| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Plag1
|
ENSMUSG00000003282.3 | pleiomorphic adenoma gene 1 |
| CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|---|---|
| chr4_3936936_3937098 | Plag1 | 1365 | 0.306282 | 0.94 | 4.6e-03 | Click! |
| chr4_3924479_3924655 | Plag1 | 13815 | 0.131327 | 0.61 | 2.0e-01 | Click! |
| chr4_3938554_3938727 | Plag1 | 217 | 0.522614 | -0.60 | 2.1e-01 | Click! |
| chr4_3936660_3936856 | Plag1 | 1624 | 0.267368 | 0.49 | 3.2e-01 | Click! |
| chr4_3929705_3929863 | Plag1 | 8598 | 0.139543 | -0.28 | 5.9e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr19_4024247_4024692 | 3.20 |
Gstp1 |
glutathione S-transferase, pi 1 |
11524 |
0.06 |
| chr9_63555594_63556179 | 2.41 |
Gm16759 |
predicted gene, 16759 |
24534 |
0.17 |
| chr14_61680870_61681697 | 1.83 |
Gm37472 |
predicted gene, 37472 |
211 |
0.83 |
| chr7_98355809_98355960 | 1.76 |
Tsku |
tsukushi, small leucine rich proteoglycan |
4195 |
0.2 |
| chr8_46492911_46493695 | 1.76 |
Acsl1 |
acyl-CoA synthetase long-chain family member 1 |
471 |
0.78 |
| chr2_31499430_31499808 | 1.64 |
Ass1 |
argininosuccinate synthetase 1 |
1107 |
0.5 |
| chr10_31313113_31313474 | 1.60 |
Hddc2 |
HD domain containing 2 |
90 |
0.96 |
| chr6_85810872_85811030 | 1.53 |
Nat8f6 |
N-acetyltransferase 8 (GCN5-related) family member 6 |
1088 |
0.31 |
| chr1_56623913_56624064 | 1.49 |
Hsfy2 |
heat shock transcription factor, Y-linked 2 |
13447 |
0.28 |
| chr17_28519046_28519420 | 1.44 |
Gm49861 |
predicted gene, 49861 |
775 |
0.35 |
| chr2_31487515_31488471 | 1.42 |
Ass1 |
argininosuccinate synthetase 1 |
9779 |
0.18 |
| chr7_98354087_98354238 | 1.40 |
Tsku |
tsukushi, small leucine rich proteoglycan |
5917 |
0.18 |
| chr5_25015695_25015994 | 1.40 |
Prkag2 |
protein kinase, AMP-activated, gamma 2 non-catalytic subunit |
20091 |
0.17 |
| chr4_140860722_140860933 | 1.37 |
4930515B02Rik |
RIKEN cDNA 4930515B02 gene |
11866 |
0.12 |
| chr9_35108621_35109370 | 1.35 |
St3gal4 |
ST3 beta-galactoside alpha-2,3-sialyltransferase 4 |
2328 |
0.23 |
| chr11_69235279_69235437 | 1.34 |
Gucy2e |
guanylate cyclase 2e |
1664 |
0.22 |
| chr11_88717551_88717702 | 1.33 |
Msi2 |
musashi RNA-binding protein 2 |
475 |
0.68 |
| chr2_31478552_31479205 | 1.28 |
Ass1 |
argininosuccinate synthetase 1 |
8671 |
0.19 |
| chr9_119936919_119937440 | 1.27 |
Gorasp1 |
golgi reassembly stacking protein 1 |
371 |
0.49 |
| chr7_127026907_127027653 | 1.25 |
Maz |
MYC-associated zinc finger protein (purine-binding transcription factor) |
243 |
0.69 |
| chr3_116329378_116329892 | 1.23 |
Gm29151 |
predicted gene 29151 |
20468 |
0.17 |
| chr9_44083899_44084207 | 1.22 |
Usp2 |
ubiquitin specific peptidase 2 |
886 |
0.32 |
| chr1_180179778_180180226 | 1.21 |
Coq8a |
coenzyme Q8A |
1080 |
0.44 |
| chr2_31489409_31489782 | 1.20 |
Ass1 |
argininosuccinate synthetase 1 |
8177 |
0.19 |
| chr3_51226339_51227024 | 1.19 |
Noct |
nocturnin |
2211 |
0.23 |
| chr4_150754056_150754234 | 1.19 |
Gm13049 |
predicted gene 13049 |
71588 |
0.08 |
| chr10_76032746_76033251 | 1.19 |
Zfp280b |
zinc finger protein 280B |
344 |
0.8 |
| chr7_18990506_18990869 | 1.18 |
Mypop |
Myb-related transcription factor, partner of profilin |
558 |
0.49 |
| chr5_92607333_92607581 | 1.16 |
Stbd1 |
starch binding domain 1 |
4389 |
0.18 |
| chr15_36472369_36472551 | 1.16 |
Ankrd46 |
ankyrin repeat domain 46 |
24255 |
0.12 |
| chr5_147421002_147421306 | 1.15 |
D5Ertd605e |
DNA segment, Chr 5, ERATO Doi 605, expressed |
2553 |
0.13 |
| chr18_24259113_24259438 | 1.14 |
Gm7701 |
predicted gene 7701 |
1897 |
0.36 |
| chr4_105004661_105004977 | 1.13 |
Gm12721 |
predicted gene 12721 |
34690 |
0.19 |
| chr8_35390018_35390398 | 1.12 |
Ppp1r3b |
protein phosphatase 1, regulatory subunit 3B |
13548 |
0.15 |
| chr9_35111753_35112155 | 1.12 |
4930581F22Rik |
RIKEN cDNA 4930581F22 gene |
4774 |
0.16 |
| chr3_34020715_34021194 | 1.11 |
Fxr1 |
fragile X mental retardation gene 1, autosomal homolog |
846 |
0.39 |
| chr11_16836874_16837160 | 1.08 |
Egfros |
epidermal growth factor receptor, opposite strand |
6315 |
0.23 |
| chr14_114864274_114864425 | 1.07 |
Gm49010 |
predicted gene, 49010 |
12161 |
0.18 |
| chr9_44087724_44088170 | 1.07 |
Usp2 |
ubiquitin specific peptidase 2 |
757 |
0.37 |
| chr7_90129909_90130310 | 1.05 |
Picalm |
phosphatidylinositol binding clathrin assembly protein |
104 |
0.52 |
| chr17_72829234_72829476 | 1.05 |
Ypel5 |
yippee like 5 |
7098 |
0.28 |
| chr19_44398143_44398357 | 1.03 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
8440 |
0.15 |
| chr6_85709563_85709731 | 1.03 |
Nat8f7 |
N-acetyltransferase 8 (GCN5-related) family member 7 |
1789 |
0.22 |
| chr5_36988627_36988798 | 1.02 |
Wfs1 |
wolframin ER transmembrane glycoprotein |
221 |
0.93 |
| chr3_87907622_87908270 | 1.02 |
Hdgf |
heparin binding growth factor |
412 |
0.71 |
| chr17_45594866_45595446 | 1.02 |
Slc29a1 |
solute carrier family 29 (nucleoside transporters), member 1 |
346 |
0.75 |
| chr8_93079410_93079731 | 1.02 |
Ces1b |
carboxylesterase 1B |
447 |
0.79 |
| chr17_35816298_35816449 | 1.02 |
Ier3 |
immediate early response 3 |
5311 |
0.08 |
| chr6_85763479_85763641 | 1.01 |
Nat8f3 |
N-acetyltransferase 8 (GCN5-related) family member 3 |
1080 |
0.33 |
| chr15_88858344_88858998 | 0.99 |
Pim3 |
proviral integration site 3 |
3515 |
0.17 |
| chr7_66839788_66839970 | 0.99 |
Adamts17 |
a disintegrin-like and metallopeptidase (reprolysin type) with thrombospondin type 1 motif, 17 |
66 |
0.98 |
| chr1_21267840_21267991 | 0.99 |
Gm28836 |
predicted gene 28836 |
3678 |
0.13 |
| chr11_58100366_58100593 | 0.99 |
Gm12247 |
predicted gene 12247 |
2706 |
0.16 |
| chr2_31483571_31483901 | 0.99 |
Ass1 |
argininosuccinate synthetase 1 |
13529 |
0.18 |
| chr13_114387142_114387320 | 0.99 |
Ndufs4 |
NADH:ubiquinone oxidoreductase core subunit S4 |
818 |
0.63 |
| chr2_27728804_27729670 | 0.98 |
Rxra |
retinoid X receptor alpha |
4018 |
0.31 |
| chr8_105606555_105606946 | 0.98 |
Ripor1 |
RHO family interacting cell polarization regulator 1 |
1495 |
0.2 |
| chr15_31511325_31511476 | 0.98 |
Marchf6 |
membrane associated ring-CH-type finger 6 |
6846 |
0.13 |
| chr4_55371738_55371889 | 0.98 |
Gm12516 |
predicted gene 12516 |
20888 |
0.13 |
| chr8_84712053_84712451 | 0.98 |
Nfix |
nuclear factor I/X |
1816 |
0.2 |
| chr18_75901792_75902127 | 0.97 |
Zbtb7c |
zinc finger and BTB domain containing 7C |
81744 |
0.09 |
| chr1_133508090_133508255 | 0.97 |
Gm8596 |
predicted gene 8596 |
21307 |
0.18 |
| chr19_6975937_6976192 | 0.96 |
Ppp1r14b |
protein phosphatase 1, regulatory inhibitor subunit 14B |
385 |
0.41 |
| chr19_5447415_5447666 | 0.96 |
Fosl1 |
fos-like antigen 1 |
7 |
0.91 |
| chr2_58761406_58761587 | 0.95 |
Upp2 |
uridine phosphorylase 2 |
3829 |
0.24 |
| chr4_108300578_108300922 | 0.95 |
Zyg11b |
zyg-ll family member B, cell cycle regulator |
346 |
0.83 |
| chr1_21263057_21263217 | 0.94 |
Gm28836 |
predicted gene 28836 |
8456 |
0.11 |
| chr6_72634309_72634791 | 0.94 |
Gm15401 |
predicted gene 15401 |
1703 |
0.17 |
| chr9_48721373_48721524 | 0.93 |
Zbtb16 |
zinc finger and BTB domain containing 16 |
114497 |
0.05 |
| chr9_55279483_55279657 | 0.93 |
Nrg4 |
neuregulin 4 |
4002 |
0.21 |
| chr9_122125893_122126094 | 0.93 |
4632418H02Rik |
RIKEN cDNA 4632418H02 gene |
1301 |
0.32 |
| chr10_84441325_84441679 | 0.91 |
Gm47962 |
predicted gene, 47962 |
676 |
0.48 |
| chr6_85810403_85810557 | 0.90 |
Nat8f6 |
N-acetyltransferase 8 (GCN5-related) family member 6 |
617 |
0.53 |
| chr2_31492850_31493284 | 0.89 |
Ass1 |
argininosuccinate synthetase 1 |
4705 |
0.21 |
| chr8_3676646_3677297 | 0.89 |
Gm45231 |
predicted gene 45231 |
17 |
0.85 |
| chr6_29868169_29868370 | 0.89 |
Ahcyl2 |
S-adenosylhomocysteine hydrolase-like 2 |
2020 |
0.29 |
| chr9_80177107_80177276 | 0.88 |
Myo6 |
myosin VI |
11964 |
0.19 |
| chr9_43224415_43225053 | 0.87 |
Oaf |
out at first homolog |
358 |
0.84 |
| chr18_36286527_36286858 | 0.87 |
Pura |
purine rich element binding protein A |
5595 |
0.2 |
| chr14_63171725_63171990 | 0.86 |
Fdft1 |
farnesyl diphosphate farnesyl transferase 1 |
5936 |
0.15 |
| chr6_108454056_108454259 | 0.86 |
Itpr1 |
inositol 1,4,5-trisphosphate receptor 1 |
4546 |
0.21 |
| chr14_21287772_21287966 | 0.86 |
Adk |
adenosine kinase |
30256 |
0.22 |
| chr7_113961588_113961904 | 0.86 |
Gm45615 |
predicted gene 45615 |
125152 |
0.05 |
| chr11_75173089_75173918 | 0.86 |
Mir212 |
microRNA 212 |
115 |
0.56 |
| chr19_55268150_55268498 | 0.85 |
Acsl5 |
acyl-CoA synthetase long-chain family member 5 |
4546 |
0.2 |
| chr5_124425319_124425853 | 0.85 |
Sbno1 |
strawberry notch 1 |
2 |
0.38 |
| chr6_148142790_148143040 | 0.85 |
Ergic2 |
ERGIC and golgi 2 |
40293 |
0.13 |
| chr2_94085464_94085615 | 0.85 |
Hsd17b12 |
hydroxysteroid (17-beta) dehydrogenase 12 |
18775 |
0.18 |
| chr6_85834814_85835012 | 0.85 |
Nat8 |
N-acetyltransferase 8 (GCN5-related) |
2831 |
0.12 |
| chr7_13007324_13007475 | 0.85 |
Zbtb45 |
zinc finger and BTB domain containing 45 |
2401 |
0.12 |
| chr3_63295217_63295546 | 0.85 |
Mme |
membrane metallo endopeptidase |
67 |
0.98 |
| chr9_65671414_65671804 | 0.84 |
Oaz2 |
ornithine decarboxylase antizyme 2 |
1897 |
0.29 |
| chr2_31477009_31477347 | 0.84 |
Ass1 |
argininosuccinate synthetase 1 |
6971 |
0.19 |
| chr17_45566723_45566926 | 0.84 |
Slc35b2 |
solute carrier family 35, member B2 |
2085 |
0.15 |
| chr13_54067978_54068148 | 0.84 |
Sfxn1 |
sideroflexin 1 |
3806 |
0.22 |
| chrX_12761746_12762400 | 0.84 |
Med14 |
mediator complex subunit 14 |
0 |
0.73 |
| chr4_118289996_118290191 | 0.84 |
Ptprf |
protein tyrosine phosphatase, receptor type, F |
1181 |
0.47 |
| chr5_147421664_147421993 | 0.84 |
D5Ertd605e |
DNA segment, Chr 5, ERATO Doi 605, expressed |
3227 |
0.11 |
| chr9_35109554_35109705 | 0.84 |
St3gal4 |
ST3 beta-galactoside alpha-2,3-sialyltransferase 4 |
2962 |
0.19 |
| chr3_92080492_92080974 | 0.83 |
Lor |
loricrin |
2409 |
0.17 |
| chr1_171221151_171222001 | 0.83 |
Tomm40l |
translocase of outer mitochondrial membrane 40-like |
608 |
0.48 |
| chr14_46512838_46513067 | 0.83 |
Gm48912 |
predicted gene, 48912 |
3490 |
0.17 |
| chr17_31479749_31480315 | 0.82 |
Gm50102 |
predicted gene, 50102 |
7337 |
0.09 |
| chr7_81213986_81214606 | 0.82 |
Pde8a |
phosphodiesterase 8A |
700 |
0.61 |
| chr9_48724021_48724519 | 0.82 |
Zbtb16 |
zinc finger and BTB domain containing 16 |
111675 |
0.06 |
| chr6_39117272_39117781 | 0.82 |
Parp12 |
poly (ADP-ribose) polymerase family, member 12 |
823 |
0.39 |
| chr6_136918135_136918302 | 0.82 |
Erp27 |
endoplasmic reticulum protein 27 |
3922 |
0.14 |
| chr11_60199988_60200509 | 0.82 |
Mir6921 |
microRNA 6921 |
369 |
0.65 |
| chrX_136742565_136742738 | 0.82 |
Morf4l2 |
mortality factor 4 like 2 |
210 |
0.62 |
| chr8_33805065_33805224 | 0.81 |
Rbpms |
RNA binding protein gene with multiple splicing |
1655 |
0.32 |
| chr11_117845425_117845576 | 0.81 |
Birc5 |
baculoviral IAP repeat-containing 5 |
3751 |
0.1 |
| chr8_70766641_70767079 | 0.81 |
Ifi30 |
interferon gamma inducible protein 30 |
197 |
0.55 |
| chr17_70661451_70661755 | 0.80 |
5031415H12Rik |
RIKEN cDNA 5031415H12 gene |
93979 |
0.07 |
| chr8_85500511_85501282 | 0.80 |
Gpt2 |
glutamic pyruvate transaminase (alanine aminotransferase) 2 |
8287 |
0.17 |
| chr2_31496143_31496706 | 0.80 |
Ass1 |
argininosuccinate synthetase 1 |
1348 |
0.43 |
| chr1_74047431_74047619 | 0.80 |
Tns1 |
tensin 1 |
10368 |
0.21 |
| chr4_135221446_135221961 | 0.80 |
Clic4 |
chloride intracellular channel 4 (mitochondrial) |
51111 |
0.09 |
| chr2_103459009_103459751 | 0.79 |
Elf5 |
E74-like factor 5 |
10642 |
0.18 |
| chr11_60201956_60202762 | 0.79 |
Mir6922 |
microRNA 6922 |
32 |
0.63 |
| chr10_127538258_127538495 | 0.78 |
Lrp1 |
low density lipoprotein receptor-related protein 1 |
1221 |
0.29 |
| chr7_81599363_81599874 | 0.78 |
Gm45698 |
predicted gene 45698 |
8724 |
0.11 |
| chr13_8831798_8831949 | 0.78 |
Gm48375 |
predicted gene, 48375 |
2499 |
0.19 |
| chr8_70351602_70351757 | 0.78 |
Upf1 |
UPF1 regulator of nonsense transcripts homolog (yeast) |
1532 |
0.24 |
| chr5_125525672_125525920 | 0.77 |
Tmem132b |
transmembrane protein 132B |
5978 |
0.17 |
| chr8_41069336_41069541 | 0.77 |
Mtus1 |
mitochondrial tumor suppressor 1 |
13338 |
0.16 |
| chr16_67621078_67621243 | 0.77 |
Cadm2 |
cell adhesion molecule 2 |
252 |
0.95 |
| chr4_152138876_152139036 | 0.77 |
Espn |
espin |
2631 |
0.17 |
| chr15_80671900_80672327 | 0.76 |
Fam83f |
family with sequence similarity 83, member F |
266 |
0.88 |
| chr10_66928213_66928377 | 0.76 |
Gm26576 |
predicted gene, 26576 |
7993 |
0.17 |
| chr2_6074858_6075460 | 0.76 |
Upf2 |
UPF2 regulator of nonsense transcripts homolog (yeast) |
24732 |
0.16 |
| chr5_124248915_124249162 | 0.76 |
Pitpnm2 |
phosphatidylinositol transfer protein, membrane-associated 2 |
413 |
0.73 |
| chr7_44465999_44466560 | 0.76 |
Aspdh |
aspartate dehydrogenase domain containing |
49 |
0.92 |
| chr14_25500862_25501016 | 0.76 |
Zmiz1 |
zinc finger, MIZ-type containing 1 |
1716 |
0.3 |
| chr6_114896405_114896875 | 0.76 |
Vgll4 |
vestigial like family member 4 |
21533 |
0.19 |
| chr11_75271553_75271704 | 0.75 |
Gm47300 |
predicted gene, 47300 |
46980 |
0.08 |
| chr1_91458255_91458771 | 0.75 |
Per2 |
period circadian clock 2 |
811 |
0.48 |
| chr5_24482719_24483670 | 0.75 |
Agap3 |
ArfGAP with GTPase domain, ankyrin repeat and PH domain 3 |
3022 |
0.12 |
| chr17_46051138_46051309 | 0.75 |
Vegfa |
vascular endothelial growth factor A |
18854 |
0.13 |
| chr18_75423697_75423848 | 0.75 |
Smad7 |
SMAD family member 7 |
48858 |
0.14 |
| chr1_93443777_93443943 | 0.74 |
Hdlbp |
high density lipoprotein (HDL) binding protein |
1572 |
0.28 |
| chr15_85735264_85735747 | 0.74 |
Ppara |
peroxisome proliferator activated receptor alpha |
59 |
0.97 |
| chr9_9218697_9218848 | 0.74 |
Gm16833 |
predicted gene, 16833 |
17516 |
0.21 |
| chr4_135789148_135789435 | 0.73 |
Myom3 |
myomesin family, member 3 |
8899 |
0.14 |
| chr17_25448539_25448703 | 0.73 |
Tekt4 |
tektin 4 |
5994 |
0.12 |
| chr4_102976483_102976667 | 0.73 |
Tctex1d1 |
Tctex1 domain containing 1 |
2031 |
0.26 |
| chr2_31491761_31492352 | 0.73 |
Ass1 |
argininosuccinate synthetase 1 |
5716 |
0.2 |
| chr1_134242182_134242346 | 0.73 |
Adora1 |
adenosine A1 receptor |
6833 |
0.15 |
| chr2_27706710_27707364 | 0.73 |
Rxra |
retinoid X receptor alpha |
2255 |
0.4 |
| chr9_106202795_106203252 | 0.72 |
Twf2 |
twinfilin actin binding protein 2 |
85 |
0.93 |
| chr8_70792727_70792913 | 0.72 |
Mast3 |
microtubule associated serine/threonine kinase 3 |
383 |
0.65 |
| chr7_24399784_24400299 | 0.72 |
Smg9 |
smg-9 homolog, nonsense mediated mRNA decay factor (C. elegans) |
120 |
0.92 |
| chrX_107816009_107816207 | 0.71 |
2610002M06Rik |
RIKEN cDNA 2610002M06 gene |
226 |
0.66 |
| chr12_21435189_21435358 | 0.71 |
Gm4419 |
predicted gene 4419 |
14514 |
0.16 |
| chr2_30197578_30197956 | 0.71 |
Kyat1 |
kynurenine aminotransferase 1 |
592 |
0.57 |
| chr5_142587425_142587576 | 0.71 |
Mmd2 |
monocyte to macrophage differentiation-associated 2 |
4632 |
0.17 |
| chr5_123975512_123975863 | 0.71 |
Hip1r |
huntingtin interacting protein 1 related |
2059 |
0.19 |
| chr11_102754312_102754670 | 0.71 |
Adam11 |
a disintegrin and metallopeptidase domain 11 |
6948 |
0.12 |
| chr7_67023097_67023249 | 0.71 |
Adamts17 |
a disintegrin-like and metallopeptidase (reprolysin type) with thrombospondin type 1 motif, 17 |
24298 |
0.16 |
| chr8_109979792_109979969 | 0.71 |
Gm45795 |
predicted gene 45795 |
5528 |
0.13 |
| chr7_143754683_143755199 | 0.70 |
Osbpl5 |
oxysterol binding protein-like 5 |
2044 |
0.2 |
| chr10_42771201_42771501 | 0.70 |
Sec63 |
SEC63-like (S. cerevisiae) |
9545 |
0.16 |
| chr15_102028397_102029113 | 0.70 |
Krt18 |
keratin 18 |
575 |
0.64 |
| chr12_80810133_80810306 | 0.70 |
Susd6 |
sushi domain containing 6 |
19660 |
0.13 |
| chr12_99570416_99570567 | 0.70 |
4930556H04Rik |
RIKEN cDNA 4930556H04 gene |
751 |
0.39 |
| chrX_100777412_100777719 | 0.70 |
Dlg3 |
discs large MAGUK scaffold protein 3 |
280 |
0.9 |
| chr9_44094238_44094412 | 0.70 |
Usp2 |
ubiquitin specific peptidase 2 |
1651 |
0.15 |
| chr2_31477347_31478122 | 0.70 |
Ass1 |
argininosuccinate synthetase 1 |
7527 |
0.19 |
| chr5_123395114_123395623 | 0.69 |
Gm15747 |
predicted gene 15747 |
304 |
0.6 |
| chr6_125144851_125145015 | 0.69 |
Iffo1 |
intermediate filament family orphan 1 |
308 |
0.73 |
| chr12_71364459_71364610 | 0.69 |
Gm40438 |
predicted gene, 40438 |
9093 |
0.15 |
| chr8_64849910_64850714 | 0.69 |
Klhl2 |
kelch-like 2, Mayven |
295 |
0.88 |
| chr7_66689074_66689542 | 0.69 |
Asb7 |
ankyrin repeat and SOCS box-containing 7 |
166 |
0.83 |
| chr7_143755701_143755887 | 0.69 |
Osbpl5 |
oxysterol binding protein-like 5 |
1191 |
0.33 |
| chr13_44430829_44431021 | 0.69 |
1700029N11Rik |
RIKEN cDNA 1700029N11 gene |
8787 |
0.15 |
| chr5_125179215_125180053 | 0.69 |
Ncor2 |
nuclear receptor co-repressor 2 |
415 |
0.87 |
| chr10_81414361_81414714 | 0.69 |
Mir1191b |
microRNA 1191b |
1760 |
0.13 |
| chr3_21936262_21936525 | 0.68 |
Gm43674 |
predicted gene 43674 |
62075 |
0.12 |
| chr19_10881068_10881374 | 0.68 |
Tmem109 |
transmembrane protein 109 |
477 |
0.67 |
| chr2_32416589_32417000 | 0.68 |
Slc25a25 |
solute carrier family 25 (mitochondrial carrier, phosphate carrier), member 25 |
223 |
0.86 |
| chr15_80681818_80682125 | 0.68 |
Fam83f |
family with sequence similarity 83, member F |
10124 |
0.13 |
| chr17_34809326_34809625 | 0.68 |
C4a |
complement component 4A (Rodgers blood group) |
279 |
0.73 |
| chr17_46052256_46052407 | 0.68 |
Vegfa |
vascular endothelial growth factor A |
19962 |
0.13 |
| chr6_135781762_135781943 | 0.68 |
Gm22892 |
predicted gene, 22892 |
40855 |
0.16 |
| chr13_4270977_4271134 | 0.68 |
Akr1c12 |
aldo-keto reductase family 1, member C12 |
8378 |
0.15 |
| chr10_68093593_68093917 | 0.68 |
Arid5b |
AT rich interactive domain 5B (MRF1-like) |
42871 |
0.14 |
| chr2_167148083_167148259 | 0.67 |
1110018N20Rik |
RIKEN cDNA 1110018N20 gene |
40531 |
0.08 |
| chr1_63112731_63113827 | 0.67 |
Ino80dos |
INO80 complex subunit D, opposite strand |
201 |
0.84 |
| chr2_31479577_31479870 | 0.67 |
Ass1 |
argininosuccinate synthetase 1 |
9516 |
0.19 |
| chr1_66816824_66817235 | 0.67 |
Kansl1l |
KAT8 regulatory NSL complex subunit 1-like |
517 |
0.58 |
| chr19_32778485_32778669 | 0.67 |
Pten |
phosphatase and tensin homolog |
20982 |
0.22 |
| chr11_63898490_63898690 | 0.67 |
Hs3st3b1 |
heparan sulfate (glucosamine) 3-O-sulfotransferase 3B1 |
23700 |
0.19 |
| chr10_127188743_127188894 | 0.67 |
Arhgef25 |
Rho guanine nucleotide exchange factor (GEF) 25 |
46 |
0.94 |
| chr6_86849988_86850139 | 0.67 |
Aak1 |
AP2 associated kinase 1 |
10 |
0.92 |
| chr7_98351265_98351558 | 0.67 |
Tsku |
tsukushi, small leucine rich proteoglycan |
8668 |
0.17 |
| chr8_127069779_127069930 | 0.67 |
Pard3 |
par-3 family cell polarity regulator |
3386 |
0.23 |
| chr2_50283993_50284144 | 0.67 |
Mmadhc |
methylmalonic aciduria (cobalamin deficiency) cblD type, with homocystinuria |
5131 |
0.24 |
| chr15_101977187_101977711 | 0.67 |
Krt78 |
keratin 78 |
23162 |
0.09 |
| chr7_139020930_139021245 | 0.67 |
Gm45613 |
predicted gene 45613 |
88 |
0.97 |
| chr16_93769998_93770254 | 0.66 |
Dop1b |
DOP1 leucine zipper like protein B |
3781 |
0.19 |
| chr11_60207570_60207721 | 0.66 |
Srebf1 |
sterol regulatory element binding transcription factor 1 |
457 |
0.71 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.9 | 5.7 | GO:0010046 | response to mycotoxin(GO:0010046) |
| 0.7 | 2.7 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 0.7 | 2.0 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
| 0.6 | 1.3 | GO:0071492 | cellular response to UV-A(GO:0071492) |
| 0.5 | 1.8 | GO:0010887 | negative regulation of cholesterol storage(GO:0010887) |
| 0.4 | 1.8 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.4 | 1.1 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.4 | 1.1 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.4 | 0.7 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
| 0.4 | 1.1 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
| 0.3 | 1.3 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
| 0.3 | 1.0 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
| 0.3 | 0.9 | GO:1900045 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.3 | 0.9 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
| 0.3 | 0.9 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
| 0.3 | 0.9 | GO:0090309 | positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
| 0.3 | 1.8 | GO:1903798 | regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903798) |
| 0.3 | 1.5 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
| 0.3 | 1.5 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
| 0.3 | 1.1 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.3 | 0.8 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
| 0.3 | 0.8 | GO:0032079 | positive regulation of endodeoxyribonuclease activity(GO:0032079) |
| 0.3 | 1.5 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
| 0.2 | 0.7 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
| 0.2 | 0.7 | GO:0097011 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) |
| 0.2 | 0.9 | GO:0071034 | CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
| 0.2 | 0.4 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
| 0.2 | 0.2 | GO:0010982 | regulation of high-density lipoprotein particle clearance(GO:0010982) |
| 0.2 | 0.7 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
| 0.2 | 0.4 | GO:0046985 | positive regulation of hemoglobin biosynthetic process(GO:0046985) |
| 0.2 | 0.2 | GO:0055118 | negative regulation of cardiac muscle contraction(GO:0055118) |
| 0.2 | 1.4 | GO:0046069 | cGMP catabolic process(GO:0046069) |
| 0.2 | 0.6 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 0.2 | 0.6 | GO:0042628 | mating plug formation(GO:0042628) post-mating behavior(GO:0045297) |
| 0.2 | 1.6 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
| 0.2 | 0.8 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
| 0.2 | 0.6 | GO:0006068 | ethanol catabolic process(GO:0006068) |
| 0.2 | 0.8 | GO:0014053 | negative regulation of gamma-aminobutyric acid secretion(GO:0014053) |
| 0.2 | 1.8 | GO:0097459 | iron ion import into cell(GO:0097459) |
| 0.2 | 0.6 | GO:2000383 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
| 0.2 | 1.0 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
| 0.2 | 0.6 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.2 | 0.4 | GO:1903977 | positive regulation of glial cell migration(GO:1903977) |
| 0.2 | 0.5 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
| 0.2 | 0.9 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) |
| 0.2 | 1.3 | GO:0032532 | regulation of microvillus length(GO:0032532) |
| 0.2 | 0.9 | GO:0032484 | Ral protein signal transduction(GO:0032484) |
| 0.2 | 0.5 | GO:1904430 | negative regulation of t-circle formation(GO:1904430) |
| 0.2 | 0.3 | GO:0032383 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.2 | 0.3 | GO:1902263 | apoptotic process involved in embryonic digit morphogenesis(GO:1902263) |
| 0.2 | 0.9 | GO:0090611 | ubiquitin-independent protein catabolic process via the multivesicular body sorting pathway(GO:0090611) |
| 0.2 | 0.5 | GO:2000259 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
| 0.2 | 0.7 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
| 0.2 | 0.3 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
| 0.2 | 0.8 | GO:1902570 | protein localization to nucleolus(GO:1902570) |
| 0.2 | 0.5 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
| 0.2 | 0.8 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
| 0.2 | 0.3 | GO:0035696 | monocyte extravasation(GO:0035696) regulation of monocyte extravasation(GO:2000437) |
| 0.2 | 0.5 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
| 0.2 | 1.7 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.2 | 0.7 | GO:1900147 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
| 0.2 | 0.5 | GO:0061535 | glutamate secretion, neurotransmission(GO:0061535) |
| 0.2 | 0.5 | GO:0061043 | regulation of vascular wound healing(GO:0061043) |
| 0.2 | 0.3 | GO:1903772 | regulation of viral budding via host ESCRT complex(GO:1903772) |
| 0.2 | 1.1 | GO:1900102 | negative regulation of endoplasmic reticulum unfolded protein response(GO:1900102) |
| 0.2 | 0.5 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
| 0.2 | 0.5 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
| 0.2 | 0.5 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) |
| 0.2 | 0.2 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.2 | 0.2 | GO:1902659 | regulation of glucose mediated signaling pathway(GO:1902659) positive regulation of glucose mediated signaling pathway(GO:1902661) |
| 0.2 | 0.5 | GO:0097167 | circadian regulation of translation(GO:0097167) |
| 0.2 | 0.8 | GO:0039702 | viral budding via host ESCRT complex(GO:0039702) |
| 0.2 | 0.6 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
| 0.2 | 0.3 | GO:0002572 | pro-T cell differentiation(GO:0002572) |
| 0.2 | 0.5 | GO:0015766 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.2 | 0.5 | GO:0071314 | cellular response to cocaine(GO:0071314) |
| 0.2 | 0.6 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.1 | 0.6 | GO:0031999 | negative regulation of fatty acid beta-oxidation(GO:0031999) |
| 0.1 | 0.6 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.1 | 0.1 | GO:0060336 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
| 0.1 | 0.6 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
| 0.1 | 0.3 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
| 0.1 | 0.4 | GO:0000087 | mitotic M phase(GO:0000087) |
| 0.1 | 0.7 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
| 0.1 | 0.6 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.1 | 0.7 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
| 0.1 | 1.0 | GO:0034625 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.1 | 0.3 | GO:0034137 | positive regulation of toll-like receptor 2 signaling pathway(GO:0034137) |
| 0.1 | 0.6 | GO:0071883 | activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) |
| 0.1 | 0.6 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
| 0.1 | 0.7 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.1 | 0.3 | GO:1901509 | regulation of endothelial tube morphogenesis(GO:1901509) |
| 0.1 | 0.3 | GO:0006538 | glutamate catabolic process(GO:0006538) |
| 0.1 | 0.7 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
| 0.1 | 0.7 | GO:0048133 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.1 | 1.0 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
| 0.1 | 0.4 | GO:0072592 | oxygen metabolic process(GO:0072592) |
| 0.1 | 0.3 | GO:0018197 | peptidyl-aspartic acid modification(GO:0018197) |
| 0.1 | 0.8 | GO:0015871 | choline transport(GO:0015871) |
| 0.1 | 0.7 | GO:0044854 | plasma membrane raft assembly(GO:0044854) plasma membrane raft organization(GO:0044857) |
| 0.1 | 0.3 | GO:0010963 | regulation of L-arginine import(GO:0010963) |
| 0.1 | 0.5 | GO:0048742 | regulation of skeletal muscle fiber development(GO:0048742) |
| 0.1 | 0.4 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
| 0.1 | 0.7 | GO:0098722 | asymmetric stem cell division(GO:0098722) |
| 0.1 | 0.4 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
| 0.1 | 0.4 | GO:0051025 | negative regulation of immunoglobulin secretion(GO:0051025) |
| 0.1 | 0.8 | GO:0045046 | peroxisomal membrane transport(GO:0015919) protein import into peroxisome membrane(GO:0045046) |
| 0.1 | 0.4 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
| 0.1 | 1.0 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
| 0.1 | 0.8 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
| 0.1 | 0.4 | GO:0070094 | positive regulation of glucagon secretion(GO:0070094) |
| 0.1 | 0.1 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
| 0.1 | 0.4 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
| 0.1 | 0.6 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
| 0.1 | 0.9 | GO:0043653 | mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
| 0.1 | 0.4 | GO:0006553 | lysine metabolic process(GO:0006553) |
| 0.1 | 0.4 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.1 | 0.5 | GO:0010288 | response to lead ion(GO:0010288) |
| 0.1 | 1.0 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.1 | 0.5 | GO:0036295 | cellular response to increased oxygen levels(GO:0036295) cellular response to hyperoxia(GO:0071455) |
| 0.1 | 0.2 | GO:0046271 | phenylpropanoid catabolic process(GO:0046271) |
| 0.1 | 0.2 | GO:0035865 | response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
| 0.1 | 0.2 | GO:0007228 | positive regulation of hh target transcription factor activity(GO:0007228) |
| 0.1 | 0.2 | GO:0034770 | histone H4-K20 methylation(GO:0034770) |
| 0.1 | 0.4 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
| 0.1 | 0.4 | GO:1902004 | positive regulation of beta-amyloid formation(GO:1902004) positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
| 0.1 | 0.7 | GO:0051639 | actin filament network formation(GO:0051639) |
| 0.1 | 0.4 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.1 | 0.4 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.1 | 0.2 | GO:0061198 | fungiform papilla formation(GO:0061198) |
| 0.1 | 0.4 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
| 0.1 | 0.2 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
| 0.1 | 0.7 | GO:0090166 | Golgi disassembly(GO:0090166) |
| 0.1 | 0.3 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
| 0.1 | 0.3 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
| 0.1 | 0.6 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
| 0.1 | 0.3 | GO:0031587 | positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
| 0.1 | 0.5 | GO:0015819 | lysine transport(GO:0015819) |
| 0.1 | 1.0 | GO:0010713 | negative regulation of collagen metabolic process(GO:0010713) negative regulation of collagen biosynthetic process(GO:0032966) |
| 0.1 | 0.1 | GO:0042524 | negative regulation of tyrosine phosphorylation of Stat5 protein(GO:0042524) |
| 0.1 | 0.3 | GO:0061010 | gall bladder development(GO:0061010) |
| 0.1 | 0.1 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
| 0.1 | 0.4 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
| 0.1 | 0.3 | GO:0045897 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
| 0.1 | 0.4 | GO:0006057 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) |
| 0.1 | 0.3 | GO:0010482 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
| 0.1 | 0.5 | GO:1990564 | protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
| 0.1 | 0.3 | GO:0035283 | central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
| 0.1 | 0.3 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
| 0.1 | 0.5 | GO:1903276 | regulation of sodium ion export(GO:1903273) regulation of sodium ion export from cell(GO:1903276) |
| 0.1 | 0.3 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.1 | 0.2 | GO:0035790 | platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
| 0.1 | 0.3 | GO:0071895 | odontoblast differentiation(GO:0071895) |
| 0.1 | 0.5 | GO:0044829 | positive regulation by host of viral genome replication(GO:0044829) |
| 0.1 | 0.4 | GO:0006551 | leucine metabolic process(GO:0006551) |
| 0.1 | 0.4 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
| 0.1 | 0.5 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.1 | 0.2 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 0.1 | 0.2 | GO:0061153 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.1 | 0.1 | GO:0031585 | regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031585) |
| 0.1 | 0.1 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.1 | 0.2 | GO:0060279 | positive regulation of ovulation(GO:0060279) |
| 0.1 | 0.3 | GO:0048696 | regulation of collateral sprouting in absence of injury(GO:0048696) |
| 0.1 | 0.3 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
| 0.1 | 0.4 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
| 0.1 | 0.3 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.1 | 0.5 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
| 0.1 | 0.4 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) |
| 0.1 | 0.2 | GO:0043321 | regulation of natural killer cell degranulation(GO:0043321) |
| 0.1 | 0.1 | GO:0048807 | female genitalia morphogenesis(GO:0048807) |
| 0.1 | 0.4 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
| 0.1 | 0.9 | GO:0009209 | pyrimidine ribonucleoside triphosphate biosynthetic process(GO:0009209) |
| 0.1 | 0.9 | GO:0052697 | xenobiotic glucuronidation(GO:0052697) |
| 0.1 | 0.1 | GO:0042362 | fat-soluble vitamin biosynthetic process(GO:0042362) |
| 0.1 | 0.2 | GO:0003213 | cardiac right atrium morphogenesis(GO:0003213) |
| 0.1 | 0.4 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
| 0.1 | 0.9 | GO:0000338 | protein deneddylation(GO:0000338) |
| 0.1 | 0.8 | GO:0006563 | L-serine metabolic process(GO:0006563) |
| 0.1 | 0.1 | GO:0009436 | glyoxylate catabolic process(GO:0009436) |
| 0.1 | 0.3 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.1 | 0.3 | GO:0048254 | snoRNA localization(GO:0048254) |
| 0.1 | 0.1 | GO:0044704 | single-organism reproductive behavior(GO:0044704) |
| 0.1 | 0.3 | GO:0006106 | fumarate metabolic process(GO:0006106) |
| 0.1 | 0.5 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
| 0.1 | 0.4 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.1 | 0.4 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.1 | 0.1 | GO:0034310 | primary alcohol catabolic process(GO:0034310) |
| 0.1 | 0.3 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.1 | 0.3 | GO:0003383 | apical constriction(GO:0003383) |
| 0.1 | 0.2 | GO:0014900 | regulation of muscle hyperplasia(GO:0014738) muscle hyperplasia(GO:0014900) |
| 0.1 | 0.2 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
| 0.1 | 0.1 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
| 0.1 | 0.1 | GO:2000828 | regulation of parathyroid hormone secretion(GO:2000828) |
| 0.1 | 0.1 | GO:0035247 | peptidyl-arginine omega-N-methylation(GO:0035247) |
| 0.1 | 1.1 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.1 | 0.2 | GO:0060462 | lung lobe development(GO:0060462) lung lobe morphogenesis(GO:0060463) |
| 0.1 | 0.4 | GO:0060155 | platelet dense granule organization(GO:0060155) |
| 0.1 | 0.3 | GO:0032201 | telomere maintenance via semi-conservative replication(GO:0032201) |
| 0.1 | 0.6 | GO:0000447 | endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
| 0.1 | 0.3 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
| 0.1 | 0.6 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
| 0.1 | 0.3 | GO:1900222 | negative regulation of beta-amyloid clearance(GO:1900222) |
| 0.1 | 0.6 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.1 | 0.4 | GO:0033578 | protein glycosylation in Golgi(GO:0033578) |
| 0.1 | 0.5 | GO:1900101 | regulation of endoplasmic reticulum unfolded protein response(GO:1900101) |
| 0.1 | 0.2 | GO:0032741 | positive regulation of interleukin-18 production(GO:0032741) |
| 0.1 | 0.3 | GO:0061368 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
| 0.1 | 0.3 | GO:0042984 | amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
| 0.1 | 0.3 | GO:1900060 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) negative regulation of ceramide biosynthetic process(GO:1900060) |
| 0.1 | 0.1 | GO:1900368 | regulation of RNA interference(GO:1900368) |
| 0.1 | 0.2 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.1 | 0.3 | GO:0021699 | cerebellar cortex maturation(GO:0021699) |
| 0.1 | 0.3 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
| 0.1 | 0.3 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.1 | 0.9 | GO:0009404 | toxin metabolic process(GO:0009404) |
| 0.1 | 0.4 | GO:0048341 | paraxial mesoderm formation(GO:0048341) |
| 0.1 | 0.5 | GO:0090209 | negative regulation of triglyceride metabolic process(GO:0090209) |
| 0.1 | 0.2 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
| 0.1 | 0.2 | GO:0010979 | regulation of vitamin D 24-hydroxylase activity(GO:0010979) positive regulation of vitamin D 24-hydroxylase activity(GO:0010980) |
| 0.1 | 0.3 | GO:0032474 | otolith morphogenesis(GO:0032474) |
| 0.1 | 0.2 | GO:1903751 | regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903750) negative regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903751) |
| 0.1 | 0.1 | GO:0071672 | negative regulation of smooth muscle cell chemotaxis(GO:0071672) |
| 0.1 | 0.4 | GO:0034379 | very-low-density lipoprotein particle assembly(GO:0034379) |
| 0.1 | 0.3 | GO:0070782 | phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
| 0.1 | 0.3 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
| 0.1 | 0.3 | GO:0045950 | negative regulation of mitotic recombination(GO:0045950) |
| 0.1 | 0.2 | GO:0071462 | cellular response to water stimulus(GO:0071462) |
| 0.1 | 0.7 | GO:0036315 | cellular response to sterol(GO:0036315) |
| 0.1 | 0.3 | GO:1990034 | calcium ion export from cell(GO:1990034) |
| 0.1 | 0.3 | GO:0070427 | nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070427) |
| 0.1 | 0.4 | GO:0021780 | oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
| 0.1 | 0.3 | GO:0032439 | endosome localization(GO:0032439) |
| 0.1 | 0.3 | GO:0016103 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
| 0.1 | 1.1 | GO:0045116 | protein neddylation(GO:0045116) |
| 0.1 | 1.6 | GO:0048643 | positive regulation of skeletal muscle tissue development(GO:0048643) |
| 0.1 | 0.3 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
| 0.1 | 0.3 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
| 0.1 | 0.3 | GO:0046959 | habituation(GO:0046959) |
| 0.1 | 0.5 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.1 | 0.7 | GO:0046512 | diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
| 0.1 | 0.2 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
| 0.1 | 0.5 | GO:0002002 | regulation of angiotensin levels in blood(GO:0002002) |
| 0.1 | 0.7 | GO:0035999 | tetrahydrofolate interconversion(GO:0035999) |
| 0.1 | 0.2 | GO:0010957 | negative regulation of vitamin D biosynthetic process(GO:0010957) |
| 0.1 | 0.7 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.1 | 0.1 | GO:0045726 | positive regulation of integrin biosynthetic process(GO:0045726) |
| 0.1 | 0.1 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
| 0.1 | 1.1 | GO:0006465 | signal peptide processing(GO:0006465) |
| 0.1 | 0.2 | GO:0021586 | pons maturation(GO:0021586) |
| 0.1 | 0.5 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
| 0.1 | 0.3 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
| 0.1 | 0.2 | GO:0034141 | positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
| 0.1 | 0.5 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
| 0.1 | 0.4 | GO:0051771 | negative regulation of nitric-oxide synthase biosynthetic process(GO:0051771) |
| 0.1 | 0.2 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
| 0.1 | 0.4 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 0.1 | 0.6 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
| 0.1 | 0.2 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
| 0.1 | 0.1 | GO:0034139 | regulation of toll-like receptor 3 signaling pathway(GO:0034139) |
| 0.1 | 0.2 | GO:0045583 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
| 0.1 | 0.3 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
| 0.1 | 0.3 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
| 0.1 | 0.5 | GO:0006108 | malate metabolic process(GO:0006108) |
| 0.1 | 0.3 | GO:0018101 | protein citrullination(GO:0018101) |
| 0.1 | 0.2 | GO:0060447 | bud outgrowth involved in lung branching(GO:0060447) |
| 0.1 | 0.2 | GO:0071638 | negative regulation of monocyte chemotactic protein-1 production(GO:0071638) |
| 0.1 | 0.2 | GO:0019478 | D-amino acid catabolic process(GO:0019478) D-amino acid metabolic process(GO:0046416) |
| 0.1 | 0.3 | GO:0051596 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 0.1 | 0.4 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
| 0.1 | 0.1 | GO:0097104 | postsynaptic membrane assembly(GO:0097104) |
| 0.1 | 0.2 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
| 0.1 | 0.6 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.1 | 0.2 | GO:0035754 | B cell chemotaxis(GO:0035754) |
| 0.1 | 0.3 | GO:1903142 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
| 0.1 | 0.4 | GO:0009249 | protein lipoylation(GO:0009249) |
| 0.1 | 0.2 | GO:1901096 | regulation of autophagosome maturation(GO:1901096) |
| 0.1 | 0.2 | GO:0072076 | nephrogenic mesenchyme development(GO:0072076) |
| 0.1 | 0.2 | GO:0009078 | alanine metabolic process(GO:0006522) pyruvate family amino acid metabolic process(GO:0009078) L-alanine metabolic process(GO:0042851) |
| 0.1 | 0.1 | GO:0032512 | regulation of protein phosphatase type 2B activity(GO:0032512) negative regulation of protein phosphatase type 2B activity(GO:0032513) |
| 0.1 | 0.3 | GO:0006742 | NADP catabolic process(GO:0006742) |
| 0.1 | 0.4 | GO:0035336 | long-chain fatty-acyl-CoA metabolic process(GO:0035336) |
| 0.1 | 0.1 | GO:1903423 | positive regulation of synaptic vesicle recycling(GO:1903423) |
| 0.1 | 0.3 | GO:0009133 | nucleoside diphosphate biosynthetic process(GO:0009133) |
| 0.1 | 0.4 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
| 0.1 | 0.4 | GO:0051122 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
| 0.1 | 0.1 | GO:0009826 | unidimensional cell growth(GO:0009826) |
| 0.1 | 0.4 | GO:0030432 | peristalsis(GO:0030432) |
| 0.1 | 0.6 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
| 0.1 | 0.2 | GO:0045112 | integrin biosynthetic process(GO:0045112) |
| 0.1 | 0.4 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.1 | 0.4 | GO:0045416 | positive regulation of interleukin-8 biosynthetic process(GO:0045416) |
| 0.1 | 0.7 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
| 0.1 | 0.8 | GO:0021527 | spinal cord association neuron differentiation(GO:0021527) |
| 0.1 | 0.3 | GO:0030638 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.1 | 0.1 | GO:0051081 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
| 0.1 | 0.1 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
| 0.1 | 0.2 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
| 0.1 | 0.4 | GO:0030259 | lipid glycosylation(GO:0030259) |
| 0.1 | 0.2 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.1 | 1.3 | GO:0070884 | regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
| 0.1 | 0.1 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
| 0.1 | 0.1 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
| 0.1 | 0.3 | GO:0003192 | mitral valve formation(GO:0003192) |
| 0.1 | 0.4 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
| 0.1 | 0.7 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.1 | 0.1 | GO:0036258 | multivesicular body assembly(GO:0036258) |
| 0.1 | 0.9 | GO:0015858 | nucleoside transport(GO:0015858) |
| 0.1 | 0.1 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
| 0.1 | 0.4 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.1 | 0.4 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
| 0.1 | 0.2 | GO:0000710 | meiotic mismatch repair(GO:0000710) |
| 0.1 | 0.5 | GO:0002091 | negative regulation of receptor internalization(GO:0002091) |
| 0.1 | 0.2 | GO:0046477 | glycosylceramide catabolic process(GO:0046477) |
| 0.1 | 0.4 | GO:0042590 | antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
| 0.1 | 0.1 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
| 0.1 | 0.2 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) |
| 0.1 | 0.3 | GO:0042761 | very long-chain fatty acid biosynthetic process(GO:0042761) |
| 0.1 | 0.5 | GO:0035280 | miRNA loading onto RISC involved in gene silencing by miRNA(GO:0035280) |
| 0.1 | 0.3 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.1 | 0.7 | GO:0032308 | positive regulation of prostaglandin secretion(GO:0032308) |
| 0.1 | 0.3 | GO:2001182 | regulation of interleukin-12 secretion(GO:2001182) |
| 0.1 | 0.1 | GO:1902414 | protein localization to cell junction(GO:1902414) |
| 0.1 | 0.2 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 0.1 | 0.7 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.1 | 0.3 | GO:0060334 | regulation of interferon-gamma-mediated signaling pathway(GO:0060334) |
| 0.1 | 0.2 | GO:0043553 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
| 0.1 | 0.3 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.1 | 0.2 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
| 0.1 | 0.1 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
| 0.1 | 0.3 | GO:0006573 | valine metabolic process(GO:0006573) |
| 0.1 | 0.1 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
| 0.1 | 0.8 | GO:0007096 | regulation of exit from mitosis(GO:0007096) |
| 0.1 | 0.2 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
| 0.1 | 0.4 | GO:0061081 | positive regulation of myeloid leukocyte cytokine production involved in immune response(GO:0061081) |
| 0.1 | 0.2 | GO:0051013 | microtubule severing(GO:0051013) |
| 0.1 | 0.3 | GO:0060179 | male mating behavior(GO:0060179) |
| 0.1 | 0.3 | GO:0015884 | folic acid transport(GO:0015884) |
| 0.1 | 0.4 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.1 | 0.1 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
| 0.1 | 0.5 | GO:0090169 | regulation of spindle assembly(GO:0090169) |
| 0.1 | 0.1 | GO:0018214 | protein carboxylation(GO:0018214) |
| 0.1 | 0.1 | GO:0006295 | nucleotide-excision repair, DNA incision, 3'-to lesion(GO:0006295) |
| 0.1 | 0.2 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.1 | 0.2 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.1 | 0.5 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
| 0.1 | 0.1 | GO:0070672 | response to interleukin-15(GO:0070672) |
| 0.1 | 0.3 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.1 | 0.5 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
| 0.1 | 0.1 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
| 0.1 | 0.1 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.1 | 0.3 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.1 | 0.4 | GO:1902222 | L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
| 0.1 | 0.3 | GO:0019740 | nitrogen utilization(GO:0019740) |
| 0.1 | 0.1 | GO:1903147 | negative regulation of mitophagy(GO:1903147) |
| 0.1 | 0.1 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.1 | 0.4 | GO:0097120 | receptor localization to synapse(GO:0097120) |
| 0.1 | 0.5 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
| 0.1 | 0.3 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
| 0.1 | 0.4 | GO:1901620 | regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901620) |
| 0.1 | 0.3 | GO:0045586 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
| 0.1 | 0.3 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
| 0.1 | 0.1 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
| 0.1 | 0.1 | GO:0046813 | receptor-mediated virion attachment to host cell(GO:0046813) |
| 0.1 | 0.1 | GO:0070092 | regulation of glucagon secretion(GO:0070092) |
| 0.1 | 0.6 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
| 0.1 | 0.1 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.1 | 0.6 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
| 0.1 | 0.5 | GO:0046831 | regulation of RNA export from nucleus(GO:0046831) |
| 0.1 | 0.4 | GO:0070189 | kynurenine metabolic process(GO:0070189) |
| 0.1 | 0.4 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
| 0.1 | 0.5 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
| 0.1 | 0.4 | GO:0031000 | response to caffeine(GO:0031000) |
| 0.1 | 0.1 | GO:1901069 | guanosine-containing compound catabolic process(GO:1901069) |
| 0.1 | 0.1 | GO:0061355 | Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) |
| 0.1 | 0.9 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
| 0.1 | 0.2 | GO:1904995 | negative regulation of leukocyte adhesion to vascular endothelial cell(GO:1904995) |
| 0.1 | 0.7 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.1 | 0.2 | GO:2000622 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.1 | 0.1 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
| 0.1 | 0.1 | GO:0001828 | inner cell mass cellular morphogenesis(GO:0001828) |
| 0.1 | 0.1 | GO:0061144 | alveolar secondary septum development(GO:0061144) |
| 0.1 | 0.2 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.1 | 0.1 | GO:0036023 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) |
| 0.1 | 0.1 | GO:2000615 | regulation of histone H3-K9 acetylation(GO:2000615) |
| 0.1 | 0.2 | GO:0048478 | replication fork protection(GO:0048478) |
| 0.1 | 0.2 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
| 0.1 | 0.2 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
| 0.1 | 0.2 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
| 0.1 | 0.4 | GO:0030836 | positive regulation of actin filament depolymerization(GO:0030836) |
| 0.1 | 0.2 | GO:0048840 | otolith development(GO:0048840) |
| 0.1 | 0.3 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
| 0.1 | 0.1 | GO:1903599 | positive regulation of mitophagy(GO:1903599) |
| 0.1 | 0.1 | GO:0046051 | UTP metabolic process(GO:0046051) |
| 0.1 | 0.3 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
| 0.1 | 0.2 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 0.1 | 0.6 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
| 0.1 | 0.1 | GO:0033026 | negative regulation of mast cell apoptotic process(GO:0033026) |
| 0.1 | 0.2 | GO:1903301 | positive regulation of glucokinase activity(GO:0033133) positive regulation of hexokinase activity(GO:1903301) |
| 0.1 | 0.3 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
| 0.1 | 0.2 | GO:0015820 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
| 0.1 | 0.3 | GO:0046134 | pyrimidine nucleoside biosynthetic process(GO:0046134) |
| 0.1 | 0.1 | GO:0006393 | termination of mitochondrial transcription(GO:0006393) |
| 0.1 | 0.1 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.1 | 0.2 | GO:0035627 | ceramide transport(GO:0035627) |
| 0.1 | 0.2 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
| 0.1 | 0.6 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.1 | 0.3 | GO:0046033 | AMP metabolic process(GO:0046033) |
| 0.1 | 0.5 | GO:0000103 | sulfate assimilation(GO:0000103) |
| 0.1 | 0.1 | GO:0036476 | neuron death in response to hydrogen peroxide(GO:0036476) regulation of hydrogen peroxide-induced neuron death(GO:1903207) negative regulation of hydrogen peroxide-induced neuron death(GO:1903208) |
| 0.1 | 0.2 | GO:0060283 | negative regulation of oocyte development(GO:0060283) negative regulation of oocyte maturation(GO:1900194) |
| 0.1 | 0.2 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
| 0.1 | 0.1 | GO:0035701 | hematopoietic stem cell migration(GO:0035701) |
| 0.1 | 0.1 | GO:0042532 | negative regulation of tyrosine phosphorylation of STAT protein(GO:0042532) |
| 0.1 | 0.2 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
| 0.1 | 0.3 | GO:0090308 | regulation of methylation-dependent chromatin silencing(GO:0090308) |
| 0.1 | 0.3 | GO:0071281 | cellular response to iron ion(GO:0071281) |
| 0.1 | 0.1 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
| 0.1 | 0.4 | GO:0090051 | negative regulation of cell migration involved in sprouting angiogenesis(GO:0090051) |
| 0.1 | 0.1 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 0.1 | 0.2 | GO:0090069 | regulation of ribosome biogenesis(GO:0090069) |
| 0.1 | 0.4 | GO:0060628 | regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
| 0.1 | 0.2 | GO:0042091 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
| 0.1 | 0.3 | GO:0046618 | drug export(GO:0046618) |
| 0.1 | 0.3 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
| 0.1 | 0.2 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
| 0.1 | 0.1 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
| 0.1 | 0.9 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
| 0.1 | 0.3 | GO:0009125 | nucleoside monophosphate catabolic process(GO:0009125) |
| 0.1 | 0.2 | GO:0060988 | lipid tube assembly(GO:0060988) |
| 0.1 | 0.2 | GO:0070842 | aggresome assembly(GO:0070842) |
| 0.1 | 0.2 | GO:0006714 | sesquiterpenoid metabolic process(GO:0006714) |
| 0.1 | 0.3 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.1 | 0.2 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
| 0.1 | 0.2 | GO:0036089 | cleavage furrow formation(GO:0036089) |
| 0.1 | 0.1 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
| 0.1 | 0.2 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.1 | 0.1 | GO:1904690 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.1 | 0.1 | GO:0043652 | engulfment of apoptotic cell(GO:0043652) |
| 0.1 | 0.4 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
| 0.1 | 0.2 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
| 0.1 | 0.3 | GO:0051657 | maintenance of organelle location(GO:0051657) |
| 0.1 | 0.2 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
| 0.1 | 0.4 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.1 | 0.3 | GO:0071267 | methionine biosynthetic process(GO:0009086) amino acid salvage(GO:0043102) L-methionine biosynthetic process(GO:0071265) L-methionine salvage(GO:0071267) |
| 0.1 | 0.9 | GO:0006491 | N-glycan processing(GO:0006491) |
| 0.1 | 0.1 | GO:0030908 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
| 0.1 | 0.1 | GO:0010993 | regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
| 0.1 | 0.2 | GO:0015677 | copper ion import(GO:0015677) |
| 0.1 | 0.4 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.1 | 0.5 | GO:0007342 | fusion of sperm to egg plasma membrane(GO:0007342) |
| 0.1 | 0.6 | GO:0042438 | melanin biosynthetic process(GO:0042438) |
| 0.0 | 0.1 | GO:0090027 | negative regulation of monocyte chemotaxis(GO:0090027) |
| 0.0 | 0.2 | GO:0060087 | relaxation of vascular smooth muscle(GO:0060087) |
| 0.0 | 0.6 | GO:0060670 | branching involved in labyrinthine layer morphogenesis(GO:0060670) |
| 0.0 | 0.0 | GO:0042402 | cellular biogenic amine catabolic process(GO:0042402) |
| 0.0 | 0.1 | GO:0007258 | JUN phosphorylation(GO:0007258) |
| 0.0 | 0.0 | GO:1904742 | regulation of telomeric DNA binding(GO:1904742) |
| 0.0 | 0.1 | GO:2000870 | regulation of progesterone secretion(GO:2000870) |
| 0.0 | 0.1 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
| 0.0 | 0.7 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.0 | 0.2 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
| 0.0 | 1.2 | GO:0045839 | negative regulation of mitotic nuclear division(GO:0045839) |
| 0.0 | 0.3 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
| 0.0 | 0.0 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
| 0.0 | 0.1 | GO:0035090 | maintenance of apical/basal cell polarity(GO:0035090) |
| 0.0 | 0.3 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
| 0.0 | 0.1 | GO:0100012 | regulation of heart induction by regulation of canonical Wnt signaling pathway(GO:0090081) regulation of heart induction(GO:0090381) regulation of heart induction by canonical Wnt signaling pathway(GO:0100012) positive regulation of heart induction(GO:1901321) |
| 0.0 | 0.1 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.0 | 0.0 | GO:0002554 | serotonin secretion by platelet(GO:0002554) |
| 0.0 | 0.1 | GO:1904528 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
| 0.0 | 0.2 | GO:0007220 | Notch receptor processing(GO:0007220) |
| 0.0 | 0.3 | GO:0086013 | membrane repolarization during cardiac muscle cell action potential(GO:0086013) |
| 0.0 | 0.0 | GO:0048769 | sarcomerogenesis(GO:0048769) |
| 0.0 | 0.1 | GO:0034756 | regulation of iron ion transport(GO:0034756) |
| 0.0 | 0.1 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
| 0.0 | 0.1 | GO:0043101 | purine-containing compound salvage(GO:0043101) |
| 0.0 | 0.3 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.0 | 0.1 | GO:1990144 | regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903297) negative regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903298) intrinsic apoptotic signaling pathway in response to hypoxia(GO:1990144) |
| 0.0 | 0.1 | GO:0099515 | actin filament-based transport(GO:0099515) |
| 0.0 | 0.5 | GO:0010165 | response to X-ray(GO:0010165) |
| 0.0 | 0.1 | GO:0060371 | regulation of atrial cardiac muscle cell membrane depolarization(GO:0060371) |
| 0.0 | 0.3 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
| 0.0 | 0.2 | GO:0040034 | regulation of development, heterochronic(GO:0040034) |
| 0.0 | 0.1 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.0 | 0.1 | GO:0009972 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
| 0.0 | 0.7 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
| 0.0 | 0.2 | GO:1903887 | motile primary cilium assembly(GO:1903887) |
| 0.0 | 0.8 | GO:0002021 | response to dietary excess(GO:0002021) |
| 0.0 | 0.1 | GO:0042182 | ketone catabolic process(GO:0042182) |
| 0.0 | 0.1 | GO:0042759 | long-chain fatty acid biosynthetic process(GO:0042759) |
| 0.0 | 0.7 | GO:0006376 | mRNA splice site selection(GO:0006376) |
| 0.0 | 0.8 | GO:0006783 | heme biosynthetic process(GO:0006783) |
| 0.0 | 0.0 | GO:0031087 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.0 | 0.0 | GO:0070669 | response to interleukin-2(GO:0070669) |
| 0.0 | 0.1 | GO:0044827 | modulation by host of viral genome replication(GO:0044827) |
| 0.0 | 0.3 | GO:1901339 | regulation of store-operated calcium channel activity(GO:1901339) |
| 0.0 | 0.1 | GO:0072102 | glomerulus morphogenesis(GO:0072102) |
| 0.0 | 0.1 | GO:0035262 | gonad morphogenesis(GO:0035262) |
| 0.0 | 0.0 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
| 0.0 | 0.1 | GO:0046104 | thymidine metabolic process(GO:0046104) |
| 0.0 | 0.0 | GO:0060684 | epithelial-mesenchymal cell signaling(GO:0060684) |
| 0.0 | 0.8 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
| 0.0 | 0.1 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
| 0.0 | 0.7 | GO:1903146 | regulation of mitophagy(GO:1903146) |
| 0.0 | 0.2 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.0 | 0.1 | GO:0035356 | cellular triglyceride homeostasis(GO:0035356) |
| 0.0 | 1.3 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
| 0.0 | 1.0 | GO:0000184 | nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
| 0.0 | 0.1 | GO:0002370 | natural killer cell cytokine production(GO:0002370) regulation of natural killer cell cytokine production(GO:0002727) |
| 0.0 | 0.1 | GO:0002636 | positive regulation of germinal center formation(GO:0002636) |
| 0.0 | 0.1 | GO:0034197 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
| 0.0 | 0.0 | GO:0031627 | telomeric loop formation(GO:0031627) |
| 0.0 | 0.1 | GO:0010455 | positive regulation of cell fate commitment(GO:0010455) |
| 0.0 | 0.2 | GO:0006517 | protein deglycosylation(GO:0006517) |
| 0.0 | 0.0 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
| 0.0 | 0.1 | GO:0010841 | positive regulation of circadian sleep/wake cycle, wakefulness(GO:0010841) |
| 0.0 | 0.0 | GO:0030497 | fatty acid elongation(GO:0030497) |
| 0.0 | 0.0 | GO:0006555 | methionine metabolic process(GO:0006555) |
| 0.0 | 0.2 | GO:0046490 | isopentenyl diphosphate metabolic process(GO:0046490) |
| 0.0 | 0.0 | GO:0090306 | spindle assembly involved in meiosis(GO:0090306) |
| 0.0 | 0.4 | GO:0000722 | telomere maintenance via recombination(GO:0000722) |
| 0.0 | 0.1 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
| 0.0 | 0.3 | GO:0070234 | positive regulation of T cell apoptotic process(GO:0070234) |
| 0.0 | 0.1 | GO:0050717 | positive regulation of interleukin-1 alpha secretion(GO:0050717) |
| 0.0 | 0.1 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
| 0.0 | 0.0 | GO:0032906 | transforming growth factor beta2 production(GO:0032906) regulation of transforming growth factor beta2 production(GO:0032909) |
| 0.0 | 0.2 | GO:0045607 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.0 | 0.4 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
| 0.0 | 0.3 | GO:2000194 | regulation of female gonad development(GO:2000194) |
| 0.0 | 0.4 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.0 | 0.2 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
| 0.0 | 0.0 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
| 0.0 | 1.8 | GO:0006892 | post-Golgi vesicle-mediated transport(GO:0006892) |
| 0.0 | 0.1 | GO:0000479 | endonucleolytic cleavage of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000479) |
| 0.0 | 0.2 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
| 0.0 | 0.0 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
| 0.0 | 0.1 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
| 0.0 | 0.3 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
| 0.0 | 0.0 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
| 0.0 | 0.2 | GO:0071763 | nuclear membrane organization(GO:0071763) |
| 0.0 | 0.2 | GO:0048149 | behavioral response to ethanol(GO:0048149) |
| 0.0 | 0.2 | GO:0031034 | myosin filament assembly(GO:0031034) |
| 0.0 | 0.1 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 0.0 | 0.2 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
| 0.0 | 0.1 | GO:1901679 | pyrimidine-containing compound transmembrane transport(GO:0072531) nucleotide transmembrane transport(GO:1901679) |
| 0.0 | 0.1 | GO:0021603 | cranial nerve formation(GO:0021603) |
| 0.0 | 0.1 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
| 0.0 | 0.4 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.0 | 0.1 | GO:0008627 | intrinsic apoptotic signaling pathway in response to osmotic stress(GO:0008627) regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902218) negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
| 0.0 | 0.2 | GO:0070475 | rRNA base methylation(GO:0070475) |
| 0.0 | 0.2 | GO:0060591 | chondroblast differentiation(GO:0060591) |
| 0.0 | 0.3 | GO:1903779 | regulation of cardiac conduction(GO:1903779) |
| 0.0 | 0.1 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.0 | 0.2 | GO:1900112 | regulation of histone H3-K9 trimethylation(GO:1900112) negative regulation of histone H3-K9 trimethylation(GO:1900113) |
| 0.0 | 0.2 | GO:0017121 | phospholipid scrambling(GO:0017121) |
| 0.0 | 0.1 | GO:0051799 | negative regulation of hair follicle development(GO:0051799) |
| 0.0 | 0.2 | GO:0000076 | DNA replication checkpoint(GO:0000076) |
| 0.0 | 0.1 | GO:0014029 | neural crest formation(GO:0014029) |
| 0.0 | 0.2 | GO:0008063 | Toll signaling pathway(GO:0008063) |
| 0.0 | 0.2 | GO:0033860 | regulation of NAD(P)H oxidase activity(GO:0033860) |
| 0.0 | 0.2 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 0.0 | 0.2 | GO:1904467 | regulation of tumor necrosis factor secretion(GO:1904467) positive regulation of tumor necrosis factor secretion(GO:1904469) tumor necrosis factor secretion(GO:1990774) |
| 0.0 | 0.2 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
| 0.0 | 0.2 | GO:0042448 | progesterone metabolic process(GO:0042448) |
| 0.0 | 0.2 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
| 0.0 | 0.1 | GO:2000680 | regulation of rubidium ion transport(GO:2000680) |
| 0.0 | 0.1 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.0 | 0.0 | GO:0003284 | septum primum development(GO:0003284) atrial septum primum morphogenesis(GO:0003289) |
| 0.0 | 0.1 | GO:0060903 | positive regulation of meiosis I(GO:0060903) |
| 0.0 | 0.2 | GO:1901407 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
| 0.0 | 0.1 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
| 0.0 | 0.0 | GO:2000409 | positive regulation of T cell extravasation(GO:2000409) |
| 0.0 | 0.1 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
| 0.0 | 0.4 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.0 | 0.1 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.0 | 0.0 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
| 0.0 | 0.1 | GO:0043649 | dicarboxylic acid catabolic process(GO:0043649) |
| 0.0 | 0.2 | GO:2000193 | positive regulation of fatty acid transport(GO:2000193) |
| 0.0 | 0.4 | GO:0048148 | behavioral response to cocaine(GO:0048148) |
| 0.0 | 0.1 | GO:0038095 | Fc-epsilon receptor signaling pathway(GO:0038095) |
| 0.0 | 0.1 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
| 0.0 | 0.1 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.0 | 0.2 | GO:0016093 | polyprenol metabolic process(GO:0016093) |
| 0.0 | 0.2 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
| 0.0 | 0.1 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
| 0.0 | 0.4 | GO:0061003 | positive regulation of dendritic spine morphogenesis(GO:0061003) |
| 0.0 | 0.1 | GO:0021912 | regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) |
| 0.0 | 0.1 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
| 0.0 | 0.2 | GO:1900107 | regulation of nodal signaling pathway(GO:1900107) |
| 0.0 | 0.0 | GO:0070508 | sterol import(GO:0035376) cholesterol import(GO:0070508) |
| 0.0 | 0.0 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
| 0.0 | 0.1 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.0 | 0.1 | GO:0052055 | modulation by symbiont of host molecular function(GO:0052055) |
| 0.0 | 0.3 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
| 0.0 | 0.2 | GO:0060693 | regulation of branching involved in salivary gland morphogenesis(GO:0060693) |
| 0.0 | 0.1 | GO:1901299 | negative regulation of hydrogen peroxide-mediated programmed cell death(GO:1901299) |
| 0.0 | 0.1 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.0 | 0.1 | GO:0048936 | peripheral nervous system neuron axonogenesis(GO:0048936) |
| 0.0 | 0.1 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.0 | 0.1 | GO:0019530 | taurine metabolic process(GO:0019530) |
| 0.0 | 0.0 | GO:0009148 | pyrimidine nucleoside triphosphate biosynthetic process(GO:0009148) |
| 0.0 | 0.1 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.0 | 0.2 | GO:0002072 | optic cup morphogenesis involved in camera-type eye development(GO:0002072) |
| 0.0 | 0.1 | GO:0036465 | synaptic vesicle recycling(GO:0036465) |
| 0.0 | 0.3 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
| 0.0 | 0.1 | GO:0046684 | response to pyrethroid(GO:0046684) |
| 0.0 | 0.0 | GO:0001951 | intestinal D-glucose absorption(GO:0001951) |
| 0.0 | 0.1 | GO:0021898 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) commitment of multipotent stem cells to neuronal lineage in forebrain(GO:0021898) |
| 0.0 | 0.3 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
| 0.0 | 0.2 | GO:0015824 | proline transport(GO:0015824) |
| 0.0 | 0.1 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 0.0 | 0.0 | GO:0072710 | response to hydroxyurea(GO:0072710) cellular response to hydroxyurea(GO:0072711) |
| 0.0 | 0.2 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
| 0.0 | 0.0 | GO:0050705 | regulation of interleukin-1 alpha secretion(GO:0050705) |
| 0.0 | 0.1 | GO:0070268 | cornification(GO:0070268) |
| 0.0 | 0.1 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
| 0.0 | 0.3 | GO:0007097 | nuclear migration(GO:0007097) |
| 0.0 | 0.1 | GO:0009629 | response to gravity(GO:0009629) |
| 0.0 | 0.1 | GO:0061743 | motor learning(GO:0061743) |
| 0.0 | 0.1 | GO:0072092 | ureteric bud invasion(GO:0072092) |
| 0.0 | 0.1 | GO:0032971 | regulation of muscle filament sliding(GO:0032971) |
| 0.0 | 0.1 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
| 0.0 | 0.1 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.0 | 0.0 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
| 0.0 | 0.1 | GO:0060112 | generation of ovulation cycle rhythm(GO:0060112) |
| 0.0 | 0.0 | GO:0072300 | regulation of metanephric glomerulus development(GO:0072298) positive regulation of metanephric glomerulus development(GO:0072300) |
| 0.0 | 0.1 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.0 | 0.1 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
| 0.0 | 0.0 | GO:0046005 | positive regulation of circadian sleep/wake cycle, REM sleep(GO:0046005) |
| 0.0 | 0.1 | GO:1900121 | negative regulation of receptor binding(GO:1900121) |
| 0.0 | 0.7 | GO:0099601 | regulation of neurotransmitter receptor activity(GO:0099601) |
| 0.0 | 0.1 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) |
| 0.0 | 0.1 | GO:0043247 | telomere maintenance in response to DNA damage(GO:0043247) |
| 0.0 | 0.0 | GO:0070989 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) oxidative demethylation(GO:0070989) |
| 0.0 | 0.1 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
| 0.0 | 0.0 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
| 0.0 | 0.4 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.0 | 0.4 | GO:0045070 | positive regulation of viral genome replication(GO:0045070) |
| 0.0 | 0.1 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
| 0.0 | 0.2 | GO:0050849 | negative regulation of calcium-mediated signaling(GO:0050849) |
| 0.0 | 0.1 | GO:0072178 | nephric duct development(GO:0072176) nephric duct morphogenesis(GO:0072178) |
| 0.0 | 0.0 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
| 0.0 | 0.1 | GO:0044034 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 0.0 | 0.2 | GO:0007194 | negative regulation of adenylate cyclase activity(GO:0007194) |
| 0.0 | 0.0 | GO:0051096 | positive regulation of helicase activity(GO:0051096) |
| 0.0 | 0.2 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 0.0 | 0.5 | GO:0097031 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.0 | 0.3 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
| 0.0 | 0.1 | GO:0060037 | pharyngeal system development(GO:0060037) |
| 0.0 | 0.3 | GO:0000460 | maturation of 5.8S rRNA(GO:0000460) |
| 0.0 | 1.1 | GO:1902476 | chloride transmembrane transport(GO:1902476) |
| 0.0 | 0.1 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
| 0.0 | 0.1 | GO:0033087 | negative regulation of immature T cell proliferation(GO:0033087) |
| 0.0 | 0.1 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
| 0.0 | 0.1 | GO:0090206 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
| 0.0 | 0.1 | GO:0015886 | heme transport(GO:0015886) |
| 0.0 | 0.0 | GO:0006558 | L-phenylalanine metabolic process(GO:0006558) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) |
| 0.0 | 0.0 | GO:1900019 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
| 0.0 | 0.1 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
| 0.0 | 0.2 | GO:0090527 | actin filament reorganization(GO:0090527) |
| 0.0 | 0.2 | GO:0045738 | negative regulation of DNA repair(GO:0045738) negative regulation of double-strand break repair(GO:2000780) |
| 0.0 | 0.2 | GO:0000059 | protein import into nucleus, docking(GO:0000059) |
| 0.0 | 0.4 | GO:0017144 | drug metabolic process(GO:0017144) |
| 0.0 | 0.1 | GO:0014051 | gamma-aminobutyric acid secretion(GO:0014051) |
| 0.0 | 0.2 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
| 0.0 | 0.1 | GO:0010519 | negative regulation of phospholipase activity(GO:0010519) |
| 0.0 | 0.1 | GO:1904714 | regulation of chaperone-mediated autophagy(GO:1904714) |
| 0.0 | 0.0 | GO:1903659 | complement-dependent cytotoxicity(GO:0097278) regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
| 0.0 | 0.1 | GO:0060017 | parathyroid gland development(GO:0060017) |
| 0.0 | 0.2 | GO:0015838 | amino-acid betaine transport(GO:0015838) |
| 0.0 | 0.0 | GO:1903059 | regulation of protein lipidation(GO:1903059) |
| 0.0 | 0.1 | GO:0051790 | short-chain fatty acid biosynthetic process(GO:0051790) |
| 0.0 | 0.3 | GO:0046855 | inositol phosphate dephosphorylation(GO:0046855) |
| 0.0 | 0.5 | GO:0051973 | positive regulation of telomerase activity(GO:0051973) |
| 0.0 | 1.0 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
| 0.0 | 0.2 | GO:0060539 | diaphragm development(GO:0060539) |
| 0.0 | 0.1 | GO:0044550 | secondary metabolite biosynthetic process(GO:0044550) |
| 0.0 | 0.1 | GO:0021756 | striatum development(GO:0021756) |
| 0.0 | 0.0 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
| 0.0 | 0.1 | GO:0042447 | hormone catabolic process(GO:0042447) |
| 0.0 | 0.1 | GO:0046469 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
| 0.0 | 0.0 | GO:0031443 | fast-twitch skeletal muscle fiber contraction(GO:0031443) |
| 0.0 | 0.1 | GO:0035814 | negative regulation of renal sodium excretion(GO:0035814) |
| 0.0 | 0.2 | GO:0006622 | protein targeting to lysosome(GO:0006622) |
| 0.0 | 0.1 | GO:0008078 | mesodermal cell migration(GO:0008078) |
| 0.0 | 0.2 | GO:0007638 | mechanosensory behavior(GO:0007638) |
| 0.0 | 0.2 | GO:0050650 | chondroitin sulfate proteoglycan biosynthetic process(GO:0050650) |
| 0.0 | 0.1 | GO:0051409 | response to nitrosative stress(GO:0051409) |
| 0.0 | 0.0 | GO:1990035 | calcium ion import into cell(GO:1990035) |
| 0.0 | 0.0 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
| 0.0 | 0.2 | GO:0060856 | establishment of blood-brain barrier(GO:0060856) |
| 0.0 | 0.1 | GO:0060676 | ureteric bud formation(GO:0060676) |
| 0.0 | 0.1 | GO:0033762 | response to glucagon(GO:0033762) |
| 0.0 | 0.1 | GO:0036123 | histone H3-K9 dimethylation(GO:0036123) |
| 0.0 | 0.1 | GO:0007625 | grooming behavior(GO:0007625) |
| 0.0 | 0.1 | GO:0032960 | regulation of inositol trisphosphate biosynthetic process(GO:0032960) |
| 0.0 | 0.2 | GO:0060033 | anatomical structure regression(GO:0060033) |
| 0.0 | 0.2 | GO:0008216 | spermidine metabolic process(GO:0008216) |
| 0.0 | 0.1 | GO:0035799 | ureter maturation(GO:0035799) |
| 0.0 | 0.1 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
| 0.0 | 0.1 | GO:0043651 | linoleic acid metabolic process(GO:0043651) |
| 0.0 | 0.6 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
| 0.0 | 0.2 | GO:0071625 | vocalization behavior(GO:0071625) |
| 0.0 | 0.1 | GO:0048007 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
| 0.0 | 0.1 | GO:0080111 | DNA demethylation(GO:0080111) |
| 0.0 | 0.5 | GO:0006998 | nuclear envelope organization(GO:0006998) |
| 0.0 | 0.1 | GO:0016266 | O-glycan processing(GO:0016266) |
| 0.0 | 0.2 | GO:0001967 | suckling behavior(GO:0001967) |
| 0.0 | 0.1 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
| 0.0 | 0.0 | GO:0070141 | response to UV-A(GO:0070141) |
| 0.0 | 0.1 | GO:0070307 | lens fiber cell development(GO:0070307) |
| 0.0 | 0.1 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
| 0.0 | 0.2 | GO:0032329 | serine transport(GO:0032329) |
| 0.0 | 0.5 | GO:0045471 | response to ethanol(GO:0045471) |
| 0.0 | 0.1 | GO:0048680 | positive regulation of axon regeneration(GO:0048680) |
| 0.0 | 0.1 | GO:0016576 | histone dephosphorylation(GO:0016576) |
| 0.0 | 0.1 | GO:1905098 | negative regulation of guanyl-nucleotide exchange factor activity(GO:1905098) |
| 0.0 | 0.1 | GO:0043615 | astrocyte cell migration(GO:0043615) |
| 0.0 | 0.3 | GO:0006298 | mismatch repair(GO:0006298) |
| 0.0 | 0.2 | GO:0048853 | forebrain morphogenesis(GO:0048853) |
| 0.0 | 0.0 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
| 0.0 | 0.0 | GO:0019364 | pyridine nucleotide catabolic process(GO:0019364) |
| 0.0 | 0.1 | GO:0001711 | endodermal cell fate commitment(GO:0001711) |
| 0.0 | 0.1 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.0 | 0.0 | GO:0042033 | chemokine biosynthetic process(GO:0042033) regulation of chemokine biosynthetic process(GO:0045073) |
| 0.0 | 0.6 | GO:0008088 | axo-dendritic transport(GO:0008088) |
| 0.0 | 0.2 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
| 0.0 | 0.1 | GO:0070269 | pyroptosis(GO:0070269) |
| 0.0 | 0.0 | GO:0043134 | hindgut contraction(GO:0043133) regulation of hindgut contraction(GO:0043134) |
| 0.0 | 0.4 | GO:0008333 | endosome to lysosome transport(GO:0008333) |
| 0.0 | 0.1 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
| 0.0 | 0.0 | GO:1901668 | regulation of superoxide dismutase activity(GO:1901668) |
| 0.0 | 0.0 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
| 0.0 | 0.0 | GO:0048318 | axial mesoderm development(GO:0048318) |
| 0.0 | 0.0 | GO:0051181 | cofactor transport(GO:0051181) |
| 0.0 | 0.0 | GO:0097477 | lateral motor column neuron migration(GO:0097477) |
| 0.0 | 0.0 | GO:0030423 | targeting of mRNA for destruction involved in RNA interference(GO:0030423) |
| 0.0 | 0.0 | GO:0006069 | ethanol metabolic process(GO:0006067) ethanol oxidation(GO:0006069) |
| 0.0 | 0.2 | GO:0016540 | protein autoprocessing(GO:0016540) |
| 0.0 | 0.1 | GO:0035740 | CD8-positive, alpha-beta T cell proliferation(GO:0035740) |
| 0.0 | 0.1 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
| 0.0 | 0.2 | GO:0007210 | serotonin receptor signaling pathway(GO:0007210) |
| 0.0 | 0.0 | GO:0060084 | synaptic transmission involved in micturition(GO:0060084) |
| 0.0 | 0.1 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
| 0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.1 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.0 | 0.1 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
| 0.0 | 0.1 | GO:2000288 | positive regulation of myoblast proliferation(GO:2000288) |
| 0.0 | 0.0 | GO:0042537 | benzene-containing compound metabolic process(GO:0042537) |
| 0.0 | 0.1 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
| 0.0 | 0.5 | GO:0006270 | DNA replication initiation(GO:0006270) |
| 0.0 | 0.1 | GO:0098787 | mRNA cleavage involved in mRNA processing(GO:0098787) pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.0 | 0.0 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
| 0.0 | 0.8 | GO:0032543 | mitochondrial translation(GO:0032543) |
| 0.0 | 0.1 | GO:0051256 | mitotic spindle elongation(GO:0000022) spindle midzone assembly(GO:0051255) mitotic spindle midzone assembly(GO:0051256) |
| 0.0 | 0.3 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
| 0.0 | 0.0 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
| 0.0 | 0.0 | GO:0001302 | replicative cell aging(GO:0001302) |
| 0.0 | 0.1 | GO:0010587 | miRNA catabolic process(GO:0010587) |
| 0.0 | 0.0 | GO:0060766 | negative regulation of androgen receptor signaling pathway(GO:0060766) |
| 0.0 | 0.1 | GO:0018231 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.0 | 0.7 | GO:0006400 | tRNA modification(GO:0006400) |
| 0.0 | 0.0 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
| 0.0 | 0.1 | GO:0036072 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
| 0.0 | 0.1 | GO:1990089 | response to nerve growth factor(GO:1990089) cellular response to nerve growth factor stimulus(GO:1990090) |
| 0.0 | 0.0 | GO:0030167 | proteoglycan catabolic process(GO:0030167) |
| 0.0 | 0.1 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
| 0.0 | 0.1 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 0.0 | 0.0 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
| 0.0 | 0.0 | GO:0045348 | positive regulation of MHC class II biosynthetic process(GO:0045348) |
| 0.0 | 0.0 | GO:2000834 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
| 0.0 | 0.1 | GO:0010803 | regulation of tumor necrosis factor-mediated signaling pathway(GO:0010803) |
| 0.0 | 0.0 | GO:2000507 | positive regulation of energy homeostasis(GO:2000507) |
| 0.0 | 0.1 | GO:0033567 | DNA replication, Okazaki fragment processing(GO:0033567) |
| 0.0 | 0.0 | GO:2000535 | entry of bacterium into host cell(GO:0035635) regulation of entry of bacterium into host cell(GO:2000535) |
| 0.0 | 0.0 | GO:0009912 | auditory receptor cell fate commitment(GO:0009912) inner ear receptor cell fate commitment(GO:0060120) |
| 0.0 | 0.0 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
| 0.0 | 0.1 | GO:0051697 | protein delipidation(GO:0051697) |
| 0.0 | 0.1 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
| 0.0 | 0.1 | GO:0010453 | regulation of cell fate commitment(GO:0010453) |
| 0.0 | 0.3 | GO:0070670 | response to interleukin-4(GO:0070670) |
| 0.0 | 0.0 | GO:0060166 | olfactory pit development(GO:0060166) |
| 0.0 | 0.5 | GO:0048791 | calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
| 0.0 | 0.0 | GO:0060051 | negative regulation of protein glycosylation(GO:0060051) |
| 0.0 | 0.2 | GO:0018023 | peptidyl-lysine trimethylation(GO:0018023) |
| 0.0 | 0.1 | GO:0043576 | regulation of respiratory gaseous exchange(GO:0043576) |
| 0.0 | 0.0 | GO:2000651 | positive regulation of sodium ion transmembrane transporter activity(GO:2000651) |
| 0.0 | 0.1 | GO:0006787 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) |
| 0.0 | 0.1 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.0 | 0.0 | GO:0002741 | positive regulation of cytokine secretion involved in immune response(GO:0002741) |
| 0.0 | 0.1 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
| 0.0 | 0.1 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
| 0.0 | 0.1 | GO:0071494 | cellular response to UV-C(GO:0071494) |
| 0.0 | 0.1 | GO:0086103 | G-protein coupled receptor signaling pathway involved in heart process(GO:0086103) |
| 0.0 | 0.0 | GO:0000255 | allantoin metabolic process(GO:0000255) |
| 0.0 | 0.1 | GO:0060484 | lung-associated mesenchyme development(GO:0060484) |
| 0.0 | 0.1 | GO:0015870 | acetylcholine transport(GO:0015870) acetate ester transport(GO:1901374) |
| 0.0 | 0.1 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
| 0.0 | 0.9 | GO:0008033 | tRNA processing(GO:0008033) |
| 0.0 | 0.0 | GO:0046668 | regulation of retinal cell programmed cell death(GO:0046668) |
| 0.0 | 0.1 | GO:0009214 | cyclic nucleotide catabolic process(GO:0009214) |
| 0.0 | 0.1 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
| 0.0 | 0.0 | GO:0048617 | embryonic foregut morphogenesis(GO:0048617) |
| 0.0 | 0.8 | GO:0071391 | cellular response to estrogen stimulus(GO:0071391) |
| 0.0 | 0.3 | GO:0030970 | retrograde protein transport, ER to cytosol(GO:0030970) |
| 0.0 | 0.0 | GO:0070103 | regulation of interleukin-6-mediated signaling pathway(GO:0070103) |
| 0.0 | 0.1 | GO:0048014 | Tie signaling pathway(GO:0048014) |
| 0.0 | 0.1 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
| 0.0 | 0.1 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
| 0.0 | 0.2 | GO:0090200 | positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
| 0.0 | 0.1 | GO:0032815 | negative regulation of natural killer cell activation(GO:0032815) |
| 0.0 | 0.1 | GO:0048671 | negative regulation of collateral sprouting(GO:0048671) |
| 0.0 | 0.1 | GO:0061643 | chemorepulsion of axon(GO:0061643) |
| 0.0 | 0.0 | GO:0001998 | angiotensin mediated vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001998) |
| 0.0 | 0.1 | GO:0098734 | protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
| 0.0 | 0.0 | GO:0038161 | prolactin signaling pathway(GO:0038161) |
| 0.0 | 0.0 | GO:0018343 | protein farnesylation(GO:0018343) |
| 0.0 | 0.0 | GO:0042420 | dopamine catabolic process(GO:0042420) |
| 0.0 | 0.0 | GO:2000823 | regulation of androgen receptor activity(GO:2000823) |
| 0.0 | 0.4 | GO:0003333 | amino acid transmembrane transport(GO:0003333) |
| 0.0 | 0.0 | GO:1902202 | regulation of hepatocyte growth factor receptor signaling pathway(GO:1902202) |
| 0.0 | 0.0 | GO:0060363 | cranial suture morphogenesis(GO:0060363) |
| 0.0 | 0.0 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
| 0.0 | 0.3 | GO:0045744 | negative regulation of G-protein coupled receptor protein signaling pathway(GO:0045744) |
| 0.0 | 0.0 | GO:0046379 | extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) |
| 0.0 | 0.0 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
| 0.0 | 0.1 | GO:0060023 | soft palate development(GO:0060023) |
| 0.0 | 0.0 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 0.0 | 0.2 | GO:0016578 | histone deubiquitination(GO:0016578) |
| 0.0 | 0.1 | GO:0014002 | astrocyte development(GO:0014002) |
| 0.0 | 0.1 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
| 0.0 | 0.1 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
| 0.0 | 0.1 | GO:0021520 | spinal cord motor neuron cell fate specification(GO:0021520) |
| 0.0 | 0.0 | GO:0006296 | nucleotide-excision repair, DNA incision, 5'-to lesion(GO:0006296) |
| 0.0 | 0.0 | GO:0048550 | negative regulation of pinocytosis(GO:0048550) |
| 0.0 | 0.1 | GO:0043586 | tongue development(GO:0043586) |
| 0.0 | 0.1 | GO:0051970 | negative regulation of transmission of nerve impulse(GO:0051970) |
| 0.0 | 0.1 | GO:0060973 | cell migration involved in heart development(GO:0060973) |
| 0.0 | 0.0 | GO:0071680 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
| 0.0 | 0.1 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
| 0.0 | 0.2 | GO:0006541 | glutamine metabolic process(GO:0006541) |
| 0.0 | 0.0 | GO:0019372 | lipoxygenase pathway(GO:0019372) |
| 0.0 | 0.2 | GO:0045899 | positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
| 0.0 | 0.2 | GO:2001240 | negative regulation of signal transduction in absence of ligand(GO:1901099) negative regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001240) |
| 0.0 | 0.1 | GO:0008272 | sulfate transport(GO:0008272) |
| 0.0 | 0.1 | GO:2000679 | positive regulation of transcription regulatory region DNA binding(GO:2000679) |
| 0.0 | 0.0 | GO:0002176 | male germ cell proliferation(GO:0002176) |
| 0.0 | 0.0 | GO:1990928 | response to amino acid starvation(GO:1990928) |
| 0.0 | 0.0 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
| 0.0 | 0.1 | GO:1902260 | negative regulation of delayed rectifier potassium channel activity(GO:1902260) negative regulation of voltage-gated potassium channel activity(GO:1903817) |
| 0.0 | 0.1 | GO:0007041 | lysosomal transport(GO:0007041) |
| 0.0 | 0.0 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
| 0.0 | 0.1 | GO:0015074 | DNA integration(GO:0015074) |
| 0.0 | 0.0 | GO:0010745 | negative regulation of macrophage derived foam cell differentiation(GO:0010745) |
| 0.0 | 0.1 | GO:1902751 | positive regulation of cell cycle G2/M phase transition(GO:1902751) |
| 0.0 | 0.0 | GO:0098528 | skeletal muscle fiber differentiation(GO:0098528) |
| 0.0 | 0.0 | GO:0071502 | cellular response to temperature stimulus(GO:0071502) |
| 0.0 | 0.0 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
| 0.0 | 0.0 | GO:0006595 | polyamine metabolic process(GO:0006595) |
| 0.0 | 0.1 | GO:1900273 | positive regulation of long-term synaptic potentiation(GO:1900273) |
| 0.0 | 0.1 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 0.0 | 0.1 | GO:0070587 | negative regulation of heterotypic cell-cell adhesion(GO:0034115) regulation of cell-cell adhesion involved in gastrulation(GO:0070587) |
| 0.0 | 0.1 | GO:2000757 | negative regulation of protein acetylation(GO:1901984) negative regulation of peptidyl-lysine acetylation(GO:2000757) |
| 0.0 | 0.1 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
| 0.0 | 0.2 | GO:0010737 | protein kinase A signaling(GO:0010737) |
| 0.0 | 0.0 | GO:0072240 | distal convoluted tubule development(GO:0072025) DCT cell differentiation(GO:0072069) metanephric distal convoluted tubule development(GO:0072221) metanephric distal tubule development(GO:0072235) metanephric DCT cell differentiation(GO:0072240) |
| 0.0 | 0.0 | GO:0010936 | macrophage cytokine production(GO:0010934) negative regulation of macrophage cytokine production(GO:0010936) |
| 0.0 | 0.1 | GO:0000132 | establishment of mitotic spindle orientation(GO:0000132) |
| 0.0 | 0.0 | GO:0002752 | cell surface pattern recognition receptor signaling pathway(GO:0002752) |
| 0.0 | 0.2 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.0 | 0.0 | GO:0045003 | DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
| 0.0 | 0.0 | GO:0009067 | aspartate family amino acid biosynthetic process(GO:0009067) |
| 0.0 | 0.1 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
| 0.0 | 0.2 | GO:0030033 | microvillus assembly(GO:0030033) |
| 0.0 | 0.1 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.0 | 0.3 | GO:0031424 | keratinization(GO:0031424) |
| 0.0 | 0.0 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
| 0.0 | 0.0 | GO:1903626 | positive regulation of apoptotic DNA fragmentation(GO:1902512) positive regulation of DNA catabolic process(GO:1903626) |
| 0.0 | 0.3 | GO:0072583 | clathrin-mediated endocytosis(GO:0072583) |
| 0.0 | 0.0 | GO:0006772 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
| 0.0 | 0.0 | GO:0001975 | response to amphetamine(GO:0001975) |
| 0.0 | 0.1 | GO:0051798 | positive regulation of hair cycle(GO:0042635) positive regulation of hair follicle development(GO:0051798) |
| 0.0 | 0.0 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.0 | 0.2 | GO:0033233 | regulation of protein sumoylation(GO:0033233) |
| 0.0 | 0.0 | GO:0071684 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
| 0.0 | 0.5 | GO:0051225 | spindle assembly(GO:0051225) |
| 0.0 | 0.0 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.0 | 0.0 | GO:0070262 | peptidyl-serine dephosphorylation(GO:0070262) |
| 0.0 | 0.0 | GO:0010446 | response to alkaline pH(GO:0010446) |
| 0.0 | 0.0 | GO:2000973 | regulation of pro-B cell differentiation(GO:2000973) |
| 0.0 | 0.3 | GO:0010761 | fibroblast migration(GO:0010761) |
| 0.0 | 0.0 | GO:0006531 | aspartate metabolic process(GO:0006531) |
| 0.0 | 0.1 | GO:0042775 | mitochondrial ATP synthesis coupled electron transport(GO:0042775) |
| 0.0 | 0.1 | GO:0048670 | regulation of collateral sprouting(GO:0048670) |
| 0.0 | 0.0 | GO:1904659 | glucose transmembrane transport(GO:1904659) |
| 0.0 | 0.0 | GO:2000781 | positive regulation of double-strand break repair(GO:2000781) |
| 0.0 | 0.1 | GO:0038093 | Fc receptor signaling pathway(GO:0038093) |
| 0.0 | 0.5 | GO:0006818 | hydrogen transport(GO:0006818) |
| 0.0 | 0.0 | GO:0035330 | regulation of hippo signaling(GO:0035330) |
| 0.0 | 0.0 | GO:0000733 | DNA strand renaturation(GO:0000733) |
| 0.0 | 0.2 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.0 | 0.0 | GO:0010960 | magnesium ion homeostasis(GO:0010960) |
| 0.0 | 0.3 | GO:0007271 | synaptic transmission, cholinergic(GO:0007271) |
| 0.0 | 0.0 | GO:0018243 | protein O-linked glycosylation via threonine(GO:0018243) |
| 0.0 | 0.0 | GO:0085020 | protein K6-linked ubiquitination(GO:0085020) |
| 0.0 | 0.0 | GO:1902109 | negative regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902109) |
| 0.0 | 0.1 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
| 0.0 | 0.0 | GO:0051571 | positive regulation of histone H3-K4 methylation(GO:0051571) |
| 0.0 | 0.0 | GO:0000212 | meiotic spindle organization(GO:0000212) |
| 0.0 | 0.1 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 0.0 | 0.0 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
| 0.0 | 0.0 | GO:0006059 | hexitol metabolic process(GO:0006059) |
| 0.0 | 0.1 | GO:0048730 | epidermis morphogenesis(GO:0048730) |
| 0.0 | 0.0 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.0 | 0.0 | GO:0031392 | regulation of prostaglandin biosynthetic process(GO:0031392) regulation of unsaturated fatty acid biosynthetic process(GO:2001279) |
| 0.0 | 0.0 | GO:0000491 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
| 0.0 | 0.1 | GO:0032099 | negative regulation of appetite(GO:0032099) |
| 0.0 | 0.0 | GO:0022605 | oogenesis stage(GO:0022605) |
| 0.0 | 0.0 | GO:0009946 | proximal/distal axis specification(GO:0009946) |
| 0.0 | 0.1 | GO:0051281 | positive regulation of release of sequestered calcium ion into cytosol(GO:0051281) |
| 0.0 | 0.0 | GO:0071044 | histone mRNA catabolic process(GO:0071044) |
| 0.0 | 0.0 | GO:0003310 | pancreatic A cell differentiation(GO:0003310) |
| 0.0 | 0.0 | GO:0043435 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
| 0.0 | 0.0 | GO:0010760 | negative regulation of macrophage chemotaxis(GO:0010760) |
| 0.0 | 0.1 | GO:0006691 | leukotriene metabolic process(GO:0006691) |
| 0.0 | 0.3 | GO:0001755 | neural crest cell migration(GO:0001755) |
| 0.0 | 0.0 | GO:0002328 | pro-B cell differentiation(GO:0002328) |
| 0.0 | 0.0 | GO:0030240 | skeletal muscle thin filament assembly(GO:0030240) |
| 0.0 | 0.1 | GO:0007379 | segment specification(GO:0007379) |
| 0.0 | 0.0 | GO:2000598 | regulation of cyclin catabolic process(GO:2000598) negative regulation of cyclin catabolic process(GO:2000599) |
| 0.0 | 0.0 | GO:0032460 | negative regulation of protein oligomerization(GO:0032460) |
| 0.0 | 0.0 | GO:0042219 | cellular modified amino acid catabolic process(GO:0042219) |
| 0.0 | 0.0 | GO:0033153 | somatic diversification of T cell receptor genes(GO:0002568) somatic recombination of T cell receptor gene segments(GO:0002681) T cell receptor V(D)J recombination(GO:0033153) |
| 0.0 | 0.0 | GO:2000778 | positive regulation of interleukin-6 secretion(GO:2000778) |
| 0.0 | 0.0 | GO:0008354 | germ cell migration(GO:0008354) |
| 0.0 | 0.0 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
| 0.0 | 0.1 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.0 | 0.0 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
| 0.0 | 0.0 | GO:0043578 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.0 | 0.3 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
| 0.0 | 0.0 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
| 0.0 | 0.2 | GO:0035115 | embryonic forelimb morphogenesis(GO:0035115) |
| 0.0 | 0.0 | GO:2000035 | regulation of stem cell division(GO:2000035) |
| 0.0 | 0.0 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
| 0.0 | 0.1 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
| 0.0 | 0.1 | GO:0042348 | regulation of NF-kappaB import into nucleus(GO:0042345) NF-kappaB import into nucleus(GO:0042348) |
| 0.0 | 0.0 | GO:0046836 | glycolipid transport(GO:0046836) |
| 0.0 | 0.1 | GO:0006805 | xenobiotic metabolic process(GO:0006805) |
| 0.0 | 0.1 | GO:0097178 | ruffle assembly(GO:0097178) |
| 0.0 | 0.0 | GO:0042891 | antibiotic transport(GO:0042891) |
| 0.0 | 0.0 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
| 0.0 | 0.0 | GO:0060065 | uterus development(GO:0060065) |
| 0.0 | 0.0 | GO:1904667 | negative regulation of ubiquitin protein ligase activity(GO:1904667) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.6 | 6.1 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.3 | 0.8 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
| 0.2 | 0.7 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
| 0.2 | 1.1 | GO:0045098 | type III intermediate filament(GO:0045098) |
| 0.2 | 0.6 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
| 0.2 | 0.6 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.2 | 0.8 | GO:0042567 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
| 0.2 | 0.6 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
| 0.2 | 0.9 | GO:0097433 | dense body(GO:0097433) |
| 0.2 | 0.7 | GO:0032021 | NELF complex(GO:0032021) |
| 0.2 | 0.2 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
| 0.2 | 0.5 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.2 | 0.8 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
| 0.2 | 0.5 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.1 | 1.5 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
| 0.1 | 0.6 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| 0.1 | 0.6 | GO:0032437 | cuticular plate(GO:0032437) |
| 0.1 | 0.7 | GO:0001651 | dense fibrillar component(GO:0001651) |
| 0.1 | 0.4 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
| 0.1 | 0.4 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.1 | 0.1 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
| 0.1 | 1.7 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
| 0.1 | 1.3 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.1 | 0.4 | GO:0043293 | apoptosome(GO:0043293) |
| 0.1 | 1.0 | GO:0030128 | clathrin coat of endocytic vesicle(GO:0030128) |
| 0.1 | 0.6 | GO:0005579 | membrane attack complex(GO:0005579) |
| 0.1 | 1.0 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.1 | 0.5 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.1 | 0.9 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
| 0.1 | 0.4 | GO:0031502 | dolichyl-phosphate-mannose-protein mannosyltransferase complex(GO:0031502) |
| 0.1 | 1.2 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.1 | 1.9 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.1 | 1.7 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
| 0.1 | 0.4 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.1 | 0.3 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.1 | 0.3 | GO:0071942 | XPC complex(GO:0071942) |
| 0.1 | 0.1 | GO:0000439 | core TFIIH complex(GO:0000439) |
| 0.1 | 0.2 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
| 0.1 | 0.1 | GO:0055087 | Ski complex(GO:0055087) |
| 0.1 | 0.5 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.1 | 0.2 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
| 0.1 | 0.5 | GO:0001652 | granular component(GO:0001652) |
| 0.1 | 1.1 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
| 0.1 | 0.6 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.1 | 0.2 | GO:1990812 | growth cone filopodium(GO:1990812) |
| 0.1 | 0.3 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.1 | 0.6 | GO:0001739 | sex chromatin(GO:0001739) |
| 0.1 | 0.4 | GO:0035339 | SPOTS complex(GO:0035339) |
| 0.1 | 0.3 | GO:0070939 | Dsl1p complex(GO:0070939) |
| 0.1 | 0.4 | GO:0000938 | GARP complex(GO:0000938) |
| 0.1 | 0.5 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.1 | 0.4 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
| 0.1 | 0.3 | GO:0071203 | WASH complex(GO:0071203) |
| 0.1 | 0.4 | GO:0089701 | U2AF(GO:0089701) |
| 0.1 | 0.3 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
| 0.1 | 0.4 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
| 0.1 | 0.2 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
| 0.1 | 0.2 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.1 | 1.2 | GO:0031528 | microvillus membrane(GO:0031528) |
| 0.1 | 0.2 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.1 | 0.2 | GO:0030689 | Noc complex(GO:0030689) |
| 0.1 | 0.3 | GO:0097425 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
| 0.1 | 0.6 | GO:0070578 | RISC-loading complex(GO:0070578) |
| 0.1 | 0.3 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.1 | 1.2 | GO:0010369 | chromocenter(GO:0010369) |
| 0.1 | 0.2 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
| 0.1 | 0.2 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.1 | 0.2 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
| 0.1 | 2.3 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.1 | 0.2 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
| 0.1 | 0.7 | GO:0071439 | clathrin complex(GO:0071439) |
| 0.1 | 0.8 | GO:0030126 | COPI vesicle coat(GO:0030126) |
| 0.1 | 0.4 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
| 0.1 | 0.4 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
| 0.1 | 3.1 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.1 | 0.3 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
| 0.1 | 0.8 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.1 | 0.2 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
| 0.1 | 0.4 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
| 0.1 | 0.2 | GO:0097524 | sperm plasma membrane(GO:0097524) |
| 0.1 | 0.4 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.1 | 0.1 | GO:0000153 | cytoplasmic ubiquitin ligase complex(GO:0000153) |
| 0.1 | 2.7 | GO:0005747 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
| 0.1 | 0.2 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
| 0.1 | 0.2 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
| 0.1 | 0.4 | GO:0016589 | NURF complex(GO:0016589) |
| 0.1 | 0.3 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.1 | 0.5 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
| 0.1 | 0.7 | GO:0032426 | stereocilium tip(GO:0032426) |
| 0.1 | 0.6 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
| 0.1 | 0.3 | GO:0043159 | acrosomal matrix(GO:0043159) |
| 0.1 | 0.3 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
| 0.1 | 0.1 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
| 0.1 | 0.4 | GO:0070847 | core mediator complex(GO:0070847) |
| 0.1 | 0.2 | GO:0097422 | tubular endosome(GO:0097422) |
| 0.1 | 0.2 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
| 0.1 | 0.6 | GO:0008278 | cohesin complex(GO:0008278) |
| 0.1 | 1.3 | GO:0022624 | proteasome accessory complex(GO:0022624) |
| 0.1 | 0.2 | GO:0030127 | COPII vesicle coat(GO:0030127) |
| 0.1 | 0.1 | GO:0043219 | lateral loop(GO:0043219) |
| 0.1 | 1.1 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.1 | 0.2 | GO:0042825 | TAP complex(GO:0042825) |
| 0.1 | 0.3 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 0.1 | 0.1 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.1 | 0.2 | GO:0043259 | laminin-10 complex(GO:0043259) |
| 0.1 | 0.6 | GO:0071564 | npBAF complex(GO:0071564) |
| 0.1 | 0.3 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 0.1 | 0.3 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 0.1 | 0.3 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
| 0.1 | 0.4 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
| 0.1 | 0.2 | GO:1990130 | Iml1 complex(GO:1990130) |
| 0.1 | 2.5 | GO:0031903 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
| 0.1 | 0.2 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
| 0.1 | 0.4 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
| 0.1 | 0.3 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.1 | 1.3 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
| 0.1 | 0.2 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
| 0.1 | 0.5 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.1 | 0.2 | GO:0070545 | PeBoW complex(GO:0070545) |
| 0.1 | 0.6 | GO:0017119 | Golgi transport complex(GO:0017119) |
| 0.1 | 0.4 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.1 | 0.4 | GO:0032009 | early phagosome(GO:0032009) |
| 0.1 | 0.4 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.0 | 0.1 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
| 0.0 | 0.4 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
| 0.0 | 0.2 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.0 | 0.2 | GO:0045239 | tricarboxylic acid cycle enzyme complex(GO:0045239) |
| 0.0 | 0.6 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.0 | 0.4 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.0 | 0.0 | GO:0009279 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
| 0.0 | 0.1 | GO:0005687 | U4 snRNP(GO:0005687) |
| 0.0 | 0.1 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
| 0.0 | 0.2 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.0 | 0.2 | GO:0030660 | Golgi-associated vesicle membrane(GO:0030660) |
| 0.0 | 0.3 | GO:0000445 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
| 0.0 | 0.1 | GO:0097413 | Lewy body(GO:0097413) |
| 0.0 | 0.8 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
| 0.0 | 0.2 | GO:0005655 | nucleolar ribonuclease P complex(GO:0005655) ribonuclease P complex(GO:0030677) multimeric ribonuclease P complex(GO:0030681) |
| 0.0 | 0.2 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.0 | 0.8 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
| 0.0 | 0.7 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
| 0.0 | 0.2 | GO:0000346 | transcription export complex(GO:0000346) |
| 0.0 | 0.1 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
| 0.0 | 0.6 | GO:0045495 | P granule(GO:0043186) pole plasm(GO:0045495) germ plasm(GO:0060293) |
| 0.0 | 0.9 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.0 | 0.1 | GO:0046691 | intracellular canaliculus(GO:0046691) |
| 0.0 | 0.3 | GO:0070187 | telosome(GO:0070187) |
| 0.0 | 0.2 | GO:0031258 | lamellipodium membrane(GO:0031258) |
| 0.0 | 0.2 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.0 | 0.4 | GO:0000124 | SAGA complex(GO:0000124) |
| 0.0 | 1.5 | GO:0000502 | proteasome complex(GO:0000502) |
| 0.0 | 0.3 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
| 0.0 | 0.4 | GO:0034719 | SMN-Sm protein complex(GO:0034719) |
| 0.0 | 0.2 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.0 | 1.1 | GO:0005763 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.0 | 1.8 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
| 0.0 | 0.2 | GO:0001674 | female germ cell nucleus(GO:0001674) |
| 0.0 | 0.3 | GO:0001939 | female pronucleus(GO:0001939) |
| 0.0 | 0.2 | GO:0090543 | Flemming body(GO:0090543) |
| 0.0 | 0.2 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
| 0.0 | 0.3 | GO:0034464 | BBSome(GO:0034464) |
| 0.0 | 0.3 | GO:0032300 | mismatch repair complex(GO:0032300) |
| 0.0 | 0.3 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
| 0.0 | 0.1 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.0 | 0.2 | GO:0044316 | cone cell pedicle(GO:0044316) |
| 0.0 | 1.5 | GO:0005876 | spindle microtubule(GO:0005876) |
| 0.0 | 0.3 | GO:0005916 | fascia adherens(GO:0005916) |
| 0.0 | 1.3 | GO:0005762 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.0 | 0.3 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.0 | 0.1 | GO:0097441 | basilar dendrite(GO:0097441) |
| 0.0 | 0.7 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
| 0.0 | 0.2 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
| 0.0 | 0.1 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 0.0 | 0.6 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
| 0.0 | 0.6 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.0 | 0.1 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
| 0.0 | 0.1 | GO:0048179 | activin receptor complex(GO:0048179) |
| 0.0 | 0.3 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
| 0.0 | 0.1 | GO:0031094 | platelet dense tubular network(GO:0031094) |
| 0.0 | 0.2 | GO:0033263 | CORVET complex(GO:0033263) |
| 0.0 | 0.1 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
| 0.0 | 0.1 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
| 0.0 | 0.3 | GO:0000800 | lateral element(GO:0000800) |
| 0.0 | 1.1 | GO:0099501 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
| 0.0 | 0.1 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
| 0.0 | 0.4 | GO:0098533 | ATPase dependent transmembrane transport complex(GO:0098533) |
| 0.0 | 0.6 | GO:0043034 | costamere(GO:0043034) |
| 0.0 | 0.3 | GO:0098827 | endoplasmic reticulum subcompartment(GO:0098827) |
| 0.0 | 0.3 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.0 | 0.1 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.0 | 3.1 | GO:0005759 | mitochondrial matrix(GO:0005759) |
| 0.0 | 0.2 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.0 | 0.0 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
| 0.0 | 0.7 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
| 0.0 | 0.2 | GO:0033503 | HULC complex(GO:0033503) |
| 0.0 | 0.7 | GO:0097228 | sperm principal piece(GO:0097228) |
| 0.0 | 0.3 | GO:0051233 | spindle midzone(GO:0051233) |
| 0.0 | 0.1 | GO:0071012 | catalytic step 1 spliceosome(GO:0071012) post-mRNA release spliceosomal complex(GO:0071014) |
| 0.0 | 0.4 | GO:0043196 | varicosity(GO:0043196) |
| 0.0 | 0.1 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.0 | 0.1 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
| 0.0 | 1.7 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
| 0.0 | 0.0 | GO:1990423 | RZZ complex(GO:1990423) |
| 0.0 | 0.3 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.0 | 0.2 | GO:0016600 | flotillin complex(GO:0016600) |
| 0.0 | 0.0 | GO:0020018 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
| 0.0 | 0.3 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
| 0.0 | 0.1 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.0 | 0.2 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.0 | 0.1 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
| 0.0 | 0.1 | GO:0070531 | BRCA1-A complex(GO:0070531) |
| 0.0 | 1.2 | GO:0042734 | presynaptic membrane(GO:0042734) |
| 0.0 | 0.2 | GO:0031415 | NatA complex(GO:0031415) |
| 0.0 | 0.1 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
| 0.0 | 1.8 | GO:0036064 | ciliary basal body(GO:0036064) |
| 0.0 | 0.1 | GO:0071141 | SMAD protein complex(GO:0071141) |
| 0.0 | 0.2 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
| 0.0 | 0.1 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
| 0.0 | 0.3 | GO:0034451 | centriolar satellite(GO:0034451) |
| 0.0 | 1.2 | GO:0005643 | nuclear pore(GO:0005643) |
| 0.0 | 0.1 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
| 0.0 | 0.1 | GO:0044327 | dendritic spine head(GO:0044327) |
| 0.0 | 0.1 | GO:0031084 | BLOC-2 complex(GO:0031084) |
| 0.0 | 0.1 | GO:0044308 | axonal spine(GO:0044308) |
| 0.0 | 0.2 | GO:0031932 | TORC2 complex(GO:0031932) |
| 0.0 | 0.0 | GO:0030666 | endocytic vesicle membrane(GO:0030666) |
| 0.0 | 0.5 | GO:0055038 | recycling endosome membrane(GO:0055038) |
| 0.0 | 1.2 | GO:0030880 | RNA polymerase complex(GO:0030880) |
| 0.0 | 0.2 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.0 | 0.1 | GO:0043083 | synaptic cleft(GO:0043083) |
| 0.0 | 0.1 | GO:0098576 | lumenal side of membrane(GO:0098576) |
| 0.0 | 0.1 | GO:0000783 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
| 0.0 | 0.8 | GO:0098878 | ionotropic glutamate receptor complex(GO:0008328) neurotransmitter receptor complex(GO:0098878) |
| 0.0 | 0.1 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
| 0.0 | 0.3 | GO:0005720 | nuclear heterochromatin(GO:0005720) |
| 0.0 | 2.5 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
| 0.0 | 0.8 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.0 | 0.1 | GO:0042583 | chromaffin granule(GO:0042583) |
| 0.0 | 0.4 | GO:0070469 | respiratory chain(GO:0070469) |
| 0.0 | 0.1 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.0 | 0.2 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
| 0.0 | 0.0 | GO:0097512 | cardiac myofibril(GO:0097512) |
| 0.0 | 0.2 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
| 0.0 | 0.4 | GO:0030662 | coated vesicle membrane(GO:0030662) |
| 0.0 | 0.5 | GO:0031672 | A band(GO:0031672) |
| 0.0 | 1.1 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.0 | 0.7 | GO:0031970 | mitochondrial intermembrane space(GO:0005758) organelle envelope lumen(GO:0031970) |
| 0.0 | 0.1 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
| 0.0 | 0.0 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
| 0.0 | 0.0 | GO:0032280 | symmetric synapse(GO:0032280) |
| 0.0 | 0.1 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.0 | 0.1 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
| 0.0 | 0.1 | GO:0097209 | epidermal lamellar body(GO:0097209) |
| 0.0 | 0.1 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.0 | 0.3 | GO:1990391 | DNA repair complex(GO:1990391) |
| 0.0 | 0.1 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
| 0.0 | 0.3 | GO:0005684 | U2-type spliceosomal complex(GO:0005684) |
| 0.0 | 0.2 | GO:0036156 | inner dynein arm(GO:0036156) |
| 0.0 | 0.5 | GO:0030684 | preribosome(GO:0030684) |
| 0.0 | 0.2 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.0 | 0.1 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.0 | 0.4 | GO:0045335 | phagocytic vesicle(GO:0045335) |
| 0.0 | 0.2 | GO:0030904 | retromer complex(GO:0030904) |
| 0.0 | 0.0 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
| 0.0 | 0.0 | GO:0000779 | condensed chromosome, centromeric region(GO:0000779) |
| 0.0 | 0.5 | GO:0005844 | polysome(GO:0005844) |
| 0.0 | 0.1 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.0 | 0.1 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
| 0.0 | 1.4 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
| 0.0 | 0.1 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.0 | 1.0 | GO:0090575 | RNA polymerase II transcription factor complex(GO:0090575) |
| 0.0 | 0.0 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.0 | 0.1 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
| 0.0 | 0.3 | GO:0031902 | late endosome membrane(GO:0031902) |
| 0.0 | 0.1 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.0 | 1.5 | GO:0005840 | ribosome(GO:0005840) |
| 0.0 | 1.2 | GO:0005802 | trans-Golgi network(GO:0005802) |
| 0.0 | 0.2 | GO:0016235 | aggresome(GO:0016235) |
| 0.0 | 0.0 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.0 | 0.1 | GO:0005861 | troponin complex(GO:0005861) |
| 0.0 | 0.1 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
| 0.0 | 0.0 | GO:1990716 | axonemal central apparatus(GO:1990716) |
| 0.0 | 0.1 | GO:0033061 | DNA recombinase mediator complex(GO:0033061) |
| 0.0 | 0.0 | GO:0033391 | chromatoid body(GO:0033391) |
| 0.0 | 0.5 | GO:0000776 | kinetochore(GO:0000776) |
| 0.0 | 0.1 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
| 0.0 | 0.8 | GO:0031514 | motile cilium(GO:0031514) |
| 0.0 | 0.7 | GO:0030176 | integral component of endoplasmic reticulum membrane(GO:0030176) |
| 0.0 | 0.0 | GO:0030870 | Mre11 complex(GO:0030870) |
| 0.0 | 0.2 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.8 | 2.5 | GO:0070644 | vitamin D response element binding(GO:0070644) |
| 0.4 | 5.4 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.4 | 0.8 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
| 0.3 | 1.0 | GO:0004771 | sterol esterase activity(GO:0004771) |
| 0.3 | 1.9 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
| 0.3 | 1.0 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
| 0.3 | 1.0 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.3 | 0.9 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.3 | 1.1 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
| 0.3 | 1.1 | GO:0030911 | TPR domain binding(GO:0030911) |
| 0.2 | 1.5 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
| 0.2 | 0.7 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
| 0.2 | 0.5 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
| 0.2 | 1.1 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.2 | 0.5 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 0.2 | 0.9 | GO:0034056 | estrogen response element binding(GO:0034056) |
| 0.2 | 0.7 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 0.2 | 0.2 | GO:0016274 | arginine N-methyltransferase activity(GO:0016273) protein-arginine N-methyltransferase activity(GO:0016274) |
| 0.2 | 0.4 | GO:0038181 | bile acid receptor activity(GO:0038181) |
| 0.2 | 0.6 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
| 0.2 | 0.8 | GO:0070546 | L-phenylalanine aminotransferase activity(GO:0070546) |
| 0.2 | 0.6 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
| 0.2 | 1.2 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
| 0.2 | 0.6 | GO:0050692 | DBD domain binding(GO:0050692) |
| 0.2 | 1.2 | GO:0030235 | nitric-oxide synthase regulator activity(GO:0030235) |
| 0.2 | 0.6 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
| 0.2 | 0.4 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.2 | 0.5 | GO:2001070 | starch binding(GO:2001070) |
| 0.2 | 0.7 | GO:0008823 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
| 0.2 | 1.4 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.2 | 0.5 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
| 0.2 | 1.4 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
| 0.2 | 0.5 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
| 0.2 | 0.7 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 0.2 | 1.3 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.2 | 1.3 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
| 0.2 | 0.7 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
| 0.2 | 0.5 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
| 0.2 | 0.3 | GO:0016842 | amidine-lyase activity(GO:0016842) |
| 0.2 | 0.8 | GO:0004331 | fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
| 0.2 | 1.0 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
| 0.2 | 0.5 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
| 0.2 | 0.3 | GO:0034046 | poly(G) binding(GO:0034046) |
| 0.2 | 1.1 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.2 | 0.6 | GO:0036033 | mediator complex binding(GO:0036033) |
| 0.2 | 0.2 | GO:0030792 | methylarsonite methyltransferase activity(GO:0030792) |
| 0.2 | 1.7 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
| 0.2 | 0.5 | GO:0015154 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.2 | 1.1 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 0.2 | 0.8 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.1 | 0.4 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.1 | 0.6 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.1 | 1.3 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.1 | 0.4 | GO:0019862 | IgA binding(GO:0019862) |
| 0.1 | 1.0 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 0.1 | 0.3 | GO:0016300 | tRNA (uracil) methyltransferase activity(GO:0016300) |
| 0.1 | 1.7 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.1 | 3.0 | GO:0052714 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) photoreceptor cyclic-nucleotide phosphodiesterase activity(GO:0004120) 7,8-dihydro-D-neopterin 2',3'-cyclic phosphate phosphodiesterase activity(GO:0044688) inositol phosphosphingolipid phospholipase activity(GO:0052712) inositol phosphorylceramide phospholipase activity(GO:0052713) mannosyl-inositol phosphorylceramide phospholipase activity(GO:0052714) mannosyl-diinositol phosphorylceramide phospholipase activity(GO:0052715) |
| 0.1 | 0.4 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
| 0.1 | 0.4 | GO:0004470 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) |
| 0.1 | 0.9 | GO:1990459 | transferrin receptor binding(GO:1990459) |
| 0.1 | 1.0 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
| 0.1 | 0.4 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
| 0.1 | 0.4 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 0.1 | 1.0 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
| 0.1 | 0.5 | GO:0070878 | primary miRNA binding(GO:0070878) |
| 0.1 | 0.5 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
| 0.1 | 2.1 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
| 0.1 | 0.4 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.1 | 0.1 | GO:0016662 | oxidoreductase activity, acting on other nitrogenous compounds as donors, cytochrome as acceptor(GO:0016662) |
| 0.1 | 0.4 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
| 0.1 | 0.6 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.1 | 2.0 | GO:0005112 | Notch binding(GO:0005112) |
| 0.1 | 0.2 | GO:0097016 | L27 domain binding(GO:0097016) |
| 0.1 | 0.3 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
| 0.1 | 0.7 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
| 0.1 | 0.6 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
| 0.1 | 0.6 | GO:0050815 | phosphoserine binding(GO:0050815) |
| 0.1 | 0.1 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
| 0.1 | 0.3 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.1 | 0.4 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
| 0.1 | 0.4 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
| 0.1 | 0.2 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
| 0.1 | 1.7 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
| 0.1 | 0.7 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.1 | 2.1 | GO:0003785 | actin monomer binding(GO:0003785) |
| 0.1 | 0.6 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
| 0.1 | 0.3 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
| 0.1 | 0.3 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
| 0.1 | 0.3 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.1 | 0.3 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
| 0.1 | 0.5 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) |
| 0.1 | 0.4 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.1 | 0.3 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
| 0.1 | 0.4 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
| 0.1 | 0.2 | GO:0016427 | tRNA (cytosine) methyltransferase activity(GO:0016427) tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
| 0.1 | 0.3 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.1 | 0.4 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
| 0.1 | 0.3 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
| 0.1 | 0.3 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
| 0.1 | 0.5 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
| 0.1 | 0.4 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.1 | 1.2 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
| 0.1 | 0.4 | GO:0000405 | bubble DNA binding(GO:0000405) |
| 0.1 | 1.0 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.1 | 0.6 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.1 | 0.4 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.1 | 0.4 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.1 | 0.5 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
| 0.1 | 0.8 | GO:0002162 | dystroglycan binding(GO:0002162) |
| 0.1 | 1.9 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
| 0.1 | 0.4 | GO:0016972 | thiol oxidase activity(GO:0016972) |
| 0.1 | 0.3 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
| 0.1 | 0.4 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.1 | 0.3 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
| 0.1 | 0.2 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.1 | 1.1 | GO:0003905 | alkylbase DNA N-glycosylase activity(GO:0003905) DNA-3-methylbase glycosylase activity(GO:0043733) |
| 0.1 | 0.7 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
| 0.1 | 0.3 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
| 0.1 | 0.2 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.1 | 1.8 | GO:0008137 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.1 | 0.3 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 0.1 | 0.3 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
| 0.1 | 0.5 | GO:0003988 | acetyl-CoA C-acyltransferase activity(GO:0003988) |
| 0.1 | 0.4 | GO:0015181 | arginine transmembrane transporter activity(GO:0015181) L-lysine transmembrane transporter activity(GO:0015189) |
| 0.1 | 0.4 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
| 0.1 | 2.8 | GO:0016749 | N-succinyltransferase activity(GO:0016749) |
| 0.1 | 1.1 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
| 0.1 | 0.5 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.1 | 0.4 | GO:1990254 | keratin filament binding(GO:1990254) |
| 0.1 | 0.3 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
| 0.1 | 0.4 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
| 0.1 | 1.4 | GO:0004629 | phospholipase C activity(GO:0004629) |
| 0.1 | 0.6 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.1 | 0.4 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.1 | 0.3 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
| 0.1 | 0.4 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 0.1 | 0.5 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| 0.1 | 1.2 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
| 0.1 | 0.6 | GO:0008469 | histone-arginine N-methyltransferase activity(GO:0008469) |
| 0.1 | 0.5 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
| 0.1 | 0.1 | GO:0016748 | succinyltransferase activity(GO:0016748) |
| 0.1 | 0.2 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
| 0.1 | 0.2 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
| 0.1 | 0.2 | GO:0034191 | apolipoprotein A-I receptor binding(GO:0034191) |
| 0.1 | 0.2 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.1 | 0.2 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
| 0.1 | 0.6 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
| 0.1 | 0.1 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
| 0.1 | 0.4 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
| 0.1 | 0.2 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
| 0.1 | 0.1 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
| 0.1 | 1.0 | GO:0005542 | folic acid binding(GO:0005542) |
| 0.1 | 0.7 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
| 0.1 | 0.1 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
| 0.1 | 0.4 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
| 0.1 | 0.4 | GO:0045545 | syndecan binding(GO:0045545) |
| 0.1 | 1.5 | GO:0030332 | cyclin binding(GO:0030332) |
| 0.1 | 0.3 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.1 | 0.6 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
| 0.1 | 0.2 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
| 0.1 | 0.3 | GO:0070728 | leucine binding(GO:0070728) |
| 0.1 | 0.6 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
| 0.1 | 0.5 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
| 0.1 | 0.2 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
| 0.1 | 0.2 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
| 0.1 | 0.2 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
| 0.1 | 0.2 | GO:0034934 | 2,3-dihydroxy DDT 1,2-dioxygenase activity(GO:0018542) phenanthrene dioxygenase activity(GO:0018555) 2,2',3-trihydroxybiphenyl dioxygenase activity(GO:0018556) 1,2-dihydroxyfluorene 1,1-alpha-dioxygenase activity(GO:0018557) 5,6-dihydroxy-3-methyl-2-oxo-1,2-dihydroquinoline dioxygenase activity(GO:0018558) 1,1-dichloro-2-(dihydroxy-4-chlorophenyl)-(4-chlorophenyl)ethene 1,2-dioxygenase activity(GO:0018559) protocatechuate 3,4-dioxygenase type II activity(GO:0018560) 2'-aminobiphenyl-2,3-diol 1,2-dioxygenase activity(GO:0018561) 3,4-dihydroxyfluorene 4,4-alpha-dioxygenase activity(GO:0018562) 2,3-dihydroxy-ethylbenzene 1,2-dioxygenase activity(GO:0018563) carbazole 1,9a-dioxygenase activity(GO:0018564) dihydroxydibenzothiophene dioxygenase activity(GO:0018565) 1,2-dihydroxynaphthalene-6-sulfonate 1,8a-dioxygenase activity(GO:0018566) styrene dioxygenase activity(GO:0018567) 3,4-dihydroxyphenanthrene dioxygenase activity(GO:0018568) hydroquinone 1,2-dioxygenase activity(GO:0018569) p-cumate 2,3-dioxygenase activity(GO:0018570) 2,3-dihydroxy-p-cumate dioxygenase activity(GO:0018571) 3,5-dichlorocatechol 1,2-dioxygenase activity(GO:0018572) 2-aminophenol 1,6-dioxygenase activity(GO:0018573) 2,6-dichloro-p-hydroquinone 1,2-dioxygenase activity(GO:0018574) chlorocatechol 1,2-dioxygenase activity(GO:0018575) catechol dioxygenase activity(GO:0019114) dihydroxyfluorene dioxygenase activity(GO:0019117) 5-aminosalicylate dioxygenase activity(GO:0034543) 3-hydroxy-2-naphthoate 2,3-dioxygenase activity(GO:0034803) benzo(a)pyrene 11,12-dioxygenase activity(GO:0034806) benzo(a)pyrene 4,5-dioxygenase activity(GO:0034808) 4,5-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034810) benzo(a)pyrene 9,10-dioxygenase activity(GO:0034811) 9,10-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034812) benzo(a)pyrene 7,8-dioxygenase activity(GO:0034813) 7,8-dihydroxy benzo(a)pyrene dioxygenase activity(GO:0034814) 1,2-dihydroxy-5,6,7,8-tetrahydronaphthalene extradiol dioxygenase activity(GO:0034827) 2-mercaptobenzothiazole dioxygenase activity(GO:0034834) pyridine-3,4-diol dioxygenase activity(GO:0034895) pyrene dioxygenase activity(GO:0034920) 4,5-dihydroxypyrene dioxygenase activity(GO:0034922) phenanthrene-4-carboxylate dioxygenase activity(GO:0034934) tetrachlorobenzene dioxygenase activity(GO:0034935) 4,6-dichloro-3-methylcatechol 1,2-dioxygenase activity(GO:0034936) 2,3-dihydroxydiphenyl ether dioxygenase activity(GO:0034955) diphenyl ether 1,2-dioxygenase activity(GO:0034956) arachidonate 8(S)-lipoxygenase activity(GO:0036403) 4-hydroxycatechol 1,2-dioxygenase activity(GO:0047074) |
| 0.1 | 0.3 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
| 0.1 | 0.3 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
| 0.1 | 0.3 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) |
| 0.1 | 0.3 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.1 | 0.1 | GO:1901612 | cardiolipin binding(GO:1901612) |
| 0.1 | 0.5 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.1 | 0.3 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
| 0.1 | 0.2 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.1 | 0.3 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.1 | 0.3 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 0.1 | 0.3 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
| 0.1 | 0.8 | GO:0043422 | protein kinase B binding(GO:0043422) |
| 0.1 | 0.3 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.1 | 1.2 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.1 | 0.5 | GO:0043995 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
| 0.1 | 0.5 | GO:0004385 | guanylate kinase activity(GO:0004385) |
| 0.1 | 0.2 | GO:0016896 | 3'-5'-exoribonuclease activity(GO:0000175) exoribonuclease activity, producing 5'-phosphomonoesters(GO:0016896) |
| 0.1 | 0.1 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
| 0.1 | 0.3 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
| 0.1 | 0.2 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
| 0.1 | 0.6 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
| 0.1 | 0.2 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
| 0.1 | 0.8 | GO:0044548 | S100 protein binding(GO:0044548) |
| 0.1 | 0.4 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 0.1 | 0.4 | GO:0016423 | tRNA (guanine) methyltransferase activity(GO:0016423) |
| 0.1 | 0.2 | GO:0001846 | opsonin binding(GO:0001846) |
| 0.1 | 0.2 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
| 0.1 | 0.1 | GO:0031852 | mu-type opioid receptor binding(GO:0031852) |
| 0.1 | 0.2 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
| 0.1 | 0.2 | GO:0005047 | signal recognition particle binding(GO:0005047) |
| 0.1 | 0.2 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
| 0.1 | 0.2 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
| 0.1 | 0.2 | GO:0004802 | transketolase activity(GO:0004802) |
| 0.1 | 1.3 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.1 | 0.1 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
| 0.1 | 0.1 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
| 0.1 | 0.1 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
| 0.1 | 0.5 | GO:0004017 | adenylate kinase activity(GO:0004017) |
| 0.1 | 0.5 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.1 | 0.2 | GO:0031781 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
| 0.1 | 0.2 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
| 0.1 | 0.2 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
| 0.1 | 0.7 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
| 0.1 | 0.1 | GO:0051723 | protein methylesterase activity(GO:0051723) |
| 0.1 | 0.3 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.1 | 0.8 | GO:0001671 | ATPase activator activity(GO:0001671) |
| 0.1 | 0.4 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.1 | 1.1 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
| 0.1 | 0.3 | GO:0004028 | 3-chloroallyl aldehyde dehydrogenase activity(GO:0004028) |
| 0.1 | 0.2 | GO:0004103 | choline kinase activity(GO:0004103) |
| 0.1 | 0.3 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
| 0.1 | 0.1 | GO:0043398 | HLH domain binding(GO:0043398) |
| 0.1 | 0.1 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
| 0.1 | 0.1 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
| 0.1 | 0.5 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
| 0.1 | 0.1 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
| 0.1 | 0.3 | GO:0035325 | Toll-like receptor binding(GO:0035325) |
| 0.1 | 0.4 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
| 0.1 | 0.6 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.1 | 0.5 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
| 0.1 | 0.2 | GO:0102345 | 3-hydroxy-behenoyl-CoA dehydratase activity(GO:0102344) 3-hydroxy-lignoceroyl-CoA dehydratase activity(GO:0102345) |
| 0.1 | 0.4 | GO:0001640 | adenylate cyclase inhibiting G-protein coupled glutamate receptor activity(GO:0001640) |
| 0.1 | 1.2 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
| 0.1 | 0.3 | GO:0016215 | acyl-CoA desaturase activity(GO:0016215) |
| 0.1 | 0.1 | GO:1990188 | euchromatin binding(GO:1990188) |
| 0.1 | 0.2 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
| 0.1 | 0.5 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.1 | 0.2 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
| 0.1 | 0.2 | GO:0019959 | interleukin-8 binding(GO:0019959) |
| 0.1 | 0.1 | GO:0004661 | protein geranylgeranyltransferase activity(GO:0004661) |
| 0.1 | 0.3 | GO:0035197 | siRNA binding(GO:0035197) |
| 0.1 | 0.5 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
| 0.0 | 0.1 | GO:0070883 | pre-miRNA binding(GO:0070883) |
| 0.0 | 0.3 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
| 0.0 | 0.2 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
| 0.0 | 0.2 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.0 | 0.4 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.0 | 0.4 | GO:0003993 | acid phosphatase activity(GO:0003993) |
| 0.0 | 0.1 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
| 0.0 | 0.0 | GO:0038191 | neuropilin binding(GO:0038191) |
| 0.0 | 0.1 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.0 | 0.2 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
| 0.0 | 0.2 | GO:0038100 | nodal binding(GO:0038100) |
| 0.0 | 0.2 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.0 | 0.4 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.0 | 0.1 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| 0.0 | 0.5 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.0 | 0.1 | GO:0043175 | RNA polymerase core enzyme binding(GO:0043175) |
| 0.0 | 0.2 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.0 | 0.6 | GO:0050664 | oxidoreductase activity, acting on NAD(P)H, oxygen as acceptor(GO:0050664) |
| 0.0 | 0.2 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.0 | 0.3 | GO:0016671 | oxidoreductase activity, acting on a sulfur group of donors, disulfide as acceptor(GO:0016671) |
| 0.0 | 0.1 | GO:0004144 | diacylglycerol O-acyltransferase activity(GO:0004144) |
| 0.0 | 0.1 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.0 | 0.1 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.0 | 0.8 | GO:0043531 | ADP binding(GO:0043531) |
| 0.0 | 0.6 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
| 0.0 | 0.2 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
| 0.0 | 0.4 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.0 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.0 | 0.1 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.0 | 0.8 | GO:0004889 | acetylcholine-activated cation-selective channel activity(GO:0004889) |
| 0.0 | 0.0 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.0 | 0.1 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
| 0.0 | 2.3 | GO:0048306 | calcium-dependent protein binding(GO:0048306) |
| 0.0 | 0.6 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
| 0.0 | 0.0 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
| 0.0 | 0.1 | GO:2001069 | glycogen binding(GO:2001069) |
| 0.0 | 0.1 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
| 0.0 | 0.3 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
| 0.0 | 0.6 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
| 0.0 | 0.1 | GO:0032564 | dATP binding(GO:0032564) |
| 0.0 | 0.3 | GO:0035014 | phosphatidylinositol 3-kinase regulator activity(GO:0035014) |
| 0.0 | 0.3 | GO:0031685 | adenosine receptor binding(GO:0031685) |
| 0.0 | 0.2 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
| 0.0 | 0.1 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
| 0.0 | 0.0 | GO:0016532 | superoxide dismutase copper chaperone activity(GO:0016532) |
| 0.0 | 0.1 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.0 | 0.2 | GO:0016668 | oxidoreductase activity, acting on a sulfur group of donors, NAD(P) as acceptor(GO:0016668) |
| 0.0 | 0.7 | GO:0016864 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
| 0.0 | 0.7 | GO:0003777 | microtubule motor activity(GO:0003777) |
| 0.0 | 0.2 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
| 0.0 | 0.3 | GO:0045294 | alpha-catenin binding(GO:0045294) |
| 0.0 | 0.0 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
| 0.0 | 0.5 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.0 | 0.1 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.0 | 0.1 | GO:0004112 | cyclic-nucleotide phosphodiesterase activity(GO:0004112) |
| 0.0 | 0.4 | GO:0048038 | quinone binding(GO:0048038) |
| 0.0 | 0.1 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
| 0.0 | 0.3 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.0 | 0.4 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.0 | 0.1 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
| 0.0 | 0.7 | GO:0005246 | calcium channel regulator activity(GO:0005246) |
| 0.0 | 0.5 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 0.0 | 0.2 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
| 0.0 | 0.3 | GO:0008097 | 5S rRNA binding(GO:0008097) |
| 0.0 | 0.2 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
| 0.0 | 0.1 | GO:0071614 | linoleic acid epoxygenase activity(GO:0071614) |
| 0.0 | 0.5 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
| 0.0 | 0.7 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.0 | 0.2 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.0 | 0.1 | GO:0005329 | dopamine transmembrane transporter activity(GO:0005329) |
| 0.0 | 0.1 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
| 0.0 | 0.4 | GO:0005521 | lamin binding(GO:0005521) |
| 0.0 | 0.3 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.0 | 0.1 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
| 0.0 | 0.1 | GO:0000339 | RNA cap binding(GO:0000339) |
| 0.0 | 0.1 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.0 | 0.2 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
| 0.0 | 0.1 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.0 | 0.2 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
| 0.0 | 0.1 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
| 0.0 | 2.5 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
| 0.0 | 0.1 | GO:0016015 | morphogen activity(GO:0016015) |
| 0.0 | 0.2 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
| 0.0 | 0.0 | GO:0051430 | corticotropin-releasing hormone receptor 1 binding(GO:0051430) |
| 0.0 | 0.1 | GO:0016803 | ether hydrolase activity(GO:0016803) |
| 0.0 | 0.2 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.0 | 0.6 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 0.0 | 0.1 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
| 0.0 | 0.1 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
| 0.0 | 0.2 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.0 | 0.1 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.0 | 0.5 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| 0.0 | 1.0 | GO:0008536 | Ran GTPase binding(GO:0008536) |
| 0.0 | 0.2 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) |
| 0.0 | 0.1 | GO:0019808 | polyamine binding(GO:0019808) |
| 0.0 | 0.2 | GO:0016776 | phosphotransferase activity, phosphate group as acceptor(GO:0016776) |
| 0.0 | 0.6 | GO:0046961 | proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
| 0.0 | 0.0 | GO:0047238 | glucuronosyl-N-acetylgalactosaminyl-proteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047238) |
| 0.0 | 1.1 | GO:0031593 | polyubiquitin binding(GO:0031593) |
| 0.0 | 0.0 | GO:0046979 | TAP1 binding(GO:0046978) TAP2 binding(GO:0046979) |
| 0.0 | 0.2 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
| 0.0 | 0.3 | GO:0001223 | transcription coactivator binding(GO:0001223) |
| 0.0 | 0.2 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.0 | 0.3 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.0 | 1.9 | GO:0008186 | ATP-dependent RNA helicase activity(GO:0004004) RNA-dependent ATPase activity(GO:0008186) |
| 0.0 | 0.1 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
| 0.0 | 2.9 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.0 | 0.2 | GO:0016679 | oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) |
| 0.0 | 0.1 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
| 0.0 | 0.1 | GO:0030621 | U4 snRNA binding(GO:0030621) |
| 0.0 | 0.9 | GO:0019894 | kinesin binding(GO:0019894) |
| 0.0 | 0.4 | GO:1990939 | ATP-dependent microtubule motor activity(GO:1990939) |
| 0.0 | 1.5 | GO:0051082 | unfolded protein binding(GO:0051082) |
| 0.0 | 0.1 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
| 0.0 | 0.2 | GO:0034713 | type I transforming growth factor beta receptor binding(GO:0034713) |
| 0.0 | 0.1 | GO:0008147 | structural constituent of bone(GO:0008147) |
| 0.0 | 0.2 | GO:0016151 | nickel cation binding(GO:0016151) |
| 0.0 | 0.1 | GO:0003909 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
| 0.0 | 0.4 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.0 | 0.3 | GO:0034946 | 2-oxoglutaryl-CoA thioesterase activity(GO:0034843) 2,4,4-trimethyl-3-oxopentanoyl-CoA thioesterase activity(GO:0034869) 3-isopropylbut-3-enoyl-CoA thioesterase activity(GO:0034946) glutaryl-CoA hydrolase activity(GO:0044466) |
| 0.0 | 0.1 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
| 0.0 | 0.1 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
| 0.0 | 0.5 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
| 0.0 | 0.1 | GO:1901567 | icosanoid binding(GO:0050542) arachidonic acid binding(GO:0050544) fatty acid derivative binding(GO:1901567) |
| 0.0 | 0.2 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.0 | 0.1 | GO:0008430 | selenium binding(GO:0008430) |
| 0.0 | 0.4 | GO:0008308 | voltage-gated anion channel activity(GO:0008308) |
| 0.0 | 0.1 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
| 0.0 | 0.1 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
| 0.0 | 0.1 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
| 0.0 | 0.1 | GO:0008410 | CoA-transferase activity(GO:0008410) |
| 0.0 | 0.1 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
| 0.0 | 0.0 | GO:0030172 | troponin C binding(GO:0030172) |
| 0.0 | 0.1 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
| 0.0 | 0.1 | GO:0051373 | FATZ binding(GO:0051373) |
| 0.0 | 0.4 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
| 0.0 | 0.3 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.0 | 0.8 | GO:0018733 | 3,4-dihydrocoumarin hydrolase activity(GO:0018733) |
| 0.0 | 0.2 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.0 | 0.1 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
| 0.0 | 0.1 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
| 0.0 | 0.8 | GO:0032813 | tumor necrosis factor receptor superfamily binding(GO:0032813) |
| 0.0 | 0.1 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.0 | 0.4 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.0 | 0.2 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.0 | 0.0 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
| 0.0 | 0.1 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
| 0.0 | 0.0 | GO:0008948 | oxaloacetate decarboxylase activity(GO:0008948) |
| 0.0 | 0.1 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
| 0.0 | 0.5 | GO:0016676 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.0 | 0.1 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
| 0.0 | 0.2 | GO:0036442 | hydrogen-exporting ATPase activity(GO:0036442) |
| 0.0 | 0.1 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
| 0.0 | 0.4 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
| 0.0 | 0.1 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
| 0.0 | 0.3 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
| 0.0 | 0.2 | GO:0005523 | tropomyosin binding(GO:0005523) |
| 0.0 | 0.1 | GO:0016408 | C-acyltransferase activity(GO:0016408) |
| 0.0 | 0.1 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
| 0.0 | 0.2 | GO:1990446 | U1 snRNP binding(GO:1990446) |
| 0.0 | 0.2 | GO:0004526 | ribonuclease P activity(GO:0004526) |
| 0.0 | 0.1 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
| 0.0 | 0.1 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.0 | 0.2 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.0 | 0.1 | GO:0004337 | geranyltranstransferase activity(GO:0004337) |
| 0.0 | 0.3 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
| 0.0 | 2.6 | GO:0008017 | microtubule binding(GO:0008017) |
| 0.0 | 0.0 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 0.0 | 0.1 | GO:0043426 | MRF binding(GO:0043426) |
| 0.0 | 0.1 | GO:0004946 | bombesin receptor activity(GO:0004946) |
| 0.0 | 0.0 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
| 0.0 | 0.1 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.0 | 0.7 | GO:0003774 | motor activity(GO:0003774) |
| 0.0 | 0.0 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
| 0.0 | 3.7 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.0 | 0.1 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
| 0.0 | 0.1 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
| 0.0 | 0.0 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
| 0.0 | 0.1 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.0 | 0.1 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
| 0.0 | 0.1 | GO:0070052 | collagen V binding(GO:0070052) |
| 0.0 | 0.1 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
| 0.0 | 0.0 | GO:0070698 | type I activin receptor binding(GO:0070698) |
| 0.0 | 0.0 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
| 0.0 | 0.1 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
| 0.0 | 0.1 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
| 0.0 | 0.1 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
| 0.0 | 0.2 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
| 0.0 | 0.1 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
| 0.0 | 0.7 | GO:0030276 | clathrin binding(GO:0030276) |
| 0.0 | 0.1 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.0 | 0.2 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
| 0.0 | 0.1 | GO:0051380 | beta-adrenergic receptor activity(GO:0004939) epinephrine binding(GO:0051379) norepinephrine binding(GO:0051380) |
| 0.0 | 0.0 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
| 0.0 | 0.1 | GO:0008174 | mRNA methyltransferase activity(GO:0008174) |
| 0.0 | 0.0 | GO:1901611 | phosphatidylglycerol binding(GO:1901611) |
| 0.0 | 0.1 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 0.0 | 0.3 | GO:0016667 | oxidoreductase activity, acting on a sulfur group of donors(GO:0016667) |
| 0.0 | 0.1 | GO:0008745 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) peptidoglycan receptor activity(GO:0016019) |
| 0.0 | 0.0 | GO:0071723 | lipopeptide binding(GO:0071723) |
| 0.0 | 0.1 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
| 0.0 | 0.3 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
| 0.0 | 0.2 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
| 0.0 | 0.1 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
| 0.0 | 0.3 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.0 | 0.1 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
| 0.0 | 0.1 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
| 0.0 | 0.0 | GO:0032453 | histone demethylase activity (H3-K4 specific)(GO:0032453) |
| 0.0 | 0.2 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.0 | 0.4 | GO:0008170 | N-methyltransferase activity(GO:0008170) |
| 0.0 | 0.1 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 0.0 | 0.3 | GO:0042056 | chemoattractant activity(GO:0042056) |
| 0.0 | 0.6 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
| 0.0 | 0.1 | GO:0019215 | intermediate filament binding(GO:0019215) |
| 0.0 | 0.0 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
| 0.0 | 0.3 | GO:0008483 | transaminase activity(GO:0008483) |
| 0.0 | 0.3 | GO:0042805 | actinin binding(GO:0042805) |
| 0.0 | 1.0 | GO:0047485 | protein N-terminus binding(GO:0047485) |
| 0.0 | 0.0 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
| 0.0 | 0.1 | GO:0002054 | nucleobase binding(GO:0002054) |
| 0.0 | 0.1 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
| 0.0 | 0.1 | GO:0045499 | chemorepellent activity(GO:0045499) |
| 0.0 | 0.0 | GO:0071209 | U7 snRNA binding(GO:0071209) |
| 0.0 | 0.8 | GO:0004843 | thiol-dependent ubiquitin-specific protease activity(GO:0004843) |
| 0.0 | 0.6 | GO:0017048 | Rho GTPase binding(GO:0017048) |
| 0.0 | 0.1 | GO:0042285 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
| 0.0 | 0.0 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
| 0.0 | 0.1 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
| 0.0 | 0.1 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.0 | 0.1 | GO:0043237 | laminin-1 binding(GO:0043237) |
| 0.0 | 0.0 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
| 0.0 | 0.4 | GO:0004364 | glutathione transferase activity(GO:0004364) |
| 0.0 | 0.1 | GO:0043842 | Kdo transferase activity(GO:0043842) |
| 0.0 | 0.3 | GO:0016765 | transferase activity, transferring alkyl or aryl (other than methyl) groups(GO:0016765) |
| 0.0 | 1.0 | GO:0005496 | steroid binding(GO:0005496) |
| 0.0 | 0.5 | GO:0004177 | aminopeptidase activity(GO:0004177) |
| 0.0 | 0.6 | GO:0016820 | hydrolase activity, acting on acid anhydrides, catalyzing transmembrane movement of substances(GO:0016820) |
| 0.0 | 0.2 | GO:0015923 | mannosidase activity(GO:0015923) |
| 0.0 | 0.1 | GO:0004303 | estradiol 17-beta-dehydrogenase activity(GO:0004303) |
| 0.0 | 0.8 | GO:0004702 | receptor signaling protein serine/threonine kinase activity(GO:0004702) |
| 0.0 | 0.0 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
| 0.0 | 0.6 | GO:0005254 | chloride channel activity(GO:0005254) |
| 0.0 | 0.2 | GO:0030506 | ankyrin binding(GO:0030506) |
| 0.0 | 0.3 | GO:0001540 | beta-amyloid binding(GO:0001540) |
| 0.0 | 0.0 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
| 0.0 | 0.1 | GO:0009881 | photoreceptor activity(GO:0009881) |
| 0.0 | 0.0 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
| 0.0 | 0.2 | GO:0005248 | voltage-gated sodium channel activity(GO:0005248) voltage-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1905030) |
| 0.0 | 0.0 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.0 | 0.0 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
| 0.0 | 0.0 | GO:0004365 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
| 0.0 | 0.1 | GO:0000150 | recombinase activity(GO:0000150) |
| 0.0 | 0.0 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
| 0.0 | 0.3 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
| 0.0 | 0.1 | GO:0031386 | protein tag(GO:0031386) |
| 0.0 | 0.0 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 9.0 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.1 | 1.5 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.1 | 1.9 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.1 | 0.9 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.1 | 2.5 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.1 | 0.2 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
| 0.1 | 0.9 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.1 | 2.0 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.1 | 1.1 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.1 | 2.2 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
| 0.1 | 0.6 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.1 | 0.3 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
| 0.1 | 0.1 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.1 | 0.1 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
| 0.1 | 1.2 | PID ATM PATHWAY | ATM pathway |
| 0.1 | 1.7 | PID BARD1 PATHWAY | BARD1 signaling events |
| 0.1 | 1.0 | PID ARF 3PATHWAY | Arf1 pathway |
| 0.1 | 1.0 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
| 0.1 | 0.9 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
| 0.1 | 0.2 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
| 0.0 | 0.5 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.0 | 0.3 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.0 | 1.1 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
| 0.0 | 0.3 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
| 0.0 | 0.3 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.0 | 0.2 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.0 | 0.7 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
| 0.0 | 0.7 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.0 | 1.4 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
| 0.0 | 1.3 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.0 | 0.3 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
| 0.0 | 0.2 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
| 0.0 | 0.3 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
| 0.0 | 0.0 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.0 | 0.1 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.0 | 0.5 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
| 0.0 | 0.3 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.0 | 1.2 | PID FGF PATHWAY | FGF signaling pathway |
| 0.0 | 0.9 | PID SHP2 PATHWAY | SHP2 signaling |
| 0.0 | 0.2 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
| 0.0 | 0.1 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
| 0.0 | 0.2 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.0 | 0.6 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
| 0.0 | 0.9 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
| 0.0 | 0.3 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.0 | 0.0 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
| 0.0 | 0.2 | PID IL2 1PATHWAY | IL2-mediated signaling events |
| 0.0 | 0.2 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
| 0.0 | 0.4 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
| 0.0 | 0.3 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.0 | 0.6 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.0 | 0.3 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.0 | 0.3 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.0 | 0.2 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
| 0.0 | 3.4 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
| 0.0 | 0.1 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.0 | 0.2 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
| 0.0 | 0.1 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
| 0.0 | 0.5 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
| 0.0 | 0.3 | PID MYC PATHWAY | C-MYC pathway |
| 0.0 | 0.2 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.0 | 0.1 | ST G ALPHA I PATHWAY | G alpha i Pathway |
| 0.0 | 0.1 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
| 0.0 | 0.0 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
| 0.0 | 0.0 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| 0.0 | 0.3 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 0.0 | 0.0 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.0 | 0.1 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.0 | 0.5 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 0.0 | 0.1 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.0 | 0.1 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 0.0 | 0.0 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 0.0 | 0.4 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.0 | 0.2 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
| 0.0 | 0.1 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
| 0.0 | 0.4 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
| 0.0 | 0.0 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
| 0.0 | 0.0 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.0 | 0.1 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.0 | 0.1 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
| 0.0 | 0.2 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
| 0.0 | 0.3 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.4 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.2 | 0.2 | REACTOME IL 2 SIGNALING | Genes involved in Interleukin-2 signaling |
| 0.2 | 2.8 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
| 0.2 | 4.6 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
| 0.2 | 0.7 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
| 0.2 | 2.5 | REACTOME SHC1 EVENTS IN EGFR SIGNALING | Genes involved in SHC1 events in EGFR signaling |
| 0.1 | 1.5 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.1 | 1.2 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.1 | 1.3 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
| 0.1 | 1.3 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
| 0.1 | 0.8 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
| 0.1 | 1.3 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.1 | 0.2 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
| 0.1 | 1.9 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
| 0.1 | 0.1 | REACTOME LAGGING STRAND SYNTHESIS | Genes involved in Lagging Strand Synthesis |
| 0.1 | 2.0 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
| 0.1 | 1.2 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
| 0.1 | 0.8 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
| 0.1 | 1.1 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
| 0.1 | 0.3 | REACTOME P53 INDEPENDENT G1 S DNA DAMAGE CHECKPOINT | Genes involved in p53-Independent G1/S DNA damage checkpoint |
| 0.1 | 0.3 | REACTOME SHC RELATED EVENTS | Genes involved in SHC-related events |
| 0.1 | 0.3 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
| 0.1 | 0.7 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.1 | 3.2 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
| 0.1 | 1.8 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
| 0.1 | 0.7 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.1 | 1.1 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.1 | 0.9 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.1 | 1.0 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.1 | 1.2 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
| 0.1 | 11.9 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
| 0.1 | 0.8 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.1 | 1.1 | REACTOME SIGNALING BY WNT | Genes involved in Signaling by Wnt |
| 0.1 | 1.0 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
| 0.1 | 0.1 | REACTOME SIGNALING BY SCF KIT | Genes involved in Signaling by SCF-KIT |
| 0.1 | 0.8 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
| 0.1 | 0.6 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.1 | 2.8 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.1 | 1.7 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
| 0.1 | 0.8 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
| 0.1 | 0.7 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.1 | 0.4 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.1 | 0.1 | REACTOME TRANSPORT OF RIBONUCLEOPROTEINS INTO THE HOST NUCLEUS | Genes involved in Transport of Ribonucleoproteins into the Host Nucleus |
| 0.1 | 0.6 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.1 | 0.7 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
| 0.1 | 0.6 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.1 | 1.3 | REACTOME KINESINS | Genes involved in Kinesins |
| 0.1 | 0.1 | REACTOME GRB2 EVENTS IN ERBB2 SIGNALING | Genes involved in GRB2 events in ERBB2 signaling |
| 0.1 | 0.5 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
| 0.1 | 0.7 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
| 0.1 | 0.1 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
| 0.1 | 0.2 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
| 0.1 | 0.2 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
| 0.1 | 0.9 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
| 0.1 | 0.4 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
| 0.1 | 1.4 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
| 0.1 | 0.1 | REACTOME GASTRIN CREB SIGNALLING PATHWAY VIA PKC AND MAPK | Genes involved in Gastrin-CREB signalling pathway via PKC and MAPK |
| 0.1 | 0.6 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.1 | 0.1 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
| 0.1 | 0.8 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
| 0.1 | 0.4 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.0 | 3.1 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
| 0.0 | 0.5 | REACTOME NRIF SIGNALS CELL DEATH FROM THE NUCLEUS | Genes involved in NRIF signals cell death from the nucleus |
| 0.0 | 0.5 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
| 0.0 | 0.2 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
| 0.0 | 1.4 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
| 0.0 | 0.9 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
| 0.0 | 0.2 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
| 0.0 | 0.2 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
| 0.0 | 0.9 | REACTOME APOPTOTIC CLEAVAGE OF CELLULAR PROTEINS | Genes involved in Apoptotic cleavage of cellular proteins |
| 0.0 | 0.2 | REACTOME ARMS MEDIATED ACTIVATION | Genes involved in ARMS-mediated activation |
| 0.0 | 0.1 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
| 0.0 | 1.0 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
| 0.0 | 0.9 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
| 0.0 | 0.3 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
| 0.0 | 1.6 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
| 0.0 | 0.1 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
| 0.0 | 0.2 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
| 0.0 | 0.7 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
| 0.0 | 0.6 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
| 0.0 | 0.1 | REACTOME CA DEPENDENT EVENTS | Genes involved in Ca-dependent events |
| 0.0 | 0.1 | REACTOME IL 3 5 AND GM CSF SIGNALING | Genes involved in Interleukin-3, 5 and GM-CSF signaling |
| 0.0 | 0.2 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
| 0.0 | 0.4 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
| 0.0 | 0.1 | REACTOME SIGNALING BY INSULIN RECEPTOR | Genes involved in Signaling by Insulin receptor |
| 0.0 | 1.0 | REACTOME REGULATION OF GLUCOKINASE BY GLUCOKINASE REGULATORY PROTEIN | Genes involved in Regulation of Glucokinase by Glucokinase Regulatory Protein |
| 0.0 | 0.2 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.0 | 0.4 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
| 0.0 | 0.7 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.0 | 0.1 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
| 0.0 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
| 0.0 | 0.6 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
| 0.0 | 0.1 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
| 0.0 | 0.6 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.0 | 0.4 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
| 0.0 | 0.3 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.0 | 0.7 | REACTOME TRANSPORT OF MATURE TRANSCRIPT TO CYTOPLASM | Genes involved in Transport of Mature Transcript to Cytoplasm |
| 0.0 | 0.1 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.0 | 0.1 | REACTOME TCR SIGNALING | Genes involved in TCR signaling |
| 0.0 | 0.3 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
| 0.0 | 1.3 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
| 0.0 | 0.1 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
| 0.0 | 0.4 | REACTOME PHOSPHORYLATION OF THE APC C | Genes involved in Phosphorylation of the APC/C |
| 0.0 | 0.3 | REACTOME CLEAVAGE OF GROWING TRANSCRIPT IN THE TERMINATION REGION | Genes involved in Cleavage of Growing Transcript in the Termination Region |
| 0.0 | 0.5 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.0 | 0.5 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
| 0.0 | 0.1 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
| 0.0 | 0.3 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
| 0.0 | 0.1 | REACTOME TRIF MEDIATED TLR3 SIGNALING | Genes involved in TRIF mediated TLR3 signaling |
| 0.0 | 0.7 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.0 | 0.6 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.0 | 0.4 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
| 0.0 | 1.4 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
| 0.0 | 0.0 | REACTOME SOS MEDIATED SIGNALLING | Genes involved in SOS-mediated signalling |
| 0.0 | 0.1 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
| 0.0 | 1.5 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
| 0.0 | 0.0 | REACTOME PROLONGED ERK ACTIVATION EVENTS | Genes involved in Prolonged ERK activation events |
| 0.0 | 0.1 | REACTOME FORMATION OF FIBRIN CLOT CLOTTING CASCADE | Genes involved in Formation of Fibrin Clot (Clotting Cascade) |
| 0.0 | 0.2 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.0 | 0.9 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
| 0.0 | 0.2 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
| 0.0 | 0.2 | REACTOME ACTIVATION OF IRF3 IRF7 MEDIATED BY TBK1 IKK EPSILON | Genes involved in Activation of IRF3/IRF7 mediated by TBK1/IKK epsilon |
| 0.0 | 0.4 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.0 | 0.3 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.0 | 0.4 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
| 0.0 | 0.4 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 0.0 | 0.3 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
| 0.0 | 0.5 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
| 0.0 | 0.1 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.0 | 0.3 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.0 | 0.0 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.0 | 0.1 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
| 0.0 | 0.3 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.0 | 0.1 | REACTOME DOUBLE STRAND BREAK REPAIR | Genes involved in Double-Strand Break Repair |
| 0.0 | 0.0 | REACTOME SIGNALING BY EGFR IN CANCER | Genes involved in Signaling by EGFR in Cancer |
| 0.0 | 0.4 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
| 0.0 | 0.4 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
| 0.0 | 0.3 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.0 | 0.3 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
| 0.0 | 0.1 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
| 0.0 | 0.3 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
| 0.0 | 0.2 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
| 0.0 | 2.0 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
| 0.0 | 0.2 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
| 0.0 | 0.1 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
| 0.0 | 0.0 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
| 0.0 | 0.2 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
| 0.0 | 0.2 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 0.0 | 0.7 | REACTOME BIOLOGICAL OXIDATIONS | Genes involved in Biological oxidations |
| 0.0 | 1.3 | REACTOME G ALPHA S SIGNALLING EVENTS | Genes involved in G alpha (s) signalling events |
| 0.0 | 0.1 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
| 0.0 | 0.2 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
| 0.0 | 0.0 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
| 0.0 | 0.0 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
| 0.0 | 0.0 | REACTOME SIGNALING BY ERBB2 | Genes involved in Signaling by ERBB2 |
| 0.0 | 0.2 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.0 | 0.3 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.0 | 0.1 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
| 0.0 | 0.5 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.0 | 0.0 | REACTOME REGULATION OF APOPTOSIS | Genes involved in Regulation of Apoptosis |
| 0.0 | 0.0 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
| 0.0 | 0.2 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
| 0.0 | 0.0 | REACTOME COSTIMULATION BY THE CD28 FAMILY | Genes involved in Costimulation by the CD28 family |
| 0.0 | 0.0 | REACTOME FORMATION OF THE HIV1 EARLY ELONGATION COMPLEX | Genes involved in Formation of the HIV-1 Early Elongation Complex |
| 0.0 | 0.0 | REACTOME NEUROTRANSMITTER RECEPTOR BINDING AND DOWNSTREAM TRANSMISSION IN THE POSTSYNAPTIC CELL | Genes involved in Neurotransmitter Receptor Binding And Downstream Transmission In The Postsynaptic Cell |
| 0.0 | 0.2 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
| 0.0 | 0.1 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
| 0.0 | 0.1 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.0 | 0.2 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
| 0.0 | 0.5 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |