0.2 | GO:0060628 | regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
0.0 | 0.0 | GO:0061724 | lipophagy(GO:0061724) |
0.0 | 0.4 | GO:0006152 | purine nucleoside catabolic process(GO:0006152) purine ribonucleoside catabolic process(GO:0046130) |
0.0 | 0.1 | GO:0034136 | negative regulation of toll-like receptor 2 signaling pathway(GO:0034136) |
0.0 | 0.3 | GO:0051418 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
0.0 | 0.1 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
0.0 | 0.2 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
0.0 | 0.1 | GO:0048619 | embryonic hindgut morphogenesis(GO:0048619) |
0.0 | 0.0 | GO:0043497 | regulation of protein heterodimerization activity(GO:0043497) |
0.0 | 0.1 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.0 | 0.0 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
0.0 | 0.1 | GO:0002317 | plasma cell differentiation(GO:0002317) |
0.0 | 0.1 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
0.0 | 0.1 | GO:0032252 | secretory granule localization(GO:0032252) |
0.0 | 0.0 | GO:0070589 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) |
0.0 | 0.0 | GO:0060268 | negative regulation of respiratory burst(GO:0060268) |
0.0 | 0.1 | GO:0001834 | trophectodermal cell proliferation(GO:0001834) |
0.0 | 0.1 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
0.0 | 0.2 | GO:0034627 | 'de novo' NAD biosynthetic process(GO:0034627) |
0.0 | 0.1 | GO:0035754 | B cell chemotaxis(GO:0035754) |
0.0 | 0.1 | GO:0003419 | growth plate cartilage chondrocyte proliferation(GO:0003419) |
0.0 | 0.1 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
0.0 | 0.2 | GO:0015780 | nucleotide-sugar transport(GO:0015780) pyrimidine nucleotide-sugar transport(GO:0015781) |
0.0 | 0.0 | GO:0010534 | regulation of activation of JAK2 kinase activity(GO:0010534) |
0.0 | 0.2 | GO:0042362 | fat-soluble vitamin biosynthetic process(GO:0042362) |
0.0 | 0.4 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
0.0 | 0.1 | GO:0045585 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
0.0 | 0.0 | GO:1901509 | regulation of endothelial tube morphogenesis(GO:1901509) |
0.0 | 0.1 | GO:0014744 | positive regulation of muscle adaptation(GO:0014744) |
0.0 | 0.5 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
0.0 | 0.1 | GO:0033091 | positive regulation of immature T cell proliferation(GO:0033091) |
0.0 | 0.1 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
0.0 | 0.1 | GO:1903416 | response to glycoside(GO:1903416) |
0.0 | 0.1 | GO:0035826 | rubidium ion transport(GO:0035826) |
0.0 | 0.3 | GO:0045607 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
0.0 | 0.0 | GO:0010982 | regulation of high-density lipoprotein particle clearance(GO:0010982) |
0.0 | 0.1 | GO:0045714 | low-density lipoprotein particle receptor biosynthetic process(GO:0045713) regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045714) |
0.0 | 1.7 | GO:0009166 | nucleotide catabolic process(GO:0009166) |
0.0 | 0.0 | GO:0002074 | extraocular skeletal muscle development(GO:0002074) |
0.0 | 0.1 | GO:0030210 | heparin biosynthetic process(GO:0030210) |
0.0 | 0.1 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.0 | 0.0 | GO:0051454 | pH elevation(GO:0045852) intracellular pH elevation(GO:0051454) |
0.0 | 0.0 | GO:0033182 | regulation of histone ubiquitination(GO:0033182) |
0.0 | 0.8 | GO:0030488 | tRNA methylation(GO:0030488) |
0.0 | 0.0 | GO:0060916 | mesenchymal cell proliferation involved in lung development(GO:0060916) |
0.0 | 0.1 | GO:0006533 | aspartate catabolic process(GO:0006533) |
0.0 | 0.2 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
0.0 | 0.0 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
0.0 | 0.1 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
0.0 | 0.1 | GO:1903596 | regulation of gap junction assembly(GO:1903596) |
0.0 | 0.1 | GO:0009125 | nucleoside monophosphate catabolic process(GO:0009125) |
0.0 | 0.0 | GO:0021986 | epithalamus development(GO:0021538) habenula development(GO:0021986) |
0.0 | 0.2 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
0.0 | 0.3 | GO:0040016 | embryonic cleavage(GO:0040016) |
0.0 | 0.0 | GO:0032696 | negative regulation of interleukin-13 production(GO:0032696) |
0.0 | 0.0 | GO:0048597 | post-embryonic camera-type eye morphogenesis(GO:0048597) |
0.0 | 0.3 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
0.0 | 0.1 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
0.0 | 0.1 | GO:1903347 | negative regulation of bicellular tight junction assembly(GO:1903347) |
0.0 | 0.1 | GO:0071492 | cellular response to UV-A(GO:0071492) |
0.0 | 0.2 | GO:0060763 | mammary duct terminal end bud growth(GO:0060763) |
0.0 | 0.3 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.0 | 0.1 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.0 | 0.2 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
0.0 | 0.2 | GO:1903278 | positive regulation of sodium ion export(GO:1903275) positive regulation of sodium ion export from cell(GO:1903278) |
0.0 | 0.1 | GO:1990928 | response to amino acid starvation(GO:1990928) |
0.0 | 0.1 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
0.0 | 0.2 | GO:0032354 | response to follicle-stimulating hormone(GO:0032354) cellular response to follicle-stimulating hormone stimulus(GO:0071372) |
0.0 | 0.2 | GO:0002636 | positive regulation of germinal center formation(GO:0002636) |
0.0 | 0.1 | GO:0060948 | cardiac vascular smooth muscle cell development(GO:0060948) |
0.0 | 0.1 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
0.0 | 0.1 | GO:0002434 | immune complex clearance(GO:0002434) |
0.0 | 0.1 | GO:0018343 | protein farnesylation(GO:0018343) |
0.0 | 0.0 | GO:0045349 | interferon-alpha biosynthetic process(GO:0045349) regulation of interferon-alpha biosynthetic process(GO:0045354) |
0.0 | 0.1 | GO:0022605 | oogenesis stage(GO:0022605) |
0.0 | 0.3 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) |
0.0 | 0.5 | GO:0034724 | DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
0.0 | 0.1 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
0.0 | 0.2 | GO:0034398 | telomere tethering at nuclear periphery(GO:0034398) |
0.0 | 0.2 | GO:2001275 | positive regulation of glucose import in response to insulin stimulus(GO:2001275) |
0.0 | 0.1 | GO:0090209 | negative regulation of triglyceride metabolic process(GO:0090209) |
0.0 | 0.5 | GO:0006883 | cellular sodium ion homeostasis(GO:0006883) |
0.0 | 0.2 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
0.0 | 0.0 | GO:0043633 | polyadenylation-dependent RNA catabolic process(GO:0043633) |
0.0 | 0.1 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.0 | 0.1 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
0.0 | 0.4 | GO:0006415 | translational termination(GO:0006415) |
0.0 | 0.1 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
0.0 | 0.3 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
0.0 | 0.1 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
0.0 | 0.0 | GO:0061031 | endodermal digestive tract morphogenesis(GO:0061031) |
0.0 | 0.1 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
0.0 | 0.2 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.0 | 0.0 | GO:2000321 | positive regulation of T-helper 17 cell differentiation(GO:2000321) |
0.0 | 0.3 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
0.0 | 0.1 | GO:1900227 | positive regulation of NLRP3 inflammasome complex assembly(GO:1900227) |
0.0 | 0.1 | GO:2000042 | negative regulation of double-strand break repair via homologous recombination(GO:2000042) |
0.0 | 0.0 | GO:0090091 | positive regulation of extracellular matrix disassembly(GO:0090091) |
0.0 | 0.1 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
0.0 | 0.0 | GO:0072592 | oxygen metabolic process(GO:0072592) |
0.0 | 0.1 | GO:0061418 | regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061418) |
0.0 | 0.0 | GO:2000015 | regulation of determination of dorsal identity(GO:2000015) |
0.0 | 0.1 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.0 | 0.1 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
0.0 | 0.1 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
0.0 | 0.0 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
0.0 | 0.1 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.0 | 0.4 | GO:0006517 | protein deglycosylation(GO:0006517) |
0.0 | 0.0 | GO:0002461 | tolerance induction dependent upon immune response(GO:0002461) |
0.0 | 0.1 | GO:1900364 | negative regulation of mRNA polyadenylation(GO:1900364) |
0.0 | 0.1 | GO:0030046 | parallel actin filament bundle assembly(GO:0030046) |
0.0 | 0.3 | GO:0060856 | establishment of blood-brain barrier(GO:0060856) |
0.0 | 0.1 | GO:1901740 | negative regulation of myoblast fusion(GO:1901740) |
0.0 | 0.4 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
0.0 | 0.2 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
0.0 | 0.0 | GO:1903059 | regulation of protein lipidation(GO:1903059) |
0.0 | 0.1 | GO:0033129 | positive regulation of histone phosphorylation(GO:0033129) |
0.0 | 0.1 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
0.0 | 0.1 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
0.0 | 0.1 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
0.0 | 0.2 | GO:0060017 | parathyroid gland development(GO:0060017) |
0.0 | 0.6 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
0.0 | 0.1 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
0.0 | 0.8 | GO:0048240 | sperm capacitation(GO:0048240) |
0.0 | 0.1 | GO:0030070 | insulin processing(GO:0030070) |
0.0 | 0.1 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
0.0 | 0.1 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
0.0 | 0.1 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
0.0 | 0.1 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
0.0 | 0.0 | GO:0006678 | glucosylceramide metabolic process(GO:0006678) |
0.0 | 0.1 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
0.0 | 0.2 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.0 | 0.0 | GO:2000807 | regulation of synaptic vesicle clustering(GO:2000807) |
0.0 | 0.2 | GO:0042219 | cellular modified amino acid catabolic process(GO:0042219) |
0.0 | 0.1 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
0.0 | 0.0 | GO:0014732 | skeletal muscle atrophy(GO:0014732) |
0.0 | 0.5 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
0.0 | 0.1 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
0.0 | 0.1 | GO:2000780 | negative regulation of double-strand break repair(GO:2000780) |
0.0 | 0.1 | GO:0072711 | response to hydroxyurea(GO:0072710) cellular response to hydroxyurea(GO:0072711) |
0.0 | 0.2 | GO:0030575 | nuclear body organization(GO:0030575) |
0.0 | 0.1 | GO:0006600 | creatine metabolic process(GO:0006600) |
0.0 | 0.1 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
0.0 | 0.2 | GO:0070862 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) regulation of retrograde protein transport, ER to cytosol(GO:1904152) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
0.0 | 0.2 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
0.0 | 0.1 | GO:1904970 | brush border assembly(GO:1904970) |
0.0 | 0.3 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.0 | 0.1 | GO:0033133 | positive regulation of glucokinase activity(GO:0033133) positive regulation of hexokinase activity(GO:1903301) |
0.0 | 0.2 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
0.0 | 0.3 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
0.0 | 0.2 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
0.0 | 0.3 | GO:0019184 | nonribosomal peptide biosynthetic process(GO:0019184) |
0.0 | 0.0 | GO:0019348 | polyprenol metabolic process(GO:0016093) dolichol metabolic process(GO:0019348) |
0.0 | 0.0 | GO:0061000 | negative regulation of dendritic spine development(GO:0061000) |
0.0 | 0.0 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
0.0 | 0.2 | GO:0030836 | positive regulation of actin filament depolymerization(GO:0030836) |
0.0 | 0.4 | GO:0045116 | protein neddylation(GO:0045116) |
0.0 | 0.7 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
0.0 | 0.3 | GO:0051770 | positive regulation of nitric-oxide synthase biosynthetic process(GO:0051770) |
0.0 | 0.1 | GO:0042447 | hormone catabolic process(GO:0042447) |
0.0 | 0.1 | GO:0070102 | interleukin-6-mediated signaling pathway(GO:0070102) |
0.0 | 0.2 | GO:0039703 | viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
0.0 | 0.2 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
0.0 | 0.2 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
0.0 | 0.1 | GO:0019087 | transformation of host cell by virus(GO:0019087) |
0.0 | 0.1 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
0.0 | 0.5 | GO:0033198 | response to ATP(GO:0033198) |
0.0 | 0.1 | GO:2000510 | positive regulation of dendritic cell chemotaxis(GO:2000510) |
0.0 | 1.0 | GO:0006493 | protein O-linked glycosylation(GO:0006493) |
0.0 | 0.2 | GO:0034312 | diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
0.0 | 0.1 | GO:0010820 | positive regulation of T cell chemotaxis(GO:0010820) |
0.0 | 0.1 | GO:0071360 | cellular response to exogenous dsRNA(GO:0071360) |
0.0 | 0.0 | GO:0072133 | negative regulation of prostatic bud formation(GO:0060686) kidney mesenchyme morphogenesis(GO:0072131) metanephric mesenchyme morphogenesis(GO:0072133) |
0.0 | 0.0 | GO:1901856 | negative regulation of cellular respiration(GO:1901856) |
0.0 | 0.3 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
0.0 | 0.0 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
0.0 | 0.1 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
0.0 | 0.1 | GO:0021637 | trigeminal nerve morphogenesis(GO:0021636) trigeminal nerve structural organization(GO:0021637) |
0.0 | 0.1 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
0.0 | 0.7 | GO:1903146 | regulation of mitophagy(GO:1903146) |
0.0 | 0.1 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.0 | 0.1 | GO:0021873 | forebrain neuroblast division(GO:0021873) |
0.0 | 1.2 | GO:0046426 | negative regulation of JAK-STAT cascade(GO:0046426) negative regulation of STAT cascade(GO:1904893) |
0.0 | 0.1 | GO:0006083 | acetate metabolic process(GO:0006083) |
0.0 | 0.1 | GO:0021898 | commitment of multipotent stem cells to neuronal lineage in forebrain(GO:0021898) |
0.0 | 0.1 | GO:0060510 | Type II pneumocyte differentiation(GO:0060510) |
0.0 | 0.1 | GO:2000224 | regulation of testosterone biosynthetic process(GO:2000224) |
0.0 | 0.1 | GO:0060648 | mammary gland bud morphogenesis(GO:0060648) |
0.0 | 0.2 | GO:1900016 | negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
0.0 | 0.1 | GO:0036006 | response to macrophage colony-stimulating factor(GO:0036005) cellular response to macrophage colony-stimulating factor stimulus(GO:0036006) |
0.0 | 0.1 | GO:0014028 | notochord formation(GO:0014028) |
0.0 | 0.1 | GO:0002215 | defense response to nematode(GO:0002215) |
0.0 | 0.1 | GO:0070257 | positive regulation of mucus secretion(GO:0070257) |
0.0 | 0.1 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
0.0 | 0.2 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
0.0 | 0.1 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
0.0 | 0.1 | GO:0031642 | negative regulation of myelination(GO:0031642) |
0.0 | 0.1 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
0.0 | 0.0 | GO:0035962 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
0.0 | 0.1 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
0.0 | 0.0 | GO:0034135 | regulation of toll-like receptor 2 signaling pathway(GO:0034135) |
0.0 | 0.6 | GO:0006308 | DNA catabolic process(GO:0006308) |
0.0 | 0.1 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.0 | 0.0 | GO:1900747 | negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) |
0.0 | 0.1 | GO:0032825 | positive regulation of natural killer cell differentiation(GO:0032825) |
0.0 | 0.2 | GO:0046831 | regulation of RNA export from nucleus(GO:0046831) |
0.0 | 0.1 | GO:0042448 | progesterone metabolic process(GO:0042448) |
0.0 | 0.1 | GO:0043134 | hindgut contraction(GO:0043133) regulation of hindgut contraction(GO:0043134) |
0.0 | 0.0 | GO:0006106 | fumarate metabolic process(GO:0006106) |
0.0 | 0.1 | GO:0006573 | valine metabolic process(GO:0006573) |
0.0 | 0.0 | GO:0042940 | D-amino acid transport(GO:0042940) |
0.0 | 0.1 | GO:0097070 | ductus arteriosus closure(GO:0097070) |
0.0 | 0.0 | GO:0060664 | epithelial cell proliferation involved in salivary gland morphogenesis(GO:0060664) |
0.0 | 0.4 | GO:0048714 | positive regulation of oligodendrocyte differentiation(GO:0048714) |
0.0 | 0.2 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
0.0 | 0.1 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
0.0 | 0.3 | GO:0033630 | positive regulation of cell adhesion mediated by integrin(GO:0033630) |
0.0 | 0.2 | GO:0048671 | negative regulation of collateral sprouting(GO:0048671) |
0.0 | 0.1 | GO:0035871 | protein K11-linked deubiquitination(GO:0035871) |
0.0 | 0.2 | GO:0001973 | adenosine receptor signaling pathway(GO:0001973) |
0.0 | 0.1 | GO:0071280 | cellular response to copper ion(GO:0071280) |
0.0 | 0.1 | GO:0061152 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
0.0 | 0.1 | GO:0034141 | positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
0.0 | 0.1 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
0.0 | 0.1 | GO:0010587 | miRNA catabolic process(GO:0010587) |
0.0 | 0.1 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
0.0 | 0.1 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
0.0 | 0.1 | GO:0033169 | histone H3-K9 demethylation(GO:0033169) |
0.0 | 0.1 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
0.0 | 0.2 | GO:0015074 | DNA integration(GO:0015074) |
0.0 | 0.1 | GO:1905097 | regulation of guanyl-nucleotide exchange factor activity(GO:1905097) |
0.0 | 0.1 | GO:0016259 | selenocysteine metabolic process(GO:0016259) |
0.0 | 0.3 | GO:0045187 | regulation of circadian sleep/wake cycle, sleep(GO:0045187) |
0.0 | 0.2 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
0.0 | 0.1 | GO:0032532 | regulation of microvillus length(GO:0032532) |
0.0 | 0.2 | GO:0042407 | cristae formation(GO:0042407) |
0.0 | 0.1 | GO:0035799 | ureter maturation(GO:0035799) |
0.0 | 0.6 | GO:0006376 | mRNA splice site selection(GO:0006376) |
0.0 | 1.1 | GO:0045454 | cell redox homeostasis(GO:0045454) |
0.0 | 0.1 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
0.0 | 0.2 | GO:0097320 | membrane tubulation(GO:0097320) |
0.0 | 0.2 | GO:2000194 | regulation of female gonad development(GO:2000194) |
0.0 | 0.0 | GO:0003104 | positive regulation of glomerular filtration(GO:0003104) |
0.0 | 0.3 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
0.0 | 0.2 | GO:0032328 | alanine transport(GO:0032328) |
0.0 | 0.2 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
0.0 | 0.1 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
0.0 | 0.0 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
0.0 | 0.1 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
0.0 | 0.0 | GO:0033153 | somatic diversification of T cell receptor genes(GO:0002568) somatic recombination of T cell receptor gene segments(GO:0002681) T cell receptor V(D)J recombination(GO:0033153) |
0.0 | 0.0 | GO:0014042 | positive regulation of neuron maturation(GO:0014042) |
0.0 | 0.0 | GO:0031443 | fast-twitch skeletal muscle fiber contraction(GO:0031443) |
0.0 | 0.1 | GO:0002727 | natural killer cell cytokine production(GO:0002370) regulation of natural killer cell cytokine production(GO:0002727) |
0.0 | 0.0 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
0.0 | 0.1 | GO:0051657 | maintenance of organelle location(GO:0051657) |
0.0 | 0.2 | GO:0032060 | bleb assembly(GO:0032060) |
0.0 | 0.1 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
0.0 | 0.4 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
0.0 | 0.0 | GO:0042660 | positive regulation of cell fate specification(GO:0042660) |
0.0 | 0.1 | GO:0009629 | response to gravity(GO:0009629) |
0.0 | 0.1 | GO:0030167 | proteoglycan catabolic process(GO:0030167) |
0.0 | 0.2 | GO:0042403 | thyroid hormone metabolic process(GO:0042403) |
0.0 | 0.1 | GO:0035360 | positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
0.0 | 0.2 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
0.0 | 0.2 | GO:0035095 | behavioral response to nicotine(GO:0035095) |
0.0 | 0.1 | GO:1904424 | regulation of GTP binding(GO:1904424) |
0.0 | 0.2 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
0.0 | 0.1 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
0.0 | 0.3 | GO:0043968 | histone H2A acetylation(GO:0043968) |
0.0 | 0.1 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.0 | 0.0 | GO:0014055 | acetylcholine secretion, neurotransmission(GO:0014055) regulation of acetylcholine secretion, neurotransmission(GO:0014056) |
0.0 | 0.0 | GO:0010725 | regulation of primitive erythrocyte differentiation(GO:0010725) |
0.0 | 0.0 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
0.0 | 0.1 | GO:0006655 | phosphatidylglycerol biosynthetic process(GO:0006655) |
0.0 | 0.1 | GO:0060083 | smooth muscle contraction involved in micturition(GO:0060083) |
0.0 | 0.0 | GO:0030007 | cellular potassium ion homeostasis(GO:0030007) |
0.0 | 0.1 | GO:0019740 | nitrogen utilization(GO:0019740) |
0.0 | 0.1 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
0.0 | 0.0 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
0.0 | 0.0 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
0.0 | 0.1 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
0.0 | 0.5 | GO:0000381 | regulation of alternative mRNA splicing, via spliceosome(GO:0000381) |
0.0 | 0.3 | GO:0008272 | sulfate transport(GO:0008272) |
0.0 | 0.0 | GO:0048755 | branching morphogenesis of a nerve(GO:0048755) |
0.0 | 0.1 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
0.0 | 0.1 | GO:0070986 | left/right axis specification(GO:0070986) |
0.0 | 0.1 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
0.0 | 0.2 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
0.0 | 0.0 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
0.0 | 0.0 | GO:0072318 | clathrin coat disassembly(GO:0072318) |
0.0 | 0.2 | GO:0008053 | mitochondrial fusion(GO:0008053) |
0.0 | 0.1 | GO:1903975 | regulation of glial cell migration(GO:1903975) |
0.0 | 0.1 | GO:0017085 | response to insecticide(GO:0017085) response to pyrethroid(GO:0046684) |
0.0 | 0.1 | GO:0048003 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
0.0 | 0.1 | GO:1904293 | negative regulation of ERAD pathway(GO:1904293) |
0.0 | 0.1 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.0 | 0.0 | GO:0050955 | thermoception(GO:0050955) |
0.0 | 0.1 | GO:0032740 | positive regulation of interleukin-17 production(GO:0032740) |
0.0 | 0.4 | GO:0033120 | positive regulation of RNA splicing(GO:0033120) |
0.0 | 0.1 | GO:0002087 | regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
0.0 | 0.0 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
0.0 | 0.0 | GO:0072319 | vesicle uncoating(GO:0072319) |
0.0 | 0.0 | GO:0048290 | isotype switching to IgA isotypes(GO:0048290) regulation of isotype switching to IgA isotypes(GO:0048296) |
0.0 | 0.1 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
0.0 | 0.0 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
0.0 | 0.1 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
0.0 | 0.1 | GO:0033119 | negative regulation of RNA splicing(GO:0033119) |
0.0 | 0.1 | GO:0000022 | mitotic spindle elongation(GO:0000022) mitotic spindle midzone assembly(GO:0051256) |
0.0 | 0.0 | GO:0034035 | purine ribonucleoside bisphosphate metabolic process(GO:0034035) |
0.0 | 0.3 | GO:0044458 | motile cilium assembly(GO:0044458) |
0.0 | 0.0 | GO:2000327 | regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
0.0 | 0.1 | GO:0045793 | positive regulation of cell size(GO:0045793) |
0.0 | 0.1 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
0.0 | 0.0 | GO:0048625 | myoblast fate commitment(GO:0048625) |
0.0 | 0.2 | GO:0018095 | protein polyglutamylation(GO:0018095) |
0.0 | 0.2 | GO:0046579 | positive regulation of Ras protein signal transduction(GO:0046579) |
0.0 | 0.0 | GO:0071692 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
0.0 | 0.1 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
0.0 | 0.0 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
0.0 | 0.0 | GO:0021571 | rhombomere 5 development(GO:0021571) |
0.0 | 0.2 | GO:1900004 | regulation of serine-type endopeptidase activity(GO:1900003) negative regulation of serine-type endopeptidase activity(GO:1900004) regulation of serine-type peptidase activity(GO:1902571) negative regulation of serine-type peptidase activity(GO:1902572) |
0.0 | 0.1 | GO:0002176 | male germ cell proliferation(GO:0002176) |
0.0 | 0.1 | GO:0098795 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
0.0 | 0.1 | GO:0006116 | NADH oxidation(GO:0006116) |
0.0 | 0.1 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
0.0 | 0.0 | GO:0060687 | regulation of branching involved in prostate gland morphogenesis(GO:0060687) |
0.0 | 0.0 | GO:0072224 | metanephric glomerulus development(GO:0072224) |
0.0 | 0.0 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
0.0 | 0.0 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
0.0 | 0.0 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
0.0 | 0.0 | GO:0003358 | noradrenergic neuron development(GO:0003358) |
0.0 | 0.0 | GO:0060618 | nipple development(GO:0060618) |
0.0 | 0.3 | GO:0032467 | positive regulation of cytokinesis(GO:0032467) |
0.0 | 0.0 | GO:0061209 | cell proliferation involved in mesonephros development(GO:0061209) |
0.0 | 0.1 | GO:0043249 | erythrocyte maturation(GO:0043249) |
0.0 | 0.1 | GO:0032222 | regulation of synaptic transmission, cholinergic(GO:0032222) |
0.0 | 0.1 | GO:0035336 | long-chain fatty-acyl-CoA metabolic process(GO:0035336) |
0.0 | 0.1 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
0.0 | 0.0 | GO:0060242 | contact inhibition(GO:0060242) |
0.0 | 0.1 | GO:0060054 | positive regulation of epithelial cell proliferation involved in wound healing(GO:0060054) |
0.0 | 0.0 | GO:1902514 | regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1902514) |
0.0 | 0.1 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
0.0 | 0.0 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
0.0 | 0.1 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
0.0 | 0.1 | GO:0031034 | myosin filament assembly(GO:0031034) |
0.0 | 0.0 | GO:0033058 | directional locomotion(GO:0033058) |
0.0 | 0.1 | GO:0003257 | positive regulation of transcription from RNA polymerase II promoter involved in myocardial precursor cell differentiation(GO:0003257) |
0.0 | 0.1 | GO:0046469 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
0.0 | 0.0 | GO:0061317 | canonical Wnt signaling pathway involved in cardiac muscle cell fate commitment(GO:0061317) |
0.0 | 0.1 | GO:0035025 | positive regulation of Rho protein signal transduction(GO:0035025) |
0.0 | 0.0 | GO:0045112 | integrin biosynthetic process(GO:0045112) |
0.0 | 0.5 | GO:0022904 | respiratory electron transport chain(GO:0022904) |
0.0 | 0.0 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
0.0 | 0.1 | GO:0030311 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.0 | 0.0 | GO:1900038 | negative regulation of cellular response to hypoxia(GO:1900038) |
0.0 | 0.1 | GO:1902047 | polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) negative regulation of polyamine transmembrane transport(GO:1902268) |
0.0 | 0.1 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.0 | 0.0 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
0.0 | 0.1 | GO:0035728 | response to hepatocyte growth factor(GO:0035728) cellular response to hepatocyte growth factor stimulus(GO:0035729) |
0.0 | 0.1 | GO:0032494 | response to peptidoglycan(GO:0032494) |
0.0 | 0.1 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.0 | 0.1 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
0.0 | 0.1 | GO:1902260 | negative regulation of delayed rectifier potassium channel activity(GO:1902260) negative regulation of voltage-gated potassium channel activity(GO:1903817) |
0.0 | 0.1 | GO:0035522 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
0.0 | 0.1 | GO:1901070 | GTP biosynthetic process(GO:0006183) UTP biosynthetic process(GO:0006228) UTP metabolic process(GO:0046051) guanosine-containing compound biosynthetic process(GO:1901070) |
0.0 | 0.1 | GO:0072012 | glomerulus vasculature development(GO:0072012) |
0.0 | 0.0 | GO:0003183 | mitral valve morphogenesis(GO:0003183) |
0.0 | 0.1 | GO:0043031 | negative regulation of macrophage activation(GO:0043031) |
0.0 | 0.1 | GO:0048733 | sebaceous gland development(GO:0048733) |
0.0 | 0.1 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
0.0 | 0.0 | GO:0040038 | polar body extrusion after meiotic divisions(GO:0040038) |
0.0 | 0.1 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
0.0 | 0.1 | GO:0008090 | retrograde axonal transport(GO:0008090) |
0.0 | 0.1 | GO:0061032 | visceral serous pericardium development(GO:0061032) |
0.0 | 0.1 | GO:0060027 | convergent extension involved in gastrulation(GO:0060027) |
0.0 | 0.0 | GO:0060979 | vasculogenesis involved in coronary vascular morphogenesis(GO:0060979) |
0.0 | 0.1 | GO:0060539 | diaphragm development(GO:0060539) |
0.0 | 0.1 | GO:0046415 | urate metabolic process(GO:0046415) |
0.0 | 0.0 | GO:0061072 | iris morphogenesis(GO:0061072) |
0.0 | 0.1 | GO:0015813 | L-glutamate transport(GO:0015813) |
0.0 | 0.0 | GO:1903894 | regulation of IRE1-mediated unfolded protein response(GO:1903894) |
0.0 | 0.2 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
0.0 | 0.1 | GO:0048857 | neural nucleus development(GO:0048857) |
0.0 | 0.1 | GO:0045047 | protein targeting to ER(GO:0045047) |
0.0 | 0.0 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
0.0 | 0.1 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
0.0 | 0.0 | GO:0046959 | habituation(GO:0046959) |
0.0 | 0.0 | GO:0045048 | protein insertion into ER membrane(GO:0045048) tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
0.0 | 0.0 | GO:0023021 | termination of signal transduction(GO:0023021) |
0.0 | 0.0 | GO:0002581 | negative regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002581) |
0.0 | 0.1 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.0 | 0.1 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
0.0 | 0.2 | GO:0014850 | response to muscle activity(GO:0014850) |
0.0 | 0.1 | GO:0007144 | female meiosis I(GO:0007144) |
0.0 | 0.0 | GO:0031284 | positive regulation of guanylate cyclase activity(GO:0031284) |
0.0 | 0.1 | GO:0046477 | glycosylceramide catabolic process(GO:0046477) |
0.0 | 0.1 | GO:0046835 | carbohydrate phosphorylation(GO:0046835) |
0.0 | 0.0 | GO:1902075 | cellular response to salt(GO:1902075) |
0.0 | 0.1 | GO:0045086 | positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
0.0 | 0.0 | GO:1900115 | sequestering of extracellular ligand from receptor(GO:0035581) extracellular regulation of signal transduction(GO:1900115) extracellular negative regulation of signal transduction(GO:1900116) |
0.0 | 0.1 | GO:0006107 | oxaloacetate metabolic process(GO:0006107) |
0.0 | 0.5 | GO:0032543 | mitochondrial translation(GO:0032543) |
0.0 | 0.2 | GO:0007096 | regulation of exit from mitosis(GO:0007096) |
0.0 | 0.0 | GO:0051549 | regulation of keratinocyte migration(GO:0051547) positive regulation of keratinocyte migration(GO:0051549) |
0.0 | 0.0 | GO:0008105 | asymmetric protein localization(GO:0008105) |
0.0 | 0.2 | GO:0030204 | chondroitin sulfate metabolic process(GO:0030204) |
0.0 | 0.0 | GO:0097476 | motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) |
0.0 | 0.0 | GO:0019859 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
0.0 | 0.1 | GO:0001780 | neutrophil homeostasis(GO:0001780) |
0.0 | 0.1 | GO:0099612 | protein localization to axon(GO:0099612) |
0.0 | 0.0 | GO:0009113 | purine nucleobase biosynthetic process(GO:0009113) |
0.0 | 0.1 | GO:0006273 | lagging strand elongation(GO:0006273) |
0.0 | 0.1 | GO:0045986 | negative regulation of smooth muscle contraction(GO:0045986) |
0.0 | 0.1 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
0.0 | 0.1 | GO:0051031 | tRNA transport(GO:0051031) |
0.0 | 0.0 | GO:0071033 | nuclear retention of pre-mRNA at the site of transcription(GO:0071033) |
0.0 | 0.0 | GO:0031282 | regulation of guanylate cyclase activity(GO:0031282) |
0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.0 | GO:0061355 | Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) |
0.0 | 0.0 | GO:0070535 | histone H2A K63-linked ubiquitination(GO:0070535) |
0.0 | 0.1 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
0.0 | 0.0 | GO:0097084 | vascular smooth muscle cell development(GO:0097084) |
0.0 | 0.0 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
0.0 | 0.1 | GO:1901673 | regulation of mitotic spindle assembly(GO:1901673) |
0.0 | 0.0 | GO:0010586 | miRNA metabolic process(GO:0010586) |
0.0 | 0.0 | GO:0021558 | trochlear nerve development(GO:0021558) |
0.0 | 0.0 | GO:0090598 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
0.0 | 0.0 | GO:0009181 | purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
0.0 | 0.0 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
0.0 | 0.2 | GO:0010842 | retina layer formation(GO:0010842) |
0.0 | 0.1 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
0.0 | 0.0 | GO:0007386 | compartment pattern specification(GO:0007386) |
0.0 | 0.0 | GO:2001025 | positive regulation of response to drug(GO:2001025) |
0.0 | 0.1 | GO:0001514 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
0.0 | 0.1 | GO:0060046 | regulation of acrosome reaction(GO:0060046) |
0.0 | 0.1 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
0.0 | 0.1 | GO:0098868 | bone growth(GO:0098868) |
0.0 | 0.0 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
0.0 | 0.0 | GO:0036462 | TRAIL-activated apoptotic signaling pathway(GO:0036462) |
0.0 | 0.0 | GO:0060126 | somatotropin secreting cell differentiation(GO:0060126) |
0.0 | 0.1 | GO:0009084 | glutamine family amino acid biosynthetic process(GO:0009084) |
0.0 | 0.3 | GO:0033014 | porphyrin-containing compound biosynthetic process(GO:0006779) tetrapyrrole biosynthetic process(GO:0033014) |
0.0 | 0.0 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
0.0 | 0.0 | GO:0006562 | proline catabolic process(GO:0006562) |
0.0 | 0.0 | GO:0031049 | programmed DNA elimination(GO:0031049) chromosome breakage(GO:0031052) |
0.0 | 0.1 | GO:0045046 | peroxisomal membrane transport(GO:0015919) protein import into peroxisome membrane(GO:0045046) |
0.0 | 0.0 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
0.0 | 0.0 | GO:0042699 | follicle-stimulating hormone signaling pathway(GO:0042699) |
0.0 | 0.1 | GO:0015871 | choline transport(GO:0015871) |
0.0 | 0.0 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
0.0 | 0.2 | GO:0031116 | positive regulation of microtubule polymerization(GO:0031116) |
0.0 | 0.2 | GO:0031163 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
0.0 | 0.0 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
0.0 | 0.0 | GO:0060379 | cardiac muscle cell myoblast differentiation(GO:0060379) |
0.0 | 0.1 | GO:0016114 | terpenoid biosynthetic process(GO:0016114) |
0.0 | 0.1 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
0.0 | 0.0 | GO:0060124 | positive regulation of growth hormone secretion(GO:0060124) |
0.0 | 0.0 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
0.0 | 0.0 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.0 | 0.0 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.0 | 0.0 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
0.0 | 0.3 | GO:0006505 | GPI anchor metabolic process(GO:0006505) |
0.0 | 0.0 | GO:0042126 | nitrate metabolic process(GO:0042126) |
0.0 | 0.0 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
0.0 | 0.0 | GO:0055093 | response to increased oxygen levels(GO:0036296) response to hyperoxia(GO:0055093) |
0.0 | 0.0 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
0.0 | 0.0 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
0.0 | 0.0 | GO:0002282 | microglial cell activation involved in immune response(GO:0002282) |
0.0 | 0.0 | GO:0070640 | vitamin D3 metabolic process(GO:0070640) |
0.0 | 0.0 | GO:0046013 | T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
0.0 | 0.3 | GO:0045839 | negative regulation of mitotic nuclear division(GO:0045839) |
0.0 | 0.0 | GO:0009191 | ribonucleoside diphosphate catabolic process(GO:0009191) |
0.0 | 0.3 | GO:1903078 | positive regulation of protein localization to plasma membrane(GO:1903078) positive regulation of protein localization to cell periphery(GO:1904377) |
0.0 | 0.0 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
0.0 | 0.0 | GO:1900451 | positive regulation of glutamate receptor signaling pathway(GO:1900451) positive regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000969) |
0.0 | 0.0 | GO:0090214 | spongiotrophoblast layer developmental growth(GO:0090214) |
0.0 | 0.1 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
0.0 | 0.0 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
0.0 | 0.0 | GO:0007228 | positive regulation of hh target transcription factor activity(GO:0007228) |
0.0 | 0.0 | GO:0070444 | oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
0.0 | 0.0 | GO:0060346 | bone trabecula formation(GO:0060346) |
0.0 | 0.0 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.0 | 0.0 | GO:0070874 | negative regulation of glycogen metabolic process(GO:0070874) |
0.0 | 0.0 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
0.0 | 0.0 | GO:0006004 | fucose metabolic process(GO:0006004) |
0.0 | 0.0 | GO:0003162 | atrioventricular node development(GO:0003162) |
0.0 | 0.0 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
0.0 | 0.0 | GO:0032202 | telomere assembly(GO:0032202) |
0.0 | 0.0 | GO:0006108 | malate metabolic process(GO:0006108) |
0.0 | 0.0 | GO:0033483 | gas homeostasis(GO:0033483) |
0.0 | 0.0 | GO:0098915 | membrane repolarization during ventricular cardiac muscle cell action potential(GO:0098915) |
0.0 | 0.0 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
0.0 | 0.1 | GO:0006032 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
0.0 | 0.0 | GO:0050650 | chondroitin sulfate proteoglycan biosynthetic process(GO:0050650) |
0.0 | 0.1 | GO:0071380 | cellular response to prostaglandin E stimulus(GO:0071380) |
0.0 | 0.0 | GO:0051140 | regulation of NK T cell proliferation(GO:0051140) positive regulation of NK T cell proliferation(GO:0051142) |
0.0 | 0.0 | GO:1902513 | regulation of organelle transport along microtubule(GO:1902513) |
0.0 | 0.1 | GO:0006491 | N-glycan processing(GO:0006491) |
0.0 | 0.0 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
0.0 | 0.1 | GO:0006833 | water transport(GO:0006833) |
0.0 | 0.0 | GO:0035493 | SNARE complex assembly(GO:0035493) |
0.0 | 0.0 | GO:0015803 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.0 | 0.0 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
0.0 | 0.1 | GO:0060575 | intestinal epithelial cell differentiation(GO:0060575) |
0.0 | 0.0 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
0.0 | 0.0 | GO:0099624 | regulation of atrial cardiac muscle cell membrane repolarization(GO:0060372) atrial cardiac muscle cell membrane repolarization(GO:0099624) |
0.0 | 0.2 | GO:0090659 | adult walking behavior(GO:0007628) walking behavior(GO:0090659) |
0.0 | 0.0 | GO:0070245 | positive regulation of thymocyte apoptotic process(GO:0070245) |
0.0 | 0.0 | GO:0002072 | optic cup morphogenesis involved in camera-type eye development(GO:0002072) |
0.0 | 0.0 | GO:0060684 | epithelial-mesenchymal cell signaling(GO:0060684) |
0.0 | 0.0 | GO:0030091 | protein repair(GO:0030091) |
0.0 | 0.0 | GO:0048664 | neuron fate determination(GO:0048664) |
0.0 | 0.0 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.0 | 0.1 | GO:0001916 | positive regulation of T cell mediated cytotoxicity(GO:0001916) |
0.0 | 0.1 | GO:0031498 | chromatin disassembly(GO:0031498) |
0.0 | 0.0 | GO:0035768 | cell chemotaxis to fibroblast growth factor(GO:0035766) endothelial cell chemotaxis to fibroblast growth factor(GO:0035768) regulation of cell chemotaxis to fibroblast growth factor(GO:1904847) regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000544) |
0.0 | 0.0 | GO:0019042 | viral latency(GO:0019042) |
0.0 | 0.0 | GO:0090611 | ubiquitin-independent protein catabolic process via the multivesicular body sorting pathway(GO:0090611) |
0.0 | 0.1 | GO:0031643 | positive regulation of myelination(GO:0031643) |
0.0 | 0.0 | GO:0006241 | CTP biosynthetic process(GO:0006241) pyrimidine ribonucleoside triphosphate metabolic process(GO:0009208) pyrimidine ribonucleoside triphosphate biosynthetic process(GO:0009209) CTP metabolic process(GO:0046036) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.9 | 5.8 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.6 | 2.9 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.4 | 1.5 | GO:0005955 | calcineurin complex(GO:0005955) |
0.4 | 1.8 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.2 | 1.9 | GO:0042587 | glycogen granule(GO:0042587) |
0.2 | 0.8 | GO:0097425 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
0.2 | 0.7 | GO:0033269 | internode region of axon(GO:0033269) |
0.2 | 0.7 | GO:0031094 | platelet dense tubular network(GO:0031094) |
0.2 | 0.5 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.2 | 0.8 | GO:0097433 | dense body(GO:0097433) |
0.1 | 0.4 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
0.1 | 0.4 | GO:0048179 | activin receptor complex(GO:0048179) |
0.1 | 1.5 | GO:0070852 | cell body fiber(GO:0070852) |
0.1 | 0.3 | GO:0032280 | symmetric synapse(GO:0032280) |
0.1 | 0.5 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.1 | 0.4 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.1 | 0.5 | GO:0005726 | perichromatin fibrils(GO:0005726) |
0.1 | 0.5 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.1 | 0.4 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.1 | 0.4 | GO:0046691 | intracellular canaliculus(GO:0046691) |
0.1 | 0.5 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.1 | 1.2 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.1 | 0.5 | GO:0031298 | replication fork protection complex(GO:0031298) |
0.1 | 0.4 | GO:0070545 | PeBoW complex(GO:0070545) |
0.1 | 1.6 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.1 | 0.8 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
0.1 | 0.3 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.1 | 1.0 | GO:0071564 | npBAF complex(GO:0071564) |
0.1 | 0.3 | GO:0097451 | glial limiting end-foot(GO:0097451) |
0.1 | 0.3 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.1 | 0.2 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.1 | 0.2 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
0.1 | 0.3 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.1 | 0.4 | GO:0044294 | dendritic growth cone(GO:0044294) |
0.1 | 0.5 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.1 | 0.1 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
0.1 | 0.3 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
0.1 | 0.8 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.1 | 0.4 | GO:0005915 | zonula adherens(GO:0005915) |
0.1 | 0.5 | GO:0016342 | catenin complex(GO:0016342) |
0.1 | 0.3 | GO:0097452 | GAIT complex(GO:0097452) |
0.1 | 0.3 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
0.1 | 0.2 | GO:0042825 | TAP complex(GO:0042825) |
0.1 | 0.8 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.1 | 0.2 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
0.1 | 0.4 | GO:0045180 | basal cortex(GO:0045180) |
0.1 | 0.2 | GO:0071942 | XPC complex(GO:0071942) |
0.1 | 0.2 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.1 | 0.1 | GO:0097450 | astrocyte end-foot(GO:0097450) |
0.1 | 0.2 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.1 | 0.2 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.1 | 0.5 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.1 | 1.0 | GO:0043034 | costamere(GO:0043034) |
0.1 | 0.4 | GO:0001650 | fibrillar center(GO:0001650) |
0.1 | 0.2 | GO:0071203 | WASH complex(GO:0071203) |
0.1 | 0.2 | GO:0097209 | epidermal lamellar body(GO:0097209) |
0.1 | 0.4 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.1 | 0.8 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
0.0 | 0.7 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
0.0 | 0.4 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.0 | 0.4 | GO:0097208 | alveolar lamellar body(GO:0097208) |
0.0 | 0.1 | GO:0032444 | activin responsive factor complex(GO:0032444) |
0.0 | 0.2 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.0 | 0.3 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
0.0 | 0.3 | GO:0071986 | Ragulator complex(GO:0071986) |
0.0 | 0.3 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
0.0 | 0.3 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.0 | 1.6 | GO:0045271 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
0.0 | 0.2 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.0 | 0.2 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
0.0 | 0.6 | GO:0000800 | lateral element(GO:0000800) |
0.0 | 0.2 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
0.0 | 0.7 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
0.0 | 0.2 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.0 | 0.1 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
0.0 | 0.3 | GO:1990909 | Wnt signalosome(GO:1990909) |
0.0 | 0.3 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.0 | 0.1 | GO:0005608 | laminin-3 complex(GO:0005608) |
0.0 | 0.1 | GO:0097413 | Lewy body(GO:0097413) |
0.0 | 0.1 | GO:0005745 | m-AAA complex(GO:0005745) |
0.0 | 0.3 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.0 | 0.0 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
0.0 | 0.2 | GO:0016589 | NURF complex(GO:0016589) |
0.0 | 1.5 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.0 | 1.0 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.0 | 0.3 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
0.0 | 0.1 | GO:0097441 | basilar dendrite(GO:0097441) |
0.0 | 0.3 | GO:0051286 | cell tip(GO:0051286) |
0.0 | 2.0 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
0.0 | 1.0 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.0 | 0.0 | GO:0000439 | core TFIIH complex(GO:0000439) |
0.0 | 0.3 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.0 | 0.3 | GO:0000124 | SAGA complex(GO:0000124) |
0.0 | 0.1 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
0.0 | 0.3 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.0 | 0.2 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.0 | 0.4 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
0.0 | 0.1 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.0 | 0.1 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.0 | 0.1 | GO:0000125 | PCAF complex(GO:0000125) |
0.0 | 0.1 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
0.0 | 0.1 | GO:0034448 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.0 | 0.4 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.0 | 0.1 | GO:1990423 | RZZ complex(GO:1990423) |
0.0 | 0.2 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
0.0 | 0.1 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.0 | 0.4 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
0.0 | 0.2 | GO:0042613 | MHC class II protein complex(GO:0042613) |
0.0 | 0.3 | GO:0032426 | stereocilium tip(GO:0032426) |
0.0 | 0.2 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.0 | 0.1 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.0 | 0.1 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.0 | 0.1 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
0.0 | 0.1 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
0.0 | 0.0 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
0.0 | 0.1 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.0 | 0.2 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.0 | 0.1 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
0.0 | 0.6 | GO:0048786 | presynaptic active zone(GO:0048786) |
0.0 | 0.1 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.0 | 0.0 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
0.0 | 0.1 | GO:0017133 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
0.0 | 0.0 | GO:0042824 | MHC class I peptide loading complex(GO:0042824) |
0.0 | 0.0 | GO:0005606 | laminin-1 complex(GO:0005606) |
0.0 | 0.1 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
0.0 | 0.1 | GO:0072534 | perineuronal net(GO:0072534) |
0.0 | 0.1 | GO:0005594 | collagen type IX trimer(GO:0005594) |
0.0 | 0.5 | GO:0071339 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
0.0 | 0.1 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
0.0 | 0.2 | GO:0030914 | STAGA complex(GO:0030914) |
0.0 | 0.6 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
0.0 | 0.1 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
0.0 | 0.1 | GO:0098533 | ATPase dependent transmembrane transport complex(GO:0098533) |
0.0 | 0.1 | GO:0019815 | B cell receptor complex(GO:0019815) |
0.0 | 0.2 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
0.0 | 0.1 | GO:0001651 | dense fibrillar component(GO:0001651) |
0.0 | 0.4 | GO:0005686 | U2 snRNP(GO:0005686) |
0.0 | 0.2 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
0.0 | 0.0 | GO:0000812 | Swr1 complex(GO:0000812) |
0.0 | 0.1 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
0.0 | 0.1 | GO:0097386 | glial cell projection(GO:0097386) |
0.0 | 0.3 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.0 | 0.2 | GO:0031083 | BLOC-1 complex(GO:0031083) |
0.0 | 0.1 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.0 | 0.1 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.0 | 0.3 | GO:0034706 | sodium channel complex(GO:0034706) |
0.0 | 0.9 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
0.0 | 0.3 | GO:0030673 | axolemma(GO:0030673) |
0.0 | 0.1 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
0.0 | 0.1 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
0.0 | 0.3 | GO:0044295 | axonal growth cone(GO:0044295) |
0.0 | 0.3 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.0 | 0.1 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
0.0 | 0.1 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
0.0 | 0.1 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
0.0 | 0.1 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
0.0 | 0.1 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.0 | 0.1 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
0.0 | 0.1 | GO:0097422 | tubular endosome(GO:0097422) |
0.0 | 0.3 | GO:0005719 | nuclear euchromatin(GO:0005719) |
0.0 | 0.1 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
0.0 | 0.1 | GO:0042575 | DNA polymerase complex(GO:0042575) |
0.0 | 0.0 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.0 | 0.0 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.0 | 0.1 | GO:0031415 | NatA complex(GO:0031415) |
0.0 | 0.2 | GO:0032797 | SMN complex(GO:0032797) |
0.0 | 0.1 | GO:0097470 | ribbon synapse(GO:0097470) |
0.0 | 0.2 | GO:0001527 | microfibril(GO:0001527) |
0.0 | 0.2 | GO:0031512 | motile primary cilium(GO:0031512) |
0.0 | 0.1 | GO:0032009 | early phagosome(GO:0032009) |
0.0 | 0.1 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
0.0 | 0.1 | GO:0098536 | deuterosome(GO:0098536) |
0.0 | 0.1 | GO:0070847 | core mediator complex(GO:0070847) |
0.0 | 0.1 | GO:0001520 | outer dense fiber(GO:0001520) |
0.0 | 0.0 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
0.0 | 0.1 | GO:0030314 | junctional membrane complex(GO:0030314) |
0.0 | 0.1 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
0.0 | 0.2 | GO:0000421 | autophagosome membrane(GO:0000421) |
0.0 | 0.2 | GO:0005614 | interstitial matrix(GO:0005614) |
0.0 | 0.1 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.0 | 0.1 | GO:0070695 | FHF complex(GO:0070695) |
0.0 | 0.0 | GO:0043293 | apoptosome(GO:0043293) |
0.0 | 0.2 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
0.0 | 0.1 | GO:0048500 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
0.0 | 0.2 | GO:0043189 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
0.0 | 0.1 | GO:0005927 | muscle tendon junction(GO:0005927) |
0.0 | 0.1 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.0 | 0.2 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
0.0 | 0.0 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
0.0 | 0.0 | GO:0097651 | phosphatidylinositol 3-kinase complex, class I(GO:0097651) |
0.0 | 0.0 | GO:0055087 | Ski complex(GO:0055087) |
0.0 | 0.1 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
0.0 | 0.1 | GO:0005682 | U5 snRNP(GO:0005682) |
0.0 | 0.6 | GO:0090575 | RNA polymerase II transcription factor complex(GO:0090575) |
0.0 | 0.0 | GO:0070461 | SAGA-type complex(GO:0070461) |
0.0 | 0.1 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.0 | 0.0 | GO:0031417 | NatC complex(GO:0031417) |
0.0 | 0.1 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.0 | 0.1 | GO:0061617 | MICOS complex(GO:0061617) |
0.0 | 0.1 | GO:0017059 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
0.0 | 0.1 | GO:0000346 | transcription export complex(GO:0000346) |
0.0 | 0.0 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.0 | 0.4 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
0.0 | 0.1 | GO:0005833 | hemoglobin complex(GO:0005833) |
0.0 | 0.7 | GO:0005902 | microvillus(GO:0005902) |
0.0 | 0.1 | GO:0000791 | euchromatin(GO:0000791) |
0.0 | 0.0 | GO:0005827 | polar microtubule(GO:0005827) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.9 | 5.8 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
0.8 | 2.3 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
0.6 | 2.6 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
0.6 | 1.7 | GO:0070538 | oleic acid binding(GO:0070538) |
0.5 | 0.9 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
0.4 | 1.7 | GO:0071614 | linoleic acid epoxygenase activity(GO:0071614) |
0.4 | 1.3 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
0.4 | 1.5 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.3 | 1.0 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.3 | 0.6 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) |
0.3 | 2.6 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.3 | 0.9 | GO:0032190 | acrosin binding(GO:0032190) |
0.3 | 0.8 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
0.2 | 0.7 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.2 | 0.7 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
0.2 | 0.6 | GO:0038181 | bile acid receptor activity(GO:0038181) |
0.2 | 2.8 | GO:0070402 | NADPH binding(GO:0070402) |
0.2 | 0.4 | GO:0070644 | vitamin D response element binding(GO:0070644) |
0.2 | 0.4 | GO:0042281 | dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase activity(GO:0042281) |
0.2 | 0.6 | GO:0004771 | sterol esterase activity(GO:0004771) |
0.2 | 0.6 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.2 | 0.8 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.2 | 0.8 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.2 | 0.6 | GO:0016215 | acyl-CoA desaturase activity(GO:0016215) |
0.2 | 0.5 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.2 | 0.5 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.2 | 0.9 | GO:0009378 | four-way junction helicase activity(GO:0009378) |
0.2 | 0.5 | GO:0055100 | adiponectin binding(GO:0055100) |
0.2 | 0.6 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
0.2 | 0.9 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
0.2 | 0.5 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.1 | 0.5 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
0.1 | 0.4 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.1 | 0.4 | GO:0015186 | L-asparagine transmembrane transporter activity(GO:0015182) L-glutamine transmembrane transporter activity(GO:0015186) |
0.1 | 0.4 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
0.1 | 0.3 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.1 | 1.4 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.1 | 0.8 | GO:0034875 | oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
0.1 | 0.5 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
0.1 | 0.6 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
0.1 | 0.4 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.1 | 0.4 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.1 | 0.5 | GO:0033142 | progesterone receptor binding(GO:0033142) |
0.1 | 0.4 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.1 | 0.6 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.1 | 0.2 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.1 | 0.3 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
0.1 | 0.4 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
0.1 | 0.5 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
0.1 | 0.7 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
0.1 | 0.8 | GO:0036122 | BMP binding(GO:0036122) |
0.1 | 0.7 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
0.1 | 1.3 | GO:0015643 | toxic substance binding(GO:0015643) |
0.1 | 2.1 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
0.1 | 0.3 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
0.1 | 2.0 | GO:0003785 | actin monomer binding(GO:0003785) |
0.1 | 0.4 | GO:0032564 | dATP binding(GO:0032564) |
0.1 | 0.3 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
0.1 | 1.1 | GO:0030553 | cGMP binding(GO:0030553) |
0.1 | 2.2 | GO:0030552 | cAMP binding(GO:0030552) |
0.1 | 0.1 | GO:0050051 | leukotriene-B4 20-monooxygenase activity(GO:0050051) |
0.1 | 0.4 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
0.1 | 1.2 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.1 | 0.4 | GO:0017040 | ceramidase activity(GO:0017040) |
0.1 | 0.4 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
0.1 | 0.3 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
0.1 | 0.3 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.1 | 3.1 | GO:0008392 | arachidonic acid epoxygenase activity(GO:0008392) |
0.1 | 0.2 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
0.1 | 0.2 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.1 | 0.2 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
0.1 | 0.2 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
0.1 | 0.2 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
0.1 | 0.3 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
0.1 | 0.2 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.1 | 0.2 | GO:0005024 | transforming growth factor beta-activated receptor activity(GO:0005024) |
0.1 | 0.4 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.1 | 0.2 | GO:0005119 | smoothened binding(GO:0005119) |
0.1 | 0.8 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.1 | 0.4 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
0.1 | 0.3 | GO:0042731 | PH domain binding(GO:0042731) |
0.1 | 0.6 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.1 | 1.4 | GO:0003756 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
0.1 | 0.5 | GO:0043495 | protein anchor(GO:0043495) |
0.1 | 0.2 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
0.1 | 1.5 | GO:0008137 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.1 | 0.1 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.1 | 0.1 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
0.1 | 0.2 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.1 | 0.5 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
0.1 | 0.2 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.1 | 0.1 | GO:0016717 | oxidoreductase activity, acting on paired donors, with oxidation of a pair of donors resulting in the reduction of molecular oxygen to two molecules of water(GO:0016717) |
0.1 | 0.2 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
0.1 | 0.1 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
0.1 | 0.4 | GO:0016889 | endodeoxyribonuclease activity, producing 3'-phosphomonoesters(GO:0016889) |
0.1 | 0.3 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.1 | 1.4 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
0.1 | 0.4 | GO:0050308 | sugar-phosphatase activity(GO:0050308) |
0.1 | 0.3 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.1 | 0.3 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.1 | 0.3 | GO:0070728 | leucine binding(GO:0070728) |
0.1 | 0.3 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.1 | 0.4 | GO:0008199 | ferric iron binding(GO:0008199) |
0.1 | 0.3 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.1 | 0.1 | GO:0019237 | centromeric DNA binding(GO:0019237) |
0.1 | 0.4 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.1 | 0.2 | GO:0008948 | oxaloacetate decarboxylase activity(GO:0008948) |
0.1 | 0.4 | GO:0008079 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
0.1 | 0.3 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.1 | 0.1 | GO:0008417 | fucosyltransferase activity(GO:0008417) |
0.1 | 0.2 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
0.1 | 0.4 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
0.1 | 0.7 | GO:0031690 | adrenergic receptor binding(GO:0031690) |
0.1 | 0.2 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
0.1 | 0.6 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
0.1 | 0.7 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.1 | 0.5 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.1 | 0.4 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
0.1 | 0.3 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
0.1 | 0.1 | GO:0030911 | TPR domain binding(GO:0030911) |
0.1 | 0.3 | GO:0050815 | phosphoserine binding(GO:0050815) |
0.1 | 0.2 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
0.1 | 0.5 | GO:0038191 | neuropilin binding(GO:0038191) |
0.1 | 0.6 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) |
0.1 | 1.8 | GO:0035460 | prenylcysteine methylesterase activity(GO:0010296) 1-oxa-2-oxocycloheptane lactonase activity(GO:0018731) sulfolactone hydrolase activity(GO:0018732) butyrolactone hydrolase activity(GO:0018734) endosulfan lactone lactonase activity(GO:0034892) L-ascorbate 6-phosphate lactonase activity(GO:0035460) Ser-tRNA(Thr) hydrolase activity(GO:0043905) Ala-tRNA(Pro) hydrolase activity(GO:0043906) Cys-tRNA(Pro) hydrolase activity(GO:0043907) Ser(Gly)-tRNA(Ala) hydrolase activity(GO:0043908) all-trans-retinyl-palmitate hydrolase, all-trans-retinol forming activity(GO:0047376) mannosyl-oligosaccharide 1,6-alpha-mannosidase activity(GO:0052767) mannosyl-oligosaccharide 1,3-alpha-mannosidase activity(GO:0052768) methyl indole-3-acetate esterase activity(GO:0080030) methyl salicylate esterase activity(GO:0080031) methyl jasmonate esterase activity(GO:0080032) |
0.1 | 0.1 | GO:0042887 | amide transmembrane transporter activity(GO:0042887) |
0.1 | 0.5 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.1 | 0.1 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
0.1 | 0.3 | GO:1990254 | keratin filament binding(GO:1990254) |
0.1 | 0.1 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.1 | 0.2 | GO:0097001 | ceramide binding(GO:0097001) |
0.1 | 0.2 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
0.1 | 0.3 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
0.1 | 0.2 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.0 | 0.9 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.0 | 0.7 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
0.0 | 0.1 | GO:0004365 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
0.0 | 0.1 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
0.0 | 0.0 | GO:0030487 | inositol-4,5-bisphosphate 5-phosphatase activity(GO:0030487) |
0.0 | 0.2 | GO:0001642 | group III metabotropic glutamate receptor activity(GO:0001642) |
0.0 | 0.2 | GO:0047105 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
0.0 | 0.0 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
0.0 | 0.5 | GO:0005536 | glucose binding(GO:0005536) |
0.0 | 0.2 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.0 | 0.1 | GO:0004802 | transketolase activity(GO:0004802) |
0.0 | 0.3 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
0.0 | 0.6 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
0.0 | 0.3 | GO:0004525 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
0.0 | 0.2 | GO:0004065 | arylsulfatase activity(GO:0004065) |
0.0 | 0.2 | GO:0004337 | geranyltranstransferase activity(GO:0004337) |
0.0 | 0.2 | GO:0031685 | adenosine receptor binding(GO:0031685) |
0.0 | 0.1 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.0 | 0.8 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
0.0 | 0.3 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.0 | 0.3 | GO:0001846 | opsonin binding(GO:0001846) |
0.0 | 0.0 | GO:0004376 | glycolipid mannosyltransferase activity(GO:0004376) |
0.0 | 2.0 | GO:0016763 | transferase activity, transferring pentosyl groups(GO:0016763) |
0.0 | 0.1 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.0 | 0.2 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
0.0 | 0.2 | GO:0043515 | kinetochore binding(GO:0043515) |
0.0 | 0.2 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
0.0 | 0.2 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
0.0 | 0.2 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
0.0 | 0.1 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
0.0 | 0.3 | GO:0046790 | virion binding(GO:0046790) |
0.0 | 0.5 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
0.0 | 0.6 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
0.0 | 0.1 | GO:1904680 | peptide-transporting ATPase activity(GO:0015440) peptide transmembrane transporter activity(GO:1904680) |
0.0 | 1.1 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
0.0 | 0.1 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.0 | 0.2 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.0 | 0.4 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.0 | 0.2 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
0.0 | 0.2 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.0 | 0.1 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.0 | 0.2 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
0.0 | 0.1 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
0.0 | 0.0 | GO:0002134 | UTP binding(GO:0002134) pyrimidine ribonucleoside binding(GO:0032551) |
0.0 | 0.3 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
0.0 | 0.1 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
0.0 | 0.2 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
0.0 | 0.1 | GO:0030284 | estrogen receptor activity(GO:0030284) |
0.0 | 0.1 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
0.0 | 0.9 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
0.0 | 0.3 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
0.0 | 0.3 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.0 | 0.1 | GO:0030350 | iron-responsive element binding(GO:0030350) |
0.0 | 0.0 | GO:0032052 | bile acid binding(GO:0032052) |
0.0 | 0.2 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.0 | 0.4 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.0 | 0.1 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
0.0 | 0.2 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.0 | 0.6 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.0 | 0.4 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.0 | 1.0 | GO:0015485 | cholesterol binding(GO:0015485) |
0.0 | 0.2 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
0.0 | 0.2 | GO:0005113 | patched binding(GO:0005113) |
0.0 | 0.1 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
0.0 | 0.1 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
0.0 | 0.2 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.0 | 0.3 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.0 | 0.0 | GO:0035251 | UDP-glucosyltransferase activity(GO:0035251) |
0.0 | 0.4 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
0.0 | 0.1 | GO:0061665 | SUMO ligase activity(GO:0061665) |
0.0 | 0.2 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.0 | 0.0 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
0.0 | 0.1 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
0.0 | 0.1 | GO:0047391 | alkylglycerophosphoethanolamine phosphodiesterase activity(GO:0047391) |
0.0 | 0.6 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
0.0 | 0.1 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.0 | 0.3 | GO:0004955 | prostaglandin receptor activity(GO:0004955) |
0.0 | 0.4 | GO:0005522 | profilin binding(GO:0005522) |
0.0 | 0.2 | GO:0015189 | arginine transmembrane transporter activity(GO:0015181) L-lysine transmembrane transporter activity(GO:0015189) |
0.0 | 0.1 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
0.0 | 0.1 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
0.0 | 0.0 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
0.0 | 0.6 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
0.0 | 0.7 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
0.0 | 0.1 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
0.0 | 0.1 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.0 | 0.0 | GO:0016015 | morphogen activity(GO:0016015) |
0.0 | 0.3 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
0.0 | 0.0 | GO:0015197 | peptide transporter activity(GO:0015197) |
0.0 | 0.2 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
0.0 | 0.2 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.0 | 0.1 | GO:0035877 | death effector domain binding(GO:0035877) |
0.0 | 0.1 | GO:0051373 | FATZ binding(GO:0051373) |
0.0 | 0.1 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
0.0 | 0.1 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
0.0 | 0.1 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
0.0 | 0.3 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
0.0 | 0.2 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
0.0 | 0.1 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
0.0 | 0.1 | GO:0043559 | insulin binding(GO:0043559) |
0.0 | 0.1 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
0.0 | 0.4 | GO:0008271 | secondary active sulfate transmembrane transporter activity(GO:0008271) |
0.0 | 0.0 | GO:0051380 | beta-adrenergic receptor activity(GO:0004939) norepinephrine binding(GO:0051380) |
0.0 | 0.1 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
0.0 | 0.1 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
0.0 | 0.4 | GO:0052712 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) photoreceptor cyclic-nucleotide phosphodiesterase activity(GO:0004120) 7,8-dihydro-D-neopterin 2',3'-cyclic phosphate phosphodiesterase activity(GO:0044688) inositol phosphosphingolipid phospholipase activity(GO:0052712) inositol phosphorylceramide phospholipase activity(GO:0052713) mannosyl-inositol phosphorylceramide phospholipase activity(GO:0052714) mannosyl-diinositol phosphorylceramide phospholipase activity(GO:0052715) |
0.0 | 0.1 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
0.0 | 0.3 | GO:0070700 | BMP receptor binding(GO:0070700) |
0.0 | 0.2 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
0.0 | 0.1 | GO:0016901 | oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
0.0 | 0.2 | GO:0035174 | histone serine kinase activity(GO:0035174) |
0.0 | 0.1 | GO:0001016 | RNA polymerase III regulatory region DNA binding(GO:0001016) |
0.0 | 1.6 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
0.0 | 0.1 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
0.0 | 0.8 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
0.0 | 0.1 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
0.0 | 0.1 | GO:0010858 | calcium-dependent protein kinase regulator activity(GO:0010858) |
0.0 | 0.3 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.0 | 0.1 | GO:0048030 | disaccharide binding(GO:0048030) |
0.0 | 0.5 | GO:0031489 | myosin V binding(GO:0031489) |
0.0 | 0.1 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.0 | 1.5 | GO:0042562 | hormone binding(GO:0042562) |
0.0 | 0.1 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.0 | 0.1 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
0.0 | 0.3 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
0.0 | 0.2 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.0 | 0.1 | GO:0004673 | protein histidine kinase activity(GO:0004673) |
0.0 | 0.2 | GO:0008430 | selenium binding(GO:0008430) |
0.0 | 0.2 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.0 | 0.3 | GO:0004568 | chitinase activity(GO:0004568) |
0.0 | 0.1 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
0.0 | 0.1 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
0.0 | 0.0 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
0.0 | 0.1 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
0.0 | 0.1 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.0 | 0.4 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
0.0 | 0.1 | GO:0051434 | BH3 domain binding(GO:0051434) |
0.0 | 0.7 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
0.0 | 0.2 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
0.0 | 0.1 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
0.0 | 0.1 | GO:0016212 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
0.0 | 0.1 | GO:0030274 | LIM domain binding(GO:0030274) |
0.0 | 0.4 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.0 | 0.2 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
0.0 | 0.2 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
0.0 | 0.0 | GO:0008061 | chitin binding(GO:0008061) |
0.0 | 0.1 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.0 | 0.0 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.0 | 0.6 | GO:0030351 | inositol-1,3,4,5,6-pentakisphosphate 3-phosphatase activity(GO:0030351) inositol-1,4,5,6-tetrakisphosphate 6-phosphatase activity(GO:0030352) inositol pentakisphosphate phosphatase activity(GO:0052827) |
0.0 | 0.1 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
0.0 | 0.1 | GO:0003910 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
0.0 | 0.1 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.0 | 0.1 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
0.0 | 0.2 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
0.0 | 0.2 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
0.0 | 0.1 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
0.0 | 0.3 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
0.0 | 0.2 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.0 | 0.1 | GO:0031127 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
0.0 | 0.1 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
0.0 | 0.1 | GO:0003896 | DNA primase activity(GO:0003896) |
0.0 | 0.2 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
0.0 | 0.1 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
0.0 | 0.0 | GO:0000405 | bubble DNA binding(GO:0000405) |
0.0 | 0.1 | GO:0019862 | IgA binding(GO:0019862) |
0.0 | 0.8 | GO:0000049 | tRNA binding(GO:0000049) |
0.0 | 0.7 | GO:0043022 | ribosome binding(GO:0043022) |
0.0 | 0.1 | GO:0043996 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
0.0 | 0.2 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.0 | 0.1 | GO:0010853 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
0.0 | 0.1 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.0 | 0.1 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
0.0 | 0.0 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.0 | 0.1 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.0 | 0.1 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
0.0 | 0.1 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
0.0 | 0.0 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
0.0 | 0.1 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
0.0 | 0.1 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
0.0 | 0.1 | GO:0030957 | Tat protein binding(GO:0030957) |
0.0 | 0.1 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
0.0 | 0.0 | GO:0004779 | sulfate adenylyltransferase activity(GO:0004779) |
0.0 | 0.1 | GO:0015288 | porin activity(GO:0015288) |
0.0 | 0.2 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
0.0 | 0.0 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.0 | 0.2 | GO:0015924 | mannosyl-oligosaccharide mannosidase activity(GO:0015924) |
0.0 | 0.2 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
0.0 | 0.1 | GO:0001163 | RNA polymerase I regulatory region DNA binding(GO:0001013) RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
0.0 | 0.1 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
0.0 | 0.1 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.0 | 0.1 | GO:0000182 | rDNA binding(GO:0000182) |
0.0 | 0.1 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.0 | 0.1 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
0.0 | 0.2 | GO:0048038 | quinone binding(GO:0048038) |
0.0 | 0.1 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.0 | 0.2 | GO:0055106 | ubiquitin-protein transferase regulator activity(GO:0055106) |
0.0 | 0.0 | GO:0034191 | apolipoprotein A-I receptor binding(GO:0034191) |
0.0 | 0.2 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
0.0 | 0.1 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
0.0 | 0.3 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
0.0 | 0.1 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.0 | 0.0 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
0.0 | 0.1 | GO:0070513 | death domain binding(GO:0070513) |
0.0 | 0.7 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
0.0 | 0.0 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
0.0 | 0.0 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
0.0 | 0.1 | GO:0052834 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
0.0 | 0.1 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
0.0 | 0.1 | GO:0031782 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
0.0 | 0.0 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.0 | 0.2 | GO:0070034 | telomerase RNA binding(GO:0070034) |
0.0 | 0.0 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
0.0 | 0.0 | GO:0032558 | adenyl deoxyribonucleotide binding(GO:0032558) |
0.0 | 0.2 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.0 | 0.0 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.0 | 0.1 | GO:0004370 | glycerol kinase activity(GO:0004370) |
0.0 | 1.2 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
0.0 | 0.1 | GO:0016151 | nickel cation binding(GO:0016151) |
0.0 | 0.2 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
0.0 | 0.1 | GO:0004556 | alpha-amylase activity(GO:0004556) |
0.0 | 0.6 | GO:0005109 | frizzled binding(GO:0005109) |
0.0 | 0.1 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.0 | 0.1 | GO:0070990 | snRNP binding(GO:0070990) |
0.0 | 0.1 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
0.0 | 0.0 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
0.0 | 0.0 | GO:0019114 | 2,3-dihydroxy DDT 1,2-dioxygenase activity(GO:0018542) phenanthrene dioxygenase activity(GO:0018555) 2,2',3-trihydroxybiphenyl dioxygenase activity(GO:0018556) 1,2-dihydroxyfluorene 1,1-alpha-dioxygenase activity(GO:0018557) 5,6-dihydroxy-3-methyl-2-oxo-1,2-dihydroquinoline dioxygenase activity(GO:0018558) 1,1-dichloro-2-(dihydroxy-4-chlorophenyl)-(4-chlorophenyl)ethene 1,2-dioxygenase activity(GO:0018559) protocatechuate 3,4-dioxygenase type II activity(GO:0018560) 2'-aminobiphenyl-2,3-diol 1,2-dioxygenase activity(GO:0018561) 3,4-dihydroxyfluorene 4,4-alpha-dioxygenase activity(GO:0018562) 2,3-dihydroxy-ethylbenzene 1,2-dioxygenase activity(GO:0018563) carbazole 1,9a-dioxygenase activity(GO:0018564) dihydroxydibenzothiophene dioxygenase activity(GO:0018565) 1,2-dihydroxynaphthalene-6-sulfonate 1,8a-dioxygenase activity(GO:0018566) styrene dioxygenase activity(GO:0018567) 3,4-dihydroxyphenanthrene dioxygenase activity(GO:0018568) hydroquinone 1,2-dioxygenase activity(GO:0018569) p-cumate 2,3-dioxygenase activity(GO:0018570) 2,3-dihydroxy-p-cumate dioxygenase activity(GO:0018571) 3,5-dichlorocatechol 1,2-dioxygenase activity(GO:0018572) 2-aminophenol 1,6-dioxygenase activity(GO:0018573) 2,6-dichloro-p-hydroquinone 1,2-dioxygenase activity(GO:0018574) chlorocatechol 1,2-dioxygenase activity(GO:0018575) catechol dioxygenase activity(GO:0019114) dihydroxyfluorene dioxygenase activity(GO:0019117) 5-aminosalicylate dioxygenase activity(GO:0034543) 3-hydroxy-2-naphthoate 2,3-dioxygenase activity(GO:0034803) benzo(a)pyrene 11,12-dioxygenase activity(GO:0034806) benzo(a)pyrene 4,5-dioxygenase activity(GO:0034808) 4,5-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034810) benzo(a)pyrene 9,10-dioxygenase activity(GO:0034811) 9,10-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034812) benzo(a)pyrene 7,8-dioxygenase activity(GO:0034813) 7,8-dihydroxy benzo(a)pyrene dioxygenase activity(GO:0034814) 1,2-dihydroxy-5,6,7,8-tetrahydronaphthalene extradiol dioxygenase activity(GO:0034827) 2-mercaptobenzothiazole dioxygenase activity(GO:0034834) pyridine-3,4-diol dioxygenase activity(GO:0034895) pyrene dioxygenase activity(GO:0034920) 4,5-dihydroxypyrene dioxygenase activity(GO:0034922) phenanthrene-4-carboxylate dioxygenase activity(GO:0034934) tetrachlorobenzene dioxygenase activity(GO:0034935) 4,6-dichloro-3-methylcatechol 1,2-dioxygenase activity(GO:0034936) 2,3-dihydroxydiphenyl ether dioxygenase activity(GO:0034955) diphenyl ether 1,2-dioxygenase activity(GO:0034956) arachidonate 8(S)-lipoxygenase activity(GO:0036403) 4-hydroxycatechol 1,2-dioxygenase activity(GO:0047074) |
0.0 | 0.0 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
0.0 | 0.1 | GO:0032135 | DNA insertion or deletion binding(GO:0032135) |
0.0 | 0.1 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
0.0 | 0.1 | GO:0002162 | dystroglycan binding(GO:0002162) |
0.0 | 0.1 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
0.0 | 0.0 | GO:0070052 | collagen V binding(GO:0070052) |
0.0 | 0.0 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.0 | 0.1 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
0.0 | 0.2 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
0.0 | 0.1 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
0.0 | 0.2 | GO:0016918 | retinal binding(GO:0016918) |
0.0 | 0.1 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.0 | 0.1 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
0.0 | 0.1 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.0 | 0.1 | GO:0005523 | tropomyosin binding(GO:0005523) |
0.0 | 0.2 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.0 | 0.3 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
0.0 | 0.1 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) |
0.0 | 0.1 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
0.0 | 0.1 | GO:0022858 | L-alanine transmembrane transporter activity(GO:0015180) alanine transmembrane transporter activity(GO:0022858) |
0.0 | 0.1 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.0 | 0.2 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
0.0 | 0.1 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.0 | 0.1 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
0.0 | 0.1 | GO:0031720 | haptoglobin binding(GO:0031720) |
0.0 | 1.0 | GO:0036459 | thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) ubiquitinyl hydrolase activity(GO:0101005) |
0.0 | 0.1 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
0.0 | 0.1 | GO:0016004 | phospholipase activator activity(GO:0016004) |
0.0 | 0.0 | GO:0015923 | mannosidase activity(GO:0015923) |
0.0 | 0.1 | GO:0004661 | protein geranylgeranyltransferase activity(GO:0004661) |
0.0 | 0.0 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
0.0 | 0.1 | GO:0019200 | carbohydrate kinase activity(GO:0019200) |
0.0 | 0.1 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
0.0 | 0.1 | GO:0016208 | AMP binding(GO:0016208) |
0.0 | 0.1 | GO:0030955 | potassium ion binding(GO:0030955) |
0.0 | 0.2 | GO:0005372 | water transmembrane transporter activity(GO:0005372) |
0.0 | 0.0 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
0.0 | 0.2 | GO:0004889 | acetylcholine-activated cation-selective channel activity(GO:0004889) |
0.0 | 0.0 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
0.0 | 0.0 | GO:0003954 | NADH dehydrogenase activity(GO:0003954) |
0.0 | 0.1 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
0.0 | 0.0 | GO:0002046 | opsin binding(GO:0002046) |
0.0 | 1.0 | GO:0017124 | SH3 domain binding(GO:0017124) |
0.0 | 0.5 | GO:0035326 | enhancer binding(GO:0035326) |
0.0 | 0.0 | GO:0019808 | polyamine binding(GO:0019808) |
0.0 | 0.2 | GO:0031491 | nucleosome binding(GO:0031491) |
0.0 | 0.0 | GO:0004645 | phosphorylase activity(GO:0004645) |
0.0 | 0.1 | GO:0016679 | oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) |
0.0 | 0.0 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.0 | 0.0 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
0.0 | 0.0 | GO:0031748 | D1 dopamine receptor binding(GO:0031748) |
0.0 | 0.0 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.0 | 0.2 | GO:0005326 | neurotransmitter transporter activity(GO:0005326) |
0.0 | 0.0 | GO:0004659 | prenyltransferase activity(GO:0004659) |
0.0 | 0.1 | GO:0008375 | acetylglucosaminyltransferase activity(GO:0008375) |
0.0 | 0.0 | GO:0004723 | calcium-dependent protein serine/threonine phosphatase activity(GO:0004723) |
0.0 | 0.1 | GO:0019992 | diacylglycerol binding(GO:0019992) |
0.0 | 0.1 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
0.0 | 0.0 | GO:0001640 | adenylate cyclase inhibiting G-protein coupled glutamate receptor activity(GO:0001640) |
0.0 | 0.0 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 6.5 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.1 | 2.9 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.1 | 2.0 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
0.1 | 1.9 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.1 | 0.2 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.1 | 0.4 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.1 | 3.0 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
0.1 | 2.3 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
0.1 | 0.6 | PID ALK2 PATHWAY | ALK2 signaling events |
0.1 | 0.9 | PID S1P S1P2 PATHWAY | S1P2 pathway |
0.1 | 1.4 | PID IGF1 PATHWAY | IGF1 pathway |
0.1 | 0.4 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.0 | 0.0 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.0 | 2.3 | PID P73PATHWAY | p73 transcription factor network |
0.0 | 0.2 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
0.0 | 0.3 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
0.0 | 0.3 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
0.0 | 1.3 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
0.0 | 0.3 | PID S1P S1P1 PATHWAY | S1P1 pathway |
0.0 | 0.1 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
0.0 | 0.1 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.0 | 0.1 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.0 | 0.7 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.0 | 0.2 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
0.0 | 0.2 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
0.0 | 1.1 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.0 | 0.2 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
0.0 | 0.9 | PID AURORA B PATHWAY | Aurora B signaling |
0.0 | 1.1 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
0.0 | 0.4 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.0 | 0.4 | PID ALK1 PATHWAY | ALK1 signaling events |
0.0 | 0.3 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.0 | 0.1 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.0 | 1.0 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.0 | 0.3 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.0 | 0.3 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.0 | 0.5 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.0 | 0.9 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
0.0 | 0.4 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.0 | 0.4 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
0.0 | 0.2 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.0 | 0.1 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
0.0 | 0.4 | PID ATM PATHWAY | ATM pathway |
0.0 | 0.3 | PID RHOA PATHWAY | RhoA signaling pathway |
0.0 | 0.4 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.0 | 0.1 | PID SHP2 PATHWAY | SHP2 signaling |
0.0 | 0.1 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.0 | 0.3 | PID REELIN PATHWAY | Reelin signaling pathway |
0.0 | 0.1 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
0.0 | 0.2 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
0.0 | 0.6 | NABA COLLAGENS | Genes encoding collagen proteins |
0.0 | 0.3 | PID ARF6 PATHWAY | Arf6 signaling events |
0.0 | 0.1 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.0 | 0.4 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.0 | 0.3 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
0.0 | 0.0 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.0 | 0.3 | PID P53 REGULATION PATHWAY | p53 pathway |
0.0 | 0.0 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
0.0 | 0.0 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
0.0 | 0.2 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 7.0 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.2 | 0.6 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
0.2 | 2.0 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
0.2 | 2.2 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
0.2 | 1.6 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.2 | 1.4 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
0.2 | 1.8 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.1 | 0.9 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
0.1 | 1.8 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.1 | 3.1 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.1 | 1.0 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
0.1 | 1.8 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
0.1 | 0.1 | REACTOME CDT1 ASSOCIATION WITH THE CDC6 ORC ORIGIN COMPLEX | Genes involved in CDT1 association with the CDC6:ORC:origin complex |
0.1 | 1.9 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.1 | 1.2 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
0.1 | 1.5 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
0.1 | 0.2 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.1 | 0.1 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
0.1 | 1.2 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
0.1 | 2.3 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
0.1 | 0.2 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
0.1 | 0.2 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
0.1 | 0.1 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
0.1 | 0.5 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
0.1 | 0.2 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
0.1 | 0.1 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.1 | 1.4 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.1 | 0.4 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
0.1 | 0.7 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
0.1 | 0.6 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.1 | 0.1 | REACTOME RNA POL I TRANSCRIPTION | Genes involved in RNA Polymerase I Transcription |
0.1 | 1.1 | REACTOME FGFR LIGAND BINDING AND ACTIVATION | Genes involved in FGFR ligand binding and activation |
0.1 | 0.2 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.1 | 0.6 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
0.1 | 0.1 | REACTOME ABORTIVE ELONGATION OF HIV1 TRANSCRIPT IN THE ABSENCE OF TAT | Genes involved in Abortive elongation of HIV-1 transcript in the absence of Tat |
0.1 | 0.1 | REACTOME MITOTIC M M G1 PHASES | Genes involved in Mitotic M-M/G1 phases |
0.0 | 0.5 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.0 | 0.1 | REACTOME S PHASE | Genes involved in S Phase |
0.0 | 0.7 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.0 | 0.9 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.0 | 0.2 | REACTOME NUCLEOTIDE BINDING DOMAIN LEUCINE RICH REPEAT CONTAINING RECEPTOR NLR SIGNALING PATHWAYS | Genes involved in Nucleotide-binding domain, leucine rich repeat containing receptor (NLR) signaling pathways |
0.0 | 0.5 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
0.0 | 0.6 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.0 | 0.8 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.0 | 0.4 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
0.0 | 0.5 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
0.0 | 1.7 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.0 | 0.2 | REACTOME ADP SIGNALLING THROUGH P2RY12 | Genes involved in ADP signalling through P2Y purinoceptor 12 |
0.0 | 0.2 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.0 | 0.3 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.0 | 0.3 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.0 | 0.9 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.0 | 0.0 | REACTOME PLC BETA MEDIATED EVENTS | Genes involved in PLC beta mediated events |
0.0 | 0.1 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
0.0 | 0.3 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
0.0 | 3.2 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
0.0 | 0.3 | REACTOME CTLA4 INHIBITORY SIGNALING | Genes involved in CTLA4 inhibitory signaling |
0.0 | 0.1 | REACTOME ADP SIGNALLING THROUGH P2RY1 | Genes involved in ADP signalling through P2Y purinoceptor 1 |
0.0 | 0.3 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.0 | 1.3 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.0 | 0.6 | REACTOME MUSCLE CONTRACTION | Genes involved in Muscle contraction |
0.0 | 0.2 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
0.0 | 0.3 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.0 | 0.3 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.0 | 0.3 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.0 | 0.2 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
0.0 | 0.3 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
0.0 | 1.5 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
0.0 | 0.3 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
0.0 | 0.0 | REACTOME DOWNSTREAM SIGNALING EVENTS OF B CELL RECEPTOR BCR | Genes involved in Downstream Signaling Events Of B Cell Receptor (BCR) |
0.0 | 0.6 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
0.0 | 0.2 | REACTOME PKB MEDIATED EVENTS | Genes involved in PKB-mediated events |
0.0 | 0.3 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
0.0 | 0.1 | REACTOME REGULATORY RNA PATHWAYS | Genes involved in Regulatory RNA pathways |
0.0 | 0.2 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
0.0 | 0.2 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
0.0 | 0.3 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.0 | 0.2 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
0.0 | 0.1 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.0 | 0.1 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.0 | 0.6 | REACTOME TRANSLATION | Genes involved in Translation |
0.0 | 0.3 | REACTOME PRE NOTCH EXPRESSION AND PROCESSING | Genes involved in Pre-NOTCH Expression and Processing |
0.0 | 0.2 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
0.0 | 0.2 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
0.0 | 0.4 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
0.0 | 0.1 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
0.0 | 0.3 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.0 | 0.1 | REACTOME PROCESSIVE SYNTHESIS ON THE LAGGING STRAND | Genes involved in Processive synthesis on the lagging strand |
0.0 | 0.1 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
0.0 | 0.2 | REACTOME N GLYCAN TRIMMING IN THE ER AND CALNEXIN CALRETICULIN CYCLE | Genes involved in N-glycan trimming in the ER and Calnexin/Calreticulin cycle |
0.0 | 0.1 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
0.0 | 0.5 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
0.0 | 0.1 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
0.0 | 0.0 | REACTOME PHOSPHORYLATION OF THE APC C | Genes involved in Phosphorylation of the APC/C |
0.0 | 0.3 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.0 | 1.7 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
0.0 | 0.0 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
0.0 | 0.3 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
0.0 | 0.1 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
0.0 | 0.8 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
0.0 | 0.2 | REACTOME SIGNALING BY FGFR1 MUTANTS | Genes involved in Signaling by FGFR1 mutants |
0.0 | 0.2 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
0.0 | 0.1 | REACTOME TGF BETA RECEPTOR SIGNALING ACTIVATES SMADS | Genes involved in TGF-beta receptor signaling activates SMADs |
0.0 | 0.3 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.0 | 0.0 | REACTOME POST NMDA RECEPTOR ACTIVATION EVENTS | Genes involved in Post NMDA receptor activation events |
0.0 | 0.1 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.0 | 0.2 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
0.0 | 0.2 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
0.0 | 0.2 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.0 | 0.3 | REACTOME INTERFERON GAMMA SIGNALING | Genes involved in Interferon gamma signaling |
0.0 | 0.6 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
0.0 | 0.1 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.0 | 0.4 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.0 | 0.0 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
0.0 | 0.2 | REACTOME GLUCOSE METABOLISM | Genes involved in Glucose metabolism |
0.0 | 0.1 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.0 | 0.1 | REACTOME ANTIGEN PROCESSING CROSS PRESENTATION | Genes involved in Antigen processing-Cross presentation |
0.0 | 0.2 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |