Gene Symbol | Gene ID | Gene Info |
---|---|---|
Nr1i3
|
ENSMUSG00000005677.8 | Nr1i3 |
Gene | Promoter | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Nr1i3 | chr1_171213833_171213993 | 57 | 0.931345 | -0.84 | 3.6e-02 | Click! |
Nr1i3 | chr1_171214951_171215119 | 686 | 0.436910 | -0.47 | 3.4e-01 | Click! |
Nr1i3 | chr1_171217871_171218022 | 3597 | 0.091052 | -0.47 | 3.5e-01 | Click! |
Nr1i3 | chr1_171214693_171214882 | 438 | 0.627929 | -0.29 | 5.7e-01 | Click! |
Nr1i3 | chr1_171215629_171216025 | 1478 | 0.188089 | 0.24 | 6.5e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr6_23121749_23122234 | 5.18 |
Aass |
aminoadipate-semialdehyde synthase |
5589 |
0.18 |
chr11_6012474_6012958 | 5.18 |
Camk2b |
calcium/calmodulin-dependent protein kinase II, beta |
12268 |
0.17 |
chr2_163037706_163037864 | 3.52 |
Ift52 |
intraflagellar transport 52 |
15342 |
0.11 |
chr2_163037922_163038123 | 2.96 |
Ift52 |
intraflagellar transport 52 |
15579 |
0.11 |
chr9_74891211_74891440 | 2.33 |
Onecut1 |
one cut domain, family member 1 |
24841 |
0.14 |
chr4_150660019_150660333 | 2.33 |
Slc45a1 |
solute carrier family 45, member 1 |
8002 |
0.19 |
chr2_163038300_163038466 | 2.31 |
Ift52 |
intraflagellar transport 52 |
15940 |
0.11 |
chr9_106235366_106235517 | 2.18 |
Alas1 |
aminolevulinic acid synthase 1 |
1643 |
0.22 |
chr10_87936218_87936369 | 2.17 |
Tyms-ps |
thymidylate synthase, pseudogene |
30554 |
0.15 |
chr19_43808145_43808467 | 2.14 |
Abcc2 |
ATP-binding cassette, sub-family C (CFTR/MRP), member 2 |
2216 |
0.25 |
chr2_163038133_163038284 | 2.12 |
Ift52 |
intraflagellar transport 52 |
15765 |
0.11 |
chr19_40191699_40191928 | 2.10 |
Gm5827 |
predicted gene 5827 |
775 |
0.57 |
chr6_51657816_51657985 | 2.00 |
Gm22914 |
predicted gene, 22914 |
36268 |
0.17 |
chr11_16879568_16879719 | 1.98 |
Egfr |
epidermal growth factor receptor |
1493 |
0.43 |
chr2_163038512_163038663 | 1.97 |
Mybl2 |
myeloblastosis oncogene-like 2 |
16100 |
0.11 |
chr11_16879295_16879446 | 1.94 |
Egfr |
epidermal growth factor receptor |
1220 |
0.5 |
chr7_97414019_97414355 | 1.87 |
Thrsp |
thyroid hormone responsive |
3332 |
0.16 |
chr9_106234809_106235123 | 1.82 |
Alas1 |
aminolevulinic acid synthase 1 |
2118 |
0.17 |
chr1_186325513_186325749 | 1.80 |
Gm37491 |
predicted gene, 37491 |
21684 |
0.24 |
chr3_89142602_89142893 | 1.72 |
Pklr |
pyruvate kinase liver and red blood cell |
6124 |
0.07 |
chr10_95434881_95435051 | 1.68 |
5730420D15Rik |
RIKEN cDNA 5730420D15 gene |
17591 |
0.11 |
chr15_84115082_84115482 | 1.66 |
Pnpla5 |
patatin-like phospholipase domain containing 5 |
7893 |
0.11 |
chr4_62703366_62703517 | 1.66 |
Gm11210 |
predicted gene 11210 |
2540 |
0.23 |
chr4_131722484_131723038 | 1.63 |
Gm16080 |
predicted gene 16080 |
12253 |
0.19 |
chr2_177902871_177903175 | 1.61 |
Gm14327 |
predicted gene 14327 |
1262 |
0.38 |
chrX_85734642_85734808 | 1.60 |
Gk |
glycerol kinase |
2885 |
0.21 |
chr8_125401526_125401692 | 1.58 |
Sipa1l2 |
signal-induced proliferation-associated 1 like 2 |
91101 |
0.09 |
chr9_74894770_74895613 | 1.58 |
Onecut1 |
one cut domain, family member 1 |
28707 |
0.13 |
chr15_84113034_84113200 | 1.57 |
Gm46526 |
predicted gene, 46526 |
6459 |
0.12 |
chrX_155151974_155152135 | 1.55 |
Gm4997 |
predicted gene 4997 |
743 |
0.48 |
chr2_177471886_177472177 | 1.54 |
Zfp970 |
zinc finger protein 970 |
7185 |
0.16 |
chr2_181276195_181276365 | 1.53 |
Gmeb2 |
glucocorticoid modulatory element binding protein 2 |
1802 |
0.2 |
chr12_104084891_104085073 | 1.52 |
Serpina4-ps1 |
serine (or cysteine) peptidase inhibitor, clade A, member 4, pseudogene 1 |
4333 |
0.12 |
chr11_120819185_120819682 | 1.52 |
Fasn |
fatty acid synthase |
3978 |
0.11 |
chr7_38162494_38162645 | 1.50 |
Gm22203 |
predicted gene, 22203 |
14102 |
0.13 |
chr11_16778095_16778246 | 1.50 |
Egfr |
epidermal growth factor receptor |
25940 |
0.17 |
chr17_57198093_57198326 | 1.49 |
Tnfsf14 |
tumor necrosis factor (ligand) superfamily, member 14 |
4032 |
0.13 |
chr15_35876385_35876551 | 1.43 |
Vps13b |
vacuolar protein sorting 13B |
4746 |
0.19 |
chr12_104346905_104347119 | 1.42 |
Serpina3k |
serine (or cysteine) peptidase inhibitor, clade A, member 3K |
8526 |
0.12 |
chr12_104087776_104088197 | 1.41 |
Serpina4-ps1 |
serine (or cysteine) peptidase inhibitor, clade A, member 4, pseudogene 1 |
7337 |
0.1 |
chr19_53225949_53226100 | 1.41 |
Add3 |
adducin 3 (gamma) |
27978 |
0.12 |
chr8_114150614_114151007 | 1.38 |
Nudt7 |
nudix (nucleoside diphosphate linked moiety X)-type motif 7 |
17168 |
0.25 |
chr2_58779732_58779883 | 1.38 |
Upp2 |
uridine phosphorylase 2 |
14482 |
0.2 |
chr11_111269853_111270023 | 1.37 |
Gm11675 |
predicted gene 11675 |
6162 |
0.34 |
chr13_31340004_31340178 | 1.37 |
Gm11373 |
predicted gene 11373 |
9324 |
0.16 |
chr11_16878966_16879155 | 1.37 |
Egfr |
epidermal growth factor receptor |
910 |
0.61 |
chr9_51670625_51670776 | 1.37 |
Gm8959 |
predicted gene 8959 |
13809 |
0.19 |
chr5_130301045_130301196 | 1.35 |
Tyw1 |
tRNA-yW synthesizing protein 1 homolog (S. cerevisiae) |
42190 |
0.1 |
chr16_87627804_87628113 | 1.35 |
Gm22808 |
predicted gene, 22808 |
6838 |
0.21 |
chr12_12499785_12499936 | 1.35 |
4921511I17Rik |
RIKEN cDNA 4921511I17 gene |
107245 |
0.07 |
chr4_129063899_129064050 | 1.34 |
Rnf19b |
ring finger protein 19B |
5160 |
0.15 |
chr1_73036643_73036816 | 1.34 |
1700027A15Rik |
RIKEN cDNA 1700027A15 gene |
12160 |
0.22 |
chr7_27252126_27252620 | 1.34 |
Gm44641 |
predicted gene 44641 |
197 |
0.84 |
chr11_16879987_16880147 | 1.33 |
Egfr |
epidermal growth factor receptor |
1917 |
0.36 |
chr15_58979084_58979584 | 1.33 |
4930544F09Rik |
RIKEN cDNA 4930544F09 gene |
4802 |
0.18 |
chr10_21046230_21046616 | 1.32 |
Gm20149 |
predicted gene, 20149 |
2476 |
0.23 |
chr13_113052500_113052836 | 1.32 |
Gpx8 |
glutathione peroxidase 8 (putative) |
6258 |
0.09 |
chr15_25435984_25436493 | 1.32 |
Gm48956 |
predicted gene, 48956 |
9402 |
0.16 |
chr9_106238297_106238448 | 1.31 |
Alas1 |
aminolevulinic acid synthase 1 |
358 |
0.77 |
chr9_74894074_74894225 | 1.31 |
Onecut1 |
one cut domain, family member 1 |
27665 |
0.13 |
chr2_11458006_11458188 | 1.29 |
Pfkfb3 |
6-phosphofructo-2-kinase/fructose-2,6-biphosphatase 3 |
24014 |
0.11 |
chr16_76754896_76755216 | 1.28 |
Gm30790 |
predicted gene, 30790 |
9139 |
0.24 |
chr7_97423614_97423975 | 1.28 |
Thrsp |
thyroid hormone responsive |
6064 |
0.14 |
chr6_55171107_55171477 | 1.28 |
Inmt |
indolethylamine N-methyltransferase |
3722 |
0.2 |
chr10_87905188_87905714 | 1.28 |
Igf1os |
insulin-like growth factor 1, opposite strand |
42070 |
0.13 |
chr19_40174897_40175092 | 1.28 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
12292 |
0.15 |
chr11_16867245_16867846 | 1.27 |
Egfr |
epidermal growth factor receptor |
10605 |
0.2 |
chr13_4577869_4578048 | 1.26 |
Akr1c21 |
aldo-keto reductase family 1, member C21 |
801 |
0.61 |
chr15_7201350_7201501 | 1.25 |
Egflam |
EGF-like, fibronectin type III and laminin G domains |
21644 |
0.23 |
chr19_36264512_36264835 | 1.25 |
Gm32027 |
predicted gene, 32027 |
236 |
0.93 |
chr15_55635658_55635834 | 1.23 |
Mtbp |
Mdm2, transformed 3T3 cell double minute p53 binding protein |
14294 |
0.25 |
chr14_89668906_89669067 | 1.23 |
Gm25415 |
predicted gene, 25415 |
37819 |
0.23 |
chr6_51709759_51710069 | 1.22 |
Gm38811 |
predicted gene, 38811 |
1167 |
0.59 |
chr18_68491528_68491858 | 1.22 |
Gm50258 |
predicted gene, 50258 |
58900 |
0.1 |
chr8_76151909_76152060 | 1.22 |
Gm45742 |
predicted gene 45742 |
34957 |
0.2 |
chr19_57115810_57115986 | 1.22 |
Ablim1 |
actin-binding LIM protein 1 |
3015 |
0.35 |
chr11_60983167_60983378 | 1.22 |
Map2k3 |
mitogen-activated protein kinase kinase 3 |
32610 |
0.12 |
chr5_125525672_125525920 | 1.21 |
Tmem132b |
transmembrane protein 132B |
5978 |
0.17 |
chr7_68975121_68975306 | 1.21 |
Gm44691 |
predicted gene 44691 |
14191 |
0.21 |
chr5_87499011_87499178 | 1.20 |
Ugt2a1 |
UDP glucuronosyltransferase 2 family, polypeptide A1 |
8223 |
0.12 |
chr12_104343910_104344587 | 1.20 |
Serpina3k |
serine (or cysteine) peptidase inhibitor, clade A, member 3K |
5762 |
0.12 |
chr5_23562685_23562882 | 1.19 |
Srpk2 |
serine/arginine-rich protein specific kinase 2 |
13413 |
0.19 |
chr19_37074801_37074963 | 1.19 |
Gm22714 |
predicted gene, 22714 |
74280 |
0.08 |
chr19_40160539_40160690 | 1.18 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
26672 |
0.14 |
chr12_16536781_16536932 | 1.18 |
Lpin1 |
lipin 1 |
25182 |
0.22 |
chr3_60553127_60553297 | 1.18 |
Gm37589 |
predicted gene, 37589 |
17461 |
0.2 |
chr4_65080374_65080537 | 1.17 |
Pappa |
pregnancy-associated plasma protein A |
43719 |
0.19 |
chr5_149616281_149616432 | 1.17 |
Hsph1 |
heat shock 105kDa/110kDa protein 1 |
2817 |
0.21 |
chr9_74890009_74890179 | 1.17 |
Onecut1 |
one cut domain, family member 1 |
23610 |
0.14 |
chr11_120809069_120809447 | 1.16 |
Fasn |
fatty acid synthase |
443 |
0.66 |
chr9_74893395_74893777 | 1.16 |
Onecut1 |
one cut domain, family member 1 |
27102 |
0.13 |
chr4_122959046_122959235 | 1.16 |
Mfsd2a |
major facilitator superfamily domain containing 2A |
850 |
0.49 |
chr15_81249111_81249532 | 1.15 |
8430426J06Rik |
RIKEN cDNA 8430426J06 gene |
1353 |
0.36 |
chr11_16822316_16822467 | 1.15 |
Egfros |
epidermal growth factor receptor, opposite strand |
8311 |
0.23 |
chr19_12717960_12718111 | 1.15 |
Gm15962 |
predicted gene 15962 |
3168 |
0.14 |
chr2_147988721_147988917 | 1.15 |
9030622O22Rik |
RIKEN cDNA 9030622O22 gene |
12634 |
0.21 |
chr11_16815536_16815687 | 1.15 |
Egfros |
epidermal growth factor receptor, opposite strand |
15091 |
0.21 |
chr10_87931882_87932033 | 1.15 |
Tyms-ps |
thymidylate synthase, pseudogene |
34890 |
0.14 |
chr9_74891582_74891747 | 1.14 |
Onecut1 |
one cut domain, family member 1 |
25180 |
0.14 |
chr11_16814206_16814660 | 1.14 |
Egfros |
epidermal growth factor receptor, opposite strand |
16269 |
0.21 |
chr16_37902046_37902197 | 1.14 |
Gpr156 |
G protein-coupled receptor 156 |
14375 |
0.14 |
chr9_74791015_74791321 | 1.14 |
Gm22315 |
predicted gene, 22315 |
9098 |
0.19 |
chr11_16833397_16833632 | 1.13 |
Egfros |
epidermal growth factor receptor, opposite strand |
2812 |
0.3 |
chr2_33224574_33224733 | 1.12 |
Angptl2 |
angiopoietin-like 2 |
8536 |
0.16 |
chr9_74326904_74327074 | 1.12 |
Gm24141 |
predicted gene, 24141 |
35621 |
0.16 |
chr6_51698772_51698923 | 1.12 |
Gm38811 |
predicted gene, 38811 |
12234 |
0.24 |
chr10_4606032_4606193 | 1.11 |
Esr1 |
estrogen receptor 1 (alpha) |
5481 |
0.24 |
chr10_89813381_89813532 | 1.11 |
Uhrf1bp1l |
UHRF1 (ICBP90) binding protein 1-like |
1585 |
0.4 |
chr11_116206084_116206272 | 1.10 |
Ten1 |
TEN1 telomerase capping complex subunit |
4756 |
0.1 |
chr12_104087488_104087669 | 1.10 |
Serpina4-ps1 |
serine (or cysteine) peptidase inhibitor, clade A, member 4, pseudogene 1 |
6929 |
0.1 |
chr11_16814706_16815122 | 1.10 |
Egfros |
epidermal growth factor receptor, opposite strand |
15788 |
0.21 |
chr9_74881714_74881880 | 1.09 |
Onecut1 |
one cut domain, family member 1 |
15313 |
0.15 |
chr1_21257119_21257270 | 1.09 |
Gsta3 |
glutathione S-transferase, alpha 3 |
3673 |
0.13 |
chr18_74418143_74418457 | 1.09 |
Gm50168 |
predicted gene, 50168 |
2505 |
0.25 |
chr11_111240540_111240737 | 1.09 |
Gm11675 |
predicted gene 11675 |
35462 |
0.23 |
chr15_41724355_41724527 | 1.09 |
Oxr1 |
oxidation resistance 1 |
13837 |
0.26 |
chr4_125936153_125936304 | 1.09 |
2610028E06Rik |
RIKEN cDNA 2610028E06 gene |
13811 |
0.22 |
chr7_12983382_12983934 | 1.08 |
Zfp446 |
zinc finger protein 446 |
4138 |
0.09 |
chr9_74885383_74885534 | 1.08 |
Onecut1 |
one cut domain, family member 1 |
18974 |
0.14 |
chr17_25127135_25127453 | 1.08 |
Clcn7 |
chloride channel, voltage-sensitive 7 |
6097 |
0.1 |
chr13_45863946_45864126 | 1.07 |
Atxn1 |
ataxin 1 |
8252 |
0.26 |
chr4_105328178_105328374 | 1.07 |
Gm12722 |
predicted gene 12722 |
46670 |
0.19 |
chr2_134499947_134500098 | 1.06 |
Hao1 |
hydroxyacid oxidase 1, liver |
54285 |
0.17 |
chr8_105089716_105089869 | 1.06 |
Ces3b |
carboxylesterase 3B |
1173 |
0.32 |
chr12_104346326_104346873 | 1.06 |
Serpina3k |
serine (or cysteine) peptidase inhibitor, clade A, member 3K |
8113 |
0.12 |
chr4_141955373_141955574 | 1.06 |
Fhad1 |
forkhead-associated (FHA) phosphopeptide binding domain 1 |
1279 |
0.36 |
chr11_16855927_16856112 | 1.06 |
Egfr |
epidermal growth factor receptor |
22131 |
0.17 |
chr9_106231818_106232229 | 1.05 |
Alas1 |
aminolevulinic acid synthase 1 |
5061 |
0.11 |
chr11_111297916_111298094 | 1.05 |
Gm11675 |
predicted gene 11675 |
21905 |
0.28 |
chr5_149579767_149579923 | 1.05 |
Wdr95 |
WD40 repeat domain 95 |
1933 |
0.28 |
chr3_94703673_94703906 | 1.05 |
Selenbp2 |
selenium binding protein 2 |
10130 |
0.11 |
chr10_87541894_87542102 | 1.04 |
Pah |
phenylalanine hydroxylase |
4675 |
0.24 |
chr2_8116897_8117048 | 1.04 |
Gm13254 |
predicted gene 13254 |
30893 |
0.26 |
chr17_36867279_36867493 | 1.04 |
Trim15 |
tripartite motif-containing 15 |
176 |
0.87 |
chr8_93176962_93177159 | 1.03 |
Ces1d |
carboxylesterase 1D |
1771 |
0.27 |
chr3_107238186_107238337 | 1.03 |
Prok1 |
prokineticin 1 |
391 |
0.8 |
chr13_75413535_75413744 | 1.03 |
Gm48234 |
predicted gene, 48234 |
65748 |
0.11 |
chr18_84210867_84211018 | 1.03 |
Gm50311 |
predicted gene, 50311 |
8018 |
0.25 |
chr3_18165162_18165350 | 1.03 |
Gm23686 |
predicted gene, 23686 |
12369 |
0.23 |
chr1_58945674_58946262 | 1.02 |
Trak2 |
trafficking protein, kinesin binding 2 |
369 |
0.84 |
chr5_120478626_120479027 | 1.02 |
Sds |
serine dehydratase |
60 |
0.95 |
chr19_10094218_10094369 | 1.02 |
Fads2 |
fatty acid desaturase 2 |
5577 |
0.16 |
chr15_67925007_67925168 | 1.02 |
Gm49409 |
predicted gene, 49409 |
17717 |
0.25 |
chr5_81885152_81885330 | 1.02 |
2900064F13Rik |
RIKEN cDNA 2900064F13 gene |
58425 |
0.14 |
chr9_106264996_106265377 | 1.02 |
Poc1a |
POC1 centriolar protein A |
15875 |
0.1 |
chr6_136954641_136954792 | 1.02 |
Pde6h |
phosphodiesterase 6H, cGMP-specific, cone, gamma |
183 |
0.93 |
chr5_22587487_22587999 | 1.01 |
Gm9057 |
predicted gene 9057 |
23786 |
0.11 |
chrX_139040939_139041181 | 1.01 |
Serpina7 |
serine (or cysteine) peptidase inhibitor, clade A (alpha-1 antiproteinase, antitrypsin), member 7 |
44155 |
0.14 |
chr4_76468484_76468676 | 1.01 |
Gm42303 |
predicted gene, 42303 |
17349 |
0.21 |
chr10_87865511_87865999 | 1.01 |
Igf1os |
insulin-like growth factor 1, opposite strand |
2374 |
0.3 |
chr2_72227448_72227599 | 1.01 |
Rapgef4os2 |
Rap guanine nucleotide exchange factor (GEF) 4, opposite strand 2 |
4779 |
0.19 |
chr9_84594839_84594990 | 1.00 |
Gm39388 |
predicted gene, 39388 |
16954 |
0.22 |
chr1_186358132_186358570 | 1.00 |
Gm37491 |
predicted gene, 37491 |
11036 |
0.28 |
chr9_61312955_61313113 | 0.99 |
B930092H01Rik |
RIKEN cDNA B930092H01 gene |
19225 |
0.19 |
chr13_20559805_20559978 | 0.99 |
Gm47657 |
predicted gene, 47657 |
55096 |
0.11 |
chr15_63155793_63155965 | 0.99 |
Gm49013 |
predicted gene, 49013 |
9646 |
0.23 |
chr5_125526040_125526191 | 0.99 |
Tmem132b |
transmembrane protein 132B |
5659 |
0.17 |
chr11_78846353_78846604 | 0.99 |
Lyrm9 |
LYR motif containing 9 |
19849 |
0.15 |
chr17_47303433_47303820 | 0.99 |
Trerf1 |
transcriptional regulating factor 1 |
9557 |
0.16 |
chr9_74702140_74702734 | 0.99 |
Gm27233 |
predicted gene 27233 |
6825 |
0.25 |
chr2_34486208_34486368 | 0.98 |
Mapkap1 |
mitogen-activated protein kinase associated protein 1 |
41941 |
0.13 |
chr1_136440845_136441026 | 0.98 |
Ddx59 |
DEAD (Asp-Glu-Ala-Asp) box polypeptide 59 |
8533 |
0.15 |
chr12_104347486_104347696 | 0.97 |
Serpina3k |
serine (or cysteine) peptidase inhibitor, clade A, member 3K |
9105 |
0.12 |
chr5_125040097_125040498 | 0.97 |
Ncor2 |
nuclear receptor co-repressor 2 |
2515 |
0.25 |
chr11_101342858_101343022 | 0.97 |
Gm28156 |
predicted gene 28156 |
4999 |
0.06 |
chr4_108085569_108085740 | 0.97 |
Mir6397 |
microRNA 6397 |
1703 |
0.28 |
chr13_12597462_12597622 | 0.97 |
Gm25483 |
predicted gene, 25483 |
7977 |
0.13 |
chr1_154251584_154251767 | 0.97 |
4930532M18Rik |
RIKEN cDNA 4930532M18 gene |
4014 |
0.2 |
chr9_74891028_74891179 | 0.97 |
Onecut1 |
one cut domain, family member 1 |
24619 |
0.14 |
chr11_16589151_16589356 | 0.97 |
Gm12663 |
predicted gene 12663 |
46813 |
0.12 |
chr2_126955772_126955950 | 0.96 |
Sppl2a |
signal peptide peptidase like 2A |
22626 |
0.15 |
chr11_16824630_16824965 | 0.96 |
Egfros |
epidermal growth factor receptor, opposite strand |
5905 |
0.24 |
chr15_55043394_55043818 | 0.96 |
Taf2 |
TATA-box binding protein associated factor 2 |
2560 |
0.24 |
chr4_103933550_103933744 | 0.96 |
Gm12719 |
predicted gene 12719 |
5894 |
0.25 |
chr7_114735164_114735333 | 0.96 |
Insc |
INSC spindle orientation adaptor protein |
8446 |
0.16 |
chr8_93107449_93107636 | 0.96 |
Ces1c |
carboxylesterase 1C |
16987 |
0.14 |
chr2_134708873_134709037 | 0.95 |
Gm14037 |
predicted gene 14037 |
22152 |
0.2 |
chr13_62879517_62879679 | 0.95 |
Fbp1 |
fructose bisphosphatase 1 |
6840 |
0.14 |
chr14_7855921_7856132 | 0.95 |
Flnb |
filamin, beta |
28715 |
0.15 |
chr19_17879683_17879834 | 0.95 |
Gm50181 |
predicted gene, 50181 |
5929 |
0.16 |
chr11_16863303_16863761 | 0.95 |
Egfr |
epidermal growth factor receptor |
14618 |
0.19 |
chr11_120815283_120815743 | 0.95 |
Fasn |
fatty acid synthase |
58 |
0.94 |
chr18_74931662_74931813 | 0.94 |
Gm18786 |
predicted gene, 18786 |
4543 |
0.12 |
chr3_96442671_96442858 | 0.94 |
Gm26232 |
predicted gene, 26232 |
7682 |
0.06 |
chr4_135789148_135789435 | 0.94 |
Myom3 |
myomesin family, member 3 |
8899 |
0.14 |
chr11_5899631_5899822 | 0.94 |
Myl7 |
myosin, light polypeptide 7, regulatory |
944 |
0.39 |
chr9_106244810_106244992 | 0.94 |
Alas1 |
aminolevulinic acid synthase 1 |
1267 |
0.28 |
chr8_12646663_12646829 | 0.94 |
Tubgcp3 |
tubulin, gamma complex associated protein 3 |
8764 |
0.15 |
chr19_40179770_40179927 | 0.93 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
7438 |
0.16 |
chr11_16838643_16838829 | 0.93 |
Egfros |
epidermal growth factor receptor, opposite strand |
8034 |
0.22 |
chr8_93176743_93176912 | 0.93 |
Ces1d |
carboxylesterase 1D |
1538 |
0.3 |
chr1_21258115_21258471 | 0.93 |
Gsta3 |
glutathione S-transferase, alpha 3 |
4772 |
0.12 |
chr3_107235103_107235636 | 0.92 |
Prok1 |
prokineticin 1 |
1892 |
0.24 |
chr1_67227779_67227978 | 0.92 |
Gm15668 |
predicted gene 15668 |
21322 |
0.2 |
chr5_120481198_120481714 | 0.92 |
Gm15690 |
predicted gene 15690 |
553 |
0.54 |
chr10_99226544_99226753 | 0.92 |
Gm34574 |
predicted gene, 34574 |
2144 |
0.19 |
chr9_74793041_74793363 | 0.92 |
Gm22315 |
predicted gene, 22315 |
11132 |
0.18 |
chr13_46020097_46020273 | 0.92 |
Gm45949 |
predicted gene, 45949 |
40412 |
0.15 |
chr11_16771754_16772101 | 0.92 |
Egfr |
epidermal growth factor receptor |
19697 |
0.18 |
chr5_125501934_125502085 | 0.92 |
Aacs |
acetoacetyl-CoA synthetase |
4140 |
0.17 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
4.8 | 14.3 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
1.2 | 5.0 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
1.2 | 3.5 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
1.1 | 3.3 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
0.9 | 5.7 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
0.9 | 2.7 | GO:0006068 | ethanol catabolic process(GO:0006068) |
0.9 | 1.8 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
0.8 | 5.8 | GO:0045542 | positive regulation of cholesterol biosynthetic process(GO:0045542) positive regulation of cholesterol metabolic process(GO:0090205) |
0.8 | 2.4 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
0.8 | 3.1 | GO:0046449 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
0.8 | 2.3 | GO:0051594 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
0.6 | 1.8 | GO:0060523 | prostate epithelial cord elongation(GO:0060523) |
0.6 | 6.5 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.6 | 1.8 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
0.6 | 1.7 | GO:0038161 | prolactin signaling pathway(GO:0038161) |
0.6 | 2.2 | GO:1903964 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.5 | 1.6 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.5 | 1.6 | GO:0021699 | cerebellar cortex maturation(GO:0021699) |
0.5 | 1.0 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
0.5 | 1.5 | GO:0015817 | histidine transport(GO:0015817) |
0.5 | 2.5 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
0.5 | 1.4 | GO:2000259 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
0.5 | 1.4 | GO:0070447 | positive regulation of oligodendrocyte progenitor proliferation(GO:0070447) |
0.5 | 1.8 | GO:0090427 | activation of meiosis(GO:0090427) |
0.4 | 1.6 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
0.4 | 1.2 | GO:0034310 | primary alcohol catabolic process(GO:0034310) |
0.4 | 1.2 | GO:0006553 | lysine metabolic process(GO:0006553) |
0.4 | 1.2 | GO:0003289 | atrial septum primum morphogenesis(GO:0003289) |
0.4 | 1.1 | GO:0061625 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
0.4 | 0.7 | GO:0042851 | L-alanine metabolic process(GO:0042851) |
0.4 | 0.7 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
0.4 | 2.5 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
0.3 | 0.7 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
0.3 | 1.0 | GO:0021553 | olfactory nerve development(GO:0021553) |
0.3 | 2.3 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
0.3 | 1.6 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) |
0.3 | 0.9 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
0.3 | 1.9 | GO:0006558 | L-phenylalanine metabolic process(GO:0006558) L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
0.3 | 1.9 | GO:0060509 | Type I pneumocyte differentiation(GO:0060509) |
0.3 | 0.9 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
0.3 | 0.6 | GO:0061144 | alveolar secondary septum development(GO:0061144) |
0.3 | 0.3 | GO:0019747 | regulation of isoprenoid metabolic process(GO:0019747) |
0.3 | 0.9 | GO:0050883 | musculoskeletal movement, spinal reflex action(GO:0050883) |
0.3 | 1.8 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
0.3 | 0.6 | GO:1904970 | brush border assembly(GO:1904970) |
0.3 | 0.3 | GO:1901671 | positive regulation of superoxide dismutase activity(GO:1901671) positive regulation of removal of superoxide radicals(GO:1904833) |
0.3 | 0.6 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.3 | 0.6 | GO:1903750 | regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903750) negative regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903751) |
0.3 | 3.3 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.3 | 5.5 | GO:0006783 | heme biosynthetic process(GO:0006783) |
0.3 | 0.8 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
0.3 | 0.8 | GO:1901475 | pyruvate transmembrane transport(GO:1901475) |
0.3 | 0.5 | GO:0003330 | regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
0.3 | 0.8 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
0.3 | 1.3 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
0.3 | 0.5 | GO:0046098 | guanine metabolic process(GO:0046098) |
0.3 | 0.8 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.3 | 0.8 | GO:0071276 | cellular response to cadmium ion(GO:0071276) |
0.3 | 1.0 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
0.3 | 1.5 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.2 | 0.2 | GO:0006714 | sesquiterpenoid metabolic process(GO:0006714) |
0.2 | 0.7 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
0.2 | 0.7 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
0.2 | 0.7 | GO:0032741 | positive regulation of interleukin-18 production(GO:0032741) |
0.2 | 1.0 | GO:0000957 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
0.2 | 0.7 | GO:1901300 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
0.2 | 0.7 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
0.2 | 0.2 | GO:0006067 | ethanol metabolic process(GO:0006067) ethanol oxidation(GO:0006069) |
0.2 | 1.2 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
0.2 | 0.7 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
0.2 | 0.9 | GO:0003383 | apical constriction(GO:0003383) |
0.2 | 0.9 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
0.2 | 1.4 | GO:0070327 | thyroid hormone transport(GO:0070327) |
0.2 | 1.1 | GO:1903599 | positive regulation of mitophagy(GO:1903599) |
0.2 | 0.5 | GO:0034395 | regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
0.2 | 1.3 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
0.2 | 0.9 | GO:1900747 | negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) |
0.2 | 1.1 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
0.2 | 0.6 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.2 | 0.9 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
0.2 | 0.6 | GO:0044337 | canonical Wnt signaling pathway involved in positive regulation of apoptotic process(GO:0044337) |
0.2 | 0.4 | GO:0014732 | skeletal muscle atrophy(GO:0014732) |
0.2 | 0.4 | GO:1903999 | negative regulation of eating behavior(GO:1903999) |
0.2 | 0.2 | GO:0010982 | regulation of high-density lipoprotein particle clearance(GO:0010982) |
0.2 | 1.1 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
0.2 | 1.5 | GO:0060613 | fat pad development(GO:0060613) |
0.2 | 1.9 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.2 | 0.6 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
0.2 | 0.4 | GO:1901631 | positive regulation of presynaptic membrane organization(GO:1901631) positive regulation of synaptic vesicle clustering(GO:2000809) |
0.2 | 0.8 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
0.2 | 0.8 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
0.2 | 1.0 | GO:0021960 | anterior commissure morphogenesis(GO:0021960) |
0.2 | 0.8 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
0.2 | 0.4 | GO:0035973 | aggrephagy(GO:0035973) |
0.2 | 1.2 | GO:0061042 | vascular wound healing(GO:0061042) |
0.2 | 0.6 | GO:0032489 | regulation of Cdc42 protein signal transduction(GO:0032489) |
0.2 | 0.4 | GO:0035962 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
0.2 | 0.6 | GO:0019627 | urea metabolic process(GO:0019627) |
0.2 | 2.9 | GO:0006699 | bile acid biosynthetic process(GO:0006699) |
0.2 | 0.2 | GO:0006549 | isoleucine metabolic process(GO:0006549) |
0.2 | 0.8 | GO:0060319 | primitive erythrocyte differentiation(GO:0060319) |
0.2 | 0.2 | GO:0010835 | regulation of protein ADP-ribosylation(GO:0010835) |
0.2 | 0.6 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
0.2 | 5.2 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
0.2 | 0.6 | GO:0030421 | defecation(GO:0030421) |
0.2 | 0.5 | GO:1902915 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
0.2 | 0.4 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
0.2 | 0.7 | GO:0044004 | killing by symbiont of host cells(GO:0001907) disruption by symbiont of host cell(GO:0044004) |
0.2 | 4.5 | GO:0006084 | acetyl-CoA metabolic process(GO:0006084) |
0.2 | 1.1 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
0.2 | 1.2 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.2 | 0.4 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
0.2 | 1.0 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.2 | 0.7 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
0.2 | 0.5 | GO:2000370 | positive regulation of clathrin-mediated endocytosis(GO:2000370) |
0.2 | 0.3 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
0.2 | 0.3 | GO:0045963 | negative regulation of catecholamine metabolic process(GO:0045914) negative regulation of dopamine metabolic process(GO:0045963) |
0.2 | 0.5 | GO:2000836 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
0.2 | 0.5 | GO:0031087 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.2 | 0.3 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
0.2 | 0.5 | GO:0061368 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
0.2 | 0.3 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
0.2 | 0.3 | GO:0060839 | endothelial cell fate commitment(GO:0060839) |
0.2 | 1.5 | GO:0052697 | xenobiotic glucuronidation(GO:0052697) |
0.2 | 0.2 | GO:0006533 | aspartate catabolic process(GO:0006533) |
0.2 | 0.5 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
0.2 | 0.7 | GO:1903352 | ornithine transport(GO:0015822) L-ornithine transmembrane transport(GO:1903352) |
0.2 | 0.7 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
0.2 | 0.3 | GO:0021827 | cerebral cortex tangential migration using cell-cell interactions(GO:0021823) postnatal olfactory bulb interneuron migration(GO:0021827) |
0.2 | 0.2 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
0.2 | 0.7 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.2 | 0.2 | GO:0075509 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
0.2 | 0.5 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
0.2 | 0.5 | GO:1990168 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
0.2 | 0.5 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
0.2 | 0.5 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.2 | 0.2 | GO:0042908 | xenobiotic transport(GO:0042908) |
0.2 | 1.0 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
0.2 | 1.3 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
0.2 | 0.5 | GO:0015842 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
0.2 | 0.5 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) |
0.2 | 0.3 | GO:2000670 | positive regulation of dendritic cell apoptotic process(GO:2000670) |
0.2 | 0.5 | GO:0035511 | oxidative DNA demethylation(GO:0035511) |
0.2 | 0.2 | GO:0003162 | atrioventricular node development(GO:0003162) |
0.2 | 0.8 | GO:0006000 | fructose metabolic process(GO:0006000) |
0.2 | 0.9 | GO:0051639 | actin filament network formation(GO:0051639) |
0.2 | 1.6 | GO:0006517 | protein deglycosylation(GO:0006517) |
0.2 | 0.2 | GO:1900368 | regulation of RNA interference(GO:1900368) |
0.2 | 0.9 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
0.2 | 0.3 | GO:1900044 | regulation of protein K63-linked ubiquitination(GO:1900044) |
0.1 | 0.4 | GO:0002513 | tolerance induction to self antigen(GO:0002513) |
0.1 | 0.4 | GO:0038171 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
0.1 | 0.1 | GO:0032727 | positive regulation of interferon-alpha production(GO:0032727) |
0.1 | 1.3 | GO:0048671 | negative regulation of collateral sprouting(GO:0048671) |
0.1 | 0.4 | GO:0097167 | circadian regulation of translation(GO:0097167) |
0.1 | 0.4 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
0.1 | 1.3 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
0.1 | 0.4 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.1 | 0.6 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.1 | 1.6 | GO:0042759 | long-chain fatty acid biosynthetic process(GO:0042759) |
0.1 | 0.9 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.1 | 0.4 | GO:0044034 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
0.1 | 0.4 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
0.1 | 0.4 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
0.1 | 0.7 | GO:0009188 | ribonucleoside diphosphate biosynthetic process(GO:0009188) |
0.1 | 0.4 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.1 | 0.4 | GO:0010040 | response to iron(II) ion(GO:0010040) |
0.1 | 0.6 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
0.1 | 0.6 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
0.1 | 0.3 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
0.1 | 0.6 | GO:0033132 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
0.1 | 0.4 | GO:1903416 | response to glycoside(GO:1903416) |
0.1 | 0.4 | GO:1901674 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
0.1 | 1.0 | GO:0032532 | regulation of microvillus length(GO:0032532) |
0.1 | 0.4 | GO:0032055 | negative regulation of translation in response to stress(GO:0032055) |
0.1 | 0.4 | GO:0046552 | eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
0.1 | 1.1 | GO:0040016 | embryonic cleavage(GO:0040016) |
0.1 | 0.3 | GO:0050427 | 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
0.1 | 1.7 | GO:0009812 | flavonoid metabolic process(GO:0009812) |
0.1 | 0.7 | GO:0010519 | negative regulation of phospholipase activity(GO:0010519) |
0.1 | 0.4 | GO:0048807 | female genitalia morphogenesis(GO:0048807) |
0.1 | 0.9 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
0.1 | 0.3 | GO:0033686 | positive regulation of luteinizing hormone secretion(GO:0033686) |
0.1 | 0.5 | GO:0036135 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
0.1 | 0.7 | GO:0071476 | cellular hypotonic response(GO:0071476) |
0.1 | 0.5 | GO:0030647 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.1 | 0.3 | GO:0019585 | uronic acid metabolic process(GO:0006063) glucuronate metabolic process(GO:0019585) |
0.1 | 0.3 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
0.1 | 0.3 | GO:1900127 | positive regulation of hyaluronan biosynthetic process(GO:1900127) |
0.1 | 0.1 | GO:0045990 | carbon catabolite regulation of transcription(GO:0045990) |
0.1 | 0.4 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
0.1 | 0.4 | GO:0051582 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
0.1 | 0.6 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
0.1 | 0.3 | GO:0061325 | cell proliferation involved in outflow tract morphogenesis(GO:0061325) |
0.1 | 0.3 | GO:0072092 | ureteric bud invasion(GO:0072092) |
0.1 | 0.5 | GO:2000510 | positive regulation of dendritic cell chemotaxis(GO:2000510) |
0.1 | 0.4 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
0.1 | 0.4 | GO:0006106 | fumarate metabolic process(GO:0006106) |
0.1 | 0.5 | GO:0016584 | nucleosome positioning(GO:0016584) |
0.1 | 0.4 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
0.1 | 0.4 | GO:0060164 | regulation of timing of neuron differentiation(GO:0060164) |
0.1 | 0.7 | GO:0070189 | kynurenine metabolic process(GO:0070189) |
0.1 | 1.0 | GO:0032825 | positive regulation of natural killer cell differentiation(GO:0032825) |
0.1 | 0.4 | GO:0032058 | positive regulation of translational initiation in response to stress(GO:0032058) |
0.1 | 0.1 | GO:0071455 | cellular response to increased oxygen levels(GO:0036295) cellular response to hyperoxia(GO:0071455) |
0.1 | 0.4 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.1 | 0.4 | GO:0072133 | kidney mesenchyme morphogenesis(GO:0072131) metanephric mesenchyme morphogenesis(GO:0072133) |
0.1 | 3.0 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
0.1 | 0.2 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
0.1 | 0.1 | GO:0071462 | cellular response to water stimulus(GO:0071462) |
0.1 | 0.4 | GO:0046005 | positive regulation of circadian sleep/wake cycle, REM sleep(GO:0046005) |
0.1 | 0.5 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
0.1 | 0.5 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
0.1 | 0.2 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
0.1 | 0.3 | GO:0030397 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
0.1 | 0.3 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.1 | 0.5 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
0.1 | 0.2 | GO:1902993 | positive regulation of beta-amyloid formation(GO:1902004) positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
0.1 | 0.3 | GO:1904684 | negative regulation of metalloendopeptidase activity(GO:1904684) negative regulation of metallopeptidase activity(GO:1905049) |
0.1 | 0.1 | GO:0072050 | S-shaped body morphogenesis(GO:0072050) |
0.1 | 0.9 | GO:1901339 | regulation of store-operated calcium channel activity(GO:1901339) |
0.1 | 0.1 | GO:0034137 | positive regulation of toll-like receptor 2 signaling pathway(GO:0034137) |
0.1 | 0.3 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
0.1 | 0.4 | GO:0060591 | chondroblast differentiation(GO:0060591) |
0.1 | 0.4 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
0.1 | 0.3 | GO:2000667 | positive regulation of interleukin-5 secretion(GO:2000664) positive regulation of interleukin-13 secretion(GO:2000667) |
0.1 | 0.2 | GO:1901740 | negative regulation of myoblast fusion(GO:1901740) |
0.1 | 0.3 | GO:0019355 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
0.1 | 0.4 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
0.1 | 0.7 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
0.1 | 0.6 | GO:0042118 | endothelial cell activation(GO:0042118) |
0.1 | 0.2 | GO:0021636 | trigeminal nerve morphogenesis(GO:0021636) trigeminal nerve structural organization(GO:0021637) |
0.1 | 0.3 | GO:0042505 | tyrosine phosphorylation of Stat6 protein(GO:0042505) regulation of tyrosine phosphorylation of Stat6 protein(GO:0042525) |
0.1 | 0.2 | GO:0000255 | allantoin metabolic process(GO:0000255) |
0.1 | 0.2 | GO:0071072 | negative regulation of phospholipid biosynthetic process(GO:0071072) |
0.1 | 0.3 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
0.1 | 0.1 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
0.1 | 0.3 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
0.1 | 0.6 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
0.1 | 0.2 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
0.1 | 0.2 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) |
0.1 | 0.3 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
0.1 | 0.1 | GO:0032252 | secretory granule localization(GO:0032252) |
0.1 | 0.1 | GO:1903753 | negative regulation of p38MAPK cascade(GO:1903753) |
0.1 | 0.2 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
0.1 | 0.4 | GO:0090151 | protein import into mitochondrial inner membrane(GO:0045039) establishment of protein localization to mitochondrial membrane(GO:0090151) |
0.1 | 0.4 | GO:0071280 | cellular response to copper ion(GO:0071280) |
0.1 | 0.1 | GO:0090296 | regulation of mitochondrial DNA replication(GO:0090296) |
0.1 | 0.1 | GO:1900135 | positive regulation of renin secretion into blood stream(GO:1900135) |
0.1 | 2.7 | GO:0070542 | response to fatty acid(GO:0070542) |
0.1 | 0.2 | GO:0010159 | specification of organ position(GO:0010159) |
0.1 | 0.2 | GO:0042167 | heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
0.1 | 0.5 | GO:0097070 | ductus arteriosus closure(GO:0097070) |
0.1 | 0.6 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.1 | 0.4 | GO:0071034 | CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
0.1 | 0.1 | GO:1904192 | cholangiocyte apoptotic process(GO:1902488) regulation of cholangiocyte apoptotic process(GO:1904192) negative regulation of cholangiocyte apoptotic process(GO:1904193) |
0.1 | 0.7 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
0.1 | 0.3 | GO:1990928 | response to amino acid starvation(GO:1990928) |
0.1 | 0.2 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
0.1 | 0.3 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.1 | 0.2 | GO:0002439 | chronic inflammatory response to antigenic stimulus(GO:0002439) |
0.1 | 0.6 | GO:0045631 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
0.1 | 0.3 | GO:1903288 | regulation of potassium ion import(GO:1903286) positive regulation of potassium ion import(GO:1903288) |
0.1 | 0.2 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
0.1 | 0.2 | GO:2000359 | regulation of binding of sperm to zona pellucida(GO:2000359) |
0.1 | 0.4 | GO:0045113 | regulation of integrin biosynthetic process(GO:0045113) |
0.1 | 0.3 | GO:0036166 | phenotypic switching(GO:0036166) |
0.1 | 0.4 | GO:0043461 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
0.1 | 0.2 | GO:0033131 | regulation of glucokinase activity(GO:0033131) |
0.1 | 0.5 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.1 | 0.4 | GO:0015808 | L-alanine transport(GO:0015808) |
0.1 | 1.1 | GO:0000042 | protein targeting to Golgi(GO:0000042) |
0.1 | 0.4 | GO:0018211 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
0.1 | 0.5 | GO:2000675 | negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
0.1 | 0.2 | GO:1990414 | replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
0.1 | 0.1 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
0.1 | 0.4 | GO:0042518 | negative regulation of tyrosine phosphorylation of Stat3 protein(GO:0042518) |
0.1 | 0.5 | GO:0036072 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
0.1 | 2.1 | GO:0019432 | triglyceride biosynthetic process(GO:0019432) |
0.1 | 1.2 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
0.1 | 0.1 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
0.1 | 0.7 | GO:0060546 | negative regulation of necroptotic process(GO:0060546) |
0.1 | 0.6 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.1 | 0.3 | GO:0032439 | endosome localization(GO:0032439) |
0.1 | 0.4 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
0.1 | 0.9 | GO:0048742 | regulation of skeletal muscle fiber development(GO:0048742) |
0.1 | 0.4 | GO:0021780 | oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
0.1 | 3.4 | GO:0048536 | spleen development(GO:0048536) |
0.1 | 0.2 | GO:0061535 | glutamate secretion, neurotransmission(GO:0061535) |
0.1 | 0.7 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
0.1 | 0.6 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
0.1 | 0.4 | GO:0045541 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
0.1 | 0.3 | GO:0042939 | glutathione transport(GO:0034635) tripeptide transport(GO:0042939) |
0.1 | 0.3 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.1 | 0.3 | GO:0046391 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
0.1 | 0.5 | GO:0060346 | bone trabecula formation(GO:0060346) |
0.1 | 1.1 | GO:0051770 | positive regulation of nitric-oxide synthase biosynthetic process(GO:0051770) |
0.1 | 0.2 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.1 | 0.2 | GO:0006600 | creatine metabolic process(GO:0006600) |
0.1 | 0.3 | GO:0006562 | proline catabolic process(GO:0006562) |
0.1 | 0.2 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
0.1 | 0.2 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
0.1 | 0.4 | GO:0042447 | hormone catabolic process(GO:0042447) |
0.1 | 0.4 | GO:0006779 | porphyrin-containing compound biosynthetic process(GO:0006779) tetrapyrrole biosynthetic process(GO:0033014) |
0.1 | 0.6 | GO:0000103 | sulfate assimilation(GO:0000103) |
0.1 | 0.2 | GO:0090209 | negative regulation of triglyceride metabolic process(GO:0090209) |
0.1 | 0.5 | GO:0015919 | peroxisomal membrane transport(GO:0015919) protein import into peroxisome membrane(GO:0045046) |
0.1 | 0.2 | GO:0006083 | acetate metabolic process(GO:0006083) |
0.1 | 0.5 | GO:0060539 | diaphragm development(GO:0060539) |
0.1 | 0.1 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
0.1 | 0.1 | GO:0034436 | glycoprotein transport(GO:0034436) |
0.1 | 1.1 | GO:0003334 | keratinocyte development(GO:0003334) |
0.1 | 0.1 | GO:0072603 | interleukin-5 secretion(GO:0072603) interleukin-13 secretion(GO:0072611) regulation of interleukin-5 secretion(GO:2000662) regulation of interleukin-13 secretion(GO:2000665) |
0.1 | 0.6 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
0.1 | 0.6 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
0.1 | 0.3 | GO:0006742 | NADP catabolic process(GO:0006742) |
0.1 | 0.3 | GO:0046607 | positive regulation of centrosome duplication(GO:0010825) positive regulation of centrosome cycle(GO:0046607) |
0.1 | 0.3 | GO:0032049 | cardiolipin biosynthetic process(GO:0032049) |
0.1 | 0.5 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
0.1 | 0.2 | GO:0086045 | membrane depolarization during AV node cell action potential(GO:0086045) |
0.1 | 0.4 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
0.1 | 0.5 | GO:1902031 | regulation of NADP metabolic process(GO:1902031) |
0.1 | 0.5 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
0.1 | 0.8 | GO:0060628 | regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
0.1 | 0.1 | GO:0090110 | cargo loading into COPII-coated vesicle(GO:0090110) |
0.1 | 0.4 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.1 | 0.2 | GO:0019086 | late viral transcription(GO:0019086) |
0.1 | 1.2 | GO:0017144 | drug metabolic process(GO:0017144) |
0.1 | 0.2 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
0.1 | 0.2 | GO:0072201 | negative regulation of mesenchymal cell proliferation(GO:0072201) |
0.1 | 0.1 | GO:0060684 | epithelial-mesenchymal cell signaling(GO:0060684) |
0.1 | 0.1 | GO:0086023 | adrenergic receptor signaling pathway involved in heart process(GO:0086023) |
0.1 | 0.2 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
0.1 | 0.6 | GO:0071498 | cellular response to fluid shear stress(GO:0071498) |
0.1 | 0.1 | GO:0006971 | hypotonic response(GO:0006971) |
0.1 | 0.1 | GO:0015819 | lysine transport(GO:0015819) |
0.1 | 0.3 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
0.1 | 0.2 | GO:0045901 | positive regulation of translational elongation(GO:0045901) |
0.1 | 1.8 | GO:0006376 | mRNA splice site selection(GO:0006376) |
0.1 | 1.1 | GO:0045116 | protein neddylation(GO:0045116) |
0.1 | 0.2 | GO:0046037 | GMP metabolic process(GO:0046037) |
0.1 | 0.3 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
0.1 | 0.2 | GO:0036215 | response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
0.1 | 0.4 | GO:0006449 | regulation of translational termination(GO:0006449) |
0.1 | 1.0 | GO:0003416 | endochondral bone growth(GO:0003416) |
0.1 | 0.2 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
0.1 | 0.2 | GO:1903849 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
0.1 | 0.4 | GO:0034433 | steroid esterification(GO:0034433) sterol esterification(GO:0034434) cholesterol esterification(GO:0034435) |
0.1 | 1.0 | GO:0014850 | response to muscle activity(GO:0014850) |
0.1 | 0.6 | GO:0030836 | positive regulation of actin filament depolymerization(GO:0030836) |
0.1 | 0.1 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
0.1 | 0.3 | GO:0048014 | Tie signaling pathway(GO:0048014) |
0.1 | 1.1 | GO:0045056 | transcytosis(GO:0045056) |
0.1 | 0.3 | GO:0002784 | regulation of antimicrobial peptide production(GO:0002784) regulation of antibacterial peptide production(GO:0002786) |
0.1 | 0.2 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
0.1 | 0.8 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
0.1 | 0.2 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
0.1 | 0.4 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
0.1 | 0.2 | GO:0046985 | positive regulation of hemoglobin biosynthetic process(GO:0046985) |
0.1 | 0.2 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
0.1 | 0.3 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
0.1 | 2.0 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
0.1 | 0.2 | GO:0033091 | positive regulation of immature T cell proliferation(GO:0033091) |
0.1 | 0.2 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
0.1 | 0.5 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
0.1 | 0.2 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
0.1 | 0.2 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
0.1 | 0.3 | GO:0006407 | rRNA export from nucleus(GO:0006407) |
0.1 | 0.2 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
0.1 | 0.3 | GO:0016093 | polyprenol metabolic process(GO:0016093) |
0.1 | 0.1 | GO:0002215 | defense response to nematode(GO:0002215) |
0.1 | 1.2 | GO:0008053 | mitochondrial fusion(GO:0008053) |
0.1 | 0.1 | GO:0097476 | motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) |
0.1 | 0.1 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
0.1 | 0.1 | GO:0045112 | integrin biosynthetic process(GO:0045112) |
0.1 | 0.1 | GO:0019364 | pyridine nucleotide catabolic process(GO:0019364) |
0.1 | 0.1 | GO:0090191 | negative regulation of branching involved in ureteric bud morphogenesis(GO:0090191) |
0.1 | 0.1 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
0.1 | 0.4 | GO:0070305 | response to cGMP(GO:0070305) |
0.1 | 0.2 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
0.1 | 0.1 | GO:1901896 | positive regulation of calcium-transporting ATPase activity(GO:1901896) |
0.1 | 0.1 | GO:0042091 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
0.1 | 0.7 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.1 | 0.3 | GO:0034080 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
0.1 | 0.4 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.1 | 0.3 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
0.1 | 0.1 | GO:0070947 | neutrophil mediated killing of fungus(GO:0070947) |
0.1 | 0.1 | GO:1900133 | regulation of renin secretion into blood stream(GO:1900133) |
0.1 | 0.1 | GO:0060916 | mesenchymal cell proliferation involved in lung development(GO:0060916) |
0.1 | 2.4 | GO:1904893 | negative regulation of JAK-STAT cascade(GO:0046426) negative regulation of STAT cascade(GO:1904893) |
0.1 | 0.1 | GO:0002370 | natural killer cell cytokine production(GO:0002370) regulation of natural killer cell cytokine production(GO:0002727) |
0.1 | 0.3 | GO:0070257 | positive regulation of mucus secretion(GO:0070257) |
0.1 | 0.2 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
0.1 | 0.1 | GO:1904749 | regulation of protein localization to nucleolus(GO:1904749) positive regulation of protein localization to nucleolus(GO:1904751) |
0.1 | 0.2 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
0.1 | 0.4 | GO:0090031 | positive regulation of steroid hormone biosynthetic process(GO:0090031) |
0.1 | 0.2 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
0.1 | 0.9 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
0.1 | 0.6 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.1 | 0.1 | GO:0002159 | desmosome assembly(GO:0002159) |
0.1 | 0.6 | GO:2000757 | negative regulation of protein acetylation(GO:1901984) negative regulation of peptidyl-lysine acetylation(GO:2000757) |
0.1 | 0.1 | GO:0003057 | regulation of the force of heart contraction by chemical signal(GO:0003057) |
0.1 | 0.2 | GO:1902572 | regulation of serine-type endopeptidase activity(GO:1900003) negative regulation of serine-type endopeptidase activity(GO:1900004) regulation of serine-type peptidase activity(GO:1902571) negative regulation of serine-type peptidase activity(GO:1902572) |
0.1 | 0.3 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
0.1 | 0.1 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
0.1 | 0.2 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
0.1 | 0.2 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
0.1 | 0.1 | GO:0060447 | bud outgrowth involved in lung branching(GO:0060447) |
0.1 | 0.4 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.1 | 0.2 | GO:0019471 | 4-hydroxyproline metabolic process(GO:0019471) |
0.1 | 0.3 | GO:0071286 | cellular response to magnesium ion(GO:0071286) |
0.1 | 0.1 | GO:0010288 | response to lead ion(GO:0010288) |
0.1 | 0.2 | GO:0048143 | astrocyte activation(GO:0048143) |
0.1 | 0.1 | GO:0002282 | microglial cell activation involved in immune response(GO:0002282) |
0.1 | 0.5 | GO:0032525 | somite rostral/caudal axis specification(GO:0032525) |
0.1 | 0.2 | GO:1903587 | regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903587) |
0.1 | 0.2 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
0.1 | 0.3 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.1 | 0.2 | GO:0070831 | basement membrane assembly(GO:0070831) |
0.1 | 0.2 | GO:1901838 | positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
0.1 | 0.1 | GO:0001983 | baroreceptor response to increased systemic arterial blood pressure(GO:0001983) |
0.1 | 0.1 | GO:0045585 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
0.1 | 0.1 | GO:0036015 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
0.1 | 0.3 | GO:0032802 | low-density lipoprotein particle receptor catabolic process(GO:0032802) regulation of low-density lipoprotein particle receptor catabolic process(GO:0032803) |
0.1 | 0.1 | GO:0048290 | isotype switching to IgA isotypes(GO:0048290) regulation of isotype switching to IgA isotypes(GO:0048296) |
0.1 | 0.1 | GO:0061724 | lipophagy(GO:0061724) |
0.1 | 0.1 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
0.1 | 0.3 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
0.1 | 0.1 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
0.1 | 0.5 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
0.1 | 0.2 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
0.1 | 0.2 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
0.1 | 0.1 | GO:0060426 | lung vasculature development(GO:0060426) |
0.1 | 0.1 | GO:1901656 | glycoside transport(GO:1901656) |
0.1 | 0.3 | GO:1900246 | positive regulation of RIG-I signaling pathway(GO:1900246) |
0.1 | 0.1 | GO:1904747 | apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
0.1 | 0.4 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
0.1 | 0.1 | GO:0021764 | amygdala development(GO:0021764) |
0.1 | 0.1 | GO:1901535 | regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
0.1 | 1.2 | GO:0090162 | establishment of epithelial cell polarity(GO:0090162) |
0.1 | 0.3 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
0.1 | 0.8 | GO:0045745 | positive regulation of G-protein coupled receptor protein signaling pathway(GO:0045745) |
0.1 | 1.2 | GO:0006308 | DNA catabolic process(GO:0006308) |
0.1 | 0.1 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
0.1 | 0.2 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.1 | 0.1 | GO:0002434 | immune complex clearance(GO:0002434) |
0.1 | 0.2 | GO:0001994 | norepinephrine-epinephrine vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001994) |
0.1 | 0.5 | GO:2000780 | negative regulation of double-strand break repair(GO:2000780) |
0.1 | 0.2 | GO:0050932 | regulation of pigment cell differentiation(GO:0050932) |
0.1 | 0.2 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.1 | 0.1 | GO:0035912 | dorsal aorta development(GO:0035907) dorsal aorta morphogenesis(GO:0035912) |
0.1 | 0.1 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
0.1 | 0.2 | GO:0001834 | trophectodermal cell proliferation(GO:0001834) |
0.1 | 0.5 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) |
0.1 | 0.2 | GO:0060510 | Type II pneumocyte differentiation(GO:0060510) |
0.1 | 0.3 | GO:0002091 | negative regulation of receptor internalization(GO:0002091) |
0.1 | 0.5 | GO:0018095 | protein polyglutamylation(GO:0018095) |
0.1 | 0.1 | GO:0061152 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
0.1 | 0.2 | GO:0023021 | termination of signal transduction(GO:0023021) |
0.1 | 0.1 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.1 | 0.1 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
0.1 | 0.3 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.1 | 0.2 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
0.1 | 0.1 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
0.1 | 0.1 | GO:1902226 | regulation of macrophage colony-stimulating factor signaling pathway(GO:1902226) regulation of response to macrophage colony-stimulating factor(GO:1903969) regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903972) |
0.1 | 0.1 | GO:0010841 | positive regulation of circadian sleep/wake cycle, wakefulness(GO:0010841) |
0.1 | 0.1 | GO:0000393 | spliceosomal conformational changes to generate catalytic conformation(GO:0000393) |
0.1 | 0.1 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
0.1 | 0.2 | GO:0042219 | cellular modified amino acid catabolic process(GO:0042219) |
0.1 | 0.2 | GO:0002636 | positive regulation of germinal center formation(GO:0002636) |
0.1 | 0.1 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
0.1 | 0.8 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
0.1 | 0.1 | GO:0070255 | regulation of mucus secretion(GO:0070255) |
0.1 | 0.1 | GO:0032071 | regulation of endodeoxyribonuclease activity(GO:0032071) |
0.1 | 0.8 | GO:0006883 | cellular sodium ion homeostasis(GO:0006883) |
0.1 | 0.1 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
0.1 | 0.1 | GO:0006116 | NADH oxidation(GO:0006116) |
0.1 | 0.2 | GO:0072318 | clathrin coat disassembly(GO:0072318) |
0.1 | 0.2 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) |
0.1 | 0.1 | GO:0060174 | limb bud formation(GO:0060174) |
0.1 | 0.1 | GO:1901662 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
0.1 | 0.1 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
0.1 | 0.4 | GO:0006183 | GTP biosynthetic process(GO:0006183) |
0.1 | 0.1 | GO:1902075 | cellular response to salt(GO:1902075) |
0.1 | 0.2 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
0.1 | 0.3 | GO:0043031 | negative regulation of macrophage activation(GO:0043031) |
0.1 | 0.2 | GO:0006290 | pyrimidine dimer repair(GO:0006290) |
0.1 | 0.1 | GO:0014819 | regulation of skeletal muscle contraction(GO:0014819) |
0.1 | 0.2 | GO:1904424 | regulation of GTP binding(GO:1904424) |
0.1 | 0.1 | GO:0046416 | D-amino acid catabolic process(GO:0019478) D-amino acid metabolic process(GO:0046416) |
0.1 | 0.1 | GO:0072718 | response to cisplatin(GO:0072718) |
0.1 | 0.1 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
0.1 | 0.1 | GO:0006152 | purine nucleoside catabolic process(GO:0006152) purine ribonucleoside catabolic process(GO:0046130) |
0.1 | 0.4 | GO:1903779 | regulation of cardiac conduction(GO:1903779) |
0.1 | 0.1 | GO:0006678 | glucosylceramide metabolic process(GO:0006678) |
0.1 | 0.1 | GO:0090027 | negative regulation of monocyte chemotaxis(GO:0090027) |
0.1 | 0.2 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
0.1 | 0.1 | GO:0044340 | canonical Wnt signaling pathway involved in regulation of cell proliferation(GO:0044340) |
0.1 | 0.2 | GO:0001547 | antral ovarian follicle growth(GO:0001547) |
0.1 | 0.4 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
0.1 | 0.3 | GO:0045792 | negative regulation of cell size(GO:0045792) |
0.1 | 0.1 | GO:0036296 | response to increased oxygen levels(GO:0036296) response to hyperoxia(GO:0055093) |
0.1 | 0.1 | GO:0042940 | D-amino acid transport(GO:0042940) |
0.1 | 0.1 | GO:0009158 | ribonucleoside monophosphate catabolic process(GO:0009158) purine ribonucleoside monophosphate catabolic process(GO:0009169) |
0.1 | 0.1 | GO:0006655 | phosphatidylglycerol biosynthetic process(GO:0006655) |
0.1 | 0.2 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
0.1 | 0.1 | GO:2000347 | positive regulation of hepatocyte proliferation(GO:2000347) |
0.1 | 0.1 | GO:0060596 | mammary placode formation(GO:0060596) |
0.1 | 0.2 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
0.1 | 0.2 | GO:0010587 | miRNA catabolic process(GO:0010587) |
0.1 | 0.5 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
0.1 | 0.1 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
0.1 | 0.7 | GO:0042438 | melanin biosynthetic process(GO:0042438) |
0.1 | 0.1 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
0.1 | 0.1 | GO:0090135 | actin filament branching(GO:0090135) |
0.1 | 0.3 | GO:0042026 | protein refolding(GO:0042026) |
0.1 | 0.2 | GO:0061010 | gall bladder development(GO:0061010) |
0.1 | 0.2 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
0.1 | 0.3 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
0.1 | 0.1 | GO:1903984 | positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
0.1 | 0.2 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
0.1 | 0.7 | GO:0010257 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.1 | 0.2 | GO:2000622 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
0.1 | 0.5 | GO:0035025 | positive regulation of Rho protein signal transduction(GO:0035025) |
0.1 | 0.1 | GO:0051095 | regulation of helicase activity(GO:0051095) |
0.1 | 0.9 | GO:0030970 | retrograde protein transport, ER to cytosol(GO:0030970) |
0.0 | 0.2 | GO:0007000 | nucleolus organization(GO:0007000) |
0.0 | 0.4 | GO:0006198 | cAMP catabolic process(GO:0006198) |
0.0 | 0.0 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
0.0 | 0.5 | GO:0016446 | somatic hypermutation of immunoglobulin genes(GO:0016446) |
0.0 | 0.1 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
0.0 | 0.1 | GO:0048619 | embryonic hindgut morphogenesis(GO:0048619) |
0.0 | 0.2 | GO:0006108 | malate metabolic process(GO:0006108) |
0.0 | 0.1 | GO:0072513 | cardioblast proliferation(GO:0003263) regulation of cardioblast proliferation(GO:0003264) regulation of secondary heart field cardioblast proliferation(GO:0003266) positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
0.0 | 0.2 | GO:0036289 | peptidyl-serine autophosphorylation(GO:0036289) |
0.0 | 0.5 | GO:0030852 | regulation of granulocyte differentiation(GO:0030852) |
0.0 | 0.4 | GO:0018342 | protein prenylation(GO:0018342) prenylation(GO:0097354) |
0.0 | 0.0 | GO:0010751 | negative regulation of nitric oxide mediated signal transduction(GO:0010751) |
0.0 | 0.1 | GO:0000087 | mitotic M phase(GO:0000087) |
0.0 | 0.1 | GO:0060501 | positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
0.0 | 0.2 | GO:0051031 | tRNA transport(GO:0051031) |
0.0 | 0.6 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
0.0 | 0.0 | GO:0051084 | 'de novo' protein folding(GO:0006458) 'de novo' posttranslational protein folding(GO:0051084) |
0.0 | 0.1 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
0.0 | 0.1 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.0 | 1.3 | GO:0000460 | maturation of 5.8S rRNA(GO:0000460) |
0.0 | 0.4 | GO:0034389 | lipid particle organization(GO:0034389) |
0.0 | 0.2 | GO:1904861 | excitatory synapse assembly(GO:1904861) |
0.0 | 0.3 | GO:0015871 | choline transport(GO:0015871) |
0.0 | 0.2 | GO:0035589 | G-protein coupled purinergic nucleotide receptor signaling pathway(GO:0035589) |
0.0 | 0.0 | GO:0071335 | hair follicle cell proliferation(GO:0071335) regulation of hair follicle cell proliferation(GO:0071336) |
0.0 | 0.4 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.0 | 0.1 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
0.0 | 0.1 | GO:0090361 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
0.0 | 0.2 | GO:0009162 | deoxyribonucleoside monophosphate metabolic process(GO:0009162) |
0.0 | 0.5 | GO:0055070 | copper ion homeostasis(GO:0055070) |
0.0 | 0.3 | GO:0030223 | neutrophil differentiation(GO:0030223) |
0.0 | 0.0 | GO:0072566 | chemokine (C-X-C motif) ligand 1 production(GO:0072566) regulation of chemokine (C-X-C motif) ligand 1 production(GO:2000338) |
0.0 | 0.2 | GO:0032754 | positive regulation of interleukin-5 production(GO:0032754) |
0.0 | 0.2 | GO:0035627 | ceramide transport(GO:0035627) |
0.0 | 0.2 | GO:0045908 | negative regulation of vasodilation(GO:0045908) |
0.0 | 0.1 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
0.0 | 0.2 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
0.0 | 0.3 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.0 | 0.4 | GO:0035909 | aorta morphogenesis(GO:0035909) |
0.0 | 0.1 | GO:0072221 | distal convoluted tubule development(GO:0072025) DCT cell differentiation(GO:0072069) metanephric distal convoluted tubule development(GO:0072221) metanephric distal tubule development(GO:0072235) metanephric DCT cell differentiation(GO:0072240) |
0.0 | 0.1 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
0.0 | 0.7 | GO:0007026 | negative regulation of microtubule depolymerization(GO:0007026) |
0.0 | 0.1 | GO:0017198 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.0 | 0.1 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.0 | 0.0 | GO:1901844 | regulation of cell communication by electrical coupling involved in cardiac conduction(GO:1901844) |
0.0 | 0.1 | GO:0090598 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
0.0 | 0.2 | GO:0046015 | regulation of transcription by glucose(GO:0046015) |
0.0 | 0.3 | GO:0045835 | negative regulation of meiotic nuclear division(GO:0045835) |
0.0 | 0.2 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
0.0 | 0.1 | GO:0060926 | cardiac pacemaker cell development(GO:0060926) |
0.0 | 0.1 | GO:0009068 | aspartate family amino acid catabolic process(GO:0009068) |
0.0 | 0.5 | GO:0097150 | neuronal stem cell population maintenance(GO:0097150) |
0.0 | 0.1 | GO:0090114 | COPII-coated vesicle budding(GO:0090114) |
0.0 | 0.3 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
0.0 | 0.2 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
0.0 | 0.1 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
0.0 | 0.2 | GO:0050746 | regulation of lipoprotein metabolic process(GO:0050746) |
0.0 | 0.1 | GO:0051013 | microtubule severing(GO:0051013) |
0.0 | 0.2 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
0.0 | 0.0 | GO:0048341 | paraxial mesoderm formation(GO:0048341) |
0.0 | 0.1 | GO:0046952 | ketone body catabolic process(GO:0046952) |
0.0 | 0.2 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
0.0 | 0.7 | GO:0048147 | negative regulation of fibroblast proliferation(GO:0048147) |
0.0 | 0.3 | GO:0098734 | protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
0.0 | 0.3 | GO:0051418 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
0.0 | 0.1 | GO:0016553 | base conversion or substitution editing(GO:0016553) |
0.0 | 0.3 | GO:0032060 | bleb assembly(GO:0032060) |
0.0 | 0.1 | GO:0070914 | UV-damage excision repair(GO:0070914) |
0.0 | 0.4 | GO:0090207 | regulation of triglyceride metabolic process(GO:0090207) |
0.0 | 0.1 | GO:0002326 | B cell lineage commitment(GO:0002326) |
0.0 | 0.2 | GO:0044821 | meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
0.0 | 0.1 | GO:0015705 | iodide transport(GO:0015705) |
0.0 | 0.0 | GO:1900451 | positive regulation of glutamate receptor signaling pathway(GO:1900451) positive regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000969) |
0.0 | 0.2 | GO:0019740 | nitrogen utilization(GO:0019740) |
0.0 | 0.0 | GO:0043366 | beta selection(GO:0043366) |
0.0 | 0.1 | GO:0034214 | protein hexamerization(GO:0034214) |
0.0 | 0.0 | GO:1902969 | mitotic DNA replication(GO:1902969) |
0.0 | 0.3 | GO:0035871 | protein K11-linked deubiquitination(GO:0035871) |
0.0 | 1.3 | GO:0051784 | negative regulation of nuclear division(GO:0051784) |
0.0 | 0.1 | GO:1990034 | calcium ion export from cell(GO:1990034) |
0.0 | 0.5 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
0.0 | 0.6 | GO:0010842 | retina layer formation(GO:0010842) |
0.0 | 0.2 | GO:0036010 | protein localization to endosome(GO:0036010) |
0.0 | 0.2 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
0.0 | 0.0 | GO:2000325 | regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
0.0 | 0.2 | GO:0045414 | regulation of interleukin-8 biosynthetic process(GO:0045414) |
0.0 | 0.3 | GO:0042795 | snRNA transcription from RNA polymerase II promoter(GO:0042795) |
0.0 | 0.5 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
0.0 | 0.1 | GO:0060084 | synaptic transmission involved in micturition(GO:0060084) |
0.0 | 0.1 | GO:0048478 | replication fork protection(GO:0048478) |
0.0 | 0.0 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
0.0 | 0.0 | GO:0050955 | thermoception(GO:0050955) |
0.0 | 0.4 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
0.0 | 0.0 | GO:0071360 | cellular response to exogenous dsRNA(GO:0071360) |
0.0 | 0.0 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
0.0 | 0.1 | GO:1903332 | regulation of protein folding(GO:1903332) |
0.0 | 0.3 | GO:0071361 | cellular response to ethanol(GO:0071361) |
0.0 | 0.2 | GO:0002183 | cytoplasmic translational initiation(GO:0002183) |
0.0 | 0.1 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
0.0 | 0.7 | GO:0048642 | negative regulation of skeletal muscle tissue development(GO:0048642) |
0.0 | 0.4 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
0.0 | 0.2 | GO:0002862 | negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
0.0 | 0.1 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
0.0 | 0.2 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
0.0 | 0.1 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
0.0 | 0.0 | GO:0032077 | positive regulation of deoxyribonuclease activity(GO:0032077) |
0.0 | 0.2 | GO:0006924 | activation-induced cell death of T cells(GO:0006924) |
0.0 | 0.1 | GO:0048102 | autophagic cell death(GO:0048102) |
0.0 | 0.0 | GO:1903799 | negative regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903799) |
0.0 | 0.0 | GO:0032364 | oxygen homeostasis(GO:0032364) metanephric collecting duct development(GO:0072205) |
0.0 | 0.2 | GO:0001514 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
0.0 | 0.1 | GO:0090214 | spongiotrophoblast layer developmental growth(GO:0090214) |
0.0 | 0.1 | GO:0045945 | positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
0.0 | 0.0 | GO:0045590 | negative regulation of regulatory T cell differentiation(GO:0045590) |
0.0 | 0.1 | GO:0021603 | cranial nerve formation(GO:0021603) |
0.0 | 0.1 | GO:0015820 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.0 | 0.1 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
0.0 | 0.0 | GO:0002925 | positive regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002925) |
0.0 | 0.6 | GO:0048240 | sperm capacitation(GO:0048240) |
0.0 | 0.1 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
0.0 | 0.2 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
0.0 | 0.1 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
0.0 | 0.2 | GO:0018065 | protein-cofactor linkage(GO:0018065) |
0.0 | 0.3 | GO:0045586 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
0.0 | 0.1 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
0.0 | 0.0 | GO:1904526 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
0.0 | 0.1 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
0.0 | 0.2 | GO:0034312 | diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
0.0 | 0.1 | GO:0035095 | behavioral response to nicotine(GO:0035095) |
0.0 | 0.0 | GO:0010749 | regulation of nitric oxide mediated signal transduction(GO:0010749) |
0.0 | 0.1 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
0.0 | 0.0 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
0.0 | 0.1 | GO:0048769 | sarcomerogenesis(GO:0048769) |
0.0 | 0.1 | GO:0006590 | thyroid hormone generation(GO:0006590) |
0.0 | 0.2 | GO:0070995 | NADPH oxidation(GO:0070995) |
0.0 | 0.0 | GO:1902570 | protein localization to nucleolus(GO:1902570) |
0.0 | 0.1 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
0.0 | 0.0 | GO:0060751 | branch elongation involved in mammary gland duct branching(GO:0060751) |
0.0 | 0.1 | GO:0031125 | rRNA 3'-end processing(GO:0031125) DNA deamination(GO:0045006) polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
0.0 | 0.1 | GO:0072307 | metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
0.0 | 0.0 | GO:0072202 | cell differentiation involved in metanephros development(GO:0072202) |
0.0 | 0.1 | GO:1902744 | negative regulation of lamellipodium organization(GO:1902744) |
0.0 | 0.1 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) mitochondrial large ribosomal subunit assembly(GO:1902775) |
0.0 | 0.0 | GO:1903116 | positive regulation of actin filament-based movement(GO:1903116) |
0.0 | 1.0 | GO:0009166 | nucleotide catabolic process(GO:0009166) |
0.0 | 0.1 | GO:0021873 | forebrain neuroblast division(GO:0021873) |
0.0 | 0.1 | GO:2000105 | positive regulation of DNA-dependent DNA replication(GO:2000105) |
0.0 | 0.2 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
0.0 | 0.0 | GO:0007494 | midgut development(GO:0007494) |
0.0 | 0.1 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
0.0 | 0.1 | GO:0035814 | negative regulation of renal sodium excretion(GO:0035814) |
0.0 | 0.1 | GO:1901524 | regulation of macromitophagy(GO:1901524) negative regulation of macromitophagy(GO:1901525) |
0.0 | 0.1 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.0 | 0.0 | GO:0060112 | generation of ovulation cycle rhythm(GO:0060112) |
0.0 | 0.1 | GO:0000963 | mitochondrial RNA processing(GO:0000963) |
0.0 | 0.1 | GO:0006573 | valine metabolic process(GO:0006573) |
0.0 | 0.2 | GO:0036089 | cleavage furrow formation(GO:0036089) |
0.0 | 0.1 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.0 | 0.4 | GO:0032012 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.0 | 0.2 | GO:0014054 | positive regulation of gamma-aminobutyric acid secretion(GO:0014054) |
0.0 | 0.0 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
0.0 | 0.0 | GO:0031126 | snoRNA 3'-end processing(GO:0031126) |
0.0 | 0.1 | GO:0007529 | establishment of synaptic specificity at neuromuscular junction(GO:0007529) |
0.0 | 0.0 | GO:0046984 | regulation of hemoglobin biosynthetic process(GO:0046984) |
0.0 | 0.0 | GO:0048597 | post-embryonic camera-type eye morphogenesis(GO:0048597) |
0.0 | 0.1 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
0.0 | 0.2 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
0.0 | 0.1 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
0.0 | 0.2 | GO:0042407 | cristae formation(GO:0042407) |
0.0 | 0.1 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
0.0 | 0.0 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
0.0 | 0.0 | GO:0072393 | microtubule anchoring at microtubule organizing center(GO:0072393) |
0.0 | 0.1 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
0.0 | 1.0 | GO:0061077 | chaperone-mediated protein folding(GO:0061077) |
0.0 | 0.1 | GO:0006107 | oxaloacetate metabolic process(GO:0006107) |
0.0 | 0.1 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
0.0 | 0.0 | GO:1901856 | negative regulation of cellular respiration(GO:1901856) |
0.0 | 0.2 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
0.0 | 0.1 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.0 | 0.3 | GO:0001976 | neurological system process involved in regulation of systemic arterial blood pressure(GO:0001976) |
0.0 | 0.1 | GO:0016237 | lysosomal microautophagy(GO:0016237) piecemeal microautophagy of nucleus(GO:0034727) late nucleophagy(GO:0044805) |
0.0 | 0.0 | GO:1901228 | positive regulation of transcription from RNA polymerase II promoter involved in myocardial precursor cell differentiation(GO:0003257) positive regulation of transcription from RNA polymerase II promoter involved in heart development(GO:1901228) |
0.0 | 0.1 | GO:0071816 | protein insertion into ER membrane(GO:0045048) tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
0.0 | 0.2 | GO:0006004 | fucose metabolic process(GO:0006004) |
0.0 | 0.2 | GO:0002024 | diet induced thermogenesis(GO:0002024) adaptive thermogenesis(GO:1990845) |
0.0 | 0.1 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
0.0 | 0.2 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
0.0 | 0.4 | GO:0060046 | regulation of acrosome reaction(GO:0060046) |
0.0 | 0.1 | GO:0006670 | sphingosine metabolic process(GO:0006670) |
0.0 | 0.1 | GO:0042723 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
0.0 | 0.1 | GO:0090274 | positive regulation of somatostatin secretion(GO:0090274) |
0.0 | 0.1 | GO:0048752 | semicircular canal morphogenesis(GO:0048752) |
0.0 | 0.1 | GO:0060023 | soft palate development(GO:0060023) |
0.0 | 0.1 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.0 | 0.4 | GO:0046622 | positive regulation of organ growth(GO:0046622) |
0.0 | 0.1 | GO:0060148 | positive regulation of posttranscriptional gene silencing(GO:0060148) |
0.0 | 0.0 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
0.0 | 0.1 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
0.0 | 0.1 | GO:0090188 | negative regulation of pancreatic juice secretion(GO:0090188) |
0.0 | 0.1 | GO:0042256 | mature ribosome assembly(GO:0042256) |
0.0 | 0.2 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
0.0 | 0.1 | GO:0030007 | cellular potassium ion homeostasis(GO:0030007) |
0.0 | 0.1 | GO:0060177 | regulation of angiotensin metabolic process(GO:0060177) |
0.0 | 0.1 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
0.0 | 0.1 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
0.0 | 0.1 | GO:0060618 | nipple development(GO:0060618) |
0.0 | 0.2 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
0.0 | 0.1 | GO:0031443 | fast-twitch skeletal muscle fiber contraction(GO:0031443) |
0.0 | 0.1 | GO:0048681 | negative regulation of axon regeneration(GO:0048681) |
0.0 | 0.0 | GO:0030167 | proteoglycan catabolic process(GO:0030167) |
0.0 | 0.1 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.0 | 0.1 | GO:0045176 | apical protein localization(GO:0045176) |
0.0 | 0.1 | GO:0033567 | DNA replication, Okazaki fragment processing(GO:0033567) |
0.0 | 0.1 | GO:0070986 | left/right axis specification(GO:0070986) |
0.0 | 0.1 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
0.0 | 0.6 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
0.0 | 0.1 | GO:0060017 | parathyroid gland development(GO:0060017) |
0.0 | 0.0 | GO:0034035 | purine ribonucleoside bisphosphate metabolic process(GO:0034035) |
0.0 | 0.1 | GO:0000291 | nuclear-transcribed mRNA catabolic process, exonucleolytic(GO:0000291) |
0.0 | 0.1 | GO:0039529 | RIG-I signaling pathway(GO:0039529) |
0.0 | 0.5 | GO:0006270 | DNA replication initiation(GO:0006270) |
0.0 | 0.1 | GO:0015889 | cobalamin transport(GO:0015889) |
0.0 | 0.0 | GO:0032696 | negative regulation of interleukin-13 production(GO:0032696) |
0.0 | 0.1 | GO:0002739 | regulation of cytokine secretion involved in immune response(GO:0002739) |
0.0 | 0.1 | GO:1902475 | L-alpha-amino acid transmembrane transport(GO:1902475) |
0.0 | 0.6 | GO:0006446 | regulation of translational initiation(GO:0006446) |
0.0 | 0.1 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.0 | 0.5 | GO:0022904 | respiratory electron transport chain(GO:0022904) |
0.0 | 0.1 | GO:0018230 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
0.0 | 0.4 | GO:0044458 | motile cilium assembly(GO:0044458) |
0.0 | 0.1 | GO:0035625 | receptor transactivation(GO:0035624) epidermal growth factor-activated receptor transactivation by G-protein coupled receptor signaling pathway(GO:0035625) |
0.0 | 0.0 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
0.0 | 1.1 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
0.0 | 0.6 | GO:0033120 | positive regulation of RNA splicing(GO:0033120) |
0.0 | 1.0 | GO:0006400 | tRNA modification(GO:0006400) |
0.0 | 0.0 | GO:0018214 | protein carboxylation(GO:0018214) |
0.0 | 0.1 | GO:0035822 | meiotic gene conversion(GO:0006311) gene conversion(GO:0035822) |
0.0 | 0.0 | GO:0034398 | telomere tethering at nuclear periphery(GO:0034398) |
0.0 | 0.1 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
0.0 | 0.1 | GO:0070162 | adiponectin secretion(GO:0070162) regulation of adiponectin secretion(GO:0070163) negative regulation of adiponectin secretion(GO:0070164) |
0.0 | 0.0 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.0 | 0.0 | GO:0035459 | cargo loading into vesicle(GO:0035459) |
0.0 | 0.2 | GO:0045187 | regulation of circadian sleep/wake cycle, sleep(GO:0045187) |
0.0 | 0.1 | GO:0033260 | nuclear DNA replication(GO:0033260) |
0.0 | 0.5 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
0.0 | 0.4 | GO:0018345 | protein palmitoylation(GO:0018345) |
0.0 | 0.2 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
0.0 | 0.4 | GO:0008272 | sulfate transport(GO:0008272) |
0.0 | 0.1 | GO:0032328 | alanine transport(GO:0032328) |
0.0 | 0.2 | GO:0021984 | adenohypophysis development(GO:0021984) |
0.0 | 0.0 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
0.0 | 0.0 | GO:0039528 | cytoplasmic pattern recognition receptor signaling pathway in response to virus(GO:0039528) |
0.0 | 0.0 | GO:0071436 | sodium ion export(GO:0071436) |
0.0 | 0.3 | GO:1904874 | regulation of telomerase RNA localization to Cajal body(GO:1904872) positive regulation of telomerase RNA localization to Cajal body(GO:1904874) |
0.0 | 0.0 | GO:0036462 | TRAIL-activated apoptotic signaling pathway(GO:0036462) |
0.0 | 0.0 | GO:1902837 | amino acid import into cell(GO:1902837) |
0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 1.1 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
0.0 | 0.0 | GO:1903059 | regulation of protein lipidation(GO:1903059) |
0.0 | 0.0 | GO:1903208 | neuron death in response to hydrogen peroxide(GO:0036476) regulation of hydrogen peroxide-induced neuron death(GO:1903207) negative regulation of hydrogen peroxide-induced neuron death(GO:1903208) |
0.0 | 0.0 | GO:0032304 | negative regulation of icosanoid secretion(GO:0032304) |
0.0 | 0.2 | GO:0006383 | transcription from RNA polymerase III promoter(GO:0006383) |
0.0 | 0.1 | GO:0051549 | regulation of keratinocyte migration(GO:0051547) positive regulation of keratinocyte migration(GO:0051549) |
0.0 | 0.1 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
0.0 | 0.1 | GO:0010388 | protein deneddylation(GO:0000338) cullin deneddylation(GO:0010388) |
0.0 | 0.2 | GO:0032516 | positive regulation of phosphoprotein phosphatase activity(GO:0032516) |
0.0 | 0.7 | GO:0042073 | intraciliary transport(GO:0042073) |
0.0 | 0.0 | GO:0034139 | regulation of toll-like receptor 3 signaling pathway(GO:0034139) positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
0.0 | 0.2 | GO:0048714 | positive regulation of oligodendrocyte differentiation(GO:0048714) |
0.0 | 0.8 | GO:0032543 | mitochondrial translation(GO:0032543) |
0.0 | 0.1 | GO:0048254 | snoRNA localization(GO:0048254) |
0.0 | 0.1 | GO:0019896 | axonal transport of mitochondrion(GO:0019896) |
0.0 | 0.0 | GO:0007468 | regulation of rhodopsin gene expression(GO:0007468) |
0.0 | 0.1 | GO:1904322 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
0.0 | 0.1 | GO:0021785 | branchiomotor neuron axon guidance(GO:0021785) |
0.0 | 0.0 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
0.0 | 0.1 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
0.0 | 0.0 | GO:2001180 | negative regulation of interleukin-10 secretion(GO:2001180) |
0.0 | 0.0 | GO:0022007 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
0.0 | 0.1 | GO:0002674 | negative regulation of acute inflammatory response(GO:0002674) |
0.0 | 0.2 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
0.0 | 0.1 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
0.0 | 0.1 | GO:0045060 | negative thymic T cell selection(GO:0045060) |
0.0 | 0.0 | GO:0060287 | epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
0.0 | 0.8 | GO:0032465 | regulation of cytokinesis(GO:0032465) |
0.0 | 0.2 | GO:0045898 | regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045898) |
0.0 | 0.1 | GO:0035437 | maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
0.0 | 0.1 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
0.0 | 0.0 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
0.0 | 0.1 | GO:0030889 | negative regulation of B cell proliferation(GO:0030889) |
0.0 | 0.2 | GO:0031116 | positive regulation of microtubule polymerization(GO:0031116) |
0.0 | 0.0 | GO:0051447 | negative regulation of meiotic cell cycle(GO:0051447) |
0.0 | 0.0 | GO:2000598 | regulation of cyclin catabolic process(GO:2000598) negative regulation of cyclin catabolic process(GO:2000599) |
0.0 | 0.1 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.0 | 0.4 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
0.0 | 0.1 | GO:0032800 | receptor biosynthetic process(GO:0032800) |
0.0 | 0.0 | GO:0032700 | negative regulation of interleukin-17 production(GO:0032700) |
0.0 | 0.0 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
0.0 | 0.1 | GO:0035729 | response to hepatocyte growth factor(GO:0035728) cellular response to hepatocyte growth factor stimulus(GO:0035729) |
0.0 | 0.1 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
0.0 | 0.1 | GO:0043249 | erythrocyte maturation(GO:0043249) |
0.0 | 0.0 | GO:2000002 | negative regulation of DNA damage checkpoint(GO:2000002) |
0.0 | 0.2 | GO:0000059 | protein import into nucleus, docking(GO:0000059) |
0.0 | 0.0 | GO:0045602 | negative regulation of endothelial cell differentiation(GO:0045602) |
0.0 | 0.0 | GO:1902302 | regulation of potassium ion export(GO:1902302) |
0.0 | 0.0 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
0.0 | 0.1 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.0 | 0.1 | GO:0045217 | cell-cell junction maintenance(GO:0045217) |
0.0 | 0.1 | GO:0045793 | positive regulation of cell size(GO:0045793) |
0.0 | 0.1 | GO:0043116 | negative regulation of vascular permeability(GO:0043116) |
0.0 | 0.0 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
0.0 | 0.1 | GO:0021871 | forebrain regionalization(GO:0021871) |
0.0 | 0.0 | GO:0014717 | regulation of satellite cell activation involved in skeletal muscle regeneration(GO:0014717) satellite cell activation involved in skeletal muscle regeneration(GO:0014901) |
0.0 | 0.0 | GO:0046471 | phosphatidylglycerol metabolic process(GO:0046471) |
0.0 | 0.1 | GO:0015074 | DNA integration(GO:0015074) |
0.0 | 0.1 | GO:0036336 | dendritic cell migration(GO:0036336) |
0.0 | 0.1 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
0.0 | 0.1 | GO:0002176 | male germ cell proliferation(GO:0002176) |
0.0 | 0.1 | GO:0021846 | cell proliferation in forebrain(GO:0021846) |
0.0 | 0.1 | GO:0070307 | lens fiber cell development(GO:0070307) |
0.0 | 0.1 | GO:0070366 | regulation of hepatocyte differentiation(GO:0070366) |
0.0 | 0.0 | GO:0044789 | modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) |
0.0 | 0.3 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
0.0 | 0.0 | GO:0006210 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
0.0 | 0.1 | GO:0043586 | tongue development(GO:0043586) |
0.0 | 0.0 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
0.0 | 0.1 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
0.0 | 0.1 | GO:0009629 | response to gravity(GO:0009629) |
0.0 | 0.1 | GO:0046959 | habituation(GO:0046959) |
0.0 | 0.1 | GO:0042255 | ribosome assembly(GO:0042255) |
0.0 | 0.0 | GO:0015793 | glycerol transport(GO:0015793) |
0.0 | 0.3 | GO:0031110 | regulation of microtubule polymerization or depolymerization(GO:0031110) |
0.0 | 0.2 | GO:0061462 | protein localization to lysosome(GO:0061462) |
0.0 | 0.0 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
0.0 | 0.0 | GO:0072396 | response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) response to intra-S DNA damage checkpoint signaling(GO:0072429) |
0.0 | 0.2 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
0.0 | 0.0 | GO:0033625 | positive regulation of integrin activation(GO:0033625) |
0.0 | 0.0 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
0.0 | 0.0 | GO:1902373 | negative regulation of mRNA catabolic process(GO:1902373) |
0.0 | 0.2 | GO:0007019 | microtubule depolymerization(GO:0007019) |
0.0 | 0.2 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
0.0 | 0.1 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
0.0 | 0.0 | GO:0014043 | negative regulation of neuron maturation(GO:0014043) |
0.0 | 0.0 | GO:0021593 | rhombomere morphogenesis(GO:0021593) |
0.0 | 0.0 | GO:0046083 | adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
0.0 | 0.1 | GO:0033962 | cytoplasmic mRNA processing body assembly(GO:0033962) |
0.0 | 0.0 | GO:0060051 | negative regulation of protein glycosylation(GO:0060051) |
0.0 | 0.0 | GO:0090237 | regulation of arachidonic acid secretion(GO:0090237) |
0.0 | 0.1 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
0.0 | 0.0 | GO:0006531 | aspartate metabolic process(GO:0006531) |
0.0 | 0.1 | GO:0061418 | regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061418) |
0.0 | 0.0 | GO:1900227 | positive regulation of NLRP3 inflammasome complex assembly(GO:1900227) |
0.0 | 0.0 | GO:0043651 | linoleic acid metabolic process(GO:0043651) |
0.0 | 0.1 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
0.0 | 0.0 | GO:0070586 | cell-cell adhesion involved in gastrulation(GO:0070586) |
0.0 | 0.0 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
0.0 | 0.0 | GO:0010520 | regulation of reciprocal meiotic recombination(GO:0010520) |
0.0 | 0.1 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
0.0 | 0.1 | GO:0033630 | positive regulation of cell adhesion mediated by integrin(GO:0033630) |
0.0 | 0.1 | GO:0046684 | response to pyrethroid(GO:0046684) |
0.0 | 0.1 | GO:0060467 | negative regulation of fertilization(GO:0060467) |
0.0 | 0.1 | GO:0045722 | positive regulation of gluconeogenesis(GO:0045722) |
0.0 | 0.0 | GO:0097084 | vascular smooth muscle cell development(GO:0097084) |
0.0 | 0.0 | GO:0060157 | urinary bladder development(GO:0060157) |
0.0 | 0.1 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
0.0 | 0.0 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
0.0 | 0.0 | GO:0033087 | negative regulation of immature T cell proliferation(GO:0033087) |
0.0 | 0.0 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
0.0 | 0.1 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
0.0 | 0.1 | GO:0042492 | gamma-delta T cell differentiation(GO:0042492) |
0.0 | 0.0 | GO:0002074 | extraocular skeletal muscle development(GO:0002074) |
0.0 | 0.0 | GO:0042494 | detection of bacterial lipoprotein(GO:0042494) |
0.0 | 0.0 | GO:0016264 | gap junction assembly(GO:0016264) |
0.0 | 0.0 | GO:0048630 | skeletal muscle tissue growth(GO:0048630) |
0.0 | 0.0 | GO:0070268 | cornification(GO:0070268) |
0.0 | 0.0 | GO:0046878 | positive regulation of saliva secretion(GO:0046878) |
0.0 | 0.1 | GO:0061469 | regulation of type B pancreatic cell proliferation(GO:0061469) |
0.0 | 0.0 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
0.0 | 0.3 | GO:0006182 | cGMP biosynthetic process(GO:0006182) |
0.0 | 0.0 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
0.0 | 0.0 | GO:0061355 | Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) |
0.0 | 0.0 | GO:1901894 | regulation of calcium-transporting ATPase activity(GO:1901894) |
0.0 | 0.0 | GO:1903887 | motile primary cilium assembly(GO:1903887) |
0.0 | 0.0 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
0.0 | 0.0 | GO:0033160 | positive regulation of protein import into nucleus, translocation(GO:0033160) |
0.0 | 0.0 | GO:0090166 | Golgi disassembly(GO:0090166) |
0.0 | 0.1 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
0.0 | 0.3 | GO:0045103 | intermediate filament-based process(GO:0045103) |
0.0 | 0.7 | GO:0042274 | ribosomal small subunit biogenesis(GO:0042274) |
0.0 | 0.0 | GO:0060753 | regulation of mast cell chemotaxis(GO:0060753) |
0.0 | 0.0 | GO:0002904 | positive regulation of B cell apoptotic process(GO:0002904) |
0.0 | 0.0 | GO:0035886 | vascular smooth muscle cell differentiation(GO:0035886) |
0.0 | 0.1 | GO:0051788 | response to misfolded protein(GO:0051788) |
0.0 | 0.0 | GO:0003177 | pulmonary valve development(GO:0003177) pulmonary valve morphogenesis(GO:0003184) |
0.0 | 0.1 | GO:0033227 | dsRNA transport(GO:0033227) |
0.0 | 0.1 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
0.0 | 0.0 | GO:2000630 | positive regulation of miRNA metabolic process(GO:2000630) |
0.0 | 0.0 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.0 | 0.1 | GO:0009191 | ribonucleoside diphosphate catabolic process(GO:0009191) |
0.0 | 0.0 | GO:0070365 | hepatocyte differentiation(GO:0070365) |
0.0 | 0.0 | GO:0070535 | histone H2A K63-linked ubiquitination(GO:0070535) |
0.0 | 0.0 | GO:0046477 | glycosylceramide catabolic process(GO:0046477) |
0.0 | 0.0 | GO:0003010 | voluntary skeletal muscle contraction(GO:0003010) twitch skeletal muscle contraction(GO:0014721) |
0.0 | 0.0 | GO:0039694 | viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
0.0 | 0.1 | GO:0046033 | AMP metabolic process(GO:0046033) |
0.0 | 0.1 | GO:0010738 | regulation of protein kinase A signaling(GO:0010738) |
0.0 | 0.1 | GO:0015813 | L-glutamate transport(GO:0015813) |
0.0 | 0.0 | GO:2000870 | regulation of progesterone secretion(GO:2000870) |
0.0 | 0.1 | GO:0006465 | signal peptide processing(GO:0006465) |
0.0 | 0.1 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
0.0 | 0.1 | GO:0043576 | regulation of respiratory gaseous exchange(GO:0043576) |
0.0 | 0.0 | GO:0017085 | response to insecticide(GO:0017085) |
0.0 | 0.0 | GO:1902774 | late endosome to lysosome transport(GO:1902774) |
0.0 | 0.1 | GO:0006032 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
0.0 | 0.0 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
0.0 | 0.1 | GO:0006903 | vesicle targeting(GO:0006903) |
0.0 | 0.2 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
0.0 | 0.1 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
0.0 | 0.1 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
0.0 | 0.0 | GO:0002581 | negative regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002581) |
0.0 | 0.1 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.0 | 0.0 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
0.0 | 0.0 | GO:2000781 | positive regulation of double-strand break repair(GO:2000781) |
0.0 | 0.0 | GO:1904431 | positive regulation of t-circle formation(GO:1904431) |
0.0 | 0.1 | GO:0016242 | negative regulation of macroautophagy(GO:0016242) |
0.0 | 0.0 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
0.0 | 0.0 | GO:0045199 | maintenance of epithelial cell apical/basal polarity(GO:0045199) |
0.0 | 0.1 | GO:0044036 | cell wall macromolecule metabolic process(GO:0044036) cell wall organization or biogenesis(GO:0071554) |
0.0 | 0.4 | GO:0006493 | protein O-linked glycosylation(GO:0006493) |
0.0 | 0.0 | GO:0035372 | protein localization to microtubule(GO:0035372) |
0.0 | 0.0 | GO:0015780 | nucleotide-sugar transport(GO:0015780) pyrimidine nucleotide-sugar transport(GO:0015781) |
0.0 | 0.1 | GO:0043278 | response to isoquinoline alkaloid(GO:0014072) response to morphine(GO:0043278) |
0.0 | 0.0 | GO:2000520 | regulation of immunological synapse formation(GO:2000520) |
0.0 | 0.1 | GO:2000647 | negative regulation of stem cell proliferation(GO:2000647) |
0.0 | 0.0 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
0.0 | 0.1 | GO:0043968 | histone H2A acetylation(GO:0043968) |
0.0 | 0.0 | GO:0060134 | prepulse inhibition(GO:0060134) |
0.0 | 0.0 | GO:0002752 | cell surface pattern recognition receptor signaling pathway(GO:0002752) |
0.0 | 0.0 | GO:0043628 | ncRNA 3'-end processing(GO:0043628) |
0.0 | 0.1 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
0.0 | 0.0 | GO:0006013 | mannose metabolic process(GO:0006013) |
0.0 | 0.0 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
0.0 | 0.1 | GO:0072498 | embryonic skeletal joint development(GO:0072498) |
0.0 | 0.1 | GO:0006474 | N-terminal protein amino acid acetylation(GO:0006474) |
0.0 | 0.0 | GO:0086015 | SA node cell action potential(GO:0086015) SA node cell to atrial cardiac muscle cell signalling(GO:0086018) SA node cell to atrial cardiac muscle cell communication(GO:0086070) |
0.0 | 0.0 | GO:2000172 | regulation of branching morphogenesis of a nerve(GO:2000172) |
0.0 | 0.1 | GO:0070886 | positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
0.0 | 0.0 | GO:0002534 | cytokine production involved in inflammatory response(GO:0002534) |
0.0 | 0.0 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
0.0 | 0.0 | GO:0002778 | antimicrobial peptide production(GO:0002775) antibacterial peptide production(GO:0002778) |
0.0 | 0.0 | GO:0021542 | dentate gyrus development(GO:0021542) |
0.0 | 0.0 | GO:0002676 | regulation of chronic inflammatory response(GO:0002676) |
0.0 | 0.0 | GO:0060462 | lung lobe development(GO:0060462) lung lobe morphogenesis(GO:0060463) |
0.0 | 0.0 | GO:0035751 | regulation of lysosomal lumen pH(GO:0035751) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
4.7 | 14.2 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.8 | 4.2 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.7 | 3.0 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.5 | 2.7 | GO:0097433 | dense body(GO:0097433) |
0.5 | 2.1 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.5 | 2.6 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.5 | 1.9 | GO:0005955 | calcineurin complex(GO:0005955) |
0.4 | 1.3 | GO:0097441 | basilar dendrite(GO:0097441) |
0.4 | 1.1 | GO:0031523 | Myb complex(GO:0031523) |
0.4 | 1.1 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
0.3 | 3.8 | GO:0070852 | cell body fiber(GO:0070852) |
0.3 | 0.9 | GO:0048179 | activin receptor complex(GO:0048179) |
0.3 | 2.0 | GO:0045180 | basal cortex(GO:0045180) |
0.2 | 1.0 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.2 | 1.0 | GO:0033269 | internode region of axon(GO:0033269) |
0.2 | 0.7 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.2 | 1.0 | GO:0071203 | WASH complex(GO:0071203) |
0.2 | 1.1 | GO:0031298 | replication fork protection complex(GO:0031298) |
0.2 | 2.4 | GO:0044292 | dendrite terminus(GO:0044292) |
0.2 | 3.4 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.2 | 0.6 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.2 | 1.5 | GO:0042587 | glycogen granule(GO:0042587) |
0.2 | 0.8 | GO:0005579 | membrane attack complex(GO:0005579) |
0.2 | 0.5 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
0.2 | 0.5 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.2 | 1.3 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
0.2 | 0.8 | GO:0045261 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
0.1 | 0.4 | GO:0097413 | Lewy body(GO:0097413) |
0.1 | 0.8 | GO:0000306 | extrinsic component of vacuolar membrane(GO:0000306) |
0.1 | 0.6 | GO:0070545 | PeBoW complex(GO:0070545) |
0.1 | 0.4 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
0.1 | 0.4 | GO:0032010 | phagolysosome(GO:0032010) |
0.1 | 0.5 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.1 | 0.6 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.1 | 4.8 | GO:0030964 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
0.1 | 0.2 | GO:0097451 | glial limiting end-foot(GO:0097451) |
0.1 | 0.5 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
0.1 | 0.4 | GO:0072534 | perineuronal net(GO:0072534) |
0.1 | 0.3 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
0.1 | 1.1 | GO:0030867 | rough endoplasmic reticulum membrane(GO:0030867) |
0.1 | 0.9 | GO:1990909 | Wnt signalosome(GO:1990909) |
0.1 | 0.3 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.1 | 0.3 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
0.1 | 0.3 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.1 | 0.4 | GO:0045293 | mRNA editing complex(GO:0045293) |
0.1 | 0.4 | GO:0000938 | GARP complex(GO:0000938) |
0.1 | 0.4 | GO:0030127 | COPII vesicle coat(GO:0030127) |
0.1 | 1.5 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
0.1 | 0.1 | GO:1990745 | EARP complex(GO:1990745) |
0.1 | 0.7 | GO:0032009 | early phagosome(GO:0032009) |
0.1 | 4.5 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.1 | 0.3 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.1 | 0.4 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.1 | 1.1 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.1 | 0.1 | GO:0055087 | Ski complex(GO:0055087) |
0.1 | 0.3 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
0.1 | 0.7 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
0.1 | 1.1 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.1 | 0.3 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
0.1 | 0.5 | GO:0031415 | NatA complex(GO:0031415) |
0.1 | 0.3 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
0.1 | 0.4 | GO:1990130 | Iml1 complex(GO:1990130) |
0.1 | 0.4 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
0.1 | 1.0 | GO:0032426 | stereocilium tip(GO:0032426) |
0.1 | 0.1 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
0.1 | 0.6 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.1 | 0.4 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.1 | 1.3 | GO:0005614 | interstitial matrix(GO:0005614) |
0.1 | 0.6 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.1 | 0.9 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
0.1 | 0.3 | GO:0098533 | ATPase dependent transmembrane transport complex(GO:0098533) |
0.1 | 0.2 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
0.1 | 0.2 | GO:0019815 | B cell receptor complex(GO:0019815) |
0.1 | 1.8 | GO:0030686 | 90S preribosome(GO:0030686) |
0.1 | 1.3 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.1 | 2.0 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
0.1 | 2.4 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.1 | 0.6 | GO:0045275 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
0.1 | 0.3 | GO:0097209 | epidermal lamellar body(GO:0097209) |
0.1 | 0.1 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
0.1 | 1.4 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.1 | 0.2 | GO:0071556 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) |
0.1 | 0.2 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
0.1 | 0.6 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.1 | 0.5 | GO:0042575 | DNA polymerase complex(GO:0042575) |
0.1 | 0.1 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.1 | 1.0 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
0.1 | 0.4 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.1 | 0.2 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
0.1 | 0.1 | GO:0031429 | box H/ACA snoRNP complex(GO:0031429) box H/ACA RNP complex(GO:0072588) |
0.1 | 0.2 | GO:0005608 | laminin-3 complex(GO:0005608) |
0.1 | 0.5 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
0.1 | 0.2 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.1 | 0.4 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.1 | 0.3 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
0.1 | 0.7 | GO:0042405 | nuclear inclusion body(GO:0042405) |
0.1 | 1.6 | GO:0048786 | presynaptic active zone(GO:0048786) |
0.1 | 0.4 | GO:0097542 | ciliary tip(GO:0097542) |
0.1 | 1.4 | GO:0005719 | nuclear euchromatin(GO:0005719) |
0.1 | 0.1 | GO:0097443 | sorting endosome(GO:0097443) |
0.1 | 0.4 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.1 | 0.7 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
0.1 | 0.2 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.1 | 0.4 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
0.1 | 0.7 | GO:0070069 | cytochrome complex(GO:0070069) |
0.1 | 0.3 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.1 | 0.9 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.1 | 0.1 | GO:0032127 | dense core granule membrane(GO:0032127) |
0.1 | 0.5 | GO:0005685 | U1 snRNP(GO:0005685) |
0.1 | 0.5 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.1 | 0.2 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.1 | 0.4 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.1 | 0.5 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.1 | 0.4 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
0.1 | 0.5 | GO:0031010 | ISWI-type complex(GO:0031010) |
0.1 | 0.1 | GO:0000109 | nucleotide-excision repair complex(GO:0000109) nucleotide-excision repair factor 1 complex(GO:0000110) |
0.1 | 0.3 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
0.1 | 0.4 | GO:0001520 | outer dense fiber(GO:0001520) |
0.1 | 0.3 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.1 | 0.5 | GO:0036156 | inner dynein arm(GO:0036156) |
0.1 | 0.4 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
0.1 | 0.5 | GO:0032797 | SMN complex(GO:0032797) |
0.1 | 1.2 | GO:0044665 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
0.1 | 0.5 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.1 | 0.2 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
0.0 | 0.2 | GO:0030891 | VCB complex(GO:0030891) |
0.0 | 0.4 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
0.0 | 0.1 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
0.0 | 0.3 | GO:0001650 | fibrillar center(GO:0001650) |
0.0 | 0.1 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
0.0 | 0.1 | GO:0032280 | symmetric synapse(GO:0032280) |
0.0 | 0.2 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
0.0 | 0.6 | GO:0036038 | MKS complex(GO:0036038) |
0.0 | 1.2 | GO:0051233 | spindle midzone(GO:0051233) |
0.0 | 0.5 | GO:0071564 | npBAF complex(GO:0071564) |
0.0 | 0.2 | GO:0097452 | GAIT complex(GO:0097452) |
0.0 | 6.0 | GO:0005759 | mitochondrial matrix(GO:0005759) |
0.0 | 0.4 | GO:0031512 | motile primary cilium(GO:0031512) |
0.0 | 0.5 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
0.0 | 0.1 | GO:1990357 | terminal web(GO:1990357) |
0.0 | 0.2 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.0 | 0.0 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
0.0 | 0.5 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.0 | 0.5 | GO:0010369 | chromocenter(GO:0010369) |
0.0 | 0.6 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) |
0.0 | 0.5 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
0.0 | 0.1 | GO:1990635 | proximal dendrite(GO:1990635) |
0.0 | 0.2 | GO:0042583 | chromaffin granule(GO:0042583) |
0.0 | 0.2 | GO:0045239 | tricarboxylic acid cycle enzyme complex(GO:0045239) |
0.0 | 0.1 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.0 | 0.1 | GO:0001651 | dense fibrillar component(GO:0001651) |
0.0 | 0.1 | GO:0098803 | respiratory chain complex(GO:0098803) |
0.0 | 0.8 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
0.0 | 0.0 | GO:0000811 | GINS complex(GO:0000811) |
0.0 | 0.4 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.0 | 0.3 | GO:0005675 | holo TFIIH complex(GO:0005675) |
0.0 | 0.1 | GO:1990423 | RZZ complex(GO:1990423) |
0.0 | 0.1 | GO:0034448 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.0 | 0.7 | GO:0043034 | costamere(GO:0043034) |
0.0 | 0.2 | GO:0097470 | ribbon synapse(GO:0097470) |
0.0 | 0.1 | GO:0045263 | proton-transporting ATP synthase complex, coupling factor F(o)(GO:0045263) |
0.0 | 0.8 | GO:0005686 | U2 snRNP(GO:0005686) |
0.0 | 0.2 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.0 | 0.2 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.0 | 0.3 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.0 | 0.2 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.0 | 0.2 | GO:0000812 | Swr1 complex(GO:0000812) |
0.0 | 0.2 | GO:0034709 | methylosome(GO:0034709) |
0.0 | 0.1 | GO:0071942 | XPC complex(GO:0071942) |
0.0 | 0.3 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
0.0 | 0.3 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.0 | 0.3 | GO:0000439 | core TFIIH complex(GO:0000439) |
0.0 | 0.2 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.0 | 0.6 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.0 | 0.0 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
0.0 | 0.9 | GO:0008287 | protein serine/threonine phosphatase complex(GO:0008287) phosphatase complex(GO:1903293) |
0.0 | 0.1 | GO:0071953 | elastic fiber(GO:0071953) |
0.0 | 0.5 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
0.0 | 0.1 | GO:0005606 | laminin-1 complex(GO:0005606) |
0.0 | 0.2 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
0.0 | 0.1 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.0 | 0.1 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.0 | 0.2 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.0 | 0.4 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
0.0 | 0.2 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.0 | 0.2 | GO:0061617 | MICOS complex(GO:0061617) |
0.0 | 1.1 | GO:0031672 | A band(GO:0031672) |
0.0 | 0.1 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
0.0 | 0.0 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
0.0 | 0.1 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.0 | 0.1 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.0 | 0.1 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.0 | 0.2 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
0.0 | 0.3 | GO:0031616 | spindle pole centrosome(GO:0031616) |
0.0 | 0.4 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.0 | 0.4 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.0 | 0.7 | GO:0070461 | SAGA-type complex(GO:0070461) |
0.0 | 0.2 | GO:0002177 | manchette(GO:0002177) |
0.0 | 1.4 | GO:0016363 | nuclear matrix(GO:0016363) |
0.0 | 0.9 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.0 | 0.1 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.0 | 0.1 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
0.0 | 0.2 | GO:0000778 | condensed nuclear chromosome kinetochore(GO:0000778) |
0.0 | 0.3 | GO:0042613 | MHC class II protein complex(GO:0042613) |
0.0 | 0.3 | GO:0001527 | microfibril(GO:0001527) |
0.0 | 0.1 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
0.0 | 0.2 | GO:0000796 | condensin complex(GO:0000796) |
0.0 | 3.4 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
0.0 | 1.2 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
0.0 | 0.3 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.0 | 0.1 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.0 | 0.6 | GO:0002080 | acrosomal membrane(GO:0002080) |
0.0 | 0.4 | GO:0030315 | T-tubule(GO:0030315) |
0.0 | 0.7 | GO:0031941 | filamentous actin(GO:0031941) |
0.0 | 0.1 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.0 | 0.1 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.0 | 0.1 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
0.0 | 0.2 | GO:0005915 | zonula adherens(GO:0005915) |
0.0 | 0.1 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
0.0 | 0.2 | GO:0016012 | dystroglycan complex(GO:0016011) sarcoglycan complex(GO:0016012) |
0.0 | 0.2 | GO:0071986 | Ragulator complex(GO:0071986) |
0.0 | 0.3 | GO:0043196 | varicosity(GO:0043196) |
0.0 | 0.2 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.0 | 0.1 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
0.0 | 0.2 | GO:0001939 | female pronucleus(GO:0001939) |
0.0 | 0.1 | GO:0005827 | polar microtubule(GO:0005827) |
0.0 | 0.0 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.0 | 0.3 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
0.0 | 0.7 | GO:0016459 | myosin complex(GO:0016459) |
0.0 | 0.4 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
0.0 | 0.2 | GO:0000791 | euchromatin(GO:0000791) |
0.0 | 0.3 | GO:0031907 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
0.0 | 0.1 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.0 | 0.6 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.0 | 0.6 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
0.0 | 0.1 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.0 | 0.1 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
0.0 | 0.1 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.0 | 1.2 | GO:0005930 | axoneme(GO:0005930) ciliary plasm(GO:0097014) |
0.0 | 0.0 | GO:0030314 | junctional membrane complex(GO:0030314) |
0.0 | 0.0 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.0 | 0.0 | GO:0000802 | transverse filament(GO:0000802) |
0.0 | 0.1 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
0.0 | 0.1 | GO:0032444 | activin responsive factor complex(GO:0032444) |
0.0 | 0.1 | GO:0000445 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
0.0 | 0.7 | GO:0015935 | small ribosomal subunit(GO:0015935) |
0.0 | 0.1 | GO:0097422 | tubular endosome(GO:0097422) |
0.0 | 0.1 | GO:1990716 | axonemal central apparatus(GO:1990716) |
0.0 | 0.3 | GO:0036379 | striated muscle thin filament(GO:0005865) myofilament(GO:0036379) |
0.0 | 0.2 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
0.0 | 0.9 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
0.0 | 0.2 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.0 | 0.1 | GO:0000346 | transcription export complex(GO:0000346) |
0.0 | 0.1 | GO:0032300 | mismatch repair complex(GO:0032300) |
0.0 | 0.1 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
0.0 | 0.0 | GO:0000835 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) |
0.0 | 0.1 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.0 | 0.1 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.0 | 0.0 | GO:0097427 | microtubule bundle(GO:0097427) |
0.0 | 0.1 | GO:0031143 | pseudopodium(GO:0031143) |
0.0 | 0.1 | GO:0001652 | granular component(GO:0001652) |
0.0 | 0.8 | GO:0090575 | RNA polymerase II transcription factor complex(GO:0090575) |
0.0 | 0.7 | GO:0001725 | stress fiber(GO:0001725) contractile actin filament bundle(GO:0097517) |
0.0 | 0.0 | GO:0044232 | organelle membrane contact site(GO:0044232) |
0.0 | 0.0 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.0 | 0.5 | GO:0045171 | intercellular bridge(GO:0045171) |
0.0 | 0.2 | GO:0031304 | intrinsic component of mitochondrial inner membrane(GO:0031304) |
0.0 | 0.0 | GO:0098536 | deuterosome(GO:0098536) |
0.0 | 0.3 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
0.0 | 0.0 | GO:1990812 | growth cone filopodium(GO:1990812) |
0.0 | 0.1 | GO:0097546 | ciliary base(GO:0097546) |
0.0 | 0.1 | GO:0070876 | SOSS complex(GO:0070876) |
0.0 | 14.8 | GO:0005783 | endoplasmic reticulum(GO:0005783) |
0.0 | 0.3 | GO:0032809 | neuronal cell body membrane(GO:0032809) |
0.0 | 0.0 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
0.0 | 3.3 | GO:0005912 | adherens junction(GO:0005912) |
0.0 | 0.1 | GO:0000801 | central element(GO:0000801) |
0.0 | 0.1 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.0 | 0.0 | GO:0031084 | BLOC-2 complex(GO:0031084) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
4.8 | 14.3 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
1.1 | 3.4 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
0.9 | 2.6 | GO:0070538 | oleic acid binding(GO:0070538) |
0.8 | 2.4 | GO:0004771 | sterol esterase activity(GO:0004771) |
0.8 | 1.6 | GO:0038181 | bile acid receptor activity(GO:0038181) |
0.8 | 1.6 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
0.8 | 2.3 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
0.7 | 4.3 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) |
0.7 | 2.0 | GO:0070644 | vitamin D response element binding(GO:0070644) |
0.7 | 4.0 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
0.6 | 0.6 | GO:0000009 | alpha-1,6-mannosyltransferase activity(GO:0000009) |
0.6 | 5.5 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.6 | 1.8 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.6 | 1.7 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.6 | 1.7 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.6 | 2.2 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
0.6 | 1.7 | GO:0016215 | acyl-CoA desaturase activity(GO:0016215) |
0.5 | 1.5 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.5 | 1.5 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.5 | 1.5 | GO:0015182 | L-asparagine transmembrane transporter activity(GO:0015182) L-glutamine transmembrane transporter activity(GO:0015186) |
0.4 | 1.2 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
0.4 | 1.1 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.4 | 1.8 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.4 | 1.4 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.3 | 1.4 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.3 | 1.0 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
0.3 | 6.6 | GO:0003785 | actin monomer binding(GO:0003785) |
0.3 | 0.9 | GO:0032190 | acrosin binding(GO:0032190) |
0.3 | 1.2 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
0.3 | 0.9 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
0.3 | 0.3 | GO:0016426 | tRNA (adenine) methyltransferase activity(GO:0016426) tRNA (adenine-N1-)-methyltransferase activity(GO:0016429) |
0.3 | 0.9 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
0.3 | 1.4 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
0.3 | 1.9 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
0.3 | 0.8 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.3 | 0.8 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.3 | 0.5 | GO:0042281 | dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase activity(GO:0042281) |
0.3 | 1.3 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.2 | 3.2 | GO:0070402 | NADPH binding(GO:0070402) |
0.2 | 1.0 | GO:1990239 | steroid hormone binding(GO:1990239) |
0.2 | 1.2 | GO:0004396 | glucokinase activity(GO:0004340) hexokinase activity(GO:0004396) |
0.2 | 1.0 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
0.2 | 1.2 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
0.2 | 5.7 | GO:0030552 | cAMP binding(GO:0030552) |
0.2 | 0.7 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.2 | 2.5 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.2 | 0.4 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
0.2 | 7.2 | GO:0018731 | prenylcysteine methylesterase activity(GO:0010296) 1-oxa-2-oxocycloheptane lactonase activity(GO:0018731) sulfolactone hydrolase activity(GO:0018732) butyrolactone hydrolase activity(GO:0018734) endosulfan lactone lactonase activity(GO:0034892) L-ascorbate 6-phosphate lactonase activity(GO:0035460) Ser-tRNA(Thr) hydrolase activity(GO:0043905) Ala-tRNA(Pro) hydrolase activity(GO:0043906) Cys-tRNA(Pro) hydrolase activity(GO:0043907) Ser(Gly)-tRNA(Ala) hydrolase activity(GO:0043908) all-trans-retinyl-palmitate hydrolase, all-trans-retinol forming activity(GO:0047376) mannosyl-oligosaccharide 1,6-alpha-mannosidase activity(GO:0052767) mannosyl-oligosaccharide 1,3-alpha-mannosidase activity(GO:0052768) methyl indole-3-acetate esterase activity(GO:0080030) methyl salicylate esterase activity(GO:0080031) methyl jasmonate esterase activity(GO:0080032) |
0.2 | 1.1 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
0.2 | 0.6 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.2 | 0.6 | GO:0071614 | linoleic acid epoxygenase activity(GO:0071614) |
0.2 | 0.6 | GO:0055100 | adiponectin binding(GO:0055100) |
0.2 | 2.4 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
0.2 | 1.2 | GO:0034875 | oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
0.2 | 0.8 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.2 | 2.5 | GO:0015643 | toxic substance binding(GO:0015643) |
0.2 | 0.4 | GO:0030228 | lipoprotein particle receptor activity(GO:0030228) |
0.2 | 0.5 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
0.2 | 0.5 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
0.2 | 0.5 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
0.2 | 0.5 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.2 | 1.3 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
0.2 | 0.7 | GO:0008948 | oxaloacetate decarboxylase activity(GO:0008948) |
0.2 | 0.9 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
0.2 | 1.6 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.2 | 0.3 | GO:0002054 | nucleobase binding(GO:0002054) |
0.2 | 1.0 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
0.2 | 1.4 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
0.2 | 0.7 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
0.2 | 0.3 | GO:0008545 | JUN kinase kinase activity(GO:0008545) |
0.2 | 0.3 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
0.2 | 1.3 | GO:0035197 | siRNA binding(GO:0035197) |
0.2 | 1.3 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.2 | 0.5 | GO:0016532 | superoxide dismutase copper chaperone activity(GO:0016532) |
0.2 | 0.5 | GO:0035514 | DNA demethylase activity(GO:0035514) |
0.2 | 0.6 | GO:0016212 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
0.2 | 0.5 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.2 | 0.8 | GO:0070728 | leucine binding(GO:0070728) |
0.2 | 0.6 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
0.2 | 2.6 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
0.2 | 0.6 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
0.1 | 0.7 | GO:0015181 | arginine transmembrane transporter activity(GO:0015181) L-lysine transmembrane transporter activity(GO:0015189) |
0.1 | 2.2 | GO:0016646 | oxidoreductase activity, acting on the CH-NH group of donors, NAD or NADP as acceptor(GO:0016646) |
0.1 | 3.0 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.1 | 0.6 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
0.1 | 0.4 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
0.1 | 0.4 | GO:2001070 | starch binding(GO:2001070) |
0.1 | 0.6 | GO:0043559 | insulin binding(GO:0043559) |
0.1 | 0.6 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.1 | 0.4 | GO:0035671 | enone reductase activity(GO:0035671) |
0.1 | 1.5 | GO:0030553 | cGMP binding(GO:0030553) |
0.1 | 1.8 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.1 | 4.6 | GO:0016749 | N-succinyltransferase activity(GO:0016749) |
0.1 | 0.7 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
0.1 | 4.8 | GO:0017046 | peptide hormone binding(GO:0017046) |
0.1 | 0.9 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.1 | 0.4 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.1 | 0.1 | GO:0016649 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.1 | 0.4 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
0.1 | 1.1 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.1 | 0.1 | GO:0030351 | inositol-1,3,4,5,6-pentakisphosphate 3-phosphatase activity(GO:0030351) inositol-1,4,5,6-tetrakisphosphate 6-phosphatase activity(GO:0030352) inositol pentakisphosphate phosphatase activity(GO:0052827) |
0.1 | 0.1 | GO:0005290 | L-histidine transmembrane transporter activity(GO:0005290) |
0.1 | 0.8 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
0.1 | 0.8 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
0.1 | 0.4 | GO:0015065 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
0.1 | 0.1 | GO:0008579 | JUN kinase phosphatase activity(GO:0008579) |
0.1 | 0.4 | GO:0030350 | iron-responsive element binding(GO:0030350) |
0.1 | 0.4 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
0.1 | 0.4 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
0.1 | 0.1 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.1 | 0.6 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
0.1 | 0.7 | GO:0015288 | porin activity(GO:0015288) |
0.1 | 0.6 | GO:0008430 | selenium binding(GO:0008430) |
0.1 | 2.4 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.1 | 0.1 | GO:0016015 | morphogen activity(GO:0016015) |
0.1 | 0.3 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.1 | 0.3 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
0.1 | 0.6 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.1 | 0.6 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
0.1 | 0.3 | GO:0004802 | transketolase activity(GO:0004802) |
0.1 | 0.3 | GO:0004705 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
0.1 | 0.3 | GO:0061513 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
0.1 | 0.3 | GO:0004515 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.1 | 0.9 | GO:0046972 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
0.1 | 0.4 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
0.1 | 3.4 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
0.1 | 0.4 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.1 | 0.3 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
0.1 | 0.1 | GO:0016427 | tRNA (cytosine) methyltransferase activity(GO:0016427) tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
0.1 | 0.8 | GO:0016679 | oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) |
0.1 | 0.6 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
0.1 | 0.8 | GO:0043140 | ATP-dependent 3'-5' DNA helicase activity(GO:0043140) |
0.1 | 1.0 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
0.1 | 0.4 | GO:0004370 | glycerol kinase activity(GO:0004370) |
0.1 | 0.4 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.1 | 0.1 | GO:0000405 | bubble DNA binding(GO:0000405) |
0.1 | 1.4 | GO:0030955 | potassium ion binding(GO:0030955) |
0.1 | 1.5 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
0.1 | 0.7 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.1 | 0.4 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
0.1 | 0.5 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
0.1 | 0.4 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.1 | 0.2 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
0.1 | 1.5 | GO:0004120 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) photoreceptor cyclic-nucleotide phosphodiesterase activity(GO:0004120) 7,8-dihydro-D-neopterin 2',3'-cyclic phosphate phosphodiesterase activity(GO:0044688) inositol phosphosphingolipid phospholipase activity(GO:0052712) inositol phosphorylceramide phospholipase activity(GO:0052713) mannosyl-inositol phosphorylceramide phospholipase activity(GO:0052714) mannosyl-diinositol phosphorylceramide phospholipase activity(GO:0052715) |
0.1 | 0.3 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
0.1 | 0.4 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.1 | 0.3 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
0.1 | 0.7 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
0.1 | 0.3 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
0.1 | 1.8 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
0.1 | 0.8 | GO:0038191 | neuropilin binding(GO:0038191) |
0.1 | 0.7 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.1 | 0.2 | GO:0050692 | DBD domain binding(GO:0050692) |
0.1 | 0.9 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.1 | 0.1 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.1 | 0.3 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
0.1 | 0.5 | GO:0043426 | MRF binding(GO:0043426) |
0.1 | 0.5 | GO:0030957 | Tat protein binding(GO:0030957) |
0.1 | 0.3 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
0.1 | 0.3 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
0.1 | 0.3 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.1 | 0.4 | GO:0086007 | voltage-gated calcium channel activity involved in cardiac muscle cell action potential(GO:0086007) |
0.1 | 0.5 | GO:0036122 | BMP binding(GO:0036122) |
0.1 | 0.6 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
0.1 | 0.3 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
0.1 | 0.1 | GO:0016937 | short-branched-chain-acyl-CoA dehydrogenase activity(GO:0016937) |
0.1 | 0.3 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
0.1 | 0.3 | GO:0043515 | kinetochore binding(GO:0043515) |
0.1 | 0.3 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
0.1 | 0.3 | GO:0030519 | snoRNP binding(GO:0030519) |
0.1 | 0.2 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.1 | 0.3 | GO:0005047 | signal recognition particle binding(GO:0005047) |
0.1 | 0.3 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.1 | 0.3 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
0.1 | 0.1 | GO:0003896 | DNA primase activity(GO:0003896) |
0.1 | 0.3 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
0.1 | 0.2 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.1 | 0.5 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.1 | 0.1 | GO:0070699 | type II activin receptor binding(GO:0070699) |
0.1 | 0.9 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.1 | 1.6 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.1 | 0.2 | GO:0003909 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
0.1 | 0.3 | GO:0032564 | dATP binding(GO:0032564) |
0.1 | 0.4 | GO:0004556 | alpha-amylase activity(GO:0004556) |
0.1 | 0.4 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
0.1 | 0.2 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
0.1 | 0.9 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.1 | 0.2 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
0.1 | 2.0 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
0.1 | 0.4 | GO:0031685 | adenosine receptor binding(GO:0031685) |
0.1 | 1.5 | GO:0016864 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
0.1 | 0.4 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.1 | 1.1 | GO:0015924 | mannosyl-oligosaccharide mannosidase activity(GO:0015924) |
0.1 | 0.4 | GO:0016712 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced flavin or flavoprotein as one donor, and incorporation of one atom of oxygen(GO:0016712) |
0.1 | 0.2 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.1 | 0.2 | GO:0097016 | L27 domain binding(GO:0097016) |
0.1 | 0.2 | GO:0034594 | phosphatidylinositol trisphosphate phosphatase activity(GO:0034594) inositol tetrakisphosphate phosphatase activity(GO:0052743) |
0.1 | 0.5 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.1 | 0.2 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.1 | 0.7 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.1 | 0.2 | GO:0032357 | oxidized DNA binding(GO:0032356) oxidized purine DNA binding(GO:0032357) |
0.1 | 4.4 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
0.1 | 0.5 | GO:0005536 | glucose binding(GO:0005536) |
0.1 | 1.1 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
0.1 | 0.7 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.1 | 0.2 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.1 | 0.2 | GO:0035877 | death effector domain binding(GO:0035877) |
0.1 | 1.9 | GO:0034596 | phosphatidylinositol phosphate 4-phosphatase activity(GO:0034596) |
0.1 | 0.6 | GO:0002162 | dystroglycan binding(GO:0002162) |
0.1 | 0.5 | GO:0034713 | type I transforming growth factor beta receptor binding(GO:0034713) |
0.1 | 2.2 | GO:0015485 | cholesterol binding(GO:0015485) |
0.1 | 0.4 | GO:0016443 | bidentate ribonuclease III activity(GO:0016443) |
0.1 | 0.4 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.1 | 0.2 | GO:0043546 | molybdopterin cofactor binding(GO:0043546) |
0.1 | 0.2 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.1 | 0.1 | GO:0015923 | mannosidase activity(GO:0015923) |
0.1 | 1.2 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
0.1 | 0.2 | GO:0019862 | IgA binding(GO:0019862) |
0.1 | 0.1 | GO:0035939 | microsatellite binding(GO:0035939) |
0.1 | 1.1 | GO:0043274 | phospholipase binding(GO:0043274) |
0.1 | 1.9 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
0.1 | 0.2 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
0.1 | 0.1 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
0.1 | 1.9 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
0.1 | 0.3 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
0.1 | 1.0 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
0.1 | 0.1 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
0.1 | 0.3 | GO:0016312 | inositol bisphosphate phosphatase activity(GO:0016312) |
0.1 | 0.1 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.1 | 0.3 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
0.1 | 0.4 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
0.1 | 0.2 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
0.1 | 0.1 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.1 | 0.3 | GO:0001642 | group III metabotropic glutamate receptor activity(GO:0001642) |
0.1 | 0.1 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
0.1 | 0.1 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
0.1 | 0.1 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.1 | 0.2 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
0.1 | 0.2 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
0.1 | 0.2 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.1 | 0.3 | GO:0016004 | phospholipase activator activity(GO:0016004) |
0.1 | 0.3 | GO:0017040 | ceramidase activity(GO:0017040) |
0.1 | 0.3 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.1 | 0.7 | GO:0070700 | BMP receptor binding(GO:0070700) |
0.1 | 0.2 | GO:0004359 | glutaminase activity(GO:0004359) |
0.1 | 0.2 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.1 | 0.1 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
0.1 | 0.1 | GO:0001032 | RNA polymerase III regulatory region DNA binding(GO:0001016) RNA polymerase III type 1 promoter DNA binding(GO:0001030) RNA polymerase III type 2 promoter DNA binding(GO:0001031) RNA polymerase III type 3 promoter DNA binding(GO:0001032) 5S rDNA binding(GO:0080084) |
0.1 | 0.7 | GO:0017065 | single-strand selective uracil DNA N-glycosylase activity(GO:0017065) nicotinamide riboside hydrolase activity(GO:0070635) nicotinic acid riboside hydrolase activity(GO:0070636) deoxyribonucleoside 5'-monophosphate N-glycosidase activity(GO:0070694) |
0.1 | 1.0 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
0.1 | 1.9 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
0.1 | 1.2 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
0.1 | 0.1 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.1 | 0.4 | GO:0050733 | RS domain binding(GO:0050733) |
0.1 | 0.1 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
0.1 | 0.4 | GO:0016889 | endodeoxyribonuclease activity, producing 3'-phosphomonoesters(GO:0016889) |
0.1 | 0.6 | GO:0004017 | adenylate kinase activity(GO:0004017) |
0.1 | 0.3 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
0.1 | 0.2 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
0.1 | 0.4 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
0.1 | 0.2 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
0.1 | 0.1 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
0.1 | 2.7 | GO:0016763 | transferase activity, transferring pentosyl groups(GO:0016763) |
0.1 | 0.1 | GO:0004723 | calcium-dependent protein serine/threonine phosphatase activity(GO:0004723) |
0.1 | 0.2 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
0.1 | 0.1 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.1 | 0.2 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.1 | 0.2 | GO:0004844 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
0.1 | 0.5 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
0.1 | 0.2 | GO:0004082 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
0.1 | 0.4 | GO:0005113 | patched binding(GO:0005113) |
0.1 | 1.0 | GO:0005527 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
0.1 | 0.5 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.1 | 0.7 | GO:0016854 | racemase and epimerase activity(GO:0016854) |
0.1 | 0.1 | GO:0051723 | protein methylesterase activity(GO:0051723) |
0.1 | 0.1 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.1 | 0.6 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
0.1 | 0.1 | GO:0008187 | poly-pyrimidine tract binding(GO:0008187) |
0.1 | 0.1 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
0.1 | 0.3 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.1 | 0.2 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.1 | 0.5 | GO:0004779 | sulfate adenylyltransferase activity(GO:0004779) |
0.1 | 0.1 | GO:0005223 | intracellular cGMP activated cation channel activity(GO:0005223) |
0.1 | 0.3 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.1 | 0.3 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.1 | 0.2 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.1 | 0.2 | GO:0002046 | opsin binding(GO:0002046) |
0.1 | 0.4 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
0.1 | 0.3 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.1 | 0.3 | GO:0048019 | receptor antagonist activity(GO:0048019) |
0.1 | 0.1 | GO:0035251 | UDP-glucosyltransferase activity(GO:0035251) |
0.1 | 0.6 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
0.1 | 0.2 | GO:0031127 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
0.1 | 0.4 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
0.1 | 0.3 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
0.1 | 0.3 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.1 | 0.2 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
0.1 | 0.1 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
0.1 | 0.3 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.1 | 0.1 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
0.1 | 0.3 | GO:0008318 | protein prenyltransferase activity(GO:0008318) |
0.1 | 0.2 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
0.1 | 0.5 | GO:0019841 | retinol binding(GO:0019841) |
0.1 | 0.8 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.1 | 0.6 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
0.1 | 0.4 | GO:0004466 | long-chain-acyl-CoA dehydrogenase activity(GO:0004466) |
0.1 | 0.3 | GO:0010853 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
0.1 | 0.7 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
0.0 | 0.0 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.0 | 0.1 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.0 | 0.4 | GO:0098599 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
0.0 | 0.1 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
0.0 | 0.2 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.0 | 0.2 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
0.0 | 1.1 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.0 | 0.0 | GO:0008905 | mannose-phosphate guanylyltransferase activity(GO:0008905) |
0.0 | 0.9 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
0.0 | 0.4 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.0 | 0.2 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.0 | 0.9 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.0 | 0.1 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
0.0 | 0.1 | GO:0016728 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
0.0 | 0.2 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
0.0 | 0.2 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.0 | 5.3 | GO:0008083 | growth factor activity(GO:0008083) |
0.0 | 0.3 | GO:0045545 | syndecan binding(GO:0045545) |
0.0 | 0.1 | GO:0000339 | RNA cap binding(GO:0000339) |
0.0 | 0.3 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.0 | 0.9 | GO:0042562 | hormone binding(GO:0042562) |
0.0 | 0.2 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.0 | 0.1 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
0.0 | 0.1 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
0.0 | 0.9 | GO:0004551 | nucleotide diphosphatase activity(GO:0004551) |
0.0 | 0.2 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
0.0 | 0.1 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.0 | 0.2 | GO:0004457 | lactate dehydrogenase activity(GO:0004457) |
0.0 | 0.0 | GO:0004936 | alpha-adrenergic receptor activity(GO:0004936) alpha2-adrenergic receptor activity(GO:0004938) |
0.0 | 0.2 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
0.0 | 0.5 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
0.0 | 0.1 | GO:0043199 | sulfate binding(GO:0043199) |
0.0 | 0.1 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
0.0 | 1.7 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
0.0 | 0.2 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
0.0 | 0.1 | GO:0004365 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
0.0 | 0.1 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
0.0 | 0.1 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
0.0 | 0.1 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
0.0 | 0.1 | GO:0034711 | inhibin binding(GO:0034711) |
0.0 | 0.1 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
0.0 | 0.4 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
0.0 | 0.1 | GO:0034452 | dynactin binding(GO:0034452) |
0.0 | 0.1 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
0.0 | 0.1 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
0.0 | 0.3 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
0.0 | 0.2 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.0 | 0.2 | GO:0016653 | oxidoreductase activity, acting on NAD(P)H, heme protein as acceptor(GO:0016653) |
0.0 | 0.2 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
0.0 | 0.2 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
0.0 | 0.2 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.0 | 0.2 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.0 | 0.0 | GO:0000700 | mismatch base pair DNA N-glycosylase activity(GO:0000700) |
0.0 | 0.1 | GO:0019976 | interleukin-2 binding(GO:0019976) |
0.0 | 0.1 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.0 | 3.0 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
0.0 | 0.2 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
0.0 | 0.3 | GO:0016208 | AMP binding(GO:0016208) |
0.0 | 0.2 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
0.0 | 1.0 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
0.0 | 0.1 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
0.0 | 0.1 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
0.0 | 0.2 | GO:0070410 | co-SMAD binding(GO:0070410) |
0.0 | 0.3 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.0 | 0.1 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
0.0 | 0.4 | GO:0008376 | acetylgalactosaminyltransferase activity(GO:0008376) |
0.0 | 0.0 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.0 | 0.1 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
0.0 | 0.1 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
0.0 | 0.2 | GO:1990405 | protein antigen binding(GO:1990405) |
0.0 | 0.4 | GO:0008271 | secondary active sulfate transmembrane transporter activity(GO:0008271) |
0.0 | 0.4 | GO:0005523 | tropomyosin binding(GO:0005523) |
0.0 | 0.1 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
0.0 | 0.4 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
0.0 | 2.6 | GO:0101005 | thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) ubiquitinyl hydrolase activity(GO:0101005) |
0.0 | 0.3 | GO:0031418 | L-ascorbic acid binding(GO:0031418) |
0.0 | 0.1 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) |
0.0 | 0.3 | GO:0048038 | quinone binding(GO:0048038) |
0.0 | 0.0 | GO:0051373 | FATZ binding(GO:0051373) |
0.0 | 0.1 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
0.0 | 0.6 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.0 | 0.3 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
0.0 | 0.1 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
0.0 | 0.1 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
0.0 | 1.2 | GO:0005109 | frizzled binding(GO:0005109) |
0.0 | 0.3 | GO:0004568 | chitinase activity(GO:0004568) |
0.0 | 0.1 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
0.0 | 0.2 | GO:0001972 | retinoic acid binding(GO:0001972) |
0.0 | 0.1 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.0 | 0.1 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
0.0 | 0.1 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
0.0 | 3.6 | GO:0004386 | helicase activity(GO:0004386) |
0.0 | 0.1 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
0.0 | 0.2 | GO:0030275 | LRR domain binding(GO:0030275) |
0.0 | 0.8 | GO:0070063 | RNA polymerase binding(GO:0070063) |
0.0 | 0.1 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
0.0 | 0.2 | GO:0030371 | translation repressor activity(GO:0030371) |
0.0 | 0.0 | GO:0019104 | DNA N-glycosylase activity(GO:0019104) |
0.0 | 0.6 | GO:0048487 | beta-tubulin binding(GO:0048487) |
0.0 | 2.7 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
0.0 | 0.1 | GO:0030274 | LIM domain binding(GO:0030274) |
0.0 | 0.2 | GO:0080011 | pivalyl-CoA mutase activity(GO:0034784) o-hydroxylaminobenzoate mutase activity(GO:0034951) lupeol synthase activity(GO:0042299) beta-amyrin synthase activity(GO:0042300) baruol synthase activity(GO:0080011) |
0.0 | 0.3 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.0 | 0.2 | GO:0050664 | oxidoreductase activity, acting on NAD(P)H, oxygen as acceptor(GO:0050664) |
0.0 | 0.3 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
0.0 | 0.6 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
0.0 | 0.4 | GO:0019215 | intermediate filament binding(GO:0019215) |
0.0 | 0.1 | GO:0038064 | collagen receptor activity(GO:0038064) |
0.0 | 0.0 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
0.0 | 0.2 | GO:0031690 | adrenergic receptor binding(GO:0031690) |
0.0 | 0.1 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
0.0 | 0.3 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
0.0 | 0.1 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
0.0 | 0.2 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
0.0 | 0.0 | GO:0070991 | medium-chain-acyl-CoA dehydrogenase activity(GO:0070991) |
0.0 | 0.1 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
0.0 | 0.5 | GO:0005246 | calcium channel regulator activity(GO:0005246) |
0.0 | 0.1 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
0.0 | 0.1 | GO:0052723 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
0.0 | 0.0 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.0 | 0.1 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
0.0 | 0.0 | GO:0019107 | myristoyltransferase activity(GO:0019107) |
0.0 | 0.1 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
0.0 | 0.0 | GO:0019002 | GMP binding(GO:0019002) |
0.0 | 0.0 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
0.0 | 0.1 | GO:0008656 | cysteine-type endopeptidase activator activity involved in apoptotic process(GO:0008656) |
0.0 | 0.1 | GO:0090079 | translation regulator activity, nucleic acid binding(GO:0090079) |
0.0 | 0.1 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
0.0 | 0.0 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.0 | 0.2 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
0.0 | 0.1 | GO:0019103 | pyrimidine nucleotide binding(GO:0019103) |
0.0 | 0.0 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
0.0 | 0.1 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
0.0 | 0.2 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
0.0 | 0.0 | GO:0046848 | hydroxyapatite binding(GO:0046848) |
0.0 | 0.4 | GO:0031369 | translation initiation factor binding(GO:0031369) |
0.0 | 0.6 | GO:0004027 | alcohol sulfotransferase activity(GO:0004027) |
0.0 | 0.2 | GO:0005451 | monovalent cation:proton antiporter activity(GO:0005451) |
0.0 | 0.3 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
0.0 | 0.6 | GO:0000049 | tRNA binding(GO:0000049) |
0.0 | 0.1 | GO:0034809 | enoyl-[acyl-carrier-protein] reductase activity(GO:0016631) 2,3-dihydroxy-2,3-dihydro-phenylpropionate dehydrogenase activity(GO:0018498) cis-2,3-dihydrodiol DDT dehydrogenase activity(GO:0018499) trans-9R,10R-dihydrodiolphenanthrene dehydrogenase activity(GO:0018500) cis-chlorobenzene dihydrodiol dehydrogenase activity(GO:0018501) 2,5-dichloro-2,5-cyclohexadiene-1,4-diol dehydrogenase activity(GO:0018502) trans-1,2-dihydrodiolphenanthrene dehydrogenase activity(GO:0018503) 3,4-dihydroxy-3,4-dihydrofluorene dehydrogenase activity(GO:0034790) benzo(a)pyrene-trans-11,12-dihydrodiol dehydrogenase activity(GO:0034805) benzo(a)pyrene-cis-4,5-dihydrodiol dehydrogenase activity(GO:0034809) citronellyl-CoA dehydrogenase activity(GO:0034824) menthone dehydrogenase activity(GO:0034838) phthalate 3,4-cis-dihydrodiol dehydrogenase activity(GO:0034912) cinnamate reductase activity(GO:0043786) NADPH-dependent curcumin reductase activity(GO:0052849) NADPH-dependent dihydrocurcumin reductase activity(GO:0052850) |
0.0 | 0.4 | GO:0004889 | acetylcholine-activated cation-selective channel activity(GO:0004889) |
0.0 | 0.6 | GO:0052771 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
0.0 | 0.3 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.0 | 0.2 | GO:0008327 | methyl-CpG binding(GO:0008327) |
0.0 | 0.1 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.0 | 0.9 | GO:0005518 | collagen binding(GO:0005518) |
0.0 | 0.1 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
0.0 | 0.5 | GO:0008536 | Ran GTPase binding(GO:0008536) |
0.0 | 0.1 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.0 | 0.0 | GO:0035870 | dITP diphosphatase activity(GO:0035870) |
0.0 | 0.0 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.0 | 0.1 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.0 | 0.7 | GO:0043022 | ribosome binding(GO:0043022) |
0.0 | 0.1 | GO:0005499 | vitamin D binding(GO:0005499) |
0.0 | 0.1 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.0 | 0.8 | GO:0051082 | unfolded protein binding(GO:0051082) |
0.0 | 0.4 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
0.0 | 0.1 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.0 | 0.1 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
0.0 | 0.1 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
0.0 | 0.2 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
0.0 | 1.2 | GO:0002020 | protease binding(GO:0002020) |
0.0 | 0.1 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
0.0 | 0.0 | GO:0070905 | serine binding(GO:0070905) |
0.0 | 0.0 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
0.0 | 0.3 | GO:0005537 | mannose binding(GO:0005537) |
0.0 | 0.6 | GO:0035064 | methylated histone binding(GO:0035064) |
0.0 | 0.0 | GO:0030235 | nitric-oxide synthase regulator activity(GO:0030235) |
0.0 | 0.0 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.0 | 0.3 | GO:0016675 | oxidoreductase activity, acting on a heme group of donors(GO:0016675) |
0.0 | 0.1 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) acidic amino acid transmembrane transporter activity(GO:0015172) |
0.0 | 0.1 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
0.0 | 0.1 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.0 | 0.0 | GO:0008410 | CoA-transferase activity(GO:0008410) |
0.0 | 0.3 | GO:0019707 | protein-cysteine S-acyltransferase activity(GO:0019707) |
0.0 | 0.0 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
0.0 | 0.2 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.0 | 0.3 | GO:0005326 | neurotransmitter transporter activity(GO:0005326) |
0.0 | 0.1 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
0.0 | 0.0 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
0.0 | 0.0 | GO:0004946 | bombesin receptor activity(GO:0004946) |
0.0 | 0.1 | GO:0019864 | IgG binding(GO:0019864) |
0.0 | 0.1 | GO:0016454 | C-palmitoyltransferase activity(GO:0016454) |
0.0 | 0.7 | GO:0030792 | methylarsonite methyltransferase activity(GO:0030792) |
0.0 | 0.4 | GO:0008135 | translation factor activity, RNA binding(GO:0008135) |
0.0 | 2.2 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.0 | 0.0 | GO:0050253 | retinyl-palmitate esterase activity(GO:0050253) |
0.0 | 0.1 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.0 | 0.0 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
0.0 | 0.0 | GO:0019863 | IgE binding(GO:0019863) |
0.0 | 0.0 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
0.0 | 0.0 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
0.0 | 0.1 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
0.0 | 0.0 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
0.0 | 0.0 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.1 | 16.5 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.3 | 8.9 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.2 | 4.6 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
0.2 | 0.5 | PID IGF1 PATHWAY | IGF1 pathway |
0.1 | 1.7 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.1 | 4.6 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.1 | 1.5 | PID ALK2 PATHWAY | ALK2 signaling events |
0.1 | 6.4 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
0.1 | 0.9 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
0.1 | 4.7 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.1 | 0.5 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.1 | 0.1 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.1 | 1.1 | PID ERBB4 PATHWAY | ErbB4 signaling events |
0.1 | 0.5 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
0.1 | 1.0 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.1 | 0.6 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
0.1 | 3.6 | PID E2F PATHWAY | E2F transcription factor network |
0.1 | 0.8 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.1 | 0.5 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.1 | 2.2 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
0.1 | 1.3 | PID AURORA A PATHWAY | Aurora A signaling |
0.1 | 1.0 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.1 | 3.6 | PID P73PATHWAY | p73 transcription factor network |
0.1 | 0.1 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.1 | 0.3 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
0.1 | 0.2 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.1 | 2.8 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.1 | 1.0 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
0.1 | 0.3 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
0.1 | 0.3 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.1 | 0.7 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
0.1 | 0.3 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
0.1 | 1.6 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.1 | 1.0 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
0.1 | 0.2 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
0.1 | 0.7 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
0.0 | 0.7 | ST G ALPHA I PATHWAY | G alpha i Pathway |
0.0 | 0.3 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
0.0 | 0.1 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.0 | 0.7 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
0.0 | 0.1 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
0.0 | 1.6 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.0 | 0.6 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
0.0 | 0.3 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
0.0 | 0.2 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.0 | 0.2 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.0 | 0.7 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
0.0 | 1.7 | PID CMYB PATHWAY | C-MYB transcription factor network |
0.0 | 2.0 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
0.0 | 0.9 | PID SHP2 PATHWAY | SHP2 signaling |
0.0 | 0.4 | PID REELIN PATHWAY | Reelin signaling pathway |
0.0 | 0.3 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
0.0 | 0.5 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
0.0 | 0.0 | PID ERBB1 RECEPTOR PROXIMAL PATHWAY | EGF receptor (ErbB1) signaling pathway |
0.0 | 0.8 | PID FGF PATHWAY | FGF signaling pathway |
0.0 | 0.7 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.0 | 0.8 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
0.0 | 0.1 | SIG CHEMOTAXIS | Genes related to chemotaxis |
0.0 | 0.2 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.0 | 0.2 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
0.0 | 0.3 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.0 | 0.2 | PID IL2 1PATHWAY | IL2-mediated signaling events |
0.0 | 0.2 | PID ALK1 PATHWAY | ALK1 signaling events |
0.0 | 0.2 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.0 | 0.2 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.0 | 0.3 | PID RAS PATHWAY | Regulation of Ras family activation |
0.0 | 0.0 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
0.0 | 0.1 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
0.0 | 0.2 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.0 | 0.2 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.0 | 0.0 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
0.0 | 0.1 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.0 | 0.0 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.0 | 0.1 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
0.0 | 0.0 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.0 | 0.2 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.0 | 0.1 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
0.0 | 0.2 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
0.0 | 0.1 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
0.0 | 0.2 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
0.0 | 0.2 | PID AURORA B PATHWAY | Aurora B signaling |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.9 | 15.3 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.4 | 1.1 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
0.4 | 5.4 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
0.3 | 3.4 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
0.3 | 4.5 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.3 | 3.6 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.3 | 0.5 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
0.3 | 2.7 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.2 | 1.5 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
0.2 | 2.4 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
0.2 | 3.0 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
0.2 | 6.1 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.2 | 1.7 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
0.2 | 3.3 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
0.2 | 3.8 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
0.2 | 1.8 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
0.2 | 1.8 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.2 | 2.1 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
0.2 | 2.5 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.2 | 1.5 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
0.2 | 1.5 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
0.1 | 0.9 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
0.1 | 0.9 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
0.1 | 0.1 | REACTOME CDT1 ASSOCIATION WITH THE CDC6 ORC ORIGIN COMPLEX | Genes involved in CDT1 association with the CDC6:ORC:origin complex |
0.1 | 2.3 | REACTOME FGFR LIGAND BINDING AND ACTIVATION | Genes involved in FGFR ligand binding and activation |
0.1 | 3.1 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
0.1 | 2.3 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.1 | 2.4 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.1 | 1.2 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF CAMKII | Genes involved in CREB phosphorylation through the activation of CaMKII |
0.1 | 1.1 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.1 | 0.7 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
0.1 | 1.0 | REACTOME PKB MEDIATED EVENTS | Genes involved in PKB-mediated events |
0.1 | 1.0 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.1 | 0.5 | REACTOME ADP SIGNALLING THROUGH P2RY1 | Genes involved in ADP signalling through P2Y purinoceptor 1 |
0.1 | 0.5 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
0.1 | 1.3 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.1 | 0.3 | REACTOME INTEGRATION OF ENERGY METABOLISM | Genes involved in Integration of energy metabolism |
0.1 | 3.7 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.1 | 0.4 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
0.1 | 0.3 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
0.1 | 5.0 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
0.1 | 0.1 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.1 | 2.5 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
0.1 | 1.5 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
0.1 | 1.4 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
0.1 | 0.5 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
0.1 | 0.8 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
0.1 | 0.5 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.1 | 0.2 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.1 | 0.2 | REACTOME TGF BETA RECEPTOR SIGNALING ACTIVATES SMADS | Genes involved in TGF-beta receptor signaling activates SMADs |
0.1 | 0.7 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.1 | 1.3 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
0.1 | 0.5 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
0.1 | 2.0 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
0.1 | 0.9 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.1 | 0.5 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
0.1 | 1.1 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.1 | 0.5 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.1 | 2.1 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
0.1 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
0.1 | 0.2 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
0.1 | 0.9 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
0.1 | 0.5 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.1 | 0.5 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
0.1 | 0.1 | REACTOME N GLYCAN TRIMMING IN THE ER AND CALNEXIN CALRETICULIN CYCLE | Genes involved in N-glycan trimming in the ER and Calnexin/Calreticulin cycle |
0.1 | 0.6 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
0.1 | 1.2 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
0.1 | 0.6 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
0.1 | 2.4 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
0.1 | 2.2 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.1 | 0.6 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.1 | 0.2 | REACTOME SHC RELATED EVENTS | Genes involved in SHC-related events |
0.1 | 1.2 | REACTOME GLUCOSE METABOLISM | Genes involved in Glucose metabolism |
0.1 | 0.4 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
0.1 | 0.6 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.1 | 1.1 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.1 | 0.2 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
0.1 | 0.2 | REACTOME CD28 DEPENDENT PI3K AKT SIGNALING | Genes involved in CD28 dependent PI3K/Akt signaling |
0.1 | 0.5 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
0.1 | 0.6 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
0.0 | 0.4 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.0 | 0.7 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
0.0 | 0.3 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
0.0 | 0.7 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
0.0 | 0.4 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.0 | 0.3 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
0.0 | 0.6 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.0 | 1.1 | REACTOME ACTIVATION OF THE PRE REPLICATIVE COMPLEX | Genes involved in Activation of the pre-replicative complex |
0.0 | 1.8 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.0 | 0.2 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
0.0 | 0.8 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.0 | 0.8 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
0.0 | 0.0 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
0.0 | 0.1 | REACTOME ADP SIGNALLING THROUGH P2RY12 | Genes involved in ADP signalling through P2Y purinoceptor 12 |
0.0 | 0.1 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
0.0 | 0.3 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.0 | 0.7 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
0.0 | 0.3 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
0.0 | 0.7 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.0 | 0.4 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
0.0 | 0.1 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
0.0 | 0.0 | REACTOME OPIOID SIGNALLING | Genes involved in Opioid Signalling |
0.0 | 0.2 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.0 | 0.0 | REACTOME CTLA4 INHIBITORY SIGNALING | Genes involved in CTLA4 inhibitory signaling |
0.0 | 1.0 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
0.0 | 0.4 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.0 | 0.0 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
0.0 | 0.6 | REACTOME AMINO ACID AND OLIGOPEPTIDE SLC TRANSPORTERS | Genes involved in Amino acid and oligopeptide SLC transporters |
0.0 | 0.8 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.0 | 0.4 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.0 | 0.1 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
0.0 | 0.0 | REACTOME PROCESSIVE SYNTHESIS ON THE LAGGING STRAND | Genes involved in Processive synthesis on the lagging strand |
0.0 | 0.4 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
0.0 | 0.9 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.0 | 0.4 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
0.0 | 1.6 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
0.0 | 0.5 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
0.0 | 0.1 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
0.0 | 0.3 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
0.0 | 0.6 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
0.0 | 0.8 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
0.0 | 0.2 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
0.0 | 0.1 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
0.0 | 0.3 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
0.0 | 0.2 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF RAS | Genes involved in CREB phosphorylation through the activation of Ras |
0.0 | 0.4 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.0 | 0.1 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.0 | 0.4 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
0.0 | 0.7 | REACTOME TRANSPORT OF MATURE TRANSCRIPT TO CYTOPLASM | Genes involved in Transport of Mature Transcript to Cytoplasm |
0.0 | 1.2 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
0.0 | 0.1 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
0.0 | 0.3 | REACTOME RNA POL I TRANSCRIPTION | Genes involved in RNA Polymerase I Transcription |
0.0 | 0.4 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
0.0 | 0.3 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.0 | 0.4 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
0.0 | 0.0 | REACTOME TCR SIGNALING | Genes involved in TCR signaling |
0.0 | 0.1 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.0 | 0.2 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
0.0 | 0.0 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.0 | 0.2 | REACTOME SIGNALING BY PDGF | Genes involved in Signaling by PDGF |
0.0 | 0.2 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
0.0 | 0.0 | REACTOME FRS2 MEDIATED CASCADE | Genes involved in FRS2-mediated cascade |
0.0 | 1.1 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
0.0 | 0.1 | REACTOME TELOMERE MAINTENANCE | Genes involved in Telomere Maintenance |
0.0 | 0.6 | REACTOME PHASE II CONJUGATION | Genes involved in Phase II conjugation |
0.0 | 1.4 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
0.0 | 0.2 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.0 | 0.2 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
0.0 | 0.1 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.0 | 0.1 | REACTOME SIGNALING BY EGFR IN CANCER | Genes involved in Signaling by EGFR in Cancer |
0.0 | 0.7 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
0.0 | 0.1 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
0.0 | 0.0 | REACTOME POST NMDA RECEPTOR ACTIVATION EVENTS | Genes involved in Post NMDA receptor activation events |
0.0 | 0.2 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.0 | 0.2 | REACTOME MAP KINASE ACTIVATION IN TLR CASCADE | Genes involved in MAP kinase activation in TLR cascade |
0.0 | 0.2 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.0 | 0.1 | REACTOME SIGNALING BY FGFR MUTANTS | Genes involved in Signaling by FGFR mutants |
0.0 | 0.0 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
0.0 | 0.0 | REACTOME GRB2 EVENTS IN ERBB2 SIGNALING | Genes involved in GRB2 events in ERBB2 signaling |