Gene Symbol | Gene ID | Gene Info |
---|---|---|
Runx2
|
ENSMUSG00000039153.10 | Runx2 |
Bcl11a
|
ENSMUSG00000000861.9 | Bcl11a |
Gene | Promoter | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Bcl11a | chr11_24079612_24079763 | 983 | 0.452629 | -0.58 | 2.2e-01 | Click! |
Bcl11a | chr11_24081029_24081192 | 440 | 0.773424 | -0.51 | 3.0e-01 | Click! |
Bcl11a | chr11_24146136_24146330 | 3854 | 0.188734 | 0.14 | 8.0e-01 | Click! |
Bcl11a | chr11_24135369_24135584 | 6903 | 0.161403 | -0.10 | 8.5e-01 | Click! |
Runx2 | chr17_44814135_44814324 | 3 | 0.980813 | -0.66 | 1.6e-01 | Click! |
Runx2 | chr17_44736318_44736469 | 217 | 0.776357 | -0.42 | 4.1e-01 | Click! |
Runx2 | chr17_44814364_44814556 | 121 | 0.968856 | 0.18 | 7.3e-01 | Click! |
Runx2 | chr17_44813941_44814092 | 210 | 0.945746 | 0.13 | 8.0e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr13_93630535_93630727 | 0.78 |
Gm15622 |
predicted gene 15622 |
5249 |
0.17 |
chrY_90740044_90740606 | 0.76 |
Mid1-ps1 |
midline 1, pseudogene 1 |
12732 |
0.18 |
chr13_93633844_93634026 | 0.66 |
Bhmt |
betaine-homocysteine methyltransferase |
3631 |
0.19 |
chr2_58770053_58770204 | 0.62 |
Upp2 |
uridine phosphorylase 2 |
4803 |
0.23 |
chr6_136954835_136955023 | 0.61 |
Pde6h |
phosphodiesterase 6H, cGMP-specific, cone, gamma |
396 |
0.8 |
chr13_20724550_20724701 | 0.58 |
Gm7611 |
predicted gene 7611 |
19243 |
0.17 |
chr9_121911874_121912245 | 0.57 |
Cyp8b1 |
cytochrome P450, family 8, subfamily b, polypeptide 1 |
4246 |
0.1 |
chr6_38120784_38120952 | 0.53 |
Gm23231 |
predicted gene, 23231 |
2485 |
0.22 |
chr13_63254050_63254201 | 0.52 |
Gm47603 |
predicted gene, 47603 |
1439 |
0.24 |
chr1_191311551_191311721 | 0.51 |
Nenf |
neuron derived neurotrophic factor |
6558 |
0.15 |
chr3_139793873_139794024 | 0.51 |
Gm32693 |
predicted gene, 32693 |
13189 |
0.23 |
chr19_29379987_29380204 | 0.50 |
Gm36043 |
predicted gene, 36043 |
504 |
0.72 |
chr11_114907736_114907887 | 0.50 |
Gm11698 |
predicted gene 11698 |
920 |
0.43 |
chr8_35207938_35208089 | 0.49 |
Gm34474 |
predicted gene, 34474 |
10625 |
0.14 |
chr19_4125330_4125504 | 0.49 |
Aip |
aryl-hydrocarbon receptor-interacting protein |
373 |
0.46 |
chr6_136957097_136957248 | 0.46 |
Pde6h |
phosphodiesterase 6H, cGMP-specific, cone, gamma |
2089 |
0.24 |
chr16_10838476_10838781 | 0.46 |
Rmi2 |
RecQ mediated genome instability 2 |
3560 |
0.12 |
chr8_23193374_23193629 | 0.46 |
Gpat4 |
glycerol-3-phosphate acyltransferase 4 |
2563 |
0.17 |
chr13_93621073_93621244 | 0.46 |
Gm15622 |
predicted gene 15622 |
4224 |
0.19 |
chr16_92369388_92369556 | 0.45 |
Kcne1 |
potassium voltage-gated channel, Isk-related subfamily, member 1 |
10004 |
0.12 |
chr9_46197938_46198202 | 0.45 |
Sik3 |
SIK family kinase 3 |
21501 |
0.1 |
chr19_44394314_44394509 | 0.44 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
12279 |
0.14 |
chr6_38122806_38123205 | 0.44 |
Atp6v0a4 |
ATPase, H+ transporting, lysosomal V0 subunit A4 |
1484 |
0.34 |
chr10_95814259_95814410 | 0.43 |
Gm47719 |
predicted gene, 47719 |
3236 |
0.16 |
chr15_81301146_81301436 | 0.43 |
8430426J06Rik |
RIKEN cDNA 8430426J06 gene |
11575 |
0.15 |
chr4_46538695_46538852 | 0.42 |
Trim14 |
tripartite motif-containing 14 |
2632 |
0.18 |
chr14_51256175_51256326 | 0.42 |
Rnase2a |
ribonuclease, RNase A family, 2A (liver, eosinophil-derived neurotoxin) |
138 |
0.93 |
chr18_10934499_10934650 | 0.41 |
Gm7575 |
predicted gene 7575 |
5690 |
0.24 |
chr2_147989563_147989714 | 0.39 |
9030622O22Rik |
RIKEN cDNA 9030622O22 gene |
13453 |
0.21 |
chr12_69767338_69767491 | 0.39 |
Mir681 |
microRNA 681 |
3470 |
0.16 |
chr13_93632868_93633228 | 0.39 |
Bhmt |
betaine-homocysteine methyltransferase |
4518 |
0.17 |
chr5_125383241_125383564 | 0.39 |
Ubc |
ubiquitin C |
5784 |
0.13 |
chr7_68709687_68709838 | 0.39 |
Gm44692 |
predicted gene 44692 |
16705 |
0.21 |
chr6_72809634_72809816 | 0.38 |
Tcf7l1 |
transcription factor 7 like 1 (T cell specific, HMG box) |
20471 |
0.15 |
chr19_44396138_44396537 | 0.38 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
10353 |
0.14 |
chr13_93617645_93617823 | 0.38 |
Gm15622 |
predicted gene 15622 |
7648 |
0.17 |
chr12_99550720_99551025 | 0.38 |
Foxn3 |
forkhead box N3 |
12636 |
0.13 |
chr9_98429187_98429338 | 0.38 |
Rbp1 |
retinol binding protein 1, cellular |
6301 |
0.22 |
chr19_44404842_44405075 | 0.38 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
1732 |
0.29 |
chr9_21837693_21838006 | 0.38 |
Angptl8 |
angiopoietin-like 8 |
2339 |
0.17 |
chr12_110866355_110866579 | 0.37 |
Mpc1-ps |
mitochondrial pyruvate carrier 1, pseudogene |
7573 |
0.09 |
chr3_89880596_89880747 | 0.37 |
Gm42809 |
predicted gene 42809 |
32245 |
0.09 |
chr13_21914635_21914872 | 0.37 |
Gm44456 |
predicted gene, 44456 |
10263 |
0.06 |
chr18_9487404_9487561 | 0.37 |
Gm7527 |
predicted gene 7527 |
8139 |
0.16 |
chrX_12189621_12189798 | 0.37 |
Gm14521 |
predicted gene 14521 |
9642 |
0.24 |
chr6_82362227_82362387 | 0.37 |
Gm44209 |
predicted gene, 44209 |
39324 |
0.16 |
chr7_130715166_130715334 | 0.37 |
Tacc2 |
transforming, acidic coiled-coil containing protein 2 |
1573 |
0.38 |
chr6_90751388_90751625 | 0.37 |
Iqsec1 |
IQ motif and Sec7 domain 1 |
6044 |
0.19 |
chr5_45431101_45431509 | 0.37 |
Gm42413 |
predicted gene, 42413 |
3084 |
0.18 |
chr6_90542416_90542793 | 0.36 |
Aldh1l1 |
aldehyde dehydrogenase 1 family, member L1 |
8185 |
0.14 |
chr9_122353524_122353735 | 0.36 |
Abhd5 |
abhydrolase domain containing 5 |
1840 |
0.27 |
chr3_27569673_27569830 | 0.36 |
Mir3092 |
microRNA 3092 |
15244 |
0.22 |
chr3_18937177_18937328 | 0.36 |
Gm30341 |
predicted gene, 30341 |
184175 |
0.03 |
chr8_26593661_26593813 | 0.36 |
Gm39149 |
predicted gene, 39149 |
13935 |
0.17 |
chr14_75069381_75069532 | 0.36 |
Rubcnl |
RUN and cysteine rich domain containing beclin 1 interacting protein like |
32834 |
0.14 |
chr15_7012544_7012713 | 0.35 |
Gm38282 |
predicted gene, 38282 |
16591 |
0.26 |
chr8_12798830_12798981 | 0.35 |
Atp11a |
ATPase, class VI, type 11A |
12511 |
0.15 |
chr6_99175134_99175460 | 0.35 |
Foxp1 |
forkhead box P1 |
12279 |
0.28 |
chr3_130709873_130710026 | 0.35 |
Ostc |
oligosaccharyltransferase complex subunit (non-catalytic) |
505 |
0.69 |
chr18_29774449_29774600 | 0.35 |
Gm7917 |
predicted gene 7917 |
116928 |
0.07 |
chrX_140529175_140529345 | 0.35 |
Tsc22d3 |
TSC22 domain family, member 3 |
13408 |
0.19 |
chr13_93627953_93628190 | 0.35 |
Gm15622 |
predicted gene 15622 |
2689 |
0.23 |
chr9_47634526_47634677 | 0.35 |
Cadm1 |
cell adhesion molecule 1 |
104228 |
0.06 |
chr10_17563057_17563274 | 0.34 |
Gm47770 |
predicted gene, 47770 |
36251 |
0.15 |
chr6_83774253_83774422 | 0.34 |
Tex261 |
testis expressed gene 261 |
1421 |
0.22 |
chr8_109705135_109705296 | 0.34 |
Zfp821 |
zinc finger protein 821 |
331 |
0.85 |
chr2_3787665_3787866 | 0.34 |
Fam107b |
family with sequence similarity 107, member B |
13819 |
0.19 |
chr14_27197125_27197310 | 0.34 |
Gm7591 |
predicted gene 7591 |
13180 |
0.2 |
chr4_125436661_125436812 | 0.34 |
Grik3 |
glutamate receptor, ionotropic, kainate 3 |
53964 |
0.13 |
chr9_78501386_78501557 | 0.34 |
Eef1a1 |
eukaryotic translation elongation factor 1 alpha 1 |
12320 |
0.11 |
chr9_121908826_121908977 | 0.34 |
Ackr2 |
atypical chemokine receptor 2 |
2637 |
0.13 |
chrX_169973316_169973553 | 0.34 |
Mid1 |
midline 1 |
549 |
0.72 |
chr10_24228216_24228389 | 0.34 |
Moxd1 |
monooxygenase, DBH-like 1 |
4757 |
0.23 |
chr11_102155524_102155688 | 0.33 |
Tmem101 |
transmembrane protein 101 |
741 |
0.43 |
chr4_118137607_118137758 | 0.33 |
St3gal3 |
ST3 beta-galactoside alpha-2,3-sialyltransferase 3 |
2768 |
0.22 |
chr2_31497033_31497351 | 0.33 |
Ass1 |
argininosuccinate synthetase 1 |
580 |
0.75 |
chr19_44404613_44404820 | 0.33 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
1974 |
0.26 |
chr2_164161443_164161616 | 0.33 |
n-R5s207 |
nuclear encoded rRNA 5S 207 |
4008 |
0.11 |
chr5_25042147_25042323 | 0.32 |
Prkag2 |
protein kinase, AMP-activated, gamma 2 non-catalytic subunit |
46482 |
0.11 |
chr3_27704926_27705320 | 0.32 |
Fndc3b |
fibronectin type III domain containing 3B |
5275 |
0.31 |
chr7_101298326_101298921 | 0.32 |
Atg16l2 |
autophagy related 16-like 2 (S. cerevisiae) |
1454 |
0.28 |
chr11_48810266_48810425 | 0.32 |
Trim41 |
tripartite motif-containing 41 |
2050 |
0.15 |
chr11_94207284_94207435 | 0.32 |
Tob1 |
transducer of ErbB-2.1 |
4095 |
0.21 |
chr19_46133855_46134398 | 0.32 |
Elovl3 |
elongation of very long chain fatty acids (FEN1/Elo2, SUR4/Elo3, yeast)-like 3 |
2229 |
0.19 |
chr13_93626581_93626763 | 0.32 |
Gm15622 |
predicted gene 15622 |
1290 |
0.4 |
chr5_99533469_99533635 | 0.32 |
Gm16227 |
predicted gene 16227 |
22870 |
0.17 |
chr3_94391090_94391241 | 0.31 |
Lingo4 |
leucine rich repeat and Ig domain containing 4 |
7352 |
0.07 |
chr4_62010452_62010603 | 0.31 |
Mup-ps20 |
major urinary protein, pseudogene 20 |
4330 |
0.17 |
chr14_11657532_11657710 | 0.31 |
Ptprg |
protein tyrosine phosphatase, receptor type, G |
104040 |
0.06 |
chr17_85026588_85026861 | 0.31 |
Slc3a1 |
solute carrier family 3, member 1 |
1652 |
0.37 |
chr1_180163257_180163435 | 0.31 |
Cdc42bpa |
CDC42 binding protein kinase alpha |
2339 |
0.24 |
chr10_95302204_95302355 | 0.31 |
Gm48880 |
predicted gene, 48880 |
12574 |
0.14 |
chr6_90569321_90569498 | 0.31 |
Aldh1l1 |
aldehyde dehydrogenase 1 family, member L1 |
1703 |
0.29 |
chr2_58793901_58794054 | 0.31 |
Upp2 |
uridine phosphorylase 2 |
28652 |
0.17 |
chr4_3084189_3084369 | 0.31 |
Vmn1r-ps2 |
vomeronasal 1 receptor, pseudogene 2 |
20313 |
0.18 |
chr4_141766764_141767191 | 0.31 |
Dnajc16 |
DnaJ heat shock protein family (Hsp40) member C16 |
7676 |
0.12 |
chr2_180692738_180692930 | 0.31 |
Gm22502 |
predicted gene, 22502 |
5229 |
0.13 |
chr4_106144651_106144802 | 0.31 |
Hspd1-ps4 |
heat shock protein 1 (chaperonin), pseudogene 4 |
6948 |
0.18 |
chr16_8189782_8190110 | 0.31 |
Gm49535 |
predicted gene, 49535 |
86158 |
0.09 |
chr15_99615190_99615358 | 0.31 |
Aqp6 |
aquaporin 6 |
13874 |
0.1 |
chr8_119827691_119828021 | 0.31 |
Cotl1 |
coactosin-like 1 (Dictyostelium) |
5139 |
0.19 |
chr9_86205855_86206006 | 0.30 |
Gm18016 |
predicted gene, 18016 |
29915 |
0.22 |
chr11_98361287_98361438 | 0.30 |
Stard3 |
START domain containing 3 |
2918 |
0.11 |
chr6_90594524_90595009 | 0.30 |
Gm15756 |
predicted gene 15756 |
5182 |
0.15 |
chr19_46984149_46984307 | 0.30 |
Nt5c2 |
5'-nucleotidase, cytosolic II |
14660 |
0.14 |
chr17_3079403_3079656 | 0.30 |
Pisd-ps2 |
phosphatidylserine decarboxylase, pseudogene 2 |
4511 |
0.1 |
chr3_95312699_95312852 | 0.30 |
Cers2 |
ceramide synthase 2 |
2016 |
0.14 |
chr5_36043248_36043399 | 0.30 |
Afap1 |
actin filament associated protein 1 |
56318 |
0.14 |
chr2_103846113_103846314 | 0.30 |
Gm13879 |
predicted gene 13879 |
2557 |
0.13 |
chr15_35885182_35885333 | 0.30 |
Vps13b |
vacuolar protein sorting 13B |
13535 |
0.16 |
chr9_54307421_54307614 | 0.30 |
Gldnos |
gliomedin, opposite strand |
5947 |
0.2 |
chr16_24180793_24181005 | 0.30 |
Gm32126 |
predicted gene, 32126 |
12338 |
0.2 |
chr7_44298836_44299206 | 0.30 |
Gm7238 |
predicted gene 7238 |
1866 |
0.11 |
chr8_109998140_109998715 | 0.30 |
Tat |
tyrosine aminotransferase |
7921 |
0.12 |
chr6_146461140_146461291 | 0.30 |
Gm15720 |
predicted gene 15720 |
2392 |
0.31 |
chr5_125461980_125462146 | 0.30 |
Gm43756 |
predicted gene 43756 |
9434 |
0.11 |
chr5_36390576_36390854 | 0.29 |
Sorcs2 |
sortilin-related VPS10 domain containing receptor 2 |
7392 |
0.21 |
chr4_120599080_120599244 | 0.29 |
Gm8439 |
predicted gene 8439 |
10416 |
0.14 |
chr2_166193015_166193397 | 0.29 |
Gm11466 |
predicted gene 11466 |
2344 |
0.23 |
chr15_31117050_31117219 | 0.29 |
Gm26416 |
predicted gene, 26416 |
77204 |
0.08 |
chr14_45552508_45552659 | 0.29 |
Gm49123 |
predicted gene, 49123 |
1819 |
0.18 |
chr9_121388029_121388181 | 0.29 |
Trak1 |
trafficking protein, kinesin binding 1 |
3856 |
0.22 |
chr13_113023247_113023398 | 0.29 |
Cdc20b |
cell division cycle 20B |
11789 |
0.08 |
chr18_54921904_54922070 | 0.29 |
Zfp608 |
zinc finger protein 608 |
26425 |
0.17 |
chr12_69768209_69768388 | 0.29 |
Mir681 |
microRNA 681 |
4354 |
0.15 |
chr1_193870865_193871025 | 0.29 |
Gm21362 |
predicted gene, 21362 |
3936 |
0.37 |
chr6_120466674_120466825 | 0.29 |
Il17ra |
interleukin 17 receptor A |
3502 |
0.18 |
chr1_59386656_59386968 | 0.29 |
Gm29016 |
predicted gene 29016 |
7882 |
0.2 |
chr14_102983264_102983448 | 0.29 |
Kctd12 |
potassium channel tetramerisation domain containing 12 |
719 |
0.39 |
chr1_154120790_154120970 | 0.29 |
A830008E24Rik |
RIKEN cDNA A830008E24 gene |
2929 |
0.26 |
chr17_87365352_87365503 | 0.29 |
0610012D04Rik |
RIKEN cDNA 0610012D04 gene |
965 |
0.48 |
chr9_47712314_47712465 | 0.29 |
Gm47198 |
predicted gene, 47198 |
58752 |
0.13 |
chr16_24172719_24172906 | 0.28 |
Gm32126 |
predicted gene, 32126 |
4251 |
0.24 |
chr9_57276467_57276644 | 0.28 |
1700017B05Rik |
RIKEN cDNA 1700017B05 gene |
13943 |
0.15 |
chr5_137152245_137152410 | 0.28 |
Muc3 |
mucin 3, intestinal |
3005 |
0.14 |
chr6_87129962_87130142 | 0.28 |
Gm44415 |
predicted gene, 44415 |
10800 |
0.15 |
chr1_106317050_106317225 | 0.28 |
Phlpp1 |
PH domain and leucine rich repeat protein phosphatase 1 |
101 |
0.98 |
chr11_49088297_49088883 | 0.28 |
Gm12188 |
predicted gene 12188 |
47 |
0.79 |
chr4_33243933_33244238 | 0.28 |
Pnrc1 |
proline-rich nuclear receptor coactivator 1 |
3490 |
0.21 |
chr9_78022288_78022639 | 0.28 |
Gm47829 |
predicted gene, 47829 |
5482 |
0.12 |
chr9_42306437_42306591 | 0.28 |
Gm26272 |
predicted gene, 26272 |
11167 |
0.16 |
chr3_86793333_86793690 | 0.28 |
Dclk2 |
doublecortin-like kinase 2 |
1196 |
0.49 |
chr10_19087108_19087313 | 0.28 |
1700124M09Rik |
RIKEN cDNA 1700124M09 gene |
32 |
0.97 |
chr8_107165249_107165400 | 0.27 |
Cyb5b |
cytochrome b5 type B |
591 |
0.71 |
chr9_100521232_100521383 | 0.27 |
Gm28586 |
predicted gene 28586 |
9764 |
0.14 |
chr2_170153375_170154192 | 0.27 |
Zfp217 |
zinc finger protein 217 |
5680 |
0.31 |
chr3_133765600_133766533 | 0.27 |
Gm6135 |
prediticted gene 6135 |
25438 |
0.2 |
chr12_111518316_111518505 | 0.27 |
Gm40578 |
predicted gene, 40578 |
17570 |
0.1 |
chr19_58370035_58370186 | 0.27 |
Gfra1 |
glial cell line derived neurotrophic factor family receptor alpha 1 |
84356 |
0.09 |
chr11_101376283_101376946 | 0.27 |
G6pc |
glucose-6-phosphatase, catalytic |
9053 |
0.06 |
chr17_17871761_17871919 | 0.27 |
Fpr1 |
formyl peptide receptor 1 |
12100 |
0.09 |
chr10_77061550_77061715 | 0.27 |
Col18a1 |
collagen, type XVIII, alpha 1 |
1635 |
0.31 |
chr18_20982537_20982795 | 0.27 |
Rnf138 |
ring finger protein 138 |
18675 |
0.18 |
chr10_126997803_126998005 | 0.27 |
Mir546 |
microRNA 546 |
536 |
0.51 |
chr7_105399056_105399443 | 0.27 |
Fam160a2 |
family with sequence similarity 160, member A2 |
736 |
0.37 |
chr5_28076176_28076405 | 0.27 |
Insig1 |
insulin induced gene 1 |
1624 |
0.34 |
chr17_84265841_84265992 | 0.27 |
Gm24492 |
predicted gene, 24492 |
21831 |
0.17 |
chr13_93629307_93629685 | 0.27 |
Gm15622 |
predicted gene 15622 |
4114 |
0.18 |
chr14_62057489_62057640 | 0.27 |
Gm47953 |
predicted gene, 47953 |
45245 |
0.16 |
chr16_43520364_43520526 | 0.27 |
Zbtb20 |
zinc finger and BTB domain containing 20 |
10137 |
0.25 |
chr1_88228088_88228708 | 0.27 |
Mroh2a |
maestro heat-like repeat family member 2A |
1367 |
0.22 |
chr18_84210867_84211018 | 0.27 |
Gm50311 |
predicted gene, 50311 |
8018 |
0.25 |
chr4_118015631_118015782 | 0.27 |
St3gal3 |
ST3 beta-galactoside alpha-2,3-sialyltransferase 3 |
16176 |
0.16 |
chr6_31126715_31126894 | 0.27 |
Gm13835 |
predicted gene 13835 |
15859 |
0.11 |
chr2_26561982_26562156 | 0.26 |
Gm13358 |
predicted gene 13358 |
3444 |
0.12 |
chr8_46791277_46791428 | 0.26 |
Irf2 |
interferon regulatory factor 2 |
2147 |
0.26 |
chr11_43960310_43960461 | 0.26 |
Gm12153 |
predicted gene 12153 |
1296 |
0.56 |
chr16_28927241_28927396 | 0.26 |
Mb21d2 |
Mab-21 domain containing 2 |
2355 |
0.37 |
chr2_31485846_31486386 | 0.26 |
Ass1 |
argininosuccinate synthetase 1 |
11656 |
0.18 |
chr11_48994173_48994324 | 0.26 |
Tgtp1 |
T cell specific GTPase 1 |
76 |
0.93 |
chr5_136246481_136246632 | 0.26 |
Sh2b2 |
SH2B adaptor protein 2 |
0 |
0.97 |
chr3_83863714_83863905 | 0.26 |
Tlr2 |
toll-like receptor 2 |
22042 |
0.18 |
chr8_121575762_121575941 | 0.26 |
Fbxo31 |
F-box protein 31 |
2896 |
0.15 |
chr12_70219339_70219561 | 0.26 |
Pygl |
liver glycogen phosphorylase |
7895 |
0.14 |
chr5_53993031_53993199 | 0.26 |
Stim2 |
stromal interaction molecule 2 |
5384 |
0.27 |
chr15_86202799_86202950 | 0.26 |
Gm22818 |
predicted gene, 22818 |
9783 |
0.16 |
chr13_23307496_23307808 | 0.26 |
4930557F10Rik |
RIKEN cDNA 4930557F10 gene |
5748 |
0.09 |
chr13_63520249_63520412 | 0.26 |
Ptch1 |
patched 1 |
8301 |
0.15 |
chr10_111318102_111318256 | 0.26 |
Gm40761 |
predicted gene, 40761 |
18945 |
0.17 |
chr15_31357037_31357188 | 0.26 |
Ankrd33b |
ankyrin repeat domain 33B |
10420 |
0.16 |
chr6_121863509_121863691 | 0.26 |
Mug1 |
murinoglobulin 1 |
21977 |
0.18 |
chr12_85468727_85468927 | 0.26 |
Fos |
FBJ osteosarcoma oncogene |
5063 |
0.18 |
chr6_142788740_142788928 | 0.26 |
Sult6b2 |
sulfotransferase family 6B, member 2 |
15632 |
0.16 |
chr16_36930894_36931070 | 0.26 |
Golgb1 |
golgi autoantigen, golgin subfamily b, macrogolgin 1 |
418 |
0.74 |
chr14_66153104_66153314 | 0.26 |
Ptk2b |
PTK2 protein tyrosine kinase 2 beta |
7469 |
0.17 |
chr3_18080789_18080940 | 0.26 |
Gm23726 |
predicted gene, 23726 |
11538 |
0.2 |
chr2_5592313_5592487 | 0.26 |
Gm13216 |
predicted gene 13216 |
11171 |
0.27 |
chr13_32970123_32970274 | 0.26 |
Serpinb6b |
serine (or cysteine) peptidase inhibitor, clade B, member 6b |
1300 |
0.35 |
chr7_83627016_83627173 | 0.26 |
Gm16638 |
predicted gene, 16638 |
4748 |
0.13 |
chr11_100836746_100836921 | 0.26 |
Stat5b |
signal transducer and activator of transcription 5B |
13705 |
0.12 |
chr10_24228469_24228788 | 0.25 |
Moxd1 |
monooxygenase, DBH-like 1 |
5083 |
0.22 |
chr12_25283699_25283904 | 0.25 |
Gm19340 |
predicted gene, 19340 |
1206 |
0.47 |
chr19_34813904_34814131 | 0.25 |
Mir107 |
microRNA 107 |
6756 |
0.14 |
chr3_144114277_144114432 | 0.25 |
Gm34078 |
predicted gene, 34078 |
21400 |
0.21 |
chr11_116021292_116021891 | 0.25 |
H3f3b |
H3.3 histone B |
2882 |
0.14 |
chr15_9361830_9361987 | 0.25 |
Ugt3a2 |
UDP glycosyltransferases 3 family, polypeptide A2 |
26319 |
0.17 |
chr17_28694775_28694944 | 0.25 |
Mapk14 |
mitogen-activated protein kinase 14 |
2291 |
0.2 |
chr11_57688556_57688722 | 0.25 |
4933426K07Rik |
RIKEN cDNA 4933426K07 gene |
30813 |
0.12 |
chr18_20938674_20939098 | 0.25 |
Rnf125 |
ring finger protein 125 |
5739 |
0.23 |
chr17_56194933_56195115 | 0.25 |
Mydgf |
myeloid derived growth factor |
11104 |
0.09 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 1.0 | GO:0010046 | response to mycotoxin(GO:0010046) |
0.2 | 1.3 | GO:0071265 | amino acid salvage(GO:0043102) L-methionine biosynthetic process(GO:0071265) L-methionine salvage(GO:0071267) |
0.2 | 0.7 | GO:1903964 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.2 | 0.8 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
0.1 | 0.5 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
0.1 | 0.8 | GO:0032933 | response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
0.1 | 0.5 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
0.1 | 0.4 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
0.1 | 0.3 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
0.1 | 0.4 | GO:0034638 | phosphatidylcholine catabolic process(GO:0034638) |
0.1 | 0.3 | GO:0034165 | positive regulation of toll-like receptor 9 signaling pathway(GO:0034165) |
0.1 | 0.5 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
0.1 | 0.3 | GO:0050713 | negative regulation of interleukin-1 beta secretion(GO:0050713) |
0.1 | 0.1 | GO:0010536 | positive regulation of activation of Janus kinase activity(GO:0010536) |
0.1 | 0.2 | GO:0009092 | homoserine metabolic process(GO:0009092) transsulfuration(GO:0019346) |
0.1 | 0.1 | GO:0032345 | negative regulation of aldosterone metabolic process(GO:0032345) negative regulation of aldosterone biosynthetic process(GO:0032348) negative regulation of cortisol biosynthetic process(GO:2000065) |
0.1 | 0.2 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
0.1 | 0.5 | GO:0035999 | tetrahydrofolate interconversion(GO:0035999) |
0.1 | 0.3 | GO:1990414 | replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
0.1 | 0.2 | GO:2000850 | negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
0.1 | 0.2 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.1 | 0.2 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
0.1 | 0.3 | GO:0070447 | positive regulation of oligodendrocyte progenitor proliferation(GO:0070447) |
0.1 | 0.4 | GO:0006642 | triglyceride mobilization(GO:0006642) |
0.1 | 0.2 | GO:0042851 | L-alanine metabolic process(GO:0042851) |
0.1 | 0.3 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
0.1 | 0.5 | GO:0070874 | negative regulation of glycogen metabolic process(GO:0070874) |
0.1 | 0.2 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.1 | 0.1 | GO:0060125 | negative regulation of growth hormone secretion(GO:0060125) |
0.1 | 0.3 | GO:0039689 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
0.1 | 0.2 | GO:0035672 | oligopeptide transmembrane transport(GO:0035672) |
0.1 | 0.2 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
0.1 | 0.2 | GO:0051344 | negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
0.1 | 0.2 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
0.1 | 0.2 | GO:1901509 | regulation of endothelial tube morphogenesis(GO:1901509) |
0.1 | 0.2 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
0.1 | 0.2 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
0.1 | 0.2 | GO:0007227 | signal transduction downstream of smoothened(GO:0007227) |
0.1 | 0.4 | GO:0006477 | protein sulfation(GO:0006477) |
0.1 | 0.2 | GO:0010748 | negative regulation of plasma membrane long-chain fatty acid transport(GO:0010748) |
0.1 | 0.2 | GO:0007525 | somatic muscle development(GO:0007525) |
0.1 | 0.4 | GO:0046337 | phosphatidylethanolamine metabolic process(GO:0046337) |
0.1 | 0.1 | GO:0035973 | aggrephagy(GO:0035973) |
0.1 | 0.4 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
0.1 | 0.2 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
0.1 | 0.3 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
0.1 | 0.1 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
0.1 | 0.3 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
0.1 | 0.3 | GO:0046069 | cGMP catabolic process(GO:0046069) |
0.1 | 0.3 | GO:0032819 | positive regulation of natural killer cell proliferation(GO:0032819) |
0.1 | 0.2 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
0.1 | 0.2 | GO:0015766 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.1 | 0.2 | GO:0051919 | positive regulation of fibrinolysis(GO:0051919) |
0.1 | 0.2 | GO:0030242 | pexophagy(GO:0030242) |
0.1 | 0.1 | GO:0070103 | regulation of interleukin-6-mediated signaling pathway(GO:0070103) |
0.1 | 0.2 | GO:0090292 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
0.1 | 0.2 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
0.1 | 0.2 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
0.1 | 0.2 | GO:0031627 | telomeric loop formation(GO:0031627) |
0.1 | 0.2 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
0.0 | 0.2 | GO:0002309 | T cell proliferation involved in immune response(GO:0002309) |
0.0 | 0.1 | GO:0034476 | U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) |
0.0 | 0.1 | GO:0006015 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
0.0 | 0.1 | GO:0009197 | dUDP biosynthetic process(GO:0006227) pyrimidine nucleoside diphosphate biosynthetic process(GO:0009139) pyrimidine deoxyribonucleoside diphosphate metabolic process(GO:0009196) pyrimidine deoxyribonucleoside diphosphate biosynthetic process(GO:0009197) dUDP metabolic process(GO:0046077) |
0.0 | 0.2 | GO:0002442 | serotonin production involved in inflammatory response(GO:0002351) serotonin secretion involved in inflammatory response(GO:0002442) |
0.0 | 0.2 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
0.0 | 0.1 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
0.0 | 0.4 | GO:0071243 | cellular response to arsenic-containing substance(GO:0071243) |
0.0 | 0.1 | GO:0002434 | immune complex clearance(GO:0002434) |
0.0 | 0.1 | GO:1903659 | regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
0.0 | 0.1 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.0 | 0.3 | GO:0097011 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) |
0.0 | 0.2 | GO:0006547 | histidine metabolic process(GO:0006547) |
0.0 | 0.1 | GO:0032489 | regulation of Cdc42 protein signal transduction(GO:0032489) |
0.0 | 0.2 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
0.0 | 0.0 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
0.0 | 0.1 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
0.0 | 0.0 | GO:0043380 | regulation of memory T cell differentiation(GO:0043380) |
0.0 | 0.1 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
0.0 | 0.1 | GO:1902563 | regulation of neutrophil activation(GO:1902563) |
0.0 | 0.3 | GO:0002756 | MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
0.0 | 0.0 | GO:0051142 | regulation of NK T cell proliferation(GO:0051140) positive regulation of NK T cell proliferation(GO:0051142) |
0.0 | 0.1 | GO:0070384 | Harderian gland development(GO:0070384) |
0.0 | 0.5 | GO:0072539 | T-helper 17 cell differentiation(GO:0072539) |
0.0 | 0.2 | GO:0071681 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
0.0 | 0.1 | GO:0065001 | specification of axis polarity(GO:0065001) |
0.0 | 0.1 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
0.0 | 0.1 | GO:0046061 | dATP catabolic process(GO:0046061) |
0.0 | 0.2 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
0.0 | 0.1 | GO:2000664 | positive regulation of interleukin-5 secretion(GO:2000664) positive regulation of interleukin-13 secretion(GO:2000667) |
0.0 | 0.2 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
0.0 | 0.2 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
0.0 | 0.1 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
0.0 | 0.0 | GO:0048003 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
0.0 | 0.1 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.0 | 0.2 | GO:0051136 | regulation of NK T cell differentiation(GO:0051136) positive regulation of NK T cell differentiation(GO:0051138) |
0.0 | 0.1 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
0.0 | 0.1 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
0.0 | 0.1 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
0.0 | 0.1 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
0.0 | 0.2 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
0.0 | 0.1 | GO:2000110 | negative regulation of macrophage apoptotic process(GO:2000110) |
0.0 | 0.1 | GO:2000870 | regulation of progesterone secretion(GO:2000870) |
0.0 | 0.0 | GO:0060686 | regulation of prostatic bud formation(GO:0060685) negative regulation of prostatic bud formation(GO:0060686) |
0.0 | 0.1 | GO:0006562 | proline catabolic process(GO:0006562) |
0.0 | 0.1 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
0.0 | 0.2 | GO:0035360 | positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
0.0 | 0.1 | GO:1903911 | positive regulation of postsynaptic membrane organization(GO:1901628) positive regulation of receptor clustering(GO:1903911) regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904393) positive regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904395) |
0.0 | 0.1 | GO:0045897 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
0.0 | 0.1 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
0.0 | 0.0 | GO:0032736 | positive regulation of interleukin-13 production(GO:0032736) |
0.0 | 0.1 | GO:0042427 | serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
0.0 | 0.1 | GO:0044038 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) |
0.0 | 0.0 | GO:0003331 | regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
0.0 | 0.1 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
0.0 | 0.1 | GO:0048859 | formation of anatomical boundary(GO:0048859) |
0.0 | 0.1 | GO:0021938 | smoothened signaling pathway involved in regulation of cerebellar granule cell precursor cell proliferation(GO:0021938) |
0.0 | 0.2 | GO:1901339 | regulation of store-operated calcium channel activity(GO:1901339) |
0.0 | 0.1 | GO:0009838 | abscission(GO:0009838) |
0.0 | 0.1 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.0 | 0.1 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
0.0 | 0.1 | GO:0006114 | glycerol biosynthetic process(GO:0006114) |
0.0 | 0.1 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
0.0 | 0.0 | GO:0002513 | tolerance induction to self antigen(GO:0002513) |
0.0 | 0.1 | GO:1903011 | negative regulation of bone development(GO:1903011) |
0.0 | 0.1 | GO:0034241 | positive regulation of macrophage fusion(GO:0034241) |
0.0 | 0.3 | GO:0007097 | nuclear migration(GO:0007097) |
0.0 | 0.3 | GO:0048680 | positive regulation of axon regeneration(GO:0048680) |
0.0 | 0.2 | GO:0070189 | kynurenine metabolic process(GO:0070189) |
0.0 | 0.1 | GO:0001712 | ectodermal cell fate commitment(GO:0001712) |
0.0 | 0.1 | GO:0071442 | positive regulation of histone H3-K14 acetylation(GO:0071442) |
0.0 | 0.1 | GO:0060137 | maternal process involved in parturition(GO:0060137) |
0.0 | 0.0 | GO:0009155 | purine deoxyribonucleotide catabolic process(GO:0009155) |
0.0 | 0.1 | GO:0018197 | peptidyl-aspartic acid modification(GO:0018197) |
0.0 | 0.8 | GO:0045742 | positive regulation of epidermal growth factor receptor signaling pathway(GO:0045742) positive regulation of ERBB signaling pathway(GO:1901186) |
0.0 | 0.1 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.0 | 0.0 | GO:1902804 | negative regulation of synaptic vesicle transport(GO:1902804) |
0.0 | 0.2 | GO:0042270 | protection from natural killer cell mediated cytotoxicity(GO:0042270) |
0.0 | 0.2 | GO:0043651 | linoleic acid metabolic process(GO:0043651) |
0.0 | 0.1 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
0.0 | 0.3 | GO:0030953 | astral microtubule organization(GO:0030953) |
0.0 | 0.1 | GO:0045726 | positive regulation of integrin biosynthetic process(GO:0045726) |
0.0 | 0.1 | GO:0008050 | female courtship behavior(GO:0008050) |
0.0 | 0.1 | GO:1902744 | negative regulation of lamellipodium organization(GO:1902744) |
0.0 | 0.1 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
0.0 | 0.1 | GO:1900147 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
0.0 | 0.3 | GO:0090308 | regulation of methylation-dependent chromatin silencing(GO:0090308) |
0.0 | 0.1 | GO:0010901 | regulation of very-low-density lipoprotein particle remodeling(GO:0010901) |
0.0 | 0.4 | GO:0097237 | cellular response to toxic substance(GO:0097237) |
0.0 | 0.1 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
0.0 | 0.0 | GO:0030656 | regulation of vitamin metabolic process(GO:0030656) |
0.0 | 0.2 | GO:0007220 | Notch receptor processing(GO:0007220) |
0.0 | 0.2 | GO:0021540 | corpus callosum morphogenesis(GO:0021540) |
0.0 | 0.1 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
0.0 | 0.1 | GO:1990928 | response to amino acid starvation(GO:1990928) |
0.0 | 0.2 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
0.0 | 0.1 | GO:0035283 | central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
0.0 | 0.2 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) |
0.0 | 0.1 | GO:2000645 | negative regulation of receptor catabolic process(GO:2000645) |
0.0 | 0.1 | GO:1902534 | single-organism membrane invagination(GO:1902534) |
0.0 | 0.1 | GO:1901563 | response to camptothecin(GO:1901563) |
0.0 | 0.0 | GO:0061144 | alveolar secondary septum development(GO:0061144) |
0.0 | 0.1 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
0.0 | 0.1 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.0 | 0.2 | GO:0046606 | negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
0.0 | 0.1 | GO:1905216 | positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
0.0 | 0.2 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.0 | 0.1 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
0.0 | 0.1 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
0.0 | 0.2 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
0.0 | 0.1 | GO:0002086 | diaphragm contraction(GO:0002086) |
0.0 | 0.1 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.0 | 0.1 | GO:0060789 | hair follicle placode formation(GO:0060789) |
0.0 | 0.1 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
0.0 | 0.1 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
0.0 | 0.2 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
0.0 | 0.1 | GO:0046104 | thymidine metabolic process(GO:0046104) |
0.0 | 0.1 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
0.0 | 0.2 | GO:0002830 | positive regulation of type 2 immune response(GO:0002830) |
0.0 | 0.1 | GO:0006116 | NADH oxidation(GO:0006116) |
0.0 | 0.1 | GO:0016095 | polyprenol catabolic process(GO:0016095) |
0.0 | 0.1 | GO:0034372 | very-low-density lipoprotein particle remodeling(GO:0034372) |
0.0 | 0.1 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
0.0 | 0.1 | GO:0071038 | nuclear polyadenylation-dependent tRNA catabolic process(GO:0071038) |
0.0 | 0.1 | GO:0043553 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
0.0 | 0.1 | GO:0043321 | regulation of natural killer cell degranulation(GO:0043321) |
0.0 | 0.1 | GO:0060315 | negative regulation of ryanodine-sensitive calcium-release channel activity(GO:0060315) |
0.0 | 0.1 | GO:1900238 | positive regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:0035793) regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:1900238) positive regulation of metanephric mesenchymal cell migration(GO:2000591) |
0.0 | 0.1 | GO:0006551 | leucine metabolic process(GO:0006551) |
0.0 | 0.1 | GO:0044359 | modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) |
0.0 | 0.1 | GO:0032079 | positive regulation of endodeoxyribonuclease activity(GO:0032079) |
0.0 | 0.1 | GO:0044154 | histone H3-K14 acetylation(GO:0044154) |
0.0 | 0.1 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
0.0 | 0.1 | GO:0046439 | cysteine catabolic process(GO:0009093) L-cysteine catabolic process(GO:0019448) L-cysteine metabolic process(GO:0046439) |
0.0 | 0.2 | GO:0015884 | folic acid transport(GO:0015884) |
0.0 | 0.1 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
0.0 | 0.2 | GO:0010759 | positive regulation of macrophage chemotaxis(GO:0010759) |
0.0 | 0.1 | GO:2000828 | regulation of parathyroid hormone secretion(GO:2000828) |
0.0 | 0.1 | GO:0033152 | immunoglobulin V(D)J recombination(GO:0033152) |
0.0 | 0.2 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
0.0 | 0.1 | GO:0071674 | mononuclear cell migration(GO:0071674) |
0.0 | 0.1 | GO:0045908 | negative regulation of vasodilation(GO:0045908) |
0.0 | 0.3 | GO:0047497 | establishment of mitochondrion localization, microtubule-mediated(GO:0034643) mitochondrion transport along microtubule(GO:0047497) |
0.0 | 0.1 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
0.0 | 0.1 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
0.0 | 0.1 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
0.0 | 0.2 | GO:0045916 | negative regulation of complement activation(GO:0045916) negative regulation of protein activation cascade(GO:2000258) |
0.0 | 0.1 | GO:0010637 | negative regulation of mitochondrial fusion(GO:0010637) |
0.0 | 0.3 | GO:0042178 | xenobiotic catabolic process(GO:0042178) |
0.0 | 0.1 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
0.0 | 0.0 | GO:0051122 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
0.0 | 0.1 | GO:0072282 | metanephric nephron tubule morphogenesis(GO:0072282) |
0.0 | 0.1 | GO:0072307 | metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
0.0 | 0.1 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
0.0 | 0.1 | GO:0002677 | negative regulation of chronic inflammatory response(GO:0002677) |
0.0 | 0.3 | GO:0042535 | positive regulation of tumor necrosis factor biosynthetic process(GO:0042535) |
0.0 | 0.0 | GO:0090403 | oxidative stress-induced premature senescence(GO:0090403) |
0.0 | 0.3 | GO:0032306 | regulation of prostaglandin secretion(GO:0032306) |
0.0 | 0.2 | GO:0045955 | negative regulation of calcium ion-dependent exocytosis(GO:0045955) |
0.0 | 0.1 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
0.0 | 0.1 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
0.0 | 0.1 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
0.0 | 0.1 | GO:0003051 | angiotensin-mediated drinking behavior(GO:0003051) |
0.0 | 0.2 | GO:0008343 | adult feeding behavior(GO:0008343) |
0.0 | 0.0 | GO:0097527 | necroptotic signaling pathway(GO:0097527) |
0.0 | 0.1 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
0.0 | 0.0 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
0.0 | 0.1 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
0.0 | 0.0 | GO:0071332 | cellular response to fructose stimulus(GO:0071332) |
0.0 | 0.0 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
0.0 | 0.2 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
0.0 | 0.0 | GO:1901674 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
0.0 | 0.1 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
0.0 | 0.0 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
0.0 | 0.1 | GO:0044004 | killing by symbiont of host cells(GO:0001907) disruption by symbiont of host cell(GO:0044004) |
0.0 | 0.0 | GO:0009750 | response to fructose(GO:0009750) |
0.0 | 0.1 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
0.0 | 0.0 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
0.0 | 0.0 | GO:2000409 | positive regulation of T cell extravasation(GO:2000409) |
0.0 | 0.2 | GO:1903441 | protein localization to ciliary membrane(GO:1903441) |
0.0 | 0.0 | GO:2000074 | regulation of type B pancreatic cell development(GO:2000074) |
0.0 | 0.0 | GO:0045091 | regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045091) |
0.0 | 0.2 | GO:0009143 | nucleoside triphosphate catabolic process(GO:0009143) |
0.0 | 0.0 | GO:0072396 | response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) response to intra-S DNA damage checkpoint signaling(GO:0072429) |
0.0 | 0.0 | GO:0034635 | glutathione transport(GO:0034635) tripeptide transport(GO:0042939) |
0.0 | 0.1 | GO:0000237 | leptotene(GO:0000237) |
0.0 | 0.1 | GO:0060742 | epithelial cell differentiation involved in prostate gland development(GO:0060742) |
0.0 | 0.1 | GO:0002025 | vasodilation by norepinephrine-epinephrine involved in regulation of systemic arterial blood pressure(GO:0002025) |
0.0 | 0.1 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
0.0 | 0.1 | GO:0042536 | negative regulation of tumor necrosis factor biosynthetic process(GO:0042536) |
0.0 | 0.0 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
0.0 | 0.1 | GO:0030070 | insulin processing(GO:0030070) |
0.0 | 0.1 | GO:1903626 | positive regulation of apoptotic DNA fragmentation(GO:1902512) positive regulation of DNA catabolic process(GO:1903626) |
0.0 | 0.0 | GO:0090210 | regulation of establishment of blood-brain barrier(GO:0090210) |
0.0 | 0.1 | GO:0046208 | spermine catabolic process(GO:0046208) |
0.0 | 0.1 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
0.0 | 0.2 | GO:0060211 | regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
0.0 | 0.1 | GO:2000035 | regulation of stem cell division(GO:2000035) |
0.0 | 0.0 | GO:0060018 | astrocyte fate commitment(GO:0060018) |
0.0 | 0.0 | GO:0070813 | hydrogen sulfide metabolic process(GO:0070813) |
0.0 | 0.1 | GO:0035459 | cargo loading into vesicle(GO:0035459) |
0.0 | 0.1 | GO:0042559 | pteridine-containing compound biosynthetic process(GO:0042559) |
0.0 | 0.2 | GO:0042448 | progesterone metabolic process(GO:0042448) |
0.0 | 0.0 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
0.0 | 0.0 | GO:0007619 | courtship behavior(GO:0007619) |
0.0 | 0.1 | GO:1904688 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
0.0 | 0.1 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
0.0 | 0.1 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
0.0 | 0.1 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
0.0 | 0.1 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
0.0 | 0.1 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
0.0 | 0.1 | GO:0030035 | microspike assembly(GO:0030035) |
0.0 | 0.0 | GO:1904180 | negative regulation of mitochondrial depolarization(GO:0051902) negative regulation of membrane depolarization(GO:1904180) |
0.0 | 0.0 | GO:0048207 | vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
0.0 | 0.3 | GO:2000353 | positive regulation of endothelial cell apoptotic process(GO:2000353) |
0.0 | 0.0 | GO:2000611 | positive regulation of thyroid hormone generation(GO:2000611) |
0.0 | 0.0 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
0.0 | 0.2 | GO:0060340 | positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
0.0 | 0.1 | GO:0033007 | negative regulation of mast cell activation involved in immune response(GO:0033007) |
0.0 | 0.1 | GO:0097284 | hepatocyte apoptotic process(GO:0097284) |
0.0 | 0.0 | GO:0002884 | negative regulation of hypersensitivity(GO:0002884) |
0.0 | 0.1 | GO:0046984 | regulation of hemoglobin biosynthetic process(GO:0046984) |
0.0 | 0.1 | GO:0060484 | lung-associated mesenchyme development(GO:0060484) |
0.0 | 0.1 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
0.0 | 0.1 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
0.0 | 0.0 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
0.0 | 0.0 | GO:1904430 | negative regulation of t-circle formation(GO:1904430) |
0.0 | 0.1 | GO:0072179 | nephric duct formation(GO:0072179) |
0.0 | 0.1 | GO:0046016 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) positive regulation of transcription by glucose(GO:0046016) |
0.0 | 0.0 | GO:0060480 | lung goblet cell differentiation(GO:0060480) |
0.0 | 0.1 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.0 | 0.0 | GO:0050955 | thermoception(GO:0050955) |
0.0 | 0.1 | GO:0042637 | catagen(GO:0042637) |
0.0 | 0.0 | GO:0043366 | beta selection(GO:0043366) |
0.0 | 0.1 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
0.0 | 0.0 | GO:0001927 | exocyst assembly(GO:0001927) |
0.0 | 0.1 | GO:1903802 | L-glutamate(1-) import into cell(GO:1903802) L-glutamate import into cell(GO:1990123) |
0.0 | 0.0 | GO:0006555 | methionine metabolic process(GO:0006555) |
0.0 | 0.1 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
0.0 | 0.2 | GO:0015858 | nucleoside transport(GO:0015858) |
0.0 | 0.0 | GO:0090315 | negative regulation of protein targeting to membrane(GO:0090315) |
0.0 | 0.4 | GO:0060080 | inhibitory postsynaptic potential(GO:0060080) |
0.0 | 0.1 | GO:0043328 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
0.0 | 0.1 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
0.0 | 0.0 | GO:0072718 | response to cisplatin(GO:0072718) |
0.0 | 0.1 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
0.0 | 0.0 | GO:0090158 | endoplasmic reticulum membrane organization(GO:0090158) |
0.0 | 0.1 | GO:0006501 | C-terminal protein lipidation(GO:0006501) |
0.0 | 0.1 | GO:0008355 | olfactory learning(GO:0008355) |
0.0 | 0.2 | GO:0050957 | equilibrioception(GO:0050957) |
0.0 | 0.1 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
0.0 | 0.3 | GO:0035994 | response to muscle stretch(GO:0035994) |
0.0 | 0.0 | GO:0042660 | positive regulation of cell fate specification(GO:0042660) |
0.0 | 0.3 | GO:0051205 | protein insertion into membrane(GO:0051205) |
0.0 | 0.1 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
0.0 | 0.0 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
0.0 | 0.0 | GO:0044849 | estrous cycle(GO:0044849) |
0.0 | 0.2 | GO:0030502 | negative regulation of bone mineralization(GO:0030502) |
0.0 | 0.2 | GO:0042790 | transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:0042790) |
0.0 | 0.1 | GO:0010388 | cullin deneddylation(GO:0010388) |
0.0 | 0.1 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
0.0 | 0.0 | GO:0098814 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
0.0 | 0.0 | GO:1902075 | cellular response to salt(GO:1902075) |
0.0 | 0.1 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
0.0 | 0.1 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
0.0 | 0.1 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) phosphatidic acid metabolic process(GO:0046473) |
0.0 | 0.1 | GO:0006295 | nucleotide-excision repair, DNA incision, 3'-to lesion(GO:0006295) |
0.0 | 0.0 | GO:0043379 | memory T cell differentiation(GO:0043379) |
0.0 | 0.2 | GO:0033962 | cytoplasmic mRNA processing body assembly(GO:0033962) |
0.0 | 0.0 | GO:2000721 | positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
0.0 | 0.0 | GO:0051464 | cortisol secretion(GO:0043400) regulation of cortisol secretion(GO:0051462) positive regulation of cortisol secretion(GO:0051464) |
0.0 | 0.1 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
0.0 | 0.1 | GO:1904668 | positive regulation of ubiquitin protein ligase activity(GO:1904668) |
0.0 | 0.1 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
0.0 | 0.1 | GO:0032957 | inositol trisphosphate metabolic process(GO:0032957) |
0.0 | 0.1 | GO:0042659 | regulation of cell fate specification(GO:0042659) |
0.0 | 0.0 | GO:0046533 | negative regulation of photoreceptor cell differentiation(GO:0046533) |
0.0 | 0.0 | GO:0061218 | negative regulation of mesonephros development(GO:0061218) |
0.0 | 0.1 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
0.0 | 0.0 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
0.0 | 0.1 | GO:1904714 | regulation of chaperone-mediated autophagy(GO:1904714) |
0.0 | 0.1 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
0.0 | 0.1 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
0.0 | 0.1 | GO:1990144 | regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903297) negative regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903298) intrinsic apoptotic signaling pathway in response to hypoxia(GO:1990144) |
0.0 | 0.1 | GO:0002283 | neutrophil activation involved in immune response(GO:0002283) |
0.0 | 0.1 | GO:0048102 | autophagic cell death(GO:0048102) |
0.0 | 0.0 | GO:0014873 | response to muscle activity involved in regulation of muscle adaptation(GO:0014873) |
0.0 | 0.0 | GO:0097709 | connective tissue replacement involved in inflammatory response wound healing(GO:0002248) connective tissue replacement(GO:0097709) |
0.0 | 0.0 | GO:0060601 | lateral sprouting from an epithelium(GO:0060601) |
0.0 | 0.1 | GO:0000012 | single strand break repair(GO:0000012) |
0.0 | 0.3 | GO:0007026 | negative regulation of microtubule depolymerization(GO:0007026) |
0.0 | 0.0 | GO:0032462 | regulation of protein homooligomerization(GO:0032462) |
0.0 | 0.1 | GO:0006704 | glucocorticoid biosynthetic process(GO:0006704) |
0.0 | 0.0 | GO:0002576 | platelet degranulation(GO:0002576) |
0.0 | 0.0 | GO:0045348 | positive regulation of MHC class II biosynthetic process(GO:0045348) |
0.0 | 0.0 | GO:0046125 | pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
0.0 | 0.5 | GO:0000381 | regulation of alternative mRNA splicing, via spliceosome(GO:0000381) |
0.0 | 0.1 | GO:2000310 | regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
0.0 | 0.0 | GO:0009629 | response to gravity(GO:0009629) |
0.0 | 0.0 | GO:0010796 | regulation of multivesicular body size(GO:0010796) |
0.0 | 0.0 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
0.0 | 0.0 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
0.0 | 0.0 | GO:1901896 | positive regulation of calcium-transporting ATPase activity(GO:1901896) |
0.0 | 0.0 | GO:1902805 | positive regulation of synaptic vesicle transport(GO:1902805) positive regulation of synaptic vesicle recycling(GO:1903423) |
0.0 | 0.1 | GO:0006857 | oligopeptide transport(GO:0006857) |
0.0 | 0.0 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
0.0 | 0.0 | GO:0019661 | fermentation(GO:0006113) glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
0.0 | 0.0 | GO:0006407 | rRNA export from nucleus(GO:0006407) |
0.0 | 0.0 | GO:0033058 | directional locomotion(GO:0033058) |
0.0 | 0.2 | GO:0036344 | platelet morphogenesis(GO:0036344) |
0.0 | 0.1 | GO:0034063 | stress granule assembly(GO:0034063) |
0.0 | 0.1 | GO:0070257 | positive regulation of mucus secretion(GO:0070257) |
0.0 | 0.1 | GO:0034427 | nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
0.0 | 0.0 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.0 | 0.0 | GO:0035630 | bone mineralization involved in bone maturation(GO:0035630) |
0.0 | 0.0 | GO:0032460 | negative regulation of protein oligomerization(GO:0032460) |
0.0 | 0.1 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.0 | 0.2 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
0.0 | 0.0 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
0.0 | 0.0 | GO:2001270 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
0.0 | 0.1 | GO:0046543 | development of secondary female sexual characteristics(GO:0046543) |
0.0 | 0.1 | GO:0006742 | NADP catabolic process(GO:0006742) |
0.0 | 0.0 | GO:0003150 | muscular septum morphogenesis(GO:0003150) |
0.0 | 0.0 | GO:0060481 | lobar bronchus epithelium development(GO:0060481) |
0.0 | 0.0 | GO:2000318 | positive regulation of T-helper 17 type immune response(GO:2000318) |
0.0 | 0.0 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
0.0 | 0.0 | GO:0002386 | immune response in mucosal-associated lymphoid tissue(GO:0002386) |
0.0 | 0.0 | GO:0003222 | ventricular trabecula myocardium morphogenesis(GO:0003222) |
0.0 | 0.1 | GO:0043931 | ossification involved in bone maturation(GO:0043931) bone maturation(GO:0070977) |
0.0 | 0.0 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
0.0 | 0.0 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
0.0 | 0.0 | GO:0060155 | platelet dense granule organization(GO:0060155) |
0.0 | 0.0 | GO:0032025 | response to cobalt ion(GO:0032025) |
0.0 | 0.0 | GO:0071462 | cellular response to water stimulus(GO:0071462) |
0.0 | 0.0 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
0.0 | 0.1 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.0 | 0.0 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.0 | 0.1 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
0.0 | 0.0 | GO:1902255 | positive regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902255) |
0.0 | 0.1 | GO:0061641 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
0.0 | 0.1 | GO:0006265 | DNA topological change(GO:0006265) |
0.0 | 0.0 | GO:0008228 | opsonization(GO:0008228) |
0.0 | 0.0 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.0 | 0.0 | GO:1903772 | regulation of viral budding via host ESCRT complex(GO:1903772) |
0.0 | 0.0 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
0.0 | 0.0 | GO:0030908 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
0.0 | 0.0 | GO:0015889 | cobalamin transport(GO:0015889) |
0.0 | 0.0 | GO:0021775 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
0.0 | 0.1 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.0 | 0.1 | GO:0002043 | blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:0002043) |
0.0 | 0.0 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
0.0 | 0.0 | GO:0071374 | cellular response to parathyroid hormone stimulus(GO:0071374) |
0.0 | 0.0 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
0.0 | 0.0 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
0.0 | 0.0 | GO:0038107 | determination of left/right asymmetry in lateral mesoderm(GO:0003140) nodal signaling pathway involved in determination of left/right asymmetry(GO:0038107) regulation of transcription from RNA polymerase II promoter involved in determination of left/right symmetry(GO:1900094) nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900164) |
0.0 | 0.0 | GO:0010963 | regulation of L-arginine import(GO:0010963) |
0.0 | 0.1 | GO:0008215 | spermine metabolic process(GO:0008215) |
0.0 | 0.1 | GO:0060754 | positive regulation of mast cell chemotaxis(GO:0060754) |
0.0 | 0.0 | GO:1901725 | regulation of histone deacetylase activity(GO:1901725) |
0.0 | 0.2 | GO:0097031 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.0 | 0.2 | GO:0022617 | extracellular matrix disassembly(GO:0022617) |
0.0 | 0.1 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
0.0 | 0.1 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.0 | 0.0 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
0.0 | 0.1 | GO:0010667 | negative regulation of cardiac muscle cell apoptotic process(GO:0010667) |
0.0 | 0.1 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
0.0 | 0.0 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) |
0.0 | 0.1 | GO:0018343 | protein farnesylation(GO:0018343) |
0.0 | 0.0 | GO:0001835 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
0.0 | 0.1 | GO:1904424 | regulation of GTP binding(GO:1904424) |
0.0 | 0.1 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.0 | 0.0 | GO:0090230 | regulation of centromere complex assembly(GO:0090230) |
0.0 | 0.1 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.0 | 0.1 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
0.0 | 0.0 | GO:0008354 | germ cell migration(GO:0008354) |
0.0 | 0.0 | GO:1901535 | regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
0.0 | 0.1 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
0.0 | 0.1 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.0 | 0.0 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
0.0 | 0.0 | GO:0036089 | cleavage furrow formation(GO:0036089) |
0.0 | 0.0 | GO:1903797 | positive regulation of inorganic anion transmembrane transport(GO:1903797) |
0.0 | 0.1 | GO:0048069 | eye pigmentation(GO:0048069) |
0.0 | 0.0 | GO:0060684 | epithelial-mesenchymal cell signaling(GO:0060684) |
0.0 | 0.1 | GO:0007190 | activation of adenylate cyclase activity(GO:0007190) |
0.0 | 0.0 | GO:0034239 | regulation of macrophage fusion(GO:0034239) |
0.0 | 0.1 | GO:0002091 | negative regulation of receptor internalization(GO:0002091) |
0.0 | 0.1 | GO:0070561 | vitamin D receptor signaling pathway(GO:0070561) |
0.0 | 0.0 | GO:1903624 | regulation of apoptotic DNA fragmentation(GO:1902510) regulation of DNA catabolic process(GO:1903624) |
0.0 | 0.0 | GO:2000767 | positive regulation of cytoplasmic translation(GO:2000767) |
0.0 | 0.1 | GO:0002636 | positive regulation of germinal center formation(GO:0002636) |
0.0 | 0.0 | GO:0006449 | regulation of translational termination(GO:0006449) |
0.0 | 0.0 | GO:1900222 | negative regulation of beta-amyloid clearance(GO:1900222) |
0.0 | 0.0 | GO:0001866 | NK T cell proliferation(GO:0001866) |
0.0 | 0.0 | GO:0009414 | response to water deprivation(GO:0009414) |
0.0 | 0.0 | GO:0001923 | B-1 B cell differentiation(GO:0001923) |
0.0 | 0.3 | GO:0018345 | protein palmitoylation(GO:0018345) |
0.0 | 0.2 | GO:0070207 | protein homotrimerization(GO:0070207) |
0.0 | 0.0 | GO:0002835 | negative regulation of response to tumor cell(GO:0002835) negative regulation of immune response to tumor cell(GO:0002838) |
0.0 | 0.0 | GO:0000429 | carbon catabolite regulation of transcription from RNA polymerase II promoter(GO:0000429) carbon catabolite activation of transcription from RNA polymerase II promoter(GO:0000436) |
0.0 | 0.1 | GO:0007210 | serotonin receptor signaling pathway(GO:0007210) |
0.0 | 0.0 | GO:0022009 | central nervous system vasculogenesis(GO:0022009) |
0.0 | 0.2 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
0.0 | 0.0 | GO:0006772 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
0.0 | 0.1 | GO:0043032 | positive regulation of macrophage activation(GO:0043032) |
0.0 | 0.1 | GO:0006777 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
0.0 | 0.0 | GO:0097384 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) cellular lipid biosynthetic process(GO:0097384) ether biosynthetic process(GO:1901503) |
0.0 | 0.0 | GO:0051683 | establishment of Golgi localization(GO:0051683) |
0.0 | 0.1 | GO:0051256 | mitotic spindle elongation(GO:0000022) spindle midzone assembly(GO:0051255) mitotic spindle midzone assembly(GO:0051256) |
0.0 | 0.1 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
0.0 | 0.0 | GO:0045990 | carbon catabolite regulation of transcription(GO:0045990) |
0.0 | 0.2 | GO:0050435 | beta-amyloid metabolic process(GO:0050435) |
0.0 | 0.0 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.0 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
0.0 | 0.0 | GO:0002568 | somatic diversification of T cell receptor genes(GO:0002568) somatic recombination of T cell receptor gene segments(GO:0002681) T cell receptor V(D)J recombination(GO:0033153) |
0.0 | 0.0 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
0.0 | 0.0 | GO:1904995 | negative regulation of leukocyte tethering or rolling(GO:1903237) negative regulation of leukocyte adhesion to vascular endothelial cell(GO:1904995) |
0.0 | 0.1 | GO:0031954 | positive regulation of protein autophosphorylation(GO:0031954) |
0.0 | 0.0 | GO:0051031 | tRNA transport(GO:0051031) |
0.0 | 0.0 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
0.0 | 0.0 | GO:0007296 | vitellogenesis(GO:0007296) |
0.0 | 0.0 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
0.0 | 0.0 | GO:0032687 | negative regulation of interferon-alpha production(GO:0032687) |
0.0 | 0.0 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
0.0 | 0.1 | GO:0097531 | mast cell chemotaxis(GO:0002551) mast cell migration(GO:0097531) |
0.0 | 0.0 | GO:2001168 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
0.0 | 0.0 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.0 | 0.0 | GO:0042628 | mating plug formation(GO:0042628) single-organism reproductive behavior(GO:0044704) post-mating behavior(GO:0045297) |
0.0 | 0.0 | GO:0030046 | parallel actin filament bundle assembly(GO:0030046) |
0.0 | 0.0 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
0.0 | 0.0 | GO:0051572 | negative regulation of histone H3-K4 methylation(GO:0051572) |
0.0 | 0.0 | GO:0032380 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
0.0 | 0.0 | GO:0060335 | positive regulation of response to interferon-gamma(GO:0060332) positive regulation of interferon-gamma-mediated signaling pathway(GO:0060335) |
0.0 | 0.0 | GO:1902093 | positive regulation of sperm motility(GO:1902093) |
0.0 | 0.0 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
0.0 | 0.0 | GO:0071502 | cellular response to temperature stimulus(GO:0071502) |
0.0 | 0.0 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
0.0 | 0.0 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
0.0 | 0.0 | GO:0090289 | regulation of osteoclast proliferation(GO:0090289) positive regulation of osteoclast proliferation(GO:0090290) |
0.0 | 0.0 | GO:0048022 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
0.0 | 0.0 | GO:0015886 | heme transport(GO:0015886) |
0.0 | 0.1 | GO:0015871 | choline transport(GO:0015871) |
0.0 | 0.1 | GO:2000191 | regulation of fatty acid transport(GO:2000191) |
0.0 | 0.1 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
0.0 | 0.1 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
0.0 | 0.1 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.0 | 0.0 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
0.0 | 0.0 | GO:0042590 | antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
0.0 | 0.1 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
0.0 | 0.0 | GO:1903975 | regulation of glial cell migration(GO:1903975) |
0.0 | 0.0 | GO:0009138 | pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
0.0 | 0.0 | GO:0036394 | amylase secretion(GO:0036394) |
0.0 | 0.0 | GO:0046103 | inosine biosynthetic process(GO:0046103) |
0.0 | 0.2 | GO:0036075 | endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
0.0 | 0.0 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
0.0 | 0.1 | GO:0031573 | intra-S DNA damage checkpoint(GO:0031573) |
0.0 | 0.0 | GO:1903347 | negative regulation of bicellular tight junction assembly(GO:1903347) |
0.0 | 0.0 | GO:0002432 | granuloma formation(GO:0002432) |
0.0 | 0.1 | GO:1902414 | protein localization to cell junction(GO:1902414) |
0.0 | 0.1 | GO:0032438 | melanosome organization(GO:0032438) |
0.0 | 0.0 | GO:0060028 | convergent extension involved in axis elongation(GO:0060028) |
0.0 | 0.1 | GO:0090399 | replicative senescence(GO:0090399) |
0.0 | 0.1 | GO:0045820 | negative regulation of nucleotide catabolic process(GO:0030812) negative regulation of glycolytic process(GO:0045820) negative regulation of cofactor metabolic process(GO:0051195) negative regulation of coenzyme metabolic process(GO:0051198) |
0.0 | 0.0 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
0.0 | 0.0 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
0.0 | 0.0 | GO:0010728 | regulation of hydrogen peroxide biosynthetic process(GO:0010728) |
0.0 | 0.1 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
0.0 | 0.1 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
0.0 | 0.1 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
0.0 | 0.1 | GO:0045084 | positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
0.0 | 0.1 | GO:1904355 | positive regulation of telomere capping(GO:1904355) |
0.0 | 0.1 | GO:0060023 | soft palate development(GO:0060023) |
0.0 | 0.1 | GO:0033129 | positive regulation of histone phosphorylation(GO:0033129) |
0.0 | 0.0 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
0.0 | 0.1 | GO:2000052 | positive regulation of non-canonical Wnt signaling pathway(GO:2000052) |
0.0 | 0.1 | GO:0030011 | maintenance of cell polarity(GO:0030011) |
0.0 | 0.0 | GO:0060527 | prostate glandular acinus morphogenesis(GO:0060526) prostate epithelial cord arborization involved in prostate glandular acinus morphogenesis(GO:0060527) |
0.0 | 0.1 | GO:0060837 | blood vessel endothelial cell differentiation(GO:0060837) |
0.0 | 0.1 | GO:0006702 | androgen biosynthetic process(GO:0006702) |
0.0 | 0.1 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 0.5 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.1 | 0.9 | GO:0070852 | cell body fiber(GO:0070852) |
0.1 | 0.4 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.1 | 0.2 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.1 | 0.5 | GO:0042587 | glycogen granule(GO:0042587) |
0.1 | 0.2 | GO:0032444 | activin responsive factor complex(GO:0032444) |
0.1 | 0.2 | GO:0043293 | apoptosome(GO:0043293) |
0.1 | 0.1 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
0.1 | 0.2 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.1 | 0.2 | GO:0000811 | GINS complex(GO:0000811) |
0.1 | 0.4 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
0.1 | 0.7 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
0.0 | 0.1 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
0.0 | 0.1 | GO:0044299 | C-fiber(GO:0044299) |
0.0 | 0.2 | GO:0005726 | perichromatin fibrils(GO:0005726) |
0.0 | 0.3 | GO:0005577 | fibrinogen complex(GO:0005577) |
0.0 | 0.1 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
0.0 | 0.2 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.0 | 0.2 | GO:0045298 | tubulin complex(GO:0045298) |
0.0 | 0.1 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
0.0 | 0.2 | GO:0005915 | zonula adherens(GO:0005915) |
0.0 | 0.1 | GO:0046691 | intracellular canaliculus(GO:0046691) |
0.0 | 0.2 | GO:0070820 | tertiary granule(GO:0070820) |
0.0 | 0.2 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.0 | 0.1 | GO:0070545 | PeBoW complex(GO:0070545) |
0.0 | 0.1 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.0 | 0.1 | GO:0031502 | dolichyl-phosphate-mannose-protein mannosyltransferase complex(GO:0031502) |
0.0 | 0.3 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.0 | 0.1 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
0.0 | 0.2 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.0 | 0.2 | GO:0089701 | U2AF(GO:0089701) |
0.0 | 0.1 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
0.0 | 0.2 | GO:0005767 | secondary lysosome(GO:0005767) |
0.0 | 0.2 | GO:0043219 | lateral loop(GO:0043219) |
0.0 | 0.1 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
0.0 | 0.1 | GO:0044326 | dendritic spine neck(GO:0044326) |
0.0 | 0.2 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
0.0 | 0.1 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
0.0 | 0.3 | GO:0044292 | dendrite terminus(GO:0044292) |
0.0 | 0.1 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.0 | 0.4 | GO:0001891 | phagocytic cup(GO:0001891) |
0.0 | 0.1 | GO:0005955 | calcineurin complex(GO:0005955) |
0.0 | 0.1 | GO:0005745 | m-AAA complex(GO:0005745) |
0.0 | 0.2 | GO:0030008 | TRAPP complex(GO:0030008) |
0.0 | 0.1 | GO:0070695 | FHF complex(GO:0070695) |
0.0 | 0.1 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
0.0 | 0.1 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.0 | 0.1 | GO:0035355 | Toll-like receptor 2-Toll-like receptor 6 protein complex(GO:0035355) |
0.0 | 0.1 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.0 | 0.1 | GO:0033269 | internode region of axon(GO:0033269) |
0.0 | 0.1 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
0.0 | 0.3 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
0.0 | 0.0 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
0.0 | 0.1 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
0.0 | 0.1 | GO:0090543 | Flemming body(GO:0090543) |
0.0 | 0.2 | GO:0042613 | MHC class II protein complex(GO:0042613) |
0.0 | 0.2 | GO:0070938 | contractile ring(GO:0070938) |
0.0 | 0.1 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.0 | 0.2 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.0 | 0.1 | GO:0008275 | gamma-tubulin small complex(GO:0008275) |
0.0 | 0.3 | GO:0030663 | COPI-coated vesicle membrane(GO:0030663) |
0.0 | 0.1 | GO:0042382 | paraspeckles(GO:0042382) |
0.0 | 0.1 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
0.0 | 0.1 | GO:0031084 | BLOC-2 complex(GO:0031084) |
0.0 | 0.2 | GO:0001650 | fibrillar center(GO:0001650) |
0.0 | 0.1 | GO:0097413 | Lewy body(GO:0097413) |
0.0 | 0.1 | GO:0005594 | collagen type IX trimer(GO:0005594) |
0.0 | 0.1 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
0.0 | 0.1 | GO:0045251 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
0.0 | 0.1 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.0 | 0.1 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.0 | 0.3 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.0 | 0.2 | GO:0035631 | CD40 receptor complex(GO:0035631) |
0.0 | 0.1 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.0 | 0.2 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.0 | 0.2 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.0 | 0.2 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.0 | 0.1 | GO:0036195 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
0.0 | 0.1 | GO:0031417 | NatC complex(GO:0031417) |
0.0 | 0.1 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
0.0 | 0.1 | GO:0042627 | chylomicron(GO:0042627) |
0.0 | 0.0 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.0 | 0.4 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
0.0 | 0.1 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.0 | 0.0 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
0.0 | 0.1 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.0 | 0.1 | GO:0042825 | TAP complex(GO:0042825) |
0.0 | 0.0 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
0.0 | 0.1 | GO:0070876 | SOSS complex(GO:0070876) |
0.0 | 0.3 | GO:0043034 | costamere(GO:0043034) |
0.0 | 0.0 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
0.0 | 0.0 | GO:0048179 | activin receptor complex(GO:0048179) |
0.0 | 0.0 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.0 | 0.3 | GO:0001673 | male germ cell nucleus(GO:0001673) |
0.0 | 0.0 | GO:0005683 | U7 snRNP(GO:0005683) |
0.0 | 0.7 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
0.0 | 0.2 | GO:0031082 | BLOC complex(GO:0031082) |
0.0 | 0.0 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.0 | 0.1 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
0.0 | 0.2 | GO:0032982 | myosin filament(GO:0032982) |
0.0 | 0.2 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.0 | 0.1 | GO:0034992 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
0.0 | 0.0 | GO:0035061 | interchromatin granule(GO:0035061) |
0.0 | 0.0 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
0.0 | 0.0 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
0.0 | 0.0 | GO:0031298 | replication fork protection complex(GO:0031298) |
0.0 | 0.2 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
0.0 | 0.0 | GO:0005642 | annulate lamellae(GO:0005642) |
0.0 | 0.2 | GO:0002102 | podosome(GO:0002102) |
0.0 | 0.1 | GO:0097546 | ciliary base(GO:0097546) |
0.0 | 0.2 | GO:0032426 | stereocilium tip(GO:0032426) |
0.0 | 0.1 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.0 | 0.1 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.0 | 0.1 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.0 | 0.0 | GO:0005927 | muscle tendon junction(GO:0005927) |
0.0 | 0.0 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
0.0 | 0.1 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
0.0 | 0.1 | GO:0097542 | ciliary tip(GO:0097542) |
0.0 | 0.0 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
0.0 | 0.0 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.0 | 0.0 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.0 | 0.0 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
0.0 | 0.2 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
0.0 | 0.1 | GO:0005688 | U6 snRNP(GO:0005688) |
0.0 | 0.0 | GO:0071942 | XPC complex(GO:0071942) |
0.0 | 0.2 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
0.0 | 0.2 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.0 | 0.1 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.0 | 0.1 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
0.0 | 0.1 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
0.0 | 0.1 | GO:0036128 | CatSper complex(GO:0036128) |
0.0 | 0.2 | GO:0000786 | nucleosome(GO:0000786) |
0.0 | 0.1 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
0.0 | 0.1 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.0 | 0.1 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
0.0 | 0.1 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 1.2 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
0.2 | 0.8 | GO:0047105 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
0.2 | 0.7 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
0.2 | 0.5 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
0.1 | 0.6 | GO:0004528 | phosphodiesterase I activity(GO:0004528) |
0.1 | 0.3 | GO:0004103 | choline kinase activity(GO:0004103) |
0.1 | 1.2 | GO:0015643 | toxic substance binding(GO:0015643) |
0.1 | 0.2 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.1 | 0.2 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.1 | 0.2 | GO:0008142 | oxysterol binding(GO:0008142) |
0.1 | 0.2 | GO:0080130 | L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
0.1 | 0.3 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.1 | 1.0 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
0.1 | 0.2 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.1 | 0.2 | GO:0032551 | UTP binding(GO:0002134) pyrimidine ribonucleoside binding(GO:0032551) |
0.1 | 0.2 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
0.1 | 0.3 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.1 | 0.4 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
0.1 | 0.2 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.1 | 0.2 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
0.1 | 0.7 | GO:0070402 | NADPH binding(GO:0070402) |
0.1 | 0.2 | GO:0016823 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
0.1 | 0.3 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
0.1 | 0.2 | GO:0008515 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
0.1 | 0.2 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
0.1 | 0.6 | GO:0005542 | folic acid binding(GO:0005542) |
0.1 | 0.2 | GO:1990715 | mRNA CDS binding(GO:1990715) |
0.1 | 0.4 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.0 | 0.1 | GO:0009041 | uridylate kinase activity(GO:0009041) |
0.0 | 0.1 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.0 | 0.3 | GO:0019957 | C-C chemokine binding(GO:0019957) |
0.0 | 0.3 | GO:0008199 | ferric iron binding(GO:0008199) |
0.0 | 0.1 | GO:0023029 | MHC class Ib protein binding(GO:0023029) |
0.0 | 0.1 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.0 | 0.1 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
0.0 | 0.2 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
0.0 | 0.5 | GO:0031994 | insulin-like growth factor I binding(GO:0031994) |
0.0 | 0.2 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.0 | 0.1 | GO:0005119 | smoothened binding(GO:0005119) |
0.0 | 0.1 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.0 | 0.2 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.0 | 0.1 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
0.0 | 0.2 | GO:0004370 | glycerol kinase activity(GO:0004370) |
0.0 | 0.2 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
0.0 | 0.5 | GO:0004622 | lysophospholipase activity(GO:0004622) |
0.0 | 0.1 | GO:0019767 | IgE receptor activity(GO:0019767) |
0.0 | 0.3 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
0.0 | 0.6 | GO:0071949 | FAD binding(GO:0071949) |
0.0 | 0.1 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
0.0 | 0.1 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
0.0 | 0.5 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
0.0 | 0.0 | GO:0016751 | S-succinyltransferase activity(GO:0016751) |
0.0 | 0.0 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
0.0 | 0.2 | GO:0035473 | lipase binding(GO:0035473) |
0.0 | 0.0 | GO:0016662 | oxidoreductase activity, acting on other nitrogenous compounds as donors, cytochrome as acceptor(GO:0016662) |
0.0 | 0.2 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
0.0 | 0.3 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
0.0 | 0.2 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
0.0 | 0.2 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
0.0 | 0.1 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.0 | 0.2 | GO:0004064 | arylesterase activity(GO:0004064) |
0.0 | 0.3 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.0 | 0.1 | GO:0032554 | purine deoxyribonucleotide binding(GO:0032554) |
0.0 | 0.1 | GO:0004346 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
0.0 | 0.1 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
0.0 | 0.2 | GO:0009378 | four-way junction helicase activity(GO:0009378) |
0.0 | 0.1 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.0 | 0.1 | GO:0097016 | L27 domain binding(GO:0097016) |
0.0 | 0.1 | GO:0016840 | carbon-nitrogen lyase activity(GO:0016840) |
0.0 | 0.1 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
0.0 | 0.0 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.0 | 0.1 | GO:0070644 | vitamin D response element binding(GO:0070644) |
0.0 | 0.1 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
0.0 | 0.1 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
0.0 | 0.1 | GO:0018741 | alkyl sulfatase activity(GO:0018741) endosulfan hemisulfate sulfatase activity(GO:0034889) endosulfan sulfate hydrolase activity(GO:0034902) |
0.0 | 0.1 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
0.0 | 0.2 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
0.0 | 0.1 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.0 | 0.1 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
0.0 | 0.1 | GO:0071614 | linoleic acid epoxygenase activity(GO:0071614) |
0.0 | 0.0 | GO:0016420 | S-malonyltransferase activity(GO:0016419) malonyltransferase activity(GO:0016420) |
0.0 | 0.0 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.0 | 0.1 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
0.0 | 0.1 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
0.0 | 0.1 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.0 | 0.1 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
0.0 | 0.2 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.0 | 0.3 | GO:0004467 | long-chain fatty acid-CoA ligase activity(GO:0004467) |
0.0 | 0.4 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
0.0 | 0.2 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
0.0 | 0.1 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.0 | 0.1 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
0.0 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.0 | 0.2 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
0.0 | 0.2 | GO:0009881 | photoreceptor activity(GO:0009881) |
0.0 | 0.2 | GO:0008430 | selenium binding(GO:0008430) |
0.0 | 0.1 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
0.0 | 0.1 | GO:0071723 | lipopeptide binding(GO:0071723) |
0.0 | 0.1 | GO:0050815 | phosphoserine binding(GO:0050815) |
0.0 | 0.1 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.0 | 0.1 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.0 | 0.1 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
0.0 | 0.1 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
0.0 | 0.3 | GO:0043295 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
0.0 | 0.2 | GO:0003916 | DNA topoisomerase activity(GO:0003916) |
0.0 | 0.1 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.0 | 0.1 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
0.0 | 0.1 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.0 | 0.1 | GO:0050733 | RS domain binding(GO:0050733) |
0.0 | 0.4 | GO:0004889 | acetylcholine-activated cation-selective channel activity(GO:0004889) |
0.0 | 0.1 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
0.0 | 0.1 | GO:0016151 | nickel cation binding(GO:0016151) |
0.0 | 0.0 | GO:0019863 | IgE binding(GO:0019863) |
0.0 | 0.3 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
0.0 | 0.1 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
0.0 | 0.1 | GO:0042289 | MHC class II protein binding(GO:0042289) |
0.0 | 0.0 | GO:0045340 | mercury ion binding(GO:0045340) |
0.0 | 0.1 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
0.0 | 0.0 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
0.0 | 0.1 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
0.0 | 0.2 | GO:0098505 | G-rich strand telomeric DNA binding(GO:0098505) |
0.0 | 0.1 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
0.0 | 0.1 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
0.0 | 0.2 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) |
0.0 | 0.1 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
0.0 | 0.0 | GO:0004645 | phosphorylase activity(GO:0004645) |
0.0 | 0.1 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
0.0 | 0.1 | GO:1990405 | protein antigen binding(GO:1990405) |
0.0 | 0.1 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
0.0 | 0.2 | GO:0017166 | vinculin binding(GO:0017166) |
0.0 | 0.0 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
0.0 | 0.0 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
0.0 | 0.7 | GO:0044390 | ubiquitin-like protein conjugating enzyme binding(GO:0044390) |
0.0 | 0.1 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) |
0.0 | 0.1 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
0.0 | 0.2 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
0.0 | 0.1 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
0.0 | 0.5 | GO:0016702 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen(GO:0016701) oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of two atoms of oxygen(GO:0016702) |
0.0 | 0.1 | GO:0051373 | FATZ binding(GO:0051373) |
0.0 | 0.1 | GO:0034190 | apolipoprotein receptor binding(GO:0034190) |
0.0 | 0.2 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.0 | 0.3 | GO:0005112 | Notch binding(GO:0005112) |
0.0 | 0.1 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.0 | 0.1 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
0.0 | 0.1 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
0.0 | 0.2 | GO:0042287 | MHC protein binding(GO:0042287) |
0.0 | 0.1 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.0 | 0.1 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
0.0 | 0.1 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
0.0 | 0.2 | GO:0044548 | S100 protein binding(GO:0044548) |
0.0 | 0.1 | GO:0034950 | mono-butyltin dioxygenase activity(GO:0018586) tri-n-butyltin dioxygenase activity(GO:0018588) di-n-butyltin dioxygenase activity(GO:0018589) methylsilanetriol hydroxylase activity(GO:0018590) methyl tertiary butyl ether 3-monooxygenase activity(GO:0018591) 4-nitrocatechol 4-monooxygenase activity(GO:0018592) 4-chlorophenoxyacetate monooxygenase activity(GO:0018593) tert-butanol 2-monooxygenase activity(GO:0018594) alpha-pinene monooxygenase activity(GO:0018595) dimethylsilanediol hydroxylase activity(GO:0018596) ammonia monooxygenase activity(GO:0018597) hydroxymethylsilanetriol oxidase activity(GO:0018598) 2-hydroxyisobutyrate 3-monooxygenase activity(GO:0018599) alpha-pinene dehydrogenase activity(GO:0018600) bisphenol A hydroxylase B activity(GO:0034559) 2,2-bis(4-hydroxyphenyl)-1-propanol hydroxylase activity(GO:0034562) 9-fluorenone-3,4-dioxygenase activity(GO:0034786) anthracene 9,10-dioxygenase activity(GO:0034816) 2-(methylthio)benzothiazole monooxygenase activity(GO:0034857) 2-hydroxybenzothiazole monooxygenase activity(GO:0034858) benzothiazole monooxygenase activity(GO:0034859) 2,6-dihydroxybenzothiazole monooxygenase activity(GO:0034862) pinacolone 5-monooxygenase activity(GO:0034870) thioacetamide S-oxygenase activity(GO:0034873) thioacetamide S-oxide S-oxygenase activity(GO:0034874) endosulfan monooxygenase I activity(GO:0034888) N-nitrodimethylamine hydroxylase activity(GO:0034893) 4-(1-ethyl-1,4-dimethyl-pentyl)phenol monoxygenase activity(GO:0034897) endosulfan ether monooxygenase activity(GO:0034903) pyrene 4,5-monooxygenase activity(GO:0034925) pyrene 1,2-monooxygenase activity(GO:0034927) 1-hydroxypyrene 6,7-monooxygenase activity(GO:0034928) 1-hydroxypyrene 7,8-monooxygenase activity(GO:0034929) phenylboronic acid monooxygenase activity(GO:0034950) spheroidene monooxygenase activity(GO:0043823) |
0.0 | 0.1 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
0.0 | 0.3 | GO:0004551 | nucleotide diphosphatase activity(GO:0004551) |
0.0 | 0.1 | GO:0070324 | thyroid hormone binding(GO:0070324) |
0.0 | 0.1 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.0 | 0.1 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
0.0 | 0.1 | GO:0005294 | neutral L-amino acid secondary active transmembrane transporter activity(GO:0005294) |
0.0 | 0.1 | GO:0005499 | vitamin D binding(GO:0005499) |
0.0 | 0.1 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
0.0 | 0.1 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
0.0 | 0.1 | GO:0034838 | enoyl-[acyl-carrier-protein] reductase activity(GO:0016631) 2,3-dihydroxy-2,3-dihydro-phenylpropionate dehydrogenase activity(GO:0018498) cis-2,3-dihydrodiol DDT dehydrogenase activity(GO:0018499) trans-9R,10R-dihydrodiolphenanthrene dehydrogenase activity(GO:0018500) cis-chlorobenzene dihydrodiol dehydrogenase activity(GO:0018501) 2,5-dichloro-2,5-cyclohexadiene-1,4-diol dehydrogenase activity(GO:0018502) trans-1,2-dihydrodiolphenanthrene dehydrogenase activity(GO:0018503) 3,4-dihydroxy-3,4-dihydrofluorene dehydrogenase activity(GO:0034790) benzo(a)pyrene-trans-11,12-dihydrodiol dehydrogenase activity(GO:0034805) benzo(a)pyrene-cis-4,5-dihydrodiol dehydrogenase activity(GO:0034809) citronellyl-CoA dehydrogenase activity(GO:0034824) menthone dehydrogenase activity(GO:0034838) phthalate 3,4-cis-dihydrodiol dehydrogenase activity(GO:0034912) cinnamate reductase activity(GO:0043786) NADPH-dependent curcumin reductase activity(GO:0052849) NADPH-dependent dihydrocurcumin reductase activity(GO:0052850) |
0.0 | 0.1 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
0.0 | 0.0 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) |
0.0 | 0.1 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.0 | 0.1 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
0.0 | 0.0 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
0.0 | 0.1 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
0.0 | 0.1 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
0.0 | 0.3 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.0 | 0.1 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.0 | 0.1 | GO:0016443 | bidentate ribonuclease III activity(GO:0016443) |
0.0 | 0.1 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.0 | 0.1 | GO:0051425 | PTB domain binding(GO:0051425) |
0.0 | 0.1 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
0.0 | 0.2 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
0.0 | 0.2 | GO:0008483 | transaminase activity(GO:0008483) |
0.0 | 0.1 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
0.0 | 0.0 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
0.0 | 0.0 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
0.0 | 0.3 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.0 | 0.0 | GO:0001884 | pyrimidine nucleoside binding(GO:0001884) |
0.0 | 0.0 | GO:0008905 | mannose-phosphate guanylyltransferase activity(GO:0008905) |
0.0 | 0.2 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
0.0 | 0.0 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.0 | 0.0 | GO:0016934 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
0.0 | 0.3 | GO:0008143 | poly(A) binding(GO:0008143) |
0.0 | 0.1 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.0 | 0.4 | GO:0019107 | myristoyltransferase activity(GO:0019107) |
0.0 | 0.1 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
0.0 | 0.4 | GO:0004532 | exoribonuclease activity(GO:0004532) |
0.0 | 0.0 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
0.0 | 0.0 | GO:0015087 | cobalt ion transmembrane transporter activity(GO:0015087) |
0.0 | 0.1 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.0 | 0.0 | GO:0017153 | sodium:dicarboxylate symporter activity(GO:0017153) |
0.0 | 0.1 | GO:0050693 | LBD domain binding(GO:0050693) |
0.0 | 0.1 | GO:0005024 | transforming growth factor beta-activated receptor activity(GO:0005024) |
0.0 | 0.1 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.0 | 0.1 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
0.0 | 0.1 | GO:0046977 | TAP binding(GO:0046977) |
0.0 | 0.0 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
0.0 | 0.0 | GO:0004676 | 3-phosphoinositide-dependent protein kinase activity(GO:0004676) |
0.0 | 0.2 | GO:0046961 | proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
0.0 | 0.0 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
0.0 | 0.0 | GO:0070568 | guanylyltransferase activity(GO:0070568) |
0.0 | 0.1 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.0 | 0.0 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
0.0 | 0.0 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
0.0 | 0.1 | GO:1990239 | steroid hormone binding(GO:1990239) |
0.0 | 0.1 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
0.0 | 0.2 | GO:0031005 | filamin binding(GO:0031005) |
0.0 | 0.4 | GO:0046875 | ephrin receptor binding(GO:0046875) |
0.0 | 0.0 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
0.0 | 0.1 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.0 | 0.1 | GO:0003993 | acid phosphatase activity(GO:0003993) |
0.0 | 0.2 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.0 | 0.2 | GO:0055106 | ubiquitin-protein transferase regulator activity(GO:0055106) |
0.0 | 0.1 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.0 | 0.0 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
0.0 | 0.1 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
0.0 | 0.0 | GO:0004359 | glutaminase activity(GO:0004359) |
0.0 | 0.0 | GO:0005347 | ATP transmembrane transporter activity(GO:0005347) |
0.0 | 0.1 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
0.0 | 0.1 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.0 | 0.2 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
0.0 | 0.3 | GO:0030507 | spectrin binding(GO:0030507) |
0.0 | 0.0 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.0 | 0.1 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
0.0 | 0.1 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
0.0 | 0.1 | GO:0001223 | transcription coactivator binding(GO:0001223) |
0.0 | 0.0 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
0.0 | 0.2 | GO:0005186 | pheromone activity(GO:0005186) |
0.0 | 0.1 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
0.0 | 0.5 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
0.0 | 0.1 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.0 | 0.1 | GO:0001163 | RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
0.0 | 0.0 | GO:0032407 | MutSalpha complex binding(GO:0032407) |
0.0 | 0.1 | GO:0005522 | profilin binding(GO:0005522) |
0.0 | 0.0 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
0.0 | 0.1 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
0.0 | 0.1 | GO:0046790 | virion binding(GO:0046790) |
0.0 | 0.0 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
0.0 | 0.1 | GO:0017040 | ceramidase activity(GO:0017040) |
0.0 | 0.2 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
0.0 | 0.0 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
0.0 | 0.2 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
0.0 | 0.1 | GO:0004457 | lactate dehydrogenase activity(GO:0004457) |
0.0 | 0.2 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
0.0 | 0.1 | GO:0070891 | lipoteichoic acid binding(GO:0070891) |
0.0 | 0.1 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
0.0 | 0.1 | GO:0016594 | glycine binding(GO:0016594) |
0.0 | 0.0 | GO:0070051 | fibrinogen binding(GO:0070051) |
0.0 | 0.0 | GO:0004487 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
0.0 | 0.0 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.0 | 0.1 | GO:0030250 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
0.0 | 0.1 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
0.0 | 0.0 | GO:0052851 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
0.0 | 0.1 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.0 | 0.1 | GO:0043422 | protein kinase B binding(GO:0043422) |
0.0 | 0.1 | GO:0015106 | bicarbonate transmembrane transporter activity(GO:0015106) |
0.0 | 0.0 | GO:0031432 | titin binding(GO:0031432) |
0.0 | 0.2 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.0 | 0.1 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
0.0 | 0.1 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
0.0 | 0.0 | GO:0003865 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) cholestenone 5-alpha-reductase activity(GO:0047751) |
0.0 | 0.1 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
0.0 | 0.0 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
0.0 | 0.0 | GO:0045503 | dynein light chain binding(GO:0045503) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.0 | 0.8 | PID CONE PATHWAY | Visual signal transduction: Cones |
0.0 | 0.0 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
0.0 | 0.4 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.0 | 0.4 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.0 | 0.6 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
0.0 | 0.3 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.0 | 0.0 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
0.0 | 0.3 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.0 | 0.8 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
0.0 | 0.1 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.0 | 0.5 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
0.0 | 0.3 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.0 | 0.3 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.0 | 0.5 | PID LKB1 PATHWAY | LKB1 signaling events |
0.0 | 0.6 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
0.0 | 0.1 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
0.0 | 0.5 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
0.0 | 0.2 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
0.0 | 0.1 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
0.0 | 0.2 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.0 | 0.3 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
0.0 | 0.0 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.0 | 0.1 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.0 | 0.0 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.0 | 0.0 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.0 | 0.2 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.0 | 0.1 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
0.0 | 0.0 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.0 | 0.2 | PID IL1 PATHWAY | IL1-mediated signaling events |
0.0 | 0.0 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 0.5 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.1 | 0.6 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.1 | 1.2 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.1 | 0.5 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.0 | 1.1 | REACTOME LIPOPROTEIN METABOLISM | Genes involved in Lipoprotein metabolism |
0.0 | 0.3 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
0.0 | 0.4 | REACTOME ACTIVATION OF IRF3 IRF7 MEDIATED BY TBK1 IKK EPSILON | Genes involved in Activation of IRF3/IRF7 mediated by TBK1/IKK epsilon |
0.0 | 0.4 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.0 | 0.2 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
0.0 | 0.8 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
0.0 | 0.1 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
0.0 | 0.3 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
0.0 | 0.5 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
0.0 | 0.3 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
0.0 | 0.2 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
0.0 | 0.2 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.0 | 0.2 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
0.0 | 0.3 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
0.0 | 0.4 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
0.0 | 0.1 | REACTOME INHIBITION OF THE PROTEOLYTIC ACTIVITY OF APC C REQUIRED FOR THE ONSET OF ANAPHASE BY MITOTIC SPINDLE CHECKPOINT COMPONENTS | Genes involved in Inhibition of the proteolytic activity of APC/C required for the onset of anaphase by mitotic spindle checkpoint components |
0.0 | 0.3 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
0.0 | 0.1 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.0 | 0.3 | REACTOME GRB2 SOS PROVIDES LINKAGE TO MAPK SIGNALING FOR INTERGRINS | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
0.0 | 0.3 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
0.0 | 0.0 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
0.0 | 0.2 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
0.0 | 0.0 | REACTOME CDK MEDIATED PHOSPHORYLATION AND REMOVAL OF CDC6 | Genes involved in CDK-mediated phosphorylation and removal of Cdc6 |
0.0 | 0.3 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.0 | 0.2 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
0.0 | 0.2 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.0 | 0.1 | REACTOME G BETA GAMMA SIGNALLING THROUGH PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
0.0 | 0.1 | REACTOME LIPID DIGESTION MOBILIZATION AND TRANSPORT | Genes involved in Lipid digestion, mobilization, and transport |
0.0 | 0.2 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.0 | 0.1 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.0 | 0.1 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.0 | 0.0 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
0.0 | 0.3 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
0.0 | 0.2 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
0.0 | 0.1 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
0.0 | 0.4 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
0.0 | 0.0 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
0.0 | 0.2 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.0 | 0.0 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
0.0 | 0.0 | REACTOME BOTULINUM NEUROTOXICITY | Genes involved in Botulinum neurotoxicity |
0.0 | 0.0 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
0.0 | 2.2 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
0.0 | 0.3 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
0.0 | 0.3 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
0.0 | 0.2 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
0.0 | 0.0 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
0.0 | 0.2 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.0 | 0.3 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
0.0 | 0.1 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.0 | 0.1 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.0 | 0.0 | REACTOME ANTIGEN PROCESSING CROSS PRESENTATION | Genes involved in Antigen processing-Cross presentation |
0.0 | 0.1 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
0.0 | 0.2 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
0.0 | 0.1 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
0.0 | 0.1 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.0 | 0.0 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
0.0 | 0.0 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
0.0 | 0.3 | REACTOME ADP SIGNALLING THROUGH P2RY1 | Genes involved in ADP signalling through P2Y purinoceptor 1 |
0.0 | 0.1 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
0.0 | 0.2 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
0.0 | 0.1 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
0.0 | 0.1 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.0 | 0.1 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
0.0 | 0.0 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
0.0 | 0.3 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
0.0 | 0.2 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |