| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Nkx2-3
|
ENSMUSG00000044220.12 | NK2 homeobox 3 |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr12_104347486_104347696 | 3.08 |
Serpina3k |
serine (or cysteine) peptidase inhibitor, clade A, member 3K |
9105 |
0.12 |
| chr2_8123996_8124147 | 2.72 |
Gm13254 |
predicted gene 13254 |
23794 |
0.29 |
| chr17_80022007_80022158 | 2.09 |
Gm22215 |
predicted gene, 22215 |
11432 |
0.14 |
| chr5_66094198_66094378 | 2.08 |
Rbm47 |
RNA binding motif protein 47 |
3903 |
0.15 |
| chr19_40160205_40160356 | 1.95 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
27006 |
0.14 |
| chr16_93333790_93334136 | 1.95 |
1810053B23Rik |
RIKEN cDNA 1810053B23 gene |
19226 |
0.18 |
| chr8_90940222_90940373 | 1.94 |
Chd9 |
chromodomain helicase DNA binding protein 9 |
7953 |
0.17 |
| chr13_115653330_115653690 | 1.83 |
Gm47892 |
predicted gene, 47892 |
65989 |
0.13 |
| chr3_149180418_149180610 | 1.80 |
Gm42647 |
predicted gene 42647 |
29757 |
0.19 |
| chr19_44395706_44395857 | 1.71 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
10909 |
0.14 |
| chr9_74894770_74895613 | 1.71 |
Onecut1 |
one cut domain, family member 1 |
28707 |
0.13 |
| chr10_113290132_113290294 | 1.70 |
Gm47532 |
predicted gene, 47532 |
133971 |
0.05 |
| chr12_57317079_57317230 | 1.69 |
Mipol1 |
mirror-image polydactyly 1 |
11071 |
0.22 |
| chr10_111583801_111583952 | 1.69 |
4933440J02Rik |
RIKEN cDNA 4933440J02 gene |
10397 |
0.16 |
| chr11_111998446_111998808 | 1.67 |
Gm11679 |
predicted gene 11679 |
44951 |
0.19 |
| chr3_18164974_18165125 | 1.61 |
Gm23686 |
predicted gene, 23686 |
12576 |
0.23 |
| chr1_97770980_97771325 | 1.57 |
Ppip5k2 |
diphosphoinositol pentakisphosphate kinase 2 |
741 |
0.49 |
| chr5_125516996_125517147 | 1.57 |
Aacs |
acetoacetyl-CoA synthetase |
1828 |
0.29 |
| chr8_45719244_45719451 | 1.56 |
Sorbs2 |
sorbin and SH3 domain containing 2 |
23834 |
0.18 |
| chr1_67169083_67169234 | 1.55 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
46132 |
0.15 |
| chr4_15066667_15066833 | 1.53 |
Gm11844 |
predicted gene 11844 |
44168 |
0.16 |
| chr19_45902358_45902683 | 1.51 |
Gm6813 |
predicted gene 6813 |
24394 |
0.14 |
| chr19_34717517_34717702 | 1.50 |
Gm18425 |
predicted gene, 18425 |
7601 |
0.14 |
| chr4_72766654_72766805 | 1.50 |
Aldoart1 |
aldolase 1 A, retrogene 1 |
85903 |
0.09 |
| chr5_147312834_147312985 | 1.46 |
Cdx2 |
caudal type homeobox 2 |
5639 |
0.11 |
| chr18_12799044_12799195 | 1.44 |
Osbpl1a |
oxysterol binding protein-like 1A |
20479 |
0.15 |
| chr9_31032003_31032163 | 1.44 |
Gm29724 |
predicted gene, 29724 |
878 |
0.48 |
| chr7_101085910_101086353 | 1.43 |
Fchsd2 |
FCH and double SH3 domains 2 |
6732 |
0.17 |
| chr3_18178370_18178521 | 1.43 |
Gm23686 |
predicted gene, 23686 |
820 |
0.7 |
| chr13_115653702_115653853 | 1.41 |
Gm47892 |
predicted gene, 47892 |
65722 |
0.13 |
| chr15_102752976_102753138 | 1.41 |
Calcoco1 |
calcium binding and coiled coil domain 1 |
30879 |
0.11 |
| chr3_18210346_18210497 | 1.41 |
Gm23686 |
predicted gene, 23686 |
32796 |
0.17 |
| chr6_51700821_51700988 | 1.39 |
Gm38811 |
predicted gene, 38811 |
10177 |
0.25 |
| chr13_51232215_51232383 | 1.38 |
Gm29787 |
predicted gene, 29787 |
26188 |
0.14 |
| chr2_58791427_58791720 | 1.38 |
Upp2 |
uridine phosphorylase 2 |
26248 |
0.18 |
| chr15_55043394_55043818 | 1.37 |
Taf2 |
TATA-box binding protein associated factor 2 |
2560 |
0.24 |
| chr3_5425056_5425268 | 1.36 |
4930555M17Rik |
RIKEN cDNA 4930555M17 gene |
90171 |
0.09 |
| chr19_31886956_31887132 | 1.35 |
A1cf |
APOBEC1 complementation factor |
18263 |
0.2 |
| chr7_67648192_67648343 | 1.35 |
Ttc23 |
tetratricopeptide repeat domain 23 |
807 |
0.52 |
| chr2_7569856_7570102 | 1.33 |
Gm28641 |
predicted gene 28641 |
40040 |
0.17 |
| chr9_74870536_74870729 | 1.33 |
Onecut1 |
one cut domain, family member 1 |
4148 |
0.18 |
| chr15_62705006_62705181 | 1.32 |
Gm24810 |
predicted gene, 24810 |
52089 |
0.16 |
| chr8_93185394_93185584 | 1.32 |
Gm45909 |
predicted gene 45909 |
5869 |
0.14 |
| chr9_55280024_55280330 | 1.32 |
Nrg4 |
neuregulin 4 |
3395 |
0.23 |
| chr10_111203502_111203653 | 1.31 |
Gm17849 |
predicted gene, 17849 |
23625 |
0.14 |
| chr7_70514791_70515356 | 1.31 |
Gm44811 |
predicted gene 44811 |
16149 |
0.13 |
| chr1_51750897_51751126 | 1.30 |
Gm28055 |
predicted gene 28055 |
4068 |
0.24 |
| chr4_122982836_122983021 | 1.30 |
Mycl |
v-myc avian myelocytomatosis viral oncogene lung carcinoma derived |
12724 |
0.13 |
| chr1_162986828_162987029 | 1.29 |
Fmo3 |
flavin containing monooxygenase 3 |
2400 |
0.25 |
| chr19_44394826_44394979 | 1.29 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
11788 |
0.14 |
| chr13_101718622_101718773 | 1.27 |
Pik3r1 |
phosphoinositide-3-kinase regulatory subunit 1 |
16593 |
0.2 |
| chr2_72156858_72157041 | 1.26 |
Rapgef4os1 |
Rap guanine nucleotide exchange factor (GEF) 4, opposite strand 1 |
8153 |
0.2 |
| chr12_104346091_104346278 | 1.26 |
Serpina3k |
serine (or cysteine) peptidase inhibitor, clade A, member 3K |
7698 |
0.12 |
| chr4_97102666_97103047 | 1.25 |
Gm27521 |
predicted gene, 27521 |
185836 |
0.03 |
| chr7_140722780_140722931 | 1.25 |
Olfr542-ps1 |
olfactory receptor 542, pseudogene 1 |
1573 |
0.22 |
| chr6_14778417_14778568 | 1.24 |
Ppp1r3a |
protein phosphatase 1, regulatory subunit 3A |
23218 |
0.27 |
| chr13_16574847_16575001 | 1.24 |
Gm48497 |
predicted gene, 48497 |
41103 |
0.17 |
| chr7_63922331_63923024 | 1.23 |
Klf13 |
Kruppel-like factor 13 |
2193 |
0.22 |
| chr11_4832480_4832698 | 1.23 |
Nf2 |
neurofibromin 2 |
544 |
0.74 |
| chr7_114430523_114430674 | 1.22 |
Pde3b |
phosphodiesterase 3B, cGMP-inhibited |
15317 |
0.2 |
| chr5_125524109_125525122 | 1.22 |
Tmem132b |
transmembrane protein 132B |
7159 |
0.16 |
| chr12_12499785_12499936 | 1.21 |
4921511I17Rik |
RIKEN cDNA 4921511I17 gene |
107245 |
0.07 |
| chr6_59348049_59348218 | 1.21 |
Gprin3 |
GPRIN family member 3 |
78161 |
0.11 |
| chr2_70813245_70813396 | 1.20 |
Tlk1 |
tousled-like kinase 1 |
11908 |
0.21 |
| chr6_143857220_143857571 | 1.19 |
Sox5 |
SRY (sex determining region Y)-box 5 |
89693 |
0.09 |
| chr8_109981175_109981347 | 1.19 |
Gm45795 |
predicted gene 45795 |
6909 |
0.13 |
| chr2_31519719_31520357 | 1.19 |
Ass1 |
argininosuccinate synthetase 1 |
1548 |
0.36 |
| chr11_58100366_58100593 | 1.19 |
Gm12247 |
predicted gene 12247 |
2706 |
0.16 |
| chr3_97649987_97650151 | 1.18 |
Prkab2 |
protein kinase, AMP-activated, beta 2 non-catalytic subunit |
8124 |
0.13 |
| chr3_52652772_52653049 | 1.16 |
Gm10293 |
predicted pseudogene 10293 |
40075 |
0.16 |
| chr1_67195986_67196354 | 1.15 |
Gm15668 |
predicted gene 15668 |
53030 |
0.13 |
| chr10_87868820_87868971 | 1.15 |
Igf1os |
insulin-like growth factor 1, opposite strand |
5514 |
0.22 |
| chr3_55113077_55113240 | 1.15 |
Spg20 |
spastic paraplegia 20, spartin (Troyer syndrome) homolog (human) |
562 |
0.72 |
| chr10_111367147_111367312 | 1.15 |
Gm40761 |
predicted gene, 40761 |
30105 |
0.16 |
| chr14_21411001_21411208 | 1.15 |
Gm25864 |
predicted gene, 25864 |
39370 |
0.14 |
| chr15_59066617_59066768 | 1.13 |
Mtss1 |
MTSS I-BAR domain containing 1 |
11228 |
0.23 |
| chr19_40191993_40192245 | 1.13 |
Gm5827 |
predicted gene 5827 |
1081 |
0.44 |
| chr4_121077501_121077678 | 1.13 |
Zmpste24 |
zinc metallopeptidase, STE24 |
149 |
0.9 |
| chr11_16764973_16765411 | 1.12 |
Egfr |
epidermal growth factor receptor |
12962 |
0.2 |
| chr2_18048778_18049088 | 1.12 |
Skida1 |
SKI/DACH domain containing 1 |
98 |
0.94 |
| chr9_43081429_43081580 | 1.11 |
Arhgef12 |
Rho guanine nucleotide exchange factor (GEF) 12 |
23982 |
0.17 |
| chr3_12608407_12608567 | 1.10 |
Gm2429 |
predicted gene 2429 |
22773 |
0.28 |
| chrX_85734642_85734808 | 1.10 |
Gk |
glycerol kinase |
2885 |
0.21 |
| chr3_51226339_51227024 | 1.09 |
Noct |
nocturnin |
2211 |
0.23 |
| chr18_33335416_33335586 | 1.08 |
Gm5503 |
predicted gene 5503 |
49454 |
0.16 |
| chr7_126673507_126673658 | 1.08 |
Sgf29 |
SAGA complex associated factor 29 |
1551 |
0.16 |
| chr1_100298746_100298897 | 1.07 |
Gm29667 |
predicted gene 29667 |
16030 |
0.18 |
| chr8_36753814_36753974 | 1.06 |
Dlc1 |
deleted in liver cancer 1 |
20840 |
0.26 |
| chr5_125479434_125479671 | 1.06 |
Gm27551 |
predicted gene, 27551 |
175 |
0.92 |
| chr19_21654390_21654886 | 1.04 |
Abhd17b |
abhydrolase domain containing 17B |
1113 |
0.45 |
| chr10_68137101_68137496 | 1.03 |
Arid5b |
AT rich interactive domain 5B (MRF1-like) |
672 |
0.78 |
| chr1_21266470_21266781 | 1.03 |
Gm28836 |
predicted gene 28836 |
4968 |
0.12 |
| chr4_6264246_6265210 | 1.02 |
Gm11798 |
predicted gene 11798 |
3763 |
0.24 |
| chr7_87371791_87371944 | 1.02 |
Tyr |
tyrosinase |
121525 |
0.05 |
| chr1_67192772_67192960 | 1.02 |
Gm15668 |
predicted gene 15668 |
56334 |
0.12 |
| chr3_60112130_60112285 | 1.02 |
Gm24382 |
predicted gene, 24382 |
15540 |
0.19 |
| chr19_26823641_26823967 | 1.01 |
4931403E22Rik |
RIKEN cDNA 4931403E22 gene |
103 |
0.97 |
| chr9_74328635_74328791 | 1.01 |
Gm24141 |
predicted gene, 24141 |
33897 |
0.17 |
| chr14_118018393_118018554 | 1.01 |
Dct |
dopachrome tautomerase |
9062 |
0.21 |
| chr11_62433617_62433927 | 1.00 |
Ncor1 |
nuclear receptor co-repressor 1 |
4709 |
0.17 |
| chr5_52945521_52945741 | 0.99 |
Gm23532 |
predicted gene, 23532 |
13831 |
0.15 |
| chr5_77314693_77314994 | 0.99 |
Gm42758 |
predicted gene 42758 |
3812 |
0.15 |
| chr13_43445030_43445211 | 0.99 |
Ranbp9 |
RAN binding protein 9 |
14324 |
0.13 |
| chr6_149344317_149344633 | 0.99 |
Gm15782 |
predicted gene 15782 |
9351 |
0.14 |
| chr11_16798476_16798627 | 0.99 |
Egfros |
epidermal growth factor receptor, opposite strand |
32151 |
0.16 |
| chr9_122849425_122849576 | 0.99 |
Gm47140 |
predicted gene, 47140 |
1082 |
0.34 |
| chr6_51681013_51681175 | 0.98 |
Gm38811 |
predicted gene, 38811 |
29987 |
0.19 |
| chr4_148616552_148616759 | 0.98 |
Tardbp |
TAR DNA binding protein |
325 |
0.81 |
| chr3_51255928_51256079 | 0.98 |
Elf2 |
E74-like factor 2 |
4238 |
0.15 |
| chr19_40174636_40174787 | 0.98 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
12575 |
0.15 |
| chr15_6891120_6891319 | 0.97 |
Osmr |
oncostatin M receptor |
16250 |
0.26 |
| chr6_59446350_59446583 | 0.96 |
Gprin3 |
GPRIN family member 3 |
20172 |
0.28 |
| chr2_58765903_58766054 | 0.96 |
Upp2 |
uridine phosphorylase 2 |
653 |
0.74 |
| chr16_65665507_65665824 | 0.96 |
Gm49633 |
predicted gene, 49633 |
52246 |
0.14 |
| chr16_45996562_45996713 | 0.96 |
Plcxd2 |
phosphatidylinositol-specific phospholipase C, X domain containing 2 |
13581 |
0.16 |
| chr6_29571610_29572022 | 0.96 |
Tnpo3 |
transportin 3 |
297 |
0.87 |
| chr13_44420237_44420395 | 0.96 |
1700029N11Rik |
RIKEN cDNA 1700029N11 gene |
19396 |
0.14 |
| chr16_59413660_59413813 | 0.95 |
Gabrr3 |
gamma-aminobutyric acid (GABA) receptor, rho 3 |
6404 |
0.16 |
| chr9_9173231_9173382 | 0.95 |
Gm16833 |
predicted gene, 16833 |
62982 |
0.13 |
| chr19_55110942_55111169 | 0.95 |
Gpam |
glycerol-3-phosphate acyltransferase, mitochondrial |
7964 |
0.2 |
| chr3_95872352_95872534 | 0.95 |
C920021L13Rik |
RIKEN cDNA C920021L13 gene |
912 |
0.26 |
| chr6_149151686_149151841 | 0.95 |
Etfbkmt |
electron transfer flavoprotein beta subunit lysine methyltransferase |
10117 |
0.13 |
| chr3_148762124_148762275 | 0.94 |
Adgrl2 |
adhesion G protein-coupled receptor L2 |
60780 |
0.14 |
| chr19_10099300_10099508 | 0.94 |
Fads2 |
fatty acid desaturase 2 |
2342 |
0.23 |
| chr10_130541752_130541903 | 0.93 |
Gm31793 |
predicted gene, 31793 |
520 |
0.7 |
| chr10_4605446_4605660 | 0.92 |
Esr1 |
estrogen receptor 1 (alpha) |
6040 |
0.23 |
| chr11_110431257_110431440 | 0.92 |
Map2k6 |
mitogen-activated protein kinase kinase 6 |
32089 |
0.21 |
| chr5_99976807_99976958 | 0.92 |
Hnrnpd |
heterogeneous nuclear ribonucleoprotein D |
331 |
0.73 |
| chr15_55635658_55635834 | 0.92 |
Mtbp |
Mdm2, transformed 3T3 cell double minute p53 binding protein |
14294 |
0.25 |
| chr1_153739671_153739993 | 0.92 |
Rgs16 |
regulator of G-protein signaling 16 |
517 |
0.61 |
| chr14_7820539_7820861 | 0.92 |
Flnb |
filamin, beta |
2743 |
0.22 |
| chr10_89471287_89471467 | 0.91 |
Gas2l3 |
growth arrest-specific 2 like 3 |
27410 |
0.18 |
| chr1_21261382_21261702 | 0.91 |
Gsta3 |
glutathione S-transferase, alpha 3 |
8021 |
0.11 |
| chr9_74881714_74881880 | 0.91 |
Onecut1 |
one cut domain, family member 1 |
15313 |
0.15 |
| chr7_46729288_46729439 | 0.90 |
Saa4 |
serum amyloid A 4 |
3240 |
0.11 |
| chr1_162892544_162892705 | 0.90 |
Fmo2 |
flavin containing monooxygenase 2 |
5860 |
0.19 |
| chr17_63370765_63370929 | 0.90 |
Gm24813 |
predicted gene, 24813 |
23176 |
0.18 |
| chrX_156479377_156479543 | 0.90 |
Gm23404 |
predicted gene, 23404 |
23365 |
0.24 |
| chr1_67160568_67161028 | 0.89 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
37772 |
0.17 |
| chr6_108447115_108447266 | 0.89 |
Itpr1 |
inositol 1,4,5-trisphosphate receptor 1 |
11513 |
0.19 |
| chr18_38856344_38856590 | 0.89 |
Fgf1 |
fibroblast growth factor 1 |
2281 |
0.33 |
| chr15_81847424_81847575 | 0.89 |
Gm8444 |
predicted gene 8444 |
3786 |
0.11 |
| chr5_87378725_87378979 | 0.89 |
Gm21049 |
predicted gene, 21049 |
1068 |
0.35 |
| chr1_131919723_131919874 | 0.89 |
Gm38067 |
predicted gene, 38067 |
5269 |
0.12 |
| chr1_162867234_162867433 | 0.89 |
Fmo1 |
flavin containing monooxygenase 1 |
723 |
0.66 |
| chr3_81149765_81149938 | 0.89 |
Gm16000 |
predicted gene 16000 |
109414 |
0.06 |
| chr6_72120521_72121047 | 0.88 |
4933431G14Rik |
RIKEN cDNA 4933431G14 gene |
2156 |
0.2 |
| chr5_43309511_43309822 | 0.88 |
6030400A10Rik |
RIKEN cDNA 6030400A10 gene |
44509 |
0.11 |
| chr8_76152377_76152560 | 0.88 |
Gm45742 |
predicted gene 45742 |
35441 |
0.19 |
| chr1_67132947_67133268 | 0.88 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
10081 |
0.24 |
| chr1_21262098_21262745 | 0.88 |
Gsta3 |
glutathione S-transferase, alpha 3 |
8900 |
0.11 |
| chr6_142802674_142803104 | 0.88 |
Sult6b2 |
sulfotransferase family 6B, member 2 |
1577 |
0.36 |
| chr1_195223205_195223404 | 0.88 |
Gm37887 |
predicted gene, 37887 |
538 |
0.73 |
| chr11_100474958_100475151 | 0.88 |
Klhl11 |
kelch-like 11 |
2313 |
0.14 |
| chr12_57537784_57538085 | 0.87 |
Foxa1 |
forkhead box A1 |
8187 |
0.15 |
| chr1_172168265_172168469 | 0.87 |
Dcaf8 |
DDB1 and CUL4 associated factor 8 |
5587 |
0.11 |
| chr2_58783987_58784138 | 0.87 |
Upp2 |
uridine phosphorylase 2 |
18737 |
0.19 |
| chr17_28428613_28428954 | 0.87 |
Fkbp5 |
FK506 binding protein 5 |
154 |
0.91 |
| chr9_61309836_61310197 | 0.87 |
B930092H01Rik |
RIKEN cDNA B930092H01 gene |
16207 |
0.2 |
| chr2_58511510_58511661 | 0.87 |
Acvr1 |
activin A receptor, type 1 |
4687 |
0.25 |
| chr12_16562529_16562714 | 0.87 |
Lpin1 |
lipin 1 |
177 |
0.97 |
| chr4_106194986_106195137 | 0.87 |
Gm12724 |
predicted gene 12724 |
46155 |
0.11 |
| chr14_61645587_61645738 | 0.87 |
Dleu2 |
deleted in lymphocytic leukemia, 2 |
2960 |
0.11 |
| chr6_136906482_136906715 | 0.86 |
Erp27 |
endoplasmic reticulum protein 27 |
15542 |
0.11 |
| chr3_149234408_149234559 | 0.85 |
Gm10287 |
predicted gene 10287 |
8738 |
0.21 |
| chr1_60545486_60545637 | 0.85 |
Gm11576 |
predicted gene 11576 |
8541 |
0.14 |
| chr14_34326226_34326377 | 0.85 |
Glud1 |
glutamate dehydrogenase 1 |
2361 |
0.17 |
| chr18_76968080_76968231 | 0.85 |
Hdhd2 |
haloacid dehalogenase-like hydrolase domain containing 2 |
23718 |
0.15 |
| chr4_141955631_141955810 | 0.85 |
Fhad1 |
forkhead-associated (FHA) phosphopeptide binding domain 1 |
1526 |
0.3 |
| chr9_111128128_111128279 | 0.85 |
Lrrfip2 |
leucine rich repeat (in FLII) interacting protein 2 |
8528 |
0.16 |
| chr3_129593850_129594054 | 0.85 |
Elovl6 |
ELOVL family member 6, elongation of long chain fatty acids (yeast) |
41572 |
0.12 |
| chr1_65167472_65167777 | 0.85 |
Idh1 |
isocitrate dehydrogenase 1 (NADP+), soluble |
7940 |
0.14 |
| chr3_95879412_95879563 | 0.84 |
Ciart |
circadian associated repressor of transcription |
1759 |
0.16 |
| chr5_126536904_126537081 | 0.84 |
Gm24839 |
predicted gene, 24839 |
23011 |
0.2 |
| chr16_24892958_24893109 | 0.84 |
Gm22672 |
predicted gene, 22672 |
8860 |
0.25 |
| chr3_70400102_70400273 | 0.84 |
Gm6631 |
predicted gene 6631 |
13132 |
0.29 |
| chr5_91244659_91245122 | 0.84 |
Gm23092 |
predicted gene, 23092 |
26886 |
0.18 |
| chr9_30592701_30592895 | 0.84 |
Gm47716 |
predicted gene, 47716 |
39789 |
0.17 |
| chr6_8862762_8862913 | 0.84 |
Ica1 |
islet cell autoantigen 1 |
84349 |
0.1 |
| chr12_57281727_57281906 | 0.84 |
Mipol1 |
mirror-image polydactyly 1 |
357 |
0.88 |
| chr13_37756552_37756712 | 0.83 |
Gm31600 |
predicted gene, 31600 |
5116 |
0.16 |
| chr1_21240946_21241097 | 0.83 |
Gsta3 |
glutathione S-transferase, alpha 3 |
392 |
0.76 |
| chr3_89147086_89147561 | 0.83 |
Hcn3 |
hyperpolarization-activated, cyclic nucleotide-gated K+ 3 |
3891 |
0.08 |
| chr3_52648763_52649088 | 0.83 |
Gm10293 |
predicted pseudogene 10293 |
36090 |
0.17 |
| chr6_138081648_138081799 | 0.83 |
Slc15a5 |
solute carrier family 15, member 5 |
1807 |
0.47 |
| chr4_6885681_6885832 | 0.83 |
Tox |
thymocyte selection-associated high mobility group box |
104727 |
0.07 |
| chr12_51274477_51274668 | 0.83 |
Rps11-ps4 |
ribosomal protein S11, pseudogene 4 |
22915 |
0.22 |
| chr8_84841387_84841538 | 0.82 |
Rad23a |
RAD23 homolog A, nucleotide excision repair protein |
797 |
0.35 |
| chr5_87499331_87499512 | 0.82 |
Ugt2a1 |
UDP glucuronosyltransferase 2 family, polypeptide A1 |
8550 |
0.12 |
| chr5_108270149_108270608 | 0.82 |
Dr1 |
down-regulator of transcription 1 |
1481 |
0.32 |
| chr19_12793824_12793975 | 0.82 |
Zfp91 |
zinc finger protein 91 |
2227 |
0.17 |
| chr3_129450558_129450716 | 0.82 |
Rpl7a-ps7 |
ribosomal protein L7A, pseudogene 7 |
11335 |
0.17 |
| chr3_63976545_63977103 | 0.82 |
Gmps |
guanine monophosphate synthetase |
718 |
0.59 |
| chr10_20347136_20347287 | 0.82 |
Mtfr2 |
mitochondrial fission regulator 2 |
559 |
0.67 |
| chr15_59454105_59454285 | 0.82 |
Nsmce2 |
NSE2/MMS21 homolog, SMC5-SMC6 complex SUMO ligase |
79908 |
0.08 |
| chr4_80924658_80924891 | 0.82 |
Lurap1l |
leucine rich adaptor protein 1-like |
14128 |
0.24 |
| chr19_31884467_31884670 | 0.82 |
A1cf |
APOBEC1 complementation factor |
15787 |
0.21 |
| chr9_79796831_79797014 | 0.81 |
4930429F24Rik |
RIKEN cDNA 4930429F24 gene |
3281 |
0.18 |
| chr18_74545000_74545185 | 0.81 |
1700120E14Rik |
RIKEN cDNA 1700120E14 gene |
13968 |
0.23 |
| chr3_65601180_65601352 | 0.81 |
Gm5847 |
predicted gene 5847 |
12323 |
0.14 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.1 | 3.2 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
| 0.6 | 2.5 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.6 | 1.8 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.5 | 2.1 | GO:0046449 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
| 0.5 | 1.0 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
| 0.5 | 3.0 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
| 0.4 | 1.3 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
| 0.4 | 1.3 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
| 0.4 | 1.2 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
| 0.4 | 1.5 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
| 0.4 | 4.1 | GO:0009404 | toxin metabolic process(GO:0009404) |
| 0.4 | 1.1 | GO:0006068 | ethanol catabolic process(GO:0006068) |
| 0.3 | 2.0 | GO:0071763 | nuclear membrane organization(GO:0071763) |
| 0.3 | 1.0 | GO:0097167 | circadian regulation of translation(GO:0097167) |
| 0.3 | 0.3 | GO:1904339 | negative regulation of dopaminergic neuron differentiation(GO:1904339) |
| 0.3 | 0.9 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
| 0.3 | 0.9 | GO:0032380 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.3 | 0.8 | GO:0034310 | primary alcohol catabolic process(GO:0034310) |
| 0.3 | 0.8 | GO:0048696 | regulation of collateral sprouting in absence of injury(GO:0048696) |
| 0.3 | 0.8 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.3 | 0.8 | GO:0060737 | prostate epithelial cord elongation(GO:0060523) prostate gland morphogenetic growth(GO:0060737) |
| 0.3 | 1.0 | GO:1903964 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.3 | 0.8 | GO:0034395 | regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
| 0.2 | 0.7 | GO:0046104 | thymidine metabolic process(GO:0046104) |
| 0.2 | 0.7 | GO:0051594 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
| 0.2 | 1.0 | GO:0044597 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.2 | 0.7 | GO:0042524 | negative regulation of tyrosine phosphorylation of Stat5 protein(GO:0042524) |
| 0.2 | 0.7 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
| 0.2 | 0.7 | GO:1904380 | endoplasmic reticulum mannose trimming(GO:1904380) |
| 0.2 | 0.7 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
| 0.2 | 0.7 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.2 | 0.9 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.2 | 0.7 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
| 0.2 | 1.7 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
| 0.2 | 0.4 | GO:2000828 | regulation of parathyroid hormone secretion(GO:2000828) |
| 0.2 | 0.2 | GO:0060916 | mesenchymal cell proliferation involved in lung development(GO:0060916) |
| 0.2 | 0.6 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.2 | 0.8 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.2 | 1.0 | GO:0006642 | triglyceride mobilization(GO:0006642) |
| 0.2 | 0.4 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
| 0.2 | 0.6 | GO:0045917 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
| 0.2 | 0.6 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
| 0.2 | 0.6 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
| 0.2 | 0.2 | GO:1901563 | response to camptothecin(GO:1901563) |
| 0.2 | 1.1 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.2 | 0.9 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
| 0.2 | 0.2 | GO:0052695 | cellular glucuronidation(GO:0052695) |
| 0.2 | 0.4 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
| 0.2 | 0.9 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
| 0.2 | 0.4 | GO:0050427 | 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
| 0.2 | 0.5 | GO:1901300 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
| 0.2 | 0.5 | GO:0072361 | regulation of glycolytic process by regulation of transcription from RNA polymerase II promoter(GO:0072361) |
| 0.2 | 0.7 | GO:0003383 | apical constriction(GO:0003383) |
| 0.2 | 0.3 | GO:0070874 | negative regulation of glycogen metabolic process(GO:0070874) |
| 0.2 | 0.3 | GO:2001245 | regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
| 0.2 | 0.6 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.2 | 0.6 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
| 0.2 | 0.5 | GO:1901656 | glycoside transport(GO:1901656) |
| 0.2 | 0.2 | GO:0035973 | aggrephagy(GO:0035973) |
| 0.2 | 1.1 | GO:1902369 | negative regulation of RNA catabolic process(GO:1902369) |
| 0.2 | 0.5 | GO:0061346 | non-canonical Wnt signaling pathway involved in heart development(GO:0061341) planar cell polarity pathway involved in heart morphogenesis(GO:0061346) |
| 0.1 | 0.7 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
| 0.1 | 0.4 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 0.1 | 0.4 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
| 0.1 | 0.4 | GO:0021699 | cerebellar cortex maturation(GO:0021699) |
| 0.1 | 0.6 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
| 0.1 | 0.7 | GO:0070857 | regulation of bile acid biosynthetic process(GO:0070857) |
| 0.1 | 0.4 | GO:1901509 | regulation of endothelial tube morphogenesis(GO:1901509) |
| 0.1 | 0.3 | GO:0060375 | regulation of mast cell differentiation(GO:0060375) |
| 0.1 | 1.1 | GO:0055091 | phospholipid homeostasis(GO:0055091) |
| 0.1 | 0.5 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
| 0.1 | 0.7 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
| 0.1 | 0.7 | GO:0039533 | regulation of MDA-5 signaling pathway(GO:0039533) |
| 0.1 | 0.8 | GO:0015871 | choline transport(GO:0015871) |
| 0.1 | 0.4 | GO:0008050 | female courtship behavior(GO:0008050) |
| 0.1 | 0.1 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
| 0.1 | 0.5 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
| 0.1 | 0.4 | GO:0048550 | negative regulation of pinocytosis(GO:0048550) |
| 0.1 | 0.4 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
| 0.1 | 0.2 | GO:0051081 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
| 0.1 | 0.1 | GO:0007440 | foregut morphogenesis(GO:0007440) |
| 0.1 | 0.4 | GO:0070947 | neutrophil mediated killing of fungus(GO:0070947) |
| 0.1 | 0.8 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
| 0.1 | 0.4 | GO:0009106 | lipoate metabolic process(GO:0009106) |
| 0.1 | 1.1 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
| 0.1 | 0.4 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
| 0.1 | 0.5 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
| 0.1 | 0.4 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.1 | 0.5 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.1 | 0.5 | GO:0045950 | negative regulation of mitotic recombination(GO:0045950) |
| 0.1 | 0.5 | GO:0090427 | activation of meiosis(GO:0090427) |
| 0.1 | 0.2 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
| 0.1 | 0.7 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
| 0.1 | 0.7 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.1 | 0.6 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 0.1 | 0.5 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 0.1 | 0.2 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 0.1 | 0.9 | GO:1901407 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
| 0.1 | 0.3 | GO:0021553 | olfactory nerve development(GO:0021553) |
| 0.1 | 0.1 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.1 | 1.2 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
| 0.1 | 0.9 | GO:0052697 | xenobiotic glucuronidation(GO:0052697) |
| 0.1 | 0.4 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) |
| 0.1 | 0.4 | GO:0018317 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.1 | 0.1 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
| 0.1 | 0.2 | GO:0006001 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
| 0.1 | 0.2 | GO:2000729 | positive regulation of mesenchymal cell proliferation involved in ureter development(GO:2000729) |
| 0.1 | 1.0 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.1 | 0.3 | GO:0002155 | regulation of thyroid hormone mediated signaling pathway(GO:0002155) |
| 0.1 | 0.6 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
| 0.1 | 0.3 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
| 0.1 | 0.3 | GO:0036295 | cellular response to increased oxygen levels(GO:0036295) cellular response to hyperoxia(GO:0071455) |
| 0.1 | 0.2 | GO:0046098 | guanine metabolic process(GO:0046098) |
| 0.1 | 0.1 | GO:0006714 | sesquiterpenoid metabolic process(GO:0006714) |
| 0.1 | 0.7 | GO:0002072 | optic cup morphogenesis involved in camera-type eye development(GO:0002072) |
| 0.1 | 0.3 | GO:0006553 | lysine metabolic process(GO:0006553) |
| 0.1 | 0.3 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
| 0.1 | 0.3 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
| 0.1 | 0.3 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
| 0.1 | 0.6 | GO:0006558 | L-phenylalanine metabolic process(GO:0006558) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) |
| 0.1 | 0.7 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
| 0.1 | 0.3 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
| 0.1 | 0.3 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
| 0.1 | 0.3 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
| 0.1 | 0.5 | GO:1904970 | brush border assembly(GO:1904970) |
| 0.1 | 0.3 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
| 0.1 | 1.2 | GO:0009812 | flavonoid metabolic process(GO:0009812) |
| 0.1 | 0.5 | GO:0032237 | activation of store-operated calcium channel activity(GO:0032237) |
| 0.1 | 0.1 | GO:2000618 | regulation of histone H4-K16 acetylation(GO:2000618) |
| 0.1 | 0.4 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
| 0.1 | 0.2 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
| 0.1 | 0.5 | GO:0046668 | regulation of retinal cell programmed cell death(GO:0046668) |
| 0.1 | 0.5 | GO:0015074 | DNA integration(GO:0015074) |
| 0.1 | 0.3 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.1 | 0.2 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
| 0.1 | 0.3 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
| 0.1 | 0.5 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.1 | 0.4 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
| 0.1 | 0.2 | GO:2000823 | regulation of androgen receptor activity(GO:2000823) |
| 0.1 | 0.8 | GO:0032754 | positive regulation of interleukin-5 production(GO:0032754) |
| 0.1 | 0.4 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
| 0.1 | 0.2 | GO:1903347 | negative regulation of bicellular tight junction assembly(GO:1903347) |
| 0.1 | 0.2 | GO:1902661 | regulation of glucose mediated signaling pathway(GO:1902659) positive regulation of glucose mediated signaling pathway(GO:1902661) |
| 0.1 | 0.2 | GO:0034436 | glycoprotein transport(GO:0034436) |
| 0.1 | 0.3 | GO:0002538 | arachidonic acid metabolite production involved in inflammatory response(GO:0002538) |
| 0.1 | 0.4 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
| 0.1 | 0.2 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.1 | 0.9 | GO:0021670 | lateral ventricle development(GO:0021670) |
| 0.1 | 0.2 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 0.1 | 0.4 | GO:0010745 | negative regulation of macrophage derived foam cell differentiation(GO:0010745) |
| 0.1 | 0.5 | GO:0000012 | single strand break repair(GO:0000012) |
| 0.1 | 0.4 | GO:2000794 | regulation of epithelial cell proliferation involved in lung morphogenesis(GO:2000794) |
| 0.1 | 0.6 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
| 0.1 | 0.2 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
| 0.1 | 0.7 | GO:0051657 | maintenance of organelle location(GO:0051657) |
| 0.1 | 0.3 | GO:0071280 | cellular response to copper ion(GO:0071280) |
| 0.1 | 0.2 | GO:0071276 | cellular response to cadmium ion(GO:0071276) |
| 0.1 | 0.1 | GO:0043651 | linoleic acid metabolic process(GO:0043651) |
| 0.1 | 0.4 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 0.1 | 0.6 | GO:0046130 | purine nucleoside catabolic process(GO:0006152) purine ribonucleoside catabolic process(GO:0046130) |
| 0.1 | 0.1 | GO:0042908 | xenobiotic transport(GO:0042908) |
| 0.1 | 0.3 | GO:0000050 | urea cycle(GO:0000050) |
| 0.1 | 0.2 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
| 0.1 | 0.2 | GO:2000302 | positive regulation of synaptic vesicle exocytosis(GO:2000302) |
| 0.1 | 0.1 | GO:0045726 | positive regulation of integrin biosynthetic process(GO:0045726) |
| 0.1 | 0.7 | GO:0010801 | negative regulation of peptidyl-threonine phosphorylation(GO:0010801) |
| 0.1 | 0.2 | GO:0046618 | drug export(GO:0046618) |
| 0.1 | 0.2 | GO:0086023 | adrenergic receptor signaling pathway involved in heart process(GO:0086023) |
| 0.1 | 1.1 | GO:0017144 | drug metabolic process(GO:0017144) |
| 0.1 | 0.4 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
| 0.1 | 0.1 | GO:0016095 | polyprenol catabolic process(GO:0016095) |
| 0.1 | 0.4 | GO:0045908 | negative regulation of vasodilation(GO:0045908) |
| 0.1 | 0.1 | GO:1904742 | regulation of telomeric DNA binding(GO:1904742) |
| 0.1 | 0.1 | GO:0003162 | atrioventricular node development(GO:0003162) |
| 0.1 | 0.4 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
| 0.1 | 0.1 | GO:0060166 | olfactory pit development(GO:0060166) |
| 0.1 | 0.2 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
| 0.1 | 0.1 | GO:0060125 | negative regulation of growth hormone secretion(GO:0060125) |
| 0.1 | 0.2 | GO:0060486 | Clara cell differentiation(GO:0060486) |
| 0.1 | 0.8 | GO:0003334 | keratinocyte development(GO:0003334) |
| 0.1 | 0.7 | GO:0042759 | long-chain fatty acid biosynthetic process(GO:0042759) |
| 0.1 | 0.3 | GO:0043247 | telomere maintenance in response to DNA damage(GO:0043247) |
| 0.1 | 0.5 | GO:0060613 | fat pad development(GO:0060613) |
| 0.1 | 0.4 | GO:0071361 | cellular response to ethanol(GO:0071361) |
| 0.1 | 0.3 | GO:0060283 | negative regulation of oocyte development(GO:0060283) |
| 0.1 | 0.1 | GO:0071879 | positive regulation of adrenergic receptor signaling pathway(GO:0071879) |
| 0.1 | 0.1 | GO:0045416 | positive regulation of interleukin-8 biosynthetic process(GO:0045416) |
| 0.1 | 0.1 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
| 0.1 | 1.3 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.1 | 0.5 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
| 0.1 | 1.9 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
| 0.1 | 0.2 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) |
| 0.1 | 0.1 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
| 0.1 | 0.1 | GO:0070094 | positive regulation of glucagon secretion(GO:0070094) |
| 0.1 | 0.1 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
| 0.1 | 0.1 | GO:0072711 | response to hydroxyurea(GO:0072710) cellular response to hydroxyurea(GO:0072711) |
| 0.1 | 0.4 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
| 0.1 | 0.1 | GO:0016539 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
| 0.1 | 0.3 | GO:0030035 | microspike assembly(GO:0030035) |
| 0.1 | 0.2 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.1 | 0.1 | GO:0000255 | allantoin metabolic process(GO:0000255) |
| 0.1 | 0.3 | GO:0060696 | regulation of phospholipid catabolic process(GO:0060696) |
| 0.1 | 0.1 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
| 0.1 | 0.2 | GO:0060509 | Type I pneumocyte differentiation(GO:0060509) |
| 0.1 | 0.3 | GO:0097343 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
| 0.1 | 0.8 | GO:2000060 | positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
| 0.1 | 0.2 | GO:0010040 | response to iron(II) ion(GO:0010040) |
| 0.1 | 0.1 | GO:0071727 | response to triacyl bacterial lipopeptide(GO:0071725) cellular response to triacyl bacterial lipopeptide(GO:0071727) |
| 0.1 | 0.1 | GO:0006570 | tyrosine metabolic process(GO:0006570) |
| 0.1 | 0.1 | GO:2000739 | regulation of mesenchymal stem cell differentiation(GO:2000739) |
| 0.1 | 0.1 | GO:0002069 | columnar/cuboidal epithelial cell maturation(GO:0002069) glandular epithelial cell maturation(GO:0002071) |
| 0.1 | 0.1 | GO:1903238 | positive regulation of leukocyte tethering or rolling(GO:1903238) |
| 0.1 | 0.2 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
| 0.1 | 0.3 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
| 0.1 | 0.2 | GO:1903689 | regulation of wound healing, spreading of epidermal cells(GO:1903689) |
| 0.1 | 0.2 | GO:1904469 | positive regulation of tumor necrosis factor secretion(GO:1904469) |
| 0.1 | 0.3 | GO:0051136 | regulation of NK T cell differentiation(GO:0051136) positive regulation of NK T cell differentiation(GO:0051138) |
| 0.1 | 0.1 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
| 0.1 | 0.1 | GO:0072240 | distal convoluted tubule development(GO:0072025) DCT cell differentiation(GO:0072069) metanephric distal convoluted tubule development(GO:0072221) metanephric distal tubule development(GO:0072235) metanephric DCT cell differentiation(GO:0072240) |
| 0.1 | 0.1 | GO:1901740 | negative regulation of myoblast fusion(GO:1901740) |
| 0.1 | 0.4 | GO:0006517 | protein deglycosylation(GO:0006517) |
| 0.1 | 0.7 | GO:0045898 | regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045898) |
| 0.1 | 0.1 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
| 0.1 | 0.2 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
| 0.1 | 0.1 | GO:0045541 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
| 0.1 | 0.1 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
| 0.1 | 0.2 | GO:0048597 | post-embryonic camera-type eye morphogenesis(GO:0048597) |
| 0.1 | 1.1 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
| 0.1 | 0.2 | GO:0001880 | Mullerian duct regression(GO:0001880) |
| 0.1 | 1.5 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
| 0.1 | 0.2 | GO:2000780 | negative regulation of double-strand break repair(GO:2000780) |
| 0.1 | 0.3 | GO:0044829 | positive regulation by host of viral genome replication(GO:0044829) |
| 0.1 | 0.2 | GO:0032367 | intracellular cholesterol transport(GO:0032367) |
| 0.1 | 0.4 | GO:0030948 | negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
| 0.1 | 0.2 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.1 | 0.1 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
| 0.1 | 0.1 | GO:1902023 | L-arginine import(GO:0043091) arginine import(GO:0090467) L-arginine transport(GO:1902023) |
| 0.1 | 0.2 | GO:1903599 | positive regulation of mitophagy(GO:1903599) |
| 0.1 | 0.2 | GO:0032202 | telomere assembly(GO:0032202) |
| 0.1 | 0.2 | GO:0060468 | prevention of polyspermy(GO:0060468) |
| 0.1 | 0.2 | GO:0019740 | nitrogen utilization(GO:0019740) |
| 0.1 | 0.1 | GO:0032696 | negative regulation of interleukin-13 production(GO:0032696) |
| 0.1 | 0.2 | GO:0014043 | negative regulation of neuron maturation(GO:0014043) |
| 0.1 | 0.1 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
| 0.1 | 0.1 | GO:0030576 | Cajal body organization(GO:0030576) |
| 0.1 | 0.2 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.1 | 0.3 | GO:0009074 | tryptophan catabolic process(GO:0006569) aromatic amino acid family catabolic process(GO:0009074) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) |
| 0.1 | 0.2 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
| 0.1 | 0.2 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
| 0.1 | 0.2 | GO:2000224 | regulation of testosterone biosynthetic process(GO:2000224) |
| 0.1 | 0.5 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
| 0.1 | 0.4 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
| 0.1 | 0.1 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.1 | 0.1 | GO:2001180 | negative regulation of interleukin-10 secretion(GO:2001180) |
| 0.1 | 0.5 | GO:0043486 | histone exchange(GO:0043486) |
| 0.1 | 0.2 | GO:1903278 | positive regulation of sodium ion export(GO:1903275) positive regulation of sodium ion export from cell(GO:1903278) |
| 0.1 | 0.1 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
| 0.1 | 0.3 | GO:0060718 | chorionic trophoblast cell differentiation(GO:0060718) |
| 0.1 | 0.3 | GO:0051639 | actin filament network formation(GO:0051639) |
| 0.1 | 0.2 | GO:0048548 | regulation of pinocytosis(GO:0048548) |
| 0.1 | 0.2 | GO:0072093 | metanephric renal vesicle formation(GO:0072093) |
| 0.1 | 0.2 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
| 0.1 | 0.1 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
| 0.1 | 0.2 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.1 | 0.2 | GO:0061724 | lipophagy(GO:0061724) |
| 0.0 | 0.1 | GO:0006768 | biotin metabolic process(GO:0006768) |
| 0.0 | 0.4 | GO:0021756 | striatum development(GO:0021756) |
| 0.0 | 0.1 | GO:0046865 | retinol transport(GO:0034633) isoprenoid transport(GO:0046864) terpenoid transport(GO:0046865) |
| 0.0 | 0.4 | GO:0007638 | mechanosensory behavior(GO:0007638) |
| 0.0 | 0.1 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
| 0.0 | 0.1 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
| 0.0 | 0.1 | GO:0042091 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
| 0.0 | 0.6 | GO:0051923 | sulfation(GO:0051923) |
| 0.0 | 0.0 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
| 0.0 | 0.4 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.0 | 0.3 | GO:0051503 | adenine nucleotide transport(GO:0051503) |
| 0.0 | 0.6 | GO:0045116 | protein neddylation(GO:0045116) |
| 0.0 | 1.6 | GO:0061077 | chaperone-mediated protein folding(GO:0061077) |
| 0.0 | 0.1 | GO:0015747 | urate transport(GO:0015747) |
| 0.0 | 0.2 | GO:0048478 | replication fork protection(GO:0048478) |
| 0.0 | 0.1 | GO:0070309 | lens fiber cell morphogenesis(GO:0070309) |
| 0.0 | 0.3 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.0 | 0.2 | GO:0060352 | cell adhesion molecule production(GO:0060352) |
| 0.0 | 0.2 | GO:1902414 | protein localization to cell junction(GO:1902414) |
| 0.0 | 0.2 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.0 | 0.3 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
| 0.0 | 0.3 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
| 0.0 | 0.1 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
| 0.0 | 0.1 | GO:2000409 | positive regulation of T cell extravasation(GO:2000409) |
| 0.0 | 0.2 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
| 0.0 | 0.1 | GO:0006393 | termination of mitochondrial transcription(GO:0006393) |
| 0.0 | 0.2 | GO:0051454 | pH elevation(GO:0045852) intracellular pH elevation(GO:0051454) |
| 0.0 | 0.1 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
| 0.0 | 0.3 | GO:0015838 | amino-acid betaine transport(GO:0015838) |
| 0.0 | 1.2 | GO:0033120 | positive regulation of RNA splicing(GO:0033120) |
| 0.0 | 0.1 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
| 0.0 | 0.1 | GO:1903371 | regulation of endoplasmic reticulum tubular network organization(GO:1903371) |
| 0.0 | 0.1 | GO:0015791 | polyol transport(GO:0015791) |
| 0.0 | 0.1 | GO:0046477 | glycosylceramide catabolic process(GO:0046477) |
| 0.0 | 0.2 | GO:0051971 | positive regulation of transmission of nerve impulse(GO:0051971) |
| 0.0 | 0.8 | GO:0006376 | mRNA splice site selection(GO:0006376) |
| 0.0 | 0.2 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.0 | 0.3 | GO:1900107 | regulation of nodal signaling pathway(GO:1900107) |
| 0.0 | 0.1 | GO:0014732 | skeletal muscle atrophy(GO:0014732) |
| 0.0 | 0.3 | GO:0045176 | apical protein localization(GO:0045176) |
| 0.0 | 0.2 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
| 0.0 | 0.1 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.0 | 0.1 | GO:0018197 | peptidyl-aspartic acid modification(GO:0018197) |
| 0.0 | 0.0 | GO:1904192 | cholangiocyte apoptotic process(GO:1902488) regulation of cholangiocyte apoptotic process(GO:1904192) negative regulation of cholangiocyte apoptotic process(GO:1904193) |
| 0.0 | 0.0 | GO:0032471 | negative regulation of endoplasmic reticulum calcium ion concentration(GO:0032471) |
| 0.0 | 0.1 | GO:0048769 | sarcomerogenesis(GO:0048769) |
| 0.0 | 0.6 | GO:0043981 | histone H4-K5 acetylation(GO:0043981) histone H4-K8 acetylation(GO:0043982) |
| 0.0 | 0.3 | GO:0032959 | inositol trisphosphate biosynthetic process(GO:0032959) |
| 0.0 | 0.1 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
| 0.0 | 0.1 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
| 0.0 | 0.1 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.0 | 0.2 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
| 0.0 | 0.1 | GO:0046005 | positive regulation of circadian sleep/wake cycle, REM sleep(GO:0046005) |
| 0.0 | 0.2 | GO:0046085 | adenosine metabolic process(GO:0046085) |
| 0.0 | 0.3 | GO:0006108 | malate metabolic process(GO:0006108) |
| 0.0 | 0.2 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.0 | 0.1 | GO:1901524 | regulation of macromitophagy(GO:1901524) negative regulation of macromitophagy(GO:1901525) |
| 0.0 | 0.2 | GO:0071494 | cellular response to UV-C(GO:0071494) |
| 0.0 | 0.1 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
| 0.0 | 0.1 | GO:0005984 | disaccharide metabolic process(GO:0005984) |
| 0.0 | 1.0 | GO:0000460 | maturation of 5.8S rRNA(GO:0000460) |
| 0.0 | 0.0 | GO:1901339 | regulation of store-operated calcium channel activity(GO:1901339) |
| 0.0 | 0.2 | GO:0022605 | oogenesis stage(GO:0022605) |
| 0.0 | 0.9 | GO:0000184 | nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
| 0.0 | 0.2 | GO:0032966 | negative regulation of collagen metabolic process(GO:0010713) negative regulation of collagen biosynthetic process(GO:0032966) |
| 0.0 | 0.1 | GO:0038171 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
| 0.0 | 0.3 | GO:0060546 | negative regulation of necroptotic process(GO:0060546) |
| 0.0 | 0.1 | GO:1900044 | regulation of protein K63-linked ubiquitination(GO:1900044) |
| 0.0 | 0.0 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
| 0.0 | 0.1 | GO:0042851 | L-alanine metabolic process(GO:0042851) |
| 0.0 | 0.2 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
| 0.0 | 0.1 | GO:0003057 | regulation of the force of heart contraction by chemical signal(GO:0003057) |
| 0.0 | 0.1 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
| 0.0 | 0.1 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
| 0.0 | 0.5 | GO:0042026 | protein refolding(GO:0042026) |
| 0.0 | 0.2 | GO:0015808 | L-alanine transport(GO:0015808) |
| 0.0 | 0.1 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
| 0.0 | 0.3 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.0 | 0.2 | GO:0045631 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.0 | 0.1 | GO:0051987 | positive regulation of attachment of spindle microtubules to kinetochore(GO:0051987) |
| 0.0 | 0.0 | GO:0001661 | conditioned taste aversion(GO:0001661) |
| 0.0 | 0.1 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.0 | 0.0 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
| 0.0 | 0.1 | GO:0044337 | canonical Wnt signaling pathway involved in positive regulation of apoptotic process(GO:0044337) |
| 0.0 | 0.1 | GO:0006562 | proline catabolic process(GO:0006562) |
| 0.0 | 0.0 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
| 0.0 | 0.2 | GO:0071243 | cellular response to arsenic-containing substance(GO:0071243) |
| 0.0 | 0.2 | GO:1902774 | late endosome to lysosome transport(GO:1902774) |
| 0.0 | 0.0 | GO:0031086 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.0 | 0.2 | GO:0045324 | late endosome to vacuole transport(GO:0045324) |
| 0.0 | 0.1 | GO:0045113 | regulation of integrin biosynthetic process(GO:0045113) |
| 0.0 | 0.0 | GO:0032727 | positive regulation of interferon-alpha production(GO:0032727) |
| 0.0 | 0.7 | GO:0048240 | sperm capacitation(GO:0048240) |
| 0.0 | 0.4 | GO:0019184 | nonribosomal peptide biosynthetic process(GO:0019184) |
| 0.0 | 1.4 | GO:0031018 | endocrine pancreas development(GO:0031018) |
| 0.0 | 0.1 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
| 0.0 | 0.1 | GO:0071680 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
| 0.0 | 0.4 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
| 0.0 | 0.1 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
| 0.0 | 0.2 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
| 0.0 | 0.1 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
| 0.0 | 0.3 | GO:2000010 | positive regulation of protein localization to cell surface(GO:2000010) |
| 0.0 | 0.1 | GO:0009794 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
| 0.0 | 0.0 | GO:0043307 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil activation(GO:0043307) eosinophil degranulation(GO:0043308) |
| 0.0 | 0.1 | GO:0032621 | interleukin-18 production(GO:0032621) |
| 0.0 | 0.2 | GO:0006048 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
| 0.0 | 0.1 | GO:0006678 | glucosylceramide metabolic process(GO:0006678) |
| 0.0 | 0.1 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
| 0.0 | 0.0 | GO:0035356 | cellular triglyceride homeostasis(GO:0035356) |
| 0.0 | 0.2 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
| 0.0 | 0.1 | GO:1904294 | positive regulation of ERAD pathway(GO:1904294) |
| 0.0 | 0.1 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
| 0.0 | 0.1 | GO:0040031 | snRNA modification(GO:0040031) |
| 0.0 | 0.3 | GO:0043249 | erythrocyte maturation(GO:0043249) |
| 0.0 | 0.1 | GO:0090403 | oxidative stress-induced premature senescence(GO:0090403) |
| 0.0 | 0.2 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
| 0.0 | 0.1 | GO:0071918 | urea transmembrane transport(GO:0071918) |
| 0.0 | 0.2 | GO:0019227 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
| 0.0 | 0.1 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
| 0.0 | 0.1 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.0 | 0.1 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
| 0.0 | 0.1 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.0 | 0.1 | GO:0048793 | pronephros development(GO:0048793) |
| 0.0 | 0.1 | GO:0008228 | opsonization(GO:0008228) |
| 0.0 | 0.2 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.0 | 0.0 | GO:0003278 | apoptotic process involved in heart morphogenesis(GO:0003278) |
| 0.0 | 0.1 | GO:0019856 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
| 0.0 | 0.0 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
| 0.0 | 0.2 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
| 0.0 | 0.1 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
| 0.0 | 0.1 | GO:0000491 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
| 0.0 | 0.3 | GO:0001780 | neutrophil homeostasis(GO:0001780) |
| 0.0 | 0.1 | GO:0042447 | hormone catabolic process(GO:0042447) |
| 0.0 | 0.3 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.0 | 0.2 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 0.0 | 0.0 | GO:0036394 | amylase secretion(GO:0036394) |
| 0.0 | 0.1 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.0 | 0.1 | GO:0006000 | fructose metabolic process(GO:0006000) |
| 0.0 | 0.2 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
| 0.0 | 0.1 | GO:1902514 | regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1902514) |
| 0.0 | 0.0 | GO:0072592 | oxygen metabolic process(GO:0072592) |
| 0.0 | 0.3 | GO:0006968 | cellular defense response(GO:0006968) |
| 0.0 | 0.1 | GO:0060440 | trachea formation(GO:0060440) |
| 0.0 | 0.1 | GO:0016584 | nucleosome positioning(GO:0016584) |
| 0.0 | 0.2 | GO:0042219 | cellular modified amino acid catabolic process(GO:0042219) |
| 0.0 | 0.0 | GO:0044314 | protein K27-linked ubiquitination(GO:0044314) |
| 0.0 | 0.1 | GO:0050955 | thermoception(GO:0050955) |
| 0.0 | 0.1 | GO:1901162 | serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
| 0.0 | 0.1 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.0 | 0.0 | GO:0031034 | myosin filament assembly(GO:0031034) |
| 0.0 | 0.0 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
| 0.0 | 0.2 | GO:0010984 | regulation of lipoprotein particle clearance(GO:0010984) |
| 0.0 | 0.4 | GO:0007096 | regulation of exit from mitosis(GO:0007096) |
| 0.0 | 0.1 | GO:0090205 | positive regulation of cholesterol biosynthetic process(GO:0045542) positive regulation of cholesterol metabolic process(GO:0090205) |
| 0.0 | 0.1 | GO:1900736 | regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900736) |
| 0.0 | 0.4 | GO:0006883 | cellular sodium ion homeostasis(GO:0006883) |
| 0.0 | 0.1 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.0 | 0.1 | GO:2000562 | negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
| 0.0 | 0.1 | GO:0046469 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
| 0.0 | 0.1 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
| 0.0 | 0.0 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
| 0.0 | 0.1 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) |
| 0.0 | 0.3 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.0 | 0.1 | GO:0060278 | regulation of ovulation(GO:0060278) |
| 0.0 | 0.0 | GO:0033629 | negative regulation of cell adhesion mediated by integrin(GO:0033629) |
| 0.0 | 0.7 | GO:0000266 | mitochondrial fission(GO:0000266) |
| 0.0 | 0.3 | GO:0042407 | cristae formation(GO:0042407) |
| 0.0 | 0.1 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
| 0.0 | 0.1 | GO:1903999 | negative regulation of eating behavior(GO:1903999) |
| 0.0 | 0.2 | GO:0042448 | progesterone metabolic process(GO:0042448) |
| 0.0 | 0.1 | GO:0018243 | protein O-linked glycosylation via threonine(GO:0018243) |
| 0.0 | 0.1 | GO:0015781 | nucleotide-sugar transport(GO:0015780) pyrimidine nucleotide-sugar transport(GO:0015781) |
| 0.0 | 0.0 | GO:0072095 | regulation of branch elongation involved in ureteric bud branching(GO:0072095) |
| 0.0 | 0.1 | GO:0040009 | regulation of growth rate(GO:0040009) |
| 0.0 | 0.1 | GO:0061218 | negative regulation of mesonephros development(GO:0061218) negative regulation of branching involved in ureteric bud morphogenesis(GO:0090191) |
| 0.0 | 0.1 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
| 0.0 | 0.3 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
| 0.0 | 0.1 | GO:0061438 | renal system vasculature morphogenesis(GO:0061438) kidney vasculature morphogenesis(GO:0061439) |
| 0.0 | 0.1 | GO:0015670 | carbon dioxide transport(GO:0015670) |
| 0.0 | 0.1 | GO:0070782 | phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
| 0.0 | 0.2 | GO:0060055 | angiogenesis involved in wound healing(GO:0060055) |
| 0.0 | 0.1 | GO:0015886 | heme transport(GO:0015886) |
| 0.0 | 0.1 | GO:0001957 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
| 0.0 | 0.1 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
| 0.0 | 0.0 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
| 0.0 | 0.1 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.0 | 0.2 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
| 0.0 | 0.1 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
| 0.0 | 0.1 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
| 0.0 | 0.1 | GO:0006573 | valine metabolic process(GO:0006573) |
| 0.0 | 0.1 | GO:1903969 | regulation of macrophage colony-stimulating factor signaling pathway(GO:1902226) regulation of response to macrophage colony-stimulating factor(GO:1903969) regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903972) |
| 0.0 | 0.3 | GO:0043586 | tongue development(GO:0043586) |
| 0.0 | 0.0 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
| 0.0 | 0.1 | GO:0002740 | negative regulation of cytokine secretion involved in immune response(GO:0002740) |
| 0.0 | 0.2 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.0 | 0.0 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
| 0.0 | 0.1 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
| 0.0 | 0.5 | GO:0071353 | cellular response to interleukin-4(GO:0071353) |
| 0.0 | 0.1 | GO:0061366 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
| 0.0 | 0.1 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.0 | 0.1 | GO:1904667 | negative regulation of ubiquitin protein ligase activity(GO:1904667) |
| 0.0 | 0.1 | GO:0090091 | positive regulation of extracellular matrix disassembly(GO:0090091) |
| 0.0 | 0.0 | GO:0070102 | interleukin-6-mediated signaling pathway(GO:0070102) |
| 0.0 | 0.4 | GO:0030852 | regulation of granulocyte differentiation(GO:0030852) |
| 0.0 | 0.1 | GO:0002215 | defense response to nematode(GO:0002215) |
| 0.0 | 0.0 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
| 0.0 | 0.2 | GO:0006465 | signal peptide processing(GO:0006465) |
| 0.0 | 0.1 | GO:0045602 | negative regulation of endothelial cell differentiation(GO:0045602) |
| 0.0 | 0.1 | GO:0017121 | phospholipid scrambling(GO:0017121) |
| 0.0 | 0.1 | GO:0006451 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.0 | 0.0 | GO:1900425 | negative regulation of defense response to bacterium(GO:1900425) |
| 0.0 | 0.0 | GO:0002125 | maternal aggressive behavior(GO:0002125) |
| 0.0 | 0.1 | GO:0009249 | protein lipoylation(GO:0009249) |
| 0.0 | 0.1 | GO:0032049 | phosphatidylglycerol biosynthetic process(GO:0006655) cardiolipin biosynthetic process(GO:0032049) |
| 0.0 | 0.1 | GO:0043201 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
| 0.0 | 0.0 | GO:0006868 | glutamine transport(GO:0006868) |
| 0.0 | 0.1 | GO:1901799 | negative regulation of proteasomal protein catabolic process(GO:1901799) |
| 0.0 | 0.1 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.0 | 0.3 | GO:0090201 | negative regulation of release of cytochrome c from mitochondria(GO:0090201) |
| 0.0 | 0.1 | GO:0034227 | tRNA thio-modification(GO:0034227) |
| 0.0 | 0.3 | GO:1904293 | negative regulation of ERAD pathway(GO:1904293) |
| 0.0 | 0.0 | GO:0035795 | negative regulation of mitochondrial membrane permeability(GO:0035795) |
| 0.0 | 0.2 | GO:0006353 | DNA-templated transcription, termination(GO:0006353) |
| 0.0 | 0.0 | GO:0046061 | dATP catabolic process(GO:0046061) |
| 0.0 | 0.0 | GO:0014029 | neural crest formation(GO:0014029) |
| 0.0 | 0.2 | GO:0045723 | positive regulation of fatty acid biosynthetic process(GO:0045723) |
| 0.0 | 0.0 | GO:2000341 | negative regulation of interleukin-8 biosynthetic process(GO:0045415) regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000341) |
| 0.0 | 0.1 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
| 0.0 | 0.2 | GO:0071380 | cellular response to prostaglandin E stimulus(GO:0071380) |
| 0.0 | 0.0 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
| 0.0 | 0.1 | GO:0048014 | Tie signaling pathway(GO:0048014) |
| 0.0 | 0.1 | GO:0060672 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.0 | 0.1 | GO:0008054 | negative regulation of cyclin-dependent protein serine/threonine kinase by cyclin degradation(GO:0008054) |
| 0.0 | 0.1 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
| 0.0 | 0.0 | GO:2001225 | regulation of chloride transport(GO:2001225) |
| 0.0 | 0.1 | GO:0003085 | negative regulation of systemic arterial blood pressure(GO:0003085) |
| 0.0 | 0.2 | GO:0051446 | positive regulation of meiotic cell cycle(GO:0051446) |
| 0.0 | 0.1 | GO:0002923 | regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002923) |
| 0.0 | 0.1 | GO:0070257 | positive regulation of mucus secretion(GO:0070257) |
| 0.0 | 0.0 | GO:0019065 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.0 | 0.1 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.0 | 0.9 | GO:0046426 | negative regulation of JAK-STAT cascade(GO:0046426) negative regulation of STAT cascade(GO:1904893) |
| 0.0 | 0.0 | GO:0010452 | histone H3-K36 methylation(GO:0010452) |
| 0.0 | 0.1 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
| 0.0 | 0.6 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
| 0.0 | 0.0 | GO:0070842 | aggresome assembly(GO:0070842) |
| 0.0 | 0.3 | GO:0010799 | regulation of peptidyl-threonine phosphorylation(GO:0010799) positive regulation of peptidyl-threonine phosphorylation(GO:0010800) |
| 0.0 | 0.1 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
| 0.0 | 0.1 | GO:0046512 | diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
| 0.0 | 0.1 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
| 0.0 | 0.1 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
| 0.0 | 0.1 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
| 0.0 | 0.2 | GO:0010832 | negative regulation of myotube differentiation(GO:0010832) |
| 0.0 | 0.2 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.0 | 0.0 | GO:0045794 | negative regulation of cell volume(GO:0045794) |
| 0.0 | 0.2 | GO:0000052 | citrulline metabolic process(GO:0000052) |
| 0.0 | 0.0 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
| 0.0 | 0.1 | GO:0060295 | regulation of cilium movement involved in cell motility(GO:0060295) regulation of cilium beat frequency involved in ciliary motility(GO:0060296) regulation of cilium-dependent cell motility(GO:1902019) |
| 0.0 | 0.1 | GO:0030836 | positive regulation of actin filament depolymerization(GO:0030836) |
| 0.0 | 0.0 | GO:0039663 | fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
| 0.0 | 0.1 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
| 0.0 | 0.1 | GO:0003348 | cardiac endothelial cell differentiation(GO:0003348) |
| 0.0 | 0.0 | GO:0031443 | fast-twitch skeletal muscle fiber contraction(GO:0031443) |
| 0.0 | 0.0 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
| 0.0 | 0.1 | GO:0048563 | post-embryonic organ morphogenesis(GO:0048563) |
| 0.0 | 0.1 | GO:0032532 | regulation of microvillus length(GO:0032532) |
| 0.0 | 0.2 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
| 0.0 | 0.1 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
| 0.0 | 0.1 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
| 0.0 | 0.1 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.0 | 0.3 | GO:0003301 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.0 | 0.0 | GO:0070189 | kynurenine metabolic process(GO:0070189) |
| 0.0 | 0.5 | GO:0006879 | cellular iron ion homeostasis(GO:0006879) |
| 0.0 | 0.1 | GO:0032958 | inositol phosphate biosynthetic process(GO:0032958) |
| 0.0 | 0.6 | GO:0045839 | negative regulation of mitotic nuclear division(GO:0045839) |
| 0.0 | 0.0 | GO:0036302 | atrioventricular canal development(GO:0036302) |
| 0.0 | 0.0 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
| 0.0 | 0.1 | GO:0051204 | protein insertion into mitochondrial membrane(GO:0051204) |
| 0.0 | 0.1 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.0 | 0.1 | GO:0090209 | negative regulation of triglyceride metabolic process(GO:0090209) |
| 0.0 | 0.1 | GO:0035809 | regulation of urine volume(GO:0035809) |
| 0.0 | 0.2 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.0 | 0.8 | GO:0009166 | nucleotide catabolic process(GO:0009166) |
| 0.0 | 0.1 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
| 0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.0 | GO:0046959 | habituation(GO:0046959) |
| 0.0 | 0.1 | GO:0022007 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
| 0.0 | 0.0 | GO:0046487 | glyoxylate metabolic process(GO:0046487) |
| 0.0 | 0.1 | GO:0060856 | establishment of blood-brain barrier(GO:0060856) |
| 0.0 | 0.1 | GO:0021798 | forebrain dorsal/ventral pattern formation(GO:0021798) |
| 0.0 | 0.1 | GO:1901475 | pyruvate transmembrane transport(GO:1901475) |
| 0.0 | 0.0 | GO:1903587 | regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903587) |
| 0.0 | 0.2 | GO:0032435 | negative regulation of proteasomal ubiquitin-dependent protein catabolic process(GO:0032435) |
| 0.0 | 0.2 | GO:0008053 | mitochondrial fusion(GO:0008053) |
| 0.0 | 0.1 | GO:0035087 | siRNA loading onto RISC involved in RNA interference(GO:0035087) |
| 0.0 | 0.4 | GO:0030488 | tRNA methylation(GO:0030488) |
| 0.0 | 0.1 | GO:0006590 | thyroid hormone generation(GO:0006590) |
| 0.0 | 0.1 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.0 | 0.7 | GO:0030433 | ER-associated ubiquitin-dependent protein catabolic process(GO:0030433) |
| 0.0 | 0.2 | GO:0006415 | translational termination(GO:0006415) |
| 0.0 | 0.1 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
| 0.0 | 0.1 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
| 0.0 | 0.0 | GO:0033689 | negative regulation of osteoblast proliferation(GO:0033689) |
| 0.0 | 0.1 | GO:0048752 | semicircular canal morphogenesis(GO:0048752) |
| 0.0 | 0.0 | GO:0003266 | cardioblast proliferation(GO:0003263) regulation of cardioblast proliferation(GO:0003264) regulation of secondary heart field cardioblast proliferation(GO:0003266) |
| 0.0 | 0.1 | GO:0035627 | ceramide transport(GO:0035627) |
| 0.0 | 0.3 | GO:0016578 | histone deubiquitination(GO:0016578) |
| 0.0 | 0.1 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
| 0.0 | 0.2 | GO:0001502 | cartilage condensation(GO:0001502) cell aggregation(GO:0098743) |
| 0.0 | 0.2 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
| 0.0 | 0.0 | GO:0061031 | endodermal digestive tract morphogenesis(GO:0061031) |
| 0.0 | 0.0 | GO:0060907 | positive regulation of macrophage cytokine production(GO:0060907) |
| 0.0 | 0.2 | GO:0006271 | DNA strand elongation involved in DNA replication(GO:0006271) |
| 0.0 | 0.1 | GO:0097070 | ductus arteriosus closure(GO:0097070) |
| 0.0 | 0.0 | GO:0002086 | diaphragm contraction(GO:0002086) |
| 0.0 | 0.2 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
| 0.0 | 0.1 | GO:0007379 | segment specification(GO:0007379) |
| 0.0 | 0.1 | GO:0032224 | positive regulation of synaptic transmission, cholinergic(GO:0032224) |
| 0.0 | 0.1 | GO:0043174 | nucleoside salvage(GO:0043174) |
| 0.0 | 0.0 | GO:0070391 | response to lipoteichoic acid(GO:0070391) cellular response to lipoteichoic acid(GO:0071223) |
| 0.0 | 0.3 | GO:0006491 | N-glycan processing(GO:0006491) |
| 0.0 | 0.1 | GO:0035360 | positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
| 0.0 | 0.1 | GO:0060979 | vasculogenesis involved in coronary vascular morphogenesis(GO:0060979) |
| 0.0 | 0.0 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
| 0.0 | 0.1 | GO:0002317 | plasma cell differentiation(GO:0002317) |
| 0.0 | 0.0 | GO:0021894 | cerebral cortex GABAergic interneuron development(GO:0021894) |
| 0.0 | 0.0 | GO:0006210 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
| 0.0 | 0.1 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
| 0.0 | 0.1 | GO:0014072 | response to isoquinoline alkaloid(GO:0014072) response to morphine(GO:0043278) |
| 0.0 | 0.1 | GO:0032354 | response to follicle-stimulating hormone(GO:0032354) |
| 0.0 | 0.1 | GO:0097211 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.0 | 0.0 | GO:0035754 | B cell chemotaxis(GO:0035754) |
| 0.0 | 0.0 | GO:0048682 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
| 0.0 | 0.1 | GO:0019348 | polyprenol metabolic process(GO:0016093) dolichol metabolic process(GO:0019348) |
| 0.0 | 0.1 | GO:0003084 | positive regulation of systemic arterial blood pressure(GO:0003084) |
| 0.0 | 0.0 | GO:0060331 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
| 0.0 | 0.3 | GO:0071539 | protein localization to centrosome(GO:0071539) |
| 0.0 | 0.2 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
| 0.0 | 0.0 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
| 0.0 | 0.2 | GO:0045070 | positive regulation of viral genome replication(GO:0045070) |
| 0.0 | 0.1 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
| 0.0 | 0.1 | GO:0019478 | D-amino acid catabolic process(GO:0019478) |
| 0.0 | 0.0 | GO:0003025 | regulation of systemic arterial blood pressure by baroreceptor feedback(GO:0003025) |
| 0.0 | 0.2 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.0 | 0.2 | GO:0035518 | histone H2A monoubiquitination(GO:0035518) |
| 0.0 | 0.1 | GO:0086013 | membrane repolarization during cardiac muscle cell action potential(GO:0086013) |
| 0.0 | 0.2 | GO:0006301 | postreplication repair(GO:0006301) |
| 0.0 | 0.0 | GO:0042940 | D-amino acid transport(GO:0042940) |
| 0.0 | 0.0 | GO:0072108 | positive regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0072108) |
| 0.0 | 0.1 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
| 0.0 | 0.1 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
| 0.0 | 0.2 | GO:0006298 | mismatch repair(GO:0006298) |
| 0.0 | 0.1 | GO:0080154 | regulation of fertilization(GO:0080154) |
| 0.0 | 0.0 | GO:1901979 | regulation of inward rectifier potassium channel activity(GO:1901979) |
| 0.0 | 0.1 | GO:0002566 | somatic diversification of immune receptors via somatic mutation(GO:0002566) |
| 0.0 | 0.1 | GO:0006670 | sphingosine metabolic process(GO:0006670) |
| 0.0 | 0.1 | GO:0060287 | epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
| 0.0 | 0.1 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
| 0.0 | 0.0 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.0 | 0.1 | GO:0035095 | behavioral response to nicotine(GO:0035095) |
| 0.0 | 0.1 | GO:0014028 | notochord formation(GO:0014028) |
| 0.0 | 0.0 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
| 0.0 | 0.1 | GO:0051799 | negative regulation of hair follicle development(GO:0051799) |
| 0.0 | 0.1 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.0 | 0.0 | GO:0060748 | tertiary branching involved in mammary gland duct morphogenesis(GO:0060748) |
| 0.0 | 0.1 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
| 0.0 | 0.0 | GO:0070368 | positive regulation of hepatocyte differentiation(GO:0070368) |
| 0.0 | 0.0 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.0 | 0.0 | GO:0001969 | activation of membrane attack complex(GO:0001905) regulation of activation of membrane attack complex(GO:0001969) |
| 0.0 | 0.0 | GO:1900368 | regulation of RNA interference(GO:1900368) |
| 0.0 | 0.1 | GO:0045586 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
| 0.0 | 0.1 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
| 0.0 | 0.0 | GO:0032627 | interleukin-23 production(GO:0032627) regulation of interleukin-23 production(GO:0032667) |
| 0.0 | 0.0 | GO:0051890 | regulation of cardioblast differentiation(GO:0051890) cardiac muscle cell myoblast differentiation(GO:0060379) |
| 0.0 | 0.0 | GO:0046684 | response to pyrethroid(GO:0046684) |
| 0.0 | 0.0 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
| 0.0 | 0.1 | GO:0046831 | regulation of RNA export from nucleus(GO:0046831) |
| 0.0 | 0.0 | GO:0014016 | neuroblast differentiation(GO:0014016) |
| 0.0 | 0.0 | GO:0034551 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
| 0.0 | 0.1 | GO:0046628 | positive regulation of insulin receptor signaling pathway(GO:0046628) |
| 0.0 | 0.1 | GO:0032305 | positive regulation of icosanoid secretion(GO:0032305) |
| 0.0 | 0.0 | GO:0019355 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
| 0.0 | 0.0 | GO:1902805 | positive regulation of synaptic vesicle transport(GO:1902805) |
| 0.0 | 0.1 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
| 0.0 | 0.0 | GO:0060013 | righting reflex(GO:0060013) |
| 0.0 | 0.0 | GO:0008582 | regulation of synaptic growth at neuromuscular junction(GO:0008582) |
| 0.0 | 0.1 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
| 0.0 | 0.2 | GO:0043124 | negative regulation of I-kappaB kinase/NF-kappaB signaling(GO:0043124) |
| 0.0 | 0.1 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
| 0.0 | 0.1 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
| 0.0 | 0.0 | GO:0045112 | integrin biosynthetic process(GO:0045112) |
| 0.0 | 0.0 | GO:0042938 | dipeptide transport(GO:0042938) |
| 0.0 | 0.1 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
| 0.0 | 0.1 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
| 0.0 | 0.0 | GO:2000343 | positive regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000343) |
| 0.0 | 0.2 | GO:0048665 | neuron fate specification(GO:0048665) |
| 0.0 | 0.1 | GO:0023035 | CD40 signaling pathway(GO:0023035) |
| 0.0 | 0.0 | GO:0046719 | regulation by virus of viral protein levels in host cell(GO:0046719) |
| 0.0 | 0.1 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
| 0.0 | 0.0 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.0 | 0.2 | GO:0046579 | positive regulation of Ras protein signal transduction(GO:0046579) |
| 0.0 | 0.2 | GO:0044406 | adhesion of symbiont to host(GO:0044406) |
| 0.0 | 0.1 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.0 | 0.1 | GO:0003338 | metanephros morphogenesis(GO:0003338) |
| 0.0 | 0.4 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
| 0.0 | 0.0 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
| 0.0 | 0.0 | GO:0030578 | PML body organization(GO:0030578) |
| 0.0 | 0.1 | GO:0036089 | cleavage furrow formation(GO:0036089) |
| 0.0 | 0.1 | GO:1902003 | regulation of beta-amyloid formation(GO:1902003) |
| 0.0 | 0.1 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
| 0.0 | 0.1 | GO:0010766 | negative regulation of sodium ion transport(GO:0010766) |
| 0.0 | 0.0 | GO:0061072 | iris morphogenesis(GO:0061072) |
| 0.0 | 0.0 | GO:0002576 | platelet degranulation(GO:0002576) |
| 0.0 | 0.1 | GO:0001835 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
| 0.0 | 0.0 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
| 0.0 | 0.1 | GO:0006707 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.0 | 0.2 | GO:0021514 | ventral spinal cord interneuron differentiation(GO:0021514) |
| 0.0 | 0.1 | GO:0045745 | positive regulation of G-protein coupled receptor protein signaling pathway(GO:0045745) |
| 0.0 | 0.1 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.0 | 0.1 | GO:0031440 | regulation of mRNA 3'-end processing(GO:0031440) |
| 0.0 | 0.0 | GO:0046084 | adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
| 0.0 | 0.2 | GO:0007026 | negative regulation of microtubule depolymerization(GO:0007026) |
| 0.0 | 0.0 | GO:2000193 | positive regulation of fatty acid transport(GO:2000193) |
| 0.0 | 0.1 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
| 0.0 | 0.0 | GO:0034035 | purine ribonucleoside bisphosphate metabolic process(GO:0034035) |
| 0.0 | 0.1 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
| 0.0 | 0.1 | GO:0002176 | male germ cell proliferation(GO:0002176) |
| 0.0 | 0.0 | GO:0046015 | regulation of transcription by glucose(GO:0046015) |
| 0.0 | 0.1 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
| 0.0 | 0.0 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
| 0.0 | 0.1 | GO:0030157 | pancreatic juice secretion(GO:0030157) |
| 0.0 | 0.0 | GO:0032687 | negative regulation of interferon-alpha production(GO:0032687) |
| 0.0 | 0.2 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
| 0.0 | 0.0 | GO:0048880 | sensory system development(GO:0048880) |
| 0.0 | 0.0 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
| 0.0 | 0.1 | GO:0043496 | regulation of protein homodimerization activity(GO:0043496) |
| 0.0 | 0.4 | GO:0007584 | response to nutrient(GO:0007584) |
| 0.0 | 0.0 | GO:0046952 | ketone body catabolic process(GO:0046952) |
| 0.0 | 0.0 | GO:2000834 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
| 0.0 | 0.1 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.0 | 0.0 | GO:0042699 | follicle-stimulating hormone signaling pathway(GO:0042699) |
| 0.0 | 0.0 | GO:1904219 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.0 | 0.0 | GO:0045759 | negative regulation of action potential(GO:0045759) |
| 0.0 | 0.0 | GO:0033522 | histone H2A ubiquitination(GO:0033522) |
| 0.0 | 0.0 | GO:0090598 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
| 0.0 | 0.1 | GO:0045793 | positive regulation of cell size(GO:0045793) |
| 0.0 | 0.1 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.0 | 0.0 | GO:0042996 | regulation of Golgi to plasma membrane protein transport(GO:0042996) |
| 0.0 | 0.5 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
| 0.0 | 0.2 | GO:0097576 | autophagosome maturation(GO:0097352) vacuole fusion(GO:0097576) |
| 0.0 | 0.4 | GO:0032465 | regulation of cytokinesis(GO:0032465) |
| 0.0 | 0.0 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
| 0.0 | 0.0 | GO:2001055 | positive regulation of mesenchymal cell apoptotic process(GO:2001055) |
| 0.0 | 0.1 | GO:0042044 | fluid transport(GO:0042044) |
| 0.0 | 0.0 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
| 0.0 | 0.1 | GO:0060236 | regulation of mitotic spindle organization(GO:0060236) |
| 0.0 | 0.1 | GO:0030311 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.0 | 0.0 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
| 0.0 | 0.1 | GO:0021830 | interneuron migration from the subpallium to the cortex(GO:0021830) |
| 0.0 | 0.2 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
| 0.0 | 0.0 | GO:0002930 | trabecular meshwork development(GO:0002930) |
| 0.0 | 0.2 | GO:0043550 | regulation of lipid kinase activity(GO:0043550) |
| 0.0 | 0.1 | GO:0090273 | regulation of somatostatin secretion(GO:0090273) |
| 0.0 | 0.1 | GO:0038093 | Fc receptor signaling pathway(GO:0038093) |
| 0.0 | 0.0 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
| 0.0 | 0.0 | GO:0010996 | response to auditory stimulus(GO:0010996) |
| 0.0 | 0.0 | GO:0044034 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 0.0 | 0.0 | GO:0033085 | negative regulation of T cell differentiation in thymus(GO:0033085) |
| 0.0 | 0.1 | GO:0035025 | positive regulation of Rho protein signal transduction(GO:0035025) |
| 0.0 | 0.1 | GO:1902855 | regulation of nonmotile primary cilium assembly(GO:1902855) |
| 0.0 | 0.0 | GO:0051582 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
| 0.0 | 0.0 | GO:0032328 | alanine transport(GO:0032328) |
| 0.0 | 0.0 | GO:1902953 | positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
| 0.0 | 0.1 | GO:0015727 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 0.0 | 0.0 | GO:0061317 | canonical Wnt signaling pathway involved in cardiac muscle cell fate commitment(GO:0061317) |
| 0.0 | 0.0 | GO:0070268 | cornification(GO:0070268) |
| 0.0 | 0.0 | GO:1902267 | polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) |
| 0.0 | 0.0 | GO:0010728 | regulation of hydrogen peroxide biosynthetic process(GO:0010728) |
| 0.0 | 0.0 | GO:0014866 | skeletal myofibril assembly(GO:0014866) |
| 0.0 | 0.1 | GO:0071420 | cellular response to histamine(GO:0071420) |
| 0.0 | 0.0 | GO:1902031 | regulation of NADP metabolic process(GO:1902031) |
| 0.0 | 0.1 | GO:0006528 | asparagine metabolic process(GO:0006528) |
| 0.0 | 0.1 | GO:0006999 | nuclear pore organization(GO:0006999) |
| 0.0 | 0.0 | GO:0043578 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.0 | 0.0 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
| 0.0 | 0.1 | GO:0006884 | cell volume homeostasis(GO:0006884) |
| 0.0 | 0.1 | GO:0018342 | protein prenylation(GO:0018342) prenylation(GO:0097354) |
| 0.0 | 0.0 | GO:1903431 | positive regulation of cell maturation(GO:1903431) |
| 0.0 | 0.0 | GO:1900165 | negative regulation of interleukin-6 secretion(GO:1900165) |
| 0.0 | 0.0 | GO:0019532 | oxalate transport(GO:0019532) |
| 0.0 | 0.2 | GO:0006958 | complement activation, classical pathway(GO:0006958) |
| 0.0 | 0.0 | GO:0090306 | spindle assembly involved in meiosis(GO:0090306) |
| 0.0 | 0.0 | GO:0035993 | deltoid tuberosity development(GO:0035993) |
| 0.0 | 0.3 | GO:0006334 | nucleosome assembly(GO:0006334) |
| 0.0 | 0.1 | GO:0014067 | negative regulation of phosphatidylinositol 3-kinase signaling(GO:0014067) |
| 0.0 | 0.0 | GO:0031999 | negative regulation of fatty acid beta-oxidation(GO:0031999) |
| 0.0 | 0.0 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.0 | 3.1 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
| 0.5 | 2.4 | GO:0045098 | type III intermediate filament(GO:0045098) |
| 0.3 | 1.0 | GO:0048179 | activin receptor complex(GO:0048179) |
| 0.3 | 1.0 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
| 0.2 | 0.9 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.2 | 0.8 | GO:0044316 | cone cell pedicle(GO:0044316) |
| 0.2 | 1.0 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
| 0.2 | 0.6 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
| 0.2 | 0.5 | GO:0070765 | gamma-secretase complex(GO:0070765) |
| 0.2 | 1.5 | GO:0016342 | catenin complex(GO:0016342) |
| 0.2 | 0.8 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.2 | 0.7 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
| 0.2 | 0.5 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
| 0.2 | 0.6 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.1 | 0.6 | GO:0045293 | mRNA editing complex(GO:0045293) |
| 0.1 | 0.1 | GO:0000811 | GINS complex(GO:0000811) |
| 0.1 | 0.1 | GO:0000125 | PCAF complex(GO:0000125) |
| 0.1 | 0.4 | GO:0097413 | Lewy body(GO:0097413) |
| 0.1 | 0.5 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.1 | 0.7 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
| 0.1 | 0.3 | GO:0036449 | microtubule minus-end(GO:0036449) |
| 0.1 | 1.9 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
| 0.1 | 0.4 | GO:0071817 | MMXD complex(GO:0071817) |
| 0.1 | 0.4 | GO:0042825 | TAP complex(GO:0042825) |
| 0.1 | 0.3 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
| 0.1 | 0.4 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.1 | 0.4 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| 0.1 | 0.3 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.1 | 0.3 | GO:0070939 | Dsl1p complex(GO:0070939) |
| 0.1 | 1.2 | GO:0005652 | nuclear lamina(GO:0005652) |
| 0.1 | 0.5 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.1 | 0.4 | GO:0070545 | PeBoW complex(GO:0070545) |
| 0.1 | 4.1 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.1 | 0.4 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.1 | 0.8 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.1 | 0.2 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
| 0.1 | 0.3 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
| 0.1 | 0.3 | GO:0043159 | acrosomal matrix(GO:0043159) |
| 0.1 | 0.8 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.1 | 0.9 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.1 | 0.5 | GO:0070688 | MLL5-L complex(GO:0070688) |
| 0.1 | 1.2 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.1 | 0.3 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 0.1 | 0.3 | GO:0097452 | GAIT complex(GO:0097452) |
| 0.1 | 0.1 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.1 | 0.3 | GO:0005610 | laminin-5 complex(GO:0005610) |
| 0.1 | 1.2 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.1 | 0.2 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
| 0.1 | 0.5 | GO:0070578 | RISC-loading complex(GO:0070578) |
| 0.1 | 0.2 | GO:0033647 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
| 0.1 | 0.2 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.1 | 0.4 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.1 | 0.4 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.1 | 0.2 | GO:0030127 | COPII vesicle coat(GO:0030127) |
| 0.1 | 0.9 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.1 | 0.2 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.1 | 0.2 | GO:0000791 | euchromatin(GO:0000791) |
| 0.1 | 0.2 | GO:0038037 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
| 0.1 | 0.3 | GO:0030686 | 90S preribosome(GO:0030686) |
| 0.1 | 0.1 | GO:0042824 | MHC class I peptide loading complex(GO:0042824) |
| 0.1 | 0.2 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
| 0.1 | 0.5 | GO:0030669 | clathrin-coated endocytic vesicle membrane(GO:0030669) |
| 0.1 | 0.5 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.1 | 0.3 | GO:0005579 | membrane attack complex(GO:0005579) |
| 0.0 | 0.3 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.0 | 1.1 | GO:0005719 | nuclear euchromatin(GO:0005719) |
| 0.0 | 0.3 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.0 | 0.1 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
| 0.0 | 0.4 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.0 | 0.1 | GO:0097441 | basilar dendrite(GO:0097441) |
| 0.0 | 0.2 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.0 | 0.1 | GO:1990423 | RZZ complex(GO:1990423) |
| 0.0 | 0.2 | GO:0042583 | chromaffin granule(GO:0042583) |
| 0.0 | 2.4 | GO:0005811 | lipid particle(GO:0005811) |
| 0.0 | 0.3 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.0 | 0.1 | GO:0043259 | laminin-10 complex(GO:0043259) |
| 0.0 | 0.3 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
| 0.0 | 0.4 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.0 | 0.2 | GO:1990130 | Iml1 complex(GO:1990130) |
| 0.0 | 0.2 | GO:0071458 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) |
| 0.0 | 0.2 | GO:0032389 | MutLalpha complex(GO:0032389) |
| 0.0 | 0.3 | GO:0070187 | telosome(GO:0070187) |
| 0.0 | 0.3 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
| 0.0 | 0.5 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
| 0.0 | 0.2 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
| 0.0 | 0.0 | GO:0044393 | microspike(GO:0044393) |
| 0.0 | 0.1 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
| 0.0 | 0.6 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
| 0.0 | 0.3 | GO:0045180 | basal cortex(GO:0045180) |
| 0.0 | 0.0 | GO:0098576 | lumenal side of membrane(GO:0098576) |
| 0.0 | 0.1 | GO:0031094 | platelet dense tubular network(GO:0031094) |
| 0.0 | 0.2 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
| 0.0 | 0.2 | GO:0089701 | U2AF(GO:0089701) |
| 0.0 | 0.2 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.0 | 0.1 | GO:0097425 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
| 0.0 | 0.6 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
| 0.0 | 0.3 | GO:0036128 | CatSper complex(GO:0036128) |
| 0.0 | 0.9 | GO:0071339 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
| 0.0 | 0.1 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.0 | 0.4 | GO:0045239 | tricarboxylic acid cycle enzyme complex(GO:0045239) |
| 0.0 | 0.4 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.0 | 0.2 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
| 0.0 | 0.3 | GO:0036156 | inner dynein arm(GO:0036156) |
| 0.0 | 0.2 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 0.0 | 0.5 | GO:0036038 | MKS complex(GO:0036038) |
| 0.0 | 0.1 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.0 | 0.2 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.0 | 0.4 | GO:0031528 | microvillus membrane(GO:0031528) |
| 0.0 | 0.1 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
| 0.0 | 0.4 | GO:0043196 | varicosity(GO:0043196) |
| 0.0 | 0.4 | GO:0032426 | stereocilium tip(GO:0032426) |
| 0.0 | 0.1 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
| 0.0 | 0.3 | GO:0005675 | holo TFIIH complex(GO:0005675) |
| 0.0 | 0.1 | GO:0072588 | box H/ACA snoRNP complex(GO:0031429) box H/ACA RNP complex(GO:0072588) |
| 0.0 | 0.1 | GO:0098536 | deuterosome(GO:0098536) |
| 0.0 | 0.1 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
| 0.0 | 1.0 | GO:0005762 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.0 | 0.2 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.0 | 0.1 | GO:0005818 | aster(GO:0005818) |
| 0.0 | 0.2 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 0.0 | 0.1 | GO:1990923 | PET complex(GO:1990923) |
| 0.0 | 0.1 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
| 0.0 | 0.1 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
| 0.0 | 0.1 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.0 | 0.1 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
| 0.0 | 0.2 | GO:0002177 | manchette(GO:0002177) |
| 0.0 | 0.3 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.0 | 0.4 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
| 0.0 | 0.1 | GO:0071797 | LUBAC complex(GO:0071797) |
| 0.0 | 0.1 | GO:0005687 | U4 snRNP(GO:0005687) |
| 0.0 | 0.2 | GO:0045275 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
| 0.0 | 1.0 | GO:0000313 | organellar ribosome(GO:0000313) mitochondrial ribosome(GO:0005761) |
| 0.0 | 0.4 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
| 0.0 | 0.1 | GO:0016939 | kinesin II complex(GO:0016939) |
| 0.0 | 1.1 | GO:0005747 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
| 0.0 | 0.2 | GO:0000777 | condensed chromosome kinetochore(GO:0000777) |
| 0.0 | 0.1 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
| 0.0 | 1.2 | GO:0031903 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
| 0.0 | 0.3 | GO:0000242 | pericentriolar material(GO:0000242) |
| 0.0 | 0.5 | GO:0043034 | costamere(GO:0043034) |
| 0.0 | 0.6 | GO:0016235 | aggresome(GO:0016235) |
| 0.0 | 0.1 | GO:0030478 | actin cap(GO:0030478) |
| 0.0 | 0.1 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.0 | 0.2 | GO:0010369 | chromocenter(GO:0010369) |
| 0.0 | 0.1 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
| 0.0 | 0.2 | GO:0033263 | CORVET complex(GO:0033263) |
| 0.0 | 0.1 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.0 | 0.1 | GO:0032437 | cuticular plate(GO:0032437) |
| 0.0 | 0.1 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
| 0.0 | 0.3 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.0 | 0.1 | GO:0008091 | spectrin(GO:0008091) |
| 0.0 | 0.1 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 0.0 | 0.1 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
| 0.0 | 0.4 | GO:0005614 | interstitial matrix(GO:0005614) |
| 0.0 | 0.8 | GO:0031519 | PcG protein complex(GO:0031519) |
| 0.0 | 0.2 | GO:0030914 | STAGA complex(GO:0030914) |
| 0.0 | 0.2 | GO:0034992 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.0 | 0.6 | GO:0005801 | cis-Golgi network(GO:0005801) |
| 0.0 | 0.8 | GO:0016592 | mediator complex(GO:0016592) |
| 0.0 | 0.1 | GO:0000938 | GARP complex(GO:0000938) |
| 0.0 | 0.1 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
| 0.0 | 0.1 | GO:0098827 | endoplasmic reticulum subcompartment(GO:0098827) |
| 0.0 | 0.3 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
| 0.0 | 0.1 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
| 0.0 | 0.2 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.0 | 0.2 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.0 | 1.3 | GO:0016363 | nuclear matrix(GO:0016363) |
| 0.0 | 0.8 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
| 0.0 | 0.5 | GO:0051233 | spindle midzone(GO:0051233) |
| 0.0 | 0.1 | GO:0016011 | dystroglycan complex(GO:0016011) |
| 0.0 | 0.3 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.0 | 0.2 | GO:0098533 | ATPase dependent transmembrane transport complex(GO:0098533) |
| 0.0 | 0.5 | GO:0032040 | small-subunit processome(GO:0032040) |
| 0.0 | 0.2 | GO:0031512 | motile primary cilium(GO:0031512) |
| 0.0 | 1.9 | GO:0008021 | synaptic vesicle(GO:0008021) |
| 0.0 | 0.3 | GO:0097228 | sperm principal piece(GO:0097228) |
| 0.0 | 2.0 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
| 0.0 | 0.2 | GO:0072546 | ER membrane protein complex(GO:0072546) |
| 0.0 | 0.1 | GO:0072534 | perineuronal net(GO:0072534) |
| 0.0 | 0.4 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
| 0.0 | 0.4 | GO:0005865 | striated muscle thin filament(GO:0005865) |
| 0.0 | 0.2 | GO:0001741 | XY body(GO:0001741) |
| 0.0 | 0.1 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
| 0.0 | 0.0 | GO:0071942 | XPC complex(GO:0071942) |
| 0.0 | 0.0 | GO:0033162 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
| 0.0 | 0.9 | GO:0030175 | filopodium(GO:0030175) |
| 0.0 | 0.1 | GO:0034709 | methylosome(GO:0034709) |
| 0.0 | 0.0 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.0 | 0.1 | GO:0016010 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
| 0.0 | 0.3 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
| 0.0 | 0.1 | GO:0000805 | X chromosome(GO:0000805) |
| 0.0 | 0.4 | GO:0031672 | A band(GO:0031672) |
| 0.0 | 0.0 | GO:0055087 | Ski complex(GO:0055087) |
| 0.0 | 0.1 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
| 0.0 | 0.0 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 0.0 | 0.0 | GO:0005712 | chiasma(GO:0005712) |
| 0.0 | 0.2 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
| 0.0 | 0.0 | GO:1990131 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.0 | 0.1 | GO:0032797 | SMN complex(GO:0032797) |
| 0.0 | 0.7 | GO:0000502 | proteasome complex(GO:0000502) |
| 0.0 | 0.1 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.0 | 0.2 | GO:0005876 | spindle microtubule(GO:0005876) |
| 0.0 | 0.0 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.0 | 0.1 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.0 | 0.2 | GO:0034451 | centriolar satellite(GO:0034451) |
| 0.0 | 0.1 | GO:0019908 | nuclear cyclin-dependent protein kinase holoenzyme complex(GO:0019908) |
| 0.0 | 0.1 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.0 | 0.3 | GO:0005637 | nuclear inner membrane(GO:0005637) |
| 0.0 | 0.1 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.0 | 0.1 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
| 0.0 | 0.2 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
| 0.0 | 0.0 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.0 | 0.2 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
| 0.0 | 0.1 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.0 | 0.0 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.0 | 0.0 | GO:0005927 | muscle tendon junction(GO:0005927) |
| 0.0 | 0.2 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.0 | 0.1 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.0 | 0.0 | GO:0097524 | sperm plasma membrane(GO:0097524) |
| 0.0 | 0.0 | GO:0044326 | dendritic spine neck(GO:0044326) |
| 0.0 | 0.5 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
| 0.0 | 0.6 | GO:0000922 | spindle pole(GO:0000922) |
| 0.0 | 0.1 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.0 | 0.4 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
| 0.0 | 0.1 | GO:0005883 | neurofilament(GO:0005883) |
| 0.0 | 0.3 | GO:0030315 | T-tubule(GO:0030315) |
| 0.0 | 0.0 | GO:1990716 | axonemal central apparatus(GO:1990716) |
| 0.0 | 0.3 | GO:0000152 | nuclear ubiquitin ligase complex(GO:0000152) |
| 0.0 | 0.0 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.0 | 0.0 | GO:0005608 | laminin-3 complex(GO:0005608) |
| 0.0 | 0.1 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
| 0.0 | 0.1 | GO:0097225 | sperm midpiece(GO:0097225) |
| 0.0 | 0.0 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
| 0.0 | 0.0 | GO:0000439 | core TFIIH complex(GO:0000439) |
| 0.0 | 0.7 | GO:0005759 | mitochondrial matrix(GO:0005759) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.1 | 3.4 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
| 0.7 | 2.1 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
| 0.5 | 1.6 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
| 0.4 | 3.5 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.4 | 1.1 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.3 | 1.0 | GO:0038181 | bile acid receptor activity(GO:0038181) |
| 0.3 | 1.0 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
| 0.3 | 1.8 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) |
| 0.3 | 0.9 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
| 0.3 | 0.8 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
| 0.3 | 0.8 | GO:0004771 | sterol esterase activity(GO:0004771) |
| 0.3 | 1.1 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
| 0.3 | 1.3 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
| 0.3 | 1.0 | GO:0034056 | estrogen response element binding(GO:0034056) |
| 0.3 | 1.0 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
| 0.2 | 0.7 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
| 0.2 | 0.7 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.2 | 1.0 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
| 0.2 | 0.7 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
| 0.2 | 0.2 | GO:0015927 | trehalase activity(GO:0015927) |
| 0.2 | 0.6 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
| 0.2 | 0.6 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.2 | 2.0 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.2 | 0.9 | GO:0052723 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
| 0.2 | 0.8 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
| 0.2 | 1.4 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.2 | 0.5 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.2 | 0.2 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
| 0.2 | 0.8 | GO:0070728 | leucine binding(GO:0070728) |
| 0.1 | 1.5 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
| 0.1 | 0.6 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
| 0.1 | 1.7 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.1 | 0.8 | GO:0043295 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
| 0.1 | 1.0 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 0.1 | 0.4 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
| 0.1 | 0.3 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
| 0.1 | 0.4 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
| 0.1 | 0.5 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.1 | 0.5 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
| 0.1 | 0.5 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.1 | 0.4 | GO:0016215 | acyl-CoA desaturase activity(GO:0016215) |
| 0.1 | 0.4 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
| 0.1 | 0.6 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
| 0.1 | 0.4 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
| 0.1 | 0.4 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
| 0.1 | 0.4 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
| 0.1 | 2.3 | GO:0003785 | actin monomer binding(GO:0003785) |
| 0.1 | 1.2 | GO:0045294 | alpha-catenin binding(GO:0045294) |
| 0.1 | 0.3 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.1 | 0.3 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
| 0.1 | 0.7 | GO:0031685 | adenosine receptor binding(GO:0031685) |
| 0.1 | 0.4 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
| 0.1 | 0.8 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
| 0.1 | 0.5 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
| 0.1 | 0.6 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
| 0.1 | 0.2 | GO:1990239 | steroid hormone binding(GO:1990239) |
| 0.1 | 0.3 | GO:0055100 | adiponectin binding(GO:0055100) |
| 0.1 | 0.4 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
| 0.1 | 0.5 | GO:0051880 | G-quadruplex DNA binding(GO:0051880) |
| 0.1 | 0.6 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.1 | 0.2 | GO:0018685 | alkane 1-monooxygenase activity(GO:0018685) |
| 0.1 | 0.1 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
| 0.1 | 0.6 | GO:0043426 | MRF binding(GO:0043426) |
| 0.1 | 0.4 | GO:0035671 | enone reductase activity(GO:0035671) |
| 0.1 | 0.6 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.1 | 3.0 | GO:0051723 | protein methylesterase activity(GO:0051723) |
| 0.1 | 0.7 | GO:0004779 | sulfate adenylyltransferase activity(GO:0004779) |
| 0.1 | 0.3 | GO:0034191 | apolipoprotein A-I receptor binding(GO:0034191) |
| 0.1 | 0.3 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.1 | 0.4 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.1 | 0.3 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
| 0.1 | 0.5 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
| 0.1 | 0.1 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
| 0.1 | 0.8 | GO:0070411 | I-SMAD binding(GO:0070411) |
| 0.1 | 0.3 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
| 0.1 | 0.6 | GO:0016668 | oxidoreductase activity, acting on a sulfur group of donors, NAD(P) as acceptor(GO:0016668) |
| 0.1 | 0.3 | GO:0038064 | collagen receptor activity(GO:0038064) |
| 0.1 | 0.2 | GO:0005347 | ATP transmembrane transporter activity(GO:0005347) |
| 0.1 | 1.1 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.1 | 0.1 | GO:0000009 | alpha-1,6-mannosyltransferase activity(GO:0000009) |
| 0.1 | 0.2 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
| 0.1 | 0.1 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
| 0.1 | 0.2 | GO:0005119 | smoothened binding(GO:0005119) |
| 0.1 | 0.5 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.1 | 0.3 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
| 0.1 | 0.3 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
| 0.1 | 0.4 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.1 | 0.2 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
| 0.1 | 0.3 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
| 0.1 | 0.2 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.1 | 0.6 | GO:0043996 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
| 0.1 | 0.1 | GO:0000403 | Y-form DNA binding(GO:0000403) |
| 0.1 | 2.0 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
| 0.1 | 0.1 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
| 0.1 | 0.2 | GO:0016842 | amidine-lyase activity(GO:0016842) |
| 0.1 | 0.2 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.1 | 0.1 | GO:0070699 | type II activin receptor binding(GO:0070699) |
| 0.1 | 0.2 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
| 0.1 | 0.1 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
| 0.1 | 0.4 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.1 | 0.1 | GO:0098847 | sequence-specific single stranded DNA binding(GO:0098847) |
| 0.1 | 0.3 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
| 0.1 | 0.8 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.1 | 0.3 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.1 | 0.2 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
| 0.1 | 0.4 | GO:0015288 | porin activity(GO:0015288) |
| 0.1 | 0.2 | GO:0050816 | phosphothreonine binding(GO:0050816) |
| 0.1 | 0.3 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 0.1 | 0.2 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
| 0.1 | 0.1 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
| 0.1 | 0.6 | GO:0001223 | transcription coactivator binding(GO:0001223) |
| 0.1 | 0.1 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
| 0.1 | 0.7 | GO:0034843 | 2-oxoglutaryl-CoA thioesterase activity(GO:0034843) 2,4,4-trimethyl-3-oxopentanoyl-CoA thioesterase activity(GO:0034869) 3-isopropylbut-3-enoyl-CoA thioesterase activity(GO:0034946) glutaryl-CoA hydrolase activity(GO:0044466) |
| 0.1 | 0.4 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
| 0.1 | 1.8 | GO:0004364 | glutathione transferase activity(GO:0004364) |
| 0.1 | 0.3 | GO:0043140 | ATP-dependent 3'-5' DNA helicase activity(GO:0043140) |
| 0.1 | 0.2 | GO:0030350 | iron-responsive element binding(GO:0030350) |
| 0.1 | 0.2 | GO:0004365 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
| 0.1 | 0.4 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
| 0.1 | 1.2 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
| 0.1 | 0.2 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
| 0.1 | 0.6 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
| 0.1 | 0.5 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
| 0.1 | 0.3 | GO:0002054 | nucleobase binding(GO:0002054) |
| 0.1 | 1.4 | GO:0030552 | cAMP binding(GO:0030552) |
| 0.1 | 0.2 | GO:0004370 | glycerol kinase activity(GO:0004370) |
| 0.1 | 0.2 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
| 0.1 | 0.2 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
| 0.1 | 0.6 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
| 0.1 | 0.1 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.1 | 0.7 | GO:0070402 | NADPH binding(GO:0070402) |
| 0.1 | 0.2 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
| 0.1 | 0.5 | GO:0030983 | mismatched DNA binding(GO:0030983) |
| 0.1 | 0.2 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
| 0.1 | 0.3 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
| 0.1 | 1.0 | GO:0005527 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.1 | 0.5 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.1 | 0.7 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.1 | 0.3 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
| 0.1 | 0.2 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 0.1 | 0.3 | GO:0042015 | interleukin-20 binding(GO:0042015) |
| 0.1 | 0.2 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
| 0.1 | 0.1 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
| 0.1 | 2.2 | GO:0016763 | transferase activity, transferring pentosyl groups(GO:0016763) |
| 0.1 | 0.3 | GO:0005113 | patched binding(GO:0005113) |
| 0.1 | 0.3 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
| 0.1 | 2.1 | GO:0017046 | peptide hormone binding(GO:0017046) |
| 0.1 | 1.0 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.1 | 0.1 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
| 0.1 | 0.4 | GO:0016679 | oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) |
| 0.1 | 0.5 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
| 0.1 | 1.0 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
| 0.0 | 0.5 | GO:0044548 | S100 protein binding(GO:0044548) |
| 0.0 | 1.0 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
| 0.0 | 0.2 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 0.0 | 0.2 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.0 | 0.2 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
| 0.0 | 0.3 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.0 | 0.2 | GO:0071614 | linoleic acid epoxygenase activity(GO:0071614) |
| 0.0 | 1.0 | GO:0008137 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.0 | 0.1 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
| 0.0 | 0.2 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.0 | 0.6 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
| 0.0 | 0.2 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) |
| 0.0 | 0.2 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
| 0.0 | 0.1 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
| 0.0 | 0.1 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
| 0.0 | 0.4 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.0 | 0.3 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.0 | 0.3 | GO:0035197 | siRNA binding(GO:0035197) |
| 0.0 | 0.2 | GO:0004340 | glucokinase activity(GO:0004340) hexokinase activity(GO:0004396) |
| 0.0 | 0.4 | GO:0019534 | toxin transporter activity(GO:0019534) |
| 0.0 | 0.2 | GO:0015057 | thrombin receptor activity(GO:0015057) |
| 0.0 | 0.3 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.0 | 0.2 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
| 0.0 | 0.5 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
| 0.0 | 0.1 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.0 | 0.1 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.0 | 0.2 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
| 0.0 | 0.2 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
| 0.0 | 0.1 | GO:0016713 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced iron-sulfur protein as one donor, and incorporation of one atom of oxygen(GO:0016713) |
| 0.0 | 0.5 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.0 | 0.3 | GO:1990446 | U1 snRNP binding(GO:1990446) |
| 0.0 | 0.5 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
| 0.0 | 0.3 | GO:0098505 | G-rich strand telomeric DNA binding(GO:0098505) |
| 0.0 | 0.1 | GO:0004470 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) |
| 0.0 | 0.2 | GO:0005047 | signal recognition particle binding(GO:0005047) |
| 0.0 | 0.8 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
| 0.0 | 0.1 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
| 0.0 | 0.1 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 0.0 | 0.1 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
| 0.0 | 0.2 | GO:0004690 | cyclic nucleotide-dependent protein kinase activity(GO:0004690) |
| 0.0 | 0.2 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
| 0.0 | 0.4 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.0 | 0.1 | GO:0016015 | morphogen activity(GO:0016015) |
| 0.0 | 0.1 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.0 | 0.2 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
| 0.0 | 0.5 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.0 | 0.2 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
| 0.0 | 0.3 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
| 0.0 | 0.2 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.0 | 0.1 | GO:0004477 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
| 0.0 | 0.3 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
| 0.0 | 0.1 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
| 0.0 | 0.3 | GO:0043912 | D-lysine oxidase activity(GO:0043912) |
| 0.0 | 0.1 | GO:0005329 | dopamine transmembrane transporter activity(GO:0005329) |
| 0.0 | 0.3 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
| 0.0 | 0.1 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 0.0 | 0.2 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
| 0.0 | 0.1 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 0.0 | 0.1 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
| 0.0 | 0.2 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.0 | 0.1 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.0 | 0.2 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.0 | 0.1 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
| 0.0 | 0.2 | GO:0008494 | translation activator activity(GO:0008494) |
| 0.0 | 0.1 | GO:0004096 | catalase activity(GO:0004096) |
| 0.0 | 0.2 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
| 0.0 | 0.1 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
| 0.0 | 0.1 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.0 | 1.4 | GO:0043022 | ribosome binding(GO:0043022) |
| 0.0 | 1.3 | GO:0000049 | tRNA binding(GO:0000049) |
| 0.0 | 0.4 | GO:0032183 | SUMO binding(GO:0032183) |
| 0.0 | 0.0 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
| 0.0 | 0.2 | GO:0046790 | virion binding(GO:0046790) |
| 0.0 | 0.4 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
| 0.0 | 0.1 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.0 | 0.1 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.0 | 0.1 | GO:0034806 | 2,3-dihydroxy DDT 1,2-dioxygenase activity(GO:0018542) phenanthrene dioxygenase activity(GO:0018555) 2,2',3-trihydroxybiphenyl dioxygenase activity(GO:0018556) 1,2-dihydroxyfluorene 1,1-alpha-dioxygenase activity(GO:0018557) 5,6-dihydroxy-3-methyl-2-oxo-1,2-dihydroquinoline dioxygenase activity(GO:0018558) 1,1-dichloro-2-(dihydroxy-4-chlorophenyl)-(4-chlorophenyl)ethene 1,2-dioxygenase activity(GO:0018559) protocatechuate 3,4-dioxygenase type II activity(GO:0018560) 2'-aminobiphenyl-2,3-diol 1,2-dioxygenase activity(GO:0018561) 3,4-dihydroxyfluorene 4,4-alpha-dioxygenase activity(GO:0018562) 2,3-dihydroxy-ethylbenzene 1,2-dioxygenase activity(GO:0018563) carbazole 1,9a-dioxygenase activity(GO:0018564) dihydroxydibenzothiophene dioxygenase activity(GO:0018565) 1,2-dihydroxynaphthalene-6-sulfonate 1,8a-dioxygenase activity(GO:0018566) styrene dioxygenase activity(GO:0018567) 3,4-dihydroxyphenanthrene dioxygenase activity(GO:0018568) hydroquinone 1,2-dioxygenase activity(GO:0018569) p-cumate 2,3-dioxygenase activity(GO:0018570) 2,3-dihydroxy-p-cumate dioxygenase activity(GO:0018571) 3,5-dichlorocatechol 1,2-dioxygenase activity(GO:0018572) 2-aminophenol 1,6-dioxygenase activity(GO:0018573) 2,6-dichloro-p-hydroquinone 1,2-dioxygenase activity(GO:0018574) chlorocatechol 1,2-dioxygenase activity(GO:0018575) catechol dioxygenase activity(GO:0019114) dihydroxyfluorene dioxygenase activity(GO:0019117) 5-aminosalicylate dioxygenase activity(GO:0034543) 3-hydroxy-2-naphthoate 2,3-dioxygenase activity(GO:0034803) benzo(a)pyrene 11,12-dioxygenase activity(GO:0034806) benzo(a)pyrene 4,5-dioxygenase activity(GO:0034808) 4,5-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034810) benzo(a)pyrene 9,10-dioxygenase activity(GO:0034811) 9,10-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034812) benzo(a)pyrene 7,8-dioxygenase activity(GO:0034813) 7,8-dihydroxy benzo(a)pyrene dioxygenase activity(GO:0034814) 1,2-dihydroxy-5,6,7,8-tetrahydronaphthalene extradiol dioxygenase activity(GO:0034827) 2-mercaptobenzothiazole dioxygenase activity(GO:0034834) pyridine-3,4-diol dioxygenase activity(GO:0034895) pyrene dioxygenase activity(GO:0034920) 4,5-dihydroxypyrene dioxygenase activity(GO:0034922) phenanthrene-4-carboxylate dioxygenase activity(GO:0034934) tetrachlorobenzene dioxygenase activity(GO:0034935) 4,6-dichloro-3-methylcatechol 1,2-dioxygenase activity(GO:0034936) 2,3-dihydroxydiphenyl ether dioxygenase activity(GO:0034955) diphenyl ether 1,2-dioxygenase activity(GO:0034956) arachidonate 8(S)-lipoxygenase activity(GO:0036403) 4-hydroxycatechol 1,2-dioxygenase activity(GO:0047074) |
| 0.0 | 0.1 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
| 0.0 | 0.3 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
| 0.0 | 0.1 | GO:0031433 | telethonin binding(GO:0031433) |
| 0.0 | 1.1 | GO:0031593 | polyubiquitin binding(GO:0031593) |
| 0.0 | 0.1 | GO:0004705 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
| 0.0 | 0.3 | GO:0001846 | opsonin binding(GO:0001846) |
| 0.0 | 0.2 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
| 0.0 | 0.2 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
| 0.0 | 0.2 | GO:0003997 | acyl-CoA oxidase activity(GO:0003997) |
| 0.0 | 0.1 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) |
| 0.0 | 0.2 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
| 0.0 | 0.2 | GO:0016443 | bidentate ribonuclease III activity(GO:0016443) |
| 0.0 | 0.7 | GO:0005227 | calcium activated cation channel activity(GO:0005227) |
| 0.0 | 0.1 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
| 0.0 | 0.2 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
| 0.0 | 0.3 | GO:0017025 | TBP-class protein binding(GO:0017025) |
| 0.0 | 0.4 | GO:0016289 | CoA hydrolase activity(GO:0016289) |
| 0.0 | 0.2 | GO:0035251 | UDP-glucosyltransferase activity(GO:0035251) |
| 0.0 | 0.0 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
| 0.0 | 0.4 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
| 0.0 | 0.1 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
| 0.0 | 0.2 | GO:0045545 | syndecan binding(GO:0045545) |
| 0.0 | 0.1 | GO:0001642 | group III metabotropic glutamate receptor activity(GO:0001642) |
| 0.0 | 0.1 | GO:0005024 | transforming growth factor beta-activated receptor activity(GO:0005024) |
| 0.0 | 0.1 | GO:0004675 | transmembrane receptor protein serine/threonine kinase activity(GO:0004675) |
| 0.0 | 0.2 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
| 0.0 | 0.6 | GO:0051990 | (R)-2-hydroxyglutarate dehydrogenase activity(GO:0051990) |
| 0.0 | 0.1 | GO:0016885 | CoA carboxylase activity(GO:0016421) ligase activity, forming carbon-carbon bonds(GO:0016885) |
| 0.0 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.0 | 0.7 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
| 0.0 | 0.1 | GO:0004556 | alpha-amylase activity(GO:0004556) |
| 0.0 | 0.4 | GO:0004559 | alpha-mannosidase activity(GO:0004559) |
| 0.0 | 0.6 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.0 | 0.1 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
| 0.0 | 0.1 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 0.0 | 0.1 | GO:0070546 | L-phenylalanine aminotransferase activity(GO:0070546) |
| 0.0 | 0.4 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.0 | 0.5 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
| 0.0 | 0.3 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
| 0.0 | 0.1 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
| 0.0 | 0.1 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
| 0.0 | 0.4 | GO:0043175 | RNA polymerase core enzyme binding(GO:0043175) |
| 0.0 | 0.4 | GO:0015645 | fatty acid ligase activity(GO:0015645) |
| 0.0 | 0.1 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
| 0.0 | 0.1 | GO:0071723 | lipopeptide binding(GO:0071723) |
| 0.0 | 0.1 | GO:0035514 | DNA demethylase activity(GO:0035514) |
| 0.0 | 0.1 | GO:0005042 | netrin receptor activity(GO:0005042) |
| 0.0 | 0.0 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
| 0.0 | 0.0 | GO:0008079 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
| 0.0 | 0.1 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
| 0.0 | 0.4 | GO:0005521 | lamin binding(GO:0005521) |
| 0.0 | 0.1 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
| 0.0 | 0.0 | GO:0000295 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) |
| 0.0 | 0.2 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
| 0.0 | 0.1 | GO:0018503 | enoyl-[acyl-carrier-protein] reductase activity(GO:0016631) 2,3-dihydroxy-2,3-dihydro-phenylpropionate dehydrogenase activity(GO:0018498) cis-2,3-dihydrodiol DDT dehydrogenase activity(GO:0018499) trans-9R,10R-dihydrodiolphenanthrene dehydrogenase activity(GO:0018500) cis-chlorobenzene dihydrodiol dehydrogenase activity(GO:0018501) 2,5-dichloro-2,5-cyclohexadiene-1,4-diol dehydrogenase activity(GO:0018502) trans-1,2-dihydrodiolphenanthrene dehydrogenase activity(GO:0018503) 3,4-dihydroxy-3,4-dihydrofluorene dehydrogenase activity(GO:0034790) benzo(a)pyrene-trans-11,12-dihydrodiol dehydrogenase activity(GO:0034805) benzo(a)pyrene-cis-4,5-dihydrodiol dehydrogenase activity(GO:0034809) citronellyl-CoA dehydrogenase activity(GO:0034824) menthone dehydrogenase activity(GO:0034838) phthalate 3,4-cis-dihydrodiol dehydrogenase activity(GO:0034912) cinnamate reductase activity(GO:0043786) NADPH-dependent curcumin reductase activity(GO:0052849) NADPH-dependent dihydrocurcumin reductase activity(GO:0052850) |
| 0.0 | 0.9 | GO:0008392 | arachidonic acid epoxygenase activity(GO:0008392) |
| 0.0 | 0.0 | GO:0030620 | U2 snRNA binding(GO:0030620) |
| 0.0 | 0.1 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
| 0.0 | 0.1 | GO:0008147 | structural constituent of bone(GO:0008147) |
| 0.0 | 0.0 | GO:0003896 | DNA primase activity(GO:0003896) |
| 0.0 | 0.2 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
| 0.0 | 0.1 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
| 0.0 | 1.9 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
| 0.0 | 0.2 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.0 | 0.1 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.0 | 0.2 | GO:0030553 | cGMP binding(GO:0030553) |
| 0.0 | 0.1 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
| 0.0 | 0.1 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.0 | 0.2 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
| 0.0 | 0.1 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
| 0.0 | 0.2 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
| 0.0 | 0.3 | GO:0030955 | potassium ion binding(GO:0030955) |
| 0.0 | 0.3 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
| 0.0 | 0.7 | GO:0052771 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
| 0.0 | 0.1 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
| 0.0 | 0.1 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.0 | 0.2 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.0 | 0.0 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
| 0.0 | 0.0 | GO:0009374 | biotin binding(GO:0009374) |
| 0.0 | 0.1 | GO:0004017 | adenylate kinase activity(GO:0004017) |
| 0.0 | 0.0 | GO:0045503 | dynein light chain binding(GO:0045503) |
| 0.0 | 0.3 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
| 0.0 | 0.1 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
| 0.0 | 0.1 | GO:0001640 | adenylate cyclase inhibiting G-protein coupled glutamate receptor activity(GO:0001640) |
| 0.0 | 1.2 | GO:0051082 | unfolded protein binding(GO:0051082) |
| 0.0 | 0.0 | GO:0071553 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
| 0.0 | 1.2 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
| 0.0 | 0.0 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
| 0.0 | 0.2 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
| 0.0 | 0.3 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
| 0.0 | 0.0 | GO:0015922 | aspartate oxidase activity(GO:0015922) |
| 0.0 | 0.1 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.0 | 0.1 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.0 | 0.1 | GO:0071253 | connexin binding(GO:0071253) |
| 0.0 | 0.0 | GO:2001070 | starch binding(GO:2001070) |
| 0.0 | 0.1 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
| 0.0 | 0.3 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.0 | 0.3 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
| 0.0 | 0.1 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
| 0.0 | 0.1 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
| 0.0 | 0.0 | GO:0097016 | L27 domain binding(GO:0097016) |
| 0.0 | 0.1 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
| 0.0 | 0.0 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
| 0.0 | 1.9 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.0 | 0.0 | GO:0015928 | fucosidase activity(GO:0015928) |
| 0.0 | 0.1 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
| 0.0 | 0.3 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 0.0 | 0.2 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
| 0.0 | 0.0 | GO:0070883 | pre-miRNA binding(GO:0070883) |
| 0.0 | 0.1 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
| 0.0 | 0.3 | GO:0001614 | purinergic nucleotide receptor activity(GO:0001614) nucleotide receptor activity(GO:0016502) |
| 0.0 | 0.2 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
| 0.0 | 1.1 | GO:0003724 | RNA helicase activity(GO:0003724) |
| 0.0 | 0.1 | GO:0070891 | lipoteichoic acid binding(GO:0070891) |
| 0.0 | 0.2 | GO:0042162 | telomeric DNA binding(GO:0042162) |
| 0.0 | 0.1 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.0 | 0.1 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
| 0.0 | 0.1 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
| 0.0 | 0.1 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
| 0.0 | 0.1 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) |
| 0.0 | 0.1 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
| 0.0 | 0.3 | GO:0042562 | hormone binding(GO:0042562) |
| 0.0 | 0.4 | GO:0003899 | DNA-directed RNA polymerase activity(GO:0003899) |
| 0.0 | 0.0 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
| 0.0 | 0.1 | GO:0034235 | GPI anchor binding(GO:0034235) |
| 0.0 | 0.4 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.0 | 0.2 | GO:0016595 | glutamate binding(GO:0016595) |
| 0.0 | 0.1 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
| 0.0 | 0.0 | GO:0036222 | XTP diphosphatase activity(GO:0036222) |
| 0.0 | 0.1 | GO:0004551 | nucleotide diphosphatase activity(GO:0004551) |
| 0.0 | 0.1 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
| 0.0 | 0.1 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
| 0.0 | 0.0 | GO:0008252 | nucleotidase activity(GO:0008252) |
| 0.0 | 0.0 | GO:0000339 | RNA cap binding(GO:0000339) |
| 0.0 | 0.1 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.0 | 0.0 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
| 0.0 | 0.1 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.0 | 0.2 | GO:0005523 | tropomyosin binding(GO:0005523) |
| 0.0 | 0.1 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
| 0.0 | 2.2 | GO:0001227 | transcriptional repressor activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001227) |
| 0.0 | 0.0 | GO:0019961 | interferon binding(GO:0019961) |
| 0.0 | 0.2 | GO:0015116 | sulfate transmembrane transporter activity(GO:0015116) |
| 0.0 | 0.0 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
| 0.0 | 0.0 | GO:0015923 | mannosidase activity(GO:0015923) |
| 0.0 | 0.1 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
| 0.0 | 0.2 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
| 0.0 | 0.9 | GO:0004386 | helicase activity(GO:0004386) |
| 0.0 | 0.0 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
| 0.0 | 0.1 | GO:0035240 | dopamine binding(GO:0035240) |
| 0.0 | 0.0 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
| 0.0 | 0.1 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.0 | 0.1 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.0 | 0.0 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
| 0.0 | 0.2 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
| 0.0 | 0.2 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
| 0.0 | 0.3 | GO:0004129 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.0 | 0.1 | GO:0008199 | ferric iron binding(GO:0008199) |
| 0.0 | 0.2 | GO:0051184 | cofactor transporter activity(GO:0051184) |
| 0.0 | 0.2 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
| 0.0 | 0.3 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
| 0.0 | 0.3 | GO:0045296 | cadherin binding(GO:0045296) |
| 0.0 | 0.1 | GO:1990405 | protein antigen binding(GO:1990405) |
| 0.0 | 0.1 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
| 0.0 | 0.0 | GO:0048030 | disaccharide binding(GO:0048030) |
| 0.0 | 0.0 | GO:0004748 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.0 | 0.0 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
| 0.0 | 0.1 | GO:0008020 | G-protein coupled photoreceptor activity(GO:0008020) |
| 0.0 | 0.1 | GO:0001618 | virus receptor activity(GO:0001618) |
| 0.0 | 0.1 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
| 0.0 | 0.2 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
| 0.0 | 0.3 | GO:0042056 | chemoattractant activity(GO:0042056) |
| 0.0 | 0.4 | GO:0035064 | methylated histone binding(GO:0035064) |
| 0.0 | 0.0 | GO:0097617 | annealing activity(GO:0097617) |
| 0.0 | 0.4 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
| 0.0 | 0.0 | GO:0005114 | type II transforming growth factor beta receptor binding(GO:0005114) |
| 0.0 | 0.0 | GO:0004046 | aminoacylase activity(GO:0004046) |
| 0.0 | 0.1 | GO:0042043 | neurexin family protein binding(GO:0042043) |
| 0.0 | 0.0 | GO:0004337 | geranyltranstransferase activity(GO:0004337) |
| 0.0 | 0.1 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
| 0.0 | 0.2 | GO:0004889 | acetylcholine-activated cation-selective channel activity(GO:0004889) |
| 0.0 | 0.0 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
| 0.0 | 0.0 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
| 0.0 | 0.0 | GO:0035877 | death effector domain binding(GO:0035877) |
| 0.0 | 0.0 | GO:0030284 | estrogen receptor activity(GO:0030284) |
| 0.0 | 0.0 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
| 0.0 | 0.0 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 0.0 | 0.0 | GO:0008443 | phosphofructokinase activity(GO:0008443) |
| 0.0 | 0.0 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
| 0.0 | 0.0 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
| 0.0 | 0.4 | GO:0005484 | SNAP receptor activity(GO:0005484) |
| 0.0 | 0.1 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.0 | 0.1 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.0 | 1.2 | GO:0008083 | growth factor activity(GO:0008083) |
| 0.0 | 0.1 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.0 | 0.1 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.0 | 0.0 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
| 0.0 | 0.1 | GO:0055106 | ubiquitin-protein transferase regulator activity(GO:0055106) |
| 0.0 | 0.0 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
| 0.0 | 0.0 | GO:0016882 | cyclo-ligase activity(GO:0016882) |
| 0.0 | 0.0 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
| 0.0 | 0.1 | GO:0005351 | sugar:proton symporter activity(GO:0005351) |
| 0.0 | 0.6 | GO:0019905 | syntaxin binding(GO:0019905) |
| 0.0 | 0.0 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 4.9 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.1 | 2.8 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.1 | 2.8 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.1 | 1.1 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.1 | 1.1 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.1 | 2.1 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
| 0.1 | 3.2 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
| 0.1 | 0.1 | ST GAQ PATHWAY | G alpha q Pathway |
| 0.1 | 1.3 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.1 | 0.1 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.1 | 0.1 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
| 0.0 | 0.6 | PID ALK1 PATHWAY | ALK1 signaling events |
| 0.0 | 0.5 | PID S1P S1P2 PATHWAY | S1P2 pathway |
| 0.0 | 1.9 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.0 | 0.7 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
| 0.0 | 2.0 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
| 0.0 | 0.2 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
| 0.0 | 0.3 | PID ERBB1 RECEPTOR PROXIMAL PATHWAY | EGF receptor (ErbB1) signaling pathway |
| 0.0 | 0.3 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
| 0.0 | 0.4 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 0.0 | 0.5 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
| 0.0 | 0.2 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| 0.0 | 0.6 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.0 | 0.1 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
| 0.0 | 0.2 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
| 0.0 | 0.1 | ST GA13 PATHWAY | G alpha 13 Pathway |
| 0.0 | 0.7 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.0 | 0.4 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.0 | 0.7 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.0 | 1.0 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.0 | 0.9 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 0.0 | 0.2 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.0 | 0.3 | ST G ALPHA I PATHWAY | G alpha i Pathway |
| 0.0 | 0.5 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.0 | 1.3 | PID E2F PATHWAY | E2F transcription factor network |
| 0.0 | 0.1 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.0 | 0.1 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 0.0 | 0.1 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
| 0.0 | 0.4 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
| 0.0 | 0.5 | PID FGF PATHWAY | FGF signaling pathway |
| 0.0 | 0.7 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 0.0 | 0.2 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.0 | 0.4 | PID ATM PATHWAY | ATM pathway |
| 0.0 | 0.1 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.0 | 0.1 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
| 0.0 | 0.3 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
| 0.0 | 0.2 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.0 | 0.4 | PID SHP2 PATHWAY | SHP2 signaling |
| 0.0 | 0.2 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
| 0.0 | 0.1 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
| 0.0 | 0.1 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
| 0.0 | 0.1 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
| 0.0 | 0.1 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.0 | 0.1 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.0 | 0.2 | PID IL23 PATHWAY | IL23-mediated signaling events |
| 0.0 | 0.5 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.0 | 0.1 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.0 | 0.0 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.0 | 0.1 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.0 | 0.1 | PID RAC1 PATHWAY | RAC1 signaling pathway |
| 0.0 | 0.1 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.0 | 0.1 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.0 | 0.4 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
| 0.0 | 0.1 | ST G ALPHA S PATHWAY | G alpha s Pathway |
| 0.0 | 0.0 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 4.9 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.2 | 1.9 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.2 | 1.8 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.2 | 2.0 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
| 0.2 | 2.5 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.1 | 0.8 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.1 | 1.6 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
| 0.1 | 1.0 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
| 0.1 | 3.0 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 0.1 | 1.3 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
| 0.1 | 0.8 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
| 0.1 | 1.4 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
| 0.1 | 0.9 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
| 0.1 | 0.3 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
| 0.1 | 1.3 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
| 0.1 | 0.9 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.1 | 1.9 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
| 0.1 | 0.9 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
| 0.1 | 1.1 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
| 0.1 | 0.9 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.1 | 0.4 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 0.1 | 0.6 | REACTOME ADP SIGNALLING THROUGH P2RY1 | Genes involved in ADP signalling through P2Y purinoceptor 1 |
| 0.1 | 1.5 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
| 0.1 | 1.6 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
| 0.1 | 0.1 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
| 0.1 | 0.7 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.1 | 0.2 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
| 0.1 | 2.5 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.1 | 1.1 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.1 | 0.6 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
| 0.1 | 0.5 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.1 | 0.6 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
| 0.1 | 1.3 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
| 0.1 | 0.2 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
| 0.1 | 0.4 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
| 0.1 | 0.3 | REACTOME PHASE II CONJUGATION | Genes involved in Phase II conjugation |
| 0.0 | 0.6 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.0 | 0.0 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
| 0.0 | 0.2 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
| 0.0 | 0.6 | REACTOME PKB MEDIATED EVENTS | Genes involved in PKB-mediated events |
| 0.0 | 0.1 | REACTOME SIGNALING BY SCF KIT | Genes involved in Signaling by SCF-KIT |
| 0.0 | 0.2 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
| 0.0 | 0.7 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
| 0.0 | 0.5 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.0 | 0.3 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
| 0.0 | 0.2 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 0.0 | 0.7 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.0 | 0.6 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.0 | 0.5 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
| 0.0 | 0.4 | REACTOME NRIF SIGNALS CELL DEATH FROM THE NUCLEUS | Genes involved in NRIF signals cell death from the nucleus |
| 0.0 | 1.2 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
| 0.0 | 0.0 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
| 0.0 | 0.0 | REACTOME TRANSPORT OF RIBONUCLEOPROTEINS INTO THE HOST NUCLEUS | Genes involved in Transport of Ribonucleoproteins into the Host Nucleus |
| 0.0 | 0.1 | REACTOME PLC BETA MEDIATED EVENTS | Genes involved in PLC beta mediated events |
| 0.0 | 0.5 | REACTOME VIRAL MESSENGER RNA SYNTHESIS | Genes involved in Viral Messenger RNA Synthesis |
| 0.0 | 0.2 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
| 0.0 | 0.2 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
| 0.0 | 0.6 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
| 0.0 | 0.2 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
| 0.0 | 1.0 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
| 0.0 | 0.4 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
| 0.0 | 0.4 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
| 0.0 | 0.2 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 0.0 | 0.3 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
| 0.0 | 0.4 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.0 | 0.9 | REACTOME MRNA 3 END PROCESSING | Genes involved in mRNA 3'-end processing |
| 0.0 | 0.6 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
| 0.0 | 0.3 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.0 | 1.3 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
| 0.0 | 2.5 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
| 0.0 | 0.4 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.0 | 0.3 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.0 | 1.1 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
| 0.0 | 0.5 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.0 | 0.3 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
| 0.0 | 1.2 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.0 | 0.3 | REACTOME SIGNALING BY WNT | Genes involved in Signaling by Wnt |
| 0.0 | 0.2 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.0 | 0.1 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
| 0.0 | 0.3 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
| 0.0 | 0.2 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.0 | 0.6 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
| 0.0 | 0.2 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
| 0.0 | 0.7 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
| 0.0 | 0.2 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
| 0.0 | 0.2 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.0 | 0.6 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
| 0.0 | 0.3 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
| 0.0 | 0.2 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
| 0.0 | 0.3 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.0 | 1.2 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
| 0.0 | 0.0 | REACTOME ACTIVATION OF NMDA RECEPTOR UPON GLUTAMATE BINDING AND POSTSYNAPTIC EVENTS | Genes involved in Activation of NMDA receptor upon glutamate binding and postsynaptic events |
| 0.0 | 0.1 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
| 0.0 | 0.2 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.0 | 0.0 | REACTOME AUTODEGRADATION OF THE E3 UBIQUITIN LIGASE COP1 | Genes involved in Autodegradation of the E3 ubiquitin ligase COP1 |
| 0.0 | 0.4 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.0 | 0.1 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.0 | 0.1 | REACTOME SIGNALING BY FGFR1 MUTANTS | Genes involved in Signaling by FGFR1 mutants |
| 0.0 | 0.1 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.0 | 0.0 | REACTOME DOWNSTREAM SIGNALING EVENTS OF B CELL RECEPTOR BCR | Genes involved in Downstream Signaling Events Of B Cell Receptor (BCR) |
| 0.0 | 0.2 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
| 0.0 | 0.2 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
| 0.0 | 0.2 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.0 | 0.2 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
| 0.0 | 0.3 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.0 | 0.1 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.0 | 0.3 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
| 0.0 | 0.0 | REACTOME RNA POL II PRE TRANSCRIPTION EVENTS | Genes involved in RNA Polymerase II Pre-transcription Events |
| 0.0 | 0.3 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
| 0.0 | 0.1 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
| 0.0 | 0.1 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.0 | 0.2 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.0 | 0.2 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
| 0.0 | 0.2 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
| 0.0 | 0.2 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 0.0 | 0.2 | REACTOME RESOLUTION OF AP SITES VIA THE MULTIPLE NUCLEOTIDE PATCH REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the multiple-nucleotide patch replacement pathway |
| 0.0 | 0.1 | REACTOME ACTIVATION OF THE PRE REPLICATIVE COMPLEX | Genes involved in Activation of the pre-replicative complex |
| 0.0 | 0.1 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
| 0.0 | 0.2 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
| 0.0 | 0.6 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.0 | 0.1 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
| 0.0 | 0.0 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |