Gene Symbol | Gene ID | Gene Info |
---|---|---|
Rhox4e
|
ENSMUSG00000071770.4 | Rhox4e |
Rhox6
|
ENSMUSG00000006200.3 | Rhox6 |
Vax2
|
ENSMUSG00000034777.1 | Vax2 |
Gene | Promoter | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Vax2 | chr6_83711040_83711212 | 138 | 0.563230 | 0.63 | 1.8e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr19_44401346_44401497 | 3.19 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
5269 |
0.16 |
chr2_18048778_18049088 | 2.77 |
Skida1 |
SKI/DACH domain containing 1 |
98 |
0.94 |
chr6_72120521_72121047 | 2.77 |
4933431G14Rik |
RIKEN cDNA 4933431G14 gene |
2156 |
0.2 |
chr8_110644559_110644860 | 2.72 |
Vac14 |
Vac14 homolog (S. cerevisiae) |
871 |
0.63 |
chr13_117745874_117746186 | 2.03 |
4933413L06Rik |
RIKEN cDNA 4933413L06 gene |
26019 |
0.26 |
chr12_51274477_51274668 | 1.99 |
Rps11-ps4 |
ribosomal protein S11, pseudogene 4 |
22915 |
0.22 |
chr17_81386211_81386362 | 1.97 |
Gm50044 |
predicted gene, 50044 |
15453 |
0.24 |
chr7_65902304_65902456 | 1.94 |
Pcsk6 |
proprotein convertase subtilisin/kexin type 6 |
39948 |
0.14 |
chr1_100298746_100298897 | 1.93 |
Gm29667 |
predicted gene 29667 |
16030 |
0.18 |
chr3_144110073_144110233 | 1.81 |
Gm34078 |
predicted gene, 34078 |
25601 |
0.2 |
chr12_55440243_55440394 | 1.81 |
Psma6 |
proteasome subunit alpha 6 |
32935 |
0.13 |
chr4_84548710_84548884 | 1.80 |
Bnc2 |
basonuclin 2 |
2178 |
0.44 |
chr2_31513022_31513372 | 1.77 |
Ass1 |
argininosuccinate synthetase 1 |
5293 |
0.19 |
chr6_58611375_58611579 | 1.76 |
Abcg2 |
ATP binding cassette subfamily G member 2 (Junior blood group) |
14806 |
0.19 |
chr9_94016628_94017010 | 1.73 |
Gm5369 |
predicted gene 5369 |
122643 |
0.06 |
chr19_4766055_4766206 | 1.72 |
Gm37206 |
predicted gene, 37206 |
959 |
0.35 |
chr6_120318643_120318978 | 1.71 |
B4galnt3 |
beta-1,4-N-acetyl-galactosaminyl transferase 3 |
24251 |
0.15 |
chr10_4618620_4618773 | 1.66 |
Esr1 |
estrogen receptor 1 (alpha) |
6675 |
0.25 |
chr9_30851911_30852248 | 1.63 |
Adamts15 |
a disintegrin-like and metallopeptidase (reprolysin type) with thrombospondin type 1 motif, 15 |
57578 |
0.11 |
chr17_17375909_17376093 | 1.63 |
Riok2 |
RIO kinase 2 |
1411 |
0.29 |
chr16_24892958_24893109 | 1.59 |
Gm22672 |
predicted gene, 22672 |
8860 |
0.25 |
chr10_87040962_87041138 | 1.58 |
1700113H08Rik |
RIKEN cDNA 1700113H08 gene |
16995 |
0.16 |
chr16_78470224_78470428 | 1.56 |
Gm49603 |
predicted gene, 49603 |
10213 |
0.17 |
chr4_88893074_88893256 | 1.51 |
Ifne |
interferon epsilon |
12964 |
0.08 |
chr9_60982764_60983106 | 1.51 |
Gm5122 |
predicted gene 5122 |
30546 |
0.14 |
chr4_121078016_121078199 | 1.49 |
Zmpste24 |
zinc metallopeptidase, STE24 |
369 |
0.74 |
chr18_45582508_45582659 | 1.49 |
Kcnn2 |
potassium intermediate/small conductance calcium-activated channel, subfamily N, member 2 |
7963 |
0.24 |
chr14_21221949_21222133 | 1.48 |
Adk |
adenosine kinase |
96084 |
0.08 |
chr15_3463467_3463618 | 1.46 |
Ghr |
growth hormone receptor |
8102 |
0.29 |
chr17_64763760_64763987 | 1.45 |
Dreh |
down-regulated in hepatocellular carcinoma |
3238 |
0.25 |
chr19_44400352_44400581 | 1.45 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
6224 |
0.15 |
chr2_122737415_122737579 | 1.44 |
Bloc1s6os |
biogenesis of lysosomal organelles complex-1, subunit 6, pallidin, opposite strand |
865 |
0.39 |
chr13_104044189_104044340 | 1.44 |
Nln |
neurolysin (metallopeptidase M3 family) |
6622 |
0.22 |
chr15_76269579_76269775 | 1.44 |
Mirt2 |
myocardial infraction associated transcript 2 |
52 |
0.92 |
chr1_23237656_23237879 | 1.43 |
Gm29506 |
predicted gene 29506 |
2094 |
0.23 |
chr8_93190868_93191185 | 1.43 |
Gm45909 |
predicted gene 45909 |
332 |
0.84 |
chr6_33823830_33824315 | 1.43 |
Exoc4 |
exocyst complex component 4 |
38028 |
0.2 |
chr13_4205379_4205553 | 1.43 |
Akr1c13 |
aldo-keto reductase family 1, member C13 |
11608 |
0.13 |
chr16_42947764_42948084 | 1.42 |
Ndufs5-ps |
NADH:ubiquinone oxidoreductase core subunit S5, pseudogene |
7707 |
0.21 |
chr4_53221393_53221544 | 1.39 |
4930412L05Rik |
RIKEN cDNA 4930412L05 gene |
3611 |
0.22 |
chr19_48883437_48883771 | 1.38 |
Gm50436 |
predicted gene, 50436 |
72468 |
0.11 |
chr17_80022007_80022158 | 1.35 |
Gm22215 |
predicted gene, 22215 |
11432 |
0.14 |
chr6_137759638_137759932 | 1.33 |
Dera |
deoxyribose-phosphate aldolase (putative) |
882 |
0.65 |
chr9_106264996_106265377 | 1.33 |
Poc1a |
POC1 centriolar protein A |
15875 |
0.1 |
chr11_22844106_22844418 | 1.33 |
Gm23772 |
predicted gene, 23772 |
2606 |
0.17 |
chr1_131919723_131919874 | 1.32 |
Gm38067 |
predicted gene, 38067 |
5269 |
0.12 |
chr4_126764112_126764263 | 1.31 |
AU040320 |
expressed sequence AU040320 |
10361 |
0.13 |
chr1_51751367_51751637 | 1.31 |
Gm28055 |
predicted gene 28055 |
4559 |
0.23 |
chr12_73341772_73342027 | 1.29 |
Slc38a6 |
solute carrier family 38, member 6 |
2468 |
0.25 |
chr1_85165585_85165793 | 1.29 |
Gm6264 |
predicted gene 6264 |
4826 |
0.12 |
chr9_67840552_67841087 | 1.29 |
Vps13c |
vacuolar protein sorting 13C |
407 |
0.85 |
chr16_18071409_18071560 | 1.28 |
Dgcr6 |
DiGeorge syndrome critical region gene 6 |
2004 |
0.23 |
chr17_45879729_45879910 | 1.27 |
4930542M03Rik |
RIKEN cDNA 4930542M03 gene |
1633 |
0.33 |
chr16_55810073_55810224 | 1.26 |
Nfkbiz |
nuclear factor of kappa light polypeptide gene enhancer in B cells inhibitor, zeta |
8367 |
0.18 |
chr9_106730382_106730719 | 1.25 |
Rad54l2 |
RAD54 like 2 (S. cerevisiae) |
7679 |
0.17 |
chr4_44777019_44777170 | 1.25 |
Zcchc7 |
zinc finger, CCHC domain containing 7 |
16650 |
0.16 |
chr12_73861884_73862127 | 1.25 |
Gm15283 |
predicted gene 15283 |
7607 |
0.18 |
chr2_67956563_67957019 | 1.25 |
Gm37964 |
predicted gene, 37964 |
58195 |
0.14 |
chr4_106354190_106354378 | 1.24 |
Usp24 |
ubiquitin specific peptidase 24 |
38050 |
0.13 |
chr11_16843001_16843162 | 1.23 |
Egfros |
epidermal growth factor receptor, opposite strand |
12379 |
0.2 |
chr19_21654390_21654886 | 1.22 |
Abhd17b |
abhydrolase domain containing 17B |
1113 |
0.45 |
chr19_7182336_7182545 | 1.20 |
Otub1 |
OTU domain, ubiquitin aldehyde binding 1 |
18024 |
0.12 |
chr19_31886956_31887132 | 1.19 |
A1cf |
APOBEC1 complementation factor |
18263 |
0.2 |
chr18_3465417_3465568 | 1.19 |
Gm50088 |
predicted gene, 50088 |
1010 |
0.43 |
chr8_23016372_23016538 | 1.17 |
Ank1 |
ankyrin 1, erythroid |
18644 |
0.17 |
chr14_30530847_30531018 | 1.16 |
Dcp1a |
decapping mRNA 1A |
7225 |
0.15 |
chr18_10707142_10707343 | 1.16 |
4930563E18Rik |
RIKEN cDNA 4930563E18 gene |
382 |
0.52 |
chr8_121898077_121898240 | 1.15 |
Slc7a5 |
solute carrier family 7 (cationic amino acid transporter, y+ system), member 5 |
1656 |
0.23 |
chr14_70068415_70068595 | 1.15 |
Egr3 |
early growth response 3 |
8698 |
0.16 |
chr12_4220651_4220920 | 1.15 |
Gm48210 |
predicted gene, 48210 |
1317 |
0.27 |
chr10_14977642_14977816 | 1.15 |
Gm23892 |
predicted gene, 23892 |
6941 |
0.26 |
chr11_23702943_23703137 | 1.15 |
Pus10 |
pseudouridylate synthase 10 |
14442 |
0.16 |
chr7_84113279_84113524 | 1.14 |
Cemip |
cell migration inducing protein, hyaluronan binding |
26899 |
0.14 |
chr1_56623913_56624064 | 1.14 |
Hsfy2 |
heat shock transcription factor, Y-linked 2 |
13447 |
0.28 |
chr4_101198122_101198415 | 1.14 |
Gm24468 |
predicted gene, 24468 |
11504 |
0.14 |
chr7_75852856_75853007 | 1.14 |
Klhl25 |
kelch-like 25 |
4490 |
0.26 |
chr1_21261382_21261702 | 1.13 |
Gsta3 |
glutathione S-transferase, alpha 3 |
8021 |
0.11 |
chr9_46479855_46480133 | 1.13 |
Gm47144 |
predicted gene, 47144 |
25079 |
0.15 |
chr4_109104769_109104920 | 1.13 |
Osbpl9 |
oxysterol binding protein-like 9 |
3187 |
0.27 |
chr3_118592277_118592428 | 1.13 |
Dpyd |
dihydropyrimidine dehydrogenase |
30166 |
0.17 |
chr2_150913728_150914090 | 1.12 |
Gins1 |
GINS complex subunit 1 (Psf1 homolog) |
1090 |
0.37 |
chr1_51740463_51740849 | 1.12 |
Gm28055 |
predicted gene 28055 |
6287 |
0.22 |
chr2_31519719_31520357 | 1.12 |
Ass1 |
argininosuccinate synthetase 1 |
1548 |
0.36 |
chr16_65665507_65665824 | 1.12 |
Gm49633 |
predicted gene, 49633 |
52246 |
0.14 |
chr8_34154737_34155230 | 1.11 |
Saraf |
store-operated calcium entry-associated regulatory factor |
302 |
0.8 |
chr5_125526040_125526191 | 1.10 |
Tmem132b |
transmembrane protein 132B |
5659 |
0.17 |
chr10_95550846_95551019 | 1.10 |
Mir3058 |
microRNA 3058 |
8389 |
0.13 |
chr3_8963133_8963313 | 1.10 |
Tpd52 |
tumor protein D52 |
823 |
0.64 |
chr11_88618341_88618520 | 1.09 |
Msi2 |
musashi RNA-binding protein 2 |
28283 |
0.2 |
chr1_69108268_69108432 | 1.09 |
Erbb4 |
erb-b2 receptor tyrosine kinase 4 |
291 |
0.88 |
chr4_84064984_84065135 | 1.09 |
6030471H07Rik |
RIKEN cDNA 6030471H07 gene |
20180 |
0.21 |
chr5_125121918_125122089 | 1.09 |
Ncor2 |
nuclear receptor co-repressor 2 |
2897 |
0.27 |
chr8_46908148_46908299 | 1.09 |
1700011L03Rik |
RIKEN cDNA 1700011L03 gene |
40576 |
0.13 |
chr6_149149841_149149992 | 1.09 |
Etfbkmt |
electron transfer flavoprotein beta subunit lysine methyltransferase |
8270 |
0.13 |
chr14_21114751_21114902 | 1.08 |
Adk |
adenosine kinase |
38674 |
0.17 |
chr8_61563294_61563445 | 1.08 |
Palld |
palladin, cytoskeletal associated protein |
27770 |
0.22 |
chr12_71909107_71909265 | 1.08 |
Daam1 |
dishevelled associated activator of morphogenesis 1 |
19456 |
0.21 |
chr3_97654801_97654984 | 1.07 |
Prkab2 |
protein kinase, AMP-activated, beta 2 non-catalytic subunit |
3301 |
0.17 |
chr4_15212980_15213172 | 1.07 |
Tmem64 |
transmembrane protein 64 |
52755 |
0.13 |
chr5_92607049_92607221 | 1.07 |
Stbd1 |
starch binding domain 1 |
4067 |
0.19 |
chr6_108836766_108836917 | 1.07 |
Edem1 |
ER degradation enhancer, mannosidase alpha-like 1 |
431 |
0.86 |
chr3_131485378_131485553 | 1.06 |
Sgms2 |
sphingomyelin synthase 2 |
5014 |
0.28 |
chr8_35495669_35495888 | 1.06 |
Eri1 |
exoribonuclease 1 |
245 |
0.93 |
chr17_64607771_64607970 | 1.06 |
Man2a1 |
mannosidase 2, alpha 1 |
7134 |
0.26 |
chr12_75531904_75532183 | 1.05 |
Ppp2r5e |
protein phosphatase 2, regulatory subunit B', epsilon |
17631 |
0.18 |
chr12_104341895_104342090 | 1.05 |
Serpina3k |
serine (or cysteine) peptidase inhibitor, clade A, member 3K |
3506 |
0.14 |
chr16_37874310_37874496 | 1.05 |
Lrrc58 |
leucine rich repeat containing 58 |
6014 |
0.14 |
chr4_124809297_124809476 | 1.04 |
Mtf1 |
metal response element binding transcription factor 1 |
6708 |
0.1 |
chr7_144551116_144551314 | 1.04 |
Ppfia1 |
protein tyrosine phosphatase, receptor type, f polypeptide (PTPRF), interacting protein (liprin), alpha 1 |
1147 |
0.45 |
chr6_52610697_52610915 | 1.04 |
Gm44434 |
predicted gene, 44434 |
7561 |
0.15 |
chr14_60387250_60387782 | 1.04 |
Amer2 |
APC membrane recruitment 2 |
9230 |
0.22 |
chr13_7415051_7415251 | 1.03 |
Gm36074 |
predicted gene, 36074 |
31358 |
0.23 |
chr1_172700535_172700739 | 1.03 |
Crp |
C-reactive protein, pentraxin-related |
2581 |
0.25 |
chr10_20723719_20723889 | 1.02 |
Pde7b |
phosphodiesterase 7B |
892 |
0.65 |
chr5_102009929_102010121 | 1.02 |
Wdfy3 |
WD repeat and FYVE domain containing 3 |
28467 |
0.16 |
chr2_103461502_103462486 | 1.01 |
Elf5 |
E74-like factor 5 |
13256 |
0.17 |
chr13_35463284_35463451 | 1.01 |
Gm48703 |
predicted gene, 48703 |
67984 |
0.1 |
chr4_147433621_147433808 | 1.01 |
Gm13161 |
predicted gene 13161 |
9757 |
0.14 |
chr3_108701624_108701775 | 1.00 |
Gpsm2 |
G-protein signalling modulator 2 (AGS3-like, C. elegans) |
814 |
0.52 |
chr5_123975512_123975863 | 1.00 |
Hip1r |
huntingtin interacting protein 1 related |
2059 |
0.19 |
chr2_172448719_172448909 | 0.99 |
Rtf2 |
replication termination factor 2 |
4163 |
0.15 |
chr15_3463620_3463812 | 0.99 |
Ghr |
growth hormone receptor |
7928 |
0.3 |
chr4_84548919_84549079 | 0.98 |
Bnc2 |
basonuclin 2 |
2380 |
0.42 |
chr10_43441199_43441579 | 0.98 |
Gm3699 |
predicted gene 3699 |
15112 |
0.13 |
chr4_108060521_108060686 | 0.98 |
Scp2 |
sterol carrier protein 2, liver |
10760 |
0.13 |
chr14_46615680_46615835 | 0.97 |
Gm49319 |
predicted gene, 49319 |
4747 |
0.13 |
chr13_16574847_16575001 | 0.97 |
Gm48497 |
predicted gene, 48497 |
41103 |
0.17 |
chr5_125476669_125476949 | 0.97 |
Aacs |
acetoacetyl-CoA synthetase |
995 |
0.4 |
chr7_132953914_132954065 | 0.97 |
Zranb1 |
zinc finger, RAN-binding domain containing 1 |
4405 |
0.17 |
chr5_130009032_130009183 | 0.97 |
Asl |
argininosuccinate lyase |
5615 |
0.12 |
chr10_20347136_20347287 | 0.97 |
Mtfr2 |
mitochondrial fission regulator 2 |
559 |
0.67 |
chr15_6218493_6218848 | 0.97 |
Gm23139 |
predicted gene, 23139 |
67322 |
0.11 |
chr6_71999696_71999905 | 0.96 |
Gm26628 |
predicted gene, 26628 |
36025 |
0.1 |
chr13_37854787_37854958 | 0.96 |
Rreb1 |
ras responsive element binding protein 1 |
3062 |
0.27 |
chr2_134977060_134977253 | 0.95 |
Gm14036 |
predicted gene 14036 |
173207 |
0.03 |
chr2_67977965_67978321 | 0.95 |
Gm37964 |
predicted gene, 37964 |
79547 |
0.1 |
chr7_30967090_30967447 | 0.94 |
Lsr |
lipolysis stimulated lipoprotein receptor |
6054 |
0.07 |
chr2_160865219_160865594 | 0.94 |
Zhx3 |
zinc fingers and homeoboxes 3 |
5775 |
0.14 |
chr9_108729006_108729157 | 0.94 |
Gm24259 |
predicted gene, 24259 |
9777 |
0.1 |
chr9_102724572_102724723 | 0.94 |
Amotl2 |
angiomotin-like 2 |
2113 |
0.21 |
chr6_119380906_119381057 | 0.93 |
Adipor2 |
adiponectin receptor 2 |
7705 |
0.21 |
chr1_67197806_67198015 | 0.93 |
Gm15668 |
predicted gene 15668 |
51290 |
0.13 |
chr14_76901248_76901599 | 0.93 |
Gm48969 |
predicted gene, 48969 |
39852 |
0.15 |
chr12_41068657_41068813 | 0.93 |
Immp2l |
IMP2 inner mitochondrial membrane peptidase-like (S. cerevisiae) |
423 |
0.86 |
chr11_75487441_75487813 | 0.93 |
Prpf8 |
pre-mRNA processing factor 8 |
772 |
0.41 |
chr13_4270161_4270342 | 0.93 |
Akr1c12 |
aldo-keto reductase family 1, member C12 |
9182 |
0.15 |
chr18_51150358_51150691 | 0.93 |
Prr16 |
proline rich 16 |
32786 |
0.23 |
chr9_112123334_112123526 | 0.93 |
Mir128-2 |
microRNA 128-2 |
4719 |
0.29 |
chr2_72309170_72309345 | 0.92 |
Map3k20 |
mitogen-activated protein kinase kinase kinase 20 |
11356 |
0.19 |
chr10_82740996_82741147 | 0.92 |
Nfyb |
nuclear transcription factor-Y beta |
10588 |
0.13 |
chr16_13359323_13359477 | 0.92 |
Mrtfb |
myocardin related transcription factor B |
979 |
0.59 |
chr13_115653330_115653690 | 0.91 |
Gm47892 |
predicted gene, 47892 |
65989 |
0.13 |
chr11_61270260_61270411 | 0.91 |
Aldh3a2 |
aldehyde dehydrogenase family 3, subfamily A2 |
2871 |
0.23 |
chr8_36720734_36721068 | 0.91 |
Dlc1 |
deleted in liver cancer 1 |
12153 |
0.29 |
chr13_51232215_51232383 | 0.91 |
Gm29787 |
predicted gene, 29787 |
26188 |
0.14 |
chr12_108235642_108235812 | 0.91 |
Ccnk |
cyclin K |
36642 |
0.13 |
chr4_47366562_47366857 | 0.90 |
Tgfbr1 |
transforming growth factor, beta receptor I |
13099 |
0.22 |
chr3_83048403_83048757 | 0.90 |
Fgb |
fibrinogen beta chain |
1283 |
0.37 |
chr4_152741969_152742142 | 0.90 |
Gm833 |
predicted gene 833 |
44515 |
0.17 |
chr19_44401904_44402310 | 0.90 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
4583 |
0.17 |
chr17_84997546_84997697 | 0.90 |
Ppm1b |
protein phosphatase 1B, magnesium dependent, beta isoform |
3941 |
0.22 |
chr3_97630832_97631292 | 0.90 |
Fmo5 |
flavin containing monooxygenase 5 |
2179 |
0.23 |
chr5_134177966_134178117 | 0.89 |
Rcc1l |
reculator of chromosome condensation 1 like |
1267 |
0.3 |
chrX_38400123_38400274 | 0.89 |
Gm4853 |
predicted pseudogene 4853 |
3263 |
0.22 |
chr14_21439813_21440115 | 0.89 |
Gm25864 |
predicted gene, 25864 |
10510 |
0.2 |
chr9_50500490_50500842 | 0.89 |
Plet1os |
placenta expressed transcript 1, opposite strand |
4139 |
0.14 |
chr18_39438249_39438499 | 0.89 |
Nr3c1 |
nuclear receptor subfamily 3, group C, member 1 |
48858 |
0.13 |
chr2_19659363_19659514 | 0.89 |
Otud1 |
OTU domain containing 1 |
1686 |
0.26 |
chr4_15023934_15024314 | 0.89 |
Gm11844 |
predicted gene 11844 |
1542 |
0.5 |
chr5_45473645_45473810 | 0.89 |
Lap3 |
leucine aminopeptidase 3 |
19647 |
0.11 |
chr3_138223407_138223558 | 0.89 |
Adh7 |
alcohol dehydrogenase 7 (class IV), mu or sigma polypeptide |
2011 |
0.23 |
chr3_102384557_102384708 | 0.88 |
Gm43245 |
predicted gene 43245 |
5375 |
0.21 |
chr7_132940461_132940655 | 0.88 |
Zranb1 |
zinc finger, RAN-binding domain containing 1 |
7610 |
0.15 |
chr12_82419285_82419473 | 0.88 |
Sipa1l1 |
signal-induced proliferation-associated 1 like 1 |
1236 |
0.58 |
chr4_57160943_57161117 | 0.88 |
Gm12530 |
predicted gene 12530 |
11041 |
0.2 |
chr6_146730929_146731080 | 0.87 |
Stk38l |
serine/threonine kinase 38 like |
5692 |
0.17 |
chr15_31250860_31251157 | 0.87 |
Dap |
death-associated protein |
17328 |
0.15 |
chr9_112785054_112785229 | 0.87 |
Gm24957 |
predicted gene, 24957 |
262612 |
0.02 |
chr1_3605947_3606103 | 0.87 |
Gm38148 |
predicted gene, 38148 |
10122 |
0.19 |
chr16_43168807_43168974 | 0.87 |
Gm15712 |
predicted gene 15712 |
15683 |
0.21 |
chr16_92631807_92631997 | 0.87 |
Gm26626 |
predicted gene, 26626 |
19088 |
0.2 |
chr5_151103258_151103409 | 0.87 |
Stard13 |
StAR-related lipid transfer (START) domain containing 13 |
5402 |
0.28 |
chr12_79436149_79436313 | 0.86 |
Rad51b |
RAD51 paralog B |
108878 |
0.06 |
chr2_163300587_163300782 | 0.86 |
Tox2 |
TOX high mobility group box family member 2 |
19694 |
0.19 |
chr3_105758672_105758857 | 0.86 |
Rap1a |
RAS-related protein 1a |
8436 |
0.11 |
chr7_68285442_68285612 | 0.86 |
Gm16157 |
predicted gene 16157 |
8933 |
0.14 |
chr1_73901414_73901565 | 0.85 |
Tns1 |
tensin 1 |
26728 |
0.15 |
chr12_12940858_12941058 | 0.85 |
Mycn |
v-myc avian myelocytomatosis viral related oncogene, neuroblastoma derived |
342 |
0.83 |
chr11_20635984_20636135 | 0.85 |
Sertad2 |
SERTA domain containing 2 |
4080 |
0.26 |
chr13_44437957_44438156 | 0.85 |
1700029N11Rik |
RIKEN cDNA 1700029N11 gene |
1656 |
0.27 |
chr9_64175252_64175472 | 0.85 |
Snord16a |
small nucleolar RNA, C/D box 16A |
61 |
0.7 |
chr4_123990393_123990580 | 0.84 |
Gm12902 |
predicted gene 12902 |
64252 |
0.08 |
chr4_19713524_19713754 | 0.84 |
Wwp1 |
WW domain containing E3 ubiquitin protein ligase 1 |
4646 |
0.23 |
chr2_122251200_122251358 | 0.84 |
Sord |
sorbitol dehydrogenase |
16530 |
0.1 |
chr2_38823684_38823849 | 0.84 |
Nr6a1os |
nuclear receptor subfamily 6, group A, member 1, opposite strand |
425 |
0.74 |
chr4_154246777_154246931 | 0.84 |
Megf6 |
multiple EGF-like-domains 6 |
2442 |
0.24 |
chr11_107462959_107463110 | 0.84 |
Pitpnc1 |
phosphatidylinositol transfer protein, cytoplasmic 1 |
7665 |
0.13 |
chr18_68260570_68260761 | 0.84 |
Mir7219 |
microRNA 7219 |
308 |
0.89 |
chr9_89220596_89220823 | 0.83 |
Mthfs |
5, 10-methenyltetrahydrofolate synthetase |
2255 |
0.23 |
chr9_48741770_48741973 | 0.83 |
Zbtb16 |
zinc finger and BTB domain containing 16 |
94074 |
0.07 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.7 | 2.2 | GO:0010046 | response to mycotoxin(GO:0010046) |
0.4 | 1.7 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
0.4 | 1.6 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.4 | 1.1 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.3 | 1.0 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
0.3 | 1.3 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
0.3 | 0.9 | GO:0060523 | prostate epithelial cord elongation(GO:0060523) |
0.3 | 0.9 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
0.3 | 0.8 | GO:0046271 | phenylpropanoid catabolic process(GO:0046271) |
0.3 | 1.0 | GO:0072338 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
0.2 | 0.7 | GO:1904017 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
0.2 | 1.2 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
0.2 | 0.9 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
0.2 | 0.6 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
0.2 | 0.6 | GO:0070340 | detection of bacterial lipopeptide(GO:0070340) |
0.2 | 0.6 | GO:1900019 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
0.2 | 0.7 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
0.2 | 0.7 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
0.2 | 1.0 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
0.2 | 0.5 | GO:2000828 | regulation of parathyroid hormone secretion(GO:2000828) |
0.2 | 0.8 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
0.2 | 0.5 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
0.2 | 0.2 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
0.2 | 0.5 | GO:0001997 | positive regulation of the force of heart contraction by epinephrine-norepinephrine(GO:0001997) positive regulation of the force of heart contraction by chemical signal(GO:0003099) |
0.2 | 0.3 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
0.2 | 0.3 | GO:2000729 | positive regulation of mesenchymal cell proliferation involved in ureter development(GO:2000729) |
0.2 | 0.5 | GO:1901740 | negative regulation of myoblast fusion(GO:1901740) |
0.2 | 1.2 | GO:0000467 | exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) |
0.2 | 0.5 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
0.1 | 1.2 | GO:0052697 | xenobiotic glucuronidation(GO:0052697) |
0.1 | 1.2 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
0.1 | 0.6 | GO:0061724 | lipophagy(GO:0061724) |
0.1 | 0.4 | GO:0006068 | ethanol catabolic process(GO:0006068) |
0.1 | 0.4 | GO:0060789 | hair follicle placode formation(GO:0060789) |
0.1 | 0.4 | GO:0032383 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
0.1 | 0.1 | GO:0006714 | sesquiterpenoid metabolic process(GO:0006714) |
0.1 | 0.4 | GO:0070103 | regulation of interleukin-6-mediated signaling pathway(GO:0070103) |
0.1 | 0.4 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
0.1 | 0.3 | GO:0021564 | vagus nerve development(GO:0021564) |
0.1 | 0.4 | GO:0034310 | primary alcohol catabolic process(GO:0034310) |
0.1 | 0.3 | GO:2000809 | positive regulation of synaptic vesicle clustering(GO:2000809) |
0.1 | 0.5 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
0.1 | 0.5 | GO:0046618 | drug export(GO:0046618) |
0.1 | 0.4 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
0.1 | 0.1 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
0.1 | 0.4 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
0.1 | 0.4 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
0.1 | 0.5 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
0.1 | 0.4 | GO:0036016 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
0.1 | 0.4 | GO:0061366 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
0.1 | 0.7 | GO:0042737 | drug catabolic process(GO:0042737) |
0.1 | 0.4 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
0.1 | 0.4 | GO:0002282 | microglial cell activation involved in immune response(GO:0002282) |
0.1 | 0.1 | GO:0046083 | adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
0.1 | 0.1 | GO:0032741 | positive regulation of interleukin-18 production(GO:0032741) |
0.1 | 0.9 | GO:0007262 | STAT protein import into nucleus(GO:0007262) |
0.1 | 2.1 | GO:0043586 | tongue development(GO:0043586) |
0.1 | 0.2 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
0.1 | 0.4 | GO:0000960 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
0.1 | 0.6 | GO:0044829 | positive regulation by host of viral genome replication(GO:0044829) |
0.1 | 0.4 | GO:0010760 | negative regulation of macrophage chemotaxis(GO:0010760) |
0.1 | 0.6 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
0.1 | 0.9 | GO:2000980 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
0.1 | 0.7 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.1 | 0.6 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
0.1 | 0.3 | GO:0006562 | proline catabolic process(GO:0006562) |
0.1 | 1.0 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.1 | 0.2 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
0.1 | 0.3 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
0.1 | 0.4 | GO:1902969 | mitotic DNA replication(GO:1902969) |
0.1 | 0.5 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
0.1 | 0.3 | GO:0000430 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) |
0.1 | 0.4 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
0.1 | 0.2 | GO:0003340 | negative regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0003340) |
0.1 | 0.6 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
0.1 | 0.2 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
0.1 | 0.3 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
0.1 | 0.4 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
0.1 | 0.3 | GO:0035973 | aggrephagy(GO:0035973) |
0.1 | 0.4 | GO:0030638 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.1 | 0.3 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
0.1 | 0.4 | GO:0060164 | regulation of timing of neuron differentiation(GO:0060164) |
0.1 | 0.3 | GO:0043201 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
0.1 | 0.5 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
0.1 | 0.4 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
0.1 | 0.3 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.1 | 0.3 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.1 | 0.3 | GO:0090168 | Golgi reassembly(GO:0090168) |
0.1 | 0.2 | GO:0070672 | response to interleukin-15(GO:0070672) |
0.1 | 0.3 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.1 | 0.2 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.1 | 0.1 | GO:0003160 | endocardium morphogenesis(GO:0003160) |
0.1 | 0.3 | GO:0090315 | negative regulation of protein targeting to membrane(GO:0090315) |
0.1 | 0.2 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.1 | 0.3 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
0.1 | 0.3 | GO:0034080 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
0.1 | 0.3 | GO:1903798 | regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903798) |
0.1 | 0.2 | GO:0003331 | regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
0.1 | 0.2 | GO:2000562 | negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
0.1 | 0.3 | GO:1903347 | negative regulation of bicellular tight junction assembly(GO:1903347) |
0.1 | 0.2 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.1 | 0.3 | GO:0021960 | anterior commissure morphogenesis(GO:0021960) |
0.1 | 0.2 | GO:0031086 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.1 | 0.2 | GO:0061419 | positive regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061419) |
0.1 | 0.3 | GO:0006573 | valine metabolic process(GO:0006573) |
0.1 | 0.2 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
0.1 | 0.4 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
0.1 | 0.5 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
0.1 | 0.6 | GO:0006013 | mannose metabolic process(GO:0006013) |
0.1 | 0.5 | GO:0044650 | virion attachment to host cell(GO:0019062) adhesion of symbiont to host cell(GO:0044650) |
0.1 | 0.2 | GO:0006768 | biotin metabolic process(GO:0006768) |
0.1 | 0.3 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
0.1 | 0.7 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
0.1 | 0.1 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
0.1 | 0.4 | GO:0009249 | protein lipoylation(GO:0009249) |
0.1 | 0.1 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
0.1 | 0.1 | GO:0046104 | thymidine metabolic process(GO:0046104) |
0.1 | 0.1 | GO:1902047 | polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) |
0.1 | 0.4 | GO:0015871 | choline transport(GO:0015871) |
0.1 | 0.1 | GO:0071866 | apoptotic process in bone marrow(GO:0071839) regulation of apoptotic process in bone marrow(GO:0071865) negative regulation of apoptotic process in bone marrow(GO:0071866) |
0.1 | 0.2 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
0.1 | 0.4 | GO:0006642 | triglyceride mobilization(GO:0006642) |
0.1 | 0.1 | GO:2000561 | regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000561) |
0.1 | 0.3 | GO:0019530 | taurine metabolic process(GO:0019530) |
0.1 | 0.1 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
0.1 | 0.3 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
0.1 | 0.2 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
0.1 | 0.2 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
0.1 | 0.3 | GO:2000370 | positive regulation of clathrin-mediated endocytosis(GO:2000370) |
0.1 | 0.3 | GO:0019230 | proprioception(GO:0019230) |
0.1 | 0.2 | GO:0071335 | hair follicle cell proliferation(GO:0071335) |
0.1 | 0.3 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
0.1 | 0.3 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
0.1 | 0.4 | GO:0006559 | L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
0.1 | 0.2 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
0.1 | 0.2 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
0.1 | 0.2 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
0.1 | 0.4 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
0.1 | 0.2 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
0.1 | 0.2 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.1 | 0.4 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
0.1 | 0.2 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
0.1 | 0.1 | GO:0060839 | endothelial cell fate commitment(GO:0060839) |
0.1 | 0.1 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
0.1 | 0.2 | GO:0007354 | zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
0.1 | 0.1 | GO:0048696 | regulation of collateral sprouting in absence of injury(GO:0048696) |
0.1 | 0.2 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
0.1 | 0.2 | GO:1902023 | L-arginine import(GO:0043091) arginine import(GO:0090467) L-arginine transport(GO:1902023) |
0.1 | 0.3 | GO:0051138 | regulation of NK T cell differentiation(GO:0051136) positive regulation of NK T cell differentiation(GO:0051138) |
0.1 | 0.8 | GO:0003334 | keratinocyte development(GO:0003334) |
0.1 | 0.4 | GO:0061072 | iris morphogenesis(GO:0061072) |
0.1 | 0.2 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
0.1 | 0.4 | GO:0006000 | fructose metabolic process(GO:0006000) |
0.1 | 0.5 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
0.1 | 0.1 | GO:0051025 | negative regulation of immunoglobulin secretion(GO:0051025) |
0.1 | 0.5 | GO:0090051 | negative regulation of cell migration involved in sprouting angiogenesis(GO:0090051) |
0.1 | 0.2 | GO:0034627 | 'de novo' NAD biosynthetic process(GO:0034627) |
0.1 | 0.2 | GO:0042695 | thelarche(GO:0042695) mammary gland branching involved in thelarche(GO:0060744) |
0.1 | 0.3 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
0.1 | 0.2 | GO:0015770 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.1 | 0.2 | GO:0032079 | positive regulation of endodeoxyribonuclease activity(GO:0032079) |
0.1 | 0.2 | GO:0001712 | ectodermal cell fate commitment(GO:0001712) |
0.1 | 0.1 | GO:1904469 | positive regulation of tumor necrosis factor secretion(GO:1904469) |
0.1 | 0.2 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
0.1 | 0.1 | GO:0007529 | establishment of synaptic specificity at neuromuscular junction(GO:0007529) |
0.1 | 0.2 | GO:0070427 | nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070427) |
0.1 | 0.2 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
0.1 | 0.2 | GO:0051204 | protein insertion into mitochondrial membrane(GO:0051204) |
0.1 | 0.2 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
0.1 | 0.3 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
0.1 | 0.2 | GO:1903232 | melanosome assembly(GO:1903232) |
0.1 | 0.4 | GO:0090308 | regulation of methylation-dependent chromatin silencing(GO:0090308) |
0.1 | 0.2 | GO:1901725 | regulation of histone deacetylase activity(GO:1901725) |
0.1 | 0.2 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
0.1 | 0.2 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
0.1 | 0.3 | GO:0052205 | modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) |
0.1 | 0.2 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
0.1 | 0.4 | GO:0016127 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
0.1 | 0.3 | GO:0060017 | parathyroid gland development(GO:0060017) |
0.1 | 0.1 | GO:0061043 | regulation of vascular wound healing(GO:0061043) |
0.1 | 0.6 | GO:0006743 | ubiquinone metabolic process(GO:0006743) |
0.1 | 0.1 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
0.1 | 0.2 | GO:0035754 | B cell chemotaxis(GO:0035754) |
0.1 | 0.9 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
0.1 | 0.3 | GO:0042759 | long-chain fatty acid biosynthetic process(GO:0042759) |
0.1 | 0.4 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
0.1 | 0.1 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
0.1 | 0.2 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.1 | 0.3 | GO:0048341 | paraxial mesoderm formation(GO:0048341) |
0.1 | 0.2 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) |
0.1 | 0.6 | GO:0009812 | flavonoid metabolic process(GO:0009812) |
0.1 | 0.2 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
0.1 | 0.4 | GO:0043651 | linoleic acid metabolic process(GO:0043651) |
0.1 | 0.6 | GO:0090005 | negative regulation of establishment of protein localization to plasma membrane(GO:0090005) |
0.1 | 1.1 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
0.1 | 0.7 | GO:0019184 | nonribosomal peptide biosynthetic process(GO:0019184) |
0.1 | 0.1 | GO:0042362 | fat-soluble vitamin biosynthetic process(GO:0042362) |
0.1 | 0.2 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.1 | 0.2 | GO:0045950 | negative regulation of mitotic recombination(GO:0045950) |
0.0 | 0.1 | GO:0009826 | unidimensional cell growth(GO:0009826) |
0.0 | 0.3 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
0.0 | 0.3 | GO:0036089 | cleavage furrow formation(GO:0036089) |
0.0 | 0.1 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
0.0 | 0.2 | GO:0035188 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
0.0 | 0.1 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
0.0 | 0.2 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.0 | 0.1 | GO:0061511 | centriole elongation(GO:0061511) |
0.0 | 0.1 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
0.0 | 0.6 | GO:0045116 | protein neddylation(GO:0045116) |
0.0 | 0.2 | GO:0048478 | replication fork protection(GO:0048478) |
0.0 | 0.1 | GO:0034197 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
0.0 | 0.1 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
0.0 | 0.4 | GO:0035999 | tetrahydrofolate interconversion(GO:0035999) |
0.0 | 0.2 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
0.0 | 1.6 | GO:0043550 | regulation of lipid kinase activity(GO:0043550) |
0.0 | 1.1 | GO:0006376 | mRNA splice site selection(GO:0006376) |
0.0 | 0.0 | GO:0060336 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
0.0 | 0.2 | GO:2000074 | regulation of type B pancreatic cell development(GO:2000074) |
0.0 | 0.1 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
0.0 | 0.1 | GO:0060685 | regulation of prostatic bud formation(GO:0060685) |
0.0 | 0.1 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
0.0 | 0.1 | GO:0032058 | positive regulation of translational initiation in response to stress(GO:0032058) |
0.0 | 0.5 | GO:0009143 | nucleoside triphosphate catabolic process(GO:0009143) |
0.0 | 0.2 | GO:1903689 | regulation of wound healing, spreading of epidermal cells(GO:1903689) |
0.0 | 0.2 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) |
0.0 | 0.1 | GO:0034756 | regulation of iron ion transport(GO:0034756) |
0.0 | 0.1 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.0 | 1.2 | GO:0000266 | mitochondrial fission(GO:0000266) |
0.0 | 0.5 | GO:0043486 | histone exchange(GO:0043486) |
0.0 | 0.3 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
0.0 | 0.1 | GO:0036022 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) |
0.0 | 0.3 | GO:1901339 | regulation of store-operated calcium channel activity(GO:1901339) |
0.0 | 0.2 | GO:0090110 | cargo loading into COPII-coated vesicle(GO:0090110) |
0.0 | 0.1 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.0 | 0.4 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
0.0 | 0.0 | GO:0090170 | trachea formation(GO:0060440) regulation of Golgi inheritance(GO:0090170) |
0.0 | 0.1 | GO:1902608 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
0.0 | 0.7 | GO:0042026 | protein refolding(GO:0042026) |
0.0 | 0.4 | GO:2000353 | positive regulation of endothelial cell apoptotic process(GO:2000353) |
0.0 | 0.3 | GO:1900264 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.0 | 0.0 | GO:0072309 | mesenchymal stem cell maintenance involved in metanephric nephron morphogenesis(GO:0072309) |
0.0 | 0.2 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
0.0 | 0.2 | GO:1904751 | regulation of protein localization to nucleolus(GO:1904749) positive regulation of protein localization to nucleolus(GO:1904751) |
0.0 | 0.3 | GO:0046628 | positive regulation of insulin receptor signaling pathway(GO:0046628) |
0.0 | 0.2 | GO:0033015 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) |
0.0 | 0.0 | GO:1903969 | regulation of macrophage colony-stimulating factor signaling pathway(GO:1902226) regulation of response to macrophage colony-stimulating factor(GO:1903969) regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903972) |
0.0 | 0.2 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
0.0 | 0.3 | GO:0017144 | drug metabolic process(GO:0017144) |
0.0 | 0.1 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
0.0 | 0.1 | GO:1904528 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
0.0 | 0.1 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
0.0 | 0.2 | GO:0018243 | protein O-linked glycosylation via threonine(GO:0018243) |
0.0 | 0.5 | GO:0045898 | regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045898) |
0.0 | 0.7 | GO:0015986 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
0.0 | 0.1 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
0.0 | 0.4 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
0.0 | 0.1 | GO:0071221 | response to bacterial lipopeptide(GO:0070339) cellular response to bacterial lipoprotein(GO:0071220) cellular response to bacterial lipopeptide(GO:0071221) |
0.0 | 0.1 | GO:0072592 | oxygen metabolic process(GO:0072592) |
0.0 | 0.2 | GO:0006563 | L-serine metabolic process(GO:0006563) |
0.0 | 0.2 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
0.0 | 0.3 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
0.0 | 0.2 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
0.0 | 0.2 | GO:0010519 | negative regulation of phospholipase activity(GO:0010519) |
0.0 | 0.2 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) |
0.0 | 0.2 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
0.0 | 0.0 | GO:0060154 | cellular process regulating host cell cycle in response to virus(GO:0060154) |
0.0 | 0.2 | GO:0015867 | ATP transport(GO:0015867) |
0.0 | 0.2 | GO:0002072 | optic cup morphogenesis involved in camera-type eye development(GO:0002072) |
0.0 | 0.7 | GO:0016578 | histone deubiquitination(GO:0016578) |
0.0 | 0.1 | GO:0007567 | parturition(GO:0007567) |
0.0 | 0.1 | GO:0070627 | ferrous iron import(GO:0070627) |
0.0 | 0.1 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
0.0 | 0.1 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
0.0 | 0.1 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
0.0 | 0.1 | GO:1902473 | regulation of protein localization to synapse(GO:1902473) |
0.0 | 0.0 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
0.0 | 0.3 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.0 | 0.0 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
0.0 | 0.2 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
0.0 | 0.0 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
0.0 | 0.0 | GO:0032077 | positive regulation of deoxyribonuclease activity(GO:0032077) |
0.0 | 0.1 | GO:0090188 | negative regulation of pancreatic juice secretion(GO:0090188) |
0.0 | 0.1 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
0.0 | 0.1 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
0.0 | 0.1 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
0.0 | 0.2 | GO:0060272 | embryonic skeletal joint morphogenesis(GO:0060272) |
0.0 | 0.1 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
0.0 | 0.2 | GO:0051639 | actin filament network formation(GO:0051639) |
0.0 | 0.2 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
0.0 | 0.1 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
0.0 | 0.1 | GO:0032471 | negative regulation of endoplasmic reticulum calcium ion concentration(GO:0032471) |
0.0 | 0.1 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
0.0 | 0.0 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
0.0 | 0.1 | GO:0019086 | late viral transcription(GO:0019086) |
0.0 | 0.1 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
0.0 | 0.1 | GO:1902101 | positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
0.0 | 0.0 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
0.0 | 0.1 | GO:0032261 | purine nucleotide salvage(GO:0032261) IMP salvage(GO:0032264) |
0.0 | 0.1 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
0.0 | 0.3 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
0.0 | 0.0 | GO:0072553 | terminal button organization(GO:0072553) |
0.0 | 0.1 | GO:2000002 | negative regulation of DNA damage checkpoint(GO:2000002) |
0.0 | 0.2 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
0.0 | 0.2 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
0.0 | 0.4 | GO:0008210 | estrogen metabolic process(GO:0008210) |
0.0 | 0.0 | GO:0044793 | negative regulation by host of viral process(GO:0044793) |
0.0 | 0.3 | GO:0006670 | sphingosine metabolic process(GO:0006670) |
0.0 | 0.3 | GO:1904152 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) regulation of retrograde protein transport, ER to cytosol(GO:1904152) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
0.0 | 0.1 | GO:0060956 | endocardial cell differentiation(GO:0060956) |
0.0 | 0.1 | GO:1900060 | negative regulation of ceramide biosynthetic process(GO:1900060) |
0.0 | 0.0 | GO:0010796 | regulation of multivesicular body size(GO:0010796) |
0.0 | 0.0 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
0.0 | 0.1 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
0.0 | 0.2 | GO:0072488 | ammonium transmembrane transport(GO:0072488) |
0.0 | 0.1 | GO:0018343 | protein farnesylation(GO:0018343) |
0.0 | 0.4 | GO:0045475 | locomotor rhythm(GO:0045475) |
0.0 | 0.0 | GO:0010825 | positive regulation of centrosome duplication(GO:0010825) |
0.0 | 0.1 | GO:0071494 | cellular response to UV-C(GO:0071494) |
0.0 | 0.1 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.0 | 0.2 | GO:0043144 | snoRNA processing(GO:0043144) |
0.0 | 0.1 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
0.0 | 0.1 | GO:0036394 | amylase secretion(GO:0036394) |
0.0 | 0.1 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
0.0 | 0.3 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.0 | 0.1 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
0.0 | 0.4 | GO:0010800 | positive regulation of peptidyl-threonine phosphorylation(GO:0010800) |
0.0 | 0.2 | GO:0060896 | neural plate pattern specification(GO:0060896) |
0.0 | 0.1 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
0.0 | 0.1 | GO:0044838 | cell quiescence(GO:0044838) |
0.0 | 0.0 | GO:0003241 | growth involved in heart morphogenesis(GO:0003241) |
0.0 | 0.0 | GO:0086023 | adrenergic receptor signaling pathway involved in heart process(GO:0086023) |
0.0 | 0.0 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
0.0 | 0.1 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
0.0 | 0.1 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
0.0 | 0.5 | GO:0060285 | cilium or flagellum-dependent cell motility(GO:0001539) cilium-dependent cell motility(GO:0060285) |
0.0 | 0.4 | GO:0006878 | cellular copper ion homeostasis(GO:0006878) |
0.0 | 0.1 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
0.0 | 0.1 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
0.0 | 0.2 | GO:0001842 | neural fold formation(GO:0001842) |
0.0 | 0.2 | GO:0031017 | exocrine pancreas development(GO:0031017) |
0.0 | 0.0 | GO:1901896 | positive regulation of calcium-transporting ATPase activity(GO:1901896) |
0.0 | 0.1 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
0.0 | 0.2 | GO:0043923 | positive regulation by host of viral transcription(GO:0043923) |
0.0 | 0.1 | GO:0042518 | negative regulation of tyrosine phosphorylation of Stat3 protein(GO:0042518) |
0.0 | 0.1 | GO:0051547 | regulation of keratinocyte migration(GO:0051547) positive regulation of keratinocyte migration(GO:0051549) |
0.0 | 0.1 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
0.0 | 0.1 | GO:2000973 | regulation of pro-B cell differentiation(GO:2000973) |
0.0 | 0.0 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
0.0 | 0.1 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
0.0 | 0.1 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
0.0 | 0.1 | GO:1904970 | brush border assembly(GO:1904970) |
0.0 | 0.0 | GO:0006532 | aspartate biosynthetic process(GO:0006532) |
0.0 | 0.1 | GO:0023041 | neuronal signal transduction(GO:0023041) |
0.0 | 0.6 | GO:0006270 | DNA replication initiation(GO:0006270) |
0.0 | 0.1 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.0 | 0.0 | GO:1901662 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
0.0 | 0.1 | GO:0061727 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
0.0 | 0.2 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.0 | 0.0 | GO:0006208 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
0.0 | 0.1 | GO:0044314 | protein K27-linked ubiquitination(GO:0044314) |
0.0 | 0.0 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
0.0 | 0.0 | GO:0051775 | response to redox state(GO:0051775) |
0.0 | 0.1 | GO:0072102 | glomerulus morphogenesis(GO:0072102) |
0.0 | 0.1 | GO:0034227 | tRNA thio-modification(GO:0034227) |
0.0 | 0.1 | GO:0097167 | circadian regulation of translation(GO:0097167) |
0.0 | 0.1 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
0.0 | 0.1 | GO:0033762 | response to glucagon(GO:0033762) |
0.0 | 0.1 | GO:0055059 | asymmetric neuroblast division(GO:0055059) |
0.0 | 0.1 | GO:0051182 | coenzyme transport(GO:0051182) |
0.0 | 0.1 | GO:0050667 | homocysteine metabolic process(GO:0050667) |
0.0 | 0.0 | GO:0019344 | cysteine biosynthetic process(GO:0019344) |
0.0 | 0.3 | GO:0042574 | retinal metabolic process(GO:0042574) |
0.0 | 0.1 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.0 | 0.2 | GO:0002176 | male germ cell proliferation(GO:0002176) |
0.0 | 0.2 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
0.0 | 0.1 | GO:0060468 | prevention of polyspermy(GO:0060468) |
0.0 | 0.1 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.0 | 0.1 | GO:0009188 | ribonucleoside diphosphate biosynthetic process(GO:0009188) |
0.0 | 0.3 | GO:0046033 | AMP metabolic process(GO:0046033) |
0.0 | 0.2 | GO:0032957 | inositol trisphosphate metabolic process(GO:0032957) |
0.0 | 0.1 | GO:0051890 | regulation of cardioblast differentiation(GO:0051890) |
0.0 | 0.1 | GO:0015780 | nucleotide-sugar transport(GO:0015780) pyrimidine nucleotide-sugar transport(GO:0015781) |
0.0 | 0.1 | GO:1902414 | protein localization to cell junction(GO:1902414) |
0.0 | 0.1 | GO:0008355 | olfactory learning(GO:0008355) |
0.0 | 0.1 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
0.0 | 0.1 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
0.0 | 0.1 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
0.0 | 0.1 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.0 | 0.1 | GO:0000103 | sulfate assimilation(GO:0000103) |
0.0 | 0.1 | GO:0090214 | spongiotrophoblast layer developmental growth(GO:0090214) |
0.0 | 0.2 | GO:0014883 | transition between fast and slow fiber(GO:0014883) |
0.0 | 0.1 | GO:0045852 | pH elevation(GO:0045852) intracellular pH elevation(GO:0051454) |
0.0 | 0.0 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
0.0 | 0.0 | GO:0006570 | tyrosine metabolic process(GO:0006570) |
0.0 | 0.5 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
0.0 | 0.0 | GO:1902990 | mitotic telomere maintenance via semi-conservative replication(GO:1902990) |
0.0 | 0.1 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.0 | 0.1 | GO:0060283 | negative regulation of oocyte development(GO:0060283) |
0.0 | 0.2 | GO:0006555 | methionine metabolic process(GO:0006555) |
0.0 | 0.0 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
0.0 | 0.0 | GO:0003130 | BMP signaling pathway involved in heart induction(GO:0003130) endodermal-mesodermal cell signaling(GO:0003133) endodermal-mesodermal cell signaling involved in heart induction(GO:0003134) |
0.0 | 0.0 | GO:1900157 | regulation of bone mineralization involved in bone maturation(GO:1900157) |
0.0 | 0.1 | GO:0021780 | oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
0.0 | 0.1 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) |
0.0 | 0.1 | GO:0042219 | cellular modified amino acid catabolic process(GO:0042219) |
0.0 | 0.2 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
0.0 | 1.2 | GO:0045454 | cell redox homeostasis(GO:0045454) |
0.0 | 0.0 | GO:0002309 | T cell proliferation involved in immune response(GO:0002309) |
0.0 | 0.1 | GO:0070589 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) |
0.0 | 0.3 | GO:0048026 | positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
0.0 | 0.4 | GO:0071466 | cellular response to xenobiotic stimulus(GO:0071466) |
0.0 | 0.2 | GO:0050872 | white fat cell differentiation(GO:0050872) |
0.0 | 0.0 | GO:2001170 | negative regulation of ATP biosynthetic process(GO:2001170) |
0.0 | 0.0 | GO:0048936 | peripheral nervous system neuron axonogenesis(GO:0048936) |
0.0 | 0.1 | GO:1902774 | late endosome to lysosome transport(GO:1902774) |
0.0 | 0.1 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
0.0 | 0.1 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
0.0 | 0.1 | GO:0006477 | protein sulfation(GO:0006477) |
0.0 | 0.0 | GO:2000646 | positive regulation of receptor catabolic process(GO:2000646) |
0.0 | 0.1 | GO:0007296 | vitellogenesis(GO:0007296) |
0.0 | 0.1 | GO:0071680 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
0.0 | 0.1 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
0.0 | 0.5 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
0.0 | 0.1 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
0.0 | 0.0 | GO:0070391 | response to lipoteichoic acid(GO:0070391) cellular response to lipoteichoic acid(GO:0071223) |
0.0 | 0.1 | GO:0045416 | positive regulation of interleukin-8 biosynthetic process(GO:0045416) |
0.0 | 0.1 | GO:0035995 | detection of muscle stretch(GO:0035995) |
0.0 | 0.0 | GO:0060279 | positive regulation of ovulation(GO:0060279) |
0.0 | 0.1 | GO:0048563 | post-embryonic organ morphogenesis(GO:0048563) |
0.0 | 0.1 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
0.0 | 0.1 | GO:0061110 | dense core granule biogenesis(GO:0061110) |
0.0 | 0.0 | GO:0006069 | ethanol metabolic process(GO:0006067) ethanol oxidation(GO:0006069) |
0.0 | 0.0 | GO:0046607 | positive regulation of centrosome cycle(GO:0046607) |
0.0 | 0.1 | GO:2000653 | regulation of genetic imprinting(GO:2000653) |
0.0 | 0.1 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.0 | 0.0 | GO:1903797 | positive regulation of inorganic anion transmembrane transport(GO:1903797) |
0.0 | 0.0 | GO:0010749 | regulation of nitric oxide mediated signal transduction(GO:0010749) |
0.0 | 0.1 | GO:0046959 | habituation(GO:0046959) |
0.0 | 0.0 | GO:2000303 | regulation of ceramide biosynthetic process(GO:2000303) |
0.0 | 0.0 | GO:0051503 | adenine nucleotide transport(GO:0051503) |
0.0 | 0.0 | GO:0009445 | putrescine metabolic process(GO:0009445) |
0.0 | 0.0 | GO:0060509 | Type I pneumocyte differentiation(GO:0060509) |
0.0 | 0.1 | GO:1990592 | protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
0.0 | 0.0 | GO:0014732 | skeletal muscle atrophy(GO:0014732) |
0.0 | 0.2 | GO:0035413 | positive regulation of catenin import into nucleus(GO:0035413) |
0.0 | 0.0 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
0.0 | 0.0 | GO:1903011 | negative regulation of bone development(GO:1903011) |
0.0 | 0.0 | GO:0071883 | activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) |
0.0 | 0.2 | GO:2000400 | positive regulation of T cell differentiation in thymus(GO:0033089) positive regulation of thymocyte aggregation(GO:2000400) |
0.0 | 0.1 | GO:0055119 | relaxation of cardiac muscle(GO:0055119) |
0.0 | 0.0 | GO:0070947 | neutrophil mediated killing of fungus(GO:0070947) |
0.0 | 0.2 | GO:0060914 | heart formation(GO:0060914) |
0.0 | 0.0 | GO:0009155 | purine deoxyribonucleotide catabolic process(GO:0009155) |
0.0 | 0.1 | GO:0043578 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
0.0 | 0.2 | GO:0006266 | DNA ligation(GO:0006266) |
0.0 | 0.0 | GO:1903371 | positive regulation of protein lipidation(GO:1903061) regulation of endoplasmic reticulum tubular network organization(GO:1903371) |
0.0 | 0.1 | GO:0032532 | regulation of microvillus length(GO:0032532) |
0.0 | 0.1 | GO:0042359 | vitamin D metabolic process(GO:0042359) |
0.0 | 0.1 | GO:0006921 | cellular component disassembly involved in execution phase of apoptosis(GO:0006921) apoptotic nuclear changes(GO:0030262) |
0.0 | 0.0 | GO:0002725 | negative regulation of T cell cytokine production(GO:0002725) |
0.0 | 0.0 | GO:0061010 | gall bladder development(GO:0061010) |
0.0 | 0.1 | GO:0006106 | fumarate metabolic process(GO:0006106) |
0.0 | 0.0 | GO:2001184 | positive regulation of interleukin-12 secretion(GO:2001184) |
0.0 | 0.1 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
0.0 | 0.2 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
0.0 | 0.1 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
0.0 | 0.1 | GO:0018406 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
0.0 | 0.0 | GO:1901492 | positive regulation of lymphangiogenesis(GO:1901492) |
0.0 | 0.0 | GO:2000409 | positive regulation of T cell extravasation(GO:2000409) |
0.0 | 0.1 | GO:0045986 | negative regulation of smooth muscle contraction(GO:0045986) |
0.0 | 0.1 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
0.0 | 0.0 | GO:0048318 | axial mesoderm development(GO:0048318) |
0.0 | 0.0 | GO:1900368 | regulation of RNA interference(GO:1900368) |
0.0 | 0.1 | GO:0060044 | negative regulation of cardiac muscle cell proliferation(GO:0060044) |
0.0 | 0.1 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
0.0 | 0.1 | GO:0045897 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
0.0 | 0.2 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
0.0 | 0.6 | GO:0048013 | ephrin receptor signaling pathway(GO:0048013) |
0.0 | 0.0 | GO:0006290 | pyrimidine dimer repair(GO:0006290) |
0.0 | 0.2 | GO:1990001 | inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
0.0 | 0.0 | GO:1901977 | negative regulation of cell cycle checkpoint(GO:1901977) |
0.0 | 0.1 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
0.0 | 0.0 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
0.0 | 0.0 | GO:1903999 | negative regulation of eating behavior(GO:1903999) |
0.0 | 0.1 | GO:0030432 | peristalsis(GO:0030432) |
0.0 | 0.1 | GO:0046686 | response to cadmium ion(GO:0046686) |
0.0 | 0.2 | GO:0072599 | establishment of protein localization to endoplasmic reticulum(GO:0072599) |
0.0 | 0.1 | GO:0007000 | nucleolus organization(GO:0007000) |
0.0 | 0.0 | GO:0035372 | protein localization to microtubule(GO:0035372) |
0.0 | 0.0 | GO:1903059 | regulation of protein lipidation(GO:1903059) |
0.0 | 0.1 | GO:1902177 | positive regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902177) |
0.0 | 0.0 | GO:0070782 | phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
0.0 | 0.1 | GO:1900864 | mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
0.0 | 0.0 | GO:0003150 | muscular septum morphogenesis(GO:0003150) |
0.0 | 0.1 | GO:0071732 | cellular response to nitric oxide(GO:0071732) |
0.0 | 0.0 | GO:0072530 | purine nucleoside transmembrane transport(GO:0015860) purine-containing compound transmembrane transport(GO:0072530) nucleoside transmembrane transport(GO:1901642) |
0.0 | 0.2 | GO:0032060 | bleb assembly(GO:0032060) |
0.0 | 0.1 | GO:0038171 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
0.0 | 0.1 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
0.0 | 0.0 | GO:0034436 | glycoprotein transport(GO:0034436) |
0.0 | 0.2 | GO:0043496 | regulation of protein homodimerization activity(GO:0043496) |
0.0 | 0.1 | GO:0006655 | phosphatidylglycerol biosynthetic process(GO:0006655) |
0.0 | 0.2 | GO:0015813 | L-glutamate transport(GO:0015813) |
0.0 | 0.1 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.0 | 0.2 | GO:0021514 | ventral spinal cord interneuron differentiation(GO:0021514) |
0.0 | 0.0 | GO:2001269 | positive regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001269) |
0.0 | 0.1 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
0.0 | 0.2 | GO:0006825 | copper ion transport(GO:0006825) |
0.0 | 0.7 | GO:0043484 | regulation of RNA splicing(GO:0043484) |
0.0 | 0.0 | GO:0072092 | ureteric bud invasion(GO:0072092) |
0.0 | 0.0 | GO:0046005 | positive regulation of circadian sleep/wake cycle, REM sleep(GO:0046005) |
0.0 | 0.1 | GO:0014022 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
0.0 | 0.1 | GO:0043174 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) nucleoside salvage(GO:0043174) |
0.0 | 0.1 | GO:1900165 | negative regulation of interleukin-6 secretion(GO:1900165) |
0.0 | 0.3 | GO:0045070 | positive regulation of viral genome replication(GO:0045070) |
0.0 | 0.1 | GO:0050955 | thermoception(GO:0050955) |
0.0 | 0.0 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
0.0 | 0.2 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
0.0 | 0.0 | GO:0036498 | IRE1-mediated unfolded protein response(GO:0036498) regulation of IRE1-mediated unfolded protein response(GO:1903894) |
0.0 | 0.0 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
0.0 | 0.2 | GO:0070670 | response to interleukin-4(GO:0070670) |
0.0 | 0.1 | GO:0035865 | response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
0.0 | 0.0 | GO:0055091 | phospholipid homeostasis(GO:0055091) |
0.0 | 0.0 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
0.0 | 0.0 | GO:0008582 | regulation of synaptic growth at neuromuscular junction(GO:0008582) |
0.0 | 0.1 | GO:0050975 | sensory perception of touch(GO:0050975) |
0.0 | 0.1 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
0.0 | 0.0 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
0.0 | 0.1 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
0.0 | 0.1 | GO:0014043 | negative regulation of neuron maturation(GO:0014043) |
0.0 | 0.0 | GO:0033029 | regulation of neutrophil apoptotic process(GO:0033029) |
0.0 | 0.0 | GO:0010901 | regulation of very-low-density lipoprotein particle remodeling(GO:0010901) |
0.0 | 0.0 | GO:2000680 | regulation of rubidium ion transport(GO:2000680) |
0.0 | 0.0 | GO:0090370 | negative regulation of cholesterol efflux(GO:0090370) |
0.0 | 0.2 | GO:0007210 | serotonin receptor signaling pathway(GO:0007210) |
0.0 | 0.1 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
0.0 | 0.0 | GO:0060447 | bud outgrowth involved in lung branching(GO:0060447) |
0.0 | 0.0 | GO:0060671 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
0.0 | 0.1 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
0.0 | 0.0 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
0.0 | 0.0 | GO:0030908 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
0.0 | 0.1 | GO:0034625 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
0.0 | 0.0 | GO:0003339 | regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0003339) |
0.0 | 0.0 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
0.0 | 0.2 | GO:0042407 | cristae formation(GO:0042407) |
0.0 | 0.0 | GO:0002154 | thyroid hormone mediated signaling pathway(GO:0002154) |
0.0 | 0.1 | GO:1900078 | positive regulation of cellular response to insulin stimulus(GO:1900078) |
0.0 | 0.1 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.0 | 0.0 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
0.0 | 0.1 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
0.0 | 0.1 | GO:0035768 | cell chemotaxis to fibroblast growth factor(GO:0035766) endothelial cell chemotaxis to fibroblast growth factor(GO:0035768) regulation of cell chemotaxis to fibroblast growth factor(GO:1904847) regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000544) |
0.0 | 0.0 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
0.0 | 0.0 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
0.0 | 0.0 | GO:0015858 | nucleoside transport(GO:0015858) |
0.0 | 0.1 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
0.0 | 0.2 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
0.0 | 0.1 | GO:0006098 | pentose-phosphate shunt(GO:0006098) |
0.0 | 0.1 | GO:0003310 | pancreatic A cell differentiation(GO:0003310) |
0.0 | 0.0 | GO:1904220 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
0.0 | 0.1 | GO:0030953 | astral microtubule organization(GO:0030953) |
0.0 | 0.1 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
0.0 | 0.0 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
0.0 | 0.1 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
0.0 | 0.3 | GO:0006730 | one-carbon metabolic process(GO:0006730) |
0.0 | 0.0 | GO:1904177 | regulation of adipose tissue development(GO:1904177) |
0.0 | 0.0 | GO:1901256 | macrophage colony-stimulating factor production(GO:0036301) granulocyte colony-stimulating factor production(GO:0071611) regulation of granulocyte colony-stimulating factor production(GO:0071655) regulation of macrophage colony-stimulating factor production(GO:1901256) |
0.0 | 0.1 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
0.0 | 0.0 | GO:0060375 | regulation of mast cell differentiation(GO:0060375) |
0.0 | 0.1 | GO:0002934 | desmosome organization(GO:0002934) |
0.0 | 0.1 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
0.0 | 0.0 | GO:2000774 | positive regulation of cellular senescence(GO:2000774) |
0.0 | 0.0 | GO:1902170 | cellular response to reactive nitrogen species(GO:1902170) |
0.0 | 0.1 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
0.0 | 0.0 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
0.0 | 0.1 | GO:0045005 | DNA-dependent DNA replication maintenance of fidelity(GO:0045005) |
0.0 | 0.2 | GO:0007099 | centriole replication(GO:0007099) centriole assembly(GO:0098534) |
0.0 | 0.1 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
0.0 | 0.0 | GO:0033629 | negative regulation of cell adhesion mediated by integrin(GO:0033629) |
0.0 | 0.1 | GO:0010544 | negative regulation of platelet activation(GO:0010544) |
0.0 | 0.0 | GO:0036508 | protein deglycosylation involved in glycoprotein catabolic process(GO:0035977) protein demannosylation(GO:0036507) protein alpha-1,2-demannosylation(GO:0036508) mannose trimming involved in glycoprotein ERAD pathway(GO:1904382) |
0.0 | 0.1 | GO:0060037 | pharyngeal system development(GO:0060037) |
0.0 | 0.4 | GO:0000380 | alternative mRNA splicing, via spliceosome(GO:0000380) |
0.0 | 0.2 | GO:0045056 | transcytosis(GO:0045056) |
0.0 | 0.1 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
0.0 | 0.1 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
0.0 | 0.1 | GO:1902165 | regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902165) |
0.0 | 0.1 | GO:0009650 | UV protection(GO:0009650) |
0.0 | 0.0 | GO:0040034 | regulation of development, heterochronic(GO:0040034) |
0.0 | 0.2 | GO:0010738 | regulation of protein kinase A signaling(GO:0010738) |
0.0 | 0.0 | GO:0015884 | folic acid transport(GO:0015884) |
0.0 | 0.2 | GO:0007026 | negative regulation of microtubule depolymerization(GO:0007026) |
0.0 | 0.1 | GO:1903140 | regulation of endothelial cell development(GO:1901550) regulation of establishment of endothelial barrier(GO:1903140) |
0.0 | 0.1 | GO:0045651 | positive regulation of macrophage differentiation(GO:0045651) |
0.0 | 0.5 | GO:0033141 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
0.0 | 0.0 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
0.0 | 0.0 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
0.0 | 0.2 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
0.0 | 0.0 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
0.0 | 0.0 | GO:0060339 | negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
0.0 | 0.0 | GO:0044557 | relaxation of smooth muscle(GO:0044557) |
0.0 | 0.5 | GO:0061077 | chaperone-mediated protein folding(GO:0061077) |
0.0 | 0.0 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
0.0 | 0.1 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.0 | 0.0 | GO:0052200 | response to defenses of other organism involved in symbiotic interaction(GO:0052173) response to host defenses(GO:0052200) response to host(GO:0075136) |
0.0 | 0.0 | GO:0015889 | cobalamin transport(GO:0015889) |
0.0 | 0.1 | GO:0045591 | positive regulation of regulatory T cell differentiation(GO:0045591) |
0.0 | 0.0 | GO:0002930 | trabecular meshwork development(GO:0002930) |
0.0 | 0.1 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
0.0 | 0.0 | GO:0010986 | regulation of high-density lipoprotein particle clearance(GO:0010982) positive regulation of lipoprotein particle clearance(GO:0010986) |
0.0 | 0.0 | GO:0046391 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
0.0 | 0.0 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
0.0 | 0.0 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
0.0 | 0.2 | GO:0051875 | melanosome localization(GO:0032400) pigment granule localization(GO:0051875) |
0.0 | 0.1 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
0.0 | 0.7 | GO:0042274 | ribosomal small subunit biogenesis(GO:0042274) |
0.0 | 0.0 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
0.0 | 0.0 | GO:0032304 | negative regulation of icosanoid secretion(GO:0032304) |
0.0 | 0.0 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
0.0 | 0.0 | GO:1903984 | regulation of TRAIL-activated apoptotic signaling pathway(GO:1903121) positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
0.0 | 0.1 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
0.0 | 0.1 | GO:0021520 | spinal cord motor neuron cell fate specification(GO:0021520) |
0.0 | 0.0 | GO:1902031 | regulation of NADP metabolic process(GO:1902031) |
0.0 | 0.1 | GO:0009074 | tryptophan catabolic process(GO:0006569) aromatic amino acid family catabolic process(GO:0009074) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) |
0.0 | 0.0 | GO:0045343 | MHC class I biosynthetic process(GO:0045341) regulation of MHC class I biosynthetic process(GO:0045343) positive regulation of MHC class I biosynthetic process(GO:0045345) |
0.0 | 0.0 | GO:0046684 | response to pyrethroid(GO:0046684) |
0.0 | 0.0 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
0.0 | 0.1 | GO:0045793 | positive regulation of cell size(GO:0045793) |
0.0 | 0.0 | GO:0090037 | positive regulation of protein kinase C signaling(GO:0090037) |
0.0 | 0.1 | GO:0061303 | cornea development in camera-type eye(GO:0061303) |
0.0 | 0.1 | GO:0070884 | regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
0.0 | 0.0 | GO:0001957 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
0.0 | 0.0 | GO:0002238 | response to molecule of fungal origin(GO:0002238) |
0.0 | 0.1 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
0.0 | 0.1 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.0 | 0.1 | GO:0035330 | regulation of hippo signaling(GO:0035330) |
0.0 | 0.0 | GO:0019896 | axonal transport of mitochondrion(GO:0019896) |
0.0 | 0.2 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
0.0 | 0.0 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
0.0 | 0.0 | GO:0090091 | positive regulation of extracellular matrix disassembly(GO:0090091) |
0.0 | 0.0 | GO:0006824 | cobalt ion transport(GO:0006824) |
0.0 | 0.0 | GO:0006553 | lysine metabolic process(GO:0006553) |
0.0 | 0.3 | GO:0045600 | positive regulation of fat cell differentiation(GO:0045600) |
0.0 | 0.0 | GO:2001182 | regulation of interleukin-12 secretion(GO:2001182) |
0.0 | 0.1 | GO:0008053 | mitochondrial fusion(GO:0008053) |
0.0 | 0.0 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
0.0 | 0.0 | GO:2000105 | positive regulation of DNA-dependent DNA replication(GO:2000105) |
0.0 | 0.3 | GO:0045839 | negative regulation of mitotic nuclear division(GO:0045839) |
0.0 | 0.2 | GO:0006308 | DNA catabolic process(GO:0006308) |
0.0 | 0.1 | GO:2000251 | positive regulation of actin cytoskeleton reorganization(GO:2000251) |
0.0 | 0.1 | GO:0044273 | sulfur compound catabolic process(GO:0044273) |
0.0 | 0.1 | GO:0032754 | positive regulation of interleukin-5 production(GO:0032754) |
0.0 | 0.1 | GO:0015074 | DNA integration(GO:0015074) |
0.0 | 0.2 | GO:0060292 | long term synaptic depression(GO:0060292) |
0.0 | 0.1 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
0.0 | 0.3 | GO:0046676 | negative regulation of insulin secretion(GO:0046676) |
0.0 | 0.0 | GO:0002572 | pro-T cell differentiation(GO:0002572) |
0.0 | 0.0 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
0.0 | 0.1 | GO:0006977 | DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) |
0.0 | 0.1 | GO:0019068 | virion assembly(GO:0019068) |
0.0 | 0.0 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.0 | 0.1 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
0.0 | 0.1 | GO:0071420 | cellular response to histamine(GO:0071420) |
0.0 | 0.0 | GO:0090240 | positive regulation of histone H4 acetylation(GO:0090240) |
0.0 | 0.0 | GO:0021569 | rhombomere 3 development(GO:0021569) |
0.0 | 0.1 | GO:0035437 | protein retention in ER lumen(GO:0006621) maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
0.0 | 0.2 | GO:0042773 | ATP synthesis coupled electron transport(GO:0042773) |
0.0 | 0.0 | GO:1903423 | positive regulation of synaptic vesicle recycling(GO:1903423) |
0.0 | 0.2 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
0.0 | 0.0 | GO:0098700 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
0.0 | 0.2 | GO:0043044 | ATP-dependent chromatin remodeling(GO:0043044) |
0.0 | 0.0 | GO:0001880 | Mullerian duct regression(GO:0001880) |
0.0 | 0.1 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
0.0 | 0.0 | GO:0046952 | cellular ketone body metabolic process(GO:0046950) ketone body catabolic process(GO:0046952) |
0.0 | 0.0 | GO:1901563 | response to camptothecin(GO:1901563) |
0.0 | 0.1 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
0.0 | 0.0 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
0.0 | 0.1 | GO:0050961 | detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
0.0 | 0.0 | GO:0010668 | ectodermal cell differentiation(GO:0010668) |
0.0 | 0.0 | GO:1903671 | negative regulation of sprouting angiogenesis(GO:1903671) |
0.0 | 0.0 | GO:0031627 | telomeric loop formation(GO:0031627) |
0.0 | 0.1 | GO:0018196 | peptidyl-asparagine modification(GO:0018196) |
0.0 | 0.0 | GO:0048769 | sarcomerogenesis(GO:0048769) |
0.0 | 0.0 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
0.0 | 0.0 | GO:0045217 | cell-cell junction maintenance(GO:0045217) |
0.0 | 0.0 | GO:0043633 | polyadenylation-dependent RNA catabolic process(GO:0043633) |
0.0 | 0.1 | GO:0006379 | mRNA cleavage(GO:0006379) |
0.0 | 0.0 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
0.0 | 0.0 | GO:0060585 | vein smooth muscle contraction(GO:0014826) regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
0.0 | 0.0 | GO:0001865 | NK T cell differentiation(GO:0001865) |
0.0 | 0.0 | GO:0014834 | skeletal muscle satellite cell maintenance involved in skeletal muscle regeneration(GO:0014834) |
0.0 | 0.3 | GO:0006958 | complement activation, classical pathway(GO:0006958) |
0.0 | 0.0 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
0.0 | 0.1 | GO:0061029 | eyelid development in camera-type eye(GO:0061029) |
0.0 | 0.2 | GO:0000186 | activation of MAPKK activity(GO:0000186) |
0.0 | 0.1 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
0.0 | 0.1 | GO:0046085 | adenosine metabolic process(GO:0046085) |
0.0 | 0.0 | GO:0014848 | urinary tract smooth muscle contraction(GO:0014848) |
0.0 | 0.1 | GO:0006353 | DNA-templated transcription, termination(GO:0006353) |
0.0 | 0.0 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
0.0 | 0.0 | GO:0002538 | arachidonic acid metabolite production involved in inflammatory response(GO:0002538) |
0.0 | 0.0 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
0.0 | 0.0 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 1.6 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
0.2 | 1.0 | GO:0005726 | perichromatin fibrils(GO:0005726) |
0.2 | 2.7 | GO:0070852 | cell body fiber(GO:0070852) |
0.2 | 0.6 | GO:0035355 | Toll-like receptor 2-Toll-like receptor 6 protein complex(GO:0035355) |
0.2 | 1.0 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.2 | 0.9 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.2 | 0.5 | GO:0000811 | GINS complex(GO:0000811) |
0.2 | 0.5 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.1 | 0.4 | GO:0031298 | replication fork protection complex(GO:0031298) |
0.1 | 0.1 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
0.1 | 0.5 | GO:0070545 | PeBoW complex(GO:0070545) |
0.1 | 0.6 | GO:0005579 | membrane attack complex(GO:0005579) |
0.1 | 0.3 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
0.1 | 0.4 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.1 | 0.3 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
0.1 | 0.1 | GO:0031261 | DNA replication preinitiation complex(GO:0031261) |
0.1 | 1.1 | GO:0097431 | mitotic spindle pole(GO:0097431) |
0.1 | 0.3 | GO:0045293 | mRNA editing complex(GO:0045293) |
0.1 | 0.4 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
0.1 | 0.3 | GO:0032389 | MutLalpha complex(GO:0032389) |
0.1 | 0.2 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
0.1 | 0.2 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.1 | 0.3 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.1 | 0.3 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.1 | 0.3 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
0.1 | 0.1 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
0.1 | 1.1 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.1 | 1.2 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.1 | 0.4 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.1 | 0.4 | GO:0000306 | extrinsic component of vacuolar membrane(GO:0000306) |
0.1 | 0.2 | GO:0097451 | glial limiting end-foot(GO:0097451) |
0.1 | 0.2 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.1 | 0.2 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.1 | 0.4 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.1 | 0.2 | GO:0005683 | U7 snRNP(GO:0005683) |
0.1 | 0.3 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.1 | 0.2 | GO:0032444 | activin responsive factor complex(GO:0032444) |
0.1 | 0.3 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
0.1 | 0.2 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
0.1 | 0.3 | GO:0097433 | dense body(GO:0097433) |
0.1 | 0.6 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.1 | 0.4 | GO:0032584 | growth cone membrane(GO:0032584) |
0.0 | 0.1 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
0.0 | 0.2 | GO:0008091 | spectrin(GO:0008091) |
0.0 | 0.1 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
0.0 | 0.2 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.0 | 0.2 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
0.0 | 0.3 | GO:0005915 | zonula adherens(GO:0005915) |
0.0 | 0.2 | GO:0097651 | phosphatidylinositol 3-kinase complex, class I(GO:0097651) |
0.0 | 0.0 | GO:0030666 | endocytic vesicle membrane(GO:0030666) |
0.0 | 0.4 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
0.0 | 0.3 | GO:0031931 | TORC1 complex(GO:0031931) |
0.0 | 0.2 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
0.0 | 0.1 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
0.0 | 0.2 | GO:0030313 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
0.0 | 0.2 | GO:0030127 | COPII vesicle coat(GO:0030127) |
0.0 | 1.1 | GO:0030120 | vesicle coat(GO:0030120) |
0.0 | 0.2 | GO:0090543 | Flemming body(GO:0090543) |
0.0 | 0.1 | GO:0016939 | kinesin II complex(GO:0016939) |
0.0 | 0.3 | GO:0017059 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
0.0 | 0.2 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.0 | 0.0 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.0 | 0.2 | GO:0000445 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
0.0 | 0.1 | GO:0048179 | activin receptor complex(GO:0048179) |
0.0 | 0.3 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.0 | 0.3 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.0 | 0.3 | GO:0000124 | SAGA complex(GO:0000124) |
0.0 | 0.1 | GO:0070552 | BRISC complex(GO:0070552) |
0.0 | 0.3 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.0 | 0.3 | GO:0031305 | integral component of mitochondrial inner membrane(GO:0031305) |
0.0 | 0.9 | GO:0000777 | condensed chromosome kinetochore(GO:0000777) |
0.0 | 0.2 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
0.0 | 0.6 | GO:0043034 | costamere(GO:0043034) |
0.0 | 0.3 | GO:0045263 | proton-transporting ATP synthase complex, coupling factor F(o)(GO:0045263) |
0.0 | 0.4 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
0.0 | 0.5 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.0 | 0.1 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.0 | 0.1 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.0 | 0.3 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
0.0 | 0.6 | GO:0005720 | nuclear heterochromatin(GO:0005720) |
0.0 | 0.1 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
0.0 | 0.1 | GO:0031502 | dolichyl-phosphate-mannose-protein mannosyltransferase complex(GO:0031502) |
0.0 | 0.1 | GO:0097427 | microtubule bundle(GO:0097427) |
0.0 | 0.4 | GO:0010369 | chromocenter(GO:0010369) |
0.0 | 0.2 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
0.0 | 3.0 | GO:0030176 | integral component of endoplasmic reticulum membrane(GO:0030176) |
0.0 | 0.4 | GO:0031229 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
0.0 | 0.1 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.0 | 0.1 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
0.0 | 0.2 | GO:0070652 | HAUS complex(GO:0070652) |
0.0 | 0.4 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
0.0 | 0.1 | GO:0045251 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
0.0 | 0.3 | GO:0031430 | M band(GO:0031430) |
0.0 | 1.2 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
0.0 | 0.1 | GO:0030665 | clathrin-coated vesicle membrane(GO:0030665) |
0.0 | 0.4 | GO:0031083 | BLOC-1 complex(GO:0031083) |
0.0 | 1.2 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.0 | 0.1 | GO:0030870 | Mre11 complex(GO:0030870) |
0.0 | 0.2 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
0.0 | 0.2 | GO:0016342 | catenin complex(GO:0016342) |
0.0 | 0.1 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
0.0 | 0.6 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
0.0 | 0.1 | GO:0005828 | kinetochore microtubule(GO:0005828) |
0.0 | 0.2 | GO:0005682 | U5 snRNP(GO:0005682) |
0.0 | 0.0 | GO:0030669 | clathrin-coated endocytic vesicle membrane(GO:0030669) |
0.0 | 1.2 | GO:0005778 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
0.0 | 1.0 | GO:0031519 | PcG protein complex(GO:0031519) |
0.0 | 0.1 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.0 | 1.0 | GO:0005747 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
0.0 | 0.2 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
0.0 | 0.2 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.0 | 0.1 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.0 | 0.1 | GO:0097208 | alveolar lamellar body(GO:0097208) |
0.0 | 0.1 | GO:0005577 | fibrinogen complex(GO:0005577) |
0.0 | 0.2 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.0 | 0.1 | GO:0048500 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
0.0 | 0.2 | GO:0097386 | glial cell projection(GO:0097386) |
0.0 | 0.1 | GO:1990131 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.0 | 0.1 | GO:1904115 | axon cytoplasm(GO:1904115) |
0.0 | 0.2 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
0.0 | 0.1 | GO:0005927 | muscle tendon junction(GO:0005927) |
0.0 | 0.5 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.0 | 0.6 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.0 | 0.0 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
0.0 | 0.1 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
0.0 | 0.2 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.0 | 0.1 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.0 | 0.1 | GO:0005688 | U6 snRNP(GO:0005688) |
0.0 | 0.8 | GO:0098800 | inner mitochondrial membrane protein complex(GO:0098800) |
0.0 | 0.1 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.0 | 0.1 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
0.0 | 0.6 | GO:0005876 | spindle microtubule(GO:0005876) |
0.0 | 0.1 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.0 | 0.1 | GO:0043293 | apoptosome(GO:0043293) |
0.0 | 0.1 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
0.0 | 0.1 | GO:0042583 | chromaffin granule(GO:0042583) |
0.0 | 0.1 | GO:0032009 | early phagosome(GO:0032009) |
0.0 | 0.4 | GO:0044295 | axonal growth cone(GO:0044295) |
0.0 | 0.1 | GO:0098536 | deuterosome(GO:0098536) |
0.0 | 0.1 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
0.0 | 0.2 | GO:0031143 | pseudopodium(GO:0031143) |
0.0 | 0.1 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
0.0 | 0.1 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.0 | 0.0 | GO:0000938 | GARP complex(GO:0000938) |
0.0 | 0.6 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
0.0 | 0.2 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.0 | 0.1 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.0 | 0.1 | GO:0005955 | calcineurin complex(GO:0005955) |
0.0 | 0.0 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.0 | 0.1 | GO:0030314 | junctional membrane complex(GO:0030314) |
0.0 | 0.1 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
0.0 | 0.2 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
0.0 | 0.0 | GO:0044393 | microspike(GO:0044393) |
0.0 | 0.0 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
0.0 | 0.0 | GO:0046930 | pore complex(GO:0046930) |
0.0 | 0.0 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
0.0 | 0.1 | GO:0002177 | manchette(GO:0002177) |
0.0 | 0.3 | GO:0000786 | nucleosome(GO:0000786) |
0.0 | 0.3 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.0 | 0.0 | GO:0001651 | dense fibrillar component(GO:0001651) |
0.0 | 0.0 | GO:0005746 | mitochondrial respiratory chain(GO:0005746) |
0.0 | 0.4 | GO:0045335 | phagocytic vesicle(GO:0045335) |
0.0 | 0.1 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
0.0 | 1.8 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
0.0 | 0.2 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
0.0 | 0.6 | GO:0000502 | proteasome complex(GO:0000502) |
0.0 | 0.4 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
0.0 | 0.1 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.0 | 0.0 | GO:0032127 | dense core granule membrane(GO:0032127) |
0.0 | 0.1 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
0.0 | 0.1 | GO:0030660 | Golgi-associated vesicle membrane(GO:0030660) |
0.0 | 0.0 | GO:0071817 | MMXD complex(GO:0071817) |
0.0 | 0.0 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.0 | 0.2 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
0.0 | 0.2 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.0 | 0.1 | GO:0035371 | microtubule plus-end(GO:0035371) |
0.0 | 0.0 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
0.0 | 0.3 | GO:0031902 | late endosome membrane(GO:0031902) |
0.0 | 0.7 | GO:0016605 | PML body(GO:0016605) |
0.0 | 0.1 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
0.0 | 0.3 | GO:0005637 | nuclear inner membrane(GO:0005637) |
0.0 | 0.1 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.0 | 0.1 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.0 | 0.0 | GO:0000125 | PCAF complex(GO:0000125) |
0.0 | 2.5 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
0.0 | 0.1 | GO:0042575 | DNA polymerase complex(GO:0042575) |
0.0 | 0.3 | GO:1990204 | oxidoreductase complex(GO:1990204) |
0.0 | 0.3 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
0.0 | 0.0 | GO:0000780 | condensed nuclear chromosome, centromeric region(GO:0000780) |
0.0 | 0.1 | GO:0042101 | T cell receptor complex(GO:0042101) |
0.0 | 0.1 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
0.0 | 0.2 | GO:0005614 | interstitial matrix(GO:0005614) |
0.0 | 0.0 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.0 | 0.1 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
0.0 | 0.1 | GO:0034464 | BBSome(GO:0034464) |
0.0 | 0.0 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
0.0 | 0.2 | GO:0048786 | presynaptic active zone(GO:0048786) |
0.0 | 0.0 | GO:1990745 | EARP complex(GO:1990745) |
0.0 | 0.0 | GO:0001650 | fibrillar center(GO:0001650) |
0.0 | 0.0 | GO:0045009 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
0.0 | 0.2 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
0.0 | 0.0 | GO:0005712 | chiasma(GO:0005712) |
0.0 | 0.0 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
0.0 | 0.3 | GO:0042734 | presynaptic membrane(GO:0042734) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 1.8 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.4 | 1.6 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
0.3 | 0.9 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
0.2 | 0.2 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
0.2 | 0.7 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
0.2 | 1.5 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
0.2 | 1.7 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.2 | 0.6 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
0.2 | 0.5 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.2 | 0.7 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
0.2 | 0.5 | GO:0038181 | bile acid receptor activity(GO:0038181) |
0.2 | 0.5 | GO:0070538 | oleic acid binding(GO:0070538) |
0.2 | 2.2 | GO:0015643 | toxic substance binding(GO:0015643) |
0.2 | 0.5 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
0.2 | 0.3 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.2 | 0.5 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
0.2 | 0.8 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.2 | 0.5 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
0.1 | 0.4 | GO:0055100 | adiponectin binding(GO:0055100) |
0.1 | 1.1 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.1 | 0.6 | GO:0033142 | progesterone receptor binding(GO:0033142) |
0.1 | 1.5 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
0.1 | 0.5 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
0.1 | 0.4 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
0.1 | 0.4 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.1 | 0.8 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.1 | 0.5 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
0.1 | 0.5 | GO:0032564 | dATP binding(GO:0032564) |
0.1 | 0.4 | GO:0051430 | corticotropin-releasing hormone receptor 1 binding(GO:0051430) |
0.1 | 0.4 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
0.1 | 0.4 | GO:0071614 | linoleic acid epoxygenase activity(GO:0071614) |
0.1 | 0.1 | GO:0004376 | glycolipid mannosyltransferase activity(GO:0004376) |
0.1 | 0.7 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
0.1 | 0.3 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.1 | 0.5 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
0.1 | 0.6 | GO:0033695 | oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
0.1 | 0.3 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
0.1 | 0.3 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.1 | 0.3 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.1 | 0.2 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.1 | 0.2 | GO:0070699 | type II activin receptor binding(GO:0070699) |
0.1 | 0.4 | GO:0005047 | signal recognition particle binding(GO:0005047) |
0.1 | 0.5 | GO:0070728 | leucine binding(GO:0070728) |
0.1 | 0.5 | GO:0050733 | RS domain binding(GO:0050733) |
0.1 | 0.3 | GO:0016882 | cyclo-ligase activity(GO:0016882) |
0.1 | 0.4 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
0.1 | 0.3 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
0.1 | 0.3 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.1 | 0.3 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.1 | 0.6 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.1 | 0.2 | GO:0016418 | S-acetyltransferase activity(GO:0016418) |
0.1 | 0.2 | GO:0004802 | transketolase activity(GO:0004802) |
0.1 | 0.2 | GO:0071209 | U7 snRNA binding(GO:0071209) |
0.1 | 0.2 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
0.1 | 0.2 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
0.1 | 0.5 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) |
0.1 | 0.2 | GO:0004103 | choline kinase activity(GO:0004103) |
0.1 | 0.5 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.1 | 0.2 | GO:0004771 | sterol esterase activity(GO:0004771) |
0.1 | 0.7 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
0.1 | 0.3 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
0.1 | 0.1 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
0.1 | 0.1 | GO:0070644 | vitamin D response element binding(GO:0070644) |
0.1 | 0.2 | GO:0043426 | MRF binding(GO:0043426) |
0.1 | 0.1 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
0.1 | 0.8 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.1 | 0.3 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.1 | 0.7 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.1 | 0.2 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
0.1 | 1.3 | GO:0003785 | actin monomer binding(GO:0003785) |
0.1 | 0.4 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.1 | 0.2 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
0.1 | 0.5 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
0.1 | 0.3 | GO:0001849 | complement component C1q binding(GO:0001849) |
0.1 | 0.2 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.1 | 0.4 | GO:0016151 | nickel cation binding(GO:0016151) |
0.1 | 0.3 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
0.1 | 0.4 | GO:0035197 | siRNA binding(GO:0035197) |
0.1 | 0.2 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
0.1 | 0.2 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.1 | 0.7 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.1 | 0.2 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.1 | 0.3 | GO:0035671 | enone reductase activity(GO:0035671) |
0.1 | 0.2 | GO:0005347 | ATP transmembrane transporter activity(GO:0005347) |
0.1 | 0.2 | GO:2001069 | glycogen binding(GO:2001069) |
0.1 | 0.2 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.1 | 0.2 | GO:0008506 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
0.1 | 0.4 | GO:0030957 | Tat protein binding(GO:0030957) |
0.1 | 0.1 | GO:0051723 | protein methylesterase activity(GO:0051723) |
0.1 | 0.4 | GO:0046790 | virion binding(GO:0046790) |
0.1 | 0.2 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
0.1 | 0.2 | GO:0004096 | catalase activity(GO:0004096) |
0.1 | 0.3 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
0.1 | 0.4 | GO:0034711 | inhibin binding(GO:0034711) |
0.1 | 0.3 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
0.1 | 0.2 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.1 | 0.6 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
0.1 | 1.2 | GO:0036002 | pre-mRNA binding(GO:0036002) |
0.1 | 0.2 | GO:0080130 | L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
0.1 | 0.2 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
0.1 | 0.2 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
0.1 | 0.2 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
0.1 | 0.2 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.1 | 0.3 | GO:0004017 | adenylate kinase activity(GO:0004017) |
0.1 | 0.3 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
0.1 | 0.2 | GO:0003840 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
0.1 | 0.9 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.1 | 0.3 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
0.1 | 0.2 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
0.0 | 0.2 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.0 | 0.4 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.0 | 0.2 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
0.0 | 0.3 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
0.0 | 0.6 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
0.0 | 0.1 | GO:0004515 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.0 | 0.2 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.0 | 1.4 | GO:0052771 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
0.0 | 0.3 | GO:1990405 | protein antigen binding(GO:1990405) |
0.0 | 1.2 | GO:0004115 | 3',5'-cyclic-AMP phosphodiesterase activity(GO:0004115) |
0.0 | 0.5 | GO:0005542 | folic acid binding(GO:0005542) |
0.0 | 0.2 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
0.0 | 0.3 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
0.0 | 0.3 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.0 | 1.0 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
0.0 | 0.1 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
0.0 | 0.1 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
0.0 | 0.1 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.0 | 0.1 | GO:0016901 | oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
0.0 | 0.2 | GO:0003909 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
0.0 | 0.1 | GO:0004477 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
0.0 | 0.4 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
0.0 | 0.4 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.0 | 1.8 | GO:0015924 | mannosyl-oligosaccharide mannosidase activity(GO:0015924) |
0.0 | 0.2 | GO:0004030 | aldehyde dehydrogenase [NAD(P)+] activity(GO:0004030) |
0.0 | 0.2 | GO:0004065 | arylsulfatase activity(GO:0004065) |
0.0 | 0.1 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
0.0 | 0.3 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
0.0 | 0.0 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
0.0 | 0.1 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.0 | 0.3 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.0 | 0.2 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
0.0 | 0.2 | GO:0004556 | alpha-amylase activity(GO:0004556) |
0.0 | 0.3 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.0 | 0.2 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.0 | 0.1 | GO:0015216 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) |
0.0 | 0.7 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.0 | 0.1 | GO:0051425 | PTB domain binding(GO:0051425) |
0.0 | 0.2 | GO:0052723 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
0.0 | 0.1 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
0.0 | 0.1 | GO:0001224 | RNA polymerase II transcription cofactor binding(GO:0001224) |
0.0 | 0.3 | GO:0048038 | quinone binding(GO:0048038) |
0.0 | 0.3 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.0 | 0.2 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.0 | 2.2 | GO:0019209 | kinase activator activity(GO:0019209) |
0.0 | 0.8 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.0 | 0.1 | GO:0008199 | ferric iron binding(GO:0008199) |
0.0 | 0.1 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.0 | 0.4 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
0.0 | 0.2 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
0.0 | 0.3 | GO:0070513 | death domain binding(GO:0070513) |
0.0 | 1.5 | GO:0005546 | phosphatidylinositol-4,5-bisphosphate binding(GO:0005546) |
0.0 | 0.2 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.0 | 0.2 | GO:0002054 | nucleobase binding(GO:0002054) |
0.0 | 0.2 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
0.0 | 0.1 | GO:0047623 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
0.0 | 0.0 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
0.0 | 0.1 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.0 | 0.1 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.0 | 0.2 | GO:0000339 | RNA cap binding(GO:0000339) |
0.0 | 0.1 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.0 | 0.1 | GO:0015211 | purine nucleoside transmembrane transporter activity(GO:0015211) |
0.0 | 0.1 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.0 | 0.1 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.0 | 0.1 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.0 | 0.1 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.0 | 0.1 | GO:0004705 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
0.0 | 0.2 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.0 | 0.1 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
0.0 | 0.1 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
0.0 | 0.1 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
0.0 | 0.3 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
0.0 | 0.2 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
0.0 | 0.2 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.0 | 0.3 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
0.0 | 0.0 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
0.0 | 0.1 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
0.0 | 0.2 | GO:0048019 | receptor antagonist activity(GO:0048019) |
0.0 | 0.1 | GO:0031781 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
0.0 | 0.7 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.0 | 0.4 | GO:0030552 | cAMP binding(GO:0030552) |
0.0 | 0.2 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.0 | 0.2 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
0.0 | 0.2 | GO:0003896 | DNA primase activity(GO:0003896) |
0.0 | 0.1 | GO:0048018 | receptor agonist activity(GO:0048018) |
0.0 | 0.3 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.0 | 0.2 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.0 | 0.1 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.0 | 0.1 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
0.0 | 0.1 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
0.0 | 0.1 | GO:0004630 | phospholipase D activity(GO:0004630) |
0.0 | 0.1 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
0.0 | 0.2 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
0.0 | 0.2 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
0.0 | 0.3 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.0 | 0.1 | GO:0017040 | ceramidase activity(GO:0017040) |
0.0 | 0.0 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) |
0.0 | 0.8 | GO:0004693 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
0.0 | 0.4 | GO:0043295 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
0.0 | 1.0 | GO:0016763 | transferase activity, transferring pentosyl groups(GO:0016763) |
0.0 | 0.7 | GO:0070063 | RNA polymerase binding(GO:0070063) |
0.0 | 0.1 | GO:0004967 | glucagon receptor activity(GO:0004967) |
0.0 | 0.1 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
0.0 | 0.1 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.0 | 0.1 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
0.0 | 2.4 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
0.0 | 0.7 | GO:0046875 | ephrin receptor binding(GO:0046875) |
0.0 | 0.1 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
0.0 | 0.1 | GO:0098847 | sequence-specific single stranded DNA binding(GO:0098847) |
0.0 | 0.8 | GO:0004033 | aldo-keto reductase (NADP) activity(GO:0004033) |
0.0 | 0.5 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
0.0 | 0.0 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
0.0 | 0.1 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
0.0 | 0.1 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
0.0 | 0.0 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.0 | 0.1 | GO:0089720 | caspase binding(GO:0089720) |
0.0 | 0.1 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
0.0 | 0.2 | GO:0102338 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
0.0 | 0.5 | GO:0004364 | glutathione transferase activity(GO:0004364) |
0.0 | 0.2 | GO:0002162 | dystroglycan binding(GO:0002162) |
0.0 | 0.7 | GO:0042169 | SH2 domain binding(GO:0042169) |
0.0 | 0.1 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.0 | 0.8 | GO:0070888 | E-box binding(GO:0070888) |
0.0 | 0.1 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) |
0.0 | 0.2 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
0.0 | 0.1 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
0.0 | 0.1 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
0.0 | 0.0 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
0.0 | 0.2 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.0 | 0.1 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.0 | 0.1 | GO:0005499 | vitamin D binding(GO:0005499) |
0.0 | 0.1 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
0.0 | 0.0 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
0.0 | 0.2 | GO:0005113 | patched binding(GO:0005113) |
0.0 | 0.2 | GO:0008432 | JUN kinase binding(GO:0008432) |
0.0 | 0.2 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
0.0 | 0.5 | GO:0001614 | purinergic nucleotide receptor activity(GO:0001614) nucleotide receptor activity(GO:0016502) |
0.0 | 0.1 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.0 | 0.1 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
0.0 | 0.1 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.0 | 0.2 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
0.0 | 0.1 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
0.0 | 0.1 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
0.0 | 0.3 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
0.0 | 0.0 | GO:0070698 | type I activin receptor binding(GO:0070698) |
0.0 | 0.1 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
0.0 | 0.2 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
0.0 | 0.2 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
0.0 | 0.1 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
0.0 | 0.1 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.0 | 0.2 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.0 | 0.1 | GO:1990239 | steroid hormone binding(GO:1990239) |
0.0 | 0.1 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
0.0 | 0.2 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.0 | 0.1 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.0 | 0.1 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
0.0 | 0.1 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
0.0 | 0.8 | GO:0000049 | tRNA binding(GO:0000049) |
0.0 | 0.4 | GO:0004889 | acetylcholine-activated cation-selective channel activity(GO:0004889) |
0.0 | 0.2 | GO:0098988 | G-protein coupled glutamate receptor activity(GO:0098988) |
0.0 | 0.2 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.0 | 0.1 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
0.0 | 0.2 | GO:0030169 | low-density lipoprotein particle binding(GO:0030169) |
0.0 | 0.1 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.0 | 0.1 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.0 | 0.1 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.0 | 0.1 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
0.0 | 0.3 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.0 | 0.1 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.0 | 0.1 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
0.0 | 0.2 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
0.0 | 0.1 | GO:0036310 | annealing helicase activity(GO:0036310) |
0.0 | 0.1 | GO:0004064 | arylesterase activity(GO:0004064) |
0.0 | 0.1 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.0 | 0.0 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
0.0 | 0.0 | GO:0035014 | phosphatidylinositol 3-kinase regulator activity(GO:0035014) |
0.0 | 0.0 | GO:0015923 | mannosidase activity(GO:0015923) |
0.0 | 0.3 | GO:0032183 | SUMO binding(GO:0032183) |
0.0 | 0.1 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
0.0 | 0.3 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
0.0 | 1.9 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
0.0 | 0.0 | GO:0033677 | DNA/RNA helicase activity(GO:0033677) |
0.0 | 0.1 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.0 | 0.0 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
0.0 | 0.1 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
0.0 | 0.3 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
0.0 | 0.1 | GO:0016668 | oxidoreductase activity, acting on a sulfur group of donors, NAD(P) as acceptor(GO:0016668) |
0.0 | 0.0 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
0.0 | 0.1 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
0.0 | 0.1 | GO:0017166 | vinculin binding(GO:0017166) |
0.0 | 0.0 | GO:0004779 | sulfate adenylyltransferase activity(GO:0004779) |
0.0 | 0.1 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.0 | 0.1 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.0 | 0.6 | GO:0005109 | frizzled binding(GO:0005109) |
0.0 | 0.2 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
0.0 | 0.2 | GO:0016595 | glutamate binding(GO:0016595) |
0.0 | 0.5 | GO:0030276 | clathrin binding(GO:0030276) |
0.0 | 0.1 | GO:0019763 | immunoglobulin receptor activity(GO:0019763) |
0.0 | 0.2 | GO:0050681 | androgen receptor binding(GO:0050681) |
0.0 | 0.0 | GO:0034604 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
0.0 | 0.0 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
0.0 | 0.0 | GO:0004028 | 3-chloroallyl aldehyde dehydrogenase activity(GO:0004028) |
0.0 | 0.1 | GO:0039706 | co-receptor binding(GO:0039706) |
0.0 | 0.0 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.0 | 0.0 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
0.0 | 0.1 | GO:0008301 | DNA binding, bending(GO:0008301) |
0.0 | 0.0 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.0 | 0.3 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.0 | 0.0 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
0.0 | 0.1 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
0.0 | 0.1 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
0.0 | 0.0 | GO:0004470 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) |
0.0 | 0.0 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.0 | 0.0 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
0.0 | 0.0 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.0 | 0.5 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
0.0 | 0.0 | GO:0035514 | DNA demethylase activity(GO:0035514) |
0.0 | 0.0 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) |
0.0 | 0.4 | GO:0019894 | kinesin binding(GO:0019894) |
0.0 | 0.0 | GO:0016934 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
0.0 | 1.3 | GO:0047485 | protein N-terminus binding(GO:0047485) |
0.0 | 0.0 | GO:0004936 | alpha-adrenergic receptor activity(GO:0004936) |
0.0 | 0.1 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
0.0 | 0.2 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
0.0 | 0.0 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
0.0 | 0.0 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
0.0 | 0.0 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
0.0 | 0.0 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
0.0 | 0.0 | GO:0008147 | structural constituent of bone(GO:0008147) |
0.0 | 0.3 | GO:0016765 | transferase activity, transferring alkyl or aryl (other than methyl) groups(GO:0016765) |
0.0 | 0.0 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.0 | 0.2 | GO:0044769 | ATPase activity, coupled to transmembrane movement of ions, rotational mechanism(GO:0044769) |
0.0 | 0.1 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
0.0 | 0.1 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
0.0 | 0.0 | GO:0004359 | glutaminase activity(GO:0004359) |
0.0 | 0.1 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.0 | 0.0 | GO:0008808 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) |
0.0 | 0.0 | GO:0008430 | selenium binding(GO:0008430) |
0.0 | 0.0 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
0.0 | 0.0 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
0.0 | 0.0 | GO:0035175 | histone kinase activity (H3-S10 specific)(GO:0035175) |
0.0 | 0.0 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.0 | 0.0 | GO:0032190 | acrosin binding(GO:0032190) |
0.0 | 0.0 | GO:0003720 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
0.0 | 0.1 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
0.0 | 0.5 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
0.0 | 0.2 | GO:0042162 | telomeric DNA binding(GO:0042162) |
0.0 | 0.1 | GO:0044548 | S100 protein binding(GO:0044548) |
0.0 | 0.0 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
0.0 | 0.1 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.0 | 0.0 | GO:0071813 | lipoprotein particle binding(GO:0071813) protein-lipid complex binding(GO:0071814) |
0.0 | 0.0 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.0 | 0.4 | GO:0035064 | methylated histone binding(GO:0035064) |
0.0 | 0.0 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
0.0 | 0.2 | GO:0001221 | transcription cofactor binding(GO:0001221) |
0.0 | 0.0 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
0.0 | 0.4 | GO:0005548 | phospholipid transporter activity(GO:0005548) |
0.0 | 0.0 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
0.0 | 0.1 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
0.0 | 2.5 | GO:0001077 | transcriptional activator activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001077) |
0.0 | 0.0 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
0.0 | 0.2 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
0.0 | 0.0 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
0.0 | 0.1 | GO:0008020 | G-protein coupled photoreceptor activity(GO:0008020) |
0.0 | 0.0 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
0.0 | 0.1 | GO:0031386 | protein tag(GO:0031386) |
0.0 | 0.1 | GO:0005523 | tropomyosin binding(GO:0005523) |
0.0 | 0.0 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) |
0.0 | 0.1 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.0 | 0.1 | GO:0016594 | glycine binding(GO:0016594) |
0.0 | 0.1 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.0 | 1.0 | GO:0016410 | N-acyltransferase activity(GO:0016410) |
0.0 | 0.1 | GO:0004112 | cyclic-nucleotide phosphodiesterase activity(GO:0004112) |
0.0 | 0.0 | GO:0070878 | primary miRNA binding(GO:0070878) |
0.0 | 0.0 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
0.0 | 0.0 | GO:0004676 | 3-phosphoinositide-dependent protein kinase activity(GO:0004676) |
0.0 | 0.1 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 1.4 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.1 | 0.2 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.1 | 1.2 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.1 | 1.0 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.1 | 1.5 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.1 | 1.5 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.1 | 0.1 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.1 | 0.1 | ST STAT3 PATHWAY | STAT3 Pathway |
0.0 | 2.2 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
0.0 | 0.1 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
0.0 | 0.2 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
0.0 | 0.4 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.0 | 1.0 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.0 | 0.6 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.0 | 0.0 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
0.0 | 1.5 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.0 | 0.3 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.0 | 0.6 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.0 | 0.4 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.0 | 1.2 | PID ATR PATHWAY | ATR signaling pathway |
0.0 | 0.2 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
0.0 | 0.3 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
0.0 | 0.2 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.0 | 0.6 | PID ALK1 PATHWAY | ALK1 signaling events |
0.0 | 0.3 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.0 | 0.8 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
0.0 | 0.2 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.0 | 0.1 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.0 | 0.5 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.0 | 0.7 | SIG CHEMOTAXIS | Genes related to chemotaxis |
0.0 | 0.7 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
0.0 | 0.3 | PID ATM PATHWAY | ATM pathway |
0.0 | 0.2 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
0.0 | 0.2 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
0.0 | 0.5 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
0.0 | 1.3 | WNT SIGNALING | Genes related to Wnt-mediated signal transduction |
0.0 | 0.1 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.0 | 0.2 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
0.0 | 0.6 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
0.0 | 0.4 | PID IL23 PATHWAY | IL23-mediated signaling events |
0.0 | 0.4 | PID LKB1 PATHWAY | LKB1 signaling events |
0.0 | 0.3 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
0.0 | 0.0 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.0 | 0.2 | PID BARD1 PATHWAY | BARD1 signaling events |
0.0 | 0.3 | PID RAC1 PATHWAY | RAC1 signaling pathway |
0.0 | 0.0 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.0 | 0.1 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.0 | 0.1 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
0.0 | 0.0 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
0.0 | 0.3 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
0.0 | 0.4 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
0.0 | 0.1 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.0 | 0.2 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
0.0 | 0.1 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
0.0 | 0.0 | PID S1P S1P3 PATHWAY | S1P3 pathway |
0.0 | 0.1 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
0.0 | 0.2 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 1.1 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
0.1 | 1.3 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
0.1 | 1.2 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.1 | 1.0 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.1 | 1.1 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
0.1 | 0.3 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
0.1 | 1.7 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
0.1 | 0.9 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
0.1 | 0.5 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.1 | 0.2 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
0.1 | 0.4 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
0.1 | 0.9 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.1 | 1.7 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
0.1 | 0.9 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
0.1 | 0.2 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
0.1 | 0.7 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.1 | 1.3 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.1 | 0.4 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
0.1 | 0.8 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
0.1 | 0.4 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.1 | 0.5 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.1 | 0.1 | REACTOME MEMBRANE TRAFFICKING | Genes involved in Membrane Trafficking |
0.1 | 0.7 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.1 | 0.2 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
0.1 | 0.8 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.1 | 1.0 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
0.1 | 0.2 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
0.0 | 0.5 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
0.0 | 0.4 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
0.0 | 0.5 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.0 | 0.4 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.0 | 0.6 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
0.0 | 0.8 | REACTOME ACTIVATION OF ATR IN RESPONSE TO REPLICATION STRESS | Genes involved in Activation of ATR in response to replication stress |
0.0 | 0.4 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
0.0 | 0.4 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.0 | 1.6 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
0.0 | 0.8 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.0 | 0.5 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.0 | 0.2 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.0 | 0.2 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
0.0 | 0.0 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
0.0 | 0.3 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.0 | 0.8 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
0.0 | 0.2 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.0 | 0.4 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
0.0 | 0.2 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.0 | 0.5 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.0 | 0.3 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
0.0 | 0.3 | REACTOME TRANSCRIPTIONAL ACTIVITY OF SMAD2 SMAD3 SMAD4 HETEROTRIMER | Genes involved in Transcriptional activity of SMAD2/SMAD3:SMAD4 heterotrimer |
0.0 | 4.6 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
0.0 | 0.3 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.0 | 0.8 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.0 | 0.2 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
0.0 | 0.4 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
0.0 | 0.4 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
0.0 | 0.3 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.0 | 0.0 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.0 | 0.4 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
0.0 | 0.5 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.0 | 0.3 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.0 | 0.9 | REACTOME APOPTOTIC CLEAVAGE OF CELLULAR PROTEINS | Genes involved in Apoptotic cleavage of cellular proteins |
0.0 | 0.5 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
0.0 | 0.1 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.0 | 0.0 | REACTOME BOTULINUM NEUROTOXICITY | Genes involved in Botulinum neurotoxicity |
0.0 | 0.4 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.0 | 0.3 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
0.0 | 0.1 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
0.0 | 0.3 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
0.0 | 0.3 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
0.0 | 0.5 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
0.0 | 0.6 | REACTOME METABOLISM OF STEROID HORMONES AND VITAMINS A AND D | Genes involved in Metabolism of steroid hormones and vitamins A and D |
0.0 | 1.7 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
0.0 | 0.2 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
0.0 | 0.1 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
0.0 | 0.3 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.0 | 0.9 | REACTOME CLEAVAGE OF GROWING TRANSCRIPT IN THE TERMINATION REGION | Genes involved in Cleavage of Growing Transcript in the Termination Region |
0.0 | 0.2 | REACTOME PERK REGULATED GENE EXPRESSION | Genes involved in PERK regulated gene expression |
0.0 | 0.5 | REACTOME G1 PHASE | Genes involved in G1 Phase |
0.0 | 0.5 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
0.0 | 0.0 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
0.0 | 0.2 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.0 | 0.1 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
0.0 | 0.3 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
0.0 | 0.5 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.0 | 0.1 | REACTOME SIGNAL TRANSDUCTION BY L1 | Genes involved in Signal transduction by L1 |
0.0 | 0.4 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
0.0 | 0.1 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
0.0 | 0.3 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.0 | 0.4 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.0 | 0.1 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
0.0 | 0.0 | REACTOME AUTODEGRADATION OF THE E3 UBIQUITIN LIGASE COP1 | Genes involved in Autodegradation of the E3 ubiquitin ligase COP1 |
0.0 | 0.3 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.0 | 0.6 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
0.0 | 0.3 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.0 | 0.2 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
0.0 | 0.2 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
0.0 | 0.2 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
0.0 | 0.2 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
0.0 | 0.2 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.0 | 0.6 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
0.0 | 0.1 | REACTOME G PROTEIN BETA GAMMA SIGNALLING | Genes involved in G-protein beta:gamma signalling |
0.0 | 0.4 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
0.0 | 0.1 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
0.0 | 0.1 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
0.0 | 0.1 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
0.0 | 0.1 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
0.0 | 0.8 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
0.0 | 0.3 | REACTOME LIPOPROTEIN METABOLISM | Genes involved in Lipoprotein metabolism |
0.0 | 0.2 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
0.0 | 0.1 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
0.0 | 0.0 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
0.0 | 0.3 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.0 | 0.1 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
0.0 | 0.1 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
0.0 | 0.2 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.0 | 0.1 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
0.0 | 0.0 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.0 | 0.1 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.0 | 0.1 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.0 | 0.1 | REACTOME FGFR LIGAND BINDING AND ACTIVATION | Genes involved in FGFR ligand binding and activation |
0.0 | 0.1 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
0.0 | 0.1 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.0 | 0.0 | REACTOME CA DEPENDENT EVENTS | Genes involved in Ca-dependent events |
0.0 | 0.0 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.0 | 0.5 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
0.0 | 0.9 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
0.0 | 0.1 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
0.0 | 0.1 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |