Gene Symbol | Gene ID | Gene Info |
---|---|---|
Nr1h2
|
ENSMUSG00000060601.6 | Nr1h2 |
Gene | Promoter | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Nr1h2 | chr7_44553292_44553632 | 224 | 0.801465 | -0.58 | 2.3e-01 | Click! |
Nr1h2 | chr7_44561160_44561317 | 7287 | 0.066218 | -0.57 | 2.4e-01 | Click! |
Nr1h2 | chr7_44553917_44554074 | 44 | 0.922677 | -0.02 | 9.6e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr6_136954835_136955023 | 4.66 |
Pde6h |
phosphodiesterase 6H, cGMP-specific, cone, gamma |
396 |
0.8 |
chr6_118939696_118939861 | 3.92 |
Gm25905 |
predicted gene, 25905 |
104878 |
0.07 |
chr7_25220574_25220762 | 3.74 |
Dedd2 |
death effector domain-containing DNA binding protein 2 |
53 |
0.89 |
chr5_149579767_149579923 | 3.28 |
Wdr95 |
WD40 repeat domain 95 |
1933 |
0.28 |
chr2_165321690_165321841 | 3.07 |
Elmo2 |
engulfment and cell motility 2 |
939 |
0.5 |
chr9_46049413_46049714 | 2.98 |
Sik3 |
SIK family kinase 3 |
36563 |
0.11 |
chr5_110431463_110431778 | 2.96 |
Fbrsl1 |
fibrosin-like 1 |
1701 |
0.28 |
chr3_31393971_31394257 | 2.49 |
Gm38025 |
predicted gene, 38025 |
53102 |
0.14 |
chr4_101742085_101742265 | 2.33 |
Lepr |
leptin receptor |
24768 |
0.19 |
chr1_164446668_164446865 | 2.32 |
Atp1b1 |
ATPase, Na+/K+ transporting, beta 1 polypeptide |
3047 |
0.2 |
chr14_89668906_89669067 | 2.31 |
Gm25415 |
predicted gene, 25415 |
37819 |
0.23 |
chr6_89157612_89157779 | 2.28 |
Gm1965 |
predicted gene 1965 |
16690 |
0.14 |
chr13_53099001_53099177 | 2.24 |
Gm48336 |
predicted gene, 48336 |
70171 |
0.1 |
chr5_135721198_135721371 | 2.22 |
Por |
P450 (cytochrome) oxidoreductase |
4444 |
0.12 |
chr5_74649861_74650018 | 2.21 |
Lnx1 |
ligand of numb-protein X 1 |
26418 |
0.15 |
chr7_68097150_68097318 | 2.21 |
Igf1r |
insulin-like growth factor I receptor |
51356 |
0.15 |
chr9_85413933_85414088 | 2.20 |
Gm48833 |
predicted gene, 48833 |
5148 |
0.22 |
chrX_134248838_134248996 | 2.14 |
Nox1 |
NADPH oxidase 1 |
26961 |
0.13 |
chr3_76796116_76796283 | 2.13 |
Gm37290 |
predicted gene, 37290 |
25860 |
0.25 |
chr13_52940068_52940219 | 2.13 |
Auh |
AU RNA binding protein/enoyl-coenzyme A hydratase |
10462 |
0.19 |
chr15_55153285_55153461 | 2.10 |
Deptor |
DEP domain containing MTOR-interacting protein |
19920 |
0.17 |
chr6_31455646_31455797 | 2.03 |
Mkln1 |
muskelin 1, intracellular mediator containing kelch motifs |
12399 |
0.19 |
chr1_4479698_4479869 | 2.00 |
Sox17 |
SRY (sex determining region Y)-box 17 |
13821 |
0.14 |
chr6_71458715_71458866 | 1.98 |
Gm44172 |
predicted gene, 44172 |
6798 |
0.11 |
chr12_27826295_27826490 | 1.96 |
Gm45941 |
predicted gene, 45941 |
119650 |
0.06 |
chr14_22421807_22421969 | 1.92 |
Lrmda |
leucine rich melanocyte differentiation associated |
111723 |
0.06 |
chr10_41262019_41262174 | 1.85 |
Fig4 |
FIG4 phosphoinositide 5-phosphatase |
41164 |
0.11 |
chr10_17551883_17552066 | 1.84 |
Gm47770 |
predicted gene, 47770 |
25060 |
0.17 |
chr9_25519353_25519535 | 1.83 |
Gm25861 |
predicted gene, 25861 |
19761 |
0.18 |
chr1_9658480_9658648 | 1.83 |
Gm29520 |
predicted gene 29520 |
17982 |
0.13 |
chr7_123643560_123643752 | 1.81 |
Zkscan2 |
zinc finger with KRAB and SCAN domains 2 |
143207 |
0.04 |
chr12_42228264_42228415 | 1.81 |
Gm25248 |
predicted gene, 25248 |
53377 |
0.15 |
chr4_98106102_98106276 | 1.80 |
Gm12691 |
predicted gene 12691 |
40410 |
0.19 |
chr14_31594823_31594990 | 1.76 |
Colq |
collagen-like tail subunit (single strand of homotrimer) of asymmetric acetylcholinesterase |
3563 |
0.19 |
chr3_121356225_121356399 | 1.75 |
Gm5711 |
predicted gene 5711 |
24367 |
0.14 |
chr17_84653653_84653824 | 1.75 |
Dync2li1 |
dynein cytoplasmic 2 light intermediate chain 1 |
4463 |
0.15 |
chr8_115719843_115720129 | 1.74 |
Maf |
avian musculoaponeurotic fibrosarcoma oncogene homolog |
12192 |
0.23 |
chr15_64334499_64334939 | 1.73 |
Gm10926 |
predicted gene 10926 |
5702 |
0.2 |
chr17_5324481_5324860 | 1.71 |
Gm29050 |
predicted gene 29050 |
64093 |
0.11 |
chr7_4641248_4641426 | 1.71 |
Ppp6r1 |
protein phosphatase 6, regulatory subunit 1 |
1174 |
0.23 |
chr11_98770698_98771034 | 1.67 |
Nr1d1 |
nuclear receptor subfamily 1, group D, member 1 |
440 |
0.69 |
chr17_84650692_84651003 | 1.64 |
Dync2li1 |
dynein cytoplasmic 2 light intermediate chain 1 |
1572 |
0.29 |
chr2_3412724_3412892 | 1.62 |
Meig1 |
meiosis expressed gene 1 |
5773 |
0.13 |
chr7_140775332_140775505 | 1.62 |
Gm29799 |
predicted gene, 29799 |
9097 |
0.09 |
chr5_121950251_121950441 | 1.61 |
Cux2 |
cut-like homeobox 2 |
25425 |
0.15 |
chr3_116520495_116520697 | 1.61 |
Dbt |
dihydrolipoamide branched chain transacylase E2 |
268 |
0.83 |
chr10_81556091_81556315 | 1.61 |
Tle5 |
TLE family member 5, transcriptional modulator |
3285 |
0.09 |
chr12_36155196_36155406 | 1.61 |
Bzw2 |
basic leucine zipper and W2 domains 2 |
1326 |
0.29 |
chr1_40220670_40221002 | 1.60 |
Il1r1 |
interleukin 1 receptor, type I |
4244 |
0.23 |
chr13_95554131_95554549 | 1.60 |
Gm48730 |
predicted gene, 48730 |
18750 |
0.14 |
chr5_102034253_102034411 | 1.58 |
Gm43787 |
predicted gene 43787 |
23737 |
0.16 |
chr16_11140694_11140854 | 1.58 |
Zc3h7a |
zinc finger CCCH type containing 7 A |
117 |
0.92 |
chr12_54261638_54261855 | 1.57 |
Gm24692 |
predicted gene, 24692 |
20846 |
0.14 |
chr12_87291107_87291406 | 1.56 |
Ism2 |
isthmin 2 |
4119 |
0.12 |
chr6_66957937_66958096 | 1.55 |
Gm36816 |
predicted gene, 36816 |
50397 |
0.08 |
chr18_64999443_64999608 | 1.55 |
Gm50368 |
predicted gene, 50368 |
1650 |
0.42 |
chr13_108065431_108065587 | 1.54 |
Smim15 |
small integral membrane protein 15 |
19051 |
0.21 |
chr3_146596723_146596929 | 1.50 |
Dnase2b |
deoxyribonuclease II beta |
214 |
0.53 |
chr1_186584026_186584190 | 1.50 |
A730004F24Rik |
RIKEN cDNA A730004F24 gene |
25427 |
0.19 |
chr6_93014634_93014788 | 1.49 |
Gm44224 |
predicted gene, 44224 |
64397 |
0.11 |
chr17_74043859_74044019 | 1.49 |
Srd5a2 |
steroid 5 alpha-reductase 2 |
3977 |
0.18 |
chr16_76763001_76763174 | 1.48 |
Gm30790 |
predicted gene, 30790 |
1108 |
0.59 |
chr7_102224048_102224209 | 1.46 |
Pgap2 |
post-GPI attachment to proteins 2 |
846 |
0.48 |
chr12_42435715_42435897 | 1.46 |
Gm25248 |
predicted gene, 25248 |
154090 |
0.04 |
chr8_77410509_77410680 | 1.46 |
Gm45407 |
predicted gene 45407 |
38078 |
0.15 |
chr10_17827456_17827607 | 1.46 |
Gm7584 |
predicted gene 7584 |
10152 |
0.18 |
chr8_84650376_84650550 | 1.45 |
Cacna1a |
calcium channel, voltage-dependent, P/Q type, alpha 1A subunit |
11472 |
0.1 |
chr2_39185084_39185263 | 1.45 |
Gm44027 |
predicted gene, 44027 |
3132 |
0.15 |
chr4_155123910_155124068 | 1.45 |
Morn1 |
MORN repeat containing 1 |
13299 |
0.15 |
chrX_77473453_77473612 | 1.44 |
Gm5937 |
predicted gene 5937 |
16946 |
0.22 |
chr6_94998823_94998998 | 1.43 |
4930511E03Rik |
RIKEN cDNA 4930511E03 gene |
55076 |
0.13 |
chr8_66494847_66495045 | 1.43 |
Gm32568 |
predicted gene, 32568 |
113 |
0.96 |
chr12_117087223_117087392 | 1.41 |
Gm10421 |
predicted gene 10421 |
63908 |
0.14 |
chr12_25112953_25113220 | 1.40 |
Id2 |
inhibitor of DNA binding 2 |
15946 |
0.15 |
chr10_75742534_75742685 | 1.39 |
Cabin1 |
calcineurin binding protein 1 |
8838 |
0.11 |
chr2_36278863_36279014 | 1.39 |
Olfr334-ps1 |
olfactory receptor 334, pseudogene 1 |
6085 |
0.13 |
chr8_61200643_61200822 | 1.38 |
Gm16178 |
predicted gene 16178 |
6084 |
0.21 |
chr12_100288092_100288247 | 1.38 |
Gm10432 |
predicted gene 10432 |
2087 |
0.29 |
chr1_43878313_43878465 | 1.37 |
Gm19587 |
predicted gene, 19587 |
9662 |
0.13 |
chr5_17849708_17849891 | 1.36 |
Cd36 |
CD36 molecule |
7 |
0.99 |
chr3_27494203_27494367 | 1.36 |
Gm43344 |
predicted gene 43344 |
52356 |
0.15 |
chr10_80077390_80077541 | 1.34 |
Sbno2 |
strawberry notch 2 |
2026 |
0.17 |
chr1_151103155_151103330 | 1.34 |
Gm19087 |
predicted gene, 19087 |
4673 |
0.15 |
chr7_99935891_99936042 | 1.34 |
Gm18959 |
predicted gene, 18959 |
9096 |
0.12 |
chr16_28914354_28914505 | 1.33 |
Mb21d2 |
Mab-21 domain containing 2 |
15244 |
0.25 |
chr11_99314639_99314793 | 1.33 |
Krt25 |
keratin 25 |
8235 |
0.1 |
chr14_8398783_8399041 | 1.33 |
Gm8416 |
predicted gene 8416 |
10005 |
0.19 |
chr11_11933040_11933228 | 1.32 |
Grb10 |
growth factor receptor bound protein 10 |
5482 |
0.2 |
chr5_122647730_122647905 | 1.32 |
P2rx7 |
purinergic receptor P2X, ligand-gated ion channel, 7 |
2607 |
0.19 |
chr9_53123329_53123494 | 1.32 |
Gm47986 |
predicted gene, 47986 |
40777 |
0.19 |
chr18_77565630_77565809 | 1.31 |
Rnf165 |
ring finger protein 165 |
558 |
0.81 |
chr13_45391616_45391796 | 1.31 |
Mylip |
myosin regulatory light chain interacting protein |
779 |
0.7 |
chr11_63883508_63883682 | 1.31 |
Hmgb1-ps3 |
high mobility group box 1, pseudogene 3 |
36777 |
0.15 |
chr11_105286166_105286345 | 1.31 |
Mrc2 |
mannose receptor, C type 2 |
6388 |
0.2 |
chr16_11455852_11456021 | 1.31 |
Snx29 |
sorting nexin 29 |
8628 |
0.23 |
chr19_7307052_7307215 | 1.30 |
Gm17227 |
predicted gene 17227 |
9399 |
0.11 |
chr3_57471128_57471279 | 1.30 |
Tm4sf4 |
transmembrane 4 superfamily member 4 |
45889 |
0.13 |
chr8_109006416_109006567 | 1.29 |
D030068K23Rik |
RIKEN cDNA D030068K23 gene |
68731 |
0.11 |
chr3_101805744_101805931 | 1.29 |
Mab21l3 |
mab-21-like 3 |
30386 |
0.17 |
chr11_64025981_64026165 | 1.29 |
Gm12289 |
predicted gene 12289 |
13458 |
0.2 |
chr6_108566583_108566734 | 1.28 |
Gm16433 |
predicted gene 16433 |
1070 |
0.46 |
chr18_39802214_39802365 | 1.28 |
Pabpc2 |
poly(A) binding protein, cytoplasmic 2 |
28792 |
0.21 |
chr6_88244946_88245100 | 1.27 |
1700031F10Rik |
RIKEN cDNA 1700031F10 gene |
19345 |
0.13 |
chr16_97497728_97497915 | 1.27 |
Gm24777 |
predicted gene, 24777 |
1201 |
0.36 |
chr10_95839908_95840069 | 1.27 |
Gm33543 |
predicted gene, 33543 |
2908 |
0.18 |
chr10_105409386_105409537 | 1.26 |
Gm48203 |
predicted gene, 48203 |
15175 |
0.18 |
chr9_74891211_74891440 | 1.26 |
Onecut1 |
one cut domain, family member 1 |
24841 |
0.14 |
chr17_86447048_86447322 | 1.26 |
Prkce |
protein kinase C, epsilon |
43377 |
0.17 |
chr11_69948543_69948720 | 1.26 |
Slc2a4 |
solute carrier family 2 (facilitated glucose transporter), member 4 |
443 |
0.53 |
chr4_120230002_120230153 | 1.25 |
Foxo6 |
forkhead box O6 |
57272 |
0.11 |
chrX_56970947_56971107 | 1.24 |
Adgrg4 |
adhesion G protein-coupled receptor G4 |
2907 |
0.31 |
chr2_32962680_32962860 | 1.24 |
Rpl12 |
ribosomal protein L12 |
504 |
0.39 |
chr14_46999806_47000002 | 1.23 |
Samd4 |
sterile alpha motif domain containing 4 |
1411 |
0.37 |
chr12_3344324_3344475 | 1.23 |
Gm26520 |
predicted gene, 26520 |
12754 |
0.13 |
chr14_60649072_60649245 | 1.23 |
Spata13 |
spermatogenesis associated 13 |
14403 |
0.22 |
chr5_30610413_30610591 | 1.23 |
Kcnk3 |
potassium channel, subfamily K, member 3 |
10871 |
0.13 |
chr14_122649527_122649829 | 1.22 |
Gm49260 |
predicted gene, 49260 |
36638 |
0.14 |
chr10_86163815_86164169 | 1.22 |
Gm15990 |
predicted gene 15990 |
38165 |
0.14 |
chr2_159826405_159826556 | 1.22 |
Gm11446 |
predicted gene 11446 |
32810 |
0.19 |
chr15_59030422_59030791 | 1.22 |
Mtss1 |
MTSS I-BAR domain containing 1 |
9990 |
0.21 |
chr1_54496220_54496429 | 1.22 |
Gm36955 |
predicted gene, 36955 |
23946 |
0.15 |
chr17_31305538_31305732 | 1.22 |
Slc37a1 |
solute carrier family 37 (glycerol-3-phosphate transporter), member 1 |
92 |
0.96 |
chr4_138186052_138186245 | 1.22 |
Eif4g3 |
eukaryotic translation initiation factor 4 gamma, 3 |
1670 |
0.28 |
chr5_97062204_97062377 | 1.22 |
Gm43145 |
predicted gene 43145 |
16109 |
0.16 |
chr13_101267799_101267950 | 1.21 |
4932411K12Rik |
RIKEN cDNA 4932411K12 gene |
13555 |
0.22 |
chr3_145736646_145736797 | 1.21 |
Gm43408 |
predicted gene 43408 |
2445 |
0.3 |
chr9_40321548_40321712 | 1.21 |
Gramd1b |
GRAM domain containing 1B |
710 |
0.51 |
chr5_46212958_46213109 | 1.20 |
Gm7931 |
predicted pseudogene 7931 |
201311 |
0.03 |
chr19_44393983_44394181 | 1.20 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
12608 |
0.14 |
chr11_100783167_100783318 | 1.20 |
Ghdc |
GH3 domain containing |
12285 |
0.1 |
chr9_121435690_121435841 | 1.20 |
Trak1 |
trafficking protein, kinesin binding 1 |
18531 |
0.17 |
chr8_123162810_123162969 | 1.20 |
Gm4316 |
predicted gene 4316 |
2366 |
0.12 |
chr5_148809153_148809304 | 1.19 |
Gm15407 |
predicted gene 15407 |
11539 |
0.15 |
chr4_11047537_11047728 | 1.19 |
Ndufaf6 |
NADH:ubiquinone oxidoreductase complex assembly factor 6 |
11451 |
0.17 |
chr5_66608422_66608589 | 1.19 |
Apbb2 |
amyloid beta (A4) precursor protein-binding, family B, member 2 |
10135 |
0.15 |
chrX_74837196_74837401 | 1.19 |
Gm5936 |
predicted gene 5936 |
102 |
0.92 |
chr5_99380288_99380455 | 1.18 |
Gm35394 |
predicted gene, 35394 |
106276 |
0.06 |
chr1_34306824_34306990 | 1.18 |
Dst |
dystonin |
12461 |
0.13 |
chr4_129811495_129811670 | 1.18 |
Ptp4a2 |
protein tyrosine phosphatase 4a2 |
360 |
0.82 |
chr15_69062103_69062352 | 1.18 |
Gm49422 |
predicted gene, 49422 |
102696 |
0.07 |
chr1_165661837_165661988 | 1.17 |
Gm18407 |
predicted gene, 18407 |
17224 |
0.1 |
chr11_82527093_82527250 | 1.17 |
Gm24612 |
predicted gene, 24612 |
69008 |
0.09 |
chr13_45698624_45698775 | 1.17 |
Gm47460 |
predicted gene, 47460 |
50873 |
0.16 |
chr14_65757767_65757918 | 1.17 |
Pbk |
PDZ binding kinase |
47995 |
0.13 |
chr8_117761646_117761797 | 1.16 |
Gm31774 |
predicted gene, 31774 |
13461 |
0.15 |
chr7_27607791_27607964 | 1.16 |
Akt2 |
thymoma viral proto-oncogene 2 |
127 |
0.93 |
chr6_70874493_70874669 | 1.16 |
Eif2ak3 |
eukaryotic translation initiation factor 2 alpha kinase 3 |
3980 |
0.17 |
chr2_165969012_165969173 | 1.16 |
Gm11462 |
predicted gene 11462 |
9303 |
0.13 |
chr17_50369359_50369516 | 1.15 |
Gm49906 |
predicted gene, 49906 |
30185 |
0.19 |
chr17_84650406_84650562 | 1.15 |
Dync2li1 |
dynein cytoplasmic 2 light intermediate chain 1 |
1209 |
0.37 |
chr5_33467030_33467208 | 1.15 |
Gm43851 |
predicted gene 43851 |
29655 |
0.14 |
chr17_29420054_29420213 | 1.15 |
Gm36199 |
predicted gene, 36199 |
12702 |
0.12 |
chr6_87994497_87994648 | 1.15 |
4933412L11Rik |
RIKEN cDNA 4933412L11 gene |
393 |
0.71 |
chr10_127999638_127999789 | 1.15 |
Hsd17b6 |
hydroxysteroid (17-beta) dehydrogenase 6 |
965 |
0.34 |
chr17_10511158_10511318 | 1.15 |
Gm16168 |
predicted gene 16168 |
14785 |
0.24 |
chr3_116356576_116356741 | 1.15 |
Gm29151 |
predicted gene 29151 |
6555 |
0.19 |
chr2_164359753_164359904 | 1.14 |
Slpi |
secretory leukocyte peptidase inhibitor |
3321 |
0.13 |
chr9_32720831_32721015 | 1.14 |
Gm27240 |
predicted gene 27240 |
9752 |
0.19 |
chr18_11926234_11926524 | 1.14 |
Gm49968 |
predicted gene, 49968 |
13248 |
0.22 |
chr4_86111546_86111735 | 1.13 |
Adamtsl1 |
ADAMTS-like 1 |
23841 |
0.25 |
chrX_169989673_169989848 | 1.13 |
Gm15247 |
predicted gene 15247 |
2821 |
0.2 |
chr2_167351419_167351615 | 1.13 |
B4galt5 |
UDP-Gal:betaGlcNAc beta 1,4-galactosyltransferase, polypeptide 5 |
2334 |
0.3 |
chr8_34744788_34744939 | 1.12 |
Dusp4 |
dual specificity phosphatase 4 |
62434 |
0.1 |
chr6_108413207_108413366 | 1.12 |
Itpr1 |
inositol 1,4,5-trisphosphate receptor 1 |
1984 |
0.39 |
chr8_64812478_64812667 | 1.12 |
Gm10997 |
predicted gene 10997 |
3434 |
0.2 |
chr5_91293069_91293447 | 1.11 |
Gm19619 |
predicted gene, 19619 |
9837 |
0.24 |
chr2_157790634_157790799 | 1.11 |
Ctnnbl1 |
catenin, beta like 1 |
852 |
0.65 |
chr12_87385183_87385342 | 1.10 |
Sptlc2 |
serine palmitoyltransferase, long chain base subunit 2 |
2979 |
0.12 |
chr8_105068017_105068704 | 1.10 |
Ces3a |
carboxylesterase 3A |
14707 |
0.09 |
chrY_90763950_90764120 | 1.10 |
Gm21860 |
predicted gene, 21860 |
8568 |
0.17 |
chr18_38849992_38850159 | 1.10 |
Fgf1 |
fibroblast growth factor 1 |
8673 |
0.22 |
chr17_47845569_47845827 | 1.09 |
n-R5s28 |
nuclear encoded rRNA 5S 28 |
3136 |
0.16 |
chr2_58742127_58742313 | 1.09 |
Gm13559 |
predicted gene 13559 |
1581 |
0.4 |
chr1_88587324_88587676 | 1.09 |
Gm19589 |
predicted gene, 19589 |
35983 |
0.13 |
chr12_111800607_111800782 | 1.09 |
Klc1 |
kinesin light chain 1 |
4810 |
0.13 |
chrX_74645420_74645602 | 1.08 |
Gm5640 |
predicted gene 5640 |
124 |
0.92 |
chr10_19087108_19087313 | 1.08 |
1700124M09Rik |
RIKEN cDNA 1700124M09 gene |
32 |
0.97 |
chr12_36722874_36723044 | 1.08 |
Mir5099 |
microRNA 5099 |
93246 |
0.08 |
chr1_131741893_131742062 | 1.07 |
Slc26a9 |
solute carrier family 26, member 9 |
2045 |
0.29 |
chr3_9783043_9783348 | 1.07 |
Gm16337 |
predicted gene 16337 |
25588 |
0.17 |
chr11_107263845_107264203 | 1.07 |
Gm11719 |
predicted gene 11719 |
66684 |
0.07 |
chr6_144491860_144492027 | 1.07 |
Sox5os2 |
SRY (sex determining region Y)-box 5, opposite strand 2 |
10718 |
0.29 |
chr19_55491305_55491575 | 1.07 |
Vti1a |
vesicle transport through interaction with t-SNAREs 1A |
110426 |
0.07 |
chr19_36779876_36780056 | 1.07 |
Gm50112 |
predicted gene, 50112 |
38682 |
0.14 |
chr9_83955977_83956177 | 1.06 |
Bckdhb |
branched chain ketoacid dehydrogenase E1, beta polypeptide |
7296 |
0.16 |
chr13_60574011_60574454 | 1.06 |
Dapk1 |
death associated protein kinase 1 |
27715 |
0.14 |
chr2_72158173_72158334 | 1.06 |
Rapgef4os1 |
Rap guanine nucleotide exchange factor (GEF) 4, opposite strand 1 |
9457 |
0.2 |
chr2_52872743_52872932 | 1.06 |
Fmnl2 |
formin-like 2 |
14969 |
0.27 |
chr5_110806721_110807048 | 1.05 |
Ulk1 |
unc-51 like kinase 1 |
3169 |
0.15 |
chr11_16834271_16834692 | 1.05 |
Egfros |
epidermal growth factor receptor, opposite strand |
3779 |
0.26 |
chr9_61189435_61189586 | 1.04 |
Gm34105 |
predicted gene, 34105 |
17169 |
0.17 |
chr1_134163496_134163749 | 1.04 |
Chil1 |
chitinase-like 1 |
18554 |
0.12 |
chr1_93029521_93029757 | 1.03 |
Kif1a |
kinesin family member 1A |
2434 |
0.2 |
chrX_129709787_129709942 | 1.03 |
Diaph2 |
diaphanous related formin 2 |
39878 |
0.21 |
chr1_54684346_54684705 | 1.03 |
4930444A19Rik |
RIKEN cDNA 4930444A19 gene |
2796 |
0.25 |
chr6_37421271_37421434 | 1.02 |
Creb3l2 |
cAMP responsive element binding protein 3-like 2 |
20794 |
0.25 |
chr12_8637058_8637209 | 1.01 |
Pum2 |
pumilio RNA-binding family member 2 |
37001 |
0.15 |
chr18_65393721_65394053 | 1.01 |
Alpk2 |
alpha-kinase 2 |
7 |
0.96 |
chr10_4624693_4624859 | 1.01 |
Esr1 |
estrogen receptor 1 (alpha) |
12755 |
0.23 |
chr14_7843041_7843416 | 1.01 |
Flnb |
filamin, beta |
25271 |
0.14 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.9 | 2.8 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
0.5 | 1.4 | GO:0034196 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
0.4 | 1.3 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
0.3 | 1.6 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
0.3 | 0.8 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
0.3 | 1.4 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
0.2 | 1.5 | GO:0010871 | negative regulation of receptor biosynthetic process(GO:0010871) |
0.2 | 0.7 | GO:1903999 | negative regulation of eating behavior(GO:1903999) |
0.2 | 1.0 | GO:0010748 | negative regulation of plasma membrane long-chain fatty acid transport(GO:0010748) |
0.2 | 1.1 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
0.2 | 1.1 | GO:0032803 | low-density lipoprotein particle receptor catabolic process(GO:0032802) regulation of low-density lipoprotein particle receptor catabolic process(GO:0032803) |
0.2 | 0.4 | GO:1902488 | cholangiocyte apoptotic process(GO:1902488) regulation of cholangiocyte apoptotic process(GO:1904192) negative regulation of cholangiocyte apoptotic process(GO:1904193) |
0.2 | 1.1 | GO:1903599 | positive regulation of mitophagy(GO:1903599) |
0.2 | 0.2 | GO:1903624 | regulation of DNA catabolic process(GO:1903624) |
0.2 | 0.8 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.2 | 0.8 | GO:1903964 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.2 | 0.6 | GO:0048320 | axial mesoderm formation(GO:0048320) |
0.2 | 0.5 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
0.2 | 3.9 | GO:0045742 | positive regulation of epidermal growth factor receptor signaling pathway(GO:0045742) |
0.2 | 1.0 | GO:0060978 | angiogenesis involved in coronary vascular morphogenesis(GO:0060978) |
0.2 | 1.0 | GO:0006477 | protein sulfation(GO:0006477) |
0.2 | 0.3 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
0.2 | 0.8 | GO:0015781 | nucleotide-sugar transport(GO:0015780) pyrimidine nucleotide-sugar transport(GO:0015781) |
0.2 | 0.8 | GO:0046618 | drug export(GO:0046618) |
0.2 | 0.6 | GO:0071276 | cellular response to cadmium ion(GO:0071276) |
0.2 | 0.5 | GO:0021823 | cerebral cortex tangential migration using cell-cell interactions(GO:0021823) postnatal olfactory bulb interneuron migration(GO:0021827) |
0.2 | 0.5 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
0.1 | 0.3 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
0.1 | 0.4 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
0.1 | 0.3 | GO:1903689 | regulation of wound healing, spreading of epidermal cells(GO:1903689) |
0.1 | 0.6 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
0.1 | 0.3 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
0.1 | 0.4 | GO:0070672 | response to interleukin-15(GO:0070672) |
0.1 | 0.4 | GO:0001757 | somite specification(GO:0001757) |
0.1 | 0.4 | GO:0015817 | histidine transport(GO:0015817) |
0.1 | 0.3 | GO:0045726 | positive regulation of integrin biosynthetic process(GO:0045726) |
0.1 | 0.7 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
0.1 | 0.4 | GO:1905005 | regulation of epithelial to mesenchymal transition involved in endocardial cushion formation(GO:1905005) |
0.1 | 0.4 | GO:0035962 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
0.1 | 0.4 | GO:0002386 | immune response in mucosal-associated lymphoid tissue(GO:0002386) |
0.1 | 0.4 | GO:0061030 | epithelial cell differentiation involved in mammary gland alveolus development(GO:0061030) |
0.1 | 0.7 | GO:1902993 | positive regulation of beta-amyloid formation(GO:1902004) positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
0.1 | 0.4 | GO:0060066 | oviduct development(GO:0060066) |
0.1 | 0.5 | GO:0071286 | cellular response to magnesium ion(GO:0071286) |
0.1 | 0.2 | GO:0034140 | negative regulation of toll-like receptor 3 signaling pathway(GO:0034140) |
0.1 | 0.4 | GO:0003419 | growth plate cartilage chondrocyte proliferation(GO:0003419) |
0.1 | 0.6 | GO:0033132 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
0.1 | 0.4 | GO:0045917 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
0.1 | 0.2 | GO:0050717 | positive regulation of interleukin-1 alpha secretion(GO:0050717) |
0.1 | 0.1 | GO:0060331 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
0.1 | 0.8 | GO:0051176 | positive regulation of sulfur metabolic process(GO:0051176) |
0.1 | 0.6 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
0.1 | 0.5 | GO:0098910 | regulation of atrial cardiac muscle cell action potential(GO:0098910) |
0.1 | 0.3 | GO:1901162 | serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
0.1 | 0.3 | GO:0060696 | regulation of phospholipid catabolic process(GO:0060696) |
0.1 | 0.2 | GO:0035973 | aggrephagy(GO:0035973) |
0.1 | 2.8 | GO:0006921 | cellular component disassembly involved in execution phase of apoptosis(GO:0006921) apoptotic nuclear changes(GO:0030262) |
0.1 | 0.4 | GO:0002175 | protein localization to paranode region of axon(GO:0002175) |
0.1 | 0.4 | GO:0060480 | lung goblet cell differentiation(GO:0060480) |
0.1 | 0.5 | GO:0034638 | phosphatidylcholine catabolic process(GO:0034638) |
0.1 | 0.2 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
0.1 | 0.3 | GO:0006068 | ethanol catabolic process(GO:0006068) |
0.1 | 0.3 | GO:0006533 | aspartate catabolic process(GO:0006533) |
0.1 | 0.5 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.1 | 0.9 | GO:0051971 | positive regulation of transmission of nerve impulse(GO:0051971) |
0.1 | 0.4 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
0.1 | 0.4 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
0.1 | 0.3 | GO:0060956 | endocardial cell differentiation(GO:0060956) |
0.1 | 0.6 | GO:0044539 | long-chain fatty acid import(GO:0044539) |
0.1 | 0.3 | GO:0050427 | 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
0.1 | 0.5 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
0.1 | 0.3 | GO:1901509 | regulation of endothelial tube morphogenesis(GO:1901509) |
0.1 | 0.3 | GO:0086045 | membrane depolarization during AV node cell action potential(GO:0086045) |
0.1 | 0.7 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
0.1 | 0.3 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
0.1 | 0.4 | GO:0034214 | protein hexamerization(GO:0034214) |
0.1 | 0.4 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
0.1 | 0.6 | GO:0019368 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
0.1 | 0.3 | GO:0071462 | cellular response to water stimulus(GO:0071462) |
0.1 | 0.1 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
0.1 | 0.3 | GO:0035582 | sequestering of BMP in extracellular matrix(GO:0035582) |
0.1 | 0.3 | GO:0038161 | prolactin signaling pathway(GO:0038161) |
0.1 | 0.6 | GO:1901841 | regulation of high voltage-gated calcium channel activity(GO:1901841) |
0.1 | 0.1 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
0.1 | 0.3 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
0.1 | 0.2 | GO:0043201 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
0.1 | 0.2 | GO:0045091 | regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045091) negative regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045869) |
0.1 | 0.2 | GO:0015889 | cobalamin transport(GO:0015889) |
0.1 | 0.2 | GO:0002069 | columnar/cuboidal epithelial cell maturation(GO:0002069) glandular epithelial cell maturation(GO:0002071) |
0.1 | 0.2 | GO:1903416 | response to glycoside(GO:1903416) |
0.1 | 0.8 | GO:0036010 | protein localization to endosome(GO:0036010) |
0.1 | 0.2 | GO:0003213 | cardiac right atrium morphogenesis(GO:0003213) |
0.1 | 0.4 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
0.1 | 0.2 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
0.1 | 0.3 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
0.1 | 0.4 | GO:1904424 | regulation of GTP binding(GO:1904424) |
0.1 | 0.4 | GO:0008582 | regulation of synaptic growth at neuromuscular junction(GO:0008582) |
0.1 | 0.3 | GO:0070779 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
0.1 | 0.4 | GO:0072675 | osteoclast fusion(GO:0072675) |
0.1 | 0.2 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.1 | 0.3 | GO:0021590 | cerebellum maturation(GO:0021590) |
0.1 | 0.2 | GO:1904528 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
0.1 | 0.2 | GO:0046061 | dATP catabolic process(GO:0046061) |
0.1 | 0.8 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) |
0.1 | 0.6 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
0.1 | 0.2 | GO:0060585 | regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
0.1 | 1.5 | GO:0007026 | negative regulation of microtubule depolymerization(GO:0007026) |
0.1 | 0.5 | GO:0072102 | glomerulus morphogenesis(GO:0072102) |
0.1 | 0.2 | GO:0072092 | ureteric bud invasion(GO:0072092) |
0.1 | 0.1 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) |
0.1 | 0.1 | GO:0060468 | prevention of polyspermy(GO:0060468) |
0.1 | 0.4 | GO:0033227 | dsRNA transport(GO:0033227) |
0.1 | 0.2 | GO:0071492 | cellular response to UV-A(GO:0071492) |
0.1 | 0.2 | GO:0009080 | alanine catabolic process(GO:0006524) pyruvate family amino acid catabolic process(GO:0009080) |
0.1 | 0.3 | GO:1904251 | regulation of bile acid metabolic process(GO:1904251) |
0.1 | 0.1 | GO:0072674 | multinuclear osteoclast differentiation(GO:0072674) |
0.1 | 0.1 | GO:0035633 | maintenance of blood-brain barrier(GO:0035633) |
0.1 | 0.1 | GO:0048022 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
0.1 | 0.6 | GO:0050957 | equilibrioception(GO:0050957) |
0.1 | 0.2 | GO:0032058 | positive regulation of translational initiation in response to stress(GO:0032058) |
0.1 | 0.2 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
0.1 | 0.3 | GO:0010424 | DNA methylation on cytosine within a CG sequence(GO:0010424) DNA methylation on cytosine(GO:0032776) |
0.1 | 0.2 | GO:0039534 | negative regulation of MDA-5 signaling pathway(GO:0039534) |
0.1 | 0.8 | GO:0071380 | cellular response to prostaglandin E stimulus(GO:0071380) |
0.1 | 0.1 | GO:0061366 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
0.1 | 0.3 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
0.1 | 0.2 | GO:0046098 | guanine metabolic process(GO:0046098) |
0.1 | 0.2 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.1 | 0.2 | GO:0010911 | regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) |
0.1 | 0.3 | GO:1903142 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
0.1 | 0.1 | GO:1900238 | cell migration involved in metanephros development(GO:0035788) metanephric mesenchymal cell migration(GO:0035789) positive regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:0035793) regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:1900238) regulation of metanephric mesenchymal cell migration(GO:2000589) positive regulation of metanephric mesenchymal cell migration(GO:2000591) |
0.1 | 0.1 | GO:0045196 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
0.1 | 0.1 | GO:0048842 | positive regulation of axon extension involved in axon guidance(GO:0048842) positive regulation of axon guidance(GO:1902669) |
0.1 | 0.5 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
0.1 | 0.3 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
0.1 | 0.1 | GO:0032077 | positive regulation of deoxyribonuclease activity(GO:0032077) |
0.1 | 0.2 | GO:1902287 | semaphorin-plexin signaling pathway involved in axon guidance(GO:1902287) |
0.1 | 0.3 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
0.1 | 0.3 | GO:0046485 | ether lipid metabolic process(GO:0046485) |
0.1 | 0.1 | GO:0045590 | negative regulation of regulatory T cell differentiation(GO:0045590) |
0.1 | 0.2 | GO:1903751 | regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903750) negative regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903751) |
0.1 | 0.2 | GO:1904996 | positive regulation of leukocyte adhesion to vascular endothelial cell(GO:1904996) |
0.1 | 0.4 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
0.1 | 0.2 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.1 | 0.1 | GO:0007403 | glial cell fate determination(GO:0007403) |
0.1 | 0.4 | GO:0070327 | thyroid hormone transport(GO:0070327) |
0.1 | 0.5 | GO:0006851 | mitochondrial calcium ion transport(GO:0006851) |
0.1 | 0.5 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
0.1 | 0.1 | GO:0033088 | negative regulation of immature T cell proliferation in thymus(GO:0033088) |
0.1 | 0.3 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.1 | 0.1 | GO:1902915 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
0.1 | 0.1 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
0.1 | 0.2 | GO:1900227 | positive regulation of NLRP3 inflammasome complex assembly(GO:1900227) |
0.1 | 0.1 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
0.1 | 0.4 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
0.1 | 0.2 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
0.1 | 0.2 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
0.1 | 0.1 | GO:1902744 | negative regulation of lamellipodium organization(GO:1902744) |
0.1 | 0.3 | GO:0045990 | carbon catabolite regulation of transcription(GO:0045990) |
0.1 | 0.2 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
0.1 | 0.2 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
0.1 | 0.2 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
0.1 | 0.1 | GO:0010725 | regulation of primitive erythrocyte differentiation(GO:0010725) |
0.1 | 0.1 | GO:0003347 | epicardial cell to mesenchymal cell transition(GO:0003347) |
0.1 | 0.5 | GO:0045725 | positive regulation of glycogen biosynthetic process(GO:0045725) |
0.1 | 0.2 | GO:1904970 | brush border assembly(GO:1904970) |
0.1 | 0.1 | GO:0003162 | atrioventricular node development(GO:0003162) |
0.1 | 0.5 | GO:0009143 | nucleoside triphosphate catabolic process(GO:0009143) |
0.1 | 0.2 | GO:1902218 | intrinsic apoptotic signaling pathway in response to osmotic stress(GO:0008627) regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902218) negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
0.1 | 0.1 | GO:0046499 | S-adenosylmethioninamine metabolic process(GO:0046499) |
0.1 | 0.3 | GO:0051639 | actin filament network formation(GO:0051639) |
0.1 | 0.1 | GO:0089700 | protein kinase D signaling(GO:0089700) |
0.1 | 0.4 | GO:0045792 | negative regulation of cell size(GO:0045792) |
0.1 | 0.3 | GO:0019856 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
0.1 | 0.1 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
0.1 | 0.1 | GO:0033686 | positive regulation of luteinizing hormone secretion(GO:0033686) |
0.1 | 0.2 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.1 | 0.2 | GO:0023021 | termination of signal transduction(GO:0023021) |
0.1 | 0.2 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
0.1 | 0.1 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
0.1 | 0.1 | GO:0071698 | olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
0.1 | 0.1 | GO:0009106 | lipoate metabolic process(GO:0009106) |
0.1 | 0.1 | GO:0000101 | sulfur amino acid transport(GO:0000101) |
0.1 | 0.3 | GO:0046037 | GMP metabolic process(GO:0046037) |
0.1 | 0.4 | GO:0015825 | L-serine transport(GO:0015825) |
0.1 | 0.2 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
0.1 | 0.2 | GO:0045348 | positive regulation of MHC class II biosynthetic process(GO:0045348) |
0.1 | 0.1 | GO:0090154 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
0.1 | 0.3 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
0.1 | 0.3 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
0.1 | 0.2 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.1 | 0.1 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
0.1 | 0.9 | GO:1902230 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902230) |
0.1 | 0.2 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
0.1 | 0.1 | GO:1905206 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
0.1 | 0.2 | GO:0045950 | negative regulation of mitotic recombination(GO:0045950) |
0.1 | 0.2 | GO:1903236 | regulation of leukocyte tethering or rolling(GO:1903236) negative regulation of leukocyte tethering or rolling(GO:1903237) |
0.1 | 0.2 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
0.1 | 0.3 | GO:0046415 | urate metabolic process(GO:0046415) |
0.1 | 0.2 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
0.1 | 0.2 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
0.1 | 0.2 | GO:2000425 | regulation of apoptotic cell clearance(GO:2000425) positive regulation of apoptotic cell clearance(GO:2000427) |
0.1 | 0.2 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
0.1 | 0.2 | GO:0014732 | skeletal muscle atrophy(GO:0014732) |
0.0 | 0.0 | GO:0070488 | neutrophil aggregation(GO:0070488) |
0.0 | 0.3 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
0.0 | 0.2 | GO:1901341 | positive regulation of store-operated calcium channel activity(GO:1901341) |
0.0 | 0.1 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
0.0 | 0.2 | GO:0009446 | putrescine biosynthetic process(GO:0009446) |
0.0 | 0.0 | GO:0002906 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
0.0 | 0.2 | GO:0014028 | notochord formation(GO:0014028) |
0.0 | 0.4 | GO:0060013 | righting reflex(GO:0060013) |
0.0 | 1.3 | GO:0003333 | amino acid transmembrane transport(GO:0003333) |
0.0 | 0.1 | GO:0043133 | hindgut contraction(GO:0043133) regulation of hindgut contraction(GO:0043134) |
0.0 | 0.1 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
0.0 | 0.2 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
0.0 | 0.2 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
0.0 | 0.0 | GO:0001923 | B-1 B cell differentiation(GO:0001923) |
0.0 | 0.1 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
0.0 | 0.1 | GO:0046066 | purine deoxyribonucleoside diphosphate metabolic process(GO:0009182) dGDP metabolic process(GO:0046066) |
0.0 | 0.2 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
0.0 | 0.0 | GO:0045113 | regulation of integrin biosynthetic process(GO:0045113) |
0.0 | 0.4 | GO:0035337 | fatty-acyl-CoA metabolic process(GO:0035337) |
0.0 | 0.1 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.0 | 0.5 | GO:0043248 | proteasome assembly(GO:0043248) |
0.0 | 1.2 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
0.0 | 1.2 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
0.0 | 0.0 | GO:0034035 | purine ribonucleoside bisphosphate metabolic process(GO:0034035) |
0.0 | 0.1 | GO:0019086 | late viral transcription(GO:0019086) |
0.0 | 0.3 | GO:0045780 | positive regulation of bone resorption(GO:0045780) positive regulation of bone remodeling(GO:0046852) |
0.0 | 0.1 | GO:0002432 | granuloma formation(GO:0002432) |
0.0 | 0.6 | GO:0001893 | maternal placenta development(GO:0001893) |
0.0 | 0.1 | GO:0048625 | myoblast fate commitment(GO:0048625) |
0.0 | 0.1 | GO:0003241 | growth involved in heart morphogenesis(GO:0003241) |
0.0 | 0.2 | GO:0060398 | regulation of growth hormone receptor signaling pathway(GO:0060398) |
0.0 | 0.1 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
0.0 | 0.0 | GO:0006067 | ethanol metabolic process(GO:0006067) ethanol oxidation(GO:0006069) |
0.0 | 0.1 | GO:0006848 | pyruvate transport(GO:0006848) pyruvate transmembrane transport(GO:1901475) |
0.0 | 1.1 | GO:0008045 | motor neuron axon guidance(GO:0008045) |
0.0 | 0.5 | GO:0007213 | G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) |
0.0 | 0.2 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
0.0 | 0.1 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
0.0 | 0.1 | GO:0070842 | aggresome assembly(GO:0070842) |
0.0 | 0.4 | GO:0007614 | short-term memory(GO:0007614) |
0.0 | 0.4 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
0.0 | 0.0 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
0.0 | 0.1 | GO:0035672 | oligopeptide transmembrane transport(GO:0035672) |
0.0 | 0.4 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) |
0.0 | 0.2 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.0 | 0.2 | GO:0045075 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
0.0 | 0.1 | GO:0060319 | primitive erythrocyte differentiation(GO:0060319) |
0.0 | 0.2 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
0.0 | 0.1 | GO:0006015 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
0.0 | 0.3 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
0.0 | 0.1 | GO:0072053 | renal inner medulla development(GO:0072053) |
0.0 | 0.0 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
0.0 | 0.1 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
0.0 | 0.2 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
0.0 | 0.8 | GO:0045672 | positive regulation of osteoclast differentiation(GO:0045672) |
0.0 | 0.1 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
0.0 | 0.4 | GO:0010560 | positive regulation of glycoprotein biosynthetic process(GO:0010560) |
0.0 | 0.2 | GO:0007262 | STAT protein import into nucleus(GO:0007262) |
0.0 | 0.2 | GO:0090232 | positive regulation of spindle checkpoint(GO:0090232) |
0.0 | 0.2 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
0.0 | 0.0 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
0.0 | 0.2 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
0.0 | 0.7 | GO:0036075 | endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
0.0 | 0.1 | GO:0035089 | establishment of apical/basal cell polarity(GO:0035089) |
0.0 | 0.1 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
0.0 | 0.1 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
0.0 | 0.2 | GO:0060768 | epithelial cell proliferation involved in prostate gland development(GO:0060767) regulation of epithelial cell proliferation involved in prostate gland development(GO:0060768) |
0.0 | 0.6 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
0.0 | 0.2 | GO:0030214 | hyaluronan catabolic process(GO:0030214) |
0.0 | 0.3 | GO:0030836 | positive regulation of actin filament depolymerization(GO:0030836) |
0.0 | 0.2 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.0 | 0.3 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.0 | 0.4 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
0.0 | 0.1 | GO:0007343 | egg activation(GO:0007343) |
0.0 | 0.1 | GO:0007412 | axon target recognition(GO:0007412) |
0.0 | 0.1 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
0.0 | 0.1 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
0.0 | 0.2 | GO:0009068 | aspartate family amino acid catabolic process(GO:0009068) |
0.0 | 0.1 | GO:0032570 | response to progesterone(GO:0032570) |
0.0 | 0.1 | GO:0045925 | positive regulation of female receptivity(GO:0045925) |
0.0 | 0.2 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
0.0 | 0.1 | GO:0030538 | embryonic genitalia morphogenesis(GO:0030538) |
0.0 | 0.2 | GO:0044351 | macropinocytosis(GO:0044351) |
0.0 | 0.0 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
0.0 | 0.1 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
0.0 | 0.7 | GO:0090162 | establishment of epithelial cell polarity(GO:0090162) |
0.0 | 0.1 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
0.0 | 0.2 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
0.0 | 0.0 | GO:0060166 | olfactory pit development(GO:0060166) |
0.0 | 0.2 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
0.0 | 0.1 | GO:0090361 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
0.0 | 0.1 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
0.0 | 0.1 | GO:0045409 | negative regulation of interleukin-6 biosynthetic process(GO:0045409) |
0.0 | 0.1 | GO:2000121 | regulation of removal of superoxide radicals(GO:2000121) |
0.0 | 0.0 | GO:0030913 | paranodal junction assembly(GO:0030913) |
0.0 | 0.1 | GO:1902003 | regulation of beta-amyloid formation(GO:1902003) |
0.0 | 0.0 | GO:0019064 | fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
0.0 | 0.1 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
0.0 | 0.1 | GO:0031642 | negative regulation of myelination(GO:0031642) |
0.0 | 0.1 | GO:0060332 | positive regulation of response to interferon-gamma(GO:0060332) positive regulation of interferon-gamma-mediated signaling pathway(GO:0060335) |
0.0 | 0.2 | GO:0097264 | self proteolysis(GO:0097264) |
0.0 | 0.1 | GO:0021564 | vagus nerve development(GO:0021564) |
0.0 | 0.1 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
0.0 | 0.1 | GO:0003344 | pericardium morphogenesis(GO:0003344) |
0.0 | 0.1 | GO:1901836 | regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901836) positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
0.0 | 0.1 | GO:0018406 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
0.0 | 0.2 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
0.0 | 0.1 | GO:0002692 | negative regulation of cellular extravasation(GO:0002692) |
0.0 | 0.1 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
0.0 | 0.1 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
0.0 | 0.1 | GO:0045048 | protein insertion into ER membrane(GO:0045048) tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
0.0 | 0.1 | GO:0032696 | negative regulation of interleukin-13 production(GO:0032696) |
0.0 | 0.1 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
0.0 | 0.0 | GO:0098911 | regulation of ventricular cardiac muscle cell action potential(GO:0098911) |
0.0 | 0.3 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
0.0 | 0.1 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
0.0 | 0.2 | GO:0016056 | rhodopsin mediated signaling pathway(GO:0016056) |
0.0 | 0.1 | GO:0042663 | regulation of endodermal cell fate specification(GO:0042663) |
0.0 | 0.0 | GO:0002461 | tolerance induction dependent upon immune response(GO:0002461) |
0.0 | 0.2 | GO:1901621 | negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
0.0 | 0.4 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
0.0 | 0.3 | GO:0017014 | protein nitrosylation(GO:0017014) |
0.0 | 0.0 | GO:0010166 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
0.0 | 0.1 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
0.0 | 0.1 | GO:0016264 | gap junction assembly(GO:0016264) |
0.0 | 0.2 | GO:0060718 | chorionic trophoblast cell differentiation(GO:0060718) |
0.0 | 0.0 | GO:2000138 | regulation of cell proliferation involved in heart morphogenesis(GO:2000136) positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
0.0 | 0.0 | GO:1900368 | regulation of RNA interference(GO:1900368) |
0.0 | 0.0 | GO:1900425 | negative regulation of defense response to bacterium(GO:1900425) |
0.0 | 0.4 | GO:0008535 | respiratory chain complex IV assembly(GO:0008535) |
0.0 | 0.1 | GO:2000110 | negative regulation of macrophage apoptotic process(GO:2000110) |
0.0 | 0.2 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
0.0 | 0.2 | GO:0071361 | cellular response to ethanol(GO:0071361) |
0.0 | 0.1 | GO:0048014 | Tie signaling pathway(GO:0048014) |
0.0 | 0.2 | GO:1900264 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.0 | 0.1 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
0.0 | 0.1 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
0.0 | 0.3 | GO:0042754 | negative regulation of circadian rhythm(GO:0042754) |
0.0 | 0.4 | GO:0051601 | exocyst localization(GO:0051601) |
0.0 | 0.1 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) |
0.0 | 0.3 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
0.0 | 0.1 | GO:0009804 | coumarin metabolic process(GO:0009804) |
0.0 | 0.2 | GO:0033169 | histone H3-K9 demethylation(GO:0033169) |
0.0 | 0.2 | GO:0060068 | vagina development(GO:0060068) |
0.0 | 0.1 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
0.0 | 0.1 | GO:1900745 | positive regulation of p38MAPK cascade(GO:1900745) |
0.0 | 0.9 | GO:0006953 | acute-phase response(GO:0006953) |
0.0 | 0.1 | GO:0002309 | T cell proliferation involved in immune response(GO:0002309) |
0.0 | 0.1 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
0.0 | 0.1 | GO:0032278 | positive regulation of gonadotropin secretion(GO:0032278) |
0.0 | 0.1 | GO:0009177 | deoxyribonucleoside monophosphate biosynthetic process(GO:0009157) pyrimidine deoxyribonucleoside monophosphate biosynthetic process(GO:0009177) |
0.0 | 0.1 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.0 | 0.1 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.0 | 0.1 | GO:2001054 | negative regulation of mesenchymal cell apoptotic process(GO:2001054) |
0.0 | 0.3 | GO:0006586 | tryptophan metabolic process(GO:0006568) indolalkylamine metabolic process(GO:0006586) |
0.0 | 0.0 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
0.0 | 0.1 | GO:0007220 | Notch receptor processing(GO:0007220) |
0.0 | 0.2 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
0.0 | 0.2 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.0 | 0.2 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.0 | 0.1 | GO:0001969 | activation of membrane attack complex(GO:0001905) regulation of activation of membrane attack complex(GO:0001969) |
0.0 | 0.1 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
0.0 | 0.2 | GO:0021957 | corticospinal tract morphogenesis(GO:0021957) |
0.0 | 0.2 | GO:0006883 | cellular sodium ion homeostasis(GO:0006883) |
0.0 | 0.2 | GO:0021894 | cerebral cortex GABAergic interneuron development(GO:0021894) |
0.0 | 0.1 | GO:0070175 | positive regulation of enamel mineralization(GO:0070175) |
0.0 | 0.1 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
0.0 | 0.1 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
0.0 | 0.1 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
0.0 | 0.1 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.0 | 0.1 | GO:1904587 | glycoprotein ERAD pathway(GO:0097466) response to glycoprotein(GO:1904587) |
0.0 | 0.1 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
0.0 | 0.0 | GO:0016078 | tRNA catabolic process(GO:0016078) |
0.0 | 0.2 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
0.0 | 0.1 | GO:0032607 | interferon-alpha production(GO:0032607) |
0.0 | 0.3 | GO:0006622 | protein targeting to lysosome(GO:0006622) |
0.0 | 0.1 | GO:0006600 | creatine metabolic process(GO:0006600) |
0.0 | 0.1 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
0.0 | 0.2 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.0 | 0.1 | GO:0036514 | dopaminergic neuron axon guidance(GO:0036514) planar cell polarity pathway involved in axon guidance(GO:1904938) |
0.0 | 0.1 | GO:0031086 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.0 | 0.1 | GO:0072257 | metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
0.0 | 0.1 | GO:0098763 | mitotic cell cycle phase(GO:0098763) |
0.0 | 0.2 | GO:0006108 | malate metabolic process(GO:0006108) |
0.0 | 0.2 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
0.0 | 0.6 | GO:0010107 | potassium ion import(GO:0010107) |
0.0 | 0.1 | GO:0035927 | RNA import into mitochondrion(GO:0035927) |
0.0 | 0.0 | GO:1900084 | regulation of peptidyl-tyrosine autophosphorylation(GO:1900084) positive regulation of peptidyl-tyrosine autophosphorylation(GO:1900086) |
0.0 | 0.1 | GO:0051790 | short-chain fatty acid biosynthetic process(GO:0051790) |
0.0 | 0.1 | GO:0048294 | negative regulation of isotype switching to IgE isotypes(GO:0048294) |
0.0 | 0.1 | GO:0086015 | SA node cell action potential(GO:0086015) SA node cell to atrial cardiac muscle cell signalling(GO:0086018) SA node cell to atrial cardiac muscle cell communication(GO:0086070) |
0.0 | 0.2 | GO:0070970 | interleukin-2 secretion(GO:0070970) |
0.0 | 0.3 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
0.0 | 0.1 | GO:0051103 | DNA ligation involved in DNA repair(GO:0051103) |
0.0 | 0.0 | GO:0065001 | specification of axis polarity(GO:0065001) |
0.0 | 0.0 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
0.0 | 0.1 | GO:0019388 | galactose catabolic process(GO:0019388) |
0.0 | 0.1 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
0.0 | 0.0 | GO:0097066 | response to thyroid hormone(GO:0097066) |
0.0 | 0.0 | GO:2000359 | regulation of binding of sperm to zona pellucida(GO:2000359) |
0.0 | 0.1 | GO:0006290 | pyrimidine dimer repair(GO:0006290) |
0.0 | 0.1 | GO:0048563 | post-embryonic organ morphogenesis(GO:0048563) |
0.0 | 0.0 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
0.0 | 0.1 | GO:2000327 | regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
0.0 | 0.1 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
0.0 | 0.1 | GO:1903798 | regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903798) |
0.0 | 0.0 | GO:1904995 | negative regulation of leukocyte adhesion to vascular endothelial cell(GO:1904995) |
0.0 | 0.1 | GO:0002091 | negative regulation of receptor internalization(GO:0002091) |
0.0 | 0.1 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
0.0 | 0.2 | GO:0006032 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
0.0 | 0.1 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
0.0 | 0.0 | GO:2001025 | positive regulation of response to drug(GO:2001025) |
0.0 | 0.1 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
0.0 | 0.1 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
0.0 | 0.1 | GO:0045636 | positive regulation of melanocyte differentiation(GO:0045636) |
0.0 | 0.3 | GO:0043206 | extracellular fibril organization(GO:0043206) |
0.0 | 0.0 | GO:1901228 | positive regulation of transcription from RNA polymerase II promoter involved in heart development(GO:1901228) |
0.0 | 0.2 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
0.0 | 0.7 | GO:0007339 | binding of sperm to zona pellucida(GO:0007339) |
0.0 | 0.1 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.0 | 0.1 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
0.0 | 0.0 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
0.0 | 0.1 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
0.0 | 0.3 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
0.0 | 0.1 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
0.0 | 0.2 | GO:0061050 | regulation of cell growth involved in cardiac muscle cell development(GO:0061050) |
0.0 | 0.1 | GO:0009191 | ribonucleoside diphosphate catabolic process(GO:0009191) |
0.0 | 0.1 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
0.0 | 0.1 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
0.0 | 0.1 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
0.0 | 0.0 | GO:0061626 | pharyngeal arch artery morphogenesis(GO:0061626) |
0.0 | 0.2 | GO:0009250 | glycogen biosynthetic process(GO:0005978) glucan biosynthetic process(GO:0009250) |
0.0 | 0.2 | GO:0071243 | cellular response to arsenic-containing substance(GO:0071243) |
0.0 | 0.0 | GO:0044340 | canonical Wnt signaling pathway involved in regulation of cell proliferation(GO:0044340) |
0.0 | 0.1 | GO:2000354 | regulation of ovarian follicle development(GO:2000354) |
0.0 | 0.3 | GO:0032968 | positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
0.0 | 0.0 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
0.0 | 0.0 | GO:0071493 | cellular response to UV-B(GO:0071493) |
0.0 | 0.0 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
0.0 | 0.1 | GO:0002278 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil degranulation(GO:0043308) |
0.0 | 0.0 | GO:0002074 | extraocular skeletal muscle development(GO:0002074) |
0.0 | 0.0 | GO:0070189 | kynurenine metabolic process(GO:0070189) |
0.0 | 0.2 | GO:0030539 | male genitalia development(GO:0030539) |
0.0 | 0.0 | GO:0045080 | positive regulation of chemokine biosynthetic process(GO:0045080) |
0.0 | 0.1 | GO:0099558 | maintenance of synapse structure(GO:0099558) |
0.0 | 0.2 | GO:0070269 | pyroptosis(GO:0070269) |
0.0 | 0.0 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
0.0 | 0.0 | GO:0035106 | operant conditioning(GO:0035106) |
0.0 | 0.1 | GO:0030070 | insulin processing(GO:0030070) |
0.0 | 0.1 | GO:0097120 | receptor localization to synapse(GO:0097120) |
0.0 | 0.2 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
0.0 | 0.0 | GO:0035166 | post-embryonic hemopoiesis(GO:0035166) |
0.0 | 0.0 | GO:0016479 | negative regulation of transcription from RNA polymerase I promoter(GO:0016479) |
0.0 | 0.2 | GO:0043011 | myeloid dendritic cell differentiation(GO:0043011) |
0.0 | 0.2 | GO:0009435 | NAD biosynthetic process(GO:0009435) |
0.0 | 0.0 | GO:0090030 | regulation of steroid hormone biosynthetic process(GO:0090030) |
0.0 | 0.0 | GO:1903275 | positive regulation of sodium ion export(GO:1903275) positive regulation of sodium ion export from cell(GO:1903278) |
0.0 | 0.1 | GO:0045136 | development of secondary sexual characteristics(GO:0045136) |
0.0 | 0.0 | GO:1900221 | regulation of beta-amyloid clearance(GO:1900221) |
0.0 | 0.1 | GO:0006548 | histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
0.0 | 0.0 | GO:0002525 | acute inflammatory response to non-antigenic stimulus(GO:0002525) |
0.0 | 0.4 | GO:0007130 | synaptonemal complex assembly(GO:0007130) |
0.0 | 0.1 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
0.0 | 0.1 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
0.0 | 0.1 | GO:0002326 | B cell lineage commitment(GO:0002326) |
0.0 | 0.1 | GO:0071318 | cellular response to ATP(GO:0071318) |
0.0 | 0.1 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
0.0 | 0.1 | GO:0042891 | antibiotic transport(GO:0042891) |
0.0 | 0.2 | GO:0046174 | polyol catabolic process(GO:0046174) |
0.0 | 0.1 | GO:0008291 | acetylcholine metabolic process(GO:0008291) acetate ester metabolic process(GO:1900619) |
0.0 | 0.0 | GO:0046959 | habituation(GO:0046959) |
0.0 | 0.1 | GO:0000957 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
0.0 | 0.1 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.0 | 0.1 | GO:0060613 | fat pad development(GO:0060613) |
0.0 | 0.1 | GO:0060023 | soft palate development(GO:0060023) |
0.0 | 0.1 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
0.0 | 0.0 | GO:0070294 | renal sodium ion transport(GO:0003096) renal sodium ion absorption(GO:0070294) |
0.0 | 0.1 | GO:0019695 | choline metabolic process(GO:0019695) |
0.0 | 0.4 | GO:0030574 | collagen catabolic process(GO:0030574) |
0.0 | 0.0 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) negative regulation of establishment of protein localization to mitochondrion(GO:1903748) |
0.0 | 0.0 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
0.0 | 0.1 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
0.0 | 0.3 | GO:0006144 | purine nucleobase metabolic process(GO:0006144) |
0.0 | 0.1 | GO:1903061 | positive regulation of protein lipidation(GO:1903061) |
0.0 | 0.1 | GO:0071651 | positive regulation of chemokine (C-C motif) ligand 5 production(GO:0071651) |
0.0 | 0.1 | GO:0042270 | protection from natural killer cell mediated cytotoxicity(GO:0042270) |
0.0 | 0.0 | GO:1900113 | negative regulation of histone H3-K9 trimethylation(GO:1900113) |
0.0 | 0.1 | GO:0061620 | glycolytic process through glucose-6-phosphate(GO:0061620) |
0.0 | 0.1 | GO:0007296 | vitellogenesis(GO:0007296) |
0.0 | 0.1 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
0.0 | 0.0 | GO:0002913 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
0.0 | 0.1 | GO:0042136 | neurotransmitter biosynthetic process(GO:0042136) |
0.0 | 0.1 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
0.0 | 0.1 | GO:0019614 | catechol-containing compound catabolic process(GO:0019614) catecholamine catabolic process(GO:0042424) |
0.0 | 0.0 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
0.0 | 0.1 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
0.0 | 0.1 | GO:0035729 | response to hepatocyte growth factor(GO:0035728) cellular response to hepatocyte growth factor stimulus(GO:0035729) |
0.0 | 0.0 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
0.0 | 0.2 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
0.0 | 0.0 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
0.0 | 0.0 | GO:0051771 | negative regulation of nitric-oxide synthase biosynthetic process(GO:0051771) |
0.0 | 0.1 | GO:0014832 | urinary bladder smooth muscle contraction(GO:0014832) |
0.0 | 0.0 | GO:0015819 | lysine transport(GO:0015819) |
0.0 | 0.0 | GO:0002767 | immune response-inhibiting cell surface receptor signaling pathway(GO:0002767) |
0.0 | 0.0 | GO:0002439 | chronic inflammatory response to antigenic stimulus(GO:0002439) |
0.0 | 0.0 | GO:0060426 | lung vasculature development(GO:0060426) |
0.0 | 0.1 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
0.0 | 0.0 | GO:2000196 | positive regulation of female gonad development(GO:2000196) |
0.0 | 0.0 | GO:0001951 | intestinal D-glucose absorption(GO:0001951) |
0.0 | 0.0 | GO:1903121 | regulation of TRAIL-activated apoptotic signaling pathway(GO:1903121) positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
0.0 | 0.5 | GO:0016445 | somatic diversification of immunoglobulins(GO:0016445) |
0.0 | 0.0 | GO:0070141 | response to UV-A(GO:0070141) |
0.0 | 0.0 | GO:0070874 | negative regulation of glycogen metabolic process(GO:0070874) |
0.0 | 0.1 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
0.0 | 0.1 | GO:0090206 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
0.0 | 0.2 | GO:0009081 | branched-chain amino acid metabolic process(GO:0009081) |
0.0 | 0.1 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
0.0 | 0.1 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
0.0 | 0.4 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
0.0 | 0.0 | GO:0002925 | positive regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002925) |
0.0 | 0.1 | GO:0010640 | regulation of platelet-derived growth factor receptor signaling pathway(GO:0010640) |
0.0 | 0.1 | GO:0034398 | telomere tethering at nuclear periphery(GO:0034398) |
0.0 | 0.2 | GO:0032986 | nucleosome disassembly(GO:0006337) chromatin disassembly(GO:0031498) protein-DNA complex disassembly(GO:0032986) |
0.0 | 0.1 | GO:0098728 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
0.0 | 0.0 | GO:0097477 | lateral motor column neuron migration(GO:0097477) |
0.0 | 0.2 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
0.0 | 0.1 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
0.0 | 0.1 | GO:0070417 | cellular response to cold(GO:0070417) |
0.0 | 0.1 | GO:0060789 | hair follicle placode formation(GO:0060789) |
0.0 | 0.1 | GO:0032148 | activation of protein kinase B activity(GO:0032148) |
0.0 | 0.1 | GO:0035994 | response to muscle stretch(GO:0035994) |
0.0 | 0.1 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
0.0 | 0.0 | GO:0034395 | regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
0.0 | 0.1 | GO:0045906 | negative regulation of vasoconstriction(GO:0045906) |
0.0 | 0.1 | GO:0032700 | negative regulation of interleukin-17 production(GO:0032700) |
0.0 | 0.1 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
0.0 | 0.1 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.0 | 0.0 | GO:0009757 | carbohydrate mediated signaling(GO:0009756) hexose mediated signaling(GO:0009757) sugar mediated signaling pathway(GO:0010182) glucose mediated signaling pathway(GO:0010255) |
0.0 | 0.1 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
0.0 | 0.0 | GO:2000586 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
0.0 | 0.0 | GO:0001907 | killing by symbiont of host cells(GO:0001907) disruption by symbiont of host cell(GO:0044004) |
0.0 | 0.0 | GO:0045897 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
0.0 | 0.1 | GO:0042953 | lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
0.0 | 0.0 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
0.0 | 0.0 | GO:1902513 | regulation of organelle transport along microtubule(GO:1902513) |
0.0 | 0.1 | GO:0018231 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
0.0 | 0.0 | GO:2000508 | regulation of dendritic cell chemotaxis(GO:2000508) positive regulation of dendritic cell chemotaxis(GO:2000510) |
0.0 | 0.1 | GO:0043562 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
0.0 | 0.1 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
0.0 | 0.1 | GO:0051013 | microtubule severing(GO:0051013) |
0.0 | 0.0 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
0.0 | 0.0 | GO:0006083 | acetate metabolic process(GO:0006083) |
0.0 | 0.0 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
0.0 | 0.1 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
0.0 | 0.0 | GO:0048319 | axial mesoderm morphogenesis(GO:0048319) |
0.0 | 0.0 | GO:1903140 | regulation of endothelial cell development(GO:1901550) regulation of establishment of endothelial barrier(GO:1903140) |
0.0 | 0.0 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.0 | 0.1 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
0.0 | 0.1 | GO:2000505 | regulation of energy homeostasis(GO:2000505) |
0.0 | 0.0 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
0.0 | 0.0 | GO:2000192 | negative regulation of fatty acid transport(GO:2000192) |
0.0 | 0.1 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.0 | 0.0 | GO:0043217 | myelin maintenance(GO:0043217) |
0.0 | 0.1 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
0.0 | 0.1 | GO:0010668 | ectodermal cell differentiation(GO:0010668) |
0.0 | 0.4 | GO:0035019 | somatic stem cell population maintenance(GO:0035019) |
0.0 | 0.2 | GO:0003334 | keratinocyte development(GO:0003334) |
0.0 | 0.1 | GO:0010960 | magnesium ion homeostasis(GO:0010960) |
0.0 | 0.1 | GO:0034472 | snRNA 3'-end processing(GO:0034472) |
0.0 | 0.0 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
0.0 | 0.0 | GO:0002328 | pro-B cell differentiation(GO:0002328) |
0.0 | 0.1 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.0 | 0.0 | GO:1904469 | positive regulation of tumor necrosis factor secretion(GO:1904469) |
0.0 | 0.0 | GO:0003383 | apical constriction(GO:0003383) |
0.0 | 0.0 | GO:1903818 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
0.0 | 0.0 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
0.0 | 0.1 | GO:0061000 | negative regulation of dendritic spine development(GO:0061000) |
0.0 | 0.1 | GO:0043586 | tongue development(GO:0043586) |
0.0 | 0.1 | GO:0090399 | replicative senescence(GO:0090399) |
0.0 | 0.1 | GO:0043312 | neutrophil degranulation(GO:0043312) |
0.0 | 0.0 | GO:0030908 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
0.0 | 0.0 | GO:0002930 | trabecular meshwork development(GO:0002930) |
0.0 | 0.0 | GO:0003330 | regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
0.0 | 0.0 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
0.0 | 0.1 | GO:0001842 | neural fold formation(GO:0001842) |
0.0 | 0.0 | GO:0071033 | nuclear retention of pre-mRNA at the site of transcription(GO:0071033) |
0.0 | 0.0 | GO:0097070 | ductus arteriosus closure(GO:0097070) |
0.0 | 0.2 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
0.0 | 0.0 | GO:0021559 | trigeminal nerve development(GO:0021559) |
0.0 | 0.0 | GO:0060433 | bronchus development(GO:0060433) |
0.0 | 0.0 | GO:1990168 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
0.0 | 0.1 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
0.0 | 0.2 | GO:0046688 | response to copper ion(GO:0046688) |
0.0 | 0.0 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
0.0 | 0.0 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
0.0 | 0.2 | GO:0048246 | macrophage chemotaxis(GO:0048246) |
0.0 | 0.1 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.0 | 0.1 | GO:0071340 | skeletal muscle acetylcholine-gated channel clustering(GO:0071340) |
0.0 | 0.0 | GO:0006772 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.1 | GO:0042482 | positive regulation of odontogenesis(GO:0042482) |
0.0 | 0.1 | GO:1903504 | regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090266) regulation of mitotic spindle checkpoint(GO:1903504) |
0.0 | 0.1 | GO:0036159 | inner dynein arm assembly(GO:0036159) |
0.0 | 0.1 | GO:0006705 | mineralocorticoid biosynthetic process(GO:0006705) mineralocorticoid metabolic process(GO:0008212) |
0.0 | 0.0 | GO:0090290 | positive regulation of osteoclast proliferation(GO:0090290) |
0.0 | 0.2 | GO:0031365 | N-terminal protein amino acid modification(GO:0031365) |
0.0 | 0.0 | GO:0045654 | positive regulation of megakaryocyte differentiation(GO:0045654) |
0.0 | 0.1 | GO:0006308 | DNA catabolic process(GO:0006308) |
0.0 | 0.0 | GO:2000909 | regulation of cholesterol import(GO:0060620) regulation of sterol import(GO:2000909) |
0.0 | 0.0 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
0.0 | 0.1 | GO:0061098 | positive regulation of protein tyrosine kinase activity(GO:0061098) |
0.0 | 0.0 | GO:0002741 | positive regulation of cytokine secretion involved in immune response(GO:0002741) |
0.0 | 0.0 | GO:0072318 | clathrin coat disassembly(GO:0072318) |
0.0 | 0.1 | GO:0045908 | negative regulation of vasodilation(GO:0045908) |
0.0 | 0.0 | GO:0043504 | mitochondrial DNA repair(GO:0043504) |
0.0 | 0.1 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
0.0 | 0.2 | GO:0017144 | drug metabolic process(GO:0017144) |
0.0 | 0.1 | GO:0060346 | bone trabecula formation(GO:0060346) |
0.0 | 0.1 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
0.0 | 0.0 | GO:0035995 | detection of muscle stretch(GO:0035995) |
0.0 | 0.1 | GO:0002922 | positive regulation of humoral immune response(GO:0002922) |
0.0 | 0.1 | GO:0016926 | protein desumoylation(GO:0016926) |
0.0 | 0.0 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
0.0 | 0.0 | GO:0015888 | thiamine transport(GO:0015888) |
0.0 | 0.1 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
0.0 | 0.1 | GO:0032288 | myelin assembly(GO:0032288) |
0.0 | 0.1 | GO:1904659 | glucose transmembrane transport(GO:1904659) |
0.0 | 0.2 | GO:0030866 | cortical actin cytoskeleton organization(GO:0030866) |
0.0 | 0.0 | GO:0035356 | cellular triglyceride homeostasis(GO:0035356) |
0.0 | 0.1 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
0.0 | 0.1 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
0.0 | 0.3 | GO:0042755 | eating behavior(GO:0042755) |
0.0 | 0.0 | GO:0061083 | regulation of protein refolding(GO:0061083) negative regulation of protein refolding(GO:0061084) |
0.0 | 0.1 | GO:0070445 | oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
0.0 | 0.1 | GO:0002098 | tRNA wobble uridine modification(GO:0002098) |
0.0 | 0.3 | GO:0022904 | respiratory electron transport chain(GO:0022904) |
0.0 | 0.0 | GO:0090230 | regulation of centromere complex assembly(GO:0090230) |
0.0 | 0.0 | GO:0034241 | positive regulation of macrophage fusion(GO:0034241) |
0.0 | 0.1 | GO:0007135 | meiosis II(GO:0007135) |
0.0 | 0.1 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
0.0 | 0.1 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
0.0 | 0.0 | GO:0060591 | chondroblast differentiation(GO:0060591) |
0.0 | 0.1 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
0.0 | 0.1 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
0.0 | 0.1 | GO:0008105 | asymmetric protein localization(GO:0008105) |
0.0 | 0.2 | GO:0001702 | gastrulation with mouth forming second(GO:0001702) |
0.0 | 0.0 | GO:0070814 | hydrogen sulfide biosynthetic process(GO:0070814) |
0.0 | 0.0 | GO:0002536 | respiratory burst involved in inflammatory response(GO:0002536) |
0.0 | 0.0 | GO:2000035 | regulation of stem cell division(GO:2000035) |
0.0 | 0.0 | GO:0002086 | diaphragm contraction(GO:0002086) involuntary skeletal muscle contraction(GO:0003011) |
0.0 | 0.1 | GO:0006273 | lagging strand elongation(GO:0006273) |
0.0 | 0.1 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
0.0 | 0.0 | GO:0046628 | positive regulation of insulin receptor signaling pathway(GO:0046628) |
0.0 | 0.0 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
0.0 | 0.0 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
0.0 | 0.1 | GO:0030575 | nuclear body organization(GO:0030575) |
0.0 | 0.0 | GO:0072075 | metanephric mesenchyme development(GO:0072075) |
0.0 | 0.0 | GO:0032713 | negative regulation of interleukin-4 production(GO:0032713) |
0.0 | 0.0 | GO:0033058 | directional locomotion(GO:0033058) |
0.0 | 0.0 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
0.0 | 0.1 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
0.0 | 0.0 | GO:0014827 | intestine smooth muscle contraction(GO:0014827) |
0.0 | 0.0 | GO:0060672 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
0.0 | 0.0 | GO:0051712 | positive regulation of killing of cells of other organism(GO:0051712) |
0.0 | 0.0 | GO:0045634 | regulation of melanocyte differentiation(GO:0045634) |
0.0 | 0.0 | GO:0014741 | negative regulation of cardiac muscle hypertrophy(GO:0010614) negative regulation of muscle hypertrophy(GO:0014741) |
0.0 | 0.0 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
0.0 | 0.0 | GO:0002125 | maternal aggressive behavior(GO:0002125) |
0.0 | 0.0 | GO:0072718 | response to cisplatin(GO:0072718) |
0.0 | 0.0 | GO:0032466 | negative regulation of cytokinesis(GO:0032466) |
0.0 | 0.1 | GO:1990118 | sodium ion import(GO:0097369) sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
0.0 | 0.0 | GO:0040031 | snRNA modification(GO:0040031) |
0.0 | 0.0 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
0.0 | 0.0 | GO:0032328 | alanine transport(GO:0032328) |
0.0 | 0.0 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
0.0 | 0.0 | GO:0060161 | positive regulation of dopamine receptor signaling pathway(GO:0060161) |
0.0 | 0.1 | GO:0000272 | polysaccharide catabolic process(GO:0000272) |
0.0 | 0.0 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
0.0 | 0.1 | GO:0061298 | retina vasculature development in camera-type eye(GO:0061298) |
0.0 | 0.0 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
0.0 | 0.0 | GO:0001807 | regulation of type IV hypersensitivity(GO:0001807) |
0.0 | 0.0 | GO:0038033 | positive regulation of endothelial cell chemotaxis by VEGF-activated vascular endothelial growth factor receptor signaling pathway(GO:0038033) |
0.0 | 0.1 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
0.0 | 0.1 | GO:0022011 | myelination in peripheral nervous system(GO:0022011) peripheral nervous system axon ensheathment(GO:0032292) |
0.0 | 0.8 | GO:0008643 | carbohydrate transport(GO:0008643) |
0.0 | 0.0 | GO:0060334 | regulation of interferon-gamma-mediated signaling pathway(GO:0060334) |
0.0 | 0.1 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
0.0 | 0.0 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
0.0 | 0.0 | GO:0098903 | regulation of membrane repolarization during action potential(GO:0098903) |
0.0 | 0.0 | GO:1903012 | positive regulation of bone development(GO:1903012) |
0.0 | 0.0 | GO:2000671 | regulation of motor neuron apoptotic process(GO:2000671) |
0.0 | 0.1 | GO:0002335 | mature B cell differentiation(GO:0002335) |
0.0 | 0.0 | GO:0002159 | desmosome assembly(GO:0002159) |
0.0 | 0.0 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
0.0 | 0.0 | GO:0038031 | non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
0.0 | 0.0 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
0.0 | 0.1 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
0.0 | 0.0 | GO:1900094 | nodal signaling pathway involved in determination of left/right asymmetry(GO:0038107) regulation of transcription from RNA polymerase II promoter involved in determination of left/right symmetry(GO:1900094) nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900164) |
0.0 | 0.0 | GO:0001698 | gastrin-induced gastric acid secretion(GO:0001698) |
0.0 | 0.0 | GO:0002540 | leukotriene production involved in inflammatory response(GO:0002540) |
0.0 | 0.0 | GO:0015886 | heme transport(GO:0015886) |
0.0 | 0.1 | GO:0090201 | negative regulation of release of cytochrome c from mitochondria(GO:0090201) |
0.0 | 0.1 | GO:0008090 | retrograde axonal transport(GO:0008090) |
0.0 | 0.0 | GO:0070827 | chromatin maintenance(GO:0070827) |
0.0 | 0.0 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
0.0 | 0.0 | GO:0009130 | pyrimidine nucleoside monophosphate biosynthetic process(GO:0009130) |
0.0 | 0.0 | GO:0031448 | regulation of fast-twitch skeletal muscle fiber contraction(GO:0031446) positive regulation of fast-twitch skeletal muscle fiber contraction(GO:0031448) |
0.0 | 0.1 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
0.0 | 0.0 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
0.0 | 0.1 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
0.0 | 0.0 | GO:0034982 | mitochondrial protein processing(GO:0034982) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.9 | 2.6 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.2 | 2.2 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.2 | 2.2 | GO:0098533 | ATPase dependent transmembrane transport complex(GO:0098533) |
0.2 | 0.5 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
0.2 | 0.7 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.2 | 0.5 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.2 | 0.9 | GO:0002139 | stereocilia coupling link(GO:0002139) |
0.1 | 0.4 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
0.1 | 0.6 | GO:0044294 | dendritic growth cone(GO:0044294) |
0.1 | 0.4 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.1 | 0.3 | GO:0097427 | microtubule bundle(GO:0097427) |
0.1 | 0.5 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.1 | 1.1 | GO:0031512 | motile primary cilium(GO:0031512) |
0.1 | 0.7 | GO:0001650 | fibrillar center(GO:0001650) |
0.1 | 0.2 | GO:1990635 | proximal dendrite(GO:1990635) |
0.1 | 0.3 | GO:0031298 | replication fork protection complex(GO:0031298) |
0.1 | 0.6 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.1 | 0.4 | GO:0045261 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
0.1 | 0.4 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
0.1 | 0.1 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
0.1 | 0.8 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
0.1 | 0.3 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.1 | 0.1 | GO:0000125 | PCAF complex(GO:0000125) |
0.1 | 0.2 | GO:0061574 | ASAP complex(GO:0061574) |
0.1 | 0.2 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
0.1 | 0.2 | GO:0097443 | sorting endosome(GO:0097443) |
0.1 | 0.4 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.1 | 0.6 | GO:0042405 | nuclear inclusion body(GO:0042405) |
0.1 | 0.6 | GO:0016600 | flotillin complex(GO:0016600) |
0.1 | 0.3 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
0.1 | 0.2 | GO:0048179 | activin receptor complex(GO:0048179) |
0.1 | 0.2 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.0 | 0.3 | GO:0000306 | extrinsic component of vacuolar membrane(GO:0000306) |
0.0 | 0.1 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
0.0 | 0.1 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.0 | 0.7 | GO:0000974 | Prp19 complex(GO:0000974) |
0.0 | 0.2 | GO:1990131 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.0 | 0.2 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
0.0 | 0.3 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.0 | 0.2 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
0.0 | 0.0 | GO:0005767 | secondary lysosome(GO:0005767) |
0.0 | 0.6 | GO:0071565 | nBAF complex(GO:0071565) |
0.0 | 0.2 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.0 | 0.6 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.0 | 0.2 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
0.0 | 0.2 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.0 | 0.1 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.0 | 0.2 | GO:0031415 | NatA complex(GO:0031415) |
0.0 | 0.4 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.0 | 0.2 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.0 | 0.8 | GO:0030057 | desmosome(GO:0030057) |
0.0 | 0.2 | GO:0005827 | polar microtubule(GO:0005827) |
0.0 | 0.1 | GO:0005712 | chiasma(GO:0005712) |
0.0 | 0.2 | GO:0005818 | aster(GO:0005818) |
0.0 | 0.2 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.0 | 0.1 | GO:0031094 | platelet dense tubular network(GO:0031094) |
0.0 | 0.1 | GO:0031417 | NatC complex(GO:0031417) |
0.0 | 0.2 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
0.0 | 0.2 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
0.0 | 0.1 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
0.0 | 0.1 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.0 | 0.2 | GO:0000801 | central element(GO:0000801) |
0.0 | 0.1 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.0 | 1.4 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.0 | 0.1 | GO:0031084 | BLOC-2 complex(GO:0031084) |
0.0 | 0.2 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
0.0 | 0.2 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.0 | 0.3 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
0.0 | 0.1 | GO:0032389 | MutLalpha complex(GO:0032389) |
0.0 | 0.3 | GO:0031143 | pseudopodium(GO:0031143) |
0.0 | 0.1 | GO:0030478 | actin cap(GO:0030478) |
0.0 | 0.2 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.0 | 0.1 | GO:0000322 | storage vacuole(GO:0000322) |
0.0 | 0.2 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.0 | 0.1 | GO:0070552 | BRISC complex(GO:0070552) |
0.0 | 0.1 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) |
0.0 | 0.1 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.0 | 1.2 | GO:0045335 | phagocytic vesicle(GO:0045335) |
0.0 | 0.1 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.0 | 0.1 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.0 | 0.1 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
0.0 | 0.4 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
0.0 | 0.2 | GO:0000812 | Swr1 complex(GO:0000812) |
0.0 | 0.2 | GO:0072557 | IPAF inflammasome complex(GO:0072557) |
0.0 | 0.2 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
0.0 | 0.3 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
0.0 | 0.1 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
0.0 | 0.1 | GO:0061617 | MICOS complex(GO:0061617) |
0.0 | 0.1 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
0.0 | 0.4 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.0 | 0.2 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
0.0 | 0.1 | GO:0070876 | SOSS complex(GO:0070876) |
0.0 | 0.2 | GO:0030285 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
0.0 | 0.0 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
0.0 | 0.0 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.0 | 0.3 | GO:0031229 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
0.0 | 0.1 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
0.0 | 0.1 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.0 | 0.3 | GO:0000800 | lateral element(GO:0000800) |
0.0 | 0.2 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.0 | 0.4 | GO:0097225 | sperm midpiece(GO:0097225) |
0.0 | 0.0 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
0.0 | 0.1 | GO:0043083 | synaptic cleft(GO:0043083) |
0.0 | 0.1 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
0.0 | 0.1 | GO:0044292 | dendrite terminus(GO:0044292) |
0.0 | 0.1 | GO:0045293 | mRNA editing complex(GO:0045293) |
0.0 | 0.1 | GO:0072534 | perineuronal net(GO:0072534) |
0.0 | 2.3 | GO:0031227 | intrinsic component of endoplasmic reticulum membrane(GO:0031227) |
0.0 | 0.3 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.0 | 0.1 | GO:0033269 | internode region of axon(GO:0033269) |
0.0 | 0.1 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
0.0 | 0.2 | GO:0033178 | proton-transporting two-sector ATPase complex, catalytic domain(GO:0033178) |
0.0 | 0.3 | GO:0031304 | intrinsic component of mitochondrial inner membrane(GO:0031304) |
0.0 | 0.1 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.0 | 0.3 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) |
0.0 | 0.3 | GO:0005614 | interstitial matrix(GO:0005614) |
0.0 | 0.1 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.0 | 0.1 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.0 | 0.2 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.0 | 0.3 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.0 | 0.1 | GO:0043202 | lysosomal lumen(GO:0043202) |
0.0 | 0.1 | GO:0032585 | multivesicular body membrane(GO:0032585) |
0.0 | 0.1 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
0.0 | 0.1 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
0.0 | 0.0 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
0.0 | 0.3 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
0.0 | 2.0 | GO:0044798 | nuclear transcription factor complex(GO:0044798) |
0.0 | 0.1 | GO:0000778 | condensed nuclear chromosome kinetochore(GO:0000778) |
0.0 | 0.1 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
0.0 | 0.1 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
0.0 | 0.1 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
0.0 | 1.1 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
0.0 | 0.2 | GO:0043205 | fibril(GO:0043205) |
0.0 | 1.0 | GO:0005901 | caveola(GO:0005901) |
0.0 | 0.1 | GO:0044393 | microspike(GO:0044393) |
0.0 | 0.1 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.0 | 0.1 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
0.0 | 0.8 | GO:0005871 | kinesin complex(GO:0005871) |
0.0 | 0.1 | GO:0097342 | ripoptosome(GO:0097342) |
0.0 | 0.1 | GO:0072487 | MSL complex(GO:0072487) |
0.0 | 0.3 | GO:0000145 | exocyst(GO:0000145) |
0.0 | 0.1 | GO:0032591 | dendritic spine membrane(GO:0032591) |
0.0 | 0.1 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.0 | 0.9 | GO:0001750 | photoreceptor outer segment(GO:0001750) |
0.0 | 0.1 | GO:0030681 | nucleolar ribonuclease P complex(GO:0005655) ribonuclease P complex(GO:0030677) multimeric ribonuclease P complex(GO:0030681) |
0.0 | 0.1 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.0 | 0.1 | GO:0060091 | kinocilium(GO:0060091) |
0.0 | 0.0 | GO:0005726 | perichromatin fibrils(GO:0005726) |
0.0 | 0.1 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
0.0 | 0.1 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
0.0 | 0.1 | GO:0044308 | axonal spine(GO:0044308) |
0.0 | 0.1 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
0.0 | 0.1 | GO:0042587 | glycogen granule(GO:0042587) |
0.0 | 0.0 | GO:0071203 | WASH complex(GO:0071203) |
0.0 | 0.0 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
0.0 | 0.1 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
0.0 | 0.2 | GO:0005583 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.0 | 0.2 | GO:0090545 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
0.0 | 0.1 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
0.0 | 0.0 | GO:0001651 | dense fibrillar component(GO:0001651) |
0.0 | 0.1 | GO:0031983 | vesicle lumen(GO:0031983) |
0.0 | 0.1 | GO:0098645 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
0.0 | 0.5 | GO:0031256 | leading edge membrane(GO:0031256) |
0.0 | 0.2 | GO:0042470 | melanosome(GO:0042470) pigment granule(GO:0048770) |
0.0 | 0.7 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
0.0 | 0.0 | GO:0032300 | mismatch repair complex(GO:0032300) |
0.0 | 0.1 | GO:0045179 | apical cortex(GO:0045179) |
0.0 | 0.1 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
0.0 | 0.0 | GO:0000439 | core TFIIH complex(GO:0000439) |
0.0 | 0.2 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
0.0 | 0.1 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.0 | 0.1 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.0 | 0.0 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
0.0 | 0.4 | GO:0016529 | sarcoplasmic reticulum(GO:0016529) |
0.0 | 1.2 | GO:0043197 | dendritic spine(GO:0043197) |
0.0 | 0.2 | GO:0031306 | intrinsic component of mitochondrial outer membrane(GO:0031306) |
0.0 | 1.4 | GO:0005777 | peroxisome(GO:0005777) microbody(GO:0042579) |
0.0 | 0.1 | GO:0031045 | dense core granule(GO:0031045) |
0.0 | 0.2 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
0.0 | 0.0 | GO:0020018 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
0.0 | 0.1 | GO:0002080 | acrosomal membrane(GO:0002080) |
0.0 | 1.1 | GO:0001726 | ruffle(GO:0001726) |
0.0 | 0.1 | GO:0031083 | BLOC-1 complex(GO:0031083) |
0.0 | 0.0 | GO:0055087 | Ski complex(GO:0055087) |
0.0 | 0.0 | GO:0044194 | cytolytic granule(GO:0044194) |
0.0 | 0.3 | GO:0005844 | polysome(GO:0005844) |
0.0 | 0.1 | GO:0012510 | trans-Golgi network transport vesicle membrane(GO:0012510) |
0.0 | 0.0 | GO:0030314 | junctional membrane complex(GO:0030314) |
0.0 | 0.0 | GO:0005955 | calcineurin complex(GO:0005955) |
0.0 | 1.1 | GO:0005882 | intermediate filament(GO:0005882) |
0.0 | 0.1 | GO:0032426 | stereocilium tip(GO:0032426) |
0.0 | 0.0 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.0 | 0.2 | GO:0032982 | myosin filament(GO:0032982) |
0.0 | 0.2 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
0.0 | 0.3 | GO:0016459 | myosin complex(GO:0016459) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.9 | 2.8 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
0.4 | 1.3 | GO:0070538 | oleic acid binding(GO:0070538) |
0.4 | 1.3 | GO:0061513 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
0.4 | 1.2 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
0.3 | 0.3 | GO:0034875 | oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
0.3 | 3.7 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
0.3 | 0.8 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
0.2 | 0.6 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.2 | 0.8 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.2 | 0.8 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
0.2 | 0.6 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
0.2 | 0.9 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
0.2 | 0.7 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
0.2 | 1.9 | GO:0019841 | retinol binding(GO:0019841) |
0.2 | 0.2 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
0.1 | 0.3 | GO:0035276 | ethanol binding(GO:0035276) |
0.1 | 0.6 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.1 | 0.1 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
0.1 | 1.4 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) |
0.1 | 0.6 | GO:0016212 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
0.1 | 0.3 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
0.1 | 1.0 | GO:0016889 | endodeoxyribonuclease activity, producing 3'-phosphomonoesters(GO:0016889) |
0.1 | 0.5 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.1 | 0.4 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
0.1 | 1.4 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
0.1 | 0.7 | GO:0042910 | xenobiotic transporter activity(GO:0042910) |
0.1 | 1.4 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.1 | 0.3 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
0.1 | 0.3 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.1 | 0.3 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
0.1 | 0.6 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
0.1 | 0.3 | GO:0019862 | IgA binding(GO:0019862) |
0.1 | 0.3 | GO:0015186 | L-asparagine transmembrane transporter activity(GO:0015182) L-glutamine transmembrane transporter activity(GO:0015186) |
0.1 | 0.4 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
0.1 | 0.3 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
0.1 | 0.4 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
0.1 | 0.8 | GO:0001164 | RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
0.1 | 0.4 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.1 | 0.5 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.1 | 0.3 | GO:0004103 | choline kinase activity(GO:0004103) |
0.1 | 1.1 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
0.1 | 0.1 | GO:0005290 | L-histidine transmembrane transporter activity(GO:0005290) |
0.1 | 0.3 | GO:0016015 | morphogen activity(GO:0016015) |
0.1 | 0.3 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
0.1 | 0.3 | GO:0003865 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) cholestenone 5-alpha-reductase activity(GO:0047751) |
0.1 | 0.3 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.1 | 0.3 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.1 | 0.4 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
0.1 | 0.1 | GO:0086007 | voltage-gated calcium channel activity involved in cardiac muscle cell action potential(GO:0086007) |
0.1 | 0.3 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.1 | 0.2 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.1 | 0.3 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
0.1 | 0.4 | GO:0030957 | Tat protein binding(GO:0030957) |
0.1 | 0.2 | GO:1990190 | peptide-serine-N-acetyltransferase activity(GO:1990189) peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
0.1 | 0.2 | GO:1990239 | steroid hormone binding(GO:1990239) |
0.1 | 0.4 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
0.1 | 0.4 | GO:0052760 | 4-methyloctanoyl-CoA dehydrogenase activity(GO:0034580) naphthyl-2-methyl-succinyl-CoA dehydrogenase activity(GO:0034845) 2-methylhexanoyl-CoA dehydrogenase activity(GO:0034916) propionyl-CoA dehydrogenase activity(GO:0043820) thiol-driven fumarate reductase activity(GO:0043830) coenzyme F420-dependent 2,4,6-trinitrophenol reductase activity(GO:0052758) coenzyme F420-dependent 2,4,6-trinitrophenol hydride reductase activity(GO:0052759) coenzyme F420-dependent 2,4-dinitrophenol reductase activity(GO:0052760) |
0.1 | 0.1 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
0.1 | 0.3 | GO:0030375 | thyroid hormone receptor coactivator activity(GO:0030375) |
0.1 | 0.2 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
0.1 | 0.2 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
0.1 | 0.2 | GO:0015143 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
0.1 | 0.1 | GO:0003896 | DNA primase activity(GO:0003896) |
0.1 | 0.3 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.1 | 0.3 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
0.1 | 0.3 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
0.1 | 1.2 | GO:0003785 | actin monomer binding(GO:0003785) |
0.1 | 0.6 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.1 | 0.3 | GO:0001642 | group III metabotropic glutamate receptor activity(GO:0001642) |
0.1 | 0.3 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
0.1 | 0.2 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.1 | 0.4 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
0.1 | 0.3 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
0.1 | 0.5 | GO:0002162 | dystroglycan binding(GO:0002162) |
0.1 | 0.1 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
0.1 | 0.3 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
0.1 | 1.0 | GO:0008143 | poly(A) binding(GO:0008143) |
0.1 | 0.4 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
0.1 | 0.5 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
0.1 | 0.2 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
0.1 | 0.1 | GO:0017099 | very-long-chain-acyl-CoA dehydrogenase activity(GO:0017099) |
0.1 | 0.8 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
0.1 | 0.1 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
0.1 | 0.2 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
0.1 | 0.3 | GO:0043237 | laminin-1 binding(GO:0043237) |
0.1 | 0.2 | GO:0001640 | adenylate cyclase inhibiting G-protein coupled glutamate receptor activity(GO:0001640) |
0.1 | 0.4 | GO:0034046 | poly(G) binding(GO:0034046) |
0.1 | 0.2 | GO:0043199 | sulfate binding(GO:0043199) |
0.1 | 0.2 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
0.1 | 0.4 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.1 | 0.2 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
0.1 | 0.2 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.1 | 0.4 | GO:0019966 | interleukin-1 binding(GO:0019966) |
0.1 | 0.2 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
0.0 | 0.4 | GO:0004779 | sulfate adenylyltransferase activity(GO:0004779) |
0.0 | 0.4 | GO:0033170 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.0 | 0.0 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
0.0 | 0.2 | GO:0004457 | lactate dehydrogenase activity(GO:0004457) |
0.0 | 0.6 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.0 | 0.1 | GO:0008390 | testosterone 16-alpha-hydroxylase activity(GO:0008390) |
0.0 | 0.2 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.0 | 0.4 | GO:0031559 | oxidosqualene cyclase activity(GO:0031559) |
0.0 | 0.0 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
0.0 | 0.1 | GO:0032190 | acrosin binding(GO:0032190) |
0.0 | 0.2 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
0.0 | 0.5 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.0 | 0.1 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.0 | 0.2 | GO:0047391 | alkylglycerophosphoethanolamine phosphodiesterase activity(GO:0047391) |
0.0 | 0.1 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
0.0 | 0.2 | GO:0008312 | 7S RNA binding(GO:0008312) |
0.0 | 0.0 | GO:0030284 | estrogen receptor activity(GO:0030284) |
0.0 | 0.2 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.0 | 0.3 | GO:0043559 | insulin binding(GO:0043559) |
0.0 | 0.4 | GO:0015194 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
0.0 | 0.1 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.0 | 0.3 | GO:0031419 | cobalamin binding(GO:0031419) |
0.0 | 0.2 | GO:0032135 | DNA insertion or deletion binding(GO:0032135) |
0.0 | 0.0 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.0 | 0.5 | GO:0044548 | S100 protein binding(GO:0044548) |
0.0 | 0.2 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.0 | 0.3 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
0.0 | 0.1 | GO:0048045 | 4-hydroxybenzoate octaprenyltransferase activity(GO:0008412) protoheme IX farnesyltransferase activity(GO:0008495) (S)-2,3-di-O-geranylgeranylglyceryl phosphate synthase activity(GO:0043888) cadaverine aminopropyltransferase activity(GO:0043918) agmatine aminopropyltransferase activity(GO:0043919) 1,4-dihydroxy-2-naphthoate octaprenyltransferase activity(GO:0046428) trans-pentaprenyltranstransferase activity(GO:0048045) ATP dimethylallyltransferase activity(GO:0052622) ADP dimethylallyltransferase activity(GO:0052623) |
0.0 | 0.2 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
0.0 | 0.1 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.0 | 0.2 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
0.0 | 0.5 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
0.0 | 0.2 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.0 | 0.4 | GO:0017127 | cholesterol transporter activity(GO:0017127) |
0.0 | 0.0 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) |
0.0 | 0.8 | GO:0030552 | cAMP binding(GO:0030552) |
0.0 | 0.2 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
0.0 | 0.0 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
0.0 | 0.2 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
0.0 | 0.1 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
0.0 | 0.1 | GO:0005148 | prolactin receptor binding(GO:0005148) |
0.0 | 0.2 | GO:0000405 | bubble DNA binding(GO:0000405) |
0.0 | 0.1 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.0 | 0.1 | GO:0070905 | serine binding(GO:0070905) |
0.0 | 0.7 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
0.0 | 0.3 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
0.0 | 0.1 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
0.0 | 0.5 | GO:0030228 | lipoprotein particle receptor activity(GO:0030228) |
0.0 | 0.1 | GO:0019959 | interleukin-8 binding(GO:0019959) |
0.0 | 0.3 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
0.0 | 0.3 | GO:0003993 | acid phosphatase activity(GO:0003993) |
0.0 | 0.1 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.0 | 0.1 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
0.0 | 0.1 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
0.0 | 0.9 | GO:0001540 | beta-amyloid binding(GO:0001540) |
0.0 | 0.2 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
0.0 | 0.2 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
0.0 | 0.2 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
0.0 | 1.2 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
0.0 | 0.1 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
0.0 | 1.6 | GO:0030971 | receptor tyrosine kinase binding(GO:0030971) |
0.0 | 0.3 | GO:0038191 | neuropilin binding(GO:0038191) |
0.0 | 0.5 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.0 | 0.1 | GO:0047105 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
0.0 | 0.4 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.0 | 0.2 | GO:0017002 | activin-activated receptor activity(GO:0017002) |
0.0 | 0.2 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.0 | 0.2 | GO:0003933 | GTP cyclohydrolase activity(GO:0003933) |
0.0 | 0.5 | GO:0005003 | ephrin receptor activity(GO:0005003) |
0.0 | 0.2 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.0 | 0.2 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
0.0 | 0.2 | GO:0003997 | acyl-CoA oxidase activity(GO:0003997) |
0.0 | 0.1 | GO:0071614 | linoleic acid epoxygenase activity(GO:0071614) |
0.0 | 0.1 | GO:0004946 | bombesin receptor activity(GO:0004946) |
0.0 | 0.2 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.0 | 0.4 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.0 | 0.6 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
0.0 | 0.3 | GO:0015386 | sodium:proton antiporter activity(GO:0015385) potassium:proton antiporter activity(GO:0015386) |
0.0 | 0.3 | GO:0070513 | death domain binding(GO:0070513) |
0.0 | 0.1 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
0.0 | 2.1 | GO:0015171 | amino acid transmembrane transporter activity(GO:0015171) |
0.0 | 3.0 | GO:0002020 | protease binding(GO:0002020) |
0.0 | 0.1 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
0.0 | 0.2 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
0.0 | 0.1 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
0.0 | 0.2 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
0.0 | 0.1 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
0.0 | 1.2 | GO:0008392 | arachidonic acid epoxygenase activity(GO:0008392) |
0.0 | 0.1 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
0.0 | 0.1 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
0.0 | 0.3 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
0.0 | 0.5 | GO:0003756 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
0.0 | 0.1 | GO:0019958 | C-X-C chemokine binding(GO:0019958) |
0.0 | 0.3 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.0 | 0.1 | GO:0042895 | antibiotic transporter activity(GO:0042895) |
0.0 | 0.3 | GO:0004016 | adenylate cyclase activity(GO:0004016) |
0.0 | 0.3 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
0.0 | 0.3 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.0 | 0.2 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
0.0 | 0.0 | GO:0050051 | leukotriene-B4 20-monooxygenase activity(GO:0050051) |
0.0 | 0.7 | GO:0015485 | cholesterol binding(GO:0015485) |
0.0 | 0.3 | GO:0010181 | FMN binding(GO:0010181) |
0.0 | 0.0 | GO:0004337 | geranyltranstransferase activity(GO:0004337) |
0.0 | 0.0 | GO:0051373 | FATZ binding(GO:0051373) |
0.0 | 0.2 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
0.0 | 0.5 | GO:0005158 | insulin receptor binding(GO:0005158) |
0.0 | 1.5 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
0.0 | 0.1 | GO:0090482 | vitamin transmembrane transporter activity(GO:0090482) |
0.0 | 0.2 | GO:0090079 | translation activator activity(GO:0008494) translation regulator activity, nucleic acid binding(GO:0090079) |
0.0 | 0.1 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.0 | 0.0 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
0.0 | 0.3 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
0.0 | 0.1 | GO:0000150 | recombinase activity(GO:0000150) |
0.0 | 0.5 | GO:0017025 | TBP-class protein binding(GO:0017025) |
0.0 | 0.0 | GO:0000403 | Y-form DNA binding(GO:0000403) |
0.0 | 0.1 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.0 | 0.0 | GO:0008297 | single-stranded DNA exodeoxyribonuclease activity(GO:0008297) |
0.0 | 0.1 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
0.0 | 0.1 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
0.0 | 0.0 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
0.0 | 0.0 | GO:0019237 | centromeric DNA binding(GO:0019237) |
0.0 | 0.2 | GO:0070492 | oligosaccharide binding(GO:0070492) |
0.0 | 0.2 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.0 | 0.1 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
0.0 | 0.2 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
0.0 | 0.4 | GO:0031434 | mitogen-activated protein kinase kinase binding(GO:0031434) |
0.0 | 0.0 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
0.0 | 0.0 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
0.0 | 0.7 | GO:0019107 | myristoyltransferase activity(GO:0019107) |
0.0 | 0.1 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
0.0 | 0.0 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
0.0 | 0.2 | GO:0034604 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
0.0 | 0.1 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
0.0 | 0.1 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
0.0 | 0.2 | GO:0001972 | retinoic acid binding(GO:0001972) |
0.0 | 0.2 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.0 | 0.2 | GO:0004568 | chitinase activity(GO:0004568) |
0.0 | 0.0 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
0.0 | 0.3 | GO:0005355 | glucose transmembrane transporter activity(GO:0005355) |
0.0 | 0.3 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
0.0 | 0.1 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
0.0 | 0.1 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.0 | 0.0 | GO:0055100 | adiponectin binding(GO:0055100) |
0.0 | 0.1 | GO:0016936 | galactoside binding(GO:0016936) |
0.0 | 0.2 | GO:0042301 | phosphate ion binding(GO:0042301) |
0.0 | 0.2 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
0.0 | 0.4 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
0.0 | 0.3 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
0.0 | 0.0 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
0.0 | 0.1 | GO:0043842 | Kdo transferase activity(GO:0043842) |
0.0 | 0.1 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.0 | 0.0 | GO:0035671 | enone reductase activity(GO:0035671) |
0.0 | 0.1 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
0.0 | 0.1 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.0 | 0.1 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
0.0 | 0.0 | GO:0051870 | methotrexate binding(GO:0051870) |
0.0 | 0.2 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
0.0 | 0.0 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
0.0 | 0.2 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
0.0 | 0.0 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
0.0 | 0.1 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
0.0 | 0.1 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.0 | 0.1 | GO:0036122 | BMP binding(GO:0036122) |
0.0 | 0.1 | GO:0015232 | heme transporter activity(GO:0015232) |
0.0 | 0.0 | GO:0008061 | chitin binding(GO:0008061) |
0.0 | 0.1 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
0.0 | 0.0 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.0 | 0.0 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
0.0 | 0.1 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
0.0 | 0.1 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.0 | 0.1 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
0.0 | 0.3 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
0.0 | 0.1 | GO:0003680 | AT DNA binding(GO:0003680) |
0.0 | 0.1 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.0 | 0.0 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
0.0 | 0.1 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
0.0 | 0.1 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
0.0 | 0.1 | GO:0031996 | thioesterase binding(GO:0031996) |
0.0 | 0.1 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
0.0 | 0.1 | GO:0016724 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.0 | 0.1 | GO:0004977 | melanocortin receptor activity(GO:0004977) |
0.0 | 0.1 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.0 | 0.3 | GO:0031489 | myosin V binding(GO:0031489) |
0.0 | 0.0 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
0.0 | 0.1 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
0.0 | 0.3 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
0.0 | 0.0 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.0 | 0.1 | GO:0043495 | protein anchor(GO:0043495) |
0.0 | 0.1 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.0 | 0.4 | GO:0001965 | G-protein alpha-subunit binding(GO:0001965) |
0.0 | 0.2 | GO:0030371 | translation repressor activity(GO:0030371) |
0.0 | 0.1 | GO:0031432 | titin binding(GO:0031432) |
0.0 | 0.4 | GO:0031369 | translation initiation factor binding(GO:0031369) |
0.0 | 0.1 | GO:0030955 | potassium ion binding(GO:0030955) |
0.0 | 0.1 | GO:0016623 | aldehyde oxidase activity(GO:0004031) oxidoreductase activity, acting on the aldehyde or oxo group of donors, oxygen as acceptor(GO:0016623) |
0.0 | 0.4 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
0.0 | 0.0 | GO:0070840 | dynein complex binding(GO:0070840) |
0.0 | 0.1 | GO:0048019 | receptor antagonist activity(GO:0048019) |
0.0 | 0.1 | GO:0031014 | troponin T binding(GO:0031014) |
0.0 | 0.3 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
0.0 | 0.7 | GO:0005080 | protein kinase C binding(GO:0005080) |
0.0 | 0.1 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.0 | 0.2 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
0.0 | 0.1 | GO:0008020 | G-protein coupled photoreceptor activity(GO:0008020) |
0.0 | 0.2 | GO:0004112 | cyclic-nucleotide phosphodiesterase activity(GO:0004112) |
0.0 | 0.2 | GO:0016646 | oxidoreductase activity, acting on the CH-NH group of donors, NAD or NADP as acceptor(GO:0016646) |
0.0 | 0.1 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.0 | 0.3 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
0.0 | 0.0 | GO:0016894 | endonuclease activity, active with either ribo- or deoxyribonucleic acids and producing 3'-phosphomonoesters(GO:0016894) |
0.0 | 0.1 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.0 | 0.0 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
0.0 | 0.1 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
0.0 | 0.0 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.0 | 0.0 | GO:0017116 | single-stranded DNA-dependent ATP-dependent DNA helicase activity(GO:0017116) |
0.0 | 0.1 | GO:0050815 | phosphoserine binding(GO:0050815) |
0.0 | 0.0 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
0.0 | 0.2 | GO:0005031 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
0.0 | 0.1 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
0.0 | 0.2 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.0 | 0.0 | GO:0030345 | extracellular matrix structural constituent conferring compression resistance(GO:0030021) structural constituent of tooth enamel(GO:0030345) |
0.0 | 0.1 | GO:0070402 | NADPH binding(GO:0070402) |
0.0 | 0.1 | GO:0048495 | Roundabout binding(GO:0048495) |
0.0 | 0.4 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
0.0 | 0.3 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
0.0 | 0.1 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.0 | 0.0 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
0.0 | 0.1 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
0.0 | 0.1 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
0.0 | 0.1 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
0.0 | 0.0 | GO:0004515 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.0 | 0.0 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
0.0 | 0.1 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.0 | 2.1 | GO:0061630 | ubiquitin protein ligase activity(GO:0061630) |
0.0 | 0.1 | GO:0042609 | CD4 receptor binding(GO:0042609) |
0.0 | 0.1 | GO:0045182 | translation regulator activity(GO:0045182) |
0.0 | 0.4 | GO:0034930 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) heparan sulfate 2-O-sulfotransferase activity(GO:0004394) HNK-1 sulfotransferase activity(GO:0016232) heparan sulfate 6-O-sulfotransferase activity(GO:0017095) trans-9R,10R-dihydrodiolphenanthrene sulfotransferase activity(GO:0018721) 1-phenanthrol sulfotransferase activity(GO:0018722) 3-phenanthrol sulfotransferase activity(GO:0018723) 4-phenanthrol sulfotransferase activity(GO:0018724) trans-3,4-dihydrodiolphenanthrene sulfotransferase activity(GO:0018725) 9-phenanthrol sulfotransferase activity(GO:0018726) 2-phenanthrol sulfotransferase activity(GO:0018727) phenanthrol sulfotransferase activity(GO:0019111) 1-hydroxypyrene sulfotransferase activity(GO:0034930) proteoglycan sulfotransferase activity(GO:0050698) cholesterol sulfotransferase activity(GO:0051922) hydroxyjasmonate sulfotransferase activity(GO:0080131) |
0.0 | 0.1 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.0 | 0.0 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
0.0 | 0.2 | GO:0008413 | 8-oxo-7,8-dihydroguanosine triphosphate pyrophosphatase activity(GO:0008413) |
0.0 | 0.0 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
0.0 | 0.1 | GO:0005113 | patched binding(GO:0005113) |
0.0 | 0.0 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
0.0 | 0.1 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.0 | 0.4 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
0.0 | 0.0 | GO:0070051 | fibrinogen binding(GO:0070051) |
0.0 | 0.1 | GO:0043996 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
0.0 | 0.0 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.0 | 0.0 | GO:0001134 | transcription factor activity, transcription factor recruiting(GO:0001134) |
0.0 | 0.1 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.0 | 0.1 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
0.0 | 0.0 | GO:0008905 | mannose-phosphate guanylyltransferase activity(GO:0008905) |
0.0 | 0.0 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
0.0 | 0.1 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
0.0 | 0.4 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
0.0 | 0.0 | GO:0046978 | TAP1 binding(GO:0046978) TAP2 binding(GO:0046979) |
0.0 | 0.1 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
0.0 | 0.1 | GO:0042288 | MHC class I protein binding(GO:0042288) |
0.0 | 0.0 | GO:0004969 | histamine receptor activity(GO:0004969) |
0.0 | 0.1 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
0.0 | 0.1 | GO:1990405 | protein antigen binding(GO:1990405) |
0.0 | 0.0 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
0.0 | 0.0 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.0 | 0.1 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
0.0 | 0.1 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
0.0 | 0.3 | GO:0050840 | extracellular matrix binding(GO:0050840) |
0.0 | 0.1 | GO:0098505 | G-rich strand telomeric DNA binding(GO:0098505) |
0.0 | 0.5 | GO:0004860 | protein kinase inhibitor activity(GO:0004860) |
0.0 | 0.1 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
0.0 | 0.0 | GO:0004724 | magnesium-dependent protein serine/threonine phosphatase activity(GO:0004724) |
0.0 | 0.0 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 5.1 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
0.2 | 3.9 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.1 | 1.5 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.1 | 1.9 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.1 | 0.1 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.1 | 0.2 | ST GA12 PATHWAY | G alpha 12 Pathway |
0.1 | 0.5 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.1 | 3.0 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
0.1 | 0.6 | PID ALK2 PATHWAY | ALK2 signaling events |
0.0 | 0.1 | PID S1P S1P4 PATHWAY | S1P4 pathway |
0.0 | 0.8 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
0.0 | 0.3 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
0.0 | 0.5 | PID IL5 PATHWAY | IL5-mediated signaling events |
0.0 | 0.8 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.0 | 1.1 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
0.0 | 0.9 | PID IGF1 PATHWAY | IGF1 pathway |
0.0 | 0.2 | PID RHOA PATHWAY | RhoA signaling pathway |
0.0 | 1.3 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.0 | 1.0 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
0.0 | 0.5 | ST B CELL ANTIGEN RECEPTOR | B Cell Antigen Receptor |
0.0 | 0.7 | PID INSULIN PATHWAY | Insulin Pathway |
0.0 | 0.5 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.0 | 0.1 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.0 | 0.1 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
0.0 | 0.7 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.0 | 0.2 | PID REELIN PATHWAY | Reelin signaling pathway |
0.0 | 0.5 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
0.0 | 0.3 | PID S1P S1P2 PATHWAY | S1P2 pathway |
0.0 | 0.3 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
0.0 | 0.3 | PID IL3 PATHWAY | IL3-mediated signaling events |
0.0 | 0.7 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
0.0 | 0.4 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.0 | 1.1 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
0.0 | 0.3 | PID S1P S1P1 PATHWAY | S1P1 pathway |
0.0 | 0.3 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.0 | 0.7 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
0.0 | 0.6 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
0.0 | 1.3 | PID NOTCH PATHWAY | Notch signaling pathway |
0.0 | 0.1 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.0 | 0.6 | PID ATM PATHWAY | ATM pathway |
0.0 | 0.6 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.0 | 0.3 | PID FGF PATHWAY | FGF signaling pathway |
0.0 | 0.0 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.0 | 0.1 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
0.0 | 0.3 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
0.0 | 0.5 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
0.0 | 0.1 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.0 | 0.2 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
0.0 | 0.2 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
0.0 | 0.2 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.0 | 0.1 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.0 | 0.2 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.0 | 0.5 | PID P53 REGULATION PATHWAY | p53 pathway |
0.0 | 0.1 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
0.0 | 0.1 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.0 | 0.3 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
0.0 | 0.5 | PID PLK1 PATHWAY | PLK1 signaling events |
0.0 | 0.1 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.0 | 0.2 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
0.0 | 0.4 | PID LKB1 PATHWAY | LKB1 signaling events |
0.0 | 0.3 | PID ATR PATHWAY | ATR signaling pathway |
0.0 | 0.2 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
0.0 | 0.2 | PID ENDOTHELIN PATHWAY | Endothelins |
0.0 | 0.2 | PID IL1 PATHWAY | IL1-mediated signaling events |
0.0 | 0.0 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
0.0 | 0.0 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
0.0 | 0.0 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.0 | 0.5 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
0.0 | 0.2 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
0.0 | 0.2 | PID ARF6 PATHWAY | Arf6 signaling events |
0.0 | 0.1 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
0.0 | 0.2 | PID BCR 5PATHWAY | BCR signaling pathway |
0.0 | 0.1 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
0.0 | 0.0 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
0.0 | 0.1 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.0 | 0.0 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.0 | 0.1 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.0 | 0.4 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.0 | 0.0 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
0.0 | 0.2 | PID P73PATHWAY | p73 transcription factor network |
0.0 | 0.1 | NABA COLLAGENS | Genes encoding collagen proteins |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 0.2 | REACTOME REGULATION OF GLUCOKINASE BY GLUCOKINASE REGULATORY PROTEIN | Genes involved in Regulation of Glucokinase by Glucokinase Regulatory Protein |
0.2 | 0.8 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.2 | 0.2 | REACTOME SIGNALING BY FGFR | Genes involved in Signaling by FGFR |
0.2 | 0.6 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
0.2 | 1.2 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.2 | 2.6 | REACTOME SHC1 EVENTS IN EGFR SIGNALING | Genes involved in SHC1 events in EGFR signaling |
0.2 | 0.2 | REACTOME REGULATION OF APOPTOSIS | Genes involved in Regulation of Apoptosis |
0.1 | 2.7 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
0.1 | 1.5 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.1 | 1.5 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
0.1 | 1.2 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
0.1 | 0.9 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
0.1 | 1.0 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.1 | 0.5 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.1 | 1.9 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
0.1 | 1.9 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
0.1 | 0.1 | REACTOME CTLA4 INHIBITORY SIGNALING | Genes involved in CTLA4 inhibitory signaling |
0.1 | 0.6 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
0.1 | 0.6 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.1 | 0.5 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
0.1 | 0.3 | REACTOME ARMS MEDIATED ACTIVATION | Genes involved in ARMS-mediated activation |
0.1 | 0.6 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
0.1 | 0.2 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.1 | 0.1 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.0 | 0.8 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.0 | 0.0 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
0.0 | 0.6 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
0.0 | 0.6 | REACTOME POL SWITCHING | Genes involved in Polymerase switching |
0.0 | 0.5 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
0.0 | 0.9 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
0.0 | 1.9 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
0.0 | 0.3 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.0 | 0.6 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
0.0 | 0.3 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
0.0 | 0.3 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.0 | 0.2 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
0.0 | 0.3 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.0 | 0.3 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
0.0 | 0.7 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
0.0 | 0.3 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
0.0 | 0.4 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
0.0 | 2.3 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
0.0 | 0.4 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
0.0 | 0.3 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
0.0 | 0.7 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
0.0 | 0.3 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.0 | 0.4 | REACTOME AMYLOIDS | Genes involved in Amyloids |
0.0 | 0.2 | REACTOME MRNA PROCESSING | Genes involved in mRNA Processing |
0.0 | 0.0 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.0 | 0.2 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
0.0 | 0.2 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.0 | 0.6 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
0.0 | 0.2 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
0.0 | 0.6 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.0 | 0.3 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.0 | 0.3 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
0.0 | 0.3 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.0 | 0.3 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
0.0 | 0.3 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
0.0 | 0.5 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
0.0 | 0.9 | REACTOME TRANS GOLGI NETWORK VESICLE BUDDING | Genes involved in trans-Golgi Network Vesicle Budding |
0.0 | 0.2 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.0 | 0.1 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.0 | 0.2 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
0.0 | 0.0 | REACTOME NUCLEAR EVENTS KINASE AND TRANSCRIPTION FACTOR ACTIVATION | Genes involved in Nuclear Events (kinase and transcription factor activation) |
0.0 | 0.2 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.0 | 0.1 | REACTOME NRIF SIGNALS CELL DEATH FROM THE NUCLEUS | Genes involved in NRIF signals cell death from the nucleus |
0.0 | 1.1 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
0.0 | 0.0 | REACTOME KINESINS | Genes involved in Kinesins |
0.0 | 0.3 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
0.0 | 0.1 | REACTOME INHIBITION OF THE PROTEOLYTIC ACTIVITY OF APC C REQUIRED FOR THE ONSET OF ANAPHASE BY MITOTIC SPINDLE CHECKPOINT COMPONENTS | Genes involved in Inhibition of the proteolytic activity of APC/C required for the onset of anaphase by mitotic spindle checkpoint components |
0.0 | 0.1 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.0 | 0.1 | REACTOME COSTIMULATION BY THE CD28 FAMILY | Genes involved in Costimulation by the CD28 family |
0.0 | 0.1 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.0 | 0.2 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
0.0 | 0.3 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.0 | 0.1 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.0 | 0.3 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
0.0 | 0.3 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
0.0 | 0.1 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
0.0 | 0.2 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
0.0 | 0.2 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
0.0 | 0.1 | REACTOME OPSINS | Genes involved in Opsins |
0.0 | 0.0 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
0.0 | 0.1 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.0 | 0.0 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
0.0 | 0.7 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.0 | 0.3 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
0.0 | 0.1 | REACTOME SIGNALLING TO RAS | Genes involved in Signalling to RAS |
0.0 | 0.5 | REACTOME PHASE II CONJUGATION | Genes involved in Phase II conjugation |
0.0 | 0.4 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
0.0 | 0.1 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
0.0 | 0.1 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
0.0 | 0.1 | REACTOME SIGNALING BY SCF KIT | Genes involved in Signaling by SCF-KIT |
0.0 | 0.3 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.0 | 0.3 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.0 | 0.1 | REACTOME RNA POL I TRANSCRIPTION | Genes involved in RNA Polymerase I Transcription |
0.0 | 0.1 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
0.0 | 0.1 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
0.0 | 0.1 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
0.0 | 0.2 | REACTOME ADENYLATE CYCLASE INHIBITORY PATHWAY | Genes involved in Adenylate cyclase inhibitory pathway |
0.0 | 0.0 | REACTOME FGFR1 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR1 ligand binding and activation |
0.0 | 1.2 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
0.0 | 0.0 | REACTOME SCF BETA TRCP MEDIATED DEGRADATION OF EMI1 | Genes involved in SCF-beta-TrCP mediated degradation of Emi1 |
0.0 | 0.1 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
0.0 | 0.3 | REACTOME RIG I MDA5 MEDIATED INDUCTION OF IFN ALPHA BETA PATHWAYS | Genes involved in RIG-I/MDA5 mediated induction of IFN-alpha/beta pathways |
0.0 | 0.1 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
0.0 | 0.2 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
0.0 | 0.1 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
0.0 | 0.0 | REACTOME P75NTR SIGNALS VIA NFKB | Genes involved in p75NTR signals via NF-kB |
0.0 | 0.1 | REACTOME ACTIVATION OF CHAPERONES BY ATF6 ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
0.0 | 0.1 | REACTOME FRS2 MEDIATED CASCADE | Genes involved in FRS2-mediated cascade |
0.0 | 0.1 | REACTOME REPAIR SYNTHESIS FOR GAP FILLING BY DNA POL IN TC NER | Genes involved in Repair synthesis for gap-filling by DNA polymerase in TC-NER |
0.0 | 0.1 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
0.0 | 0.4 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
0.0 | 0.1 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.0 | 0.1 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
0.0 | 0.0 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
0.0 | 0.1 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |