Gene Symbol | Gene ID | Gene Info |
---|---|---|
Nkx2-9
|
ENSMUSG00000058669.7 | Nkx2-9 |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr3_138287619_138288216 | 3.31 |
Adh1 |
alcohol dehydrogenase 1 (class I) |
10266 |
0.12 |
chr5_125524109_125525122 | 3.17 |
Tmem132b |
transmembrane protein 132B |
7159 |
0.16 |
chr9_122055647_122055822 | 2.66 |
Gm39465 |
predicted gene, 39465 |
4271 |
0.14 |
chr2_58791427_58791720 | 2.28 |
Upp2 |
uridine phosphorylase 2 |
26248 |
0.18 |
chr11_120815283_120815743 | 2.24 |
Fasn |
fatty acid synthase |
58 |
0.94 |
chr16_37902046_37902197 | 2.23 |
Gpr156 |
G protein-coupled receptor 156 |
14375 |
0.14 |
chr8_105090572_105090895 | 2.16 |
Ces3b |
carboxylesterase 3B |
2114 |
0.18 |
chr19_58374259_58374410 | 2.14 |
Gfra1 |
glial cell line derived neurotrophic factor family receptor alpha 1 |
80132 |
0.09 |
chr11_28699819_28700011 | 2.02 |
2810471M01Rik |
RIKEN cDNA 2810471M01 gene |
18351 |
0.16 |
chr3_60582048_60582207 | 2.01 |
Mbnl1 |
muscleblind like splicing factor 1 |
13514 |
0.2 |
chr4_122945793_122945944 | 1.95 |
Mfsd2a |
major facilitator superfamily domain containing 2A |
14122 |
0.13 |
chr3_60502342_60502895 | 1.94 |
Mbnl1 |
muscleblind like splicing factor 1 |
1340 |
0.51 |
chr19_4782985_4783158 | 1.93 |
Rbm4 |
RNA binding motif protein 4 |
10780 |
0.08 |
chr6_134514281_134514440 | 1.88 |
Lrp6 |
low density lipoprotein receptor-related protein 6 |
27354 |
0.17 |
chr3_94398218_94398392 | 1.87 |
Lingo4 |
leucine rich repeat and Ig domain containing 4 |
212 |
0.81 |
chr11_120804691_120805015 | 1.86 |
Fasn |
fatty acid synthase |
3752 |
0.1 |
chr9_122856062_122856261 | 1.82 |
Zfp445 |
zinc finger protein 445 |
781 |
0.47 |
chr9_106245058_106245282 | 1.78 |
Alas1 |
aminolevulinic acid synthase 1 |
1536 |
0.23 |
chr12_16535033_16535184 | 1.72 |
Lpin1 |
lipin 1 |
26930 |
0.22 |
chr15_62939365_62939695 | 1.68 |
Tsg101-ps |
tumor susceptibility gene 101, pseudogene |
41118 |
0.2 |
chr9_57056548_57056705 | 1.67 |
Ptpn9 |
protein tyrosine phosphatase, non-receptor type 9 |
2812 |
0.19 |
chr19_40146515_40146666 | 1.67 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
40696 |
0.11 |
chr2_177468355_177468573 | 1.67 |
Zfp970 |
zinc finger protein 970 |
3618 |
0.19 |
chr1_83900189_83900548 | 1.65 |
4933436I20Rik |
RIKEN cDNA 4933436I20 gene |
11203 |
0.23 |
chr4_125392688_125392839 | 1.63 |
Grik3 |
glutamate receptor, ionotropic, kainate 3 |
97937 |
0.07 |
chr19_45902358_45902683 | 1.62 |
Gm6813 |
predicted gene 6813 |
24394 |
0.14 |
chr5_147744758_147744909 | 1.60 |
Gm43156 |
predicted gene 43156 |
683 |
0.71 |
chr5_125516996_125517147 | 1.60 |
Aacs |
acetoacetyl-CoA synthetase |
1828 |
0.29 |
chr2_34777584_34777817 | 1.59 |
Hspa5 |
heat shock protein 5 |
2853 |
0.18 |
chr7_63923519_63923771 | 1.59 |
Klf13 |
Kruppel-like factor 13 |
1225 |
0.37 |
chr6_97282124_97282455 | 1.57 |
Frmd4b |
FERM domain containing 4B |
8972 |
0.19 |
chr1_153918898_153919085 | 1.57 |
Glul |
glutamate-ammonia ligase (glutamine synthetase) |
12948 |
0.1 |
chr4_95640632_95640805 | 1.57 |
Fggy |
FGGY carbohydrate kinase domain containing |
3831 |
0.31 |
chr2_167781922_167782108 | 1.56 |
9230111E07Rik |
RIKEN cDNA 9230111E07 gene |
38 |
0.97 |
chr5_149047906_149048073 | 1.56 |
Hmgb1 |
high mobility group box 1 |
2458 |
0.17 |
chr2_58771100_58771251 | 1.55 |
Upp2 |
uridine phosphorylase 2 |
5850 |
0.22 |
chr19_40158328_40158479 | 1.55 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
28883 |
0.13 |
chr2_48981052_48981464 | 1.54 |
Orc4 |
origin recognition complex, subunit 4 |
30981 |
0.18 |
chr4_76286709_76286940 | 1.54 |
Ptprd |
protein tyrosine phosphatase, receptor type, D |
38419 |
0.21 |
chr15_59057020_59057199 | 1.53 |
Mtss1 |
MTSS I-BAR domain containing 1 |
1645 |
0.43 |
chr5_140106200_140106351 | 1.53 |
Gm16121 |
predicted gene 16121 |
5076 |
0.17 |
chr4_150660019_150660333 | 1.52 |
Slc45a1 |
solute carrier family 45, member 1 |
8002 |
0.19 |
chr8_76152735_76152886 | 1.51 |
Gm45742 |
predicted gene 45742 |
35783 |
0.19 |
chr3_95864904_95865315 | 1.51 |
Mrps21 |
mitochondrial ribosomal protein S21 |
1802 |
0.16 |
chr10_87937503_87937727 | 1.50 |
Tyms-ps |
thymidylate synthase, pseudogene |
29232 |
0.15 |
chr19_38242555_38242732 | 1.49 |
Fra10ac1 |
FRA10AC1 homolog (human) |
18487 |
0.15 |
chr6_51695749_51695900 | 1.48 |
Gm38811 |
predicted gene, 38811 |
15257 |
0.23 |
chr11_16589377_16589551 | 1.44 |
Gm12663 |
predicted gene 12663 |
46602 |
0.12 |
chr7_98355230_98355493 | 1.44 |
Tsku |
tsukushi, small leucine rich proteoglycan |
4718 |
0.19 |
chr15_59024907_59025221 | 1.43 |
Mtss1 |
MTSS I-BAR domain containing 1 |
15532 |
0.19 |
chr11_70446493_70446691 | 1.43 |
Med11 |
mediator complex subunit 11 |
5327 |
0.08 |
chr7_101352628_101353015 | 1.43 |
Gm45548 |
predicted gene 45548 |
1618 |
0.22 |
chr8_104593346_104593714 | 1.41 |
Pdp2 |
pyruvate dehyrogenase phosphatase catalytic subunit 2 |
2079 |
0.17 |
chr4_122961433_122961602 | 1.41 |
4933421A08Rik |
RIKEN cDNA 4933421A08 gene |
208 |
0.63 |
chr7_98351056_98351207 | 1.40 |
Tsku |
tsukushi, small leucine rich proteoglycan |
8948 |
0.17 |
chr1_21299385_21299536 | 1.39 |
Gm4956 |
predicted gene 4956 |
1148 |
0.32 |
chr19_40174636_40174787 | 1.39 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
12575 |
0.15 |
chr12_24706013_24706174 | 1.38 |
Rrm2 |
ribonucleotide reductase M2 |
2148 |
0.23 |
chr12_32678614_32678795 | 1.38 |
Gm47937 |
predicted gene, 47937 |
5410 |
0.25 |
chr7_16598127_16598332 | 1.36 |
Gm29443 |
predicted gene 29443 |
15595 |
0.09 |
chr2_72204001_72204398 | 1.35 |
Rapgef4 |
Rap guanine nucleotide exchange factor (GEF) 4 |
5400 |
0.2 |
chr3_51226339_51227024 | 1.35 |
Noct |
nocturnin |
2211 |
0.23 |
chr9_48676128_48676279 | 1.34 |
Nnmt |
nicotinamide N-methyltransferase |
71050 |
0.11 |
chr11_120813788_120814608 | 1.34 |
Fasn |
fatty acid synthase |
1257 |
0.26 |
chr6_108666051_108666462 | 1.34 |
Bhlhe40 |
basic helix-loop-helix family, member e40 |
3210 |
0.21 |
chr9_60982764_60983106 | 1.33 |
Gm5122 |
predicted gene 5122 |
30546 |
0.14 |
chr18_5817835_5818007 | 1.33 |
Zeb1 |
zinc finger E-box binding homeobox 1 |
86840 |
0.09 |
chr3_129589084_129589235 | 1.33 |
Elovl6 |
ELOVL family member 6, elongation of long chain fatty acids (yeast) |
36779 |
0.13 |
chr8_82402195_82403147 | 1.33 |
Il15 |
interleukin 15 |
101 |
0.98 |
chr1_67175551_67175991 | 1.32 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
52745 |
0.13 |
chr8_105089716_105089869 | 1.31 |
Ces3b |
carboxylesterase 3B |
1173 |
0.32 |
chr11_52234394_52234545 | 1.31 |
Gm12207 |
predicted gene 12207 |
745 |
0.51 |
chr11_69934702_69934853 | 1.28 |
Ybx2 |
Y box protein 2 |
1019 |
0.23 |
chr3_138293165_138293347 | 1.28 |
Gm16559 |
predicted gene 16559 |
13766 |
0.11 |
chr3_97645418_97646002 | 1.28 |
Prkab2 |
protein kinase, AMP-activated, beta 2 non-catalytic subunit |
12483 |
0.13 |
chr10_4618021_4618397 | 1.27 |
Esr1 |
estrogen receptor 1 (alpha) |
6188 |
0.25 |
chr2_135138624_135138783 | 1.24 |
4930545L23Rik |
RIKEN cDNA 4930545L23 gene |
76913 |
0.11 |
chr6_21806569_21806937 | 1.23 |
Tspan12 |
tetraspanin 12 |
45075 |
0.14 |
chr16_93342574_93342799 | 1.22 |
1810053B23Rik |
RIKEN cDNA 1810053B23 gene |
10503 |
0.18 |
chr13_93305580_93305985 | 1.22 |
Homer1 |
homer scaffolding protein 1 |
504 |
0.73 |
chr12_16534577_16534728 | 1.22 |
Lpin1 |
lipin 1 |
27386 |
0.22 |
chr5_54093277_54093447 | 1.21 |
Gm15820 |
predicted gene 15820 |
1718 |
0.43 |
chr3_32562720_32562907 | 1.21 |
Mfn1 |
mitofusin 1 |
95 |
0.96 |
chr7_80029343_80029494 | 1.20 |
Zfp710 |
zinc finger protein 710 |
1604 |
0.27 |
chr15_58981082_58981268 | 1.19 |
4930544F09Rik |
RIKEN cDNA 4930544F09 gene |
2961 |
0.22 |
chr1_15611121_15611272 | 1.19 |
Gm37138 |
predicted gene, 37138 |
54947 |
0.13 |
chr12_104342354_104343298 | 1.18 |
Serpina3k |
serine (or cysteine) peptidase inhibitor, clade A, member 3K |
4340 |
0.13 |
chr16_37874612_37874787 | 1.18 |
Lrrc58 |
leucine rich repeat containing 58 |
6310 |
0.14 |
chr16_18069271_18069422 | 1.18 |
Dgcr6 |
DiGeorge syndrome critical region gene 6 |
134 |
0.94 |
chr16_34159706_34159860 | 1.18 |
Kalrn |
kalirin, RhoGEF kinase |
3496 |
0.36 |
chr10_85102143_85102819 | 1.18 |
Fhl4 |
four and a half LIM domains 4 |
14 |
0.65 |
chr4_63256184_63256378 | 1.17 |
Mir455 |
microRNA 455 |
570 |
0.73 |
chr6_119681279_119681450 | 1.17 |
Erc1 |
ELKS/RAB6-interacting/CAST family member 1 |
59259 |
0.13 |
chr5_125522690_125522841 | 1.17 |
Aacs |
acetoacetyl-CoA synthetase |
7522 |
0.16 |
chr12_104084479_104084838 | 1.16 |
Serpina4-ps1 |
serine (or cysteine) peptidase inhibitor, clade A, member 4, pseudogene 1 |
4009 |
0.12 |
chr7_49429195_49429408 | 1.16 |
Nav2 |
neuron navigator 2 |
21459 |
0.21 |
chr5_43781881_43782536 | 1.15 |
Gm43182 |
predicted gene 43182 |
35 |
0.51 |
chr17_33667328_33667604 | 1.15 |
Hnrnpm |
heterogeneous nuclear ribonucleoprotein M |
896 |
0.43 |
chr10_67192820_67193057 | 1.15 |
Jmjd1c |
jumonji domain containing 1C |
7185 |
0.22 |
chr19_12444451_12444657 | 1.14 |
Mpeg1 |
macrophage expressed gene 1 |
16225 |
0.1 |
chr3_144109828_144110050 | 1.12 |
Gm34078 |
predicted gene, 34078 |
25815 |
0.2 |
chr17_32272780_32272931 | 1.12 |
Brd4 |
bromodomain containing 4 |
490 |
0.72 |
chr8_91530156_91530338 | 1.12 |
Gm45290 |
predicted gene 45290 |
2477 |
0.23 |
chr18_54250519_54250670 | 1.12 |
Redrum |
Redrum, erythroid developmental long intergenic non-protein coding transcript |
171701 |
0.03 |
chr19_20633325_20633630 | 1.11 |
Aldh1a1 |
aldehyde dehydrogenase family 1, subfamily A1 |
31516 |
0.18 |
chr19_44398143_44398357 | 1.11 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
8440 |
0.15 |
chr1_72873626_72873777 | 1.10 |
Igfbp5 |
insulin-like growth factor binding protein 5 |
574 |
0.79 |
chr4_137351449_137351600 | 1.10 |
Cdc42 |
cell division cycle 42 |
6175 |
0.14 |
chr6_108667961_108668112 | 1.10 |
Bhlhe40 |
basic helix-loop-helix family, member e40 |
4990 |
0.18 |
chr12_79481726_79481911 | 1.10 |
Rad51b |
RAD51 paralog B |
154465 |
0.04 |
chr17_34627918_34628356 | 1.10 |
Ppt2 |
palmitoyl-protein thioesterase 2 |
98 |
0.83 |
chr2_52299386_52299564 | 1.09 |
Gm22095 |
predicted gene, 22095 |
16398 |
0.18 |
chr10_89526269_89526420 | 1.09 |
Nr1h4 |
nuclear receptor subfamily 1, group H, member 4 |
7241 |
0.22 |
chr6_129423771_129423946 | 1.09 |
Gm43914 |
predicted gene, 43914 |
5679 |
0.11 |
chr19_44406005_44406525 | 1.09 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
425 |
0.79 |
chr8_64747754_64747924 | 1.08 |
Klhl2 |
kelch-like 2, Mayven |
7132 |
0.16 |
chr13_107645708_107645859 | 1.08 |
Gm32090 |
predicted gene, 32090 |
32934 |
0.17 |
chr11_7134102_7134258 | 1.08 |
Adcy1 |
adenylate cyclase 1 |
25702 |
0.18 |
chr3_52289802_52290007 | 1.07 |
Gm38034 |
predicted gene, 38034 |
7663 |
0.15 |
chr2_31510334_31510882 | 1.07 |
Ass1 |
argininosuccinate synthetase 1 |
7882 |
0.18 |
chr18_75497746_75497943 | 1.07 |
Gm10532 |
predicted gene 10532 |
16801 |
0.25 |
chr11_16848480_16848912 | 1.07 |
Egfros |
epidermal growth factor receptor, opposite strand |
17994 |
0.19 |
chr2_128186998_128187160 | 1.07 |
Gm14009 |
predicted gene 14009 |
2908 |
0.3 |
chr19_40164076_40164449 | 1.07 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
23024 |
0.14 |
chr5_114154896_114155238 | 1.07 |
Acacb |
acetyl-Coenzyme A carboxylase beta |
8532 |
0.12 |
chr6_66963164_66963414 | 1.06 |
Gm36816 |
predicted gene, 36816 |
45124 |
0.08 |
chr14_56618004_56618162 | 1.06 |
Gm16573 |
predicted gene 16573 |
2414 |
0.23 |
chr12_70198492_70198710 | 1.06 |
Pygl |
liver glycogen phosphorylase |
760 |
0.59 |
chr2_113534474_113534796 | 1.05 |
Gm13964 |
predicted gene 13964 |
30601 |
0.17 |
chr13_101737163_101737338 | 1.05 |
Gm36638 |
predicted gene, 36638 |
14638 |
0.21 |
chr15_3398924_3399075 | 1.05 |
Ghr |
growth hormone receptor |
72645 |
0.11 |
chr8_109998736_109999105 | 1.04 |
Tat |
tyrosine aminotransferase |
8414 |
0.12 |
chr6_51695515_51695666 | 1.04 |
Gm38811 |
predicted gene, 38811 |
15491 |
0.23 |
chr8_114129813_114130087 | 1.04 |
Nudt7 |
nudix (nucleoside diphosphate linked moiety X)-type motif 7 |
3607 |
0.35 |
chr16_24248838_24249029 | 1.04 |
Gm31814 |
predicted gene, 31814 |
14226 |
0.2 |
chr13_43546777_43546928 | 1.04 |
Mcur1 |
mitochondrial calcium uniporter regulator 1 |
732 |
0.61 |
chr3_41138122_41138276 | 1.04 |
Gm40038 |
predicted gene, 40038 |
34464 |
0.16 |
chr8_105546479_105546766 | 1.03 |
Atp6v0d1 |
ATPase, H+ transporting, lysosomal V0 subunit D1 |
7146 |
0.09 |
chr13_44445691_44446120 | 1.03 |
Gm27036 |
predicted gene, 27036 |
6092 |
0.16 |
chr3_98723391_98723749 | 1.03 |
Hsd3b2 |
hydroxy-delta-5-steroid dehydrogenase, 3 beta- and steroid delta-isomerase 2 |
961 |
0.47 |
chr10_89486614_89486765 | 1.03 |
Nr1h4 |
nuclear receptor subfamily 1, group H, member 4 |
19960 |
0.2 |
chr8_93193941_93194092 | 1.03 |
Gm45909 |
predicted gene 45909 |
2658 |
0.19 |
chr3_149215671_149215885 | 1.03 |
Gm42647 |
predicted gene 42647 |
5507 |
0.23 |
chr8_36291368_36291583 | 1.02 |
Lonrf1 |
LON peptidase N-terminal domain and ring finger 1 |
41959 |
0.14 |
chr17_43114196_43114355 | 1.02 |
E130008D07Rik |
RIKEN cDNA E130008D07 gene |
43921 |
0.18 |
chr10_87865511_87865999 | 1.02 |
Igf1os |
insulin-like growth factor 1, opposite strand |
2374 |
0.3 |
chr9_61914762_61915200 | 1.02 |
Rplp1 |
ribosomal protein, large, P1 |
439 |
0.83 |
chr11_22199917_22200190 | 1.02 |
Ehbp1 |
EH domain binding protein 1 |
27047 |
0.24 |
chr5_104032553_104032755 | 1.02 |
Hsd17b11 |
hydroxysteroid (17-beta) dehydrogenase 11 |
10735 |
0.1 |
chr3_62374467_62374623 | 1.02 |
Arhgef26 |
Rho guanine nucleotide exchange factor (GEF) 26 |
33444 |
0.19 |
chr11_43900248_43900399 | 1.02 |
Adra1b |
adrenergic receptor, alpha 1b |
887 |
0.69 |
chr10_95420100_95420251 | 1.01 |
5730420D15Rik |
RIKEN cDNA 5730420D15 gene |
2800 |
0.17 |
chr8_93179883_93180034 | 1.01 |
Ces1d |
carboxylesterase 1D |
4669 |
0.15 |
chr6_94683582_94684101 | 1.01 |
Lrig1 |
leucine-rich repeats and immunoglobulin-like domains 1 |
3211 |
0.3 |
chr11_117083977_117084371 | 1.00 |
Gm24323 |
predicted gene, 24323 |
1662 |
0.21 |
chr19_44401346_44401497 | 1.00 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
5269 |
0.16 |
chr19_17599754_17599928 | 1.00 |
Gm17819 |
predicted gene, 17819 |
92922 |
0.09 |
chr19_44401904_44402310 | 1.00 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
4583 |
0.17 |
chr15_59195501_59195712 | 1.00 |
Rpl7-ps8 |
ribosomal protein L7, pseudogene 8 |
15302 |
0.19 |
chr19_55100331_55100599 | 1.00 |
Gm31356 |
predicted gene, 31356 |
963 |
0.41 |
chr4_48272049_48272240 | 1.00 |
Erp44 |
endoplasmic reticulum protein 44 |
7308 |
0.2 |
chr5_150585305_150585456 | 1.00 |
N4bp2l1 |
NEDD4 binding protein 2-like 1 |
8389 |
0.08 |
chr1_67141728_67142108 | 1.00 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
18892 |
0.22 |
chr10_75067957_75068521 | 1.00 |
Bcr |
BCR activator of RhoGEF and GTPase |
7647 |
0.18 |
chr2_155082285_155082438 | 0.99 |
Gm45609 |
predicted gene 45609 |
180 |
0.93 |
chr2_154405536_154405724 | 0.99 |
Snta1 |
syntrophin, acidic 1 |
2350 |
0.26 |
chr12_8271731_8271909 | 0.99 |
Ldah |
lipid droplet associated hydrolase |
3400 |
0.2 |
chr19_4718313_4718464 | 0.99 |
Sptbn2 |
spectrin beta, non-erythrocytic 2 |
2691 |
0.16 |
chr19_48883437_48883771 | 0.99 |
Gm50436 |
predicted gene, 50436 |
72468 |
0.11 |
chr1_67200730_67200905 | 0.98 |
Gm15668 |
predicted gene 15668 |
48383 |
0.14 |
chr4_109805630_109805981 | 0.98 |
Faf1 |
Fas-associated factor 1 |
34980 |
0.17 |
chr7_19326739_19326919 | 0.98 |
Gm44698 |
predicted gene 44698 |
6300 |
0.07 |
chr8_70347637_70347823 | 0.98 |
Upf1 |
UPF1 regulator of nonsense transcripts homolog (yeast) |
5481 |
0.11 |
chr1_188903984_188904135 | 0.98 |
Ush2a |
usherin |
49685 |
0.15 |
chr1_21259850_21260251 | 0.98 |
Gsta3 |
glutathione S-transferase, alpha 3 |
6529 |
0.11 |
chr10_68093593_68093917 | 0.98 |
Arid5b |
AT rich interactive domain 5B (MRF1-like) |
42871 |
0.14 |
chr9_74894770_74895613 | 0.98 |
Onecut1 |
one cut domain, family member 1 |
28707 |
0.13 |
chr14_57397795_57398338 | 0.98 |
Cryl1 |
crystallin, lambda 1 |
390 |
0.8 |
chr9_106890623_106890780 | 0.97 |
Manf |
mesencephalic astrocyte-derived neurotrophic factor |
418 |
0.62 |
chr18_84907854_84908170 | 0.97 |
Fbxo15 |
F-box protein 15 |
26770 |
0.13 |
chr6_149150480_149150842 | 0.97 |
Etfbkmt |
electron transfer flavoprotein beta subunit lysine methyltransferase |
9015 |
0.13 |
chr17_86393578_86393897 | 0.97 |
Prkce |
protein kinase C, epsilon |
96825 |
0.07 |
chr1_21262098_21262745 | 0.97 |
Gsta3 |
glutathione S-transferase, alpha 3 |
8900 |
0.11 |
chr6_146914910_146915281 | 0.97 |
Ppfibp1 |
PTPRF interacting protein, binding protein 1 (liprin beta 1) |
26506 |
0.13 |
chr10_111595271_111595428 | 0.97 |
4933440J02Rik |
RIKEN cDNA 4933440J02 gene |
1076 |
0.46 |
chr7_97413837_97414007 | 0.97 |
Thrsp |
thyroid hormone responsive |
3597 |
0.16 |
chr3_9833570_9834046 | 0.96 |
Pag1 |
phosphoprotein associated with glycosphingolipid microdomains 1 |
129 |
0.96 |
chr13_103916686_103916837 | 0.96 |
Erbin |
Erbb2 interacting protein |
3534 |
0.28 |
chr15_62345274_62345435 | 0.96 |
Pvt1 |
Pvt1 oncogene |
122751 |
0.06 |
chr5_122285372_122285934 | 0.96 |
Pptc7 |
PTC7 protein phosphatase homolog |
1288 |
0.31 |
chr17_64203273_64203432 | 0.96 |
Pja2 |
praja ring finger ubiquitin ligase 2 |
109679 |
0.07 |
chr8_56408789_56408940 | 0.96 |
Gm7419 |
predicted gene 7419 |
44651 |
0.14 |
chr1_23257165_23257357 | 0.95 |
Gm6420 |
predicted gene 6420 |
854 |
0.48 |
chr12_102090498_102090674 | 0.95 |
Slc24a4 |
solute carrier family 24 (sodium/potassium/calcium exchanger), member 4 |
38147 |
0.14 |
chr1_9968795_9969006 | 0.95 |
Tcf24 |
transcription factor 24 |
968 |
0.33 |
chr15_84987122_84987708 | 0.95 |
5031439G07Rik |
RIKEN cDNA 5031439G07 gene |
556 |
0.65 |
chr14_34323242_34323393 | 0.95 |
Glud1 |
glutamate dehydrogenase 1 |
5345 |
0.11 |
chr6_58609926_58610104 | 0.95 |
Abcg2 |
ATP binding cassette subfamily G member 2 (Junior blood group) |
13344 |
0.2 |
chr17_64764123_64764318 | 0.95 |
Dreh |
down-regulated in hepatocellular carcinoma |
2891 |
0.27 |
chr1_102517902_102518283 | 0.95 |
Gm20281 |
predicted gene, 20281 |
59170 |
0.14 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.0 | 3.0 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
0.9 | 3.6 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
0.8 | 2.4 | GO:0010046 | response to mycotoxin(GO:0010046) |
0.7 | 2.7 | GO:0046449 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
0.6 | 1.8 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
0.6 | 2.3 | GO:1903964 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.5 | 3.3 | GO:0060687 | regulation of branching involved in prostate gland morphogenesis(GO:0060687) |
0.4 | 1.3 | GO:0042851 | L-alanine metabolic process(GO:0042851) |
0.4 | 1.6 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
0.4 | 1.2 | GO:0006068 | ethanol catabolic process(GO:0006068) |
0.4 | 1.2 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
0.3 | 1.0 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
0.3 | 0.7 | GO:1904339 | negative regulation of dopaminergic neuron differentiation(GO:1904339) |
0.3 | 1.4 | GO:0032819 | positive regulation of natural killer cell proliferation(GO:0032819) |
0.3 | 1.6 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
0.3 | 0.6 | GO:0070672 | response to interleukin-15(GO:0070672) |
0.3 | 1.3 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
0.3 | 0.6 | GO:0003213 | cardiac right atrium morphogenesis(GO:0003213) |
0.3 | 0.9 | GO:0001996 | positive regulation of heart rate by epinephrine-norepinephrine(GO:0001996) |
0.3 | 0.9 | GO:0048696 | regulation of collateral sprouting in absence of injury(GO:0048696) |
0.3 | 0.9 | GO:0046391 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
0.3 | 1.4 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
0.3 | 0.8 | GO:0032489 | regulation of Cdc42 protein signal transduction(GO:0032489) |
0.3 | 2.8 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.3 | 0.8 | GO:0021553 | olfactory nerve development(GO:0021553) |
0.3 | 0.3 | GO:0006714 | sesquiterpenoid metabolic process(GO:0006714) |
0.3 | 0.8 | GO:0061368 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
0.3 | 1.0 | GO:0001834 | trophectodermal cell proliferation(GO:0001834) |
0.3 | 1.0 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
0.2 | 0.7 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
0.2 | 0.2 | GO:1904833 | positive regulation of superoxide dismutase activity(GO:1901671) positive regulation of removal of superoxide radicals(GO:1904833) |
0.2 | 0.2 | GO:0009804 | coumarin metabolic process(GO:0009804) |
0.2 | 0.7 | GO:0032383 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
0.2 | 0.9 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
0.2 | 0.7 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
0.2 | 1.1 | GO:0021779 | oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
0.2 | 0.7 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
0.2 | 0.7 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
0.2 | 0.7 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
0.2 | 1.3 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
0.2 | 0.6 | GO:0090158 | endoplasmic reticulum membrane organization(GO:0090158) |
0.2 | 0.6 | GO:0015772 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.2 | 1.2 | GO:0061042 | vascular wound healing(GO:0061042) |
0.2 | 0.6 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
0.2 | 1.4 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.2 | 0.4 | GO:0045917 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
0.2 | 0.2 | GO:0046098 | guanine metabolic process(GO:0046098) |
0.2 | 0.6 | GO:0021699 | cerebellar cortex maturation(GO:0021699) |
0.2 | 0.8 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
0.2 | 1.0 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
0.2 | 0.6 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
0.2 | 0.6 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
0.2 | 0.4 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
0.2 | 0.6 | GO:0003273 | cell migration involved in endocardial cushion formation(GO:0003273) |
0.2 | 0.2 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
0.2 | 0.8 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.2 | 0.8 | GO:0018211 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
0.2 | 0.2 | GO:0046083 | adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
0.2 | 0.6 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
0.2 | 0.5 | GO:0009732 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
0.2 | 0.5 | GO:0061535 | glutamate secretion, neurotransmission(GO:0061535) |
0.2 | 0.7 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
0.2 | 0.7 | GO:0071034 | CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
0.2 | 1.6 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.2 | 0.4 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
0.2 | 0.5 | GO:0034310 | primary alcohol catabolic process(GO:0034310) |
0.2 | 0.4 | GO:0032741 | positive regulation of interleukin-18 production(GO:0032741) |
0.2 | 0.5 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
0.2 | 0.3 | GO:0090110 | cargo loading into COPII-coated vesicle(GO:0090110) |
0.2 | 0.5 | GO:0097167 | circadian regulation of translation(GO:0097167) |
0.2 | 0.2 | GO:0006549 | isoleucine metabolic process(GO:0006549) |
0.2 | 0.9 | GO:1904861 | excitatory synapse assembly(GO:1904861) |
0.2 | 0.5 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.2 | 0.2 | GO:0001997 | positive regulation of the force of heart contraction by epinephrine-norepinephrine(GO:0001997) positive regulation of the force of heart contraction by chemical signal(GO:0003099) |
0.2 | 1.0 | GO:0060509 | Type I pneumocyte differentiation(GO:0060509) |
0.2 | 0.7 | GO:0006742 | NADP catabolic process(GO:0006742) |
0.2 | 0.8 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
0.2 | 0.2 | GO:2000468 | regulation of peroxidase activity(GO:2000468) |
0.2 | 0.5 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
0.2 | 0.5 | GO:0048619 | embryonic hindgut morphogenesis(GO:0048619) |
0.2 | 0.5 | GO:1903972 | regulation of macrophage colony-stimulating factor signaling pathway(GO:1902226) regulation of response to macrophage colony-stimulating factor(GO:1903969) regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903972) |
0.2 | 1.2 | GO:0055091 | phospholipid homeostasis(GO:0055091) |
0.2 | 0.2 | GO:0009698 | phenylpropanoid metabolic process(GO:0009698) phenylpropanoid catabolic process(GO:0046271) |
0.2 | 1.3 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
0.2 | 0.5 | GO:0030397 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
0.2 | 0.5 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
0.2 | 0.5 | GO:0060633 | negative regulation of transcription initiation from RNA polymerase II promoter(GO:0060633) negative regulation of DNA-templated transcription, initiation(GO:2000143) |
0.2 | 0.5 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.2 | 0.5 | GO:0050427 | 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
0.2 | 0.3 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
0.2 | 1.4 | GO:0052697 | xenobiotic glucuronidation(GO:0052697) |
0.2 | 0.6 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
0.2 | 0.5 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
0.2 | 0.3 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
0.2 | 0.5 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
0.1 | 1.5 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
0.1 | 0.4 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
0.1 | 0.6 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
0.1 | 1.9 | GO:0014041 | regulation of neuron maturation(GO:0014041) |
0.1 | 0.3 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.1 | 0.6 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
0.1 | 0.4 | GO:0071276 | cellular response to cadmium ion(GO:0071276) |
0.1 | 0.3 | GO:0016539 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
0.1 | 0.7 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
0.1 | 0.4 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
0.1 | 0.6 | GO:0070535 | histone H2A K63-linked ubiquitination(GO:0070535) |
0.1 | 0.7 | GO:0071476 | cellular hypotonic response(GO:0071476) |
0.1 | 1.7 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.1 | 0.4 | GO:1901475 | pyruvate transmembrane transport(GO:1901475) |
0.1 | 1.5 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
0.1 | 0.5 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
0.1 | 0.1 | GO:0000098 | sulfur amino acid catabolic process(GO:0000098) cysteine catabolic process(GO:0009093) L-cysteine catabolic process(GO:0019448) L-cysteine metabolic process(GO:0046439) |
0.1 | 0.4 | GO:2001274 | negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
0.1 | 0.1 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
0.1 | 0.3 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
0.1 | 3.3 | GO:0006084 | acetyl-CoA metabolic process(GO:0006084) |
0.1 | 0.8 | GO:0015871 | choline transport(GO:0015871) |
0.1 | 0.3 | GO:1901535 | regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
0.1 | 0.1 | GO:1903371 | regulation of endoplasmic reticulum tubular network organization(GO:1903371) |
0.1 | 0.1 | GO:1901844 | regulation of cell communication by electrical coupling involved in cardiac conduction(GO:1901844) |
0.1 | 0.4 | GO:0035511 | oxidative DNA demethylation(GO:0035511) |
0.1 | 1.0 | GO:0043651 | linoleic acid metabolic process(GO:0043651) |
0.1 | 0.1 | GO:0070103 | regulation of interleukin-6-mediated signaling pathway(GO:0070103) |
0.1 | 1.8 | GO:0045056 | transcytosis(GO:0045056) |
0.1 | 0.6 | GO:0051138 | regulation of NK T cell differentiation(GO:0051136) positive regulation of NK T cell differentiation(GO:0051138) |
0.1 | 0.8 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
0.1 | 0.4 | GO:1990168 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
0.1 | 0.3 | GO:0072531 | pyrimidine-containing compound transmembrane transport(GO:0072531) |
0.1 | 0.1 | GO:0006067 | ethanol metabolic process(GO:0006067) ethanol oxidation(GO:0006069) |
0.1 | 0.6 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
0.1 | 0.5 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.1 | 1.2 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
0.1 | 0.7 | GO:0036296 | response to increased oxygen levels(GO:0036296) response to hyperoxia(GO:0055093) |
0.1 | 0.7 | GO:1902221 | L-phenylalanine metabolic process(GO:0006558) L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
0.1 | 0.6 | GO:0071830 | chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
0.1 | 0.6 | GO:0032484 | Ral protein signal transduction(GO:0032484) |
0.1 | 0.6 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
0.1 | 0.2 | GO:0060847 | endothelial cell fate specification(GO:0060847) |
0.1 | 0.2 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
0.1 | 0.8 | GO:0051683 | establishment of Golgi localization(GO:0051683) |
0.1 | 0.6 | GO:0035509 | negative regulation of myosin-light-chain-phosphatase activity(GO:0035509) |
0.1 | 0.4 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
0.1 | 0.2 | GO:0006553 | lysine metabolic process(GO:0006553) |
0.1 | 0.5 | GO:0097460 | ferrous iron import into cell(GO:0097460) |
0.1 | 1.1 | GO:0036315 | cellular response to sterol(GO:0036315) |
0.1 | 0.2 | GO:0071798 | response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
0.1 | 0.9 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
0.1 | 0.5 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
0.1 | 0.3 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.1 | 1.5 | GO:0008105 | asymmetric protein localization(GO:0008105) |
0.1 | 0.2 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
0.1 | 0.5 | GO:0018214 | protein carboxylation(GO:0018214) |
0.1 | 0.3 | GO:0006210 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
0.1 | 0.3 | GO:0006642 | triglyceride mobilization(GO:0006642) |
0.1 | 0.1 | GO:0070627 | ferrous iron import(GO:0070627) |
0.1 | 0.3 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
0.1 | 0.3 | GO:0061643 | chemorepulsion of axon(GO:0061643) |
0.1 | 0.2 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
0.1 | 1.2 | GO:0030949 | positive regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030949) |
0.1 | 0.1 | GO:1900368 | regulation of RNA interference(GO:1900368) |
0.1 | 0.9 | GO:0046512 | diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
0.1 | 0.3 | GO:0006001 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
0.1 | 0.3 | GO:0045583 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
0.1 | 0.3 | GO:0010887 | negative regulation of cholesterol storage(GO:0010887) |
0.1 | 0.2 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.1 | 0.4 | GO:0017182 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
0.1 | 0.3 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
0.1 | 0.3 | GO:1903797 | positive regulation of inorganic anion transmembrane transport(GO:1903797) |
0.1 | 0.1 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
0.1 | 1.1 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
0.1 | 0.3 | GO:0046881 | positive regulation of follicle-stimulating hormone secretion(GO:0046881) |
0.1 | 0.3 | GO:0021960 | anterior commissure morphogenesis(GO:0021960) |
0.1 | 0.9 | GO:0060628 | regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
0.1 | 0.7 | GO:0008090 | retrograde axonal transport(GO:0008090) |
0.1 | 0.4 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.1 | 0.3 | GO:1901674 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
0.1 | 0.3 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
0.1 | 0.3 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
0.1 | 0.1 | GO:0044340 | canonical Wnt signaling pathway involved in regulation of cell proliferation(GO:0044340) |
0.1 | 0.3 | GO:0014826 | vein smooth muscle contraction(GO:0014826) |
0.1 | 0.2 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.1 | 1.9 | GO:0008053 | mitochondrial fusion(GO:0008053) |
0.1 | 0.2 | GO:0035459 | cargo loading into vesicle(GO:0035459) |
0.1 | 0.3 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
0.1 | 0.6 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
0.1 | 0.6 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
0.1 | 0.1 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
0.1 | 0.1 | GO:0042524 | negative regulation of tyrosine phosphorylation of Stat5 protein(GO:0042524) |
0.1 | 0.1 | GO:2001180 | negative regulation of interleukin-10 secretion(GO:2001180) |
0.1 | 0.3 | GO:0019856 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
0.1 | 0.8 | GO:2001275 | positive regulation of glucose import in response to insulin stimulus(GO:2001275) |
0.1 | 0.2 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
0.1 | 0.3 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
0.1 | 0.6 | GO:2000980 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
0.1 | 0.4 | GO:1902414 | protein localization to cell junction(GO:1902414) |
0.1 | 1.7 | GO:0017144 | drug metabolic process(GO:0017144) |
0.1 | 0.3 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
0.1 | 0.3 | GO:0042518 | negative regulation of tyrosine phosphorylation of Stat3 protein(GO:0042518) |
0.1 | 0.6 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
0.1 | 0.3 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
0.1 | 0.2 | GO:0021943 | formation of radial glial scaffolds(GO:0021943) |
0.1 | 0.7 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
0.1 | 0.4 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
0.1 | 0.3 | GO:0070129 | regulation of mitochondrial translation(GO:0070129) |
0.1 | 0.3 | GO:0015747 | urate transport(GO:0015747) |
0.1 | 1.6 | GO:0015986 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
0.1 | 0.6 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
0.1 | 0.6 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
0.1 | 0.6 | GO:0010793 | regulation of mRNA export from nucleus(GO:0010793) regulation of ribonucleoprotein complex localization(GO:2000197) |
0.1 | 0.4 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
0.1 | 0.4 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
0.1 | 0.1 | GO:0060916 | mesenchymal cell proliferation involved in lung development(GO:0060916) |
0.1 | 1.3 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
0.1 | 0.4 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.1 | 0.7 | GO:0006517 | protein deglycosylation(GO:0006517) |
0.1 | 1.9 | GO:0006376 | mRNA splice site selection(GO:0006376) |
0.1 | 0.4 | GO:0042436 | tryptophan catabolic process(GO:0006569) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) |
0.1 | 0.3 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
0.1 | 0.3 | GO:0090069 | regulation of ribosome biogenesis(GO:0090069) |
0.1 | 0.1 | GO:0071727 | response to triacyl bacterial lipopeptide(GO:0071725) cellular response to triacyl bacterial lipopeptide(GO:0071727) |
0.1 | 0.2 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
0.1 | 0.4 | GO:0097070 | ductus arteriosus closure(GO:0097070) |
0.1 | 0.3 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
0.1 | 0.1 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
0.1 | 0.1 | GO:0045349 | interferon-alpha biosynthetic process(GO:0045349) regulation of interferon-alpha biosynthetic process(GO:0045354) |
0.1 | 0.1 | GO:0035771 | interleukin-4-mediated signaling pathway(GO:0035771) |
0.1 | 0.3 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
0.1 | 0.1 | GO:0010990 | regulation of SMAD protein complex assembly(GO:0010990) |
0.1 | 0.5 | GO:0000237 | leptotene(GO:0000237) |
0.1 | 0.5 | GO:0001547 | antral ovarian follicle growth(GO:0001547) |
0.1 | 0.2 | GO:0002741 | positive regulation of cytokine secretion involved in immune response(GO:0002741) |
0.1 | 0.3 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.1 | 0.2 | GO:1904430 | negative regulation of t-circle formation(GO:1904430) |
0.1 | 0.3 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
0.1 | 0.3 | GO:1902744 | negative regulation of lamellipodium organization(GO:1902744) |
0.1 | 0.5 | GO:0002072 | optic cup morphogenesis involved in camera-type eye development(GO:0002072) |
0.1 | 0.3 | GO:0035627 | ceramide transport(GO:0035627) |
0.1 | 0.4 | GO:0046485 | ether lipid metabolic process(GO:0046485) |
0.1 | 0.3 | GO:0015842 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
0.1 | 0.3 | GO:0032055 | negative regulation of translation in response to stress(GO:0032055) |
0.1 | 0.3 | GO:0035754 | B cell chemotaxis(GO:0035754) |
0.1 | 0.3 | GO:0006106 | fumarate metabolic process(GO:0006106) |
0.1 | 0.2 | GO:0033092 | positive regulation of immature T cell proliferation in thymus(GO:0033092) |
0.1 | 0.6 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
0.1 | 0.4 | GO:0010960 | magnesium ion homeostasis(GO:0010960) |
0.1 | 0.3 | GO:0009133 | nucleoside diphosphate biosynthetic process(GO:0009133) |
0.1 | 0.1 | GO:0061031 | endodermal digestive tract morphogenesis(GO:0061031) |
0.1 | 0.7 | GO:1900363 | regulation of mRNA polyadenylation(GO:1900363) |
0.1 | 0.1 | GO:0048669 | collateral sprouting in absence of injury(GO:0048669) |
0.1 | 0.2 | GO:0010993 | regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
0.1 | 0.1 | GO:0014834 | skeletal muscle satellite cell maintenance involved in skeletal muscle regeneration(GO:0014834) |
0.1 | 1.6 | GO:0006783 | heme biosynthetic process(GO:0006783) |
0.1 | 0.6 | GO:0097286 | iron ion import(GO:0097286) |
0.1 | 0.2 | GO:0010288 | response to lead ion(GO:0010288) |
0.1 | 0.2 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.1 | 1.7 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
0.1 | 0.2 | GO:0036289 | peptidyl-serine autophosphorylation(GO:0036289) |
0.1 | 0.6 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
0.1 | 0.1 | GO:0046490 | isopentenyl diphosphate metabolic process(GO:0046490) |
0.1 | 0.1 | GO:0051572 | negative regulation of histone H3-K4 methylation(GO:0051572) |
0.1 | 0.2 | GO:0043970 | histone H3-K9 acetylation(GO:0043970) |
0.1 | 0.2 | GO:2000850 | negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
0.1 | 0.2 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
0.1 | 0.2 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
0.1 | 0.3 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
0.1 | 0.2 | GO:0006825 | copper ion transport(GO:0006825) |
0.1 | 0.3 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
0.1 | 0.2 | GO:0048014 | Tie signaling pathway(GO:0048014) |
0.1 | 0.2 | GO:0019086 | late viral transcription(GO:0019086) |
0.1 | 0.6 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
0.1 | 0.2 | GO:0046684 | response to pyrethroid(GO:0046684) |
0.1 | 0.2 | GO:0070932 | histone H3 deacetylation(GO:0070932) |
0.1 | 0.3 | GO:1905065 | positive regulation of vascular smooth muscle cell differentiation(GO:1905065) |
0.1 | 0.1 | GO:2001245 | regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
0.1 | 0.3 | GO:1903911 | positive regulation of receptor clustering(GO:1903911) |
0.1 | 0.1 | GO:1900739 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
0.1 | 0.2 | GO:2000173 | negative regulation of branching morphogenesis of a nerve(GO:2000173) |
0.1 | 0.1 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
0.1 | 0.3 | GO:0039530 | MDA-5 signaling pathway(GO:0039530) |
0.1 | 0.2 | GO:0070949 | regulation of neutrophil mediated cytotoxicity(GO:0070948) regulation of neutrophil mediated killing of symbiont cell(GO:0070949) |
0.1 | 0.2 | GO:0045416 | positive regulation of interleukin-8 biosynthetic process(GO:0045416) |
0.1 | 0.1 | GO:0030952 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) establishment or maintenance of cytoskeleton polarity(GO:0030952) |
0.1 | 0.2 | GO:0035973 | aggrephagy(GO:0035973) |
0.1 | 0.2 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
0.1 | 0.4 | GO:0006451 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
0.1 | 0.2 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.1 | 0.6 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
0.1 | 0.2 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
0.1 | 0.2 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
0.1 | 0.2 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
0.1 | 0.2 | GO:0006116 | NADH oxidation(GO:0006116) |
0.1 | 0.1 | GO:0071028 | nuclear RNA surveillance(GO:0071027) nuclear mRNA surveillance(GO:0071028) |
0.1 | 0.1 | GO:0038027 | apolipoprotein A-I-mediated signaling pathway(GO:0038027) |
0.1 | 0.1 | GO:1903660 | complement-dependent cytotoxicity(GO:0097278) regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
0.1 | 0.4 | GO:0042663 | regulation of endodermal cell fate specification(GO:0042663) |
0.1 | 0.2 | GO:0070427 | nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070427) |
0.1 | 0.2 | GO:0006562 | proline catabolic process(GO:0006562) |
0.1 | 0.5 | GO:0060055 | angiogenesis involved in wound healing(GO:0060055) |
0.1 | 0.1 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
0.1 | 0.1 | GO:0048807 | female genitalia morphogenesis(GO:0048807) |
0.1 | 0.1 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
0.1 | 0.2 | GO:0002069 | columnar/cuboidal epithelial cell maturation(GO:0002069) glandular epithelial cell maturation(GO:0002071) |
0.1 | 0.2 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
0.1 | 0.4 | GO:0042659 | regulation of cell fate specification(GO:0042659) |
0.1 | 0.4 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
0.1 | 1.2 | GO:0031440 | regulation of mRNA 3'-end processing(GO:0031440) |
0.1 | 0.2 | GO:0060054 | positive regulation of epithelial cell proliferation involved in wound healing(GO:0060054) |
0.1 | 0.2 | GO:0002155 | regulation of thyroid hormone mediated signaling pathway(GO:0002155) |
0.1 | 0.4 | GO:0035336 | long-chain fatty-acyl-CoA metabolic process(GO:0035336) |
0.1 | 0.1 | GO:0010040 | response to iron(II) ion(GO:0010040) |
0.1 | 0.5 | GO:0019367 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
0.1 | 0.4 | GO:0035927 | RNA import into mitochondrion(GO:0035927) |
0.1 | 0.1 | GO:0015677 | copper ion import(GO:0015677) |
0.1 | 0.2 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
0.1 | 0.1 | GO:0060336 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
0.1 | 0.1 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
0.1 | 0.2 | GO:0061153 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
0.1 | 0.1 | GO:0046607 | positive regulation of centrosome cycle(GO:0046607) |
0.1 | 0.2 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.1 | 0.2 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
0.1 | 0.2 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
0.1 | 0.1 | GO:0006573 | valine metabolic process(GO:0006573) |
0.1 | 0.1 | GO:0061205 | paramesonephric duct development(GO:0061205) |
0.1 | 0.8 | GO:0034315 | regulation of Arp2/3 complex-mediated actin nucleation(GO:0034315) |
0.1 | 0.4 | GO:0032959 | inositol trisphosphate biosynthetic process(GO:0032959) |
0.1 | 0.1 | GO:0042532 | negative regulation of tyrosine phosphorylation of STAT protein(GO:0042532) |
0.1 | 0.2 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
0.1 | 0.2 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
0.1 | 0.3 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
0.1 | 0.2 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.1 | 0.2 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
0.1 | 0.1 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
0.1 | 0.2 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.1 | 0.7 | GO:0051770 | positive regulation of nitric-oxide synthase biosynthetic process(GO:0051770) |
0.1 | 0.1 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.1 | 0.1 | GO:0030202 | heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
0.1 | 0.3 | GO:0000042 | protein targeting to Golgi(GO:0000042) |
0.1 | 0.3 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
0.1 | 0.4 | GO:0009162 | deoxyribonucleoside monophosphate metabolic process(GO:0009162) |
0.1 | 0.1 | GO:0015705 | iodide transport(GO:0015705) |
0.1 | 0.5 | GO:0007638 | mechanosensory behavior(GO:0007638) |
0.1 | 0.1 | GO:0032696 | negative regulation of interleukin-13 production(GO:0032696) |
0.1 | 0.2 | GO:0090188 | negative regulation of pancreatic juice secretion(GO:0090188) |
0.1 | 0.2 | GO:2000834 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
0.1 | 0.3 | GO:0090656 | t-circle formation(GO:0090656) |
0.1 | 0.6 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.1 | 0.3 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
0.1 | 0.3 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.1 | 0.1 | GO:0001555 | oocyte growth(GO:0001555) |
0.1 | 0.2 | GO:1901740 | negative regulation of myoblast fusion(GO:1901740) |
0.1 | 0.5 | GO:0000076 | DNA replication checkpoint(GO:0000076) |
0.1 | 0.1 | GO:0035814 | negative regulation of renal sodium excretion(GO:0035814) |
0.1 | 0.2 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
0.1 | 0.3 | GO:0021957 | corticospinal tract morphogenesis(GO:0021957) |
0.1 | 0.2 | GO:1901030 | positive regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901030) |
0.1 | 0.2 | GO:0032226 | positive regulation of synaptic transmission, dopaminergic(GO:0032226) |
0.1 | 0.3 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
0.1 | 0.1 | GO:0042231 | interleukin-13 biosynthetic process(GO:0042231) |
0.1 | 0.6 | GO:0006020 | inositol metabolic process(GO:0006020) |
0.1 | 0.2 | GO:0009642 | response to light intensity(GO:0009642) |
0.1 | 0.4 | GO:0009263 | deoxyribonucleotide biosynthetic process(GO:0009263) |
0.1 | 0.4 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
0.1 | 0.1 | GO:0000255 | allantoin metabolic process(GO:0000255) |
0.1 | 0.2 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
0.1 | 0.1 | GO:0086023 | adrenergic receptor signaling pathway involved in heart process(GO:0086023) |
0.1 | 0.4 | GO:0042447 | hormone catabolic process(GO:0042447) |
0.1 | 0.1 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.1 | 0.2 | GO:2000510 | positive regulation of dendritic cell chemotaxis(GO:2000510) |
0.1 | 0.1 | GO:0043045 | DNA methylation involved in embryo development(GO:0043045) changes to DNA methylation involved in embryo development(GO:1901538) |
0.1 | 0.2 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
0.1 | 0.1 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
0.1 | 0.3 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
0.1 | 0.8 | GO:1901984 | negative regulation of protein acetylation(GO:1901984) |
0.1 | 0.2 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
0.1 | 0.2 | GO:0090370 | negative regulation of cholesterol efflux(GO:0090370) |
0.1 | 0.2 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
0.1 | 0.7 | GO:0001967 | suckling behavior(GO:0001967) |
0.1 | 0.1 | GO:0070189 | kynurenine metabolic process(GO:0070189) |
0.1 | 0.1 | GO:0070368 | positive regulation of hepatocyte differentiation(GO:0070368) |
0.1 | 0.3 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
0.1 | 0.5 | GO:0045019 | negative regulation of nitric oxide biosynthetic process(GO:0045019) negative regulation of nitric oxide metabolic process(GO:1904406) |
0.1 | 0.1 | GO:0010536 | positive regulation of activation of Janus kinase activity(GO:0010536) |
0.1 | 0.4 | GO:0032825 | positive regulation of natural killer cell differentiation(GO:0032825) |
0.1 | 0.4 | GO:0070914 | UV-damage excision repair(GO:0070914) |
0.1 | 0.4 | GO:0036089 | cleavage furrow formation(GO:0036089) |
0.1 | 0.1 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
0.1 | 0.2 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.1 | 0.2 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
0.1 | 0.6 | GO:0003084 | positive regulation of systemic arterial blood pressure(GO:0003084) |
0.1 | 0.1 | GO:0002082 | regulation of oxidative phosphorylation(GO:0002082) |
0.1 | 0.3 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
0.1 | 0.4 | GO:0070933 | histone H4 deacetylation(GO:0070933) |
0.1 | 0.2 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.1 | 0.2 | GO:0060442 | branching involved in prostate gland morphogenesis(GO:0060442) |
0.1 | 0.1 | GO:0018202 | peptidyl-histidine modification(GO:0018202) |
0.1 | 0.1 | GO:0051029 | rRNA export from nucleus(GO:0006407) rRNA transport(GO:0051029) |
0.1 | 0.1 | GO:2000172 | regulation of branching morphogenesis of a nerve(GO:2000172) |
0.1 | 0.1 | GO:0060164 | regulation of timing of neuron differentiation(GO:0060164) |
0.1 | 0.4 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
0.1 | 0.2 | GO:1990034 | calcium ion export from cell(GO:1990034) |
0.1 | 0.1 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
0.1 | 0.2 | GO:0046005 | positive regulation of circadian sleep/wake cycle, REM sleep(GO:0046005) |
0.1 | 0.3 | GO:1904424 | regulation of GTP binding(GO:1904424) |
0.1 | 0.2 | GO:0048478 | replication fork protection(GO:0048478) |
0.1 | 0.2 | GO:1990928 | response to amino acid starvation(GO:1990928) |
0.1 | 0.2 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
0.1 | 0.2 | GO:2000623 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
0.1 | 0.5 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.1 | 0.1 | GO:0061051 | positive regulation of cell growth involved in cardiac muscle cell development(GO:0061051) |
0.1 | 0.3 | GO:0033085 | negative regulation of T cell differentiation in thymus(GO:0033085) |
0.1 | 0.1 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
0.1 | 0.3 | GO:1901673 | regulation of mitotic spindle assembly(GO:1901673) |
0.1 | 0.1 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
0.1 | 0.1 | GO:0061355 | Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) |
0.1 | 0.5 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
0.1 | 0.1 | GO:0034182 | regulation of maintenance of sister chromatid cohesion(GO:0034091) regulation of maintenance of mitotic sister chromatid cohesion(GO:0034182) |
0.1 | 0.2 | GO:0006681 | galactosylceramide metabolic process(GO:0006681) |
0.1 | 0.2 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
0.1 | 2.2 | GO:0045471 | response to ethanol(GO:0045471) |
0.1 | 0.4 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
0.1 | 0.3 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
0.1 | 0.3 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
0.1 | 0.1 | GO:0060005 | vestibular reflex(GO:0060005) |
0.1 | 0.1 | GO:1900151 | regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
0.1 | 0.1 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
0.1 | 0.1 | GO:0032252 | secretory granule localization(GO:0032252) |
0.1 | 0.8 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
0.1 | 0.1 | GO:0046060 | dATP metabolic process(GO:0046060) dATP catabolic process(GO:0046061) |
0.1 | 0.2 | GO:0043097 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
0.1 | 0.1 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
0.1 | 0.6 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
0.1 | 0.3 | GO:0071044 | histone mRNA catabolic process(GO:0071044) |
0.1 | 0.2 | GO:0010917 | negative regulation of mitochondrial membrane potential(GO:0010917) |
0.1 | 0.1 | GO:0036394 | amylase secretion(GO:0036394) |
0.1 | 0.1 | GO:0060061 | Spemann organizer formation(GO:0060061) |
0.1 | 0.3 | GO:0035584 | calcium-mediated signaling using intracellular calcium source(GO:0035584) |
0.1 | 0.1 | GO:0010901 | regulation of very-low-density lipoprotein particle remodeling(GO:0010901) |
0.1 | 0.1 | GO:0032058 | positive regulation of translational initiation in response to stress(GO:0032058) |
0.1 | 0.3 | GO:0097152 | mesenchymal cell apoptotic process(GO:0097152) |
0.1 | 1.1 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
0.1 | 0.2 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
0.1 | 0.1 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
0.1 | 0.6 | GO:0045116 | protein neddylation(GO:0045116) |
0.1 | 0.1 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
0.1 | 0.2 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
0.1 | 0.6 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
0.1 | 0.1 | GO:0061084 | negative regulation of protein refolding(GO:0061084) |
0.1 | 0.1 | GO:0003264 | cardioblast proliferation(GO:0003263) regulation of cardioblast proliferation(GO:0003264) regulation of secondary heart field cardioblast proliferation(GO:0003266) |
0.1 | 0.1 | GO:0036016 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
0.1 | 0.1 | GO:0060948 | cardiac vascular smooth muscle cell development(GO:0060948) |
0.1 | 0.2 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
0.1 | 0.2 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) |
0.0 | 0.3 | GO:0006108 | malate metabolic process(GO:0006108) |
0.0 | 0.9 | GO:0045070 | positive regulation of viral genome replication(GO:0045070) |
0.0 | 0.2 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
0.0 | 0.2 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
0.0 | 0.2 | GO:0045906 | negative regulation of vasoconstriction(GO:0045906) |
0.0 | 0.6 | GO:0050962 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
0.0 | 0.0 | GO:0016584 | nucleosome positioning(GO:0016584) |
0.0 | 0.1 | GO:0002254 | kinin cascade(GO:0002254) |
0.0 | 0.0 | GO:0003176 | aortic valve development(GO:0003176) aortic valve morphogenesis(GO:0003180) |
0.0 | 0.1 | GO:0090361 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
0.0 | 0.1 | GO:1903224 | regulation of endodermal cell differentiation(GO:1903224) negative regulation of gastrulation(GO:2000542) |
0.0 | 0.8 | GO:0043171 | peptide catabolic process(GO:0043171) |
0.0 | 0.0 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
0.0 | 0.4 | GO:0045792 | negative regulation of cell size(GO:0045792) |
0.0 | 0.6 | GO:0033235 | positive regulation of protein sumoylation(GO:0033235) |
0.0 | 0.6 | GO:0099514 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
0.0 | 0.1 | GO:0070459 | prolactin secretion(GO:0070459) |
0.0 | 0.2 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
0.0 | 0.2 | GO:1902570 | protein localization to nucleolus(GO:1902570) |
0.0 | 2.7 | GO:0006892 | post-Golgi vesicle-mediated transport(GO:0006892) |
0.0 | 0.6 | GO:0008608 | attachment of spindle microtubules to kinetochore(GO:0008608) |
0.0 | 0.3 | GO:0055070 | copper ion homeostasis(GO:0055070) |
0.0 | 0.3 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
0.0 | 0.1 | GO:0030035 | microspike assembly(GO:0030035) |
0.0 | 0.3 | GO:0045722 | positive regulation of gluconeogenesis(GO:0045722) |
0.0 | 0.1 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
0.0 | 0.1 | GO:0048808 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
0.0 | 0.1 | GO:0032849 | positive regulation of cellular pH reduction(GO:0032849) |
0.0 | 0.3 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
0.0 | 0.2 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.0 | 0.1 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.0 | 0.2 | GO:0021523 | somatic motor neuron differentiation(GO:0021523) |
0.0 | 0.2 | GO:0048563 | post-embryonic organ morphogenesis(GO:0048563) |
0.0 | 0.5 | GO:0015693 | magnesium ion transport(GO:0015693) |
0.0 | 0.1 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.0 | 0.2 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
0.0 | 0.4 | GO:0061003 | positive regulation of dendritic spine morphogenesis(GO:0061003) |
0.0 | 0.0 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
0.0 | 0.1 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
0.0 | 0.0 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
0.0 | 0.0 | GO:0003072 | regulation of blood vessel size by renin-angiotensin(GO:0002034) renal control of peripheral vascular resistance involved in regulation of systemic arterial blood pressure(GO:0003072) |
0.0 | 0.3 | GO:0060394 | negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
0.0 | 0.2 | GO:1903427 | negative regulation of reactive oxygen species biosynthetic process(GO:1903427) |
0.0 | 0.0 | GO:0060375 | mast cell differentiation(GO:0060374) regulation of mast cell differentiation(GO:0060375) |
0.0 | 0.0 | GO:0009223 | pyrimidine deoxyribonucleotide catabolic process(GO:0009223) |
0.0 | 0.1 | GO:2000313 | fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
0.0 | 0.0 | GO:0048769 | sarcomerogenesis(GO:0048769) |
0.0 | 0.2 | GO:0044387 | negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
0.0 | 0.2 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
0.0 | 0.0 | GO:0044314 | protein K27-linked ubiquitination(GO:0044314) |
0.0 | 0.1 | GO:0071883 | activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) |
0.0 | 0.2 | GO:0016115 | diterpenoid catabolic process(GO:0016103) terpenoid catabolic process(GO:0016115) retinoic acid catabolic process(GO:0034653) |
0.0 | 0.1 | GO:0070309 | lens fiber cell morphogenesis(GO:0070309) |
0.0 | 2.2 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
0.0 | 0.7 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
0.0 | 0.1 | GO:0090155 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) negative regulation of ceramide biosynthetic process(GO:1900060) |
0.0 | 0.5 | GO:1904376 | negative regulation of protein localization to plasma membrane(GO:1903077) negative regulation of protein localization to cell periphery(GO:1904376) |
0.0 | 0.2 | GO:0006779 | porphyrin-containing compound biosynthetic process(GO:0006779) tetrapyrrole biosynthetic process(GO:0033014) |
0.0 | 0.2 | GO:0009838 | abscission(GO:0009838) |
0.0 | 0.0 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
0.0 | 0.1 | GO:0046719 | regulation by virus of viral protein levels in host cell(GO:0046719) |
0.0 | 0.0 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
0.0 | 0.3 | GO:0008343 | adult feeding behavior(GO:0008343) |
0.0 | 0.3 | GO:0046349 | amino sugar biosynthetic process(GO:0046349) |
0.0 | 0.0 | GO:0021564 | vagus nerve development(GO:0021564) |
0.0 | 0.1 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
0.0 | 0.2 | GO:0035280 | miRNA loading onto RISC involved in gene silencing by miRNA(GO:0035280) |
0.0 | 0.2 | GO:0007000 | nucleolus organization(GO:0007000) |
0.0 | 0.0 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
0.0 | 0.1 | GO:0042891 | antibiotic transport(GO:0042891) |
0.0 | 0.2 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
0.0 | 0.2 | GO:0006477 | protein sulfation(GO:0006477) |
0.0 | 0.1 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
0.0 | 0.0 | GO:0019364 | pyridine nucleotide catabolic process(GO:0019364) |
0.0 | 0.0 | GO:0021747 | cochlear nucleus development(GO:0021747) |
0.0 | 0.1 | GO:0006824 | cobalt ion transport(GO:0006824) |
0.0 | 0.1 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
0.0 | 0.2 | GO:0042795 | snRNA transcription from RNA polymerase II promoter(GO:0042795) |
0.0 | 0.1 | GO:0046487 | glyoxylate metabolic process(GO:0046487) |
0.0 | 0.0 | GO:0090324 | negative regulation of oxidative phosphorylation(GO:0090324) |
0.0 | 0.2 | GO:0060283 | negative regulation of oocyte development(GO:0060283) |
0.0 | 0.1 | GO:0033860 | regulation of NAD(P)H oxidase activity(GO:0033860) |
0.0 | 0.0 | GO:0002924 | negative regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002924) |
0.0 | 0.1 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
0.0 | 0.6 | GO:0070884 | regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
0.0 | 0.2 | GO:0009125 | nucleoside monophosphate catabolic process(GO:0009125) |
0.0 | 0.9 | GO:0034605 | cellular response to heat(GO:0034605) |
0.0 | 0.1 | GO:0002282 | microglial cell activation involved in immune response(GO:0002282) |
0.0 | 0.1 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.0 | 0.3 | GO:0035020 | regulation of Rac protein signal transduction(GO:0035020) |
0.0 | 0.4 | GO:0002755 | MyD88-dependent toll-like receptor signaling pathway(GO:0002755) |
0.0 | 0.0 | GO:2000409 | positive regulation of T cell extravasation(GO:2000409) |
0.0 | 0.0 | GO:0055118 | negative regulation of cardiac muscle contraction(GO:0055118) |
0.0 | 0.2 | GO:0032509 | endosome transport via multivesicular body sorting pathway(GO:0032509) |
0.0 | 0.9 | GO:0018345 | protein palmitoylation(GO:0018345) |
0.0 | 0.1 | GO:0097284 | hepatocyte apoptotic process(GO:0097284) |
0.0 | 0.3 | GO:0030011 | maintenance of cell polarity(GO:0030011) |
0.0 | 0.1 | GO:1901843 | positive regulation of high voltage-gated calcium channel activity(GO:1901843) |
0.0 | 0.1 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
0.0 | 0.0 | GO:1904304 | regulation of gastro-intestinal system smooth muscle contraction(GO:1904304) |
0.0 | 0.3 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.0 | 0.0 | GO:0006971 | hypotonic response(GO:0006971) |
0.0 | 0.1 | GO:0035701 | hematopoietic stem cell migration(GO:0035701) |
0.0 | 0.1 | GO:0042701 | progesterone secretion(GO:0042701) |
0.0 | 0.1 | GO:1901660 | calcium ion export(GO:1901660) |
0.0 | 0.0 | GO:1904526 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
0.0 | 0.2 | GO:0035518 | histone H2A monoubiquitination(GO:0035518) |
0.0 | 0.1 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.0 | 0.1 | GO:0048320 | axial mesoderm formation(GO:0048320) |
0.0 | 0.2 | GO:0046628 | positive regulation of insulin receptor signaling pathway(GO:0046628) |
0.0 | 0.3 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
0.0 | 0.2 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
0.0 | 0.1 | GO:0042219 | cellular modified amino acid catabolic process(GO:0042219) |
0.0 | 0.1 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
0.0 | 0.0 | GO:0060455 | negative regulation of gastric acid secretion(GO:0060455) |
0.0 | 0.9 | GO:0045839 | negative regulation of mitotic nuclear division(GO:0045839) |
0.0 | 0.2 | GO:0048680 | positive regulation of axon regeneration(GO:0048680) |
0.0 | 0.0 | GO:0090168 | Golgi reassembly(GO:0090168) |
0.0 | 0.1 | GO:0055089 | fatty acid homeostasis(GO:0055089) |
0.0 | 0.1 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
0.0 | 0.1 | GO:1903300 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
0.0 | 0.1 | GO:0010455 | positive regulation of cell fate commitment(GO:0010455) |
0.0 | 0.4 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
0.0 | 0.1 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
0.0 | 0.2 | GO:0050995 | negative regulation of lipid catabolic process(GO:0050995) |
0.0 | 0.1 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) negative regulation of mitophagy(GO:1903147) |
0.0 | 0.1 | GO:0021764 | amygdala development(GO:0021764) |
0.0 | 0.1 | GO:0031126 | snoRNA 3'-end processing(GO:0031126) |
0.0 | 0.3 | GO:0051654 | establishment of mitochondrion localization(GO:0051654) |
0.0 | 0.1 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
0.0 | 0.2 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.0 | 0.1 | GO:0006857 | oligopeptide transport(GO:0006857) |
0.0 | 0.2 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.0 | 0.1 | GO:0010760 | negative regulation of macrophage chemotaxis(GO:0010760) |
0.0 | 0.1 | GO:0007529 | establishment of synaptic specificity at neuromuscular junction(GO:0007529) |
0.0 | 0.1 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
0.0 | 0.2 | GO:0014072 | response to isoquinoline alkaloid(GO:0014072) response to morphine(GO:0043278) |
0.0 | 0.1 | GO:0021936 | regulation of cerebellar granule cell precursor proliferation(GO:0021936) |
0.0 | 0.4 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
0.0 | 0.7 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
0.0 | 0.1 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
0.0 | 0.1 | GO:0071072 | negative regulation of phospholipid biosynthetic process(GO:0071072) |
0.0 | 0.1 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
0.0 | 0.2 | GO:1904970 | brush border assembly(GO:1904970) |
0.0 | 0.2 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
0.0 | 0.1 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
0.0 | 0.0 | GO:0051140 | regulation of NK T cell proliferation(GO:0051140) positive regulation of NK T cell proliferation(GO:0051142) |
0.0 | 0.0 | GO:2000670 | positive regulation of dendritic cell apoptotic process(GO:2000670) |
0.0 | 1.0 | GO:0009166 | nucleotide catabolic process(GO:0009166) |
0.0 | 0.3 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.0 | 0.0 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
0.0 | 0.1 | GO:0044273 | sulfur compound catabolic process(GO:0044273) |
0.0 | 0.1 | GO:0034627 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process(GO:0034627) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
0.0 | 0.1 | GO:0060340 | positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
0.0 | 0.1 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
0.0 | 0.0 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
0.0 | 0.1 | GO:0002118 | aggressive behavior(GO:0002118) |
0.0 | 0.3 | GO:0043153 | entrainment of circadian clock by photoperiod(GO:0043153) |
0.0 | 0.1 | GO:0045741 | positive regulation of epidermal growth factor-activated receptor activity(GO:0045741) |
0.0 | 0.1 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) inner cell mass cellular morphogenesis(GO:0001828) |
0.0 | 0.0 | GO:0051204 | protein insertion into mitochondrial membrane(GO:0051204) |
0.0 | 0.1 | GO:0048069 | eye pigmentation(GO:0048069) |
0.0 | 0.1 | GO:1901656 | glycoside transport(GO:1901656) |
0.0 | 0.7 | GO:0032456 | endocytic recycling(GO:0032456) |
0.0 | 0.6 | GO:0030431 | sleep(GO:0030431) |
0.0 | 0.1 | GO:0034080 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
0.0 | 0.2 | GO:2000010 | positive regulation of protein localization to cell surface(GO:2000010) |
0.0 | 0.2 | GO:0042407 | cristae formation(GO:0042407) |
0.0 | 0.1 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.0 | 0.1 | GO:0010613 | positive regulation of cardiac muscle hypertrophy(GO:0010613) positive regulation of muscle hypertrophy(GO:0014742) |
0.0 | 0.0 | GO:0039692 | single stranded viral RNA replication via double stranded DNA intermediate(GO:0039692) |
0.0 | 0.2 | GO:0098870 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
0.0 | 0.2 | GO:0051852 | disruption by host of symbiont cells(GO:0051852) killing by host of symbiont cells(GO:0051873) |
0.0 | 0.3 | GO:0002931 | response to ischemia(GO:0002931) |
0.0 | 0.3 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
0.0 | 0.2 | GO:0046069 | cGMP catabolic process(GO:0046069) |
0.0 | 0.3 | GO:0016926 | protein desumoylation(GO:0016926) |
0.0 | 0.3 | GO:0019682 | glyceraldehyde-3-phosphate metabolic process(GO:0019682) |
0.0 | 0.1 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
0.0 | 0.2 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
0.0 | 0.3 | GO:0045898 | regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045898) |
0.0 | 0.0 | GO:0060748 | tertiary branching involved in mammary gland duct morphogenesis(GO:0060748) |
0.0 | 0.5 | GO:1903146 | regulation of mitophagy(GO:1903146) |
0.0 | 0.2 | GO:0015732 | prostaglandin transport(GO:0015732) |
0.0 | 0.1 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.0 | 0.1 | GO:0046013 | T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
0.0 | 0.1 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
0.0 | 0.1 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
0.0 | 0.0 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
0.0 | 0.1 | GO:0031034 | myosin filament assembly(GO:0031034) |
0.0 | 0.3 | GO:0031116 | positive regulation of microtubule polymerization(GO:0031116) |
0.0 | 0.1 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.0 | 0.0 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
0.0 | 0.5 | GO:0035909 | aorta morphogenesis(GO:0035909) |
0.0 | 0.2 | GO:0046185 | aldehyde catabolic process(GO:0046185) |
0.0 | 0.1 | GO:0001710 | mesodermal cell fate commitment(GO:0001710) |
0.0 | 0.1 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
0.0 | 0.4 | GO:0097186 | amelogenesis(GO:0097186) |
0.0 | 0.4 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.0 | 0.1 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
0.0 | 1.1 | GO:2001238 | positive regulation of extrinsic apoptotic signaling pathway(GO:2001238) |
0.0 | 1.2 | GO:1903845 | negative regulation of transforming growth factor beta receptor signaling pathway(GO:0030512) negative regulation of cellular response to transforming growth factor beta stimulus(GO:1903845) |
0.0 | 0.0 | GO:0009648 | photoperiodism(GO:0009648) |
0.0 | 0.2 | GO:0007210 | serotonin receptor signaling pathway(GO:0007210) |
0.0 | 0.1 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
0.0 | 0.1 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
0.0 | 0.3 | GO:0042574 | retinal metabolic process(GO:0042574) |
0.0 | 0.1 | GO:0031443 | fast-twitch skeletal muscle fiber contraction(GO:0031443) |
0.0 | 0.1 | GO:0045196 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
0.0 | 0.1 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
0.0 | 0.2 | GO:0021670 | lateral ventricle development(GO:0021670) |
0.0 | 0.2 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
0.0 | 0.1 | GO:0045213 | neurotransmitter receptor metabolic process(GO:0045213) |
0.0 | 0.1 | GO:0046015 | regulation of transcription by glucose(GO:0046015) |
0.0 | 0.2 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
0.0 | 0.1 | GO:0046950 | cellular ketone body metabolic process(GO:0046950) |
0.0 | 0.1 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
0.0 | 0.0 | GO:0090365 | regulation of mRNA modification(GO:0090365) |
0.0 | 0.0 | GO:0048048 | embryonic eye morphogenesis(GO:0048048) |
0.0 | 0.1 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
0.0 | 0.0 | GO:0006152 | purine nucleoside catabolic process(GO:0006152) purine ribonucleoside catabolic process(GO:0046130) |
0.0 | 0.1 | GO:0060279 | regulation of ovulation(GO:0060278) positive regulation of ovulation(GO:0060279) |
0.0 | 0.1 | GO:0035357 | peroxisome proliferator activated receptor signaling pathway(GO:0035357) |
0.0 | 0.1 | GO:0060546 | negative regulation of necroptotic process(GO:0060546) |
0.0 | 0.1 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
0.0 | 0.2 | GO:0030889 | negative regulation of B cell proliferation(GO:0030889) |
0.0 | 0.9 | GO:0032543 | mitochondrial translation(GO:0032543) |
0.0 | 0.2 | GO:0045793 | positive regulation of cell size(GO:0045793) |
0.0 | 0.2 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
0.0 | 0.0 | GO:2000338 | chemokine (C-X-C motif) ligand 1 production(GO:0072566) regulation of chemokine (C-X-C motif) ligand 1 production(GO:2000338) |
0.0 | 0.1 | GO:1904714 | regulation of chaperone-mediated autophagy(GO:1904714) |
0.0 | 0.1 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
0.0 | 0.0 | GO:0071681 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
0.0 | 0.5 | GO:0046039 | GTP metabolic process(GO:0046039) |
0.0 | 0.1 | GO:0060044 | negative regulation of cardiac muscle cell proliferation(GO:0060044) |
0.0 | 0.2 | GO:0043922 | negative regulation by host of viral transcription(GO:0043922) |
0.0 | 0.1 | GO:0021894 | cerebral cortex GABAergic interneuron development(GO:0021894) |
0.0 | 0.1 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
0.0 | 0.0 | GO:1901626 | regulation of postsynaptic membrane organization(GO:1901626) |
0.0 | 0.1 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
0.0 | 0.0 | GO:2000680 | regulation of rubidium ion transport(GO:2000680) |
0.0 | 0.1 | GO:0022900 | electron transport chain(GO:0022900) |
0.0 | 0.1 | GO:0023021 | termination of signal transduction(GO:0023021) |
0.0 | 0.3 | GO:0007141 | male meiosis I(GO:0007141) |
0.0 | 0.0 | GO:0051665 | membrane raft localization(GO:0051665) |
0.0 | 0.1 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
0.0 | 0.1 | GO:0032049 | cardiolipin biosynthetic process(GO:0032049) |
0.0 | 0.1 | GO:0009249 | protein lipoylation(GO:0009249) |
0.0 | 0.3 | GO:0006119 | oxidative phosphorylation(GO:0006119) |
0.0 | 0.1 | GO:0035992 | tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
0.0 | 0.2 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
0.0 | 0.1 | GO:1901142 | insulin metabolic process(GO:1901142) |
0.0 | 0.1 | GO:0048793 | pronephros development(GO:0048793) |
0.0 | 0.1 | GO:0097210 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
0.0 | 0.1 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
0.0 | 0.0 | GO:0046379 | extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) |
0.0 | 0.4 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
0.0 | 0.1 | GO:0045063 | T-helper 1 cell differentiation(GO:0045063) |
0.0 | 0.5 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
0.0 | 0.0 | GO:0034454 | microtubule anchoring at centrosome(GO:0034454) |
0.0 | 0.1 | GO:0042723 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
0.0 | 0.1 | GO:0022904 | respiratory electron transport chain(GO:0022904) |
0.0 | 0.1 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
0.0 | 0.0 | GO:0048505 | regulation of timing of cell differentiation(GO:0048505) |
0.0 | 0.0 | GO:1900020 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
0.0 | 0.0 | GO:0048318 | axial mesoderm development(GO:0048318) |
0.0 | 0.1 | GO:1901874 | regulation of post-translational protein modification(GO:1901873) negative regulation of post-translational protein modification(GO:1901874) |
0.0 | 0.0 | GO:0042256 | mature ribosome assembly(GO:0042256) |
0.0 | 0.0 | GO:0043396 | corticotropin-releasing hormone secretion(GO:0043396) regulation of corticotropin-releasing hormone secretion(GO:0043397) positive regulation of corticotropin-releasing hormone secretion(GO:0051466) |
0.0 | 0.1 | GO:0048539 | bone marrow development(GO:0048539) |
0.0 | 0.0 | GO:0032364 | oxygen homeostasis(GO:0032364) gas homeostasis(GO:0033483) |
0.0 | 0.0 | GO:0090135 | actin filament branching(GO:0090135) |
0.0 | 0.1 | GO:0035089 | establishment of apical/basal cell polarity(GO:0035089) |
0.0 | 0.1 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
0.0 | 0.0 | GO:0045627 | positive regulation of T-helper 1 cell differentiation(GO:0045627) |
0.0 | 0.1 | GO:0097049 | motor neuron apoptotic process(GO:0097049) |
0.0 | 0.0 | GO:0043382 | positive regulation of memory T cell differentiation(GO:0043382) |
0.0 | 0.1 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
0.0 | 0.3 | GO:0010257 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.0 | 0.0 | GO:0003348 | cardiac endothelial cell differentiation(GO:0003348) |
0.0 | 0.0 | GO:0035330 | regulation of hippo signaling(GO:0035330) |
0.0 | 0.0 | GO:2000384 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
0.0 | 0.0 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
0.0 | 0.0 | GO:0007199 | G-protein coupled receptor signaling pathway coupled to cGMP nucleotide second messenger(GO:0007199) |
0.0 | 0.1 | GO:0003338 | metanephros morphogenesis(GO:0003338) |
0.0 | 0.0 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
0.0 | 0.1 | GO:0032570 | response to progesterone(GO:0032570) |
0.0 | 0.0 | GO:0045759 | negative regulation of action potential(GO:0045759) |
0.0 | 0.2 | GO:0030325 | adrenal gland development(GO:0030325) |
0.0 | 0.1 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
0.0 | 0.4 | GO:0006182 | cGMP biosynthetic process(GO:0006182) |
0.0 | 0.2 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
0.0 | 0.3 | GO:0021680 | cerebellar Purkinje cell layer development(GO:0021680) |
0.0 | 0.2 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
0.0 | 0.1 | GO:0010453 | regulation of cell fate commitment(GO:0010453) |
0.0 | 0.0 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
0.0 | 0.0 | GO:0048003 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
0.0 | 0.0 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
0.0 | 0.0 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
0.0 | 0.1 | GO:0001780 | neutrophil homeostasis(GO:0001780) |
0.0 | 0.0 | GO:2000823 | regulation of androgen receptor activity(GO:2000823) |
0.0 | 0.0 | GO:0003214 | cardiac left ventricle morphogenesis(GO:0003214) |
0.0 | 0.0 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
0.0 | 0.4 | GO:0000184 | nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
0.0 | 0.2 | GO:1990403 | embryonic brain development(GO:1990403) |
0.0 | 0.1 | GO:0070272 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
0.0 | 0.3 | GO:0016180 | snRNA processing(GO:0016180) |
0.0 | 0.0 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
0.0 | 0.1 | GO:0008334 | histone mRNA metabolic process(GO:0008334) |
0.0 | 2.2 | GO:0007286 | spermatid development(GO:0007286) |
0.0 | 0.0 | GO:0071321 | cellular response to cGMP(GO:0071321) |
0.0 | 0.1 | GO:0007144 | female meiosis I(GO:0007144) |
0.0 | 0.1 | GO:0060456 | positive regulation of digestive system process(GO:0060456) |
0.0 | 0.1 | GO:0019740 | nitrogen utilization(GO:0019740) |
0.0 | 0.0 | GO:0031112 | positive regulation of microtubule polymerization or depolymerization(GO:0031112) |
0.0 | 0.0 | GO:1903818 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
0.0 | 0.1 | GO:0051447 | negative regulation of meiotic cell cycle(GO:0051447) |
0.0 | 0.1 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
0.0 | 0.0 | GO:0002572 | pro-T cell differentiation(GO:0002572) |
0.0 | 0.1 | GO:0071494 | cellular response to UV-C(GO:0071494) |
0.0 | 0.0 | GO:1903795 | regulation of inorganic anion transmembrane transport(GO:1903795) |
0.0 | 0.1 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
0.0 | 0.0 | GO:0061450 | trophoblast cell migration(GO:0061450) |
0.0 | 0.0 | GO:0035880 | embryonic nail plate morphogenesis(GO:0035880) |
0.0 | 0.2 | GO:0007091 | metaphase/anaphase transition of mitotic cell cycle(GO:0007091) metaphase/anaphase transition of cell cycle(GO:0044784) |
0.0 | 0.0 | GO:0050703 | interleukin-1 alpha secretion(GO:0050703) |
0.0 | 0.2 | GO:0016556 | mRNA modification(GO:0016556) |
0.0 | 0.2 | GO:0097150 | neuronal stem cell population maintenance(GO:0097150) |
0.0 | 0.1 | GO:0048596 | embryonic camera-type eye morphogenesis(GO:0048596) |
0.0 | 0.1 | GO:0031937 | positive regulation of chromatin silencing(GO:0031937) |
0.0 | 0.0 | GO:0033572 | transferrin transport(GO:0033572) |
0.0 | 0.1 | GO:0042168 | heme metabolic process(GO:0042168) |
0.0 | 0.1 | GO:0042546 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) |
0.0 | 0.1 | GO:0009191 | ribonucleoside diphosphate catabolic process(GO:0009191) |
0.0 | 0.0 | GO:0035635 | entry of bacterium into host cell(GO:0035635) regulation of entry of bacterium into host cell(GO:2000535) |
0.0 | 0.1 | GO:0021898 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) commitment of multipotent stem cells to neuronal lineage in forebrain(GO:0021898) |
0.0 | 0.3 | GO:0097178 | ruffle assembly(GO:0097178) |
0.0 | 0.1 | GO:0007342 | fusion of sperm to egg plasma membrane(GO:0007342) |
0.0 | 0.2 | GO:0016572 | histone phosphorylation(GO:0016572) |
0.0 | 0.0 | GO:0072599 | establishment of protein localization to endoplasmic reticulum(GO:0072599) |
0.0 | 0.0 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
0.0 | 0.0 | GO:1900078 | positive regulation of cellular response to insulin stimulus(GO:1900078) |
0.0 | 0.1 | GO:0014049 | positive regulation of glutamate secretion(GO:0014049) |
0.0 | 0.6 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
0.0 | 0.1 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
0.0 | 0.1 | GO:0010544 | negative regulation of platelet activation(GO:0010544) |
0.0 | 0.0 | GO:0002752 | cell surface pattern recognition receptor signaling pathway(GO:0002752) |
0.0 | 0.0 | GO:0002370 | natural killer cell cytokine production(GO:0002370) regulation of natural killer cell cytokine production(GO:0002727) |
0.0 | 0.1 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.0 | 0.1 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
0.0 | 1.0 | GO:0035308 | negative regulation of protein dephosphorylation(GO:0035308) |
0.0 | 0.1 | GO:0033131 | regulation of glucokinase activity(GO:0033131) |
0.0 | 0.1 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
0.0 | 0.1 | GO:0009414 | response to water deprivation(GO:0009414) |
0.0 | 0.0 | GO:1902177 | positive regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902177) |
0.0 | 0.4 | GO:0045761 | regulation of adenylate cyclase activity(GO:0045761) |
0.0 | 0.1 | GO:0016540 | protein autoprocessing(GO:0016540) |
0.0 | 0.0 | GO:0034238 | macrophage fusion(GO:0034238) regulation of macrophage fusion(GO:0034239) positive regulation of macrophage fusion(GO:0034241) |
0.0 | 0.1 | GO:0048515 | spermatid differentiation(GO:0048515) |
0.0 | 0.1 | GO:1903887 | motile primary cilium assembly(GO:1903887) |
0.0 | 0.0 | GO:0000087 | mitotic M phase(GO:0000087) |
0.0 | 0.0 | GO:0001698 | gastrin-induced gastric acid secretion(GO:0001698) |
0.0 | 0.0 | GO:0001927 | exocyst assembly(GO:0001927) |
0.0 | 0.1 | GO:0008078 | mesodermal cell migration(GO:0008078) |
0.0 | 0.4 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
0.0 | 0.0 | GO:0060931 | sinoatrial node cell differentiation(GO:0060921) sinoatrial node cell development(GO:0060931) |
0.0 | 0.0 | GO:0043084 | penile erection(GO:0043084) |
0.0 | 0.0 | GO:0046499 | S-adenosylmethioninamine metabolic process(GO:0046499) |
0.0 | 0.1 | GO:0046085 | adenosine metabolic process(GO:0046085) |
0.0 | 0.1 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.0 | 0.3 | GO:0035019 | somatic stem cell population maintenance(GO:0035019) |
0.0 | 0.1 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
0.0 | 0.1 | GO:0031163 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
0.0 | 0.1 | GO:1901186 | positive regulation of ERBB signaling pathway(GO:1901186) |
0.0 | 0.0 | GO:0038202 | TORC1 signaling(GO:0038202) regulation of TORC1 signaling(GO:1903432) |
0.0 | 0.0 | GO:0051385 | response to mineralocorticoid(GO:0051385) |
0.0 | 0.0 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
0.0 | 0.0 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
0.0 | 0.0 | GO:0035989 | tendon development(GO:0035989) |
0.0 | 0.0 | GO:0033239 | negative regulation of cellular amine metabolic process(GO:0033239) |
0.0 | 0.2 | GO:0043968 | histone H2A acetylation(GO:0043968) |
0.0 | 0.1 | GO:0015074 | DNA integration(GO:0015074) |
0.0 | 0.5 | GO:0006334 | nucleosome assembly(GO:0006334) |
0.0 | 0.2 | GO:0014002 | astrocyte development(GO:0014002) |
0.0 | 0.0 | GO:0021794 | thalamus development(GO:0021794) |
0.0 | 0.0 | GO:0060166 | olfactory pit development(GO:0060166) |
0.0 | 0.0 | GO:0019478 | D-amino acid catabolic process(GO:0019478) |
0.0 | 0.1 | GO:0035372 | protein localization to microtubule(GO:0035372) |
0.0 | 0.1 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
0.0 | 0.0 | GO:0097050 | type B pancreatic cell apoptotic process(GO:0097050) |
0.0 | 0.0 | GO:0043650 | aspartate biosynthetic process(GO:0006532) dicarboxylic acid biosynthetic process(GO:0043650) |
0.0 | 0.0 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
0.0 | 0.0 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
0.0 | 0.0 | GO:0061724 | lipophagy(GO:0061724) |
0.0 | 0.0 | GO:0002441 | histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
0.0 | 0.0 | GO:0002826 | negative regulation of T-helper 1 type immune response(GO:0002826) |
0.0 | 0.0 | GO:0010956 | negative regulation of calcidiol 1-monooxygenase activity(GO:0010956) |
0.0 | 0.0 | GO:0032367 | intracellular cholesterol transport(GO:0032367) |
0.0 | 0.0 | GO:0060051 | negative regulation of protein glycosylation(GO:0060051) |
0.0 | 0.0 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
0.0 | 0.2 | GO:0014850 | response to muscle activity(GO:0014850) |
0.0 | 0.0 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
0.0 | 0.1 | GO:0051923 | sulfation(GO:0051923) |
0.0 | 0.1 | GO:0042635 | positive regulation of hair cycle(GO:0042635) |
0.0 | 0.0 | GO:0007468 | regulation of rhodopsin gene expression(GO:0007468) |
0.0 | 0.0 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
0.0 | 0.0 | GO:0051349 | positive regulation of lyase activity(GO:0051349) |
0.0 | 0.0 | GO:2000586 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
0.0 | 0.1 | GO:0006265 | DNA topological change(GO:0006265) |
0.0 | 0.0 | GO:0002725 | negative regulation of T cell cytokine production(GO:0002725) |
0.0 | 0.0 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
0.0 | 0.1 | GO:0044550 | secondary metabolite biosynthetic process(GO:0044550) |
0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.0 | GO:0060753 | regulation of mast cell chemotaxis(GO:0060753) |
0.0 | 0.1 | GO:0051290 | protein heterotetramerization(GO:0051290) |
0.0 | 0.1 | GO:0045141 | meiotic telomere clustering(GO:0045141) |
0.0 | 0.0 | GO:0031052 | programmed DNA elimination(GO:0031049) chromosome breakage(GO:0031052) |
0.0 | 0.0 | GO:0090214 | spongiotrophoblast layer developmental growth(GO:0090214) |
0.0 | 0.0 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
0.0 | 0.3 | GO:0015988 | energy coupled proton transmembrane transport, against electrochemical gradient(GO:0015988) ATP hydrolysis coupled proton transport(GO:0015991) ATP hydrolysis coupled transmembrane transport(GO:0090662) |
0.0 | 0.0 | GO:0060492 | foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) |
0.0 | 0.1 | GO:0045830 | positive regulation of isotype switching(GO:0045830) |
0.0 | 0.0 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
0.0 | 0.0 | GO:0072240 | distal convoluted tubule development(GO:0072025) DCT cell differentiation(GO:0072069) metanephric distal convoluted tubule development(GO:0072221) metanephric distal tubule development(GO:0072235) metanephric DCT cell differentiation(GO:0072240) |
0.0 | 0.1 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
0.0 | 0.0 | GO:2000653 | regulation of genetic imprinting(GO:2000653) |
0.0 | 1.4 | GO:0071230 | cellular response to amino acid stimulus(GO:0071230) |
0.0 | 0.0 | GO:0033623 | regulation of integrin activation(GO:0033623) |
0.0 | 0.0 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
0.0 | 0.1 | GO:0010842 | retina layer formation(GO:0010842) |
0.0 | 0.0 | GO:0006768 | biotin metabolic process(GO:0006768) |
0.0 | 0.1 | GO:0032826 | natural killer cell differentiation involved in immune response(GO:0002325) negative regulation of natural killer cell differentiation(GO:0032824) regulation of natural killer cell differentiation involved in immune response(GO:0032826) negative regulation of natural killer cell differentiation involved in immune response(GO:0032827) |
0.0 | 0.1 | GO:0000154 | rRNA modification(GO:0000154) |
0.0 | 0.0 | GO:0097104 | postsynaptic membrane assembly(GO:0097104) neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) positive regulation of presynaptic membrane organization(GO:1901631) positive regulation of synaptic vesicle clustering(GO:2000809) |
0.0 | 0.2 | GO:0005978 | glycogen biosynthetic process(GO:0005978) glucan biosynthetic process(GO:0009250) |
0.0 | 0.0 | GO:0090315 | negative regulation of protein targeting to membrane(GO:0090315) |
0.0 | 0.1 | GO:0043248 | proteasome assembly(GO:0043248) |
0.0 | 0.1 | GO:1902108 | regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902108) |
0.0 | 0.0 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
0.0 | 0.0 | GO:0015793 | glycerol transport(GO:0015793) |
0.0 | 0.0 | GO:0070255 | regulation of mucus secretion(GO:0070255) |
0.0 | 0.0 | GO:0042637 | catagen(GO:0042637) |
0.0 | 0.1 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.0 | 0.1 | GO:0042761 | very long-chain fatty acid biosynthetic process(GO:0042761) |
0.0 | 0.1 | GO:0090200 | positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
0.0 | 0.0 | GO:0031086 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.0 | 0.1 | GO:0060576 | intestinal epithelial cell development(GO:0060576) |
0.0 | 0.0 | GO:0035812 | renal sodium excretion(GO:0035812) regulation of renal sodium excretion(GO:0035813) |
0.0 | 0.0 | GO:0030576 | Cajal body organization(GO:0030576) |
0.0 | 0.0 | GO:0002581 | negative regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002581) regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002586) |
0.0 | 0.0 | GO:0045136 | development of secondary sexual characteristics(GO:0045136) |
0.0 | 0.0 | GO:0042488 | positive regulation of odontogenesis of dentin-containing tooth(GO:0042488) |
0.0 | 0.0 | GO:0021903 | rostrocaudal neural tube patterning(GO:0021903) |
0.0 | 0.0 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
0.0 | 0.1 | GO:0016139 | glycoside catabolic process(GO:0016139) |
0.0 | 0.0 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
0.0 | 0.1 | GO:0043649 | dicarboxylic acid catabolic process(GO:0043649) |
0.0 | 0.0 | GO:0051561 | positive regulation of mitochondrial calcium ion concentration(GO:0051561) |
0.0 | 0.2 | GO:0030521 | androgen receptor signaling pathway(GO:0030521) |
0.0 | 0.0 | GO:0046125 | pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
0.0 | 0.1 | GO:0045086 | positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
0.0 | 0.0 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.0 | 0.0 | GO:0048550 | negative regulation of pinocytosis(GO:0048550) |
0.0 | 0.1 | GO:0032331 | negative regulation of chondrocyte differentiation(GO:0032331) |
0.0 | 0.1 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
0.0 | 0.3 | GO:0032465 | regulation of cytokinesis(GO:0032465) |
0.0 | 0.0 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
0.0 | 0.0 | GO:0098795 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
0.0 | 0.0 | GO:0010603 | regulation of cytoplasmic mRNA processing body assembly(GO:0010603) |
0.0 | 0.0 | GO:0033962 | cytoplasmic mRNA processing body assembly(GO:0033962) |
0.0 | 0.0 | GO:0031133 | regulation of axon diameter(GO:0031133) |
0.0 | 0.0 | GO:0090308 | regulation of methylation-dependent chromatin silencing(GO:0090308) |
0.0 | 0.2 | GO:0006493 | protein O-linked glycosylation(GO:0006493) |
0.0 | 0.0 | GO:2000381 | negative regulation of mesoderm development(GO:2000381) |
0.0 | 0.0 | GO:0060017 | parathyroid gland development(GO:0060017) |
0.0 | 0.0 | GO:0044154 | histone H3-K14 acetylation(GO:0044154) |
0.0 | 0.0 | GO:0043144 | snoRNA processing(GO:0043144) |
0.0 | 0.0 | GO:0021542 | dentate gyrus development(GO:0021542) |
0.0 | 0.0 | GO:0044090 | positive regulation of vacuole organization(GO:0044090) |
0.0 | 0.0 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
0.0 | 0.0 | GO:0032971 | regulation of muscle filament sliding(GO:0032971) |
0.0 | 0.0 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
0.0 | 0.2 | GO:0009142 | nucleoside triphosphate biosynthetic process(GO:0009142) |
0.0 | 0.1 | GO:0016601 | Rac protein signal transduction(GO:0016601) |
0.0 | 0.0 | GO:0015820 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.0 | 0.2 | GO:2000785 | regulation of autophagosome assembly(GO:2000785) |
0.0 | 0.0 | GO:0002634 | regulation of germinal center formation(GO:0002634) |
0.0 | 0.0 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
0.0 | 0.0 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
0.0 | 0.1 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
0.0 | 0.0 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.0 | 0.1 | GO:0009084 | glutamine family amino acid biosynthetic process(GO:0009084) |
0.0 | 0.0 | GO:0061014 | positive regulation of mRNA catabolic process(GO:0061014) |
0.0 | 0.1 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
0.0 | 0.0 | GO:1900222 | negative regulation of beta-amyloid clearance(GO:1900222) |
0.0 | 0.0 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
0.0 | 0.0 | GO:0035106 | operant conditioning(GO:0035106) |
0.0 | 0.1 | GO:0031114 | regulation of microtubule depolymerization(GO:0031114) |
0.0 | 0.0 | GO:0046416 | D-amino acid metabolic process(GO:0046416) |
0.0 | 0.0 | GO:0046864 | retinol transport(GO:0034633) isoprenoid transport(GO:0046864) terpenoid transport(GO:0046865) |
0.0 | 0.1 | GO:0097320 | membrane tubulation(GO:0097320) |
0.0 | 0.0 | GO:1901838 | positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
0.0 | 0.0 | GO:0033182 | regulation of histone ubiquitination(GO:0033182) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.0 | 3.0 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.5 | 2.3 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.4 | 3.5 | GO:0042587 | glycogen granule(GO:0042587) |
0.3 | 1.1 | GO:0036454 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
0.3 | 0.8 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.2 | 1.5 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
0.2 | 1.0 | GO:0031094 | platelet dense tubular network(GO:0031094) |
0.2 | 0.6 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
0.2 | 2.1 | GO:0070852 | cell body fiber(GO:0070852) |
0.2 | 0.8 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.2 | 0.4 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
0.2 | 0.5 | GO:0055087 | Ski complex(GO:0055087) |
0.2 | 0.5 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
0.2 | 0.8 | GO:0042824 | MHC class I peptide loading complex(GO:0042824) |
0.2 | 0.5 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.2 | 1.3 | GO:1990909 | Wnt signalosome(GO:1990909) |
0.2 | 0.5 | GO:0044393 | microspike(GO:0044393) |
0.2 | 0.6 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.2 | 1.1 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
0.2 | 0.5 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.2 | 0.3 | GO:0008091 | spectrin(GO:0008091) |
0.1 | 1.3 | GO:0045263 | proton-transporting ATP synthase complex, coupling factor F(o)(GO:0045263) |
0.1 | 0.4 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.1 | 0.4 | GO:0097441 | basilar dendrite(GO:0097441) |
0.1 | 0.3 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.1 | 0.7 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
0.1 | 0.7 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.1 | 0.5 | GO:0042583 | chromaffin granule(GO:0042583) |
0.1 | 0.6 | GO:0045261 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
0.1 | 0.6 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.1 | 2.3 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.1 | 0.8 | GO:0071437 | invadopodium(GO:0071437) |
0.1 | 0.7 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.1 | 0.1 | GO:0098798 | mitochondrial protein complex(GO:0098798) |
0.1 | 0.3 | GO:0097413 | Lewy body(GO:0097413) |
0.1 | 0.9 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.1 | 0.1 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
0.1 | 0.3 | GO:0071942 | XPC complex(GO:0071942) |
0.1 | 0.4 | GO:0030127 | COPII vesicle coat(GO:0030127) |
0.1 | 1.3 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
0.1 | 0.9 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.1 | 0.3 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
0.1 | 0.4 | GO:0070876 | SOSS complex(GO:0070876) |
0.1 | 0.4 | GO:1990745 | EARP complex(GO:1990745) |
0.1 | 0.4 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
0.1 | 0.6 | GO:0016342 | catenin complex(GO:0016342) |
0.1 | 1.4 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.1 | 0.3 | GO:0048179 | activin receptor complex(GO:0048179) |
0.1 | 0.3 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
0.1 | 0.5 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
0.1 | 0.5 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
0.1 | 0.6 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.1 | 0.7 | GO:0016600 | flotillin complex(GO:0016600) |
0.1 | 0.5 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.1 | 1.5 | GO:0043034 | costamere(GO:0043034) |
0.1 | 3.4 | GO:0005747 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
0.1 | 0.3 | GO:0036449 | microtubule minus-end(GO:0036449) |
0.1 | 1.3 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.1 | 2.9 | GO:0005762 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
0.1 | 3.6 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.1 | 0.3 | GO:0045293 | mRNA editing complex(GO:0045293) |
0.1 | 0.2 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.1 | 0.4 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
0.1 | 0.6 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.1 | 0.2 | GO:0032444 | activin responsive factor complex(GO:0032444) |
0.1 | 0.6 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
0.1 | 0.2 | GO:0016939 | kinesin II complex(GO:0016939) |
0.1 | 0.4 | GO:0005579 | membrane attack complex(GO:0005579) |
0.1 | 0.3 | GO:0097651 | phosphatidylinositol 3-kinase complex, class I(GO:0097651) |
0.1 | 0.2 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.1 | 0.4 | GO:0005687 | U4 snRNP(GO:0005687) |
0.1 | 0.6 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.1 | 0.4 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.1 | 0.5 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.1 | 0.8 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.1 | 0.5 | GO:0048500 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
0.1 | 0.3 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.1 | 0.3 | GO:0033503 | HULC complex(GO:0033503) |
0.1 | 0.3 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
0.1 | 0.6 | GO:0030126 | COPI vesicle coat(GO:0030126) |
0.1 | 1.4 | GO:0034451 | centriolar satellite(GO:0034451) |
0.1 | 0.4 | GO:0071986 | Ragulator complex(GO:0071986) |
0.1 | 1.5 | GO:0071339 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
0.1 | 1.7 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
0.1 | 0.3 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
0.1 | 0.4 | GO:0000796 | condensin complex(GO:0000796) |
0.1 | 0.2 | GO:0045251 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
0.1 | 0.2 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
0.1 | 0.4 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
0.1 | 0.2 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
0.1 | 0.2 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.1 | 0.8 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) |
0.1 | 0.2 | GO:0043293 | apoptosome(GO:0043293) |
0.1 | 0.5 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.1 | 1.9 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.1 | 0.8 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.1 | 0.5 | GO:0036128 | CatSper complex(GO:0036128) |
0.1 | 0.3 | GO:0001651 | dense fibrillar component(GO:0001651) |
0.1 | 0.5 | GO:0034709 | methylosome(GO:0034709) |
0.1 | 0.2 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
0.1 | 0.2 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.1 | 0.2 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
0.1 | 1.3 | GO:0005719 | nuclear euchromatin(GO:0005719) |
0.1 | 0.2 | GO:0070069 | cytochrome complex(GO:0070069) |
0.1 | 0.3 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
0.1 | 0.1 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
0.1 | 0.1 | GO:0000322 | storage vacuole(GO:0000322) |
0.1 | 0.3 | GO:0044294 | dendritic growth cone(GO:0044294) |
0.1 | 0.2 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.1 | 0.4 | GO:1904115 | axon cytoplasm(GO:1904115) |
0.1 | 0.6 | GO:0005583 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.1 | 0.2 | GO:0030056 | hemidesmosome(GO:0030056) |
0.1 | 0.5 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.1 | 0.2 | GO:0030478 | actin cap(GO:0030478) |
0.0 | 0.6 | GO:0035371 | microtubule plus-end(GO:0035371) |
0.0 | 0.9 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.0 | 0.1 | GO:0032437 | cuticular plate(GO:0032437) |
0.0 | 0.1 | GO:0044354 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.0 | 0.4 | GO:0031211 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
0.0 | 0.1 | GO:0098536 | deuterosome(GO:0098536) |
0.0 | 0.1 | GO:0000125 | PCAF complex(GO:0000125) |
0.0 | 0.3 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.0 | 0.3 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
0.0 | 0.1 | GO:0072487 | MSL complex(GO:0072487) |
0.0 | 0.3 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
0.0 | 0.2 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.0 | 0.3 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
0.0 | 0.3 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
0.0 | 0.6 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
0.0 | 0.1 | GO:0005683 | U7 snRNP(GO:0005683) |
0.0 | 0.1 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
0.0 | 0.1 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
0.0 | 0.4 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
0.0 | 0.4 | GO:0000242 | pericentriolar material(GO:0000242) |
0.0 | 0.2 | GO:1990130 | Iml1 complex(GO:1990130) |
0.0 | 0.4 | GO:0030867 | rough endoplasmic reticulum membrane(GO:0030867) |
0.0 | 0.1 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.0 | 0.2 | GO:0005796 | Golgi lumen(GO:0005796) |
0.0 | 0.8 | GO:0005838 | proteasome regulatory particle(GO:0005838) |
0.0 | 0.2 | GO:0005927 | muscle tendon junction(GO:0005927) |
0.0 | 0.3 | GO:0031932 | TORC2 complex(GO:0031932) |
0.0 | 4.7 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
0.0 | 0.3 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
0.0 | 0.0 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
0.0 | 0.3 | GO:0033270 | paranode region of axon(GO:0033270) |
0.0 | 0.1 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
0.0 | 0.3 | GO:0031616 | spindle pole centrosome(GO:0031616) |
0.0 | 0.7 | GO:0097228 | sperm principal piece(GO:0097228) |
0.0 | 0.4 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
0.0 | 0.2 | GO:0002139 | stereocilia coupling link(GO:0002139) |
0.0 | 3.6 | GO:0030176 | integral component of endoplasmic reticulum membrane(GO:0030176) |
0.0 | 1.8 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
0.0 | 0.3 | GO:0001939 | female pronucleus(GO:0001939) |
0.0 | 0.5 | GO:0030673 | axolemma(GO:0030673) |
0.0 | 0.1 | GO:0031931 | TORC1 complex(GO:0031931) |
0.0 | 0.1 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
0.0 | 0.5 | GO:1902562 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
0.0 | 0.0 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.0 | 1.4 | GO:0031201 | SNARE complex(GO:0031201) |
0.0 | 0.1 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.0 | 0.1 | GO:0005827 | polar microtubule(GO:0005827) |
0.0 | 0.1 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
0.0 | 0.2 | GO:0005686 | U2 snRNP(GO:0005686) |
0.0 | 0.2 | GO:0032133 | chromosome passenger complex(GO:0032133) |
0.0 | 0.3 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
0.0 | 0.1 | GO:0043259 | laminin-10 complex(GO:0043259) |
0.0 | 0.1 | GO:1990812 | growth cone filopodium(GO:1990812) |
0.0 | 0.2 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
0.0 | 0.1 | GO:0045298 | tubulin complex(GO:0045298) |
0.0 | 0.8 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
0.0 | 0.1 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.0 | 0.3 | GO:0000783 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
0.0 | 0.2 | GO:0042382 | paraspeckles(GO:0042382) |
0.0 | 0.0 | GO:0000938 | GARP complex(GO:0000938) |
0.0 | 0.2 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
0.0 | 0.1 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.0 | 0.4 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
0.0 | 0.3 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.0 | 0.1 | GO:0005712 | chiasma(GO:0005712) |
0.0 | 0.2 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.0 | 0.4 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.0 | 0.2 | GO:0071546 | pi-body(GO:0071546) |
0.0 | 0.3 | GO:0032426 | stereocilium tip(GO:0032426) |
0.0 | 0.1 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.0 | 0.2 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.0 | 0.2 | GO:0089701 | U2AF(GO:0089701) |
0.0 | 0.2 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
0.0 | 1.4 | GO:0044455 | mitochondrial membrane part(GO:0044455) |
0.0 | 0.1 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.0 | 0.1 | GO:0033647 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
0.0 | 0.1 | GO:0005766 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
0.0 | 0.1 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.0 | 1.8 | GO:0005814 | centriole(GO:0005814) |
0.0 | 0.7 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.0 | 0.1 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
0.0 | 0.7 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
0.0 | 0.1 | GO:0031084 | BLOC-2 complex(GO:0031084) |
0.0 | 0.0 | GO:0032280 | symmetric synapse(GO:0032280) |
0.0 | 0.2 | GO:0000439 | core TFIIH complex(GO:0000439) |
0.0 | 0.1 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
0.0 | 0.2 | GO:0070847 | core mediator complex(GO:0070847) |
0.0 | 0.1 | GO:1990635 | proximal dendrite(GO:1990635) |
0.0 | 0.1 | GO:0031227 | intrinsic component of endoplasmic reticulum membrane(GO:0031227) |
0.0 | 0.1 | GO:0097513 | myosin II filament(GO:0097513) |
0.0 | 0.3 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
0.0 | 0.1 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.0 | 0.1 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.0 | 0.1 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.0 | 0.1 | GO:0032009 | early phagosome(GO:0032009) |
0.0 | 0.0 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
0.0 | 0.2 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.0 | 0.2 | GO:0097208 | alveolar lamellar body(GO:0097208) |
0.0 | 0.1 | GO:0034448 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.0 | 0.0 | GO:0000812 | Swr1 complex(GO:0000812) |
0.0 | 0.4 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
0.0 | 0.4 | GO:0002102 | podosome(GO:0002102) |
0.0 | 0.1 | GO:0016012 | dystroglycan complex(GO:0016011) sarcoglycan complex(GO:0016012) |
0.0 | 0.1 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
0.0 | 0.6 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
0.0 | 0.1 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
0.0 | 0.1 | GO:0001652 | granular component(GO:0001652) |
0.0 | 0.2 | GO:0005682 | U5 snRNP(GO:0005682) |
0.0 | 0.9 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
0.0 | 0.1 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.0 | 0.1 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
0.0 | 0.1 | GO:0070469 | respiratory chain(GO:0070469) |
0.0 | 0.1 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
0.0 | 0.3 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.0 | 0.1 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
0.0 | 1.0 | GO:0016459 | myosin complex(GO:0016459) |
0.0 | 0.3 | GO:0005614 | interstitial matrix(GO:0005614) |
0.0 | 0.2 | GO:0036038 | MKS complex(GO:0036038) |
0.0 | 0.0 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
0.0 | 0.1 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
0.0 | 0.4 | GO:0005865 | striated muscle thin filament(GO:0005865) |
0.0 | 0.2 | GO:0000346 | transcription export complex(GO:0000346) |
0.0 | 0.1 | GO:0044666 | MLL3/4 complex(GO:0044666) |
0.0 | 0.2 | GO:0001891 | phagocytic cup(GO:0001891) |
0.0 | 1.6 | GO:0005759 | mitochondrial matrix(GO:0005759) |
0.0 | 0.1 | GO:0031502 | dolichyl-phosphate-mannose-protein mannosyltransferase complex(GO:0031502) |
0.0 | 0.1 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
0.0 | 0.2 | GO:0035869 | ciliary transition zone(GO:0035869) |
0.0 | 0.0 | GO:1990423 | RZZ complex(GO:1990423) |
0.0 | 0.4 | GO:0032154 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
0.0 | 0.1 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.0 | 0.1 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.0 | 1.3 | GO:0043204 | perikaryon(GO:0043204) |
0.0 | 0.1 | GO:0030914 | STAGA complex(GO:0030914) |
0.0 | 0.1 | GO:0045239 | tricarboxylic acid cycle enzyme complex(GO:0045239) |
0.0 | 0.1 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.0 | 0.1 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
0.0 | 0.1 | GO:0042575 | DNA polymerase complex(GO:0042575) |
0.0 | 0.1 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.0 | 0.6 | GO:0000502 | proteasome complex(GO:0000502) |
0.0 | 0.3 | GO:0005798 | Golgi-associated vesicle(GO:0005798) |
0.0 | 0.1 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
0.0 | 0.1 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
0.0 | 0.3 | GO:1990391 | DNA repair complex(GO:1990391) |
0.0 | 0.0 | GO:0005915 | zonula adherens(GO:0005915) |
0.0 | 0.1 | GO:0000805 | X chromosome(GO:0000805) |
0.0 | 0.0 | GO:0032585 | multivesicular body membrane(GO:0032585) |
0.0 | 1.0 | GO:0097014 | axoneme(GO:0005930) ciliary plasm(GO:0097014) |
0.0 | 0.2 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.0 | 0.1 | GO:0001739 | sex chromatin(GO:0001739) |
0.0 | 0.4 | GO:0016592 | mediator complex(GO:0016592) |
0.0 | 0.1 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
0.0 | 0.1 | GO:0070545 | PeBoW complex(GO:0070545) |
0.0 | 0.9 | GO:0016607 | nuclear speck(GO:0016607) |
0.0 | 0.3 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.0 | 0.0 | GO:0097342 | ripoptosome(GO:0097342) |
0.0 | 0.0 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.0 | 0.4 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
0.0 | 0.1 | GO:0044308 | axonal spine(GO:0044308) |
0.0 | 0.1 | GO:0031430 | M band(GO:0031430) |
0.0 | 0.3 | GO:0032809 | neuronal cell body membrane(GO:0032809) |
0.0 | 0.5 | GO:0044291 | cell-cell contact zone(GO:0044291) |
0.0 | 0.1 | GO:0031045 | dense core granule(GO:0031045) |
0.0 | 0.0 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
0.0 | 0.1 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.0 | 1.1 | GO:0008021 | synaptic vesicle(GO:0008021) |
0.0 | 0.0 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.0 | 0.0 | GO:1990752 | microtubule end(GO:1990752) |
0.0 | 0.7 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
0.0 | 0.0 | GO:0002177 | manchette(GO:0002177) |
0.0 | 0.1 | GO:0000788 | nuclear nucleosome(GO:0000788) |
0.0 | 0.1 | GO:0097346 | Ino80 complex(GO:0031011) INO80-type complex(GO:0097346) |
0.0 | 0.5 | GO:0090575 | RNA polymerase II transcription factor complex(GO:0090575) |
0.0 | 0.0 | GO:0043256 | laminin complex(GO:0043256) |
0.0 | 1.7 | GO:0005789 | endoplasmic reticulum membrane(GO:0005789) |
0.0 | 0.0 | GO:0046691 | intracellular canaliculus(GO:0046691) |
0.0 | 0.0 | GO:0090576 | RNA polymerase III transcription factor complex(GO:0090576) |
0.0 | 0.8 | GO:0001669 | acrosomal vesicle(GO:0001669) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.0 | 3.1 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
0.6 | 1.9 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
0.6 | 2.3 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
0.6 | 1.7 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.6 | 1.7 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
0.5 | 1.5 | GO:0038181 | bile acid receptor activity(GO:0038181) |
0.5 | 1.4 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
0.5 | 0.9 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) |
0.4 | 2.4 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
0.4 | 2.0 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
0.4 | 1.1 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
0.3 | 1.0 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
0.3 | 1.0 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
0.3 | 3.5 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
0.3 | 2.1 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
0.3 | 0.9 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
0.3 | 0.9 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.3 | 1.1 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.3 | 0.8 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.3 | 1.1 | GO:0071614 | linoleic acid epoxygenase activity(GO:0071614) |
0.3 | 0.8 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
0.2 | 0.7 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.2 | 0.7 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.2 | 2.5 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
0.2 | 0.7 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.2 | 2.0 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.2 | 0.6 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.2 | 0.6 | GO:0008506 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
0.2 | 0.6 | GO:0008142 | oxysterol binding(GO:0008142) |
0.2 | 0.8 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.2 | 0.6 | GO:0055100 | adiponectin binding(GO:0055100) |
0.2 | 1.2 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
0.2 | 0.4 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
0.2 | 0.8 | GO:0052834 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
0.2 | 0.9 | GO:0017040 | ceramidase activity(GO:0017040) |
0.2 | 0.5 | GO:0016728 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
0.2 | 0.9 | GO:0004030 | aldehyde dehydrogenase [NAD(P)+] activity(GO:0004030) |
0.2 | 3.4 | GO:0003785 | actin monomer binding(GO:0003785) |
0.2 | 0.7 | GO:0032453 | histone demethylase activity (H3-K4 specific)(GO:0032453) |
0.2 | 0.5 | GO:0002134 | UTP binding(GO:0002134) pyrimidine ribonucleoside binding(GO:0032551) |
0.2 | 0.5 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.2 | 1.9 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.2 | 0.6 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
0.2 | 0.8 | GO:0070728 | leucine binding(GO:0070728) |
0.2 | 0.5 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.2 | 1.4 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
0.2 | 0.5 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
0.1 | 1.5 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.1 | 0.4 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.1 | 1.9 | GO:0015643 | toxic substance binding(GO:0015643) |
0.1 | 0.7 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.1 | 0.6 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
0.1 | 0.3 | GO:0042281 | dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase activity(GO:0042281) |
0.1 | 3.0 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.1 | 0.7 | GO:0022820 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
0.1 | 0.6 | GO:0016212 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
0.1 | 1.5 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.1 | 0.4 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.1 | 0.4 | GO:0004771 | sterol esterase activity(GO:0004771) |
0.1 | 0.8 | GO:0043426 | MRF binding(GO:0043426) |
0.1 | 0.7 | GO:0071253 | connexin binding(GO:0071253) |
0.1 | 0.9 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
0.1 | 0.5 | GO:0061665 | SUMO ligase activity(GO:0061665) |
0.1 | 1.2 | GO:0098599 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
0.1 | 0.4 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
0.1 | 0.4 | GO:0035514 | DNA demethylase activity(GO:0035514) |
0.1 | 0.5 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
0.1 | 0.4 | GO:0070137 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
0.1 | 0.4 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
0.1 | 0.5 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
0.1 | 0.5 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
0.1 | 0.5 | GO:0005047 | signal recognition particle binding(GO:0005047) |
0.1 | 0.4 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.1 | 0.4 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
0.1 | 0.2 | GO:0016427 | tRNA (cytosine) methyltransferase activity(GO:0016427) tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
0.1 | 0.4 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
0.1 | 0.9 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
0.1 | 0.5 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.1 | 0.7 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
0.1 | 0.9 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.1 | 0.4 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.1 | 0.2 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
0.1 | 0.3 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.1 | 0.2 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.1 | 2.5 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
0.1 | 0.3 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
0.1 | 0.8 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.1 | 0.3 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
0.1 | 3.6 | GO:0018733 | 3,4-dihydrocoumarin hydrolase activity(GO:0018733) |
0.1 | 1.5 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
0.1 | 0.3 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.1 | 0.4 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.1 | 0.6 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
0.1 | 0.6 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.1 | 0.4 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.1 | 1.0 | GO:0034713 | type I transforming growth factor beta receptor binding(GO:0034713) |
0.1 | 0.8 | GO:0001223 | transcription coactivator binding(GO:0001223) |
0.1 | 0.5 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
0.1 | 0.4 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
0.1 | 0.2 | GO:0002054 | nucleobase binding(GO:0002054) |
0.1 | 0.4 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
0.1 | 1.1 | GO:0070403 | NAD+ binding(GO:0070403) |
0.1 | 0.4 | GO:0016151 | nickel cation binding(GO:0016151) |
0.1 | 0.4 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.1 | 0.9 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
0.1 | 0.5 | GO:0000146 | microfilament motor activity(GO:0000146) |
0.1 | 0.3 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.1 | 0.5 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.1 | 0.4 | GO:1990405 | protein antigen binding(GO:1990405) |
0.1 | 0.4 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
0.1 | 0.4 | GO:0097001 | ceramide binding(GO:0097001) |
0.1 | 0.9 | GO:0008828 | thiamine-pyrophosphatase activity(GO:0004787) UDP-2,3-diacylglucosamine hydrolase activity(GO:0008758) dATP pyrophosphohydrolase activity(GO:0008828) dihydroneopterin monophosphate phosphatase activity(GO:0019176) dihydroneopterin triphosphate pyrophosphohydrolase activity(GO:0019177) dTTP diphosphatase activity(GO:0036218) phosphocholine hydrolase activity(GO:0044606) |
0.1 | 0.5 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
0.1 | 2.1 | GO:0030552 | cAMP binding(GO:0030552) |
0.1 | 0.2 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.1 | 0.4 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
0.1 | 0.1 | GO:0030235 | nitric-oxide synthase regulator activity(GO:0030235) |
0.1 | 0.2 | GO:0016631 | enoyl-[acyl-carrier-protein] reductase activity(GO:0016631) 2,3-dihydroxy-2,3-dihydro-phenylpropionate dehydrogenase activity(GO:0018498) cis-2,3-dihydrodiol DDT dehydrogenase activity(GO:0018499) trans-9R,10R-dihydrodiolphenanthrene dehydrogenase activity(GO:0018500) cis-chlorobenzene dihydrodiol dehydrogenase activity(GO:0018501) 2,5-dichloro-2,5-cyclohexadiene-1,4-diol dehydrogenase activity(GO:0018502) trans-1,2-dihydrodiolphenanthrene dehydrogenase activity(GO:0018503) 3,4-dihydroxy-3,4-dihydrofluorene dehydrogenase activity(GO:0034790) benzo(a)pyrene-trans-11,12-dihydrodiol dehydrogenase activity(GO:0034805) benzo(a)pyrene-cis-4,5-dihydrodiol dehydrogenase activity(GO:0034809) citronellyl-CoA dehydrogenase activity(GO:0034824) menthone dehydrogenase activity(GO:0034838) phthalate 3,4-cis-dihydrodiol dehydrogenase activity(GO:0034912) cinnamate reductase activity(GO:0043786) NADPH-dependent curcumin reductase activity(GO:0052849) NADPH-dependent dihydrocurcumin reductase activity(GO:0052850) |
0.1 | 0.8 | GO:0019534 | toxin transporter activity(GO:0019534) |
0.1 | 0.2 | GO:0005119 | smoothened binding(GO:0005119) |
0.1 | 0.5 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.1 | 0.2 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
0.1 | 0.5 | GO:0050897 | cobalt ion binding(GO:0050897) |
0.1 | 0.2 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
0.1 | 0.3 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
0.1 | 0.3 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.1 | 0.3 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.1 | 0.3 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
0.1 | 0.2 | GO:0004793 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
0.1 | 0.5 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.1 | 0.6 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
0.1 | 0.2 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
0.1 | 0.5 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
0.1 | 0.3 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.1 | 0.8 | GO:0070990 | snRNP binding(GO:0070990) |
0.1 | 0.8 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.1 | 0.1 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
0.1 | 0.3 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
0.1 | 0.4 | GO:0017002 | activin-activated receptor activity(GO:0017002) |
0.1 | 0.2 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
0.1 | 0.4 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
0.1 | 0.4 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
0.1 | 0.1 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.1 | 0.2 | GO:0016215 | acyl-CoA desaturase activity(GO:0016215) |
0.1 | 0.3 | GO:0052851 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
0.1 | 0.1 | GO:0015087 | cobalt ion transmembrane transporter activity(GO:0015087) |
0.1 | 0.2 | GO:0034862 | fluorene oxygenase activity(GO:0018585) mono-butyltin dioxygenase activity(GO:0018586) tri-n-butyltin dioxygenase activity(GO:0018588) di-n-butyltin dioxygenase activity(GO:0018589) methylsilanetriol hydroxylase activity(GO:0018590) methyl tertiary butyl ether 3-monooxygenase activity(GO:0018591) 4-nitrocatechol 4-monooxygenase activity(GO:0018592) 4-chlorophenoxyacetate monooxygenase activity(GO:0018593) tert-butanol 2-monooxygenase activity(GO:0018594) alpha-pinene monooxygenase activity(GO:0018595) dimethylsilanediol hydroxylase activity(GO:0018596) ammonia monooxygenase activity(GO:0018597) hydroxymethylsilanetriol oxidase activity(GO:0018598) 2-hydroxyisobutyrate 3-monooxygenase activity(GO:0018599) alpha-pinene dehydrogenase activity(GO:0018600) bisphenol A hydroxylase B activity(GO:0034559) 2,2-bis(4-hydroxyphenyl)-1-propanol hydroxylase activity(GO:0034562) 9-fluorenone-3,4-dioxygenase activity(GO:0034786) anthracene 9,10-dioxygenase activity(GO:0034816) 2-(methylthio)benzothiazole monooxygenase activity(GO:0034857) 2-hydroxybenzothiazole monooxygenase activity(GO:0034858) benzothiazole monooxygenase activity(GO:0034859) 2,6-dihydroxybenzothiazole monooxygenase activity(GO:0034862) pinacolone 5-monooxygenase activity(GO:0034870) thioacetamide S-oxygenase activity(GO:0034873) thioacetamide S-oxide S-oxygenase activity(GO:0034874) endosulfan monooxygenase I activity(GO:0034888) N-nitrodimethylamine hydroxylase activity(GO:0034893) 4-(1-ethyl-1,4-dimethyl-pentyl)phenol monoxygenase activity(GO:0034897) endosulfan ether monooxygenase activity(GO:0034903) pyrene 4,5-monooxygenase activity(GO:0034925) pyrene 1,2-monooxygenase activity(GO:0034927) 1-hydroxypyrene 6,7-monooxygenase activity(GO:0034928) 1-hydroxypyrene 7,8-monooxygenase activity(GO:0034929) phenylboronic acid monooxygenase activity(GO:0034950) spheroidene monooxygenase activity(GO:0043823) |
0.1 | 0.5 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.1 | 0.4 | GO:0005113 | patched binding(GO:0005113) |
0.1 | 1.0 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
0.1 | 0.2 | GO:0032190 | acrosin binding(GO:0032190) |
0.1 | 1.0 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.1 | 0.1 | GO:0005329 | dopamine transmembrane transporter activity(GO:0005329) |
0.1 | 0.1 | GO:0016717 | oxidoreductase activity, acting on paired donors, with oxidation of a pair of donors resulting in the reduction of molecular oxygen to two molecules of water(GO:0016717) |
0.1 | 0.3 | GO:0008948 | oxaloacetate decarboxylase activity(GO:0008948) |
0.1 | 0.2 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
0.1 | 0.1 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
0.1 | 0.2 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.1 | 0.8 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
0.1 | 0.3 | GO:0032554 | purine deoxyribonucleotide binding(GO:0032554) |
0.1 | 0.2 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
0.1 | 0.3 | GO:0070878 | primary miRNA binding(GO:0070878) |
0.1 | 0.3 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
0.1 | 0.3 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
0.1 | 0.5 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
0.1 | 0.2 | GO:0004487 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
0.1 | 0.2 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.1 | 0.5 | GO:0015172 | L-glutamate transmembrane transporter activity(GO:0005313) acidic amino acid transmembrane transporter activity(GO:0015172) |
0.1 | 3.0 | GO:0016763 | transferase activity, transferring pentosyl groups(GO:0016763) |
0.1 | 0.1 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
0.1 | 0.4 | GO:0098634 | protein binding involved in cell-matrix adhesion(GO:0098634) |
0.1 | 0.2 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
0.1 | 0.3 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
0.1 | 0.5 | GO:0008430 | selenium binding(GO:0008430) |
0.1 | 0.5 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.1 | 0.8 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
0.1 | 0.2 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.1 | 1.1 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
0.1 | 0.4 | GO:0016724 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.1 | 0.4 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.1 | 0.2 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
0.1 | 0.2 | GO:0004096 | catalase activity(GO:0004096) |
0.1 | 0.1 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
0.1 | 0.6 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.1 | 0.2 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
0.1 | 0.9 | GO:0004118 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) photoreceptor cyclic-nucleotide phosphodiesterase activity(GO:0004120) 7,8-dihydro-D-neopterin 2',3'-cyclic phosphate phosphodiesterase activity(GO:0044688) inositol phosphosphingolipid phospholipase activity(GO:0052712) inositol phosphorylceramide phospholipase activity(GO:0052713) mannosyl-inositol phosphorylceramide phospholipase activity(GO:0052714) mannosyl-diinositol phosphorylceramide phospholipase activity(GO:0052715) |
0.1 | 1.0 | GO:0005527 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
0.1 | 1.8 | GO:0016749 | N-succinyltransferase activity(GO:0016749) |
0.1 | 0.2 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.1 | 0.5 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.1 | 0.3 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.1 | 0.6 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
0.1 | 0.6 | GO:0035198 | miRNA binding(GO:0035198) |
0.1 | 0.2 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
0.1 | 0.2 | GO:1990239 | steroid hormone binding(GO:1990239) |
0.1 | 0.6 | GO:0001846 | opsonin binding(GO:0001846) |
0.1 | 0.8 | GO:0070628 | proteasome binding(GO:0070628) |
0.1 | 0.2 | GO:0035877 | death effector domain binding(GO:0035877) |
0.1 | 0.2 | GO:2001070 | starch binding(GO:2001070) |
0.1 | 0.2 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
0.1 | 0.2 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
0.1 | 0.2 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
0.1 | 0.2 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
0.1 | 0.2 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
0.1 | 0.3 | GO:0098505 | G-rich strand telomeric DNA binding(GO:0098505) |
0.1 | 0.1 | GO:0080130 | L-phenylalanine aminotransferase activity(GO:0070546) L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
0.1 | 0.4 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.1 | 0.3 | GO:0003997 | acyl-CoA oxidase activity(GO:0003997) |
0.1 | 0.2 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
0.1 | 0.9 | GO:0008483 | transaminase activity(GO:0008483) |
0.1 | 0.2 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.1 | 0.3 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.1 | 0.3 | GO:0052724 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
0.1 | 0.8 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
0.1 | 0.4 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.1 | 0.1 | GO:0031705 | bombesin receptor binding(GO:0031705) |
0.1 | 0.3 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
0.1 | 0.2 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.1 | 0.1 | GO:0004488 | methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
0.1 | 0.1 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
0.1 | 0.5 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
0.1 | 0.2 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
0.0 | 0.0 | GO:0008193 | tRNA guanylyltransferase activity(GO:0008193) |
0.0 | 1.0 | GO:0042162 | telomeric DNA binding(GO:0042162) |
0.0 | 1.3 | GO:0051059 | NF-kappaB binding(GO:0051059) |
0.0 | 0.2 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.0 | 0.1 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
0.0 | 0.1 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.0 | 0.1 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
0.0 | 0.8 | GO:0004629 | phospholipase C activity(GO:0004629) |
0.0 | 0.0 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.0 | 0.9 | GO:0003756 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
0.0 | 0.4 | GO:0005123 | death receptor binding(GO:0005123) |
0.0 | 0.1 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
0.0 | 0.4 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.0 | 0.2 | GO:0016454 | C-palmitoyltransferase activity(GO:0016454) |
0.0 | 0.0 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
0.0 | 0.2 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.0 | 0.2 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
0.0 | 0.1 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
0.0 | 0.3 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.0 | 0.2 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.0 | 0.1 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.0 | 0.7 | GO:0001221 | transcription cofactor binding(GO:0001221) |
0.0 | 0.1 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
0.0 | 1.1 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.0 | 0.1 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
0.0 | 0.4 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.0 | 0.3 | GO:0008097 | 5S rRNA binding(GO:0008097) |
0.0 | 0.2 | GO:0010861 | thyroid hormone receptor activator activity(GO:0010861) |
0.0 | 0.1 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
0.0 | 0.3 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
0.0 | 0.2 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
0.0 | 0.0 | GO:0050253 | retinyl-palmitate esterase activity(GO:0050253) |
0.0 | 0.0 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
0.0 | 0.1 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.0 | 0.2 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
0.0 | 1.3 | GO:0042169 | SH2 domain binding(GO:0042169) |
0.0 | 0.1 | GO:0019976 | interleukin-2 binding(GO:0019976) |
0.0 | 0.1 | GO:0016015 | morphogen activity(GO:0016015) |
0.0 | 0.6 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
0.0 | 0.7 | GO:0070888 | E-box binding(GO:0070888) |
0.0 | 0.2 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.0 | 0.1 | GO:0051379 | epinephrine binding(GO:0051379) |
0.0 | 0.4 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
0.0 | 0.1 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.0 | 0.1 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
0.0 | 0.2 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.0 | 1.3 | GO:0061650 | ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
0.0 | 0.1 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.0 | 0.4 | GO:0005522 | profilin binding(GO:0005522) |
0.0 | 0.2 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.0 | 0.4 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
0.0 | 0.8 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
0.0 | 0.1 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
0.0 | 0.9 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
0.0 | 0.6 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.0 | 0.6 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.0 | 0.2 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
0.0 | 0.2 | GO:0003680 | AT DNA binding(GO:0003680) |
0.0 | 0.1 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
0.0 | 0.2 | GO:0034946 | 2-oxoglutaryl-CoA thioesterase activity(GO:0034843) 2,4,4-trimethyl-3-oxopentanoyl-CoA thioesterase activity(GO:0034869) 3-isopropylbut-3-enoyl-CoA thioesterase activity(GO:0034946) glutaryl-CoA hydrolase activity(GO:0044466) |
0.0 | 0.2 | GO:0016443 | bidentate ribonuclease III activity(GO:0016443) |
0.0 | 0.1 | GO:0030284 | estrogen receptor activity(GO:0030284) |
0.0 | 0.2 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.0 | 0.7 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
0.0 | 0.1 | GO:0008301 | DNA binding, bending(GO:0008301) |
0.0 | 0.7 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.0 | 0.1 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
0.0 | 0.2 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
0.0 | 0.2 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
0.0 | 0.0 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.0 | 2.6 | GO:0005496 | steroid binding(GO:0005496) |
0.0 | 0.3 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
0.0 | 0.0 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) |
0.0 | 0.4 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.0 | 1.3 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.0 | 0.1 | GO:0042609 | CD4 receptor binding(GO:0042609) |
0.0 | 0.1 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.0 | 0.2 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
0.0 | 0.1 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.0 | 0.3 | GO:0004955 | prostaglandin receptor activity(GO:0004955) |
0.0 | 0.1 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
0.0 | 1.1 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
0.0 | 0.3 | GO:0016679 | oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) |
0.0 | 0.1 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.0 | 0.3 | GO:0003993 | acid phosphatase activity(GO:0003993) |
0.0 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.0 | 0.2 | GO:0043495 | protein anchor(GO:0043495) |
0.0 | 0.1 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
0.0 | 2.6 | GO:0030792 | methylarsonite methyltransferase activity(GO:0030792) |
0.0 | 0.6 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
0.0 | 0.1 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.0 | 0.0 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
0.0 | 0.1 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
0.0 | 2.1 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
0.0 | 0.1 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.0 | 0.1 | GO:0035014 | phosphatidylinositol 3-kinase regulator activity(GO:0035014) |
0.0 | 0.0 | GO:0031701 | angiotensin receptor binding(GO:0031701) |
0.0 | 0.3 | GO:0016594 | glycine binding(GO:0016594) |
0.0 | 0.0 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
0.0 | 0.1 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
0.0 | 0.1 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
0.0 | 0.1 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.0 | 0.1 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
0.0 | 0.2 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
0.0 | 0.1 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
0.0 | 0.0 | GO:0046978 | TAP1 binding(GO:0046978) TAP2 binding(GO:0046979) |
0.0 | 0.1 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.0 | 0.1 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.0 | 0.2 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
0.0 | 0.4 | GO:0004029 | aldehyde dehydrogenase (NAD) activity(GO:0004029) |
0.0 | 0.1 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
0.0 | 0.1 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
0.0 | 0.4 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.0 | 0.0 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
0.0 | 0.1 | GO:0010858 | calcium-dependent protein kinase regulator activity(GO:0010858) |
0.0 | 0.4 | GO:0004559 | alpha-mannosidase activity(GO:0004559) |
0.0 | 0.2 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.0 | 0.1 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
0.0 | 0.0 | GO:0004645 | phosphorylase activity(GO:0004645) |
0.0 | 0.0 | GO:0016934 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
0.0 | 0.1 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
0.0 | 0.2 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
0.0 | 0.2 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.0 | 0.2 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.0 | 0.5 | GO:0005112 | Notch binding(GO:0005112) |
0.0 | 0.2 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
0.0 | 0.1 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
0.0 | 0.4 | GO:0005243 | gap junction channel activity(GO:0005243) |
0.0 | 0.1 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
0.0 | 0.6 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.0 | 0.1 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.0 | 0.4 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
0.0 | 0.4 | GO:0030275 | LRR domain binding(GO:0030275) |
0.0 | 0.2 | GO:0042171 | lysophosphatidic acid acyltransferase activity(GO:0042171) lysophospholipid acyltransferase activity(GO:0071617) |
0.0 | 0.2 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
0.0 | 0.1 | GO:0004376 | glycolipid mannosyltransferase activity(GO:0004376) |
0.0 | 0.1 | GO:0015925 | galactosidase activity(GO:0015925) |
0.0 | 0.1 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
0.0 | 0.1 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
0.0 | 0.2 | GO:0004779 | sulfate adenylyltransferase activity(GO:0004779) |
0.0 | 0.3 | GO:0005523 | tropomyosin binding(GO:0005523) |
0.0 | 0.1 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
0.0 | 0.1 | GO:0004359 | glutaminase activity(GO:0004359) |
0.0 | 0.6 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
0.0 | 0.1 | GO:0016997 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
0.0 | 0.1 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
0.0 | 0.1 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
0.0 | 0.1 | GO:0046790 | virion binding(GO:0046790) |
0.0 | 1.9 | GO:0008376 | acetylgalactosaminyltransferase activity(GO:0008376) |
0.0 | 0.1 | GO:0001094 | RNA polymerase II basal transcription factor binding(GO:0001091) TFIID-class transcription factor binding(GO:0001094) |
0.0 | 0.1 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
0.0 | 0.3 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
0.0 | 0.7 | GO:0032813 | tumor necrosis factor receptor superfamily binding(GO:0032813) |
0.0 | 0.1 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.0 | 0.4 | GO:0016790 | thiolester hydrolase activity(GO:0016790) |
0.0 | 0.1 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
0.0 | 0.0 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.0 | 0.2 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
0.0 | 0.1 | GO:0003910 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
0.0 | 1.0 | GO:0019905 | syntaxin binding(GO:0019905) |
0.0 | 0.3 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
0.0 | 0.1 | GO:0008174 | mRNA methyltransferase activity(GO:0008174) |
0.0 | 0.0 | GO:0000339 | RNA cap binding(GO:0000339) |
0.0 | 0.1 | GO:0008443 | phosphofructokinase activity(GO:0008443) |
0.0 | 0.2 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.0 | 0.1 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) |
0.0 | 0.1 | GO:0002162 | dystroglycan binding(GO:0002162) |
0.0 | 0.0 | GO:0031726 | CCR1 chemokine receptor binding(GO:0031726) |
0.0 | 0.9 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
0.0 | 0.1 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.0 | 0.1 | GO:0015288 | porin activity(GO:0015288) |
0.0 | 0.1 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
0.0 | 0.2 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.0 | 0.1 | GO:0097016 | L27 domain binding(GO:0097016) |
0.0 | 0.1 | GO:0001642 | group III metabotropic glutamate receptor activity(GO:0001642) |
0.0 | 4.7 | GO:0001077 | transcriptional activator activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001077) |
0.0 | 0.1 | GO:0070699 | type II activin receptor binding(GO:0070699) |
0.0 | 0.2 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
0.0 | 0.1 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
0.0 | 0.1 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
0.0 | 0.1 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
0.0 | 0.7 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
0.0 | 0.7 | GO:0005109 | frizzled binding(GO:0005109) |
0.0 | 0.0 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
0.0 | 0.4 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.0 | 0.1 | GO:0003988 | acetyl-CoA C-acyltransferase activity(GO:0003988) |
0.0 | 0.1 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.0 | 0.6 | GO:0019894 | kinesin binding(GO:0019894) |
0.0 | 0.1 | GO:0015197 | peptide transporter activity(GO:0015197) |
0.0 | 0.1 | GO:0003964 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
0.0 | 0.3 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.0 | 0.2 | GO:0019789 | SUMO transferase activity(GO:0019789) |
0.0 | 0.2 | GO:0005227 | calcium activated cation channel activity(GO:0005227) |
0.0 | 0.3 | GO:0004889 | acetylcholine-activated cation-selective channel activity(GO:0004889) |
0.0 | 0.2 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.0 | 0.7 | GO:0001517 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) heparan sulfate 2-O-sulfotransferase activity(GO:0004394) HNK-1 sulfotransferase activity(GO:0016232) heparan sulfate 6-O-sulfotransferase activity(GO:0017095) trans-9R,10R-dihydrodiolphenanthrene sulfotransferase activity(GO:0018721) 1-phenanthrol sulfotransferase activity(GO:0018722) 3-phenanthrol sulfotransferase activity(GO:0018723) 4-phenanthrol sulfotransferase activity(GO:0018724) trans-3,4-dihydrodiolphenanthrene sulfotransferase activity(GO:0018725) 9-phenanthrol sulfotransferase activity(GO:0018726) 2-phenanthrol sulfotransferase activity(GO:0018727) phenanthrol sulfotransferase activity(GO:0019111) 1-hydroxypyrene sulfotransferase activity(GO:0034930) proteoglycan sulfotransferase activity(GO:0050698) cholesterol sulfotransferase activity(GO:0051922) hydroxyjasmonate sulfotransferase activity(GO:0080131) |
0.0 | 0.1 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
0.0 | 0.1 | GO:0034584 | piRNA binding(GO:0034584) |
0.0 | 0.4 | GO:0031369 | translation initiation factor binding(GO:0031369) |
0.0 | 0.2 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
0.0 | 0.2 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
0.0 | 0.1 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
0.0 | 0.1 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.0 | 0.0 | GO:0033677 | DNA/RNA helicase activity(GO:0033677) |
0.0 | 0.1 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.0 | 3.2 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.0 | 0.2 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
0.0 | 0.1 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
0.0 | 1.2 | GO:0015078 | hydrogen ion transmembrane transporter activity(GO:0015078) |
0.0 | 0.1 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.0 | 0.1 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
0.0 | 0.1 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.0 | 0.2 | GO:0031386 | protein tag(GO:0031386) |
0.0 | 0.1 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
0.0 | 0.1 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
0.0 | 0.1 | GO:0010853 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
0.0 | 0.1 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
0.0 | 0.1 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
0.0 | 0.0 | GO:0030249 | guanylate cyclase regulator activity(GO:0030249) |
0.0 | 0.1 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
0.0 | 0.0 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
0.0 | 0.1 | GO:0042834 | peptidoglycan binding(GO:0042834) |
0.0 | 0.1 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.0 | 0.0 | GO:0015928 | fucosidase activity(GO:0015928) |
0.0 | 0.0 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.0 | 0.0 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.0 | 0.4 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
0.0 | 0.1 | GO:0005536 | glucose binding(GO:0005536) |
0.0 | 0.0 | GO:0002046 | opsin binding(GO:0002046) |
0.0 | 0.1 | GO:0070891 | lipoteichoic acid binding(GO:0070891) |
0.0 | 0.0 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.0 | 0.0 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
0.0 | 0.0 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
0.0 | 0.1 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.0 | 0.1 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.0 | 0.4 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
0.0 | 0.1 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
0.0 | 0.4 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
0.0 | 0.0 | GO:0015923 | mannosidase activity(GO:0015923) |
0.0 | 0.1 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
0.0 | 0.0 | GO:0016889 | endodeoxyribonuclease activity, producing 3'-phosphomonoesters(GO:0016889) |
0.0 | 0.1 | GO:0005048 | signal sequence binding(GO:0005048) |
0.0 | 0.1 | GO:0031544 | peptidyl-proline 3-dioxygenase activity(GO:0031544) |
0.0 | 0.2 | GO:0036002 | pre-mRNA binding(GO:0036002) |
0.0 | 1.1 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
0.0 | 0.3 | GO:0005035 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
0.0 | 0.0 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
0.0 | 0.1 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.0 | 0.1 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.0 | 0.1 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.0 | 0.2 | GO:0030276 | clathrin binding(GO:0030276) |
0.0 | 0.0 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
0.0 | 1.3 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
0.0 | 0.3 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
0.0 | 0.0 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
0.0 | 0.1 | GO:0008061 | chitin binding(GO:0008061) |
0.0 | 0.7 | GO:0004004 | ATP-dependent RNA helicase activity(GO:0004004) RNA-dependent ATPase activity(GO:0008186) |
0.0 | 0.1 | GO:0016646 | oxidoreductase activity, acting on the CH-NH group of donors, NAD or NADP as acceptor(GO:0016646) |
0.0 | 0.1 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
0.0 | 0.1 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
0.0 | 0.2 | GO:0003755 | peptidyl-prolyl cis-trans isomerase activity(GO:0003755) |
0.0 | 0.1 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
0.0 | 0.2 | GO:0070566 | adenylyltransferase activity(GO:0070566) |
0.0 | 0.1 | GO:0004673 | protein histidine kinase activity(GO:0004673) |
0.0 | 0.2 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
0.0 | 0.1 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.0 | 0.4 | GO:0003899 | DNA-directed RNA polymerase activity(GO:0003899) RNA polymerase activity(GO:0034062) |
0.0 | 0.7 | GO:0004386 | helicase activity(GO:0004386) |
0.0 | 0.1 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
0.0 | 0.0 | GO:0015927 | trehalase activity(GO:0015927) |
0.0 | 0.0 | GO:0043515 | kinetochore binding(GO:0043515) |
0.0 | 0.1 | GO:0008656 | cysteine-type endopeptidase activator activity involved in apoptotic process(GO:0008656) |
0.0 | 0.0 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.0 | 0.1 | GO:0008327 | methyl-CpG binding(GO:0008327) |
0.0 | 0.0 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
0.0 | 0.1 | GO:0008198 | ferrous iron binding(GO:0008198) |
0.0 | 0.1 | GO:0008242 | omega peptidase activity(GO:0008242) |
0.0 | 0.0 | GO:0016408 | C-acyltransferase activity(GO:0016408) |
0.0 | 0.0 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 4.2 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.2 | 5.9 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.1 | 1.3 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.1 | 2.7 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.1 | 0.2 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.1 | 5.4 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
0.1 | 1.5 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.1 | 3.9 | SIG CHEMOTAXIS | Genes related to chemotaxis |
0.1 | 1.1 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.1 | 0.7 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.1 | 5.1 | PID P73PATHWAY | p73 transcription factor network |
0.1 | 2.8 | PID LKB1 PATHWAY | LKB1 signaling events |
0.1 | 0.3 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.1 | 1.0 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
0.1 | 1.4 | PID ALK1 PATHWAY | ALK1 signaling events |
0.1 | 0.2 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.1 | 0.2 | PID FOXO PATHWAY | FoxO family signaling |
0.1 | 1.9 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.1 | 0.7 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.0 | 0.2 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.0 | 0.2 | PID S1P S1P4 PATHWAY | S1P4 pathway |
0.0 | 0.1 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
0.0 | 0.7 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
0.0 | 0.5 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.0 | 1.6 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
0.0 | 0.7 | PID AURORA B PATHWAY | Aurora B signaling |
0.0 | 0.1 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
0.0 | 0.3 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.0 | 0.4 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.0 | 0.3 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.0 | 0.5 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
0.0 | 0.3 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.0 | 0.4 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.0 | 0.4 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.0 | 0.3 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.0 | 0.2 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.0 | 0.5 | ST GA12 PATHWAY | G alpha 12 Pathway |
0.0 | 0.8 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.0 | 0.7 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
0.0 | 0.5 | PID EPHA FWDPATHWAY | EPHA forward signaling |
0.0 | 0.1 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.0 | 0.1 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
0.0 | 0.3 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
0.0 | 0.6 | PID CONE PATHWAY | Visual signal transduction: Cones |
0.0 | 0.5 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
0.0 | 1.0 | PID SHP2 PATHWAY | SHP2 signaling |
0.0 | 0.1 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
0.0 | 0.4 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
0.0 | 0.2 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.0 | 0.3 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.0 | 0.4 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.0 | 0.5 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
0.0 | 0.1 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
0.0 | 1.2 | PID E2F PATHWAY | E2F transcription factor network |
0.0 | 0.3 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
0.0 | 0.6 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
0.0 | 0.0 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
0.0 | 0.1 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
0.0 | 0.8 | PID AP1 PATHWAY | AP-1 transcription factor network |
0.0 | 0.1 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
0.0 | 0.2 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.0 | 0.2 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
0.0 | 0.4 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.0 | 0.3 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.0 | 0.3 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
0.0 | 0.6 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.0 | 0.1 | PID AURORA A PATHWAY | Aurora A signaling |
0.0 | 0.1 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.0 | 0.5 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
0.0 | 0.3 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
0.0 | 0.3 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
0.0 | 0.3 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
0.0 | 3.9 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
0.0 | 0.1 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
0.0 | 0.4 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
0.0 | 0.3 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.0 | 0.2 | PID RAS PATHWAY | Regulation of Ras family activation |
0.0 | 0.0 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.0 | 0.3 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.0 | 0.1 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
0.0 | 0.1 | PID RHOA PATHWAY | RhoA signaling pathway |
0.0 | 0.1 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
0.0 | 0.1 | PID ATM PATHWAY | ATM pathway |
0.0 | 0.1 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
0.0 | 0.2 | PID ARF 3PATHWAY | Arf1 pathway |
0.0 | 0.4 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
0.0 | 0.1 | PID IL4 2PATHWAY | IL4-mediated signaling events |
0.0 | 0.0 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
0.0 | 0.1 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.0 | 0.1 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
0.0 | 0.1 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
0.0 | 0.2 | PID BARD1 PATHWAY | BARD1 signaling events |
0.0 | 0.0 | ST G ALPHA I PATHWAY | G alpha i Pathway |
0.0 | 0.1 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.0 | 0.0 | ST GAQ PATHWAY | G alpha q Pathway |
0.0 | 0.1 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
0.0 | 0.3 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 4.2 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
0.2 | 3.8 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.2 | 1.3 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
0.2 | 2.4 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.2 | 1.8 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
0.2 | 2.0 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.2 | 0.3 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
0.2 | 2.3 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.1 | 1.5 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
0.1 | 3.0 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
0.1 | 1.7 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.1 | 2.2 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
0.1 | 1.3 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.1 | 0.9 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.1 | 3.0 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.1 | 1.0 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.1 | 1.4 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.1 | 0.4 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
0.1 | 0.8 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.1 | 0.8 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
0.1 | 1.4 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.1 | 0.9 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
0.1 | 0.8 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.1 | 1.0 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.1 | 1.3 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
0.1 | 1.1 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.1 | 0.9 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
0.1 | 0.9 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.1 | 0.6 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.1 | 0.9 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
0.1 | 1.0 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
0.1 | 1.1 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.1 | 0.6 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.1 | 0.8 | REACTOME TRAF6 MEDIATED INDUCTION OF TAK1 COMPLEX | Genes involved in TRAF6 mediated induction of TAK1 complex |
0.1 | 0.7 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.1 | 0.4 | REACTOME SIGNALING BY NOTCH3 | Genes involved in Signaling by NOTCH3 |
0.1 | 0.6 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.1 | 0.2 | REACTOME CELL DEATH SIGNALLING VIA NRAGE NRIF AND NADE | Genes involved in Cell death signalling via NRAGE, NRIF and NADE |
0.1 | 0.4 | REACTOME SIGNALING BY ERBB4 | Genes involved in Signaling by ERBB4 |
0.1 | 0.5 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
0.1 | 1.5 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
0.1 | 0.1 | REACTOME MITOTIC M M G1 PHASES | Genes involved in Mitotic M-M/G1 phases |
0.1 | 0.7 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
0.1 | 3.8 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
0.1 | 0.8 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
0.1 | 0.4 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
0.1 | 0.6 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
0.1 | 0.8 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
0.1 | 0.2 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.1 | 1.2 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
0.1 | 0.9 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.1 | 0.2 | REACTOME G PROTEIN BETA GAMMA SIGNALLING | Genes involved in G-protein beta:gamma signalling |
0.1 | 0.3 | REACTOME SEMA4D IN SEMAPHORIN SIGNALING | Genes involved in Sema4D in semaphorin signaling |
0.1 | 1.0 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
0.1 | 0.9 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
0.1 | 0.5 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
0.1 | 0.3 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
0.0 | 0.5 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
0.0 | 0.1 | REACTOME CDK MEDIATED PHOSPHORYLATION AND REMOVAL OF CDC6 | Genes involved in CDK-mediated phosphorylation and removal of Cdc6 |
0.0 | 0.5 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.0 | 0.4 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
0.0 | 0.1 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
0.0 | 0.4 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
0.0 | 0.5 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.0 | 0.4 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
0.0 | 0.9 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.0 | 0.9 | REACTOME ACTIVATION OF KAINATE RECEPTORS UPON GLUTAMATE BINDING | Genes involved in Activation of Kainate Receptors upon glutamate binding |
0.0 | 1.4 | REACTOME CLEAVAGE OF GROWING TRANSCRIPT IN THE TERMINATION REGION | Genes involved in Cleavage of Growing Transcript in the Termination Region |
0.0 | 1.7 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
0.0 | 0.2 | REACTOME MRNA PROCESSING | Genes involved in mRNA Processing |
0.0 | 0.9 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.0 | 2.5 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
0.0 | 0.3 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
0.0 | 0.2 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
0.0 | 1.3 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.0 | 0.6 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
0.0 | 0.1 | REACTOME ADP SIGNALLING THROUGH P2RY12 | Genes involved in ADP signalling through P2Y purinoceptor 12 |
0.0 | 4.6 | REACTOME TRANSLATION | Genes involved in Translation |
0.0 | 0.6 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.0 | 0.6 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
0.0 | 0.6 | REACTOME GAB1 SIGNALOSOME | Genes involved in GAB1 signalosome |
0.0 | 0.1 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
0.0 | 0.8 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
0.0 | 0.1 | REACTOME P53 DEPENDENT G1 DNA DAMAGE RESPONSE | Genes involved in p53-Dependent G1 DNA Damage Response |
0.0 | 1.3 | REACTOME CELL CYCLE CHECKPOINTS | Genes involved in Cell Cycle Checkpoints |
0.0 | 0.2 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
0.0 | 0.2 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
0.0 | 0.6 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.0 | 1.1 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.0 | 0.4 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
0.0 | 0.0 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
0.0 | 0.1 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
0.0 | 0.0 | REACTOME DOWNSTREAM SIGNALING EVENTS OF B CELL RECEPTOR BCR | Genes involved in Downstream Signaling Events Of B Cell Receptor (BCR) |
0.0 | 0.6 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
0.0 | 0.2 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
0.0 | 4.4 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
0.0 | 1.2 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.0 | 0.0 | REACTOME SIGNALING BY NOTCH2 | Genes involved in Signaling by NOTCH2 |
0.0 | 0.4 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
0.0 | 0.5 | REACTOME NCAM SIGNALING FOR NEURITE OUT GROWTH | Genes involved in NCAM signaling for neurite out-growth |
0.0 | 0.2 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
0.0 | 0.2 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.0 | 0.0 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
0.0 | 0.1 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
0.0 | 0.3 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.0 | 0.4 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
0.0 | 0.2 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
0.0 | 0.3 | REACTOME DEADENYLATION DEPENDENT MRNA DECAY | Genes involved in Deadenylation-dependent mRNA decay |
0.0 | 1.7 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
0.0 | 0.6 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
0.0 | 0.3 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
0.0 | 0.1 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.0 | 0.8 | REACTOME HEPARAN SULFATE HEPARIN HS GAG METABOLISM | Genes involved in Heparan sulfate/heparin (HS-GAG) metabolism |
0.0 | 0.1 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
0.0 | 0.1 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
0.0 | 0.3 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
0.0 | 0.1 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.0 | 0.3 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
0.0 | 0.0 | REACTOME CTLA4 INHIBITORY SIGNALING | Genes involved in CTLA4 inhibitory signaling |
0.0 | 0.0 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
0.0 | 0.1 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
0.0 | 0.2 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.0 | 0.0 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
0.0 | 0.2 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
0.0 | 0.6 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
0.0 | 0.2 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
0.0 | 0.1 | REACTOME ORC1 REMOVAL FROM CHROMATIN | Genes involved in Orc1 removal from chromatin |
0.0 | 0.1 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
0.0 | 0.6 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
0.0 | 0.3 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.0 | 0.7 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
0.0 | 0.1 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.0 | 0.4 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.0 | 0.2 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.0 | 0.4 | REACTOME PROTEIN FOLDING | Genes involved in Protein folding |
0.0 | 0.1 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
0.0 | 0.7 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
0.0 | 0.0 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
0.0 | 0.0 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
0.0 | 0.6 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |