Gene Symbol | Gene ID | Gene Info |
---|---|---|
Sin3a
|
ENSMUSG00000042557.8 | Sin3a |
Gene | Promoter | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Sin3a | chr9_57078362_57078551 | 1828 | 0.245305 | 0.86 | 3.0e-02 | Click! |
Sin3a | chr9_57073042_57073235 | 1098 | 0.312608 | 0.76 | 8.0e-02 | Click! |
Sin3a | chr9_57073656_57073872 | 1574 | 0.249578 | 0.65 | 1.6e-01 | Click! |
Sin3a | chr9_57076088_57076313 | 176 | 0.920805 | 0.63 | 1.8e-01 | Click! |
Sin3a | chr9_57073309_57073651 | 1440 | 0.259534 | 0.57 | 2.3e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr17_57199524_57200036 | 4.29 |
Tnfsf14 |
tumor necrosis factor (ligand) superfamily, member 14 |
5603 |
0.12 |
chr17_57200639_57201014 | 3.77 |
Tnfsf14 |
tumor necrosis factor (ligand) superfamily, member 14 |
6649 |
0.11 |
chr11_69416113_69416276 | 1.76 |
Kdm6b |
KDM1 lysine (K)-specific demethylase 6B |
2519 |
0.13 |
chr8_119417171_119417322 | 1.67 |
Osgin1 |
oxidative stress induced growth inhibitor 1 |
16878 |
0.13 |
chr19_16132652_16132926 | 1.44 |
Gnaq |
guanine nucleotide binding protein, alpha q polypeptide |
42 |
0.98 |
chr16_22163049_22163219 | 1.30 |
Igf2bp2 |
insulin-like growth factor 2 mRNA binding protein 2 |
115 |
0.96 |
chr7_27252126_27252620 | 1.17 |
Gm44641 |
predicted gene 44641 |
197 |
0.84 |
chrX_13846465_13846885 | 1.15 |
Cask |
calcium/calmodulin-dependent serine protein kinase (MAGUK family) |
60 |
0.98 |
chr17_57200072_57200273 | 1.12 |
Tnfsf14 |
tumor necrosis factor (ligand) superfamily, member 14 |
5995 |
0.12 |
chr7_133710448_133710606 | 1.09 |
Uros |
uroporphyrinogen III synthase |
455 |
0.64 |
chr9_44881325_44881623 | 0.94 |
Kmt2a |
lysine (K)-specific methyltransferase 2A |
178 |
0.57 |
chr8_119417830_119417981 | 0.92 |
Osgin1 |
oxidative stress induced growth inhibitor 1 |
16219 |
0.14 |
chr12_102788080_102788385 | 0.90 |
Gm47042 |
predicted gene, 47042 |
23520 |
0.08 |
chr4_133753896_133754062 | 0.90 |
Arid1a |
AT rich interactive domain 1A (SWI-like) |
3 |
0.97 |
chr5_139359081_139359268 | 0.86 |
Cyp2w1 |
cytochrome P450, family 2, subfamily w, polypeptide 1 |
4598 |
0.13 |
chr12_84190226_84190393 | 0.86 |
Gm19327 |
predicted gene, 19327 |
2503 |
0.16 |
chr1_58056967_58057118 | 0.86 |
Aox1 |
aldehyde oxidase 1 |
27078 |
0.14 |
chr4_16163611_16163787 | 0.86 |
Ripk2 |
receptor (TNFRSF)-interacting serine-threonine kinase 2 |
52 |
0.86 |
chr2_44927013_44927284 | 0.85 |
Gtdc1 |
glycosyltransferase-like domain containing 1 |
1 |
0.99 |
chr11_103106497_103106684 | 0.83 |
Acbd4 |
acyl-Coenzyme A binding domain containing 4 |
386 |
0.77 |
chr3_86920420_86920588 | 0.82 |
Dclk2 |
doublecortin-like kinase 2 |
125 |
0.95 |
chr9_8003649_8004083 | 0.82 |
Yap1 |
yes-associated protein 1 |
91 |
0.94 |
chrX_13072528_13072686 | 0.81 |
Usp9x |
ubiquitin specific peptidase 9, X chromosome |
1093 |
0.52 |
chrX_102478577_102478728 | 0.81 |
Hdac8 |
histone deacetylase 8 |
26089 |
0.19 |
chr9_107651822_107652162 | 0.78 |
Slc38a3 |
solute carrier family 38, member 3 |
4028 |
0.09 |
chr1_73936610_73936841 | 0.78 |
Tns1 |
tensin 1 |
4289 |
0.26 |
chr7_35118823_35119005 | 0.77 |
Cebpa |
CCAAT/enhancer binding protein (C/EBP), alpha |
379 |
0.6 |
chr6_72899633_72900030 | 0.76 |
Kcmf1 |
potassium channel modulatory factor 1 |
128 |
0.95 |
chr13_98815095_98815432 | 0.76 |
Fcho2 |
FCH domain only 2 |
55 |
0.95 |
chr5_43233554_43233922 | 0.75 |
Cpeb2 |
cytoplasmic polyadenylation element binding protein 2 |
189 |
0.9 |
chr17_74294775_74294926 | 0.75 |
Memo1 |
mediator of cell motility 1 |
9 |
0.97 |
chr17_67512799_67512950 | 0.75 |
Gm36201 |
predicted gene, 36201 |
116458 |
0.06 |
chr11_112808258_112808441 | 0.75 |
Gm11681 |
predicted gene 11681 |
9341 |
0.18 |
chr13_108214131_108214447 | 0.75 |
Elovl7 |
ELOVL family member 7, elongation of long chain fatty acids (yeast) |
115 |
0.96 |
chr11_19924023_19924195 | 0.74 |
Spred2 |
sprouty-related EVH1 domain containing 2 |
266 |
0.95 |
chr12_100725024_100725232 | 0.73 |
Rps6ka5 |
ribosomal protein S6 kinase, polypeptide 5 |
8 |
0.97 |
chr5_53213263_53213555 | 0.72 |
Sel1l3 |
sel-1 suppressor of lin-12-like 3 (C. elegans) |
43 |
0.98 |
chr17_34120395_34120586 | 0.72 |
Gm50336 |
predicted gene, 50336 |
78 |
0.47 |
chr7_26833249_26833400 | 0.71 |
Cyp2a5 |
cytochrome P450, family 2, subfamily a, polypeptide 5 |
1981 |
0.29 |
chr6_125333032_125333183 | 0.71 |
Scnn1a |
sodium channel, nonvoltage-gated 1 alpha |
11586 |
0.1 |
chr10_39731356_39731646 | 0.70 |
E130307A14Rik |
RIKEN cDNA E130307A14 gene |
275 |
0.72 |
chr8_119416779_119416930 | 0.70 |
Osgin1 |
oxidative stress induced growth inhibitor 1 |
17270 |
0.13 |
chr4_131924003_131924348 | 0.69 |
Tmem200b |
transmembrane protein 200B |
2404 |
0.15 |
chr6_124918029_124918194 | 0.69 |
Ptms |
parathymosin |
165 |
0.85 |
chr4_8690229_8690380 | 0.69 |
Chd7 |
chromodomain helicase DNA binding protein 7 |
102 |
0.98 |
chr11_98770698_98771034 | 0.69 |
Nr1d1 |
nuclear receptor subfamily 1, group D, member 1 |
440 |
0.69 |
chr11_98767109_98767369 | 0.68 |
Nr1d1 |
nuclear receptor subfamily 1, group D, member 1 |
3187 |
0.13 |
chr7_30956799_30956950 | 0.67 |
Gm4673 |
predicted gene 4673 |
35 |
0.51 |
chr10_63338137_63338648 | 0.66 |
Sirt1 |
sirtuin 1 |
640 |
0.61 |
chr14_100750255_100750445 | 0.66 |
Gm23538 |
predicted gene, 23538 |
9918 |
0.23 |
chr9_122713984_122714139 | 0.65 |
Gm47136 |
predicted gene, 47136 |
272 |
0.8 |
chr2_128387976_128388132 | 0.65 |
Morrbid |
myeloid RNA regulator of BCL2L11 induced cell death |
14911 |
0.19 |
chr3_97337526_97337699 | 0.65 |
Bcl9 |
B cell CLL/lymphoma 9 |
39695 |
0.14 |
chr17_5958348_5958506 | 0.65 |
Synj2 |
synaptojanin 2 |
17024 |
0.17 |
chr19_4042250_4042414 | 0.64 |
Gstp2 |
glutathione S-transferase, pi 2 |
69 |
0.91 |
chr8_94172420_94173095 | 0.64 |
Mt2 |
metallothionein 2 |
93 |
0.88 |
chr11_99168233_99168384 | 0.64 |
Ccr7 |
chemokine (C-C motif) receptor 7 |
13231 |
0.15 |
chr13_9012065_9012217 | 0.64 |
Gtpbp4 |
GTP binding protein 4 |
16058 |
0.11 |
chr1_134079839_134079990 | 0.64 |
Btg2 |
BTG anti-proliferation factor 2 |
794 |
0.53 |
chr2_31825447_31825664 | 0.64 |
Qrfp |
pyroglutamylated RFamide peptide |
14975 |
0.13 |
chr3_105046941_105047154 | 0.63 |
Cttnbp2nl |
CTTNBP2 N-terminal like |
5878 |
0.19 |
chr11_101772503_101772688 | 0.63 |
Etv4 |
ets variant 4 |
414 |
0.8 |
chr8_84978044_84978195 | 0.62 |
Junb |
jun B proto-oncogene |
599 |
0.41 |
chr17_30948483_30948657 | 0.62 |
Gm41562 |
predicted gene, 41562 |
2677 |
0.14 |
chr6_31148380_31148897 | 0.62 |
Gm37728 |
predicted gene, 37728 |
1219 |
0.36 |
chr4_128918307_128918477 | 0.61 |
Gm15904 |
predicted gene 15904 |
17613 |
0.14 |
chr8_95488751_95489033 | 0.61 |
Csnk2a2 |
casein kinase 2, alpha prime polypeptide |
65 |
0.95 |
chr4_149517962_149518308 | 0.61 |
Ctnnbip1 |
catenin beta interacting protein 1 |
101 |
0.9 |
chr17_66123664_66123841 | 0.61 |
Ddx11 |
DEAD/H (Asp-Glu-Ala-Asp/His) box helicase 11 |
139 |
0.93 |
chr5_121850762_121850913 | 0.60 |
Pheta1 |
PH domain containing endocytic trafficking adaptor 1 |
1832 |
0.19 |
chr8_13201367_13201561 | 0.60 |
2810030D12Rik |
RIKEN cDNA 2810030D12 gene |
644 |
0.42 |
chr4_53440081_53440358 | 0.60 |
Slc44a1 |
solute carrier family 44, member 1 |
194 |
0.96 |
chr5_148735573_148735724 | 0.59 |
2210417A02Rik |
RIKEN cDNA 2210417A02 gene |
6192 |
0.16 |
chr5_124605226_124605412 | 0.59 |
Tctn2 |
tectonic family member 2 |
6522 |
0.12 |
chr1_194636096_194636252 | 0.58 |
Plxna2 |
plexin A2 |
8682 |
0.17 |
chr11_116615779_116616354 | 0.58 |
Rhbdf2 |
rhomboid 5 homolog 2 |
8134 |
0.1 |
chr14_73349284_73349435 | 0.57 |
Gm49131 |
predicted gene, 49131 |
14267 |
0.17 |
chr5_135674436_135674608 | 0.57 |
Por |
P450 (cytochrome) oxidoreductase |
59 |
0.94 |
chr12_81860044_81860336 | 0.57 |
Pcnx |
pecanex homolog |
151 |
0.96 |
chr13_58479343_58479494 | 0.56 |
Gm47918 |
predicted gene, 47918 |
36397 |
0.12 |
chr12_3806884_3807044 | 0.56 |
Dnmt3a |
DNA methyltransferase 3A |
66 |
0.97 |
chr19_7217620_7217775 | 0.56 |
Cox8a |
cytochrome c oxidase subunit 8A |
81 |
0.95 |
chr3_79567848_79568031 | 0.56 |
Fnip2 |
folliculin interacting protein 2 |
143 |
0.64 |
chr3_35932730_35932963 | 0.55 |
Dcun1d1 |
DCN1, defective in cullin neddylation 1, domain containing 1 (S. cerevisiae) |
10 |
0.71 |
chr2_22773808_22773959 | 0.55 |
Apbb1ip |
amyloid beta (A4) precursor protein-binding, family B, member 1 interacting protein |
211 |
0.92 |
chr10_127621012_127621163 | 0.55 |
Lrp1 |
low density lipoprotein receptor-related protein 1 |
61 |
0.94 |
chr10_127516737_127516940 | 0.55 |
Ndufa4l2 |
Ndufa4, mitochondrial complex associated like 2 |
1871 |
0.17 |
chr7_19715424_19715597 | 0.55 |
Tomm40 |
translocase of outer mitochondrial membrane 40 |
72 |
0.84 |
chr1_191718324_191718483 | 0.55 |
Lpgat1 |
lysophosphatidylglycerol acyltransferase 1 |
14 |
0.98 |
chr12_110381296_110381622 | 0.55 |
Gm47195 |
predicted gene, 47195 |
56074 |
0.08 |
chr6_23098041_23098398 | 0.55 |
Aass |
aminoadipate-semialdehyde synthase |
29361 |
0.14 |
chr18_75984332_75984483 | 0.55 |
1700003O11Rik |
RIKEN cDNA 1700003O11 gene |
31270 |
0.2 |
chr8_35211753_35211929 | 0.54 |
Gm34474 |
predicted gene, 34474 |
6797 |
0.15 |
chrX_77433202_77433456 | 0.54 |
Gm5937 |
predicted gene 5937 |
23257 |
0.22 |
chr7_34655400_34655819 | 0.54 |
Kctd15 |
potassium channel tetramerisation domain containing 15 |
100 |
0.95 |
chr9_20727791_20727965 | 0.54 |
Olfm2 |
olfactomedin 2 |
351 |
0.85 |
chr1_65346015_65346330 | 0.53 |
Pth2r |
parathyroid hormone 2 receptor |
34915 |
0.14 |
chr18_60748821_60749236 | 0.53 |
Ndst1 |
N-deacetylase/N-sulfotransferase (heparan glucosaminyl) 1 |
378 |
0.77 |
chr1_133908470_133908621 | 0.53 |
Optc |
opticin |
546 |
0.66 |
chr17_35164874_35165221 | 0.53 |
Gm17705 |
predicted gene, 17705 |
72 |
0.57 |
chr4_76327444_76327611 | 0.53 |
Ptprd |
protein tyrosine phosphatase, receptor type, D |
2239 |
0.42 |
chr9_109095750_109095924 | 0.53 |
Plxnb1 |
plexin B1 |
115 |
0.92 |
chr16_93369696_93369958 | 0.53 |
Mir802 |
microRNA 802 |
107 |
0.95 |
chr9_45677619_45677770 | 0.52 |
Dscaml1 |
DS cell adhesion molecule like 1 |
4857 |
0.22 |
chr11_31770620_31770796 | 0.52 |
D630024D03Rik |
RIKEN cDNA D630024D03 gene |
53765 |
0.12 |
chr2_33908505_33908656 | 0.52 |
Mvb12b |
multivesicular body subunit 12B |
20634 |
0.19 |
chr1_107645210_107645382 | 0.52 |
Serpinb8 |
serine (or cysteine) peptidase inhibitor, clade B, member 8 |
39416 |
0.15 |
chr11_119086212_119086558 | 0.52 |
Cbx4 |
chromobox 4 |
164 |
0.94 |
chr16_23988325_23988531 | 0.52 |
Gm37419 |
predicted gene, 37419 |
54 |
0.87 |
chr5_120536242_120536393 | 0.51 |
Slc8b1 |
solute carrier family 8 (sodium/lithium/calcium exchanger), member B1 |
15538 |
0.1 |
chr19_46501644_46501821 | 0.51 |
Trim8 |
tripartite motif-containing 8 |
30 |
0.97 |
chr7_25220574_25220762 | 0.51 |
Dedd2 |
death effector domain-containing DNA binding protein 2 |
53 |
0.89 |
chr16_20672995_20673293 | 0.51 |
Eif4g1 |
eukaryotic translation initiation factor 4, gamma 1 |
151 |
0.88 |
chr5_134986039_134986190 | 0.51 |
Cldn3 |
claudin 3 |
100 |
0.92 |
chr1_176874134_176874434 | 0.51 |
Gm25993 |
predicted gene, 25993 |
5550 |
0.12 |
chr17_46162734_46163102 | 0.51 |
Gtpbp2 |
GTP binding protein 2 |
115 |
0.93 |
chrX_161716827_161716990 | 0.51 |
Rai2 |
retinoic acid induced 2 |
161 |
0.97 |
chr6_48444394_48444549 | 0.51 |
Zfp467 |
zinc finger protein 467 |
435 |
0.7 |
chr5_23411134_23411430 | 0.50 |
Gm42509 |
predicted gene 42509 |
15179 |
0.12 |
chr17_86754051_86754206 | 0.50 |
Epas1 |
endothelial PAS domain protein 1 |
428 |
0.83 |
chr4_107801994_107802271 | 0.50 |
Lrp8 |
low density lipoprotein receptor-related protein 8, apolipoprotein e receptor |
32 |
0.52 |
chr7_66131887_66132038 | 0.50 |
Gm18988 |
predicted gene, 18988 |
4263 |
0.15 |
chr5_143732139_143732352 | 0.50 |
Usp42 |
ubiquitin specific peptidase 42 |
35 |
0.97 |
chr13_48967958_48968445 | 0.50 |
Fam120a |
family with sequence similarity 120, member A |
184 |
0.96 |
chr15_78790472_78790626 | 0.50 |
Card10 |
caspase recruitment domain family, member 10 |
34 |
0.96 |
chr16_97606924_97607075 | 0.49 |
Tmprss2 |
transmembrane protease, serine 2 |
3970 |
0.25 |
chr12_76371036_76371200 | 0.49 |
Zbtb1 |
zinc finger and BTB domain containing 1 |
852 |
0.39 |
chr4_62516235_62516394 | 0.49 |
Alad |
aminolevulinate, delta-, dehydratase |
3567 |
0.14 |
chrX_73910525_73910676 | 0.49 |
Arhgap4 |
Rho GTPase activating protein 4 |
629 |
0.55 |
chr10_117025635_117025807 | 0.48 |
Gm10747 |
predicted gene 10747 |
18025 |
0.11 |
chr1_36259020_36259171 | 0.48 |
Neurl3 |
neuralized E3 ubiquitin protein ligase 3 |
14340 |
0.14 |
chr2_170131433_170131598 | 0.48 |
Zfp217 |
zinc finger protein 217 |
295 |
0.94 |
chr16_20716658_20716809 | 0.48 |
Clcn2 |
chloride channel, voltage-sensitive 2 |
569 |
0.44 |
chr13_45963545_45963696 | 0.48 |
Atxn1 |
ataxin 1 |
1337 |
0.37 |
chr7_112479242_112479393 | 0.48 |
Parva |
parvin, alpha |
40384 |
0.16 |
chr17_27826034_27826569 | 0.48 |
Ilrun |
inflammation and lipid regulator with UBA-like and NBR1-like domains |
5653 |
0.13 |
chr17_88065756_88066103 | 0.48 |
Fbxo11 |
F-box protein 11 |
638 |
0.74 |
chr9_75625685_75625836 | 0.48 |
Lysmd2 |
LysM, putative peptidoglycan-binding, domain containing 2 |
1 |
0.97 |
chr1_35926625_35927035 | 0.47 |
Gm8022 |
predicted gene 8022 |
32089 |
0.14 |
chr2_170129078_170129597 | 0.47 |
Zfp217 |
zinc finger protein 217 |
1883 |
0.47 |
chr12_45079507_45079683 | 0.47 |
Stxbp6 |
syntaxin binding protein 6 (amisyn) |
4886 |
0.22 |
chr12_112109668_112109994 | 0.47 |
Mir3073b |
microRNA 3073b |
522 |
0.45 |
chr7_118243426_118243633 | 0.47 |
Smg1 |
SMG1 homolog, phosphatidylinositol 3-kinase-related kinase (C. elegans) |
94 |
0.78 |
chr1_136141421_136141597 | 0.47 |
Kif21b |
kinesin family member 21B |
10055 |
0.11 |
chr1_171329852_171330003 | 0.47 |
Dedd |
death effector domain-containing |
159 |
0.86 |
chrX_42152085_42152285 | 0.47 |
Stag2 |
stromal antigen 2 |
5 |
0.97 |
chr7_99534983_99535177 | 0.47 |
Arrb1 |
arrestin, beta 1 |
386 |
0.77 |
chr11_108343516_108344044 | 0.47 |
Prkca |
protein kinase C, alpha |
132 |
0.81 |
chr3_121982194_121982345 | 0.47 |
Arhgap29 |
Rho GTPase activating protein 29 |
719 |
0.68 |
chr5_100498464_100498779 | 0.46 |
Lin54 |
lin-54 homolog (C. elegans) |
12 |
0.95 |
chr9_82975424_82975588 | 0.46 |
Phip |
pleckstrin homology domain interacting protein |
10 |
0.98 |
chr11_106789161_106789321 | 0.46 |
Cep95 |
centrosomal protein 95 |
11 |
0.52 |
chr16_95700323_95700474 | 0.46 |
Ets2 |
E26 avian leukemia oncogene 2, 3' domain |
1677 |
0.41 |
chr7_12928392_12928543 | 0.46 |
Rnf225 |
ring finger protein 225 |
1051 |
0.27 |
chr7_121269276_121269568 | 0.46 |
4930486N12Rik |
RIKEN cDNA 4930486N12 gene |
10027 |
0.17 |
chr10_80152069_80152378 | 0.46 |
Midn |
midnolin |
985 |
0.31 |
chr5_123144055_123144218 | 0.46 |
Setd1b |
SET domain containing 1B |
1179 |
0.24 |
chr10_117025914_117026071 | 0.45 |
Gm10747 |
predicted gene 10747 |
17754 |
0.11 |
chr5_112486568_112486719 | 0.45 |
Sez6l |
seizure related 6 homolog like |
11516 |
0.16 |
chr7_24610415_24610850 | 0.45 |
Phldb3 |
pleckstrin homology like domain, family B, member 3 |
131 |
0.91 |
chr7_130248180_130248534 | 0.45 |
Fgfr2 |
fibroblast growth factor receptor 2 |
13500 |
0.27 |
chr19_22066401_22066552 | 0.45 |
Gm50134 |
predicted gene, 50134 |
69145 |
0.1 |
chr4_126533313_126533464 | 0.44 |
Ago4 |
argonaute RISC catalytic subunit 4 |
84 |
0.94 |
chrX_142966510_142966805 | 0.44 |
Ammecr1 |
Alport syndrome, mental retardation, midface hypoplasia and elliptocytosis chromosomal region gene 1 |
71 |
0.98 |
chr15_77882832_77883023 | 0.44 |
Txn2 |
thioredoxin 2 |
32773 |
0.11 |
chr6_114921784_114921974 | 0.44 |
Vgll4 |
vestigial like family member 4 |
58 |
0.98 |
chrX_42148063_42148502 | 0.44 |
Stag2 |
stromal antigen 2 |
1035 |
0.46 |
chr7_67951889_67952040 | 0.44 |
Igf1r |
insulin-like growth factor I receptor |
863 |
0.66 |
chr7_45053316_45053568 | 0.44 |
Prr12 |
proline rich 12 |
561 |
0.42 |
chr2_32712738_32712909 | 0.44 |
Cdk9 |
cyclin-dependent kinase 9 (CDC2-related kinase) |
39 |
0.4 |
chr8_45626757_45627016 | 0.44 |
Sorbs2 |
sorbin and SH3 domain containing 2 |
853 |
0.61 |
chr8_70372073_70372256 | 0.44 |
Comp |
cartilage oligomeric matrix protein |
1394 |
0.28 |
chr8_111739071_111739223 | 0.44 |
Bcar1 |
breast cancer anti-estrogen resistance 1 |
4662 |
0.21 |
chr9_102890195_102890346 | 0.44 |
Ryk |
receptor-like tyrosine kinase |
8285 |
0.18 |
chr11_106920576_106920740 | 0.44 |
Smurf2 |
SMAD specific E3 ubiquitin protein ligase 2 |
57 |
0.55 |
chr1_169659535_169659755 | 0.43 |
Rgs5 |
regulator of G-protein signaling 5 |
4123 |
0.26 |
chr8_119445523_119446899 | 0.43 |
Necab2 |
N-terminal EF-hand calcium binding protein 2 |
508 |
0.74 |
chr4_105109724_105110029 | 0.43 |
Prkaa2 |
protein kinase, AMP-activated, alpha 2 catalytic subunit |
14 |
0.99 |
chr10_96616968_96617119 | 0.43 |
Btg1 |
BTG anti-proliferation factor 1 |
37 |
0.98 |
chr5_38486025_38486222 | 0.43 |
Slc2a9 |
solute carrier family 2 (facilitated glucose transporter), member 9 |
2738 |
0.25 |
chrX_140599053_140599582 | 0.43 |
Tsc22d3 |
TSC22 domain family, member 3 |
1342 |
0.4 |
chr13_62978237_62978398 | 0.43 |
Aopep |
aminopeptidase O |
13424 |
0.15 |
chr3_9610097_9610273 | 0.42 |
Zfp704 |
zinc finger protein 704 |
100 |
0.98 |
chr6_39206583_39206759 | 0.42 |
Kdm7a |
lysine (K)-specific demethylase 7A |
118 |
0.8 |
chr5_66435089_66435240 | 0.42 |
Gm43792 |
predicted gene 43792 |
3038 |
0.21 |
chr1_172027330_172027509 | 0.42 |
Vangl2 |
VANGL planar cell polarity 2 |
124 |
0.95 |
chr11_98795069_98795435 | 0.42 |
Msl1 |
male specific lethal 1 |
264 |
0.84 |
chr17_86963193_86963351 | 0.42 |
Rhoq |
ras homolog family member Q |
20 |
0.96 |
chr1_13374064_13374236 | 0.42 |
Ncoa2 |
nuclear receptor coactivator 2 |
67 |
0.95 |
chr4_82505575_82505973 | 0.42 |
Nfib |
nuclear factor I/B |
4 |
0.98 |
chr7_145047841_145048023 | 0.42 |
Ccnd1 |
cyclin D1 |
108007 |
0.05 |
chr5_21266271_21266422 | 0.42 |
Gm43214 |
predicted gene 43214 |
13275 |
0.16 |
chr7_30193818_30193981 | 0.42 |
Gm26810 |
predicted gene, 26810 |
55 |
0.56 |
chr7_66689696_66689866 | 0.42 |
Lins1 |
lines homolog 1 |
108 |
0.61 |
chr5_113648899_113649050 | 0.42 |
Cmklr1 |
chemokine-like receptor 1 |
1422 |
0.36 |
chr8_36779874_36780040 | 0.42 |
Dlc1 |
deleted in liver cancer 1 |
46903 |
0.18 |
chr4_155178360_155178562 | 0.41 |
Ski |
ski sarcoma viral oncogene homolog (avian) |
9835 |
0.18 |
chr15_73061025_73061335 | 0.41 |
Trappc9 |
trafficking protein particle complex 9 |
24 |
0.98 |
chr7_16320577_16320748 | 0.41 |
Bbc3 |
BCL2 binding component 3 |
7145 |
0.12 |
chr5_100663119_100663274 | 0.41 |
Coq2 |
coenzyme Q2 4-hydroxybenzoate polyprenyltransferase |
1223 |
0.4 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 1.1 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
0.3 | 0.9 | GO:2000259 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
0.3 | 0.9 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
0.3 | 0.8 | GO:0000432 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) |
0.3 | 1.8 | GO:0045634 | regulation of melanocyte differentiation(GO:0045634) |
0.2 | 0.7 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
0.2 | 1.0 | GO:0070671 | response to interleukin-12(GO:0070671) |
0.2 | 0.2 | GO:0021785 | branchiomotor neuron axon guidance(GO:0021785) |
0.2 | 0.6 | GO:2000586 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
0.2 | 0.8 | GO:0016479 | negative regulation of transcription from RNA polymerase I promoter(GO:0016479) |
0.2 | 1.0 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
0.2 | 0.6 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
0.2 | 0.2 | GO:2000828 | regulation of parathyroid hormone secretion(GO:2000828) |
0.2 | 1.0 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
0.2 | 0.6 | GO:0003347 | epicardial cell to mesenchymal cell transition(GO:0003347) |
0.2 | 0.6 | GO:0003419 | growth plate cartilage chondrocyte proliferation(GO:0003419) |
0.2 | 0.5 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
0.2 | 0.5 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
0.2 | 0.5 | GO:0043974 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
0.2 | 0.5 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
0.2 | 1.7 | GO:0032986 | nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
0.2 | 0.5 | GO:0090240 | positive regulation of histone H4 acetylation(GO:0090240) |
0.2 | 0.5 | GO:1901492 | positive regulation of lymphangiogenesis(GO:1901492) |
0.2 | 0.5 | GO:0048370 | lateral mesoderm morphogenesis(GO:0048369) lateral mesoderm formation(GO:0048370) lateral mesodermal cell differentiation(GO:0048371) |
0.2 | 0.6 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
0.2 | 0.8 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
0.2 | 0.6 | GO:0048625 | myoblast fate commitment(GO:0048625) |
0.2 | 0.5 | GO:0061010 | gall bladder development(GO:0061010) |
0.1 | 0.6 | GO:1990169 | detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
0.1 | 0.3 | GO:1900739 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
0.1 | 0.6 | GO:0060486 | Clara cell differentiation(GO:0060486) |
0.1 | 0.6 | GO:2000143 | negative regulation of transcription initiation from RNA polymerase II promoter(GO:0060633) negative regulation of DNA-templated transcription, initiation(GO:2000143) |
0.1 | 1.1 | GO:0021860 | pyramidal neuron development(GO:0021860) |
0.1 | 0.4 | GO:0016344 | meiotic chromosome movement towards spindle pole(GO:0016344) |
0.1 | 0.4 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
0.1 | 0.3 | GO:0044337 | canonical Wnt signaling pathway involved in positive regulation of apoptotic process(GO:0044337) |
0.1 | 0.6 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
0.1 | 0.4 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
0.1 | 0.4 | GO:2000619 | negative regulation of histone H4-K16 acetylation(GO:2000619) |
0.1 | 0.3 | GO:0097296 | activation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:0097296) |
0.1 | 0.4 | GO:1904017 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
0.1 | 0.4 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
0.1 | 0.4 | GO:0015817 | histidine transport(GO:0015817) |
0.1 | 0.5 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
0.1 | 0.4 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
0.1 | 0.7 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
0.1 | 0.3 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
0.1 | 0.1 | GO:0003223 | ventricular compact myocardium morphogenesis(GO:0003223) |
0.1 | 1.3 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
0.1 | 0.7 | GO:0070857 | regulation of bile acid biosynthetic process(GO:0070857) |
0.1 | 0.4 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
0.1 | 0.3 | GO:0034184 | positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
0.1 | 0.4 | GO:0033132 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
0.1 | 0.1 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) |
0.1 | 0.4 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
0.1 | 0.5 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
0.1 | 0.3 | GO:1902065 | response to L-glutamate(GO:1902065) |
0.1 | 0.4 | GO:0034085 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
0.1 | 0.5 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
0.1 | 0.3 | GO:2000705 | regulation of dense core granule biogenesis(GO:2000705) |
0.1 | 0.3 | GO:2000321 | positive regulation of T-helper 17 cell differentiation(GO:2000321) |
0.1 | 0.9 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
0.1 | 0.3 | GO:0035928 | rRNA import into mitochondrion(GO:0035928) |
0.1 | 1.0 | GO:1902287 | semaphorin-plexin signaling pathway involved in axon guidance(GO:1902287) |
0.1 | 0.4 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
0.1 | 0.1 | GO:0035509 | negative regulation of myosin-light-chain-phosphatase activity(GO:0035509) |
0.1 | 0.4 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
0.1 | 0.3 | GO:0035022 | positive regulation of Rac protein signal transduction(GO:0035022) |
0.1 | 0.5 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.1 | 0.3 | GO:0036493 | positive regulation of translation in response to endoplasmic reticulum stress(GO:0036493) |
0.1 | 0.6 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
0.1 | 1.2 | GO:0045603 | positive regulation of endothelial cell differentiation(GO:0045603) |
0.1 | 0.4 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.1 | 0.3 | GO:0000255 | allantoin metabolic process(GO:0000255) |
0.1 | 0.2 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.1 | 0.3 | GO:0070488 | neutrophil aggregation(GO:0070488) |
0.1 | 0.2 | GO:0033121 | regulation of purine nucleotide catabolic process(GO:0033121) |
0.1 | 0.3 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
0.1 | 1.0 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
0.1 | 0.3 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
0.1 | 0.5 | GO:0034625 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
0.1 | 0.1 | GO:2000591 | positive regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:0035793) regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:1900238) positive regulation of metanephric mesenchymal cell migration(GO:2000591) |
0.1 | 1.0 | GO:0010839 | negative regulation of keratinocyte proliferation(GO:0010839) |
0.1 | 0.5 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.1 | 0.1 | GO:0030046 | parallel actin filament bundle assembly(GO:0030046) |
0.1 | 0.4 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
0.1 | 0.2 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
0.1 | 0.1 | GO:0072262 | metanephric glomerular mesangium development(GO:0072223) metanephric glomerular mesangial cell proliferation involved in metanephros development(GO:0072262) |
0.1 | 0.3 | GO:0071276 | cellular response to cadmium ion(GO:0071276) |
0.1 | 0.9 | GO:0010759 | positive regulation of macrophage chemotaxis(GO:0010759) |
0.1 | 0.2 | GO:1902416 | positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
0.1 | 0.1 | GO:0070094 | positive regulation of glucagon secretion(GO:0070094) |
0.1 | 0.5 | GO:0035280 | miRNA loading onto RISC involved in gene silencing by miRNA(GO:0035280) |
0.1 | 0.2 | GO:0060397 | JAK-STAT cascade involved in growth hormone signaling pathway(GO:0060397) |
0.1 | 0.1 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
0.1 | 0.2 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
0.1 | 0.4 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
0.1 | 0.3 | GO:0019660 | fermentation(GO:0006113) glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
0.1 | 0.1 | GO:0010159 | specification of organ position(GO:0010159) |
0.1 | 0.2 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
0.1 | 0.1 | GO:0021538 | epithalamus development(GO:0021538) habenula development(GO:0021986) |
0.1 | 0.3 | GO:0060318 | regulation of definitive erythrocyte differentiation(GO:0010724) definitive erythrocyte differentiation(GO:0060318) |
0.1 | 0.4 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
0.1 | 0.3 | GO:0010626 | negative regulation of Schwann cell proliferation(GO:0010626) |
0.1 | 0.2 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.1 | 0.4 | GO:1901096 | regulation of autophagosome maturation(GO:1901096) |
0.1 | 0.2 | GO:0002159 | desmosome assembly(GO:0002159) |
0.1 | 0.1 | GO:0072191 | ureter smooth muscle development(GO:0072191) ureter smooth muscle cell differentiation(GO:0072193) |
0.1 | 0.2 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
0.1 | 0.4 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
0.1 | 0.4 | GO:0070327 | thyroid hormone transport(GO:0070327) |
0.1 | 0.1 | GO:0072553 | terminal button organization(GO:0072553) |
0.1 | 0.2 | GO:2000474 | regulation of opioid receptor signaling pathway(GO:2000474) |
0.1 | 0.1 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
0.1 | 0.1 | GO:0032346 | positive regulation of aldosterone metabolic process(GO:0032346) positive regulation of aldosterone biosynthetic process(GO:0032349) |
0.1 | 0.4 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
0.1 | 0.1 | GO:1900747 | negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) |
0.1 | 0.3 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
0.1 | 0.2 | GO:1901631 | positive regulation of presynaptic membrane organization(GO:1901631) |
0.1 | 0.1 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
0.1 | 0.1 | GO:2001170 | negative regulation of ATP biosynthetic process(GO:2001170) |
0.1 | 0.1 | GO:0034196 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
0.1 | 0.5 | GO:0043619 | regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0043619) |
0.1 | 0.2 | GO:0007354 | zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
0.1 | 0.2 | GO:0035672 | oligopeptide transmembrane transport(GO:0035672) |
0.1 | 0.3 | GO:2000169 | regulation of peptidyl-cysteine S-nitrosylation(GO:2000169) |
0.1 | 0.1 | GO:0061626 | pharyngeal arch artery morphogenesis(GO:0061626) |
0.1 | 0.1 | GO:0010748 | negative regulation of plasma membrane long-chain fatty acid transport(GO:0010748) |
0.1 | 0.1 | GO:0007619 | courtship behavior(GO:0007619) |
0.1 | 0.4 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
0.1 | 0.3 | GO:0072319 | vesicle uncoating(GO:0072319) |
0.1 | 0.2 | GO:0070601 | centromeric sister chromatid cohesion(GO:0070601) |
0.1 | 0.2 | GO:0043309 | regulation of eosinophil degranulation(GO:0043309) |
0.1 | 0.2 | GO:0060978 | angiogenesis involved in coronary vascular morphogenesis(GO:0060978) |
0.1 | 0.3 | GO:0015871 | choline transport(GO:0015871) |
0.1 | 0.4 | GO:0060710 | chorio-allantoic fusion(GO:0060710) |
0.1 | 0.6 | GO:0048268 | clathrin coat assembly(GO:0048268) |
0.1 | 0.3 | GO:0097466 | glycoprotein ERAD pathway(GO:0097466) response to glycoprotein(GO:1904587) |
0.1 | 0.3 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
0.1 | 0.1 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
0.1 | 0.1 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.1 | 0.3 | GO:0002756 | MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
0.1 | 0.2 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
0.1 | 0.5 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
0.1 | 0.2 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
0.1 | 0.2 | GO:0060591 | chondroblast differentiation(GO:0060591) |
0.1 | 0.1 | GO:0075509 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
0.1 | 0.1 | GO:2000275 | regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
0.1 | 0.2 | GO:0061101 | neuroendocrine cell differentiation(GO:0061101) |
0.1 | 0.1 | GO:0097195 | pilomotor reflex(GO:0097195) |
0.1 | 0.2 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
0.1 | 0.2 | GO:0046552 | eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
0.1 | 0.2 | GO:0035627 | ceramide transport(GO:0035627) |
0.1 | 0.1 | GO:0072718 | response to cisplatin(GO:0072718) |
0.1 | 0.1 | GO:0008050 | female courtship behavior(GO:0008050) |
0.0 | 0.4 | GO:0021903 | rostrocaudal neural tube patterning(GO:0021903) |
0.0 | 0.2 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
0.0 | 1.0 | GO:0006783 | heme biosynthetic process(GO:0006783) |
0.0 | 0.4 | GO:0046697 | decidualization(GO:0046697) |
0.0 | 0.2 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
0.0 | 0.1 | GO:0035771 | interleukin-4-mediated signaling pathway(GO:0035771) |
0.0 | 0.2 | GO:0034214 | protein hexamerization(GO:0034214) |
0.0 | 0.1 | GO:0051295 | establishment of meiotic spindle localization(GO:0051295) |
0.0 | 0.2 | GO:0030091 | protein repair(GO:0030091) |
0.0 | 0.1 | GO:0070814 | hydrogen sulfide biosynthetic process(GO:0070814) |
0.0 | 0.1 | GO:0036394 | amylase secretion(GO:0036394) |
0.0 | 0.2 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
0.0 | 0.2 | GO:0016584 | nucleosome positioning(GO:0016584) |
0.0 | 0.7 | GO:0035024 | negative regulation of Rho protein signal transduction(GO:0035024) |
0.0 | 0.1 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
0.0 | 0.2 | GO:2000973 | regulation of pro-B cell differentiation(GO:2000973) |
0.0 | 0.3 | GO:0043031 | negative regulation of macrophage activation(GO:0043031) |
0.0 | 0.1 | GO:0021570 | rhombomere 4 development(GO:0021570) |
0.0 | 0.1 | GO:0045583 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
0.0 | 0.3 | GO:0060693 | regulation of branching involved in salivary gland morphogenesis(GO:0060693) |
0.0 | 0.1 | GO:0051204 | protein insertion into mitochondrial membrane(GO:0051204) |
0.0 | 0.1 | GO:0046655 | folic acid metabolic process(GO:0046655) |
0.0 | 0.3 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
0.0 | 0.1 | GO:0006553 | lysine metabolic process(GO:0006553) |
0.0 | 0.3 | GO:0043981 | histone H4-K5 acetylation(GO:0043981) histone H4-K8 acetylation(GO:0043982) |
0.0 | 0.1 | GO:0021776 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
0.0 | 0.8 | GO:0060074 | synapse maturation(GO:0060074) |
0.0 | 0.1 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
0.0 | 0.1 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.0 | 0.2 | GO:0060235 | lens induction in camera-type eye(GO:0060235) |
0.0 | 0.4 | GO:0071420 | cellular response to histamine(GO:0071420) |
0.0 | 0.2 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
0.0 | 0.2 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
0.0 | 0.3 | GO:0051503 | adenine nucleotide transport(GO:0051503) |
0.0 | 0.1 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
0.0 | 0.3 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
0.0 | 0.1 | GO:0051342 | regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051342) |
0.0 | 0.5 | GO:0051601 | exocyst localization(GO:0051601) |
0.0 | 0.2 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
0.0 | 0.3 | GO:0035590 | purinergic nucleotide receptor signaling pathway(GO:0035590) |
0.0 | 0.3 | GO:0006857 | oligopeptide transport(GO:0006857) |
0.0 | 0.1 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
0.0 | 0.1 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
0.0 | 0.0 | GO:0006046 | N-acetylglucosamine catabolic process(GO:0006046) |
0.0 | 0.1 | GO:0070314 | G1 to G0 transition(GO:0070314) |
0.0 | 0.4 | GO:0044273 | sulfur compound catabolic process(GO:0044273) |
0.0 | 0.2 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
0.0 | 0.1 | GO:0046439 | cysteine catabolic process(GO:0009093) L-cysteine catabolic process(GO:0019448) L-cysteine metabolic process(GO:0046439) |
0.0 | 0.3 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
0.0 | 0.1 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
0.0 | 0.4 | GO:0035278 | miRNA mediated inhibition of translation(GO:0035278) |
0.0 | 0.1 | GO:0060155 | platelet dense granule organization(GO:0060155) |
0.0 | 0.0 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
0.0 | 0.2 | GO:0033600 | negative regulation of mammary gland epithelial cell proliferation(GO:0033600) |
0.0 | 0.4 | GO:0042416 | dopamine biosynthetic process(GO:0042416) |
0.0 | 0.1 | GO:0045541 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
0.0 | 0.2 | GO:0009115 | xanthine catabolic process(GO:0009115) |
0.0 | 0.0 | GO:0014016 | neuroblast differentiation(GO:0014016) response to folic acid(GO:0051593) |
0.0 | 0.1 | GO:0070447 | positive regulation of oligodendrocyte progenitor proliferation(GO:0070447) |
0.0 | 0.3 | GO:0090005 | negative regulation of establishment of protein localization to plasma membrane(GO:0090005) |
0.0 | 0.3 | GO:0006000 | fructose metabolic process(GO:0006000) |
0.0 | 0.1 | GO:1901857 | positive regulation of cellular respiration(GO:1901857) |
0.0 | 0.3 | GO:0048702 | embryonic neurocranium morphogenesis(GO:0048702) |
0.0 | 0.2 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
0.0 | 0.1 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
0.0 | 0.1 | GO:0035511 | oxidative DNA demethylation(GO:0035511) |
0.0 | 0.1 | GO:1990928 | response to amino acid starvation(GO:1990928) |
0.0 | 0.2 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.0 | 0.1 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
0.0 | 0.3 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
0.0 | 0.1 | GO:0002309 | T cell proliferation involved in immune response(GO:0002309) |
0.0 | 0.6 | GO:0061377 | mammary gland alveolus development(GO:0060749) mammary gland lobule development(GO:0061377) |
0.0 | 0.2 | GO:0006048 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
0.0 | 0.1 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
0.0 | 0.1 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
0.0 | 0.1 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
0.0 | 0.1 | GO:0090370 | negative regulation of cholesterol efflux(GO:0090370) |
0.0 | 0.3 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
0.0 | 0.1 | GO:0032439 | endosome localization(GO:0032439) |
0.0 | 0.1 | GO:1900368 | regulation of RNA interference(GO:1900368) |
0.0 | 0.1 | GO:0007100 | mitotic centrosome separation(GO:0007100) |
0.0 | 0.2 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
0.0 | 0.1 | GO:0043970 | histone H3-K9 acetylation(GO:0043970) |
0.0 | 0.2 | GO:0043416 | regulation of skeletal muscle tissue regeneration(GO:0043416) |
0.0 | 0.0 | GO:0007403 | glial cell fate determination(GO:0007403) |
0.0 | 0.1 | GO:0001893 | maternal placenta development(GO:0001893) |
0.0 | 0.1 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
0.0 | 0.2 | GO:0043486 | histone exchange(GO:0043486) |
0.0 | 0.4 | GO:0051150 | regulation of smooth muscle cell differentiation(GO:0051150) |
0.0 | 0.2 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
0.0 | 0.3 | GO:0034643 | establishment of mitochondrion localization, microtubule-mediated(GO:0034643) mitochondrion transport along microtubule(GO:0047497) |
0.0 | 0.1 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
0.0 | 0.1 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
0.0 | 0.1 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
0.0 | 0.1 | GO:0000957 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
0.0 | 0.0 | GO:0035733 | hepatic stellate cell activation(GO:0035733) |
0.0 | 0.2 | GO:0032494 | response to peptidoglycan(GO:0032494) |
0.0 | 0.1 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.0 | 0.1 | GO:1901844 | regulation of cell communication by electrical coupling involved in cardiac conduction(GO:1901844) |
0.0 | 0.1 | GO:0034182 | regulation of maintenance of sister chromatid cohesion(GO:0034091) regulation of maintenance of mitotic sister chromatid cohesion(GO:0034182) |
0.0 | 0.1 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
0.0 | 0.1 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
0.0 | 0.1 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.0 | 0.1 | GO:1903587 | regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903587) |
0.0 | 0.1 | GO:0033483 | gas homeostasis(GO:0033483) |
0.0 | 0.1 | GO:0035822 | meiotic gene conversion(GO:0006311) gene conversion(GO:0035822) |
0.0 | 0.1 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
0.0 | 0.1 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
0.0 | 0.2 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
0.0 | 0.3 | GO:0043518 | negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
0.0 | 0.2 | GO:0035608 | protein deglutamylation(GO:0035608) |
0.0 | 0.2 | GO:0006517 | protein deglycosylation(GO:0006517) |
0.0 | 0.2 | GO:1902895 | positive regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902895) |
0.0 | 0.5 | GO:0014850 | response to muscle activity(GO:0014850) |
0.0 | 0.1 | GO:0090168 | Golgi reassembly(GO:0090168) |
0.0 | 0.1 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
0.0 | 0.1 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
0.0 | 0.1 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
0.0 | 0.1 | GO:0048069 | eye pigmentation(GO:0048069) |
0.0 | 0.2 | GO:0071285 | cellular response to lithium ion(GO:0071285) |
0.0 | 0.1 | GO:0045869 | negative regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045869) |
0.0 | 0.1 | GO:0097343 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
0.0 | 0.1 | GO:1901798 | positive regulation of signal transduction by p53 class mediator(GO:1901798) |
0.0 | 0.2 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
0.0 | 0.1 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
0.0 | 0.1 | GO:1903521 | apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
0.0 | 0.1 | GO:0070340 | detection of bacterial lipopeptide(GO:0070340) |
0.0 | 0.1 | GO:1902255 | positive regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902255) |
0.0 | 0.2 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
0.0 | 0.2 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
0.0 | 0.1 | GO:1900242 | regulation of synaptic vesicle endocytosis(GO:1900242) |
0.0 | 0.0 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
0.0 | 0.2 | GO:0021707 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
0.0 | 0.4 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
0.0 | 0.3 | GO:0035561 | regulation of chromatin binding(GO:0035561) |
0.0 | 0.0 | GO:0046881 | positive regulation of follicle-stimulating hormone secretion(GO:0046881) |
0.0 | 0.1 | GO:0001842 | neural fold formation(GO:0001842) |
0.0 | 0.1 | GO:0051987 | positive regulation of attachment of spindle microtubules to kinetochore(GO:0051987) |
0.0 | 0.1 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.0 | 0.1 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
0.0 | 0.3 | GO:0035767 | endothelial cell chemotaxis(GO:0035767) |
0.0 | 0.3 | GO:0021542 | dentate gyrus development(GO:0021542) |
0.0 | 0.2 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
0.0 | 0.4 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.0 | 0.1 | GO:0018992 | germ-line sex determination(GO:0018992) |
0.0 | 0.1 | GO:1903140 | regulation of endothelial cell development(GO:1901550) regulation of establishment of endothelial barrier(GO:1903140) |
0.0 | 0.1 | GO:0016264 | gap junction assembly(GO:0016264) |
0.0 | 0.2 | GO:0043116 | negative regulation of vascular permeability(GO:0043116) |
0.0 | 0.1 | GO:0090091 | positive regulation of extracellular matrix disassembly(GO:0090091) |
0.0 | 0.2 | GO:0032367 | intracellular cholesterol transport(GO:0032367) |
0.0 | 0.0 | GO:1904251 | regulation of bile acid metabolic process(GO:1904251) |
0.0 | 0.1 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
0.0 | 0.1 | GO:0048012 | hepatocyte growth factor receptor signaling pathway(GO:0048012) |
0.0 | 0.3 | GO:0035025 | positive regulation of Rho protein signal transduction(GO:0035025) |
0.0 | 0.2 | GO:0036010 | protein localization to endosome(GO:0036010) |
0.0 | 0.5 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
0.0 | 0.0 | GO:0061687 | detoxification of inorganic compound(GO:0061687) |
0.0 | 0.0 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
0.0 | 0.1 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
0.0 | 0.1 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
0.0 | 0.0 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
0.0 | 0.1 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.0 | 0.1 | GO:0050955 | thermoception(GO:0050955) |
0.0 | 0.1 | GO:0035523 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
0.0 | 0.1 | GO:0071670 | smooth muscle cell chemotaxis(GO:0071670) |
0.0 | 0.0 | GO:1900451 | positive regulation of glutamate receptor signaling pathway(GO:1900451) positive regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000969) |
0.0 | 0.3 | GO:0007614 | short-term memory(GO:0007614) |
0.0 | 0.1 | GO:0071679 | commissural neuron axon guidance(GO:0071679) |
0.0 | 0.1 | GO:1904376 | negative regulation of protein localization to plasma membrane(GO:1903077) negative regulation of protein localization to cell periphery(GO:1904376) |
0.0 | 0.0 | GO:0010446 | response to alkaline pH(GO:0010446) |
0.0 | 0.1 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
0.0 | 0.1 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
0.0 | 0.0 | GO:2000664 | positive regulation of interleukin-5 secretion(GO:2000664) positive regulation of interleukin-13 secretion(GO:2000667) |
0.0 | 0.1 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
0.0 | 0.6 | GO:0006972 | hyperosmotic response(GO:0006972) |
0.0 | 0.1 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
0.0 | 0.1 | GO:0051541 | elastin metabolic process(GO:0051541) |
0.0 | 0.0 | GO:0009092 | homoserine metabolic process(GO:0009092) transsulfuration(GO:0019346) |
0.0 | 0.2 | GO:0032926 | negative regulation of activin receptor signaling pathway(GO:0032926) |
0.0 | 0.0 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
0.0 | 0.2 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
0.0 | 0.1 | GO:0051547 | regulation of keratinocyte migration(GO:0051547) positive regulation of keratinocyte migration(GO:0051549) |
0.0 | 0.2 | GO:0043249 | erythrocyte maturation(GO:0043249) |
0.0 | 0.1 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
0.0 | 0.2 | GO:0018904 | ether metabolic process(GO:0018904) |
0.0 | 0.1 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
0.0 | 0.2 | GO:0033617 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
0.0 | 0.0 | GO:0003166 | bundle of His development(GO:0003166) |
0.0 | 0.1 | GO:0019532 | oxalate transport(GO:0019532) |
0.0 | 0.5 | GO:0030866 | cortical actin cytoskeleton organization(GO:0030866) |
0.0 | 0.2 | GO:0000059 | protein import into nucleus, docking(GO:0000059) |
0.0 | 0.4 | GO:0042036 | negative regulation of cytokine biosynthetic process(GO:0042036) |
0.0 | 0.1 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
0.0 | 0.1 | GO:0009226 | nucleotide-sugar biosynthetic process(GO:0009226) |
0.0 | 0.4 | GO:0030262 | cellular component disassembly involved in execution phase of apoptosis(GO:0006921) apoptotic nuclear changes(GO:0030262) |
0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.1 | GO:1901299 | negative regulation of hydrogen peroxide-mediated programmed cell death(GO:1901299) |
0.0 | 0.0 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
0.0 | 0.1 | GO:0046543 | development of secondary female sexual characteristics(GO:0046543) |
0.0 | 0.1 | GO:0034627 | 'de novo' NAD biosynthetic process(GO:0034627) |
0.0 | 0.0 | GO:1904124 | microglial cell migration(GO:1904124) regulation of microglial cell migration(GO:1904139) |
0.0 | 0.2 | GO:0046579 | positive regulation of Ras protein signal transduction(GO:0046579) |
0.0 | 0.1 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
0.0 | 0.0 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
0.0 | 0.7 | GO:0014068 | positive regulation of phosphatidylinositol 3-kinase signaling(GO:0014068) |
0.0 | 0.2 | GO:0035873 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
0.0 | 0.0 | GO:0060423 | foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) |
0.0 | 0.0 | GO:0051890 | regulation of cardioblast differentiation(GO:0051890) |
0.0 | 0.0 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
0.0 | 0.1 | GO:0072307 | metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
0.0 | 0.0 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.0 | 0.1 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
0.0 | 0.1 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
0.0 | 0.0 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
0.0 | 0.0 | GO:1900020 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
0.0 | 0.1 | GO:0043578 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
0.0 | 0.2 | GO:0001675 | acrosome assembly(GO:0001675) |
0.0 | 0.1 | GO:0002035 | brain renin-angiotensin system(GO:0002035) |
0.0 | 0.0 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
0.0 | 0.1 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.0 | 0.1 | GO:0010715 | regulation of extracellular matrix disassembly(GO:0010715) |
0.0 | 0.1 | GO:1904424 | regulation of GTP binding(GO:1904424) |
0.0 | 0.1 | GO:0051823 | regulation of synapse structural plasticity(GO:0051823) |
0.0 | 0.1 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
0.0 | 0.0 | GO:2000359 | regulation of binding of sperm to zona pellucida(GO:2000359) |
0.0 | 0.0 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
0.0 | 0.1 | GO:0033227 | dsRNA transport(GO:0033227) |
0.0 | 0.1 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
0.0 | 0.1 | GO:0060044 | negative regulation of cardiac muscle cell proliferation(GO:0060044) |
0.0 | 0.0 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
0.0 | 0.4 | GO:0008299 | isoprenoid biosynthetic process(GO:0008299) |
0.0 | 0.1 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
0.0 | 0.1 | GO:0035425 | autocrine signaling(GO:0035425) |
0.0 | 0.1 | GO:0015888 | thiamine transport(GO:0015888) |
0.0 | 0.1 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
0.0 | 0.0 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.0 | 0.0 | GO:0045974 | negative regulation of translation, ncRNA-mediated(GO:0040033) regulation of translation, ncRNA-mediated(GO:0045974) |
0.0 | 0.0 | GO:0051299 | centrosome separation(GO:0051299) |
0.0 | 0.2 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
0.0 | 0.4 | GO:0051443 | positive regulation of ubiquitin-protein transferase activity(GO:0051443) |
0.0 | 0.2 | GO:0035855 | megakaryocyte development(GO:0035855) |
0.0 | 0.1 | GO:0071168 | protein localization to chromatin(GO:0071168) |
0.0 | 0.1 | GO:0002536 | respiratory burst involved in inflammatory response(GO:0002536) |
0.0 | 0.1 | GO:0051106 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
0.0 | 0.0 | GO:0002246 | wound healing involved in inflammatory response(GO:0002246) connective tissue replacement involved in inflammatory response wound healing(GO:0002248) inflammatory response to wounding(GO:0090594) connective tissue replacement(GO:0097709) |
0.0 | 0.1 | GO:0006172 | ADP biosynthetic process(GO:0006172) |
0.0 | 0.2 | GO:0003301 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
0.0 | 0.1 | GO:1901621 | negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
0.0 | 0.1 | GO:0008616 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
0.0 | 0.0 | GO:0002840 | T cell mediated immune response to tumor cell(GO:0002424) regulation of T cell mediated immune response to tumor cell(GO:0002840) |
0.0 | 0.1 | GO:0060671 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
0.0 | 0.3 | GO:0043171 | peptide catabolic process(GO:0043171) |
0.0 | 0.1 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) |
0.0 | 0.1 | GO:0006012 | galactose metabolic process(GO:0006012) |
0.0 | 0.1 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.0 | 0.0 | GO:1902033 | regulation of hematopoietic stem cell proliferation(GO:1902033) |
0.0 | 0.1 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
0.0 | 0.1 | GO:0031054 | pre-miRNA processing(GO:0031054) |
0.0 | 0.1 | GO:0070445 | oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
0.0 | 0.3 | GO:0045954 | positive regulation of natural killer cell mediated cytotoxicity(GO:0045954) |
0.0 | 0.2 | GO:0032968 | positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
0.0 | 0.1 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.0 | 0.1 | GO:0010566 | regulation of ketone biosynthetic process(GO:0010566) |
0.0 | 0.1 | GO:0034638 | phosphatidylcholine catabolic process(GO:0034638) |
0.0 | 0.0 | GO:0006059 | hexitol metabolic process(GO:0006059) inner medullary collecting duct development(GO:0072061) |
0.0 | 0.1 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
0.0 | 0.1 | GO:0019695 | choline metabolic process(GO:0019695) |
0.0 | 0.1 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
0.0 | 0.3 | GO:0009225 | nucleotide-sugar metabolic process(GO:0009225) |
0.0 | 0.0 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
0.0 | 0.1 | GO:0016559 | peroxisome fission(GO:0016559) |
0.0 | 0.0 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.0 | 0.1 | GO:2000194 | regulation of female gonad development(GO:2000194) |
0.0 | 0.1 | GO:0060613 | fat pad development(GO:0060613) |
0.0 | 0.1 | GO:0034243 | regulation of transcription elongation from RNA polymerase II promoter(GO:0034243) |
0.0 | 0.1 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
0.0 | 0.0 | GO:0033629 | negative regulation of cell adhesion mediated by integrin(GO:0033629) |
0.0 | 0.0 | GO:0045048 | protein insertion into ER membrane(GO:0045048) tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
0.0 | 0.1 | GO:0006244 | pyrimidine nucleotide catabolic process(GO:0006244) |
0.0 | 0.1 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.0 | 0.1 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
0.0 | 0.0 | GO:0072603 | interleukin-5 secretion(GO:0072603) interleukin-13 secretion(GO:0072611) regulation of interleukin-5 secretion(GO:2000662) regulation of interleukin-13 secretion(GO:2000665) |
0.0 | 0.0 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
0.0 | 0.1 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
0.0 | 0.0 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
0.0 | 0.0 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
0.0 | 0.0 | GO:0001547 | antral ovarian follicle growth(GO:0001547) |
0.0 | 0.1 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
0.0 | 0.0 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
0.0 | 0.0 | GO:0042435 | indole-containing compound biosynthetic process(GO:0042435) |
0.0 | 0.0 | GO:1902262 | apoptotic process involved in patterning of blood vessels(GO:1902262) |
0.0 | 0.0 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
0.0 | 0.0 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
0.0 | 0.1 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
0.0 | 0.0 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.0 | 0.1 | GO:0002084 | protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
0.0 | 0.0 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
0.0 | 0.1 | GO:0098719 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
0.0 | 0.0 | GO:1901529 | positive regulation of anion channel activity(GO:1901529) |
0.0 | 0.2 | GO:0001553 | luteinization(GO:0001553) |
0.0 | 0.1 | GO:0010225 | response to UV-C(GO:0010225) |
0.0 | 0.2 | GO:1901741 | positive regulation of myoblast fusion(GO:1901741) |
0.0 | 0.0 | GO:0001880 | Mullerian duct regression(GO:0001880) |
0.0 | 0.0 | GO:0015860 | purine nucleoside transmembrane transport(GO:0015860) purine-containing compound transmembrane transport(GO:0072530) nucleoside transmembrane transport(GO:1901642) |
0.0 | 0.1 | GO:0070365 | hepatocyte differentiation(GO:0070365) |
0.0 | 0.1 | GO:0034063 | stress granule assembly(GO:0034063) |
0.0 | 0.0 | GO:1904742 | regulation of telomeric DNA binding(GO:1904742) |
0.0 | 0.1 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.0 | 0.1 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
0.0 | 0.0 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
0.0 | 0.1 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.0 | 0.0 | GO:0006600 | creatine metabolic process(GO:0006600) |
0.0 | 0.3 | GO:1901385 | regulation of voltage-gated calcium channel activity(GO:1901385) |
0.0 | 0.1 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
0.0 | 0.2 | GO:0003084 | positive regulation of systemic arterial blood pressure(GO:0003084) |
0.0 | 0.0 | GO:0043328 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
0.0 | 0.0 | GO:0070842 | aggresome assembly(GO:0070842) |
0.0 | 0.1 | GO:0001955 | blood vessel maturation(GO:0001955) |
0.0 | 0.1 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
0.0 | 0.0 | GO:0002925 | positive regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002925) |
0.0 | 0.0 | GO:0071879 | positive regulation of adrenergic receptor signaling pathway(GO:0071879) |
0.0 | 0.0 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
0.0 | 0.1 | GO:0030311 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.0 | 0.0 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
0.0 | 0.1 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
0.0 | 0.1 | GO:0006779 | porphyrin-containing compound biosynthetic process(GO:0006779) tetrapyrrole biosynthetic process(GO:0033014) |
0.0 | 0.6 | GO:0006334 | nucleosome assembly(GO:0006334) |
0.0 | 0.0 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
0.0 | 0.1 | GO:0015670 | carbon dioxide transport(GO:0015670) |
0.0 | 0.1 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
0.0 | 0.1 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
0.0 | 0.0 | GO:0003174 | mitral valve development(GO:0003174) mitral valve morphogenesis(GO:0003183) |
0.0 | 0.2 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
0.0 | 0.0 | GO:0006534 | cysteine metabolic process(GO:0006534) |
0.0 | 0.1 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
0.0 | 0.1 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
0.0 | 0.1 | GO:0060406 | positive regulation of penile erection(GO:0060406) |
0.0 | 0.1 | GO:0070633 | transepithelial transport(GO:0070633) |
0.0 | 0.0 | GO:0071569 | protein ufmylation(GO:0071569) protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
0.0 | 0.0 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
0.0 | 0.1 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
0.0 | 0.1 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
0.0 | 0.0 | GO:0045590 | negative regulation of regulatory T cell differentiation(GO:0045590) |
0.0 | 0.1 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
0.0 | 0.2 | GO:0030574 | collagen catabolic process(GO:0030574) |
0.0 | 0.1 | GO:0060135 | maternal process involved in female pregnancy(GO:0060135) |
0.0 | 0.0 | GO:0032785 | negative regulation of DNA-templated transcription, elongation(GO:0032785) |
0.0 | 0.1 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
0.0 | 0.1 | GO:0071260 | cellular response to mechanical stimulus(GO:0071260) |
0.0 | 0.0 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
0.0 | 0.0 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
0.0 | 0.0 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.0 | 0.1 | GO:0033572 | transferrin transport(GO:0033572) |
0.0 | 0.0 | GO:0032430 | positive regulation of phospholipase A2 activity(GO:0032430) |
0.0 | 0.0 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
0.0 | 0.2 | GO:0040018 | positive regulation of multicellular organism growth(GO:0040018) |
0.0 | 0.1 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
0.0 | 0.0 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
0.0 | 0.0 | GO:0030920 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.0 | 0.0 | GO:0052041 | negative regulation by symbiont of host apoptotic process(GO:0033668) negative regulation by symbiont of host programmed cell death(GO:0052041) negative regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052490) |
0.0 | 0.1 | GO:0006044 | N-acetylglucosamine metabolic process(GO:0006044) |
0.0 | 0.1 | GO:0010718 | positive regulation of epithelial to mesenchymal transition(GO:0010718) |
0.0 | 0.1 | GO:0080009 | mRNA methylation(GO:0080009) |
0.0 | 0.1 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.0 | 0.0 | GO:2000525 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
0.0 | 0.0 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
0.0 | 0.0 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
0.0 | 0.1 | GO:0045176 | apical protein localization(GO:0045176) |
0.0 | 0.0 | GO:0032264 | IMP salvage(GO:0032264) |
0.0 | 0.3 | GO:0048240 | sperm capacitation(GO:0048240) |
0.0 | 0.1 | GO:0043277 | apoptotic cell clearance(GO:0043277) |
0.0 | 0.0 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
0.0 | 0.1 | GO:0072378 | blood coagulation, fibrin clot formation(GO:0072378) |
0.0 | 0.0 | GO:0071318 | cellular response to ATP(GO:0071318) |
0.0 | 0.0 | GO:0021586 | pons maturation(GO:0021586) |
0.0 | 0.1 | GO:0043312 | neutrophil degranulation(GO:0043312) |
0.0 | 0.0 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
0.0 | 0.1 | GO:0009438 | methylglyoxal metabolic process(GO:0009438) |
0.0 | 0.0 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
0.0 | 0.0 | GO:0001692 | histamine metabolic process(GO:0001692) |
0.0 | 0.0 | GO:0046110 | xanthine metabolic process(GO:0046110) |
0.0 | 0.1 | GO:0006098 | pentose-phosphate shunt(GO:0006098) |
0.0 | 0.3 | GO:0009268 | response to pH(GO:0009268) |
0.0 | 0.3 | GO:0019835 | cytolysis(GO:0019835) |
0.0 | 0.0 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
0.0 | 0.1 | GO:0048488 | synaptic vesicle endocytosis(GO:0048488) |
0.0 | 0.0 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
0.0 | 0.1 | GO:0097352 | autophagosome maturation(GO:0097352) |
0.0 | 0.0 | GO:0031508 | chromatin remodeling at centromere(GO:0031055) pericentric heterochromatin assembly(GO:0031508) |
0.0 | 0.0 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
0.0 | 0.1 | GO:0006108 | malate metabolic process(GO:0006108) |
0.0 | 0.0 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.0 | 0.1 | GO:0045779 | negative regulation of bone resorption(GO:0045779) |
0.0 | 0.0 | GO:1902414 | protein localization to cell junction(GO:1902414) |
0.0 | 0.1 | GO:0019240 | citrulline biosynthetic process(GO:0019240) |
0.0 | 0.1 | GO:0016188 | synaptic vesicle maturation(GO:0016188) |
0.0 | 0.1 | GO:0001542 | ovulation from ovarian follicle(GO:0001542) |
0.0 | 0.1 | GO:1900027 | regulation of ruffle assembly(GO:1900027) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 0.8 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
0.2 | 0.7 | GO:0072487 | MSL complex(GO:0072487) |
0.2 | 0.5 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.2 | 2.0 | GO:0016514 | SWI/SNF complex(GO:0016514) |
0.1 | 0.6 | GO:0035189 | Rb-E2F complex(GO:0035189) |
0.1 | 0.4 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
0.1 | 1.2 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.1 | 0.5 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
0.1 | 0.4 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.1 | 0.4 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
0.1 | 0.2 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.1 | 0.3 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.1 | 0.4 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
0.1 | 0.1 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
0.1 | 0.4 | GO:0005827 | polar microtubule(GO:0005827) |
0.1 | 0.3 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.1 | 0.2 | GO:0097513 | myosin II filament(GO:0097513) |
0.1 | 0.5 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.1 | 0.2 | GO:0031417 | NatC complex(GO:0031417) |
0.1 | 0.5 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.1 | 0.3 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.1 | 1.8 | GO:0000791 | euchromatin(GO:0000791) |
0.1 | 0.7 | GO:0005652 | nuclear lamina(GO:0005652) |
0.1 | 2.0 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
0.1 | 1.0 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.1 | 0.3 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
0.1 | 0.7 | GO:0031229 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
0.1 | 0.2 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
0.1 | 0.8 | GO:0046930 | pore complex(GO:0046930) |
0.0 | 0.4 | GO:0090544 | BAF-type complex(GO:0090544) |
0.0 | 0.2 | GO:0005955 | calcineurin complex(GO:0005955) |
0.0 | 0.6 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.0 | 0.3 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.0 | 0.1 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.0 | 0.3 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
0.0 | 0.4 | GO:0000124 | SAGA complex(GO:0000124) |
0.0 | 0.5 | GO:0042405 | nuclear inclusion body(GO:0042405) |
0.0 | 0.3 | GO:0000798 | nuclear cohesin complex(GO:0000798) |
0.0 | 0.5 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.0 | 0.4 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.0 | 0.1 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.0 | 2.4 | GO:0005905 | clathrin-coated pit(GO:0005905) |
0.0 | 0.2 | GO:1990130 | Iml1 complex(GO:1990130) |
0.0 | 0.2 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.0 | 0.3 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
0.0 | 0.1 | GO:0071141 | SMAD protein complex(GO:0071141) |
0.0 | 0.1 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.0 | 0.2 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
0.0 | 0.1 | GO:0070552 | BRISC complex(GO:0070552) |
0.0 | 0.3 | GO:0030056 | hemidesmosome(GO:0030056) |
0.0 | 0.1 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
0.0 | 0.0 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
0.0 | 0.1 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
0.0 | 0.2 | GO:0030285 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
0.0 | 1.2 | GO:0016328 | lateral plasma membrane(GO:0016328) |
0.0 | 0.5 | GO:0042101 | T cell receptor complex(GO:0042101) |
0.0 | 0.2 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
0.0 | 0.1 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.0 | 0.9 | GO:0009925 | basal plasma membrane(GO:0009925) |
0.0 | 0.1 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.0 | 0.2 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
0.0 | 0.1 | GO:0044299 | C-fiber(GO:0044299) |
0.0 | 0.1 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.0 | 0.1 | GO:0097443 | sorting endosome(GO:0097443) |
0.0 | 0.1 | GO:0097433 | dense body(GO:0097433) |
0.0 | 0.1 | GO:0097648 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
0.0 | 0.1 | GO:0044462 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
0.0 | 0.5 | GO:0031907 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
0.0 | 0.5 | GO:0000145 | exocyst(GO:0000145) |
0.0 | 0.1 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
0.0 | 0.1 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.0 | 0.2 | GO:0071556 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) |
0.0 | 0.6 | GO:0044665 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
0.0 | 0.4 | GO:0097225 | sperm midpiece(GO:0097225) |
0.0 | 0.1 | GO:0071817 | MMXD complex(GO:0071817) |
0.0 | 0.2 | GO:1990462 | omegasome(GO:1990462) |
0.0 | 0.3 | GO:0042582 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
0.0 | 0.0 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
0.0 | 0.1 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.0 | 0.2 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
0.0 | 0.2 | GO:0019908 | nuclear cyclin-dependent protein kinase holoenzyme complex(GO:0019908) |
0.0 | 0.9 | GO:0031519 | PcG protein complex(GO:0031519) |
0.0 | 0.1 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
0.0 | 0.3 | GO:0018995 | host(GO:0018995) host cell part(GO:0033643) host cell(GO:0043657) |
0.0 | 0.2 | GO:0031932 | TORC2 complex(GO:0031932) |
0.0 | 0.1 | GO:0097413 | Lewy body(GO:0097413) |
0.0 | 0.3 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) |
0.0 | 0.1 | GO:0000125 | PCAF complex(GO:0000125) |
0.0 | 0.2 | GO:0036157 | outer dynein arm(GO:0036157) |
0.0 | 0.4 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
0.0 | 0.4 | GO:1902710 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
0.0 | 0.3 | GO:0030867 | rough endoplasmic reticulum membrane(GO:0030867) |
0.0 | 0.1 | GO:0005606 | laminin-1 complex(GO:0005606) |
0.0 | 0.0 | GO:0045263 | proton-transporting ATP synthase complex, coupling factor F(o)(GO:0045263) |
0.0 | 0.1 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.0 | 0.1 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
0.0 | 0.1 | GO:0048179 | activin receptor complex(GO:0048179) |
0.0 | 0.2 | GO:0061700 | GATOR2 complex(GO:0061700) |
0.0 | 0.2 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
0.0 | 0.0 | GO:0017133 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
0.0 | 0.1 | GO:0072534 | perineuronal net(GO:0072534) |
0.0 | 0.1 | GO:0045261 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
0.0 | 0.1 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.0 | 0.1 | GO:0016942 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
0.0 | 0.3 | GO:0005637 | nuclear inner membrane(GO:0005637) |
0.0 | 0.2 | GO:0005916 | fascia adherens(GO:0005916) |
0.0 | 0.1 | GO:0036396 | MIS complex(GO:0036396) |
0.0 | 0.4 | GO:0048786 | presynaptic active zone(GO:0048786) |
0.0 | 0.1 | GO:0035355 | Toll-like receptor 2-Toll-like receptor 6 protein complex(GO:0035355) |
0.0 | 0.9 | GO:0032587 | ruffle membrane(GO:0032587) |
0.0 | 0.1 | GO:0042825 | TAP complex(GO:0042825) |
0.0 | 0.2 | GO:0032039 | integrator complex(GO:0032039) |
0.0 | 0.1 | GO:0042583 | chromaffin granule(GO:0042583) |
0.0 | 0.1 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
0.0 | 0.2 | GO:0001891 | phagocytic cup(GO:0001891) |
0.0 | 0.1 | GO:1990909 | Wnt signalosome(GO:1990909) |
0.0 | 0.1 | GO:0045179 | apical cortex(GO:0045179) |
0.0 | 0.1 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.0 | 0.3 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.0 | 0.1 | GO:0070652 | HAUS complex(GO:0070652) |
0.0 | 0.1 | GO:0001940 | male pronucleus(GO:0001940) |
0.0 | 0.0 | GO:0044326 | dendritic spine neck(GO:0044326) |
0.0 | 0.0 | GO:0030312 | external encapsulating structure(GO:0030312) |
0.0 | 0.0 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.0 | 0.1 | GO:0000235 | astral microtubule(GO:0000235) |
0.0 | 0.4 | GO:0055038 | recycling endosome membrane(GO:0055038) |
0.0 | 0.2 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.0 | 0.1 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.0 | 0.0 | GO:0030125 | clathrin vesicle coat(GO:0030125) |
0.0 | 0.5 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.0 | 0.0 | GO:1990393 | 3M complex(GO:1990393) |
0.0 | 0.1 | GO:0097470 | ribbon synapse(GO:0097470) |
0.0 | 0.5 | GO:0016592 | mediator complex(GO:0016592) |
0.0 | 0.1 | GO:0030891 | VCB complex(GO:0030891) |
0.0 | 0.1 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
0.0 | 0.2 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
0.0 | 0.3 | GO:0000786 | nucleosome(GO:0000786) |
0.0 | 0.2 | GO:0031083 | BLOC-1 complex(GO:0031083) |
0.0 | 0.0 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.0 | 0.1 | GO:1904115 | axon cytoplasm(GO:1904115) |
0.0 | 0.1 | GO:0042555 | MCM complex(GO:0042555) |
0.0 | 0.0 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.0 | 0.2 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
0.0 | 0.2 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.0 | 0.1 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
0.0 | 0.3 | GO:0031305 | integral component of mitochondrial inner membrane(GO:0031305) |
0.0 | 0.1 | GO:0001527 | microfibril(GO:0001527) |
0.0 | 0.0 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
0.0 | 0.0 | GO:0044393 | microspike(GO:0044393) |
0.0 | 0.3 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.0 | 0.3 | GO:0005763 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
0.0 | 0.0 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
0.0 | 0.0 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.0 | 0.1 | GO:0005577 | fibrinogen complex(GO:0005577) |
0.0 | 0.1 | GO:0032426 | stereocilium tip(GO:0032426) |
0.0 | 0.1 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
0.0 | 0.0 | GO:0005594 | collagen type IX trimer(GO:0005594) |
0.0 | 0.1 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 1.4 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
0.3 | 0.9 | GO:0035175 | histone kinase activity (H3-S10 specific)(GO:0035175) |
0.2 | 0.9 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.2 | 0.8 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
0.2 | 0.9 | GO:0030274 | LIM domain binding(GO:0030274) |
0.1 | 0.6 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.1 | 0.4 | GO:1990188 | euchromatin binding(GO:1990188) |
0.1 | 1.1 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
0.1 | 0.7 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
0.1 | 0.4 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
0.1 | 0.4 | GO:0036033 | mediator complex binding(GO:0036033) |
0.1 | 0.6 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.1 | 0.4 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
0.1 | 0.4 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
0.1 | 0.5 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.1 | 1.1 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
0.1 | 0.6 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
0.1 | 0.6 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
0.1 | 0.3 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
0.1 | 0.5 | GO:0010861 | thyroid hormone receptor activator activity(GO:0010861) |
0.1 | 0.5 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
0.1 | 1.2 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.1 | 0.7 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
0.1 | 0.6 | GO:0043559 | insulin binding(GO:0043559) |
0.1 | 0.5 | GO:1990239 | steroid hormone binding(GO:1990239) |
0.1 | 0.8 | GO:0001013 | RNA polymerase I regulatory region DNA binding(GO:0001013) |
0.1 | 0.4 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.1 | 0.4 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.1 | 0.3 | GO:0005290 | L-histidine transmembrane transporter activity(GO:0005290) |
0.1 | 0.3 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
0.1 | 0.3 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.1 | 0.3 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
0.1 | 0.3 | GO:0051434 | BH3 domain binding(GO:0051434) |
0.1 | 1.6 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
0.1 | 0.7 | GO:0038191 | neuropilin binding(GO:0038191) |
0.1 | 0.5 | GO:0102336 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
0.1 | 0.4 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.1 | 0.2 | GO:0015143 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
0.1 | 0.4 | GO:0043426 | MRF binding(GO:0043426) |
0.1 | 0.4 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
0.1 | 0.4 | GO:0008494 | translation activator activity(GO:0008494) |
0.1 | 0.4 | GO:0015288 | porin activity(GO:0015288) |
0.1 | 0.2 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
0.1 | 0.3 | GO:0004065 | arylsulfatase activity(GO:0004065) |
0.1 | 0.2 | GO:0031852 | mu-type opioid receptor binding(GO:0031852) |
0.1 | 0.7 | GO:0070410 | co-SMAD binding(GO:0070410) |
0.1 | 0.2 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
0.1 | 0.8 | GO:0034185 | apolipoprotein binding(GO:0034185) |
0.1 | 0.1 | GO:0050693 | LBD domain binding(GO:0050693) |
0.1 | 0.7 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.1 | 0.3 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.1 | 0.3 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
0.1 | 0.2 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.1 | 0.3 | GO:0035197 | siRNA binding(GO:0035197) |
0.1 | 0.2 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
0.1 | 0.4 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
0.1 | 0.8 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.1 | 0.4 | GO:0050897 | cobalt ion binding(GO:0050897) |
0.1 | 0.2 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.1 | 0.4 | GO:0004931 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.1 | 0.3 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.1 | 0.2 | GO:0008732 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
0.1 | 0.3 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.1 | 0.2 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.1 | 0.2 | GO:0031686 | A1 adenosine receptor binding(GO:0031686) |
0.1 | 0.3 | GO:1990254 | keratin filament binding(GO:1990254) |
0.1 | 0.7 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.1 | 0.2 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.1 | 0.3 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
0.1 | 0.2 | GO:0097001 | ceramide binding(GO:0097001) |
0.1 | 0.2 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
0.0 | 0.2 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
0.0 | 0.1 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
0.0 | 0.2 | GO:0016623 | aldehyde oxidase activity(GO:0004031) oxidoreductase activity, acting on the aldehyde or oxo group of donors, oxygen as acceptor(GO:0016623) |
0.0 | 0.6 | GO:0008432 | JUN kinase binding(GO:0008432) |
0.0 | 0.4 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
0.0 | 1.1 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
0.0 | 0.3 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
0.0 | 0.1 | GO:0070644 | vitamin D response element binding(GO:0070644) |
0.0 | 0.2 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.0 | 0.2 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
0.0 | 0.1 | GO:0046979 | TAP1 binding(GO:0046978) TAP2 binding(GO:0046979) |
0.0 | 0.6 | GO:0032183 | SUMO binding(GO:0032183) |
0.0 | 0.4 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
0.0 | 0.2 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.0 | 0.2 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
0.0 | 0.7 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.0 | 0.1 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.0 | 0.0 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
0.0 | 0.1 | GO:0035514 | DNA demethylase activity(GO:0035514) |
0.0 | 0.2 | GO:0031748 | D1 dopamine receptor binding(GO:0031748) |
0.0 | 0.4 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
0.0 | 0.4 | GO:0019841 | retinol binding(GO:0019841) |
0.0 | 0.0 | GO:0004457 | lactate dehydrogenase activity(GO:0004457) |
0.0 | 0.1 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.0 | 0.3 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
0.0 | 0.8 | GO:0070888 | E-box binding(GO:0070888) |
0.0 | 0.1 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
0.0 | 0.4 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.0 | 0.1 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
0.0 | 0.5 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.0 | 0.3 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.0 | 0.4 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.0 | 0.4 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
0.0 | 0.2 | GO:0032041 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
0.0 | 0.2 | GO:0042285 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
0.0 | 0.1 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
0.0 | 0.3 | GO:0046972 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
0.0 | 0.2 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
0.0 | 0.2 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
0.0 | 0.3 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
0.0 | 0.1 | GO:0035939 | microsatellite binding(GO:0035939) |
0.0 | 0.1 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
0.0 | 0.1 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
0.0 | 0.7 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.0 | 0.2 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.0 | 0.5 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.0 | 0.1 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.0 | 0.2 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.0 | 0.2 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
0.0 | 0.5 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
0.0 | 0.1 | GO:0004103 | choline kinase activity(GO:0004103) |
0.0 | 0.2 | GO:0031996 | thioesterase binding(GO:0031996) |
0.0 | 0.1 | GO:0051733 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) |
0.0 | 0.1 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.0 | 0.1 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
0.0 | 0.4 | GO:0000400 | four-way junction DNA binding(GO:0000400) |
0.0 | 0.1 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.0 | 0.1 | GO:0034580 | 4-methyloctanoyl-CoA dehydrogenase activity(GO:0034580) naphthyl-2-methyl-succinyl-CoA dehydrogenase activity(GO:0034845) 2-methylhexanoyl-CoA dehydrogenase activity(GO:0034916) propionyl-CoA dehydrogenase activity(GO:0043820) thiol-driven fumarate reductase activity(GO:0043830) coenzyme F420-dependent 2,4,6-trinitrophenol reductase activity(GO:0052758) coenzyme F420-dependent 2,4,6-trinitrophenol hydride reductase activity(GO:0052759) coenzyme F420-dependent 2,4-dinitrophenol reductase activity(GO:0052760) |
0.0 | 0.1 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
0.0 | 0.4 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
0.0 | 0.3 | GO:0031994 | insulin-like growth factor I binding(GO:0031994) |
0.0 | 0.1 | GO:0005499 | vitamin D binding(GO:0005499) |
0.0 | 0.1 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
0.0 | 0.5 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
0.0 | 0.1 | GO:0045118 | azole transporter activity(GO:0045118) azole transmembrane transporter activity(GO:1901474) |
0.0 | 0.5 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.0 | 0.1 | GO:0030572 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) |
0.0 | 0.2 | GO:0004064 | arylesterase activity(GO:0004064) |
0.0 | 0.1 | GO:0048030 | disaccharide binding(GO:0048030) |
0.0 | 0.1 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.0 | 0.1 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
0.0 | 0.1 | GO:0071209 | U7 snRNA binding(GO:0071209) |
0.0 | 0.5 | GO:0003785 | actin monomer binding(GO:0003785) |
0.0 | 0.0 | GO:0070546 | L-phenylalanine aminotransferase activity(GO:0070546) L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
0.0 | 0.2 | GO:0043912 | D-lysine oxidase activity(GO:0043912) |
0.0 | 0.1 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.0 | 0.1 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
0.0 | 0.2 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.0 | 0.3 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
0.0 | 0.2 | GO:0005522 | profilin binding(GO:0005522) |
0.0 | 0.3 | GO:0044548 | S100 protein binding(GO:0044548) |
0.0 | 0.5 | GO:0030332 | cyclin binding(GO:0030332) |
0.0 | 0.2 | GO:0001972 | retinoic acid binding(GO:0001972) |
0.0 | 0.1 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
0.0 | 0.2 | GO:0019957 | C-C chemokine binding(GO:0019957) |
0.0 | 0.1 | GO:0004104 | cholinesterase activity(GO:0004104) |
0.0 | 0.1 | GO:0019211 | phosphatase activator activity(GO:0019211) |
0.0 | 0.1 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
0.0 | 0.4 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
0.0 | 0.7 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
0.0 | 0.4 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
0.0 | 0.3 | GO:0048156 | tau protein binding(GO:0048156) |
0.0 | 0.1 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
0.0 | 0.2 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
0.0 | 0.1 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
0.0 | 0.2 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
0.0 | 0.2 | GO:0048185 | activin binding(GO:0048185) |
0.0 | 0.2 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
0.0 | 0.1 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.0 | 0.1 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
0.0 | 0.5 | GO:0017069 | snRNA binding(GO:0017069) |
0.0 | 0.1 | GO:0019158 | fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
0.0 | 0.3 | GO:0032452 | histone demethylase activity(GO:0032452) |
0.0 | 0.1 | GO:0016889 | endodeoxyribonuclease activity, producing 3'-phosphomonoesters(GO:0016889) |
0.0 | 0.0 | GO:0008297 | single-stranded DNA exodeoxyribonuclease activity(GO:0008297) |
0.0 | 0.1 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.0 | 0.1 | GO:0070139 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
0.0 | 0.6 | GO:0044390 | ubiquitin-like protein conjugating enzyme binding(GO:0044390) |
0.0 | 0.6 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
0.0 | 0.2 | GO:0008061 | chitin binding(GO:0008061) |
0.0 | 0.6 | GO:0090595 | dihydrolipoamide branched chain acyltransferase activity(GO:0004147) palmitoleoyl [acyl-carrier-protein]-dependent acyltransferase activity(GO:0008951) serine O-acyltransferase activity(GO:0016412) O-succinyltransferase activity(GO:0016750) sinapoyltransferase activity(GO:0016752) O-sinapoyltransferase activity(GO:0016753) peptidyl-lysine N6-myristoyltransferase activity(GO:0018030) peptidyl-lysine N6-palmitoyltransferase activity(GO:0018031) benzoyl acetate-CoA thiolase activity(GO:0018711) 3-hydroxybutyryl-CoA thiolase activity(GO:0018712) 3-ketopimelyl-CoA thiolase activity(GO:0018713) N-palmitoyltransferase activity(GO:0019105) acyl-CoA N-acyltransferase activity(GO:0019186) protein-cysteine S-myristoyltransferase activity(GO:0019705) glucosaminyl-phosphotidylinositol O-acyltransferase activity(GO:0032216) ergosterol O-acyltransferase activity(GO:0034737) lanosterol O-acyltransferase activity(GO:0034738) naphthyl-2-oxomethyl-succinyl-CoA succinyl transferase activity(GO:0034848) 2,4,4-trimethyl-3-oxopentanoyl-CoA 2-C-propanoyl transferase activity(GO:0034851) 2-methylhexanoyl-CoA C-acetyltransferase activity(GO:0034915) butyryl-CoA 2-C-propionyltransferase activity(GO:0034919) 2,6-dimethyl-5-methylene-3-oxo-heptanoyl-CoA C-acetyltransferase activity(GO:0034945) L-2-aminoadipate N-acetyltransferase activity(GO:0043741) keto acid formate lyase activity(GO:0043806) azetidine-2-carboxylic acid acetyltransferase activity(GO:0046941) peptidyl-lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0052858) acetyl-CoA:L-lysine N6-acetyltransferase(GO:0090595) |
0.0 | 0.1 | GO:0004461 | lactose synthase activity(GO:0004461) |
0.0 | 0.1 | GO:0071253 | connexin binding(GO:0071253) |
0.0 | 0.1 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
0.0 | 0.7 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
0.0 | 0.2 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
0.0 | 0.1 | GO:0008390 | testosterone 16-alpha-hydroxylase activity(GO:0008390) |
0.0 | 0.3 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
0.0 | 0.1 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
0.0 | 0.1 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
0.0 | 0.1 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.0 | 0.3 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.0 | 0.1 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
0.0 | 0.0 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
0.0 | 0.1 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
0.0 | 0.1 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
0.0 | 0.4 | GO:0018024 | histone-lysine N-methyltransferase activity(GO:0018024) |
0.0 | 0.1 | GO:0008296 | 3'-5'-exodeoxyribonuclease activity(GO:0008296) |
0.0 | 0.1 | GO:0004082 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
0.0 | 0.8 | GO:0008392 | arachidonic acid epoxygenase activity(GO:0008392) |
0.0 | 0.2 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
0.0 | 0.1 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
0.0 | 0.5 | GO:0005158 | insulin receptor binding(GO:0005158) |
0.0 | 0.1 | GO:0030519 | snoRNP binding(GO:0030519) |
0.0 | 0.3 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
0.0 | 0.1 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
0.0 | 0.2 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.0 | 0.1 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.0 | 0.1 | GO:0070492 | oligosaccharide binding(GO:0070492) |
0.0 | 0.1 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
0.0 | 0.1 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
0.0 | 0.1 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.0 | 0.2 | GO:0030275 | LRR domain binding(GO:0030275) |
0.0 | 0.6 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
0.0 | 0.1 | GO:0090482 | vitamin transmembrane transporter activity(GO:0090482) |
0.0 | 0.1 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
0.0 | 0.0 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
0.0 | 0.1 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) |
0.0 | 0.2 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.0 | 0.1 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
0.0 | 0.1 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
0.0 | 0.0 | GO:1901611 | phosphatidylglycerol binding(GO:1901611) cardiolipin binding(GO:1901612) |
0.0 | 0.0 | GO:0004096 | catalase activity(GO:0004096) |
0.0 | 0.1 | GO:0017166 | vinculin binding(GO:0017166) |
0.0 | 0.0 | GO:0030350 | iron-responsive element binding(GO:0030350) |
0.0 | 0.1 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
0.0 | 0.0 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.0 | 0.1 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.0 | 0.1 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
0.0 | 0.0 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
0.0 | 0.1 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
0.0 | 0.0 | GO:0055100 | adiponectin binding(GO:0055100) |
0.0 | 0.1 | GO:0030984 | kininogen binding(GO:0030984) |
0.0 | 0.1 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
0.0 | 0.1 | GO:0036137 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
0.0 | 0.1 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.0 | 0.1 | GO:0071723 | lipopeptide binding(GO:0071723) |
0.0 | 0.0 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.0 | 0.1 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.0 | 0.2 | GO:0035198 | miRNA binding(GO:0035198) |
0.0 | 0.1 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
0.0 | 0.0 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.0 | 0.1 | GO:0042731 | PH domain binding(GO:0042731) |
0.0 | 0.0 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.0 | 0.8 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
0.0 | 0.1 | GO:0043495 | protein anchor(GO:0043495) |
0.0 | 0.0 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
0.0 | 0.0 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
0.0 | 0.0 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.0 | 0.0 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
0.0 | 0.0 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) |
0.0 | 0.0 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
0.0 | 0.0 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.0 | 0.1 | GO:0015386 | sodium:proton antiporter activity(GO:0015385) potassium:proton antiporter activity(GO:0015386) |
0.0 | 0.1 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.0 | 0.1 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
0.0 | 0.0 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.0 | 0.1 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
0.0 | 0.1 | GO:0098599 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
0.0 | 0.0 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
0.0 | 0.2 | GO:0005035 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
0.0 | 0.1 | GO:0003933 | GTP cyclohydrolase activity(GO:0003933) |
0.0 | 0.1 | GO:0042171 | lysophosphatidic acid acyltransferase activity(GO:0042171) |
0.0 | 0.1 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
0.0 | 0.1 | GO:0019966 | interleukin-1 binding(GO:0019966) |
0.0 | 0.1 | GO:0016416 | O-palmitoyltransferase activity(GO:0016416) |
0.0 | 0.1 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.0 | 0.0 | GO:0004942 | anaphylatoxin receptor activity(GO:0004942) |
0.0 | 0.2 | GO:0051721 | protein phosphatase 2A binding(GO:0051721) |
0.0 | 0.2 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
0.0 | 0.0 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
0.0 | 2.2 | GO:0018169 | UDP-N-acetylmuramoylalanyl-D-glutamyl-2,6-diaminopimelate-D-alanyl-D-alanine ligase activity(GO:0008766) ribosomal S6-glutamic acid ligase activity(GO:0018169) coenzyme F420-0 gamma-glutamyl ligase activity(GO:0043773) coenzyme F420-2 alpha-glutamyl ligase activity(GO:0043774) protein-glycine ligase activity(GO:0070735) protein-glycine ligase activity, initiating(GO:0070736) protein-glycine ligase activity, elongating(GO:0070737) tubulin-glycine ligase activity(GO:0070738) |
0.0 | 0.1 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.0 | 0.0 | GO:0016406 | carnitine O-acyltransferase activity(GO:0016406) |
0.0 | 0.0 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
0.0 | 0.1 | GO:0016881 | acid-amino acid ligase activity(GO:0016881) |
0.0 | 0.0 | GO:0032052 | bile acid binding(GO:0032052) |
0.0 | 0.0 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
0.0 | 0.1 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
0.0 | 0.1 | GO:0034046 | poly(G) binding(GO:0034046) |
0.0 | 0.1 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
0.0 | 0.5 | GO:0038024 | cargo receptor activity(GO:0038024) |
0.0 | 0.0 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
0.0 | 0.0 | GO:0015232 | heme transporter activity(GO:0015232) |
0.0 | 0.0 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
0.0 | 0.0 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
0.0 | 0.1 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
0.0 | 0.2 | GO:0048020 | CCR chemokine receptor binding(GO:0048020) |
0.0 | 0.0 | GO:0016892 | endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
0.0 | 0.1 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.0 | 0.0 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) |
0.0 | 0.1 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.0 | 0.0 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
0.0 | 0.1 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
0.0 | 0.0 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 1.5 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
0.1 | 1.4 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.1 | 1.2 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.1 | 1.1 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.1 | 2.3 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.1 | 0.7 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.1 | 1.2 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.0 | 0.4 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
0.0 | 0.1 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.0 | 0.4 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
0.0 | 0.7 | PID IGF1 PATHWAY | IGF1 pathway |
0.0 | 1.6 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
0.0 | 2.0 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
0.0 | 0.1 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.0 | 0.2 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.0 | 0.9 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
0.0 | 1.3 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.0 | 2.3 | PID CMYB PATHWAY | C-MYB transcription factor network |
0.0 | 0.6 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
0.0 | 0.1 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
0.0 | 0.6 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
0.0 | 0.3 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.0 | 1.0 | PID BMP PATHWAY | BMP receptor signaling |
0.0 | 0.1 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
0.0 | 0.2 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.0 | 0.9 | PID LKB1 PATHWAY | LKB1 signaling events |
0.0 | 0.1 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.0 | 0.7 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.0 | 0.4 | PID S1P S1P3 PATHWAY | S1P3 pathway |
0.0 | 0.8 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
0.0 | 0.1 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
0.0 | 0.1 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
0.0 | 0.2 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
0.0 | 0.1 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.0 | 0.3 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.0 | 0.1 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.0 | 0.2 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
0.0 | 0.4 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.0 | 0.1 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
0.0 | 0.5 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
0.0 | 0.2 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
0.0 | 0.1 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.0 | 0.3 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
0.0 | 0.1 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
0.0 | 0.2 | SIG CHEMOTAXIS | Genes related to chemotaxis |
0.0 | 0.1 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
0.0 | 0.3 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
0.0 | 0.1 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.0 | 0.1 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
0.0 | 0.2 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
0.0 | 0.5 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.0 | 0.3 | PID RAS PATHWAY | Regulation of Ras family activation |
0.0 | 0.2 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.0 | 0.3 | PID REELIN PATHWAY | Reelin signaling pathway |
0.0 | 0.5 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.0 | 0.6 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
0.0 | 0.1 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
0.0 | 0.6 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
0.0 | 0.1 | ST B CELL ANTIGEN RECEPTOR | B Cell Antigen Receptor |
0.0 | 0.1 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.0 | 0.1 | PID AURORA A PATHWAY | Aurora A signaling |
0.0 | 0.1 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
0.0 | 0.2 | PID IL2 1PATHWAY | IL2-mediated signaling events |
0.0 | 0.1 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
0.0 | 0.1 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
0.0 | 0.1 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
0.0 | 0.1 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
0.0 | 0.0 | PID S1P S1P1 PATHWAY | S1P1 pathway |
0.0 | 0.1 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.0 | 0.0 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.0 | 0.3 | PID RHOA PATHWAY | RhoA signaling pathway |
0.0 | 0.1 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.0 | 0.0 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
0.0 | 0.2 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 1.4 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.1 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
0.1 | 0.2 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
0.1 | 0.5 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.1 | 0.9 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
0.1 | 0.9 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
0.1 | 1.4 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.1 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
0.1 | 0.9 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.1 | 0.7 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
0.1 | 1.9 | REACTOME TRANSCRIPTIONAL ACTIVITY OF SMAD2 SMAD3 SMAD4 HETEROTRIMER | Genes involved in Transcriptional activity of SMAD2/SMAD3:SMAD4 heterotrimer |
0.1 | 0.2 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
0.1 | 0.4 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
0.1 | 0.7 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
0.1 | 1.0 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
0.1 | 0.4 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
0.1 | 1.4 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.1 | 0.5 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
0.0 | 0.6 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
0.0 | 0.3 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.0 | 0.8 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
0.0 | 0.8 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
0.0 | 1.3 | REACTOME SIGNAL TRANSDUCTION BY L1 | Genes involved in Signal transduction by L1 |
0.0 | 0.6 | REACTOME P130CAS LINKAGE TO MAPK SIGNALING FOR INTEGRINS | Genes involved in p130Cas linkage to MAPK signaling for integrins |
0.0 | 0.7 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
0.0 | 0.9 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
0.0 | 0.3 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.0 | 1.0 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
0.0 | 0.6 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
0.0 | 0.1 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
0.0 | 0.6 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.0 | 0.3 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.0 | 0.7 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
0.0 | 0.1 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
0.0 | 0.4 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.0 | 0.5 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
0.0 | 0.4 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.0 | 0.1 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.0 | 0.1 | REACTOME G PROTEIN BETA GAMMA SIGNALLING | Genes involved in G-protein beta:gamma signalling |
0.0 | 0.4 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
0.0 | 0.2 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.0 | 0.2 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
0.0 | 0.2 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.0 | 1.0 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
0.0 | 0.8 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
0.0 | 0.4 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
0.0 | 0.7 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
0.0 | 0.1 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
0.0 | 0.2 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
0.0 | 0.3 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
0.0 | 0.0 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
0.0 | 0.4 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
0.0 | 0.0 | REACTOME CTLA4 INHIBITORY SIGNALING | Genes involved in CTLA4 inhibitory signaling |
0.0 | 0.1 | REACTOME SEMA4D IN SEMAPHORIN SIGNALING | Genes involved in Sema4D in semaphorin signaling |
0.0 | 0.4 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
0.0 | 0.2 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.0 | 0.2 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
0.0 | 0.3 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.0 | 0.1 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.0 | 0.1 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
0.0 | 0.3 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.0 | 0.3 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.0 | 0.5 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
0.0 | 0.2 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
0.0 | 0.1 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.0 | 0.3 | REACTOME CD28 DEPENDENT PI3K AKT SIGNALING | Genes involved in CD28 dependent PI3K/Akt signaling |
0.0 | 0.0 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
0.0 | 0.2 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
0.0 | 0.1 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
0.0 | 0.2 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
0.0 | 1.2 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
0.0 | 0.4 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.0 | 0.7 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.0 | 0.1 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
0.0 | 0.5 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.0 | 0.8 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
0.0 | 0.2 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
0.0 | 0.4 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.0 | 0.4 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
0.0 | 0.3 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
0.0 | 0.2 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
0.0 | 0.1 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
0.0 | 0.1 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
0.0 | 0.1 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
0.0 | 0.1 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
0.0 | 0.1 | REACTOME RAF MAP KINASE CASCADE | Genes involved in RAF/MAP kinase cascade |
0.0 | 1.3 | REACTOME DIABETES PATHWAYS | Genes involved in Diabetes pathways |
0.0 | 0.0 | REACTOME P75NTR SIGNALS VIA NFKB | Genes involved in p75NTR signals via NF-kB |
0.0 | 0.1 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
0.0 | 0.2 | REACTOME REGULATION OF WATER BALANCE BY RENAL AQUAPORINS | Genes involved in Regulation of Water Balance by Renal Aquaporins |
0.0 | 0.0 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
0.0 | 0.1 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
0.0 | 0.4 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
0.0 | 0.1 | REACTOME VIRAL MESSENGER RNA SYNTHESIS | Genes involved in Viral Messenger RNA Synthesis |
0.0 | 0.1 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
0.0 | 0.2 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
0.0 | 0.1 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
0.0 | 0.2 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |