Gene Symbol | Gene ID | Gene Info |
---|---|---|
Six6
|
ENSMUSG00000021099.5 | Six6 |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr3_97631864_97632097 | 4.64 |
Fmo5 |
flavin containing monooxygenase 5 |
3097 |
0.18 |
chr1_79750259_79750416 | 4.34 |
Wdfy1 |
WD repeat and FYVE domain containing 1 |
11384 |
0.17 |
chr11_28689224_28689493 | 3.82 |
2810471M01Rik |
RIKEN cDNA 2810471M01 gene |
7794 |
0.19 |
chr13_101679671_101680043 | 3.80 |
Pik3r1 |
phosphoinositide-3-kinase regulatory subunit 1 |
12486 |
0.22 |
chr11_120813788_120814608 | 3.78 |
Fasn |
fatty acid synthase |
1257 |
0.26 |
chr4_33467139_33467300 | 3.71 |
Gm11935 |
predicted gene 11935 |
14330 |
0.21 |
chr10_111315364_111315552 | 3.59 |
Bbs10 |
Bardet-Biedl syndrome 10 (human) |
16779 |
0.18 |
chr19_44393747_44393961 | 3.33 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
12836 |
0.14 |
chr9_106233703_106233854 | 3.23 |
Alas1 |
aminolevulinic acid synthase 1 |
3306 |
0.13 |
chr1_30941324_30941475 | 3.20 |
Ptp4a1 |
protein tyrosine phosphatase 4a1 |
2905 |
0.22 |
chr4_76964763_76964914 | 3.14 |
Gm23159 |
predicted gene, 23159 |
6340 |
0.27 |
chr3_94398765_94399136 | 2.96 |
Lingo4 |
leucine rich repeat and Ig domain containing 4 |
433 |
0.59 |
chr3_121808114_121808423 | 2.95 |
Abcd3 |
ATP-binding cassette, sub-family D (ALD), member 3 |
6641 |
0.13 |
chr5_87334492_87334755 | 2.87 |
Ugt2a3 |
UDP glucuronosyltransferase 2 family, polypeptide A3 |
2572 |
0.17 |
chr17_46052426_46052577 | 2.73 |
Vegfa |
vascular endothelial growth factor A |
20132 |
0.13 |
chr13_95792630_95792781 | 2.63 |
Iqgap2 |
IQ motif containing GTPase activating protein 2 |
28308 |
0.16 |
chr9_106239011_106239162 | 2.62 |
Alas1 |
aminolevulinic acid synthase 1 |
326 |
0.79 |
chr14_10750731_10751121 | 2.57 |
Fhitos |
fragile histidine triad gene, opposite strand |
12373 |
0.25 |
chr1_195013221_195013372 | 2.56 |
9630010A21Rik |
RIKEN cDNA 9630010A21 gene |
450 |
0.65 |
chr2_155102805_155102956 | 2.54 |
2310005A03Rik |
RIKEN cDNA 2310005A03 gene |
2799 |
0.2 |
chr6_50133249_50133400 | 2.49 |
Mpp6 |
membrane protein, palmitoylated 6 (MAGUK p55 subfamily member 6) |
22464 |
0.22 |
chr5_112287930_112288081 | 2.49 |
Tpst2 |
protein-tyrosine sulfotransferase 2 |
757 |
0.52 |
chr12_99858543_99858709 | 2.48 |
Efcab11 |
EF-hand calcium binding domain 11 |
24231 |
0.11 |
chr2_31515291_31515653 | 2.45 |
Ass1 |
argininosuccinate synthetase 1 |
3018 |
0.23 |
chr8_123978504_123978907 | 2.44 |
Abcb10 |
ATP-binding cassette, sub-family B (MDR/TAP), member 10 |
4417 |
0.12 |
chr17_28283665_28283835 | 2.43 |
Ppard |
peroxisome proliferator activator receptor delta |
9496 |
0.11 |
chr2_128968966_128969121 | 2.43 |
Gm10762 |
predicted gene 10762 |
999 |
0.34 |
chr12_104346326_104346873 | 2.42 |
Serpina3k |
serine (or cysteine) peptidase inhibitor, clade A, member 3K |
8113 |
0.12 |
chr9_48720821_48720995 | 2.42 |
Zbtb16 |
zinc finger and BTB domain containing 16 |
115037 |
0.05 |
chr8_18711435_18711873 | 2.42 |
Angpt2 |
angiopoietin 2 |
12107 |
0.18 |
chr7_98358819_98359055 | 2.41 |
Tsku |
tsukushi, small leucine rich proteoglycan |
1142 |
0.47 |
chr3_60965282_60965682 | 2.36 |
P2ry1 |
purinergic receptor P2Y, G-protein coupled 1 |
37313 |
0.16 |
chr15_3444192_3444343 | 2.36 |
Ghr |
growth hormone receptor |
27377 |
0.24 |
chr3_98723391_98723749 | 2.36 |
Hsd3b2 |
hydroxy-delta-5-steroid dehydrogenase, 3 beta- and steroid delta-isomerase 2 |
961 |
0.47 |
chr19_30039522_30039673 | 2.35 |
Uhrf2 |
ubiquitin-like, containing PHD and RING finger domains 2 |
9008 |
0.2 |
chrX_142478453_142478626 | 2.35 |
Gm25915 |
predicted gene, 25915 |
6908 |
0.19 |
chr3_130635863_130636014 | 2.34 |
Etnppl |
ethanolamine phosphate phospholyase |
9418 |
0.16 |
chr15_85716911_85717062 | 2.33 |
Mirlet7b |
microRNA let7b |
9667 |
0.13 |
chr6_70874333_70874484 | 2.32 |
Eif2ak3 |
eukaryotic translation initiation factor 2 alpha kinase 3 |
4153 |
0.17 |
chr8_64849910_64850714 | 2.32 |
Klhl2 |
kelch-like 2, Mayven |
295 |
0.88 |
chr12_104086888_104087200 | 2.28 |
Serpina4-ps1 |
serine (or cysteine) peptidase inhibitor, clade A, member 4, pseudogene 1 |
6395 |
0.1 |
chr10_87915013_87915171 | 2.26 |
Igf1os |
insulin-like growth factor 1, opposite strand |
51711 |
0.1 |
chr17_64607771_64607970 | 2.25 |
Man2a1 |
mannosidase 2, alpha 1 |
7134 |
0.26 |
chr2_155067847_155068055 | 2.22 |
Gm45609 |
predicted gene 45609 |
6230 |
0.14 |
chr9_109966945_109967106 | 2.22 |
Map4 |
microtubule-associated protein 4 |
1992 |
0.21 |
chr14_17725181_17725373 | 2.22 |
Gm48320 |
predicted gene, 48320 |
45845 |
0.18 |
chr6_120453197_120453348 | 2.19 |
Il17ra |
interleukin 17 receptor A |
9975 |
0.14 |
chr13_51089168_51089510 | 2.18 |
Spin1 |
spindlin 1 |
11541 |
0.24 |
chr3_116329378_116329892 | 2.17 |
Gm29151 |
predicted gene 29151 |
20468 |
0.17 |
chr9_24504187_24504390 | 2.16 |
Gm47772 |
predicted gene, 47772 |
839 |
0.5 |
chr17_56218078_56218458 | 2.13 |
Dpp9 |
dipeptidylpeptidase 9 |
621 |
0.53 |
chr16_26624427_26624775 | 2.13 |
Il1rap |
interleukin 1 receptor accessory protein |
445 |
0.89 |
chr15_97047584_97047768 | 2.12 |
Slc38a4 |
solute carrier family 38, member 4 |
2411 |
0.4 |
chr11_100975850_100976001 | 2.08 |
Cavin1 |
caveolae associated 1 |
5038 |
0.14 |
chr1_186358605_186358797 | 2.04 |
Gm37491 |
predicted gene, 37491 |
11386 |
0.28 |
chr1_67162712_67162908 | 2.04 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
39784 |
0.16 |
chr8_114151527_114151678 | 2.04 |
Nudt7 |
nudix (nucleoside diphosphate linked moiety X)-type motif 7 |
17960 |
0.25 |
chr7_81577348_81577499 | 2.04 |
Whamm |
WAS protein homolog associated with actin, golgi membranes and microtubules |
5479 |
0.11 |
chr3_12608407_12608567 | 2.03 |
Gm2429 |
predicted gene 2429 |
22773 |
0.28 |
chr19_44415624_44415803 | 2.02 |
Gm50337 |
predicted gene, 50337 |
3897 |
0.17 |
chr13_9932808_9933042 | 2.02 |
Gm47406 |
predicted gene, 47406 |
40015 |
0.14 |
chr7_26315751_26315908 | 2.02 |
Gm42375 |
predicted gene, 42375 |
8543 |
0.14 |
chr2_11503631_11503923 | 1.96 |
Pfkfb3 |
6-phosphofructo-2-kinase/fructose-2,6-biphosphatase 3 |
1676 |
0.29 |
chr13_91748935_91749127 | 1.95 |
Gm27656 |
predicted gene, 27656 |
3075 |
0.19 |
chr11_5899631_5899822 | 1.94 |
Myl7 |
myosin, light polypeptide 7, regulatory |
944 |
0.39 |
chr2_13270830_13271180 | 1.94 |
Rsu1 |
Ras suppressor protein 1 |
216 |
0.8 |
chr13_24378651_24378989 | 1.92 |
Cmah |
cytidine monophospho-N-acetylneuraminic acid hydroxylase |
2737 |
0.19 |
chr1_131919723_131919874 | 1.92 |
Gm38067 |
predicted gene, 38067 |
5269 |
0.12 |
chr2_18048778_18049088 | 1.91 |
Skida1 |
SKI/DACH domain containing 1 |
98 |
0.94 |
chr18_76019040_76019250 | 1.91 |
1700003O11Rik |
RIKEN cDNA 1700003O11 gene |
3468 |
0.29 |
chr7_102292941_102293166 | 1.90 |
Stim1 |
stromal interaction molecule 1 |
24726 |
0.12 |
chr17_46053621_46054045 | 1.90 |
Vegfa |
vascular endothelial growth factor A |
21464 |
0.12 |
chr3_18178649_18178800 | 1.90 |
Gm23686 |
predicted gene, 23686 |
1099 |
0.59 |
chr8_93183570_93183871 | 1.89 |
Gm45909 |
predicted gene 45909 |
7638 |
0.14 |
chr2_163301082_163301278 | 1.88 |
Tox2 |
TOX high mobility group box family member 2 |
19198 |
0.19 |
chr16_79086922_79087073 | 1.87 |
Tmprss15 |
transmembrane protease, serine 15 |
4095 |
0.35 |
chr7_119847310_119847629 | 1.87 |
Rexo5 |
RNA exonuclease 5 |
3263 |
0.18 |
chr17_28495920_28496094 | 1.87 |
Fkbp5 |
FK506 binding protein 5 |
9858 |
0.08 |
chr10_87868820_87868971 | 1.87 |
Igf1os |
insulin-like growth factor 1, opposite strand |
5514 |
0.22 |
chr7_98357834_98358027 | 1.84 |
Tsku |
tsukushi, small leucine rich proteoglycan |
2149 |
0.28 |
chr11_16878004_16878233 | 1.84 |
Egfr |
epidermal growth factor receptor |
32 |
0.98 |
chr18_39366595_39366746 | 1.83 |
Arhgap26 |
Rho GTPase activating protein 26 |
4087 |
0.22 |
chr4_6225587_6225787 | 1.82 |
Ubxn2b |
UBX domain protein 2B |
34589 |
0.15 |
chr15_36269773_36269927 | 1.81 |
Rnf19a |
ring finger protein 19A |
13248 |
0.11 |
chr3_31074905_31075056 | 1.80 |
Skil |
SKI-like |
20078 |
0.16 |
chr2_52371770_52371921 | 1.80 |
Neb |
nebulin |
4315 |
0.17 |
chr14_59549214_59549387 | 1.79 |
Cdadc1 |
cytidine and dCMP deaminase domain containing 1 |
48536 |
0.12 |
chr6_128973141_128973308 | 1.78 |
Mir7649 |
microRNA 7649 |
1671 |
0.15 |
chr10_53989891_53990042 | 1.77 |
Man1a |
mannosidase 1, alpha |
12851 |
0.24 |
chr1_67160278_67160544 | 1.76 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
37385 |
0.17 |
chr18_4842215_4842386 | 1.75 |
Gm10556 |
predicted gene 10556 |
29814 |
0.21 |
chr2_19646277_19646428 | 1.75 |
Gm13343 |
predicted gene 13343 |
5996 |
0.14 |
chr1_184791005_184791166 | 1.74 |
Mtarc1 |
mitochondrial amidoxime reducing component 1 |
17768 |
0.13 |
chr12_95624393_95624559 | 1.73 |
Gm22246 |
predicted gene, 22246 |
4658 |
0.27 |
chr19_12651908_12652059 | 1.72 |
Glyat |
glycine-N-acyltransferase |
12491 |
0.09 |
chr10_69217231_69217448 | 1.72 |
Rhobtb1 |
Rho-related BTB domain containing 1 |
2037 |
0.3 |
chr11_16777068_16777446 | 1.72 |
Egfr |
epidermal growth factor receptor |
25027 |
0.17 |
chr15_38079426_38079586 | 1.72 |
Gm49312 |
predicted gene, 49312 |
404 |
0.62 |
chr1_51771229_51771422 | 1.71 |
Myo1b |
myosin IB |
446 |
0.84 |
chr11_50312282_50312433 | 1.71 |
Canx |
calnexin |
11367 |
0.12 |
chr7_126673507_126673658 | 1.70 |
Sgf29 |
SAGA complex associated factor 29 |
1551 |
0.16 |
chr2_31491761_31492352 | 1.70 |
Ass1 |
argininosuccinate synthetase 1 |
5716 |
0.2 |
chr9_48648645_48648796 | 1.70 |
Nnmt |
nicotinamide N-methyltransferase |
43567 |
0.17 |
chr8_46750315_46750466 | 1.69 |
Irf2 |
interferon regulatory factor 2 |
10124 |
0.14 |
chr12_93152728_93152880 | 1.68 |
Gm47998 |
predicted gene, 47998 |
154653 |
0.04 |
chr8_4275384_4275766 | 1.68 |
Timm44 |
translocase of inner mitochondrial membrane 44 |
274 |
0.82 |
chr12_104100793_104100977 | 1.68 |
Serpina5 |
serine (or cysteine) peptidase inhibitor, clade A, member 5 |
228 |
0.86 |
chr8_36291164_36291366 | 1.68 |
Lonrf1 |
LON peptidase N-terminal domain and ring finger 1 |
41749 |
0.14 |
chr3_27604322_27604514 | 1.66 |
Mir3092 |
microRNA 3092 |
19423 |
0.23 |
chr12_16562529_16562714 | 1.66 |
Lpin1 |
lipin 1 |
177 |
0.97 |
chr5_92725821_92725972 | 1.66 |
Gm20500 |
predicted gene 20500 |
10309 |
0.19 |
chr7_63923519_63923771 | 1.65 |
Klf13 |
Kruppel-like factor 13 |
1225 |
0.37 |
chr2_134828446_134828597 | 1.65 |
Gm14036 |
predicted gene 14036 |
24572 |
0.2 |
chr13_81327556_81327707 | 1.65 |
Adgrv1 |
adhesion G protein-coupled receptor V1 |
15205 |
0.25 |
chr2_51512380_51512539 | 1.65 |
Gm23505 |
predicted gene, 23505 |
18677 |
0.19 |
chr18_59092890_59093288 | 1.63 |
Minar2 |
membrane integral NOTCH2 associated receptor 2 |
30578 |
0.22 |
chr1_23257165_23257357 | 1.61 |
Gm6420 |
predicted gene 6420 |
854 |
0.48 |
chr13_102569889_102570107 | 1.61 |
Gm29927 |
predicted gene, 29927 |
20287 |
0.22 |
chr8_41020077_41020232 | 1.61 |
B430010I23Rik |
RIKEN cDNA B430010I23 gene |
2416 |
0.22 |
chr2_18435403_18435565 | 1.60 |
Dnajc1 |
DnaJ heat shock protein family (Hsp40) member C1 |
42654 |
0.16 |
chr15_39861023_39861174 | 1.59 |
Dpys |
dihydropyrimidinase |
3628 |
0.27 |
chr3_138285092_138285352 | 1.59 |
Adh1 |
alcohol dehydrogenase 1 (class I) |
7571 |
0.12 |
chr17_80784545_80784708 | 1.59 |
Map4k3 |
mitogen-activated protein kinase kinase kinase kinase 3 |
56141 |
0.12 |
chr6_72600544_72600754 | 1.59 |
Retsat |
retinol saturase (all trans retinol 13,14 reductase) |
2021 |
0.15 |
chr16_13898723_13898906 | 1.58 |
Pdxdc1 |
pyridoxal-dependent decarboxylase domain containing 1 |
4161 |
0.15 |
chr14_21148896_21149047 | 1.58 |
Adk |
adenosine kinase |
72819 |
0.1 |
chr4_100114235_100114698 | 1.57 |
Gm12701 |
predicted gene 12701 |
5155 |
0.23 |
chr10_111625398_111625575 | 1.57 |
Gm47864 |
predicted gene, 47864 |
24326 |
0.14 |
chr7_68975779_68975947 | 1.57 |
Gm44691 |
predicted gene 44691 |
13541 |
0.21 |
chr2_177901070_177901508 | 1.55 |
Gm14327 |
predicted gene 14327 |
2996 |
0.19 |
chr9_24494490_24494678 | 1.54 |
Dpy19l1 |
dpy-19-like 1 (C. elegans) |
2588 |
0.3 |
chr19_31884467_31884670 | 1.54 |
A1cf |
APOBEC1 complementation factor |
15787 |
0.21 |
chr1_91300915_91301207 | 1.54 |
Scly |
selenocysteine lyase |
1129 |
0.35 |
chr16_26643331_26643502 | 1.53 |
Il1rap |
interleukin 1 receptor accessory protein |
19260 |
0.26 |
chr6_38823618_38823874 | 1.53 |
Hipk2 |
homeodomain interacting protein kinase 2 |
5400 |
0.26 |
chr3_18239524_18239975 | 1.53 |
Cyp7b1 |
cytochrome P450, family 7, subfamily b, polypeptide 1 |
3589 |
0.29 |
chr2_160362942_160363707 | 1.53 |
Mafb |
v-maf musculoaponeurotic fibrosarcoma oncogene family, protein B (avian) |
3741 |
0.3 |
chr16_43394836_43395188 | 1.53 |
Gm15713 |
predicted gene 15713 |
25184 |
0.16 |
chr4_104871987_104872184 | 1.53 |
C8a |
complement component 8, alpha polypeptide |
4298 |
0.23 |
chr2_42022841_42022992 | 1.52 |
Gm13461 |
predicted gene 13461 |
34087 |
0.23 |
chr7_35792963_35793124 | 1.52 |
Zfp507 |
zinc finger protein 507 |
1001 |
0.52 |
chr13_20512265_20512416 | 1.51 |
Gm47657 |
predicted gene, 47657 |
7545 |
0.18 |
chr1_130761129_130761587 | 1.51 |
Gm28856 |
predicted gene 28856 |
5026 |
0.11 |
chr7_121002556_121002718 | 1.51 |
Mfsd13b |
major facilitator superfamily domain containing 13B |
10814 |
0.09 |
chr10_87936414_87936806 | 1.51 |
Tyms-ps |
thymidylate synthase, pseudogene |
30237 |
0.15 |
chr10_67192820_67193057 | 1.51 |
Jmjd1c |
jumonji domain containing 1C |
7185 |
0.22 |
chr2_75698638_75698789 | 1.51 |
Nfe2l2 |
nuclear factor, erythroid derived 2, like 2 |
5776 |
0.13 |
chr2_44920398_44920555 | 1.51 |
Gtdc1 |
glycosyltransferase-like domain containing 1 |
6673 |
0.29 |
chrX_77473216_77473367 | 1.50 |
Gm5937 |
predicted gene 5937 |
16705 |
0.22 |
chr13_9493955_9494714 | 1.50 |
Gm48871 |
predicted gene, 48871 |
48434 |
0.12 |
chr6_129094978_129095181 | 1.49 |
Clec2e |
C-type lectin domain family 2, member e |
5834 |
0.12 |
chr6_108834740_108834891 | 1.49 |
Edem1 |
ER degradation enhancer, mannosidase alpha-like 1 |
1595 |
0.43 |
chr10_111245198_111245370 | 1.49 |
Osbpl8 |
oxysterol binding protein-like 8 |
2784 |
0.27 |
chr2_84359341_84359492 | 1.49 |
Calcrl |
calcitonin receptor-like |
15942 |
0.19 |
chr10_50896822_50896973 | 1.49 |
Sim1 |
single-minded family bHLH transcription factor 1 |
1246 |
0.58 |
chr3_113570784_113571146 | 1.49 |
Amy1 |
amylase 1, salivary |
3307 |
0.26 |
chrX_105929569_105929720 | 1.47 |
Atrx |
ATRX, chromatin remodeler |
241 |
0.93 |
chr3_130650366_130650549 | 1.47 |
Etnppl |
ethanolamine phosphate phospholyase |
23937 |
0.13 |
chr18_39482744_39482920 | 1.46 |
Nr3c1 |
nuclear receptor subfamily 3, group C, member 1 |
4400 |
0.3 |
chr4_35004522_35004673 | 1.46 |
Gm12364 |
predicted gene 12364 |
42377 |
0.13 |
chr13_63253031_63253209 | 1.46 |
Gm47603 |
predicted gene, 47603 |
2444 |
0.15 |
chr4_139601582_139602248 | 1.46 |
Gm21969 |
predicted gene 21969 |
1271 |
0.37 |
chr12_25861580_25861731 | 1.46 |
Gm47733 |
predicted gene, 47733 |
9498 |
0.26 |
chr7_39841504_39841670 | 1.45 |
4930558N11Rik |
RIKEN cDNA 4930558N11 gene |
43845 |
0.11 |
chr12_16535290_16535473 | 1.45 |
Lpin1 |
lipin 1 |
26657 |
0.22 |
chr14_62884538_62884723 | 1.45 |
n-R5s47 |
nuclear encoded rRNA 5S 47 |
14916 |
0.13 |
chr3_36532262_36532452 | 1.45 |
Gm11549 |
predicted gene 11549 |
26 |
0.96 |
chr14_86301203_86301445 | 1.45 |
Gm32815 |
predicted gene, 32815 |
1590 |
0.29 |
chr11_16843001_16843162 | 1.45 |
Egfros |
epidermal growth factor receptor, opposite strand |
12379 |
0.2 |
chr2_6871414_6871679 | 1.44 |
Celf2 |
CUGBP, Elav-like family member 2 |
426 |
0.85 |
chr10_86691292_86691645 | 1.44 |
Gm15344 |
predicted gene 15344 |
1627 |
0.16 |
chr16_11884290_11884471 | 1.44 |
Gm9961 |
predicted gene 9961 |
16983 |
0.21 |
chr4_45475445_45475639 | 1.44 |
Shb |
src homology 2 domain-containing transforming protein B |
7260 |
0.17 |
chr4_15145228_15145428 | 1.44 |
Necab1 |
N-terminal EF-hand calcium binding protein 1 |
3633 |
0.27 |
chr18_45563342_45563666 | 1.43 |
Kcnn2 |
potassium intermediate/small conductance calcium-activated channel, subfamily N, member 2 |
3350 |
0.27 |
chr12_32828463_32828637 | 1.43 |
Nampt |
nicotinamide phosphoribosyltransferase |
7749 |
0.21 |
chr1_151325474_151325655 | 1.43 |
Gm10138 |
predicted gene 10138 |
18518 |
0.13 |
chr13_41005844_41005995 | 1.43 |
Pak1ip1 |
PAK1 interacting protein 1 |
4653 |
0.13 |
chr16_97610441_97610883 | 1.43 |
Tmprss2 |
transmembrane protease, serine 2 |
307 |
0.91 |
chr6_29571610_29572022 | 1.43 |
Tnpo3 |
transportin 3 |
297 |
0.87 |
chr15_4725142_4725293 | 1.43 |
C6 |
complement component 6 |
1958 |
0.43 |
chr14_70712939_70713321 | 1.43 |
Xpo7 |
exportin 7 |
5095 |
0.18 |
chr4_70531624_70531805 | 1.42 |
Megf9 |
multiple EGF-like-domains 9 |
3214 |
0.39 |
chr5_24825075_24825274 | 1.41 |
Rheb |
Ras homolog enriched in brain |
11215 |
0.16 |
chr10_53318105_53318261 | 1.41 |
Gm17823 |
predicted gene, 17823 |
18041 |
0.12 |
chr19_41629603_41629757 | 1.41 |
Slit1 |
slit guidance ligand 1 |
21150 |
0.18 |
chr16_25067456_25067616 | 1.41 |
A230028O05Rik |
RIKEN cDNA A230028O05 gene |
7897 |
0.31 |
chr19_8400709_8400872 | 1.40 |
Slc22a30 |
solute carrier family 22, member 30 |
4270 |
0.24 |
chr4_122955991_122956232 | 1.39 |
Mfsd2a |
major facilitator superfamily domain containing 2A |
3879 |
0.16 |
chr15_3570914_3571065 | 1.39 |
Ghr |
growth hormone receptor |
10853 |
0.25 |
chr13_54100929_54101113 | 1.39 |
Sfxn1 |
sideroflexin 1 |
8310 |
0.19 |
chr10_81627809_81628227 | 1.39 |
Sirt6 |
sirtuin 6 |
221 |
0.7 |
chr4_106317002_106317643 | 1.39 |
Usp24 |
ubiquitin specific peptidase 24 |
1088 |
0.47 |
chr1_172159886_172160228 | 1.39 |
Dcaf8 |
DDB1 and CUL4 associated factor 8 |
11109 |
0.1 |
chr9_117714906_117715134 | 1.38 |
Rbms3 |
RNA binding motif, single stranded interacting protein |
85107 |
0.1 |
chr1_188902459_188902627 | 1.38 |
Ush2a |
usherin |
51201 |
0.15 |
chr5_100419251_100419681 | 1.38 |
Sec31a |
Sec31 homolog A (S. cerevisiae) |
3232 |
0.18 |
chrX_145769946_145770202 | 1.38 |
Gm15058 |
predicted gene 15058 |
16118 |
0.23 |
chr6_124812471_124812707 | 1.38 |
Tpi1 |
triosephosphate isomerase 1 |
251 |
0.78 |
chr6_116046891_116047100 | 1.37 |
Tmcc1 |
transmembrane and coiled coil domains 1 |
9960 |
0.17 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.2 | 3.6 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
1.0 | 3.1 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
0.7 | 4.4 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
0.5 | 1.1 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
0.5 | 2.7 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
0.5 | 0.5 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.5 | 2.6 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
0.5 | 2.0 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.4 | 2.2 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
0.4 | 1.7 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
0.4 | 1.7 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
0.4 | 1.3 | GO:0060468 | prevention of polyspermy(GO:0060468) |
0.4 | 1.2 | GO:1903660 | regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
0.4 | 1.2 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
0.4 | 1.2 | GO:0035973 | aggrephagy(GO:0035973) |
0.4 | 1.6 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
0.4 | 1.2 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
0.4 | 1.9 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
0.4 | 1.2 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
0.4 | 1.1 | GO:0006210 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
0.4 | 1.5 | GO:0046449 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
0.4 | 2.2 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.3 | 0.3 | GO:0046084 | adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
0.3 | 0.7 | GO:2000611 | positive regulation of thyroid hormone generation(GO:2000611) |
0.3 | 1.7 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
0.3 | 0.3 | GO:0042851 | L-alanine metabolic process(GO:0042851) |
0.3 | 1.0 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.3 | 1.3 | GO:0018211 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
0.3 | 0.9 | GO:1900045 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
0.3 | 0.9 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
0.3 | 0.9 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
0.3 | 0.9 | GO:0006068 | ethanol catabolic process(GO:0006068) |
0.3 | 1.5 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) |
0.3 | 1.2 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.3 | 0.8 | GO:0009730 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
0.3 | 0.6 | GO:0060375 | regulation of mast cell differentiation(GO:0060375) |
0.3 | 0.6 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
0.3 | 0.8 | GO:0015770 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.3 | 0.8 | GO:0003330 | regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
0.3 | 0.8 | GO:0002282 | microglial cell activation involved in immune response(GO:0002282) |
0.3 | 1.6 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
0.3 | 0.8 | GO:0021553 | olfactory nerve development(GO:0021553) |
0.3 | 1.0 | GO:0003241 | growth involved in heart morphogenesis(GO:0003241) |
0.3 | 1.0 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
0.2 | 0.7 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
0.2 | 0.7 | GO:0019065 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
0.2 | 0.2 | GO:0034310 | primary alcohol catabolic process(GO:0034310) |
0.2 | 0.7 | GO:0045917 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
0.2 | 1.1 | GO:0032237 | activation of store-operated calcium channel activity(GO:0032237) |
0.2 | 0.6 | GO:0050427 | 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
0.2 | 0.4 | GO:0003162 | atrioventricular node development(GO:0003162) |
0.2 | 0.6 | GO:0045356 | positive regulation of interferon-alpha biosynthetic process(GO:0045356) |
0.2 | 1.3 | GO:0070995 | NADPH oxidation(GO:0070995) |
0.2 | 0.8 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
0.2 | 1.2 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
0.2 | 0.8 | GO:0010529 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
0.2 | 1.4 | GO:0006108 | malate metabolic process(GO:0006108) |
0.2 | 0.8 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
0.2 | 0.6 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
0.2 | 2.8 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.2 | 1.5 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
0.2 | 0.6 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.2 | 0.7 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
0.2 | 0.4 | GO:0051790 | short-chain fatty acid biosynthetic process(GO:0051790) |
0.2 | 0.6 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
0.2 | 0.7 | GO:0070900 | mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
0.2 | 0.7 | GO:0009414 | response to water deprivation(GO:0009414) |
0.2 | 0.5 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
0.2 | 0.5 | GO:0015819 | lysine transport(GO:0015819) |
0.2 | 0.5 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
0.2 | 0.9 | GO:0046487 | glyoxylate metabolic process(GO:0046487) |
0.2 | 0.7 | GO:0061641 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
0.2 | 0.5 | GO:0001998 | angiotensin mediated vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001998) |
0.2 | 0.5 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
0.2 | 0.5 | GO:0032763 | regulation of mast cell cytokine production(GO:0032763) |
0.2 | 0.3 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.2 | 0.5 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
0.2 | 0.5 | GO:0036394 | amylase secretion(GO:0036394) |
0.2 | 0.7 | GO:0007227 | signal transduction downstream of smoothened(GO:0007227) |
0.2 | 1.3 | GO:0006013 | mannose metabolic process(GO:0006013) |
0.2 | 0.7 | GO:0032819 | positive regulation of natural killer cell proliferation(GO:0032819) |
0.2 | 0.8 | GO:0030647 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.2 | 0.5 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
0.2 | 0.5 | GO:0061368 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
0.2 | 0.5 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
0.2 | 1.1 | GO:0060613 | fat pad development(GO:0060613) |
0.2 | 0.6 | GO:0071276 | cellular response to cadmium ion(GO:0071276) |
0.2 | 0.9 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
0.2 | 0.5 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
0.2 | 0.3 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
0.1 | 0.4 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
0.1 | 0.4 | GO:0006015 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
0.1 | 0.4 | GO:0061625 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
0.1 | 1.0 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
0.1 | 0.3 | GO:1904339 | negative regulation of dopaminergic neuron differentiation(GO:1904339) |
0.1 | 0.3 | GO:0060737 | prostate gland morphogenetic growth(GO:0060737) |
0.1 | 0.1 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
0.1 | 0.4 | GO:0003419 | growth plate cartilage chondrocyte proliferation(GO:0003419) |
0.1 | 0.5 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
0.1 | 1.4 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
0.1 | 0.7 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.1 | 0.3 | GO:0061535 | glutamate secretion, neurotransmission(GO:0061535) |
0.1 | 0.4 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
0.1 | 0.5 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
0.1 | 0.5 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.1 | 0.4 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
0.1 | 0.5 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
0.1 | 2.6 | GO:0006376 | mRNA splice site selection(GO:0006376) |
0.1 | 3.3 | GO:0006084 | acetyl-CoA metabolic process(GO:0006084) |
0.1 | 2.5 | GO:0006783 | heme biosynthetic process(GO:0006783) |
0.1 | 0.5 | GO:0045541 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
0.1 | 0.4 | GO:0007525 | somatic muscle development(GO:0007525) |
0.1 | 0.4 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
0.1 | 0.2 | GO:0000430 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) |
0.1 | 0.4 | GO:0048208 | vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
0.1 | 1.5 | GO:0010801 | negative regulation of peptidyl-threonine phosphorylation(GO:0010801) |
0.1 | 0.1 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
0.1 | 0.7 | GO:1902222 | L-phenylalanine metabolic process(GO:0006558) L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
0.1 | 0.5 | GO:2000370 | positive regulation of clathrin-mediated endocytosis(GO:2000370) |
0.1 | 0.4 | GO:1901475 | pyruvate transmembrane transport(GO:1901475) |
0.1 | 0.8 | GO:0071318 | cellular response to ATP(GO:0071318) |
0.1 | 1.1 | GO:0055091 | phospholipid homeostasis(GO:0055091) |
0.1 | 0.4 | GO:0000467 | exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) |
0.1 | 0.1 | GO:2000828 | regulation of parathyroid hormone secretion(GO:2000828) |
0.1 | 0.5 | GO:0032532 | regulation of microvillus length(GO:0032532) |
0.1 | 0.9 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
0.1 | 1.3 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
0.1 | 0.6 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
0.1 | 0.7 | GO:0006642 | triglyceride mobilization(GO:0006642) |
0.1 | 1.4 | GO:0072413 | signal transduction involved in mitotic cell cycle checkpoint(GO:0072413) signal transduction involved in mitotic DNA damage checkpoint(GO:1902402) signal transduction involved in mitotic DNA integrity checkpoint(GO:1902403) |
0.1 | 0.9 | GO:0071404 | cellular response to low-density lipoprotein particle stimulus(GO:0071404) |
0.1 | 0.1 | GO:0072361 | regulation of glycolytic process by regulation of transcription from RNA polymerase II promoter(GO:0072361) |
0.1 | 0.4 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
0.1 | 0.9 | GO:0000059 | protein import into nucleus, docking(GO:0000059) |
0.1 | 1.1 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
0.1 | 1.0 | GO:0006707 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
0.1 | 0.3 | GO:0003284 | septum primum development(GO:0003284) |
0.1 | 0.7 | GO:0021540 | corpus callosum morphogenesis(GO:0021540) |
0.1 | 0.8 | GO:0008300 | isoprenoid catabolic process(GO:0008300) |
0.1 | 0.3 | GO:1904469 | positive regulation of tumor necrosis factor secretion(GO:1904469) |
0.1 | 0.8 | GO:0007220 | Notch receptor processing(GO:0007220) |
0.1 | 1.4 | GO:0006098 | pentose-phosphate shunt(GO:0006098) |
0.1 | 0.5 | GO:0032960 | regulation of inositol trisphosphate biosynthetic process(GO:0032960) |
0.1 | 0.2 | GO:0019747 | regulation of isoprenoid metabolic process(GO:0019747) |
0.1 | 0.9 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
0.1 | 0.4 | GO:1902004 | positive regulation of beta-amyloid formation(GO:1902004) positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
0.1 | 0.3 | GO:0021699 | cerebellar cortex maturation(GO:0021699) |
0.1 | 0.4 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
0.1 | 1.1 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
0.1 | 0.7 | GO:0009435 | NAD biosynthetic process(GO:0009435) |
0.1 | 0.4 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
0.1 | 0.6 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
0.1 | 0.3 | GO:1902415 | regulation of mRNA binding(GO:1902415) regulation of RNA binding(GO:1905214) |
0.1 | 0.4 | GO:0036135 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
0.1 | 0.2 | GO:0061144 | alveolar secondary septum development(GO:0061144) |
0.1 | 0.2 | GO:0050883 | musculoskeletal movement, spinal reflex action(GO:0050883) |
0.1 | 0.3 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.1 | 0.1 | GO:0010745 | negative regulation of macrophage derived foam cell differentiation(GO:0010745) |
0.1 | 0.5 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
0.1 | 0.4 | GO:0046959 | habituation(GO:0046959) |
0.1 | 0.4 | GO:0055059 | asymmetric neuroblast division(GO:0055059) |
0.1 | 0.3 | GO:1902990 | mitotic telomere maintenance via semi-conservative replication(GO:1902990) |
0.1 | 0.1 | GO:0070672 | response to interleukin-15(GO:0070672) |
0.1 | 0.5 | GO:1904970 | brush border assembly(GO:1904970) |
0.1 | 0.6 | GO:0008616 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
0.1 | 0.4 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
0.1 | 0.3 | GO:0031087 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.1 | 0.3 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
0.1 | 0.4 | GO:1903689 | regulation of wound healing, spreading of epidermal cells(GO:1903689) |
0.1 | 0.1 | GO:0070368 | positive regulation of hepatocyte differentiation(GO:0070368) |
0.1 | 0.6 | GO:0071267 | amino acid salvage(GO:0043102) L-methionine biosynthetic process(GO:0071265) L-methionine salvage(GO:0071267) |
0.1 | 0.4 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
0.1 | 0.3 | GO:2000667 | positive regulation of interleukin-5 secretion(GO:2000664) positive regulation of interleukin-13 secretion(GO:2000667) |
0.1 | 0.2 | GO:0006059 | hexitol metabolic process(GO:0006059) |
0.1 | 0.3 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
0.1 | 0.2 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
0.1 | 0.3 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
0.1 | 0.2 | GO:0003383 | apical constriction(GO:0003383) |
0.1 | 0.3 | GO:2000562 | negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
0.1 | 0.4 | GO:0048014 | Tie signaling pathway(GO:0048014) |
0.1 | 0.1 | GO:1902473 | regulation of protein localization to synapse(GO:1902473) |
0.1 | 0.3 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
0.1 | 0.3 | GO:0010728 | regulation of hydrogen peroxide biosynthetic process(GO:0010728) |
0.1 | 0.3 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
0.1 | 0.4 | GO:0060684 | epithelial-mesenchymal cell signaling(GO:0060684) |
0.1 | 0.3 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
0.1 | 0.6 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
0.1 | 0.3 | GO:0009826 | unidimensional cell growth(GO:0009826) |
0.1 | 0.4 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
0.1 | 0.2 | GO:0002826 | negative regulation of T-helper 1 type immune response(GO:0002826) |
0.1 | 0.2 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
0.1 | 0.1 | GO:1900425 | negative regulation of defense response to bacterium(GO:1900425) |
0.1 | 0.3 | GO:1900060 | negative regulation of ceramide biosynthetic process(GO:1900060) |
0.1 | 0.5 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
0.1 | 0.3 | GO:0043321 | regulation of natural killer cell degranulation(GO:0043321) |
0.1 | 0.2 | GO:0018214 | peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
0.1 | 0.4 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
0.1 | 0.3 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
0.1 | 0.3 | GO:0042628 | mating plug formation(GO:0042628) post-mating behavior(GO:0045297) |
0.1 | 0.3 | GO:0044789 | modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) |
0.1 | 1.2 | GO:0015693 | magnesium ion transport(GO:0015693) |
0.1 | 1.2 | GO:0042026 | protein refolding(GO:0042026) |
0.1 | 0.3 | GO:0060535 | trachea cartilage morphogenesis(GO:0060535) |
0.1 | 0.4 | GO:0051204 | protein insertion into mitochondrial membrane(GO:0051204) |
0.1 | 0.6 | GO:0046512 | diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
0.1 | 0.2 | GO:0031627 | telomeric loop formation(GO:0031627) |
0.1 | 0.2 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
0.1 | 0.2 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
0.1 | 0.3 | GO:1903599 | positive regulation of mitophagy(GO:1903599) |
0.1 | 0.2 | GO:0002155 | regulation of thyroid hormone mediated signaling pathway(GO:0002155) |
0.1 | 0.1 | GO:0010918 | positive regulation of mitochondrial membrane potential(GO:0010918) |
0.1 | 0.2 | GO:0009597 | detection of virus(GO:0009597) |
0.1 | 0.2 | GO:0006824 | cobalt ion transport(GO:0006824) |
0.1 | 0.2 | GO:0051344 | negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
0.1 | 0.7 | GO:0052697 | xenobiotic glucuronidation(GO:0052697) |
0.1 | 0.1 | GO:0090370 | negative regulation of cholesterol efflux(GO:0090370) |
0.1 | 0.4 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
0.1 | 0.8 | GO:0030828 | positive regulation of cGMP biosynthetic process(GO:0030828) |
0.1 | 0.1 | GO:0006000 | fructose metabolic process(GO:0006000) |
0.1 | 0.8 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
0.1 | 0.1 | GO:2000586 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
0.1 | 0.2 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.1 | 0.6 | GO:0090308 | regulation of methylation-dependent chromatin silencing(GO:0090308) |
0.1 | 1.4 | GO:0017144 | drug metabolic process(GO:0017144) |
0.1 | 0.1 | GO:0046098 | guanine metabolic process(GO:0046098) |
0.1 | 0.5 | GO:1901621 | negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
0.1 | 0.2 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
0.1 | 0.1 | GO:1900020 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
0.1 | 0.1 | GO:1903975 | regulation of glial cell migration(GO:1903975) |
0.1 | 0.4 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
0.1 | 0.2 | GO:0035799 | ureter maturation(GO:0035799) |
0.1 | 0.1 | GO:0070318 | G0 to G1 transition(GO:0045023) regulation of G0 to G1 transition(GO:0070316) positive regulation of G0 to G1 transition(GO:0070318) |
0.1 | 0.4 | GO:0071476 | cellular hypotonic response(GO:0071476) |
0.1 | 0.2 | GO:0060480 | lung goblet cell differentiation(GO:0060480) |
0.1 | 0.4 | GO:0006477 | protein sulfation(GO:0006477) |
0.1 | 0.9 | GO:0061157 | mRNA destabilization(GO:0061157) |
0.1 | 0.2 | GO:0071866 | regulation of apoptotic process in bone marrow(GO:0071865) negative regulation of apoptotic process in bone marrow(GO:0071866) |
0.1 | 0.2 | GO:0032788 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
0.1 | 0.7 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
0.1 | 0.2 | GO:0003099 | positive regulation of the force of heart contraction by epinephrine-norepinephrine(GO:0001997) regulation of the force of heart contraction by chemical signal(GO:0003057) positive regulation of the force of heart contraction by chemical signal(GO:0003099) |
0.1 | 0.1 | GO:0030423 | targeting of mRNA for destruction involved in RNA interference(GO:0030423) siRNA loading onto RISC involved in RNA interference(GO:0035087) |
0.1 | 1.1 | GO:0014002 | astrocyte development(GO:0014002) |
0.1 | 0.1 | GO:0060355 | positive regulation of cell adhesion molecule production(GO:0060355) |
0.1 | 0.4 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
0.1 | 0.1 | GO:0070375 | ERK5 cascade(GO:0070375) |
0.1 | 0.6 | GO:0000466 | maturation of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000466) |
0.1 | 0.2 | GO:0007354 | zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
0.1 | 0.6 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
0.1 | 0.1 | GO:0006848 | pyruvate transport(GO:0006848) |
0.1 | 0.2 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
0.1 | 0.1 | GO:0071029 | polyadenylation-dependent ncRNA catabolic process(GO:0043634) nuclear ncRNA surveillance(GO:0071029) nuclear polyadenylation-dependent rRNA catabolic process(GO:0071035) nuclear polyadenylation-dependent ncRNA catabolic process(GO:0071046) |
0.1 | 0.4 | GO:0048318 | axial mesoderm development(GO:0048318) |
0.1 | 0.1 | GO:0051891 | positive regulation of cardioblast differentiation(GO:0051891) |
0.1 | 0.3 | GO:0046881 | positive regulation of follicle-stimulating hormone secretion(GO:0046881) |
0.1 | 0.1 | GO:0030210 | heparin biosynthetic process(GO:0030210) |
0.1 | 0.2 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
0.1 | 0.1 | GO:0048382 | mesendoderm development(GO:0048382) |
0.1 | 0.6 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.1 | 0.3 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
0.1 | 0.1 | GO:1900242 | regulation of synaptic vesicle endocytosis(GO:1900242) |
0.1 | 0.1 | GO:0006393 | termination of mitochondrial transcription(GO:0006393) |
0.1 | 0.3 | GO:1901563 | response to camptothecin(GO:1901563) |
0.1 | 0.2 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
0.1 | 0.1 | GO:0032380 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
0.1 | 0.2 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
0.1 | 0.1 | GO:0016539 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
0.1 | 1.5 | GO:0018345 | protein palmitoylation(GO:0018345) |
0.1 | 0.3 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
0.1 | 0.2 | GO:0008050 | female courtship behavior(GO:0008050) |
0.1 | 0.1 | GO:0090155 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) |
0.1 | 0.7 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
0.1 | 0.2 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
0.1 | 0.2 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
0.1 | 0.3 | GO:0009838 | abscission(GO:0009838) |
0.1 | 0.3 | GO:1903772 | regulation of viral budding via host ESCRT complex(GO:1903772) |
0.1 | 0.2 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
0.1 | 0.5 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
0.1 | 0.1 | GO:0003139 | secondary heart field specification(GO:0003139) |
0.1 | 0.4 | GO:0000012 | single strand break repair(GO:0000012) |
0.1 | 0.2 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
0.1 | 0.1 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
0.1 | 0.1 | GO:0030240 | skeletal muscle thin filament assembly(GO:0030240) |
0.1 | 0.2 | GO:2001269 | positive regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001269) |
0.1 | 0.2 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
0.1 | 0.2 | GO:0016479 | negative regulation of transcription from RNA polymerase I promoter(GO:0016479) |
0.1 | 0.3 | GO:0061051 | positive regulation of cell growth involved in cardiac muscle cell development(GO:0061051) |
0.1 | 0.1 | GO:0010963 | regulation of L-arginine import(GO:0010963) |
0.1 | 0.1 | GO:0008078 | mesodermal cell migration(GO:0008078) |
0.1 | 0.1 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
0.1 | 0.2 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
0.1 | 0.4 | GO:0051418 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
0.1 | 0.2 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
0.1 | 0.3 | GO:2000074 | regulation of type B pancreatic cell development(GO:2000074) |
0.1 | 0.1 | GO:1901339 | regulation of store-operated calcium channel activity(GO:1901339) |
0.1 | 0.2 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
0.1 | 0.2 | GO:0033092 | positive regulation of immature T cell proliferation in thymus(GO:0033092) |
0.1 | 0.9 | GO:0007026 | negative regulation of microtubule depolymerization(GO:0007026) |
0.1 | 0.1 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
0.1 | 0.4 | GO:0008063 | Toll signaling pathway(GO:0008063) |
0.1 | 0.2 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
0.1 | 0.2 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
0.1 | 0.2 | GO:0042939 | glutathione transport(GO:0034635) tripeptide transport(GO:0042939) |
0.1 | 0.6 | GO:0006353 | DNA-templated transcription, termination(GO:0006353) |
0.1 | 0.7 | GO:1902043 | positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
0.1 | 0.1 | GO:0002215 | defense response to nematode(GO:0002215) |
0.1 | 0.2 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
0.1 | 0.2 | GO:1990000 | amyloid fibril formation(GO:1990000) |
0.1 | 0.9 | GO:1901741 | positive regulation of myoblast fusion(GO:1901741) |
0.1 | 0.5 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
0.1 | 0.5 | GO:0035999 | tetrahydrofolate interconversion(GO:0035999) |
0.1 | 0.1 | GO:0090237 | regulation of arachidonic acid secretion(GO:0090237) |
0.1 | 0.1 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
0.1 | 0.3 | GO:1901077 | regulation of relaxation of muscle(GO:1901077) |
0.1 | 0.2 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
0.1 | 0.4 | GO:0043486 | histone exchange(GO:0043486) |
0.1 | 0.2 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
0.1 | 0.1 | GO:0009169 | purine nucleoside monophosphate catabolic process(GO:0009128) ribonucleoside monophosphate catabolic process(GO:0009158) purine ribonucleoside monophosphate catabolic process(GO:0009169) |
0.1 | 1.4 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
0.1 | 0.4 | GO:0060211 | regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
0.1 | 0.4 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
0.1 | 0.1 | GO:0018197 | peptidyl-aspartic acid modification(GO:0018197) |
0.1 | 0.2 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.1 | 0.2 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
0.1 | 0.4 | GO:0098828 | modulation of inhibitory postsynaptic potential(GO:0098828) |
0.1 | 0.2 | GO:0060526 | prostate glandular acinus morphogenesis(GO:0060526) prostate epithelial cord arborization involved in prostate glandular acinus morphogenesis(GO:0060527) |
0.1 | 0.3 | GO:0046349 | amino sugar biosynthetic process(GO:0046349) |
0.1 | 0.5 | GO:0007020 | microtubule nucleation(GO:0007020) |
0.1 | 0.3 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.1 | 0.2 | GO:0071926 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
0.1 | 0.2 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
0.1 | 0.3 | GO:0090166 | Golgi disassembly(GO:0090166) |
0.1 | 0.5 | GO:0046085 | adenosine metabolic process(GO:0046085) |
0.1 | 0.2 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
0.1 | 0.2 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
0.1 | 0.1 | GO:0034454 | microtubule anchoring at centrosome(GO:0034454) |
0.1 | 0.3 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
0.1 | 0.4 | GO:0031033 | myosin filament organization(GO:0031033) |
0.1 | 0.1 | GO:1990774 | regulation of tumor necrosis factor secretion(GO:1904467) negative regulation of tumor necrosis factor secretion(GO:1904468) tumor necrosis factor secretion(GO:1990774) |
0.1 | 0.3 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
0.1 | 0.1 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
0.1 | 0.2 | GO:1901740 | negative regulation of myoblast fusion(GO:1901740) |
0.1 | 0.1 | GO:0051138 | regulation of NK T cell differentiation(GO:0051136) positive regulation of NK T cell differentiation(GO:0051138) |
0.1 | 0.1 | GO:0071462 | cellular response to water stimulus(GO:0071462) |
0.1 | 0.2 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
0.1 | 0.3 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
0.1 | 0.2 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.1 | 0.4 | GO:2000060 | positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
0.1 | 0.2 | GO:0045629 | negative regulation of T-helper 2 cell differentiation(GO:0045629) |
0.1 | 0.7 | GO:2000193 | positive regulation of fatty acid transport(GO:2000193) |
0.1 | 0.9 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
0.1 | 0.1 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.1 | 0.1 | GO:0001983 | baroreceptor response to increased systemic arterial blood pressure(GO:0001983) |
0.1 | 0.2 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.1 | 0.1 | GO:1990441 | negative regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990441) |
0.0 | 0.4 | GO:0008343 | adult feeding behavior(GO:0008343) |
0.0 | 0.2 | GO:0048102 | autophagic cell death(GO:0048102) |
0.0 | 0.6 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
0.0 | 0.2 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
0.0 | 0.1 | GO:0006570 | tyrosine metabolic process(GO:0006570) |
0.0 | 0.5 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
0.0 | 0.1 | GO:0046005 | positive regulation of circadian sleep/wake cycle, REM sleep(GO:0046005) |
0.0 | 0.1 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
0.0 | 0.1 | GO:1905206 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
0.0 | 0.0 | GO:0055118 | negative regulation of cardiac muscle contraction(GO:0055118) |
0.0 | 0.1 | GO:0035754 | B cell chemotaxis(GO:0035754) |
0.0 | 0.6 | GO:0015858 | nucleoside transport(GO:0015858) |
0.0 | 0.1 | GO:0003105 | negative regulation of glomerular filtration(GO:0003105) |
0.0 | 0.5 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
0.0 | 0.2 | GO:0002576 | platelet degranulation(GO:0002576) |
0.0 | 0.2 | GO:0051409 | response to nitrosative stress(GO:0051409) |
0.0 | 0.1 | GO:0001712 | ectodermal cell fate commitment(GO:0001712) |
0.0 | 0.1 | GO:0031937 | positive regulation of chromatin silencing(GO:0031937) |
0.0 | 0.3 | GO:0060017 | parathyroid gland development(GO:0060017) |
0.0 | 0.2 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.0 | 0.0 | GO:0072710 | response to hydroxyurea(GO:0072710) cellular response to hydroxyurea(GO:0072711) |
0.0 | 0.2 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
0.0 | 0.3 | GO:0048194 | Golgi vesicle budding(GO:0048194) |
0.0 | 0.4 | GO:0002934 | desmosome organization(GO:0002934) |
0.0 | 0.2 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
0.0 | 0.8 | GO:0015986 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
0.0 | 0.1 | GO:0060696 | regulation of phospholipid catabolic process(GO:0060696) |
0.0 | 0.2 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
0.0 | 0.6 | GO:0099517 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
0.0 | 0.1 | GO:0070272 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
0.0 | 0.0 | GO:0072144 | glomerular mesangial cell differentiation(GO:0072008) glomerular mesangial cell development(GO:0072144) |
0.0 | 0.1 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
0.0 | 0.2 | GO:0032026 | response to magnesium ion(GO:0032026) |
0.0 | 0.1 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
0.0 | 0.0 | GO:1903121 | regulation of TRAIL-activated apoptotic signaling pathway(GO:1903121) |
0.0 | 0.1 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
0.0 | 0.1 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
0.0 | 0.1 | GO:0031125 | rRNA 3'-end processing(GO:0031125) |
0.0 | 1.0 | GO:0014823 | response to activity(GO:0014823) |
0.0 | 0.6 | GO:0042744 | hydrogen peroxide catabolic process(GO:0042744) |
0.0 | 0.2 | GO:2000727 | positive regulation of cardiac muscle cell differentiation(GO:2000727) |
0.0 | 0.3 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
0.0 | 0.3 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
0.0 | 1.2 | GO:0019228 | neuronal action potential(GO:0019228) |
0.0 | 0.9 | GO:0006368 | transcription elongation from RNA polymerase II promoter(GO:0006368) |
0.0 | 0.3 | GO:0090267 | positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
0.0 | 0.0 | GO:0003130 | BMP signaling pathway involved in heart induction(GO:0003130) endodermal-mesodermal cell signaling(GO:0003133) endodermal-mesodermal cell signaling involved in heart induction(GO:0003134) |
0.0 | 0.2 | GO:2001198 | regulation of dendritic cell differentiation(GO:2001198) negative regulation of dendritic cell differentiation(GO:2001199) |
0.0 | 0.3 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
0.0 | 0.2 | GO:0010040 | response to iron(II) ion(GO:0010040) |
0.0 | 0.2 | GO:0030948 | negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
0.0 | 0.1 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
0.0 | 0.3 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
0.0 | 0.0 | GO:0002513 | tolerance induction to self antigen(GO:0002513) |
0.0 | 0.5 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
0.0 | 0.6 | GO:0097031 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.0 | 0.0 | GO:0035771 | interleukin-4-mediated signaling pathway(GO:0035771) |
0.0 | 0.1 | GO:0035865 | response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
0.0 | 0.3 | GO:0043653 | mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
0.0 | 0.3 | GO:0051923 | sulfation(GO:0051923) |
0.0 | 0.1 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
0.0 | 0.0 | GO:2000384 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
0.0 | 0.1 | GO:0043144 | snoRNA processing(GO:0043144) |
0.0 | 0.2 | GO:1904526 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
0.0 | 0.1 | GO:0035356 | cellular triglyceride homeostasis(GO:0035356) |
0.0 | 0.3 | GO:0033148 | positive regulation of intracellular estrogen receptor signaling pathway(GO:0033148) |
0.0 | 0.0 | GO:0002351 | serotonin production involved in inflammatory response(GO:0002351) serotonin secretion involved in inflammatory response(GO:0002442) |
0.0 | 0.0 | GO:0021943 | formation of radial glial scaffolds(GO:0021943) |
0.0 | 0.2 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
0.0 | 0.3 | GO:0097033 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
0.0 | 1.0 | GO:0016601 | Rac protein signal transduction(GO:0016601) |
0.0 | 0.2 | GO:0006498 | N-terminal protein lipidation(GO:0006498) N-terminal protein myristoylation(GO:0006499) |
0.0 | 0.2 | GO:0046628 | positive regulation of insulin receptor signaling pathway(GO:0046628) |
0.0 | 0.5 | GO:0006110 | regulation of glycolytic process(GO:0006110) |
0.0 | 0.1 | GO:0060371 | regulation of atrial cardiac muscle cell membrane depolarization(GO:0060371) |
0.0 | 0.1 | GO:1900368 | regulation of RNA interference(GO:1900368) |
0.0 | 1.6 | GO:0006334 | nucleosome assembly(GO:0006334) |
0.0 | 0.0 | GO:0060534 | trachea cartilage development(GO:0060534) |
0.0 | 0.2 | GO:0042537 | benzene-containing compound metabolic process(GO:0042537) |
0.0 | 0.2 | GO:0060623 | regulation of chromosome condensation(GO:0060623) |
0.0 | 0.1 | GO:2000224 | regulation of testosterone biosynthetic process(GO:2000224) |
0.0 | 0.1 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
0.0 | 0.2 | GO:0022007 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
0.0 | 0.2 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
0.0 | 0.1 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
0.0 | 0.2 | GO:0001777 | T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
0.0 | 0.4 | GO:0007096 | regulation of exit from mitosis(GO:0007096) |
0.0 | 0.1 | GO:0060332 | positive regulation of response to interferon-gamma(GO:0060332) positive regulation of interferon-gamma-mediated signaling pathway(GO:0060335) |
0.0 | 0.3 | GO:0045793 | positive regulation of cell size(GO:0045793) |
0.0 | 0.4 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.0 | 0.1 | GO:0006222 | UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
0.0 | 0.2 | GO:0042590 | antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
0.0 | 0.1 | GO:0015820 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.0 | 0.1 | GO:0009698 | phenylpropanoid metabolic process(GO:0009698) phenylpropanoid catabolic process(GO:0046271) |
0.0 | 0.2 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
0.0 | 0.2 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
0.0 | 0.0 | GO:0055064 | chloride ion homeostasis(GO:0055064) |
0.0 | 0.1 | GO:0010835 | regulation of protein ADP-ribosylation(GO:0010835) |
0.0 | 0.0 | GO:1903969 | regulation of macrophage colony-stimulating factor signaling pathway(GO:1902226) regulation of response to macrophage colony-stimulating factor(GO:1903969) regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903972) microglial cell migration(GO:1904124) regulation of microglial cell migration(GO:1904139) |
0.0 | 0.3 | GO:0072112 | renal filtration cell differentiation(GO:0061318) glomerular epithelium development(GO:0072010) glomerular visceral epithelial cell differentiation(GO:0072112) glomerular epithelial cell differentiation(GO:0072311) |
0.0 | 0.2 | GO:1900102 | negative regulation of endoplasmic reticulum unfolded protein response(GO:1900102) |
0.0 | 0.1 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
0.0 | 0.1 | GO:0019464 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.0 | 0.1 | GO:0010513 | regulation of phosphatidylinositol biosynthetic process(GO:0010511) positive regulation of phosphatidylinositol biosynthetic process(GO:0010513) |
0.0 | 0.2 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
0.0 | 0.1 | GO:0080009 | mRNA methylation(GO:0080009) |
0.0 | 0.2 | GO:0003056 | regulation of vascular smooth muscle contraction(GO:0003056) |
0.0 | 0.3 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
0.0 | 0.6 | GO:0006805 | xenobiotic metabolic process(GO:0006805) |
0.0 | 0.0 | GO:0002461 | tolerance induction dependent upon immune response(GO:0002461) |
0.0 | 0.2 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
0.0 | 0.3 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.0 | 0.1 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
0.0 | 0.0 | GO:0043380 | regulation of memory T cell differentiation(GO:0043380) |
0.0 | 0.1 | GO:0046618 | drug export(GO:0046618) |
0.0 | 0.1 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
0.0 | 0.0 | GO:2001180 | negative regulation of interleukin-10 secretion(GO:2001180) |
0.0 | 0.0 | GO:0048007 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
0.0 | 0.1 | GO:0034770 | histone H4-K20 methylation(GO:0034770) histone H4-K20 trimethylation(GO:0034773) |
0.0 | 0.1 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
0.0 | 0.0 | GO:1903333 | negative regulation of protein folding(GO:1903333) |
0.0 | 0.1 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
0.0 | 0.1 | GO:2001166 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
0.0 | 0.2 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
0.0 | 0.0 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
0.0 | 0.2 | GO:0072102 | glomerulus morphogenesis(GO:0072102) |
0.0 | 0.1 | GO:0090091 | positive regulation of extracellular matrix disassembly(GO:0090091) |
0.0 | 0.1 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
0.0 | 0.1 | GO:0034139 | regulation of toll-like receptor 3 signaling pathway(GO:0034139) |
0.0 | 0.2 | GO:0032825 | positive regulation of natural killer cell differentiation(GO:0032825) |
0.0 | 0.2 | GO:0006265 | DNA topological change(GO:0006265) |
0.0 | 0.7 | GO:0034605 | cellular response to heat(GO:0034605) |
0.0 | 0.1 | GO:0006116 | NADH oxidation(GO:0006116) |
0.0 | 0.1 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
0.0 | 0.1 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
0.0 | 0.2 | GO:0007000 | nucleolus organization(GO:0007000) |
0.0 | 0.1 | GO:0018101 | protein citrullination(GO:0018101) |
0.0 | 0.0 | GO:0010991 | regulation of SMAD protein complex assembly(GO:0010990) negative regulation of SMAD protein complex assembly(GO:0010991) |
0.0 | 0.9 | GO:0051568 | histone H3-K4 methylation(GO:0051568) |
0.0 | 0.1 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
0.0 | 0.3 | GO:0043249 | erythrocyte maturation(GO:0043249) |
0.0 | 0.1 | GO:0017085 | response to insecticide(GO:0017085) |
0.0 | 0.1 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
0.0 | 0.1 | GO:0001840 | neural plate development(GO:0001840) |
0.0 | 0.2 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
0.0 | 0.1 | GO:0060839 | endothelial cell fate commitment(GO:0060839) |
0.0 | 0.1 | GO:0035672 | oligopeptide transmembrane transport(GO:0035672) |
0.0 | 0.1 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
0.0 | 0.3 | GO:0003416 | endochondral bone growth(GO:0003416) |
0.0 | 0.1 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) |
0.0 | 0.1 | GO:0071899 | regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
0.0 | 0.0 | GO:2000304 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
0.0 | 0.3 | GO:0031340 | positive regulation of vesicle fusion(GO:0031340) |
0.0 | 0.0 | GO:0010870 | positive regulation of receptor biosynthetic process(GO:0010870) |
0.0 | 0.0 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
0.0 | 0.1 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.0 | 0.1 | GO:0051036 | regulation of endosome size(GO:0051036) |
0.0 | 0.1 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.0 | 0.0 | GO:2000347 | positive regulation of hepatocyte proliferation(GO:2000347) |
0.0 | 0.3 | GO:0021670 | lateral ventricle development(GO:0021670) |
0.0 | 0.0 | GO:0071502 | cellular response to temperature stimulus(GO:0071502) |
0.0 | 0.1 | GO:0033030 | negative regulation of neutrophil apoptotic process(GO:0033030) |
0.0 | 0.1 | GO:0034379 | very-low-density lipoprotein particle assembly(GO:0034379) |
0.0 | 0.0 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
0.0 | 0.1 | GO:2000409 | positive regulation of T cell extravasation(GO:2000409) |
0.0 | 0.1 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
0.0 | 0.4 | GO:0006182 | cGMP biosynthetic process(GO:0006182) |
0.0 | 0.0 | GO:1902514 | regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1902514) |
0.0 | 0.1 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
0.0 | 0.0 | GO:0002930 | trabecular meshwork development(GO:0002930) |
0.0 | 0.1 | GO:0033160 | positive regulation of protein import into nucleus, translocation(GO:0033160) |
0.0 | 0.2 | GO:0006290 | pyrimidine dimer repair(GO:0006290) |
0.0 | 1.6 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
0.0 | 0.2 | GO:0035584 | calcium-mediated signaling using intracellular calcium source(GO:0035584) |
0.0 | 0.3 | GO:0045047 | protein targeting to ER(GO:0045047) |
0.0 | 0.1 | GO:0090427 | activation of meiosis(GO:0090427) |
0.0 | 0.1 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
0.0 | 0.2 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.0 | 0.1 | GO:0048669 | collateral sprouting in absence of injury(GO:0048669) |
0.0 | 0.1 | GO:0008655 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
0.0 | 0.4 | GO:0045116 | protein neddylation(GO:0045116) |
0.0 | 0.1 | GO:1900038 | negative regulation of cellular response to hypoxia(GO:1900038) |
0.0 | 0.1 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
0.0 | 0.1 | GO:2000773 | negative regulation of cellular senescence(GO:2000773) |
0.0 | 0.1 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.0 | 0.4 | GO:0051647 | nucleus localization(GO:0051647) |
0.0 | 0.1 | GO:0009642 | response to light intensity(GO:0009642) |
0.0 | 0.1 | GO:0006772 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
0.0 | 1.5 | GO:0006892 | post-Golgi vesicle-mediated transport(GO:0006892) |
0.0 | 0.1 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
0.0 | 0.1 | GO:2000010 | positive regulation of protein localization to cell surface(GO:2000010) |
0.0 | 0.1 | GO:0021938 | smoothened signaling pathway involved in regulation of cerebellar granule cell precursor cell proliferation(GO:0021938) |
0.0 | 0.1 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
0.0 | 0.2 | GO:1902254 | negative regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902254) |
0.0 | 0.1 | GO:0006298 | mismatch repair(GO:0006298) |
0.0 | 0.2 | GO:0031167 | rRNA methylation(GO:0031167) |
0.0 | 0.1 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
0.0 | 0.1 | GO:0001546 | preantral ovarian follicle growth(GO:0001546) multi-layer follicle stage(GO:0048162) |
0.0 | 0.4 | GO:0008272 | sulfate transport(GO:0008272) |
0.0 | 0.3 | GO:0006198 | cAMP catabolic process(GO:0006198) |
0.0 | 0.1 | GO:0015722 | canalicular bile acid transport(GO:0015722) |
0.0 | 0.0 | GO:0019087 | transformation of host cell by virus(GO:0019087) |
0.0 | 0.2 | GO:0042790 | transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:0042790) |
0.0 | 0.1 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
0.0 | 0.1 | GO:0000479 | endonucleolytic cleavage of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000479) |
0.0 | 0.1 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
0.0 | 0.2 | GO:0043403 | skeletal muscle tissue regeneration(GO:0043403) |
0.0 | 0.0 | GO:0033625 | positive regulation of integrin activation(GO:0033625) |
0.0 | 0.2 | GO:0009191 | ribonucleoside diphosphate catabolic process(GO:0009191) |
0.0 | 0.1 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
0.0 | 0.1 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.0 | 0.1 | GO:0043173 | nucleotide salvage(GO:0043173) |
0.0 | 0.1 | GO:0019086 | late viral transcription(GO:0019086) |
0.0 | 0.4 | GO:2000272 | negative regulation of receptor activity(GO:2000272) |
0.0 | 0.1 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
0.0 | 0.5 | GO:0031122 | cytoplasmic microtubule organization(GO:0031122) |
0.0 | 0.1 | GO:0046037 | GMP metabolic process(GO:0046037) |
0.0 | 0.3 | GO:0016446 | somatic hypermutation of immunoglobulin genes(GO:0016446) |
0.0 | 0.1 | GO:0010887 | negative regulation of cholesterol storage(GO:0010887) |
0.0 | 0.1 | GO:1903142 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
0.0 | 0.1 | GO:1902805 | positive regulation of synaptic vesicle transport(GO:1902805) |
0.0 | 0.2 | GO:0098869 | cellular oxidant detoxification(GO:0098869) |
0.0 | 0.2 | GO:0035067 | negative regulation of histone acetylation(GO:0035067) |
0.0 | 0.0 | GO:0015889 | cobalamin transport(GO:0015889) |
0.0 | 0.2 | GO:0032494 | response to peptidoglycan(GO:0032494) |
0.0 | 0.1 | GO:0090231 | regulation of spindle checkpoint(GO:0090231) |
0.0 | 0.1 | GO:0032224 | positive regulation of synaptic transmission, cholinergic(GO:0032224) |
0.0 | 0.1 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
0.0 | 0.0 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
0.0 | 0.1 | GO:0071692 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
0.0 | 0.1 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
0.0 | 0.1 | GO:0071364 | cellular response to epidermal growth factor stimulus(GO:0071364) |
0.0 | 0.1 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
0.0 | 0.1 | GO:0035372 | protein localization to microtubule(GO:0035372) |
0.0 | 0.2 | GO:0035745 | T-helper 2 cell cytokine production(GO:0035745) |
0.0 | 0.0 | GO:1902202 | regulation of hepatocyte growth factor receptor signaling pathway(GO:1902202) |
0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.1 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
0.0 | 0.1 | GO:0045713 | low-density lipoprotein particle receptor biosynthetic process(GO:0045713) regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045714) |
0.0 | 0.1 | GO:0000087 | mitotic M phase(GO:0000087) |
0.0 | 0.1 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
0.0 | 0.0 | GO:0030576 | Cajal body organization(GO:0030576) |
0.0 | 0.3 | GO:0048714 | positive regulation of oligodendrocyte differentiation(GO:0048714) |
0.0 | 0.0 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
0.0 | 0.1 | GO:0060394 | negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
0.0 | 0.1 | GO:0007210 | serotonin receptor signaling pathway(GO:0007210) |
0.0 | 0.0 | GO:2000015 | regulation of determination of dorsal identity(GO:2000015) |
0.0 | 0.2 | GO:0030889 | negative regulation of B cell proliferation(GO:0030889) |
0.0 | 0.2 | GO:0035493 | SNARE complex assembly(GO:0035493) |
0.0 | 0.0 | GO:0009125 | nucleoside monophosphate catabolic process(GO:0009125) |
0.0 | 0.0 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
0.0 | 0.1 | GO:0006903 | vesicle targeting(GO:0006903) |
0.0 | 0.1 | GO:0039694 | viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
0.0 | 0.0 | GO:0033058 | directional locomotion(GO:0033058) |
0.0 | 0.1 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
0.0 | 0.1 | GO:0048681 | negative regulation of axon regeneration(GO:0048681) |
0.0 | 0.0 | GO:1903069 | regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903069) |
0.0 | 0.1 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.0 | 0.0 | GO:0022009 | central nervous system vasculogenesis(GO:0022009) |
0.0 | 0.1 | GO:1901201 | regulation of extracellular matrix assembly(GO:1901201) |
0.0 | 0.1 | GO:0001955 | blood vessel maturation(GO:0001955) |
0.0 | 0.2 | GO:0042743 | hydrogen peroxide metabolic process(GO:0042743) |
0.0 | 0.1 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.0 | 0.0 | GO:1904714 | regulation of chaperone-mediated autophagy(GO:1904714) |
0.0 | 0.0 | GO:0010986 | positive regulation of lipoprotein particle clearance(GO:0010986) |
0.0 | 0.1 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
0.0 | 0.2 | GO:0021514 | ventral spinal cord interneuron differentiation(GO:0021514) |
0.0 | 0.3 | GO:0097484 | dendrite extension(GO:0097484) |
0.0 | 0.0 | GO:1904738 | vascular associated smooth muscle cell migration(GO:1904738) regulation of vascular associated smooth muscle cell migration(GO:1904752) |
0.0 | 0.2 | GO:0042573 | retinoic acid metabolic process(GO:0042573) |
0.0 | 0.1 | GO:0048742 | regulation of skeletal muscle fiber development(GO:0048742) |
0.0 | 0.2 | GO:0030049 | muscle filament sliding(GO:0030049) |
0.0 | 0.1 | GO:0030091 | protein repair(GO:0030091) |
0.0 | 0.0 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
0.0 | 0.1 | GO:0014043 | negative regulation of neuron maturation(GO:0014043) |
0.0 | 0.1 | GO:0009189 | deoxyribonucleoside diphosphate biosynthetic process(GO:0009189) |
0.0 | 0.2 | GO:0070200 | establishment of protein localization to telomere(GO:0070200) |
0.0 | 0.1 | GO:1902895 | positive regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902895) |
0.0 | 0.1 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
0.0 | 0.2 | GO:0090520 | sphingolipid mediated signaling pathway(GO:0090520) |
0.0 | 0.0 | GO:0010668 | ectodermal cell differentiation(GO:0010668) |
0.0 | 0.1 | GO:0097240 | telomere tethering at nuclear periphery(GO:0034398) meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
0.0 | 0.1 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
0.0 | 0.3 | GO:0050650 | chondroitin sulfate proteoglycan biosynthetic process(GO:0050650) |
0.0 | 0.2 | GO:0042159 | lipoprotein catabolic process(GO:0042159) |
0.0 | 0.1 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.0 | 0.0 | GO:1903799 | negative regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903799) |
0.0 | 0.2 | GO:0009303 | rRNA transcription(GO:0009303) |
0.0 | 0.8 | GO:0006400 | tRNA modification(GO:0006400) |
0.0 | 0.0 | GO:0021764 | amygdala development(GO:0021764) |
0.0 | 0.1 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
0.0 | 0.1 | GO:0048733 | sebaceous gland development(GO:0048733) |
0.0 | 0.0 | GO:0090365 | regulation of mRNA modification(GO:0090365) |
0.0 | 0.1 | GO:0032827 | natural killer cell differentiation involved in immune response(GO:0002325) negative regulation of natural killer cell differentiation(GO:0032824) regulation of natural killer cell differentiation involved in immune response(GO:0032826) negative regulation of natural killer cell differentiation involved in immune response(GO:0032827) |
0.0 | 0.2 | GO:0048268 | clathrin coat assembly(GO:0048268) |
0.0 | 0.0 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
0.0 | 0.0 | GO:0090240 | positive regulation of histone H4 acetylation(GO:0090240) |
0.0 | 0.0 | GO:0010046 | response to mycotoxin(GO:0010046) |
0.0 | 0.1 | GO:0021603 | cranial nerve formation(GO:0021603) |
0.0 | 0.1 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
0.0 | 0.0 | GO:0006714 | sesquiterpenoid metabolic process(GO:0006714) |
0.0 | 0.0 | GO:0050872 | white fat cell differentiation(GO:0050872) |
0.0 | 0.0 | GO:1903261 | regulation of serine phosphorylation of STAT3 protein(GO:1903261) |
0.0 | 0.1 | GO:0006449 | regulation of translational termination(GO:0006449) |
0.0 | 0.0 | GO:0043379 | memory T cell differentiation(GO:0043379) |
0.0 | 0.1 | GO:0097011 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) |
0.0 | 0.1 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
0.0 | 0.5 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
0.0 | 0.1 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
0.0 | 0.0 | GO:0036481 | intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:0036481) |
0.0 | 0.1 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
0.0 | 0.2 | GO:0010640 | regulation of platelet-derived growth factor receptor signaling pathway(GO:0010640) |
0.0 | 0.0 | GO:0051196 | regulation of coenzyme metabolic process(GO:0051196) |
0.0 | 0.0 | GO:2001023 | regulation of response to drug(GO:2001023) |
0.0 | 0.0 | GO:0042508 | tyrosine phosphorylation of Stat1 protein(GO:0042508) |
0.0 | 0.0 | GO:0070571 | negative regulation of neuron projection regeneration(GO:0070571) |
0.0 | 0.1 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
0.0 | 0.1 | GO:1900016 | negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
0.0 | 0.0 | GO:0010519 | negative regulation of phospholipase activity(GO:0010519) |
0.0 | 0.1 | GO:0015879 | carnitine transport(GO:0015879) |
0.0 | 0.3 | GO:1902108 | regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902108) |
0.0 | 0.0 | GO:0097623 | potassium ion export across plasma membrane(GO:0097623) |
0.0 | 0.2 | GO:0046548 | retinal rod cell development(GO:0046548) |
0.0 | 0.1 | GO:0015871 | choline transport(GO:0015871) |
0.0 | 0.1 | GO:2000209 | regulation of anoikis(GO:2000209) |
0.0 | 0.1 | GO:0042136 | neurotransmitter biosynthetic process(GO:0042136) |
0.0 | 0.0 | GO:0032829 | regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032829) |
0.0 | 0.0 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
0.0 | 0.1 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
0.0 | 0.0 | GO:0045542 | positive regulation of cholesterol biosynthetic process(GO:0045542) positive regulation of cholesterol metabolic process(GO:0090205) |
0.0 | 0.2 | GO:0019184 | nonribosomal peptide biosynthetic process(GO:0019184) |
0.0 | 0.2 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
0.0 | 0.1 | GO:0090315 | negative regulation of protein targeting to membrane(GO:0090315) |
0.0 | 0.5 | GO:1902476 | chloride transmembrane transport(GO:1902476) |
0.0 | 0.1 | GO:1900078 | positive regulation of cellular response to insulin stimulus(GO:1900078) |
0.0 | 0.1 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
0.0 | 0.0 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
0.0 | 0.1 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.0 | 0.1 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.0 | 0.1 | GO:1904152 | regulation of retrograde protein transport, ER to cytosol(GO:1904152) |
0.0 | 0.1 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
0.0 | 0.0 | GO:0003100 | regulation of systemic arterial blood pressure by endothelin(GO:0003100) |
0.0 | 0.1 | GO:1902176 | negative regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902176) |
0.0 | 0.2 | GO:0098739 | import across plasma membrane(GO:0098739) |
0.0 | 0.1 | GO:0030167 | proteoglycan catabolic process(GO:0030167) |
0.0 | 0.0 | GO:0050779 | RNA destabilization(GO:0050779) |
0.0 | 0.1 | GO:0060767 | epithelial cell proliferation involved in prostate gland development(GO:0060767) regulation of epithelial cell proliferation involved in prostate gland development(GO:0060768) |
0.0 | 0.2 | GO:0006465 | signal peptide processing(GO:0006465) |
0.0 | 0.1 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
0.0 | 0.1 | GO:0045086 | positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
0.0 | 0.4 | GO:1901292 | nucleoside phosphate catabolic process(GO:1901292) |
0.0 | 0.1 | GO:0035814 | negative regulation of renal sodium excretion(GO:0035814) |
0.0 | 0.2 | GO:0008340 | determination of adult lifespan(GO:0008340) |
0.0 | 0.1 | GO:0000042 | protein targeting to Golgi(GO:0000042) |
0.0 | 0.0 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
0.0 | 0.1 | GO:0033089 | positive regulation of T cell differentiation in thymus(GO:0033089) positive regulation of thymocyte aggregation(GO:2000400) |
0.0 | 0.0 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
0.0 | 0.1 | GO:0042574 | retinal metabolic process(GO:0042574) |
0.0 | 0.0 | GO:0070459 | prolactin secretion(GO:0070459) |
0.0 | 0.4 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
0.0 | 0.2 | GO:0045956 | positive regulation of calcium ion-dependent exocytosis(GO:0045956) |
0.0 | 0.0 | GO:0031935 | regulation of chromatin silencing(GO:0031935) |
0.0 | 0.1 | GO:0030917 | midbrain-hindbrain boundary development(GO:0030917) |
0.0 | 0.3 | GO:0032467 | positive regulation of cytokinesis(GO:0032467) |
0.0 | 0.0 | GO:0072092 | ureteric bud invasion(GO:0072092) metanephric renal vesicle formation(GO:0072093) |
0.0 | 0.0 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
0.0 | 0.2 | GO:0042403 | thyroid hormone metabolic process(GO:0042403) |
0.0 | 0.0 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
0.0 | 0.0 | GO:1901620 | regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901620) |
0.0 | 0.1 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
0.0 | 0.1 | GO:0032230 | positive regulation of synaptic transmission, GABAergic(GO:0032230) |
0.0 | 0.3 | GO:0008333 | endosome to lysosome transport(GO:0008333) |
0.0 | 0.4 | GO:0033120 | positive regulation of RNA splicing(GO:0033120) |
0.0 | 0.0 | GO:0072531 | pyrimidine-containing compound transmembrane transport(GO:0072531) nucleotide transmembrane transport(GO:1901679) |
0.0 | 0.1 | GO:1901407 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
0.0 | 0.2 | GO:0050910 | detection of mechanical stimulus involved in sensory perception of sound(GO:0050910) |
0.0 | 0.1 | GO:0060235 | lens induction in camera-type eye(GO:0060235) |
0.0 | 0.0 | GO:0045080 | chemokine biosynthetic process(GO:0042033) regulation of chemokine biosynthetic process(GO:0045073) positive regulation of chemokine biosynthetic process(GO:0045080) |
0.0 | 0.5 | GO:0010761 | fibroblast migration(GO:0010761) |
0.0 | 0.0 | GO:1901162 | serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
0.0 | 0.0 | GO:0048769 | sarcomerogenesis(GO:0048769) |
0.0 | 0.8 | GO:0007030 | Golgi organization(GO:0007030) |
0.0 | 0.0 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
0.0 | 0.1 | GO:0002778 | antimicrobial peptide production(GO:0002775) antibacterial peptide production(GO:0002778) |
0.0 | 0.0 | GO:0021898 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) commitment of multipotent stem cells to neuronal lineage in forebrain(GO:0021898) |
0.0 | 0.0 | GO:0045113 | regulation of integrin biosynthetic process(GO:0045113) |
0.0 | 0.0 | GO:2000774 | positive regulation of cellular senescence(GO:2000774) |
0.0 | 0.1 | GO:0021683 | cerebellar granular layer morphogenesis(GO:0021683) |
0.0 | 0.0 | GO:0030202 | heparin metabolic process(GO:0030202) |
0.0 | 0.1 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
0.0 | 0.1 | GO:1901970 | positive regulation of mitotic sister chromatid separation(GO:1901970) |
0.0 | 0.0 | GO:0023041 | neuronal signal transduction(GO:0023041) |
0.0 | 0.1 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
0.0 | 0.0 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
0.0 | 0.1 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
0.0 | 0.0 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
0.0 | 0.0 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
0.0 | 0.0 | GO:0042747 | regulation of circadian sleep/wake cycle, REM sleep(GO:0042320) circadian sleep/wake cycle, REM sleep(GO:0042747) |
0.0 | 0.0 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
0.0 | 0.1 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
0.0 | 0.1 | GO:0015677 | copper ion import(GO:0015677) |
0.0 | 0.2 | GO:0006379 | mRNA cleavage(GO:0006379) |
0.0 | 0.0 | GO:0035627 | ceramide transport(GO:0035627) |
0.0 | 0.1 | GO:0042511 | positive regulation of tyrosine phosphorylation of Stat1 protein(GO:0042511) |
0.0 | 0.1 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
0.0 | 0.0 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
0.0 | 0.1 | GO:0050435 | beta-amyloid metabolic process(GO:0050435) |
0.0 | 0.1 | GO:0097210 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
0.0 | 0.1 | GO:0061085 | regulation of histone H3-K27 methylation(GO:0061085) positive regulation of histone H3-K27 methylation(GO:0061087) |
0.0 | 0.0 | GO:0035384 | thioester biosynthetic process(GO:0035384) acyl-CoA biosynthetic process(GO:0071616) |
0.0 | 0.1 | GO:0060037 | pharyngeal system development(GO:0060037) |
0.0 | 0.1 | GO:0042407 | cristae formation(GO:0042407) |
0.0 | 0.1 | GO:2000095 | regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000095) |
0.0 | 0.1 | GO:0034331 | cell junction maintenance(GO:0034331) |
0.0 | 0.0 | GO:0036016 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
0.0 | 0.1 | GO:0032048 | cardiolipin metabolic process(GO:0032048) |
0.0 | 0.1 | GO:0042448 | progesterone metabolic process(GO:0042448) |
0.0 | 0.1 | GO:0060013 | righting reflex(GO:0060013) |
0.0 | 0.0 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
0.0 | 0.4 | GO:0006284 | base-excision repair(GO:0006284) |
0.0 | 0.0 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
0.0 | 0.0 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
0.0 | 0.0 | GO:0060330 | regulation of response to interferon-gamma(GO:0060330) |
0.0 | 0.1 | GO:0006228 | UTP biosynthetic process(GO:0006228) |
0.0 | 0.0 | GO:0070827 | chromatin maintenance(GO:0070827) |
0.0 | 0.0 | GO:0033145 | positive regulation of intracellular steroid hormone receptor signaling pathway(GO:0033145) |
0.0 | 0.1 | GO:0006779 | porphyrin-containing compound biosynthetic process(GO:0006779) tetrapyrrole biosynthetic process(GO:0033014) |
0.0 | 0.0 | GO:0060027 | convergent extension involved in gastrulation(GO:0060027) convergent extension involved in axis elongation(GO:0060028) |
0.0 | 0.1 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
0.0 | 0.0 | GO:0001834 | trophectodermal cell proliferation(GO:0001834) |
0.0 | 0.1 | GO:0035610 | protein side chain deglutamylation(GO:0035610) |
0.0 | 0.0 | GO:0086045 | membrane depolarization during AV node cell action potential(GO:0086045) |
0.0 | 0.1 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
0.0 | 0.1 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.0 | 0.0 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
0.0 | 0.1 | GO:0051968 | positive regulation of synaptic transmission, glutamatergic(GO:0051968) |
0.0 | 0.2 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
0.0 | 0.0 | GO:1903894 | regulation of IRE1-mediated unfolded protein response(GO:1903894) |
0.0 | 0.0 | GO:0051665 | membrane raft localization(GO:0051665) |
0.0 | 0.6 | GO:0008033 | tRNA processing(GO:0008033) |
0.0 | 0.0 | GO:0043970 | histone H3-K9 acetylation(GO:0043970) |
0.0 | 0.1 | GO:1900101 | regulation of endoplasmic reticulum unfolded protein response(GO:1900101) |
0.0 | 0.0 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
0.0 | 0.0 | GO:0060023 | soft palate development(GO:0060023) |
0.0 | 0.1 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
0.0 | 0.0 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.0 | 0.0 | GO:0030035 | microspike assembly(GO:0030035) |
0.0 | 0.1 | GO:0032525 | somite rostral/caudal axis specification(GO:0032525) |
0.0 | 0.2 | GO:2001014 | regulation of skeletal muscle cell differentiation(GO:2001014) |
0.0 | 0.1 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
0.0 | 0.0 | GO:0048478 | replication fork protection(GO:0048478) |
0.0 | 0.0 | GO:0061101 | neuroendocrine cell differentiation(GO:0061101) |
0.0 | 0.1 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.0 | 0.0 | GO:0090361 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
0.0 | 0.0 | GO:0071280 | cellular response to copper ion(GO:0071280) |
0.0 | 0.0 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
0.0 | 0.0 | GO:0051013 | microtubule severing(GO:0051013) |
0.0 | 0.1 | GO:0008088 | axo-dendritic transport(GO:0008088) |
0.0 | 0.1 | GO:0042523 | positive regulation of tyrosine phosphorylation of Stat5 protein(GO:0042523) |
0.0 | 0.1 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
0.0 | 0.1 | GO:0071435 | potassium ion export(GO:0071435) |
0.0 | 0.1 | GO:0033630 | positive regulation of cell adhesion mediated by integrin(GO:0033630) |
0.0 | 0.2 | GO:0045747 | positive regulation of Notch signaling pathway(GO:0045747) |
0.0 | 0.0 | GO:0060467 | negative regulation of fertilization(GO:0060467) |
0.0 | 0.2 | GO:0045839 | negative regulation of mitotic nuclear division(GO:0045839) |
0.0 | 0.3 | GO:0001662 | behavioral fear response(GO:0001662) |
0.0 | 0.0 | GO:2000321 | positive regulation of T-helper 17 cell differentiation(GO:2000321) |
0.0 | 0.0 | GO:0045059 | positive thymic T cell selection(GO:0045059) |
0.0 | 0.2 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
0.0 | 0.1 | GO:0032292 | Schwann cell development(GO:0014044) myelination in peripheral nervous system(GO:0022011) peripheral nervous system axon ensheathment(GO:0032292) |
0.0 | 0.0 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
0.0 | 0.2 | GO:0006491 | N-glycan processing(GO:0006491) |
0.0 | 0.0 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
0.0 | 0.0 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
0.0 | 0.2 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.0 | 0.3 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
0.0 | 0.0 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
0.0 | 1.3 | GO:0071230 | cellular response to amino acid stimulus(GO:0071230) |
0.0 | 0.1 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
0.0 | 0.0 | GO:0072497 | mesenchymal stem cell differentiation(GO:0072497) |
0.0 | 0.0 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
0.0 | 0.5 | GO:0032543 | mitochondrial translation(GO:0032543) |
0.0 | 0.0 | GO:0002905 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
0.0 | 0.0 | GO:0060967 | negative regulation of posttranscriptional gene silencing(GO:0060149) negative regulation of gene silencing by miRNA(GO:0060965) negative regulation of gene silencing by RNA(GO:0060967) |
0.0 | 0.0 | GO:0061462 | protein localization to lysosome(GO:0061462) |
0.0 | 0.4 | GO:0045454 | cell redox homeostasis(GO:0045454) |
0.0 | 0.3 | GO:0061077 | chaperone-mediated protein folding(GO:0061077) |
0.0 | 0.0 | GO:0007041 | lysosomal transport(GO:0007041) |
0.0 | 0.0 | GO:0009109 | coenzyme catabolic process(GO:0009109) |
0.0 | 0.0 | GO:1904742 | regulation of telomeric DNA binding(GO:1904742) |
0.0 | 0.0 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
0.0 | 0.0 | GO:1902855 | regulation of nonmotile primary cilium assembly(GO:1902855) |
0.0 | 0.2 | GO:0050873 | brown fat cell differentiation(GO:0050873) |
0.0 | 0.0 | GO:0090085 | regulation of protein deubiquitination(GO:0090085) |
0.0 | 0.0 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
0.0 | 0.0 | GO:0010984 | regulation of lipoprotein particle clearance(GO:0010984) |
0.0 | 0.1 | GO:0006744 | ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
0.0 | 0.0 | GO:1904219 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
0.0 | 0.0 | GO:0021747 | cochlear nucleus development(GO:0021747) |
0.0 | 0.2 | GO:0006829 | zinc II ion transport(GO:0006829) |
0.0 | 0.1 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
0.0 | 0.0 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
0.0 | 0.4 | GO:0030819 | positive regulation of cAMP biosynthetic process(GO:0030819) |
0.0 | 0.0 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
0.0 | 0.1 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
0.0 | 0.0 | GO:0072401 | signal transduction involved in cell cycle checkpoint(GO:0072395) signal transduction involved in DNA integrity checkpoint(GO:0072401) signal transduction involved in DNA damage checkpoint(GO:0072422) |
0.0 | 0.0 | GO:0001555 | oocyte growth(GO:0001555) |
0.0 | 0.0 | GO:0015755 | fructose transport(GO:0015755) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.2 | 3.6 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.8 | 2.3 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
0.7 | 3.3 | GO:0031094 | platelet dense tubular network(GO:0031094) |
0.3 | 1.3 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.3 | 1.2 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.3 | 0.9 | GO:0048179 | activin receptor complex(GO:0048179) |
0.3 | 0.9 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
0.3 | 0.8 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.2 | 1.0 | GO:0097425 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
0.2 | 1.1 | GO:0005579 | membrane attack complex(GO:0005579) |
0.2 | 0.9 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.2 | 2.2 | GO:0070852 | cell body fiber(GO:0070852) |
0.2 | 0.8 | GO:1990696 | USH2 complex(GO:1990696) |
0.2 | 1.5 | GO:0016342 | catenin complex(GO:0016342) |
0.2 | 1.3 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.2 | 0.7 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
0.2 | 0.7 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.2 | 0.7 | GO:0045293 | mRNA editing complex(GO:0045293) |
0.1 | 1.3 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
0.1 | 0.6 | GO:0030891 | VCB complex(GO:0030891) |
0.1 | 0.8 | GO:0042587 | glycogen granule(GO:0042587) |
0.1 | 0.5 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.1 | 0.4 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.1 | 0.4 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
0.1 | 0.5 | GO:0070545 | PeBoW complex(GO:0070545) |
0.1 | 0.4 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.1 | 1.9 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
0.1 | 0.5 | GO:0032021 | NELF complex(GO:0032021) |
0.1 | 0.7 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.1 | 0.5 | GO:0036449 | microtubule minus-end(GO:0036449) |
0.1 | 0.5 | GO:0030478 | actin cap(GO:0030478) |
0.1 | 0.3 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.1 | 0.6 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.1 | 0.8 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
0.1 | 0.3 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
0.1 | 0.5 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.1 | 0.3 | GO:0005712 | chiasma(GO:0005712) |
0.1 | 1.5 | GO:0043220 | Schmidt-Lanterman incisure(GO:0043220) |
0.1 | 2.0 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.1 | 0.2 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
0.1 | 0.5 | GO:0045261 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
0.1 | 0.4 | GO:0008274 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
0.1 | 0.4 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.1 | 1.1 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.1 | 1.4 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.1 | 0.4 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
0.1 | 1.1 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.1 | 0.6 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
0.1 | 0.3 | GO:0070876 | SOSS complex(GO:0070876) |
0.1 | 1.0 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.1 | 0.2 | GO:0031523 | Myb complex(GO:0031523) |
0.1 | 0.2 | GO:0097413 | Lewy body(GO:0097413) |
0.1 | 0.4 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.1 | 0.7 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.1 | 3.2 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.1 | 0.7 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.1 | 0.2 | GO:0055087 | Ski complex(GO:0055087) |
0.1 | 0.3 | GO:1990246 | uniplex complex(GO:1990246) |
0.1 | 0.8 | GO:0000346 | transcription export complex(GO:0000346) |
0.1 | 0.3 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
0.1 | 0.2 | GO:0032010 | phagolysosome(GO:0032010) |
0.1 | 0.3 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.1 | 0.5 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.1 | 0.1 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.1 | 0.5 | GO:0035631 | CD40 receptor complex(GO:0035631) |
0.1 | 0.3 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
0.1 | 0.3 | GO:0071203 | WASH complex(GO:0071203) |
0.1 | 0.5 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.1 | 0.3 | GO:0035339 | SPOTS complex(GO:0035339) |
0.1 | 0.2 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
0.1 | 3.4 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
0.1 | 0.2 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.1 | 0.3 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.1 | 0.3 | GO:0030056 | hemidesmosome(GO:0030056) |
0.1 | 1.6 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.1 | 0.4 | GO:0045180 | basal cortex(GO:0045180) |
0.1 | 2.0 | GO:0030660 | Golgi-associated vesicle membrane(GO:0030660) |
0.1 | 2.1 | GO:0045271 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
0.1 | 0.2 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.1 | 9.2 | GO:0005759 | mitochondrial matrix(GO:0005759) |
0.1 | 0.2 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
0.1 | 0.2 | GO:0032444 | activin responsive factor complex(GO:0032444) |
0.1 | 0.5 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.1 | 1.0 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
0.1 | 1.0 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.1 | 0.4 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.1 | 0.2 | GO:0005827 | polar microtubule(GO:0005827) |
0.1 | 0.2 | GO:1990745 | EARP complex(GO:1990745) |
0.1 | 0.9 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.1 | 3.1 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
0.1 | 1.1 | GO:0005719 | nuclear euchromatin(GO:0005719) |
0.1 | 0.6 | GO:0032426 | stereocilium tip(GO:0032426) |
0.1 | 0.1 | GO:0043259 | laminin-10 complex(GO:0043259) |
0.1 | 0.3 | GO:0090543 | Flemming body(GO:0090543) |
0.1 | 0.2 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.1 | 1.9 | GO:0005637 | nuclear inner membrane(GO:0005637) |
0.1 | 0.9 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
0.1 | 1.0 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
0.1 | 0.1 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
0.1 | 0.2 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.0 | 0.1 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
0.0 | 0.1 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
0.0 | 0.2 | GO:0005915 | zonula adherens(GO:0005915) |
0.0 | 0.2 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
0.0 | 0.3 | GO:0045239 | tricarboxylic acid cycle enzyme complex(GO:0045239) |
0.0 | 0.5 | GO:0031527 | filopodium membrane(GO:0031527) |
0.0 | 0.8 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.0 | 0.2 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
0.0 | 0.1 | GO:0005638 | lamin filament(GO:0005638) |
0.0 | 0.4 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.0 | 0.5 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
0.0 | 0.5 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.0 | 0.2 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.0 | 0.3 | GO:1904115 | axon cytoplasm(GO:1904115) |
0.0 | 0.6 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
0.0 | 0.4 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.0 | 0.2 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.0 | 1.3 | GO:0031672 | A band(GO:0031672) |
0.0 | 0.1 | GO:1990635 | proximal dendrite(GO:1990635) |
0.0 | 0.2 | GO:0071986 | Ragulator complex(GO:0071986) |
0.0 | 0.3 | GO:0001650 | fibrillar center(GO:0001650) |
0.0 | 0.7 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
0.0 | 0.2 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.0 | 0.4 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.0 | 0.3 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.0 | 0.1 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.0 | 0.8 | GO:0008305 | integrin complex(GO:0008305) |
0.0 | 0.2 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.0 | 0.2 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.0 | 0.2 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.0 | 0.5 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.0 | 3.1 | GO:0005930 | axoneme(GO:0005930) ciliary plasm(GO:0097014) |
0.0 | 0.3 | GO:0045275 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
0.0 | 0.2 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
0.0 | 0.1 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
0.0 | 0.1 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.0 | 0.2 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.0 | 0.1 | GO:0033647 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
0.0 | 0.2 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.0 | 0.1 | GO:0033162 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
0.0 | 0.2 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.0 | 0.4 | GO:0000974 | Prp19 complex(GO:0000974) |
0.0 | 4.8 | GO:0031965 | nuclear membrane(GO:0031965) |
0.0 | 1.5 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
0.0 | 0.2 | GO:0070847 | core mediator complex(GO:0070847) |
0.0 | 0.1 | GO:0071942 | XPC complex(GO:0071942) |
0.0 | 0.1 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
0.0 | 0.2 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
0.0 | 0.1 | GO:0005927 | muscle tendon junction(GO:0005927) |
0.0 | 0.2 | GO:0044326 | dendritic spine neck(GO:0044326) |
0.0 | 0.4 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
0.0 | 0.3 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.0 | 0.2 | GO:0032009 | early phagosome(GO:0032009) |
0.0 | 0.1 | GO:0001739 | sex chromatin(GO:0001739) |
0.0 | 0.5 | GO:0035371 | microtubule plus-end(GO:0035371) |
0.0 | 1.5 | GO:0005811 | lipid particle(GO:0005811) |
0.0 | 0.1 | GO:0043202 | lysosomal lumen(GO:0043202) |
0.0 | 0.1 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
0.0 | 0.2 | GO:0048500 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
0.0 | 0.1 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.0 | 0.4 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
0.0 | 0.4 | GO:0016514 | SWI/SNF complex(GO:0016514) |
0.0 | 0.1 | GO:0005955 | calcineurin complex(GO:0005955) |
0.0 | 1.0 | GO:0016459 | myosin complex(GO:0016459) |
0.0 | 0.4 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
0.0 | 0.1 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.0 | 0.3 | GO:0031932 | TORC2 complex(GO:0031932) |
0.0 | 0.0 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
0.0 | 0.1 | GO:0005652 | nuclear lamina(GO:0005652) |
0.0 | 0.2 | GO:0097342 | ripoptosome(GO:0097342) |
0.0 | 0.2 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.0 | 0.1 | GO:0097422 | tubular endosome(GO:0097422) |
0.0 | 0.1 | GO:0030120 | vesicle coat(GO:0030120) |
0.0 | 0.6 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
0.0 | 0.1 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.0 | 0.1 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.0 | 0.1 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.0 | 0.0 | GO:0045298 | tubulin complex(GO:0045298) |
0.0 | 0.1 | GO:0001652 | granular component(GO:0001652) |
0.0 | 0.3 | GO:0043034 | costamere(GO:0043034) |
0.0 | 0.1 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
0.0 | 0.6 | GO:0031941 | filamentous actin(GO:0031941) |
0.0 | 0.1 | GO:0005914 | spot adherens junction(GO:0005914) |
0.0 | 0.5 | GO:0032420 | stereocilium(GO:0032420) |
0.0 | 0.4 | GO:1902554 | serine/threonine protein kinase complex(GO:1902554) |
0.0 | 0.4 | GO:0036379 | myofilament(GO:0036379) |
0.0 | 1.4 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
0.0 | 0.1 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
0.0 | 0.1 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
0.0 | 0.1 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
0.0 | 0.1 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
0.0 | 0.1 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.0 | 0.2 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.0 | 0.1 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
0.0 | 0.2 | GO:0032279 | asymmetric synapse(GO:0032279) |
0.0 | 0.3 | GO:0031907 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
0.0 | 0.1 | GO:0071797 | LUBAC complex(GO:0071797) |
0.0 | 0.5 | GO:0016592 | mediator complex(GO:0016592) |
0.0 | 0.1 | GO:0016272 | prefoldin complex(GO:0016272) |
0.0 | 0.2 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
0.0 | 0.1 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.0 | 0.2 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.0 | 0.2 | GO:0045263 | proton-transporting ATP synthase complex, coupling factor F(o)(GO:0045263) |
0.0 | 0.8 | GO:0005643 | nuclear pore(GO:0005643) |
0.0 | 0.1 | GO:0042629 | mast cell granule(GO:0042629) |
0.0 | 0.0 | GO:0020016 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
0.0 | 0.0 | GO:1990752 | microtubule end(GO:1990752) |
0.0 | 0.1 | GO:0097208 | alveolar lamellar body(GO:0097208) |
0.0 | 0.0 | GO:0030689 | Noc complex(GO:0030689) |
0.0 | 0.1 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
0.0 | 0.1 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
0.0 | 0.2 | GO:0051233 | spindle midzone(GO:0051233) |
0.0 | 0.1 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
0.0 | 0.0 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.0 | 0.2 | GO:0032797 | SMN complex(GO:0032797) |
0.0 | 0.1 | GO:0097209 | epidermal lamellar body(GO:0097209) |
0.0 | 0.2 | GO:0072546 | ER membrane protein complex(GO:0072546) |
0.0 | 0.0 | GO:0031502 | dolichyl-phosphate-mannose-protein mannosyltransferase complex(GO:0031502) |
0.0 | 0.2 | GO:0000242 | pericentriolar material(GO:0000242) |
0.0 | 0.3 | GO:0031304 | intrinsic component of mitochondrial inner membrane(GO:0031304) |
0.0 | 0.2 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.0 | 0.5 | GO:0032040 | small-subunit processome(GO:0032040) |
0.0 | 0.2 | GO:0045277 | respiratory chain complex IV(GO:0045277) |
0.0 | 0.0 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
0.0 | 0.1 | GO:0044294 | dendritic growth cone(GO:0044294) |
0.0 | 0.1 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
0.0 | 0.1 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.0 | 0.2 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
0.0 | 0.0 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
0.0 | 0.2 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
0.0 | 0.1 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.0 | 0.1 | GO:0035363 | histone locus body(GO:0035363) |
0.0 | 0.0 | GO:0042824 | MHC class I peptide loading complex(GO:0042824) |
0.0 | 0.0 | GO:0030314 | junctional membrane complex(GO:0030314) |
0.0 | 0.1 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.0 | 0.1 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
0.0 | 0.0 | GO:0008091 | spectrin(GO:0008091) |
0.0 | 0.0 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
0.0 | 0.4 | GO:0072686 | mitotic spindle(GO:0072686) |
0.0 | 0.2 | GO:0097225 | sperm midpiece(GO:0097225) |
0.0 | 0.1 | GO:0000798 | nuclear cohesin complex(GO:0000798) |
0.0 | 0.1 | GO:0010369 | chromocenter(GO:0010369) |
0.0 | 0.0 | GO:0097255 | R2TP complex(GO:0097255) |
0.0 | 0.0 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.0 | 0.0 | GO:0071953 | elastic fiber(GO:0071953) |
0.0 | 0.0 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.0 | 0.2 | GO:0016235 | aggresome(GO:0016235) |
0.0 | 0.7 | GO:0000502 | proteasome complex(GO:0000502) |
0.0 | 0.4 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
0.0 | 0.2 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.0 | 0.0 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.0 | 0.1 | GO:0000124 | SAGA complex(GO:0000124) |
0.0 | 0.0 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
0.0 | 0.1 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.2 | 3.7 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
0.8 | 2.3 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
0.7 | 3.3 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
0.6 | 1.3 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
0.6 | 1.9 | GO:0032190 | acrosin binding(GO:0032190) |
0.6 | 1.1 | GO:0016418 | S-acetyltransferase activity(GO:0016418) |
0.5 | 1.5 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.5 | 2.0 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
0.5 | 1.5 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.5 | 3.4 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
0.4 | 1.2 | GO:0032551 | UTP binding(GO:0002134) pyrimidine ribonucleoside binding(GO:0032551) |
0.4 | 1.2 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
0.4 | 1.2 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
0.4 | 3.4 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.4 | 1.1 | GO:0004771 | sterol esterase activity(GO:0004771) |
0.4 | 1.9 | GO:0070728 | leucine binding(GO:0070728) |
0.3 | 1.0 | GO:0038181 | bile acid receptor activity(GO:0038181) |
0.3 | 0.9 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
0.3 | 0.9 | GO:0004470 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) |
0.3 | 0.8 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.3 | 1.4 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
0.3 | 0.8 | GO:0008506 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
0.3 | 1.1 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
0.3 | 0.8 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
0.3 | 2.9 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.3 | 0.8 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
0.2 | 0.7 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.2 | 0.2 | GO:0018423 | protein C-terminal leucine carboxyl O-methyltransferase activity(GO:0018423) |
0.2 | 1.1 | GO:0004556 | alpha-amylase activity(GO:0004556) |
0.2 | 1.4 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
0.2 | 1.4 | GO:0046790 | virion binding(GO:0046790) |
0.2 | 0.6 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
0.2 | 1.0 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
0.2 | 0.6 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
0.2 | 0.6 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
0.2 | 1.1 | GO:0002054 | nucleobase binding(GO:0002054) |
0.2 | 0.6 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
0.2 | 0.2 | GO:0032557 | pyrimidine ribonucleotide binding(GO:0032557) |
0.2 | 0.5 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
0.2 | 0.5 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.2 | 1.0 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
0.2 | 0.6 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
0.2 | 5.3 | GO:0052768 | prenylcysteine methylesterase activity(GO:0010296) 1-oxa-2-oxocycloheptane lactonase activity(GO:0018731) sulfolactone hydrolase activity(GO:0018732) butyrolactone hydrolase activity(GO:0018734) endosulfan lactone lactonase activity(GO:0034892) L-ascorbate 6-phosphate lactonase activity(GO:0035460) Ser-tRNA(Thr) hydrolase activity(GO:0043905) Ala-tRNA(Pro) hydrolase activity(GO:0043906) Cys-tRNA(Pro) hydrolase activity(GO:0043907) Ser(Gly)-tRNA(Ala) hydrolase activity(GO:0043908) all-trans-retinyl-palmitate hydrolase, all-trans-retinol forming activity(GO:0047376) mannosyl-oligosaccharide 1,6-alpha-mannosidase activity(GO:0052767) mannosyl-oligosaccharide 1,3-alpha-mannosidase activity(GO:0052768) methyl indole-3-acetate esterase activity(GO:0080030) methyl salicylate esterase activity(GO:0080031) methyl jasmonate esterase activity(GO:0080032) |
0.2 | 0.5 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
0.2 | 0.9 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
0.2 | 0.9 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
0.2 | 0.5 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
0.1 | 0.6 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
0.1 | 0.3 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.1 | 0.4 | GO:0005347 | ATP transmembrane transporter activity(GO:0005347) |
0.1 | 1.4 | GO:0015266 | protein channel activity(GO:0015266) |
0.1 | 0.6 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.1 | 0.4 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
0.1 | 1.1 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.1 | 0.4 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
0.1 | 0.4 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
0.1 | 0.5 | GO:0031781 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
0.1 | 1.1 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.1 | 0.7 | GO:0010853 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
0.1 | 0.4 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) |
0.1 | 0.5 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
0.1 | 0.4 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.1 | 0.6 | GO:0017040 | ceramidase activity(GO:0017040) |
0.1 | 1.5 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.1 | 1.3 | GO:0070411 | I-SMAD binding(GO:0070411) |
0.1 | 0.4 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
0.1 | 1.2 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
0.1 | 0.4 | GO:0031686 | A1 adenosine receptor binding(GO:0031686) |
0.1 | 1.5 | GO:0001223 | transcription coactivator binding(GO:0001223) |
0.1 | 0.4 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.1 | 0.8 | GO:0016443 | bidentate ribonuclease III activity(GO:0016443) |
0.1 | 3.9 | GO:0016749 | N-succinyltransferase activity(GO:0016749) |
0.1 | 0.6 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
0.1 | 0.6 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
0.1 | 1.0 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.1 | 1.2 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
0.1 | 0.7 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
0.1 | 2.5 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
0.1 | 2.1 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.1 | 0.5 | GO:0015181 | arginine transmembrane transporter activity(GO:0015181) L-lysine transmembrane transporter activity(GO:0015189) |
0.1 | 0.9 | GO:0004779 | sulfate adenylyltransferase activity(GO:0004779) |
0.1 | 0.3 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.1 | 0.3 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
0.1 | 0.6 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.1 | 0.4 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.1 | 0.5 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
0.1 | 0.3 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.1 | 0.8 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.1 | 0.3 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
0.1 | 0.3 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.1 | 0.4 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
0.1 | 0.3 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.1 | 0.3 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
0.1 | 0.4 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.1 | 0.3 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.1 | 1.4 | GO:0015924 | mannosyl-oligosaccharide mannosidase activity(GO:0015924) |
0.1 | 0.4 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
0.1 | 0.3 | GO:0016532 | superoxide dismutase copper chaperone activity(GO:0016532) |
0.1 | 0.5 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.1 | 0.6 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
0.1 | 0.4 | GO:0098748 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
0.1 | 0.2 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) |
0.1 | 0.4 | GO:0050693 | LBD domain binding(GO:0050693) |
0.1 | 0.3 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.1 | 0.4 | GO:0031852 | mu-type opioid receptor binding(GO:0031852) |
0.1 | 0.3 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
0.1 | 1.2 | GO:0015643 | toxic substance binding(GO:0015643) |
0.1 | 0.8 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) |
0.1 | 0.7 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
0.1 | 0.7 | GO:0035197 | siRNA binding(GO:0035197) |
0.1 | 0.3 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
0.1 | 0.3 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
0.1 | 0.9 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
0.1 | 1.2 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
0.1 | 0.3 | GO:0019145 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
0.1 | 0.4 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
0.1 | 0.3 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
0.1 | 0.2 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.1 | 0.2 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.1 | 0.7 | GO:0031748 | D1 dopamine receptor binding(GO:0031748) |
0.1 | 0.2 | GO:0004359 | glutaminase activity(GO:0004359) |
0.1 | 0.2 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
0.1 | 0.8 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.1 | 0.2 | GO:0055100 | adiponectin binding(GO:0055100) |
0.1 | 1.3 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
0.1 | 2.2 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
0.1 | 0.1 | GO:0030792 | methylarsonite methyltransferase activity(GO:0030792) |
0.1 | 0.2 | GO:0016300 | tRNA (uracil) methyltransferase activity(GO:0016300) |
0.1 | 0.6 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
0.1 | 0.2 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) |
0.1 | 0.3 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
0.1 | 0.9 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.1 | 0.3 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.1 | 2.3 | GO:0045543 | sulfonate dioxygenase activity(GO:0000907) 2,4-dichlorophenoxyacetate alpha-ketoglutarate dioxygenase activity(GO:0018602) hypophosphite dioxygenase activity(GO:0034792) gibberellin 2-beta-dioxygenase activity(GO:0045543) C-19 gibberellin 2-beta-dioxygenase activity(GO:0052634) C-20 gibberellin 2-beta-dioxygenase activity(GO:0052635) |
0.1 | 1.2 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.1 | 0.2 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
0.1 | 0.3 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.1 | 0.2 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
0.1 | 1.0 | GO:0016854 | racemase and epimerase activity(GO:0016854) |
0.1 | 0.3 | GO:0035671 | enone reductase activity(GO:0035671) |
0.1 | 0.1 | GO:0005346 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) |
0.1 | 0.2 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
0.1 | 1.0 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.1 | 0.1 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.1 | 0.3 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.1 | 0.2 | GO:0019976 | interleukin-2 binding(GO:0019976) |
0.1 | 0.3 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.1 | 0.3 | GO:0005047 | signal recognition particle binding(GO:0005047) |
0.1 | 0.2 | GO:0046538 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
0.1 | 0.3 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.1 | 0.7 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.1 | 1.6 | GO:0030552 | cAMP binding(GO:0030552) |
0.1 | 0.3 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
0.1 | 0.3 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.1 | 0.2 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
0.1 | 1.1 | GO:1905030 | voltage-gated sodium channel activity(GO:0005248) voltage-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1905030) |
0.1 | 0.7 | GO:0043733 | alkylbase DNA N-glycosylase activity(GO:0003905) DNA-3-methylbase glycosylase activity(GO:0043733) |
0.1 | 0.3 | GO:0048495 | Roundabout binding(GO:0048495) |
0.1 | 0.5 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
0.1 | 2.4 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
0.1 | 0.2 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.1 | 0.1 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
0.1 | 0.5 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
0.1 | 0.3 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
0.1 | 0.3 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.1 | 0.2 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
0.1 | 0.2 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
0.1 | 0.8 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
0.1 | 0.2 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.1 | 0.5 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.1 | 0.2 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
0.1 | 0.2 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
0.1 | 1.7 | GO:0001540 | beta-amyloid binding(GO:0001540) |
0.1 | 0.5 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
0.1 | 0.2 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
0.1 | 0.8 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
0.1 | 0.2 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
0.1 | 0.4 | GO:0016681 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.1 | 0.2 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.1 | 0.1 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.1 | 0.3 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
0.1 | 1.0 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
0.1 | 0.7 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
0.1 | 0.4 | GO:0002162 | dystroglycan binding(GO:0002162) |
0.1 | 0.1 | GO:0034617 | tetrahydrobiopterin binding(GO:0034617) |
0.1 | 0.1 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.1 | 1.1 | GO:0003785 | actin monomer binding(GO:0003785) |
0.1 | 0.7 | GO:0030169 | low-density lipoprotein particle binding(GO:0030169) |
0.1 | 0.2 | GO:0043515 | kinetochore binding(GO:0043515) |
0.1 | 0.7 | GO:0005542 | folic acid binding(GO:0005542) |
0.1 | 0.2 | GO:0001849 | complement component C1q binding(GO:0001849) |
0.1 | 0.2 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.1 | 1.3 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
0.1 | 0.2 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
0.1 | 0.3 | GO:0050733 | RS domain binding(GO:0050733) |
0.1 | 0.1 | GO:0032052 | bile acid binding(GO:0032052) |
0.1 | 0.2 | GO:0016717 | oxidoreductase activity, acting on paired donors, with oxidation of a pair of donors resulting in the reduction of molecular oxygen to two molecules of water(GO:0016717) |
0.1 | 0.8 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
0.1 | 0.8 | GO:0019825 | oxygen binding(GO:0019825) |
0.1 | 1.0 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
0.1 | 1.2 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
0.1 | 0.7 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.1 | 0.2 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.1 | 0.3 | GO:1990254 | keratin filament binding(GO:1990254) |
0.1 | 0.2 | GO:1901611 | phosphatidylglycerol binding(GO:1901611) cardiolipin binding(GO:1901612) |
0.1 | 0.2 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.0 | 0.0 | GO:0051723 | protein methylesterase activity(GO:0051723) |
0.0 | 0.1 | GO:0032564 | dATP binding(GO:0032564) |
0.0 | 0.2 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.0 | 0.1 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.0 | 0.1 | GO:0042281 | dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase activity(GO:0042281) |
0.0 | 0.2 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
0.0 | 0.2 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.0 | 0.1 | GO:0004096 | catalase activity(GO:0004096) |
0.0 | 0.7 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.0 | 0.1 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.0 | 0.1 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.0 | 0.1 | GO:1990715 | mRNA CDS binding(GO:1990715) |
0.0 | 0.6 | GO:0001848 | complement binding(GO:0001848) |
0.0 | 0.1 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.0 | 0.3 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.0 | 0.3 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
0.0 | 2.3 | GO:0038024 | cargo receptor activity(GO:0038024) |
0.0 | 0.1 | GO:0004690 | cyclic nucleotide-dependent protein kinase activity(GO:0004690) |
0.0 | 0.1 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
0.0 | 0.2 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
0.0 | 0.0 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.0 | 0.1 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
0.0 | 0.1 | GO:2001069 | glycogen binding(GO:2001069) |
0.0 | 0.0 | GO:0033142 | progesterone receptor binding(GO:0033142) |
0.0 | 0.2 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
0.0 | 0.5 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.0 | 1.2 | GO:0016763 | transferase activity, transferring pentosyl groups(GO:0016763) |
0.0 | 0.1 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.0 | 0.6 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.0 | 0.2 | GO:0004337 | geranyltranstransferase activity(GO:0004337) |
0.0 | 0.5 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
0.0 | 0.4 | GO:0004955 | prostaglandin receptor activity(GO:0004955) |
0.0 | 0.1 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
0.0 | 0.0 | GO:0003696 | satellite DNA binding(GO:0003696) |
0.0 | 0.2 | GO:0016151 | nickel cation binding(GO:0016151) |
0.0 | 0.1 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
0.0 | 3.4 | GO:0001948 | glycoprotein binding(GO:0001948) |
0.0 | 0.2 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.0 | 0.2 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
0.0 | 0.2 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
0.0 | 0.2 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
0.0 | 0.2 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
0.0 | 0.1 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.0 | 0.8 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.0 | 0.4 | GO:0070403 | NAD+ binding(GO:0070403) |
0.0 | 0.0 | GO:0035514 | DNA demethylase activity(GO:0035514) |
0.0 | 0.1 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.0 | 0.8 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
0.0 | 0.2 | GO:0005113 | patched binding(GO:0005113) |
0.0 | 0.2 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
0.0 | 0.1 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
0.0 | 0.2 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.0 | 0.5 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
0.0 | 0.7 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
0.0 | 0.2 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
0.0 | 0.5 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
0.0 | 0.1 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.0 | 0.2 | GO:0043495 | protein anchor(GO:0043495) |
0.0 | 0.3 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.0 | 0.1 | GO:0019959 | interleukin-8 binding(GO:0019959) |
0.0 | 0.4 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.0 | 0.3 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
0.0 | 0.2 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.0 | 0.1 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.0 | 0.3 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.0 | 0.5 | GO:0004707 | MAP kinase activity(GO:0004707) |
0.0 | 0.2 | GO:0050815 | phosphoserine binding(GO:0050815) |
0.0 | 0.4 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
0.0 | 0.0 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
0.0 | 0.7 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
0.0 | 0.3 | GO:0031386 | protein tag(GO:0031386) |
0.0 | 0.0 | GO:0004809 | tRNA (guanine-N2-)-methyltransferase activity(GO:0004809) |
0.0 | 0.2 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.0 | 0.5 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
0.0 | 0.1 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
0.0 | 0.2 | GO:0000146 | microfilament motor activity(GO:0000146) |
0.0 | 0.1 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.0 | 0.2 | GO:0034603 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
0.0 | 0.1 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.0 | 0.1 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
0.0 | 0.5 | GO:0030291 | protein serine/threonine kinase inhibitor activity(GO:0030291) |
0.0 | 0.1 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
0.0 | 0.1 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
0.0 | 0.2 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
0.0 | 0.3 | GO:0031996 | thioesterase binding(GO:0031996) |
0.0 | 0.2 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
0.0 | 0.2 | GO:0016624 | oxidoreductase activity, acting on the aldehyde or oxo group of donors, disulfide as acceptor(GO:0016624) |
0.0 | 0.5 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
0.0 | 0.1 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
0.0 | 0.5 | GO:0016891 | endoribonuclease activity, producing 5'-phosphomonoesters(GO:0016891) |
0.0 | 0.3 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.0 | 0.1 | GO:0051425 | PTB domain binding(GO:0051425) |
0.0 | 0.3 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
0.0 | 0.4 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
0.0 | 0.1 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.0 | 0.2 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
0.0 | 0.1 | GO:0034416 | bisphosphoglycerate phosphatase activity(GO:0034416) |
0.0 | 0.1 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
0.0 | 0.1 | GO:0034618 | arginine binding(GO:0034618) |
0.0 | 0.1 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
0.0 | 0.1 | GO:0050897 | cobalt ion binding(GO:0050897) |
0.0 | 0.5 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
0.0 | 0.1 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
0.0 | 0.1 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
0.0 | 0.1 | GO:0071614 | linoleic acid epoxygenase activity(GO:0071614) |
0.0 | 0.2 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
0.0 | 0.1 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
0.0 | 0.1 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
0.0 | 0.7 | GO:0004448 | isocitrate dehydrogenase activity(GO:0004448) |
0.0 | 0.1 | GO:0004969 | histamine receptor activity(GO:0004969) |
0.0 | 0.1 | GO:0004308 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
0.0 | 0.5 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
0.0 | 0.2 | GO:0003993 | acid phosphatase activity(GO:0003993) |
0.0 | 0.1 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
0.0 | 0.3 | GO:0031404 | chloride ion binding(GO:0031404) |
0.0 | 1.5 | GO:0000009 | alpha-1,6-mannosyltransferase activity(GO:0000009) |
0.0 | 0.1 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.0 | 0.3 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
0.0 | 0.0 | GO:0008297 | single-stranded DNA exodeoxyribonuclease activity(GO:0008297) |
0.0 | 0.1 | GO:0004723 | calcium-dependent protein serine/threonine phosphatase activity(GO:0004723) |
0.0 | 0.7 | GO:0070888 | E-box binding(GO:0070888) |
0.0 | 0.5 | GO:0003756 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
0.0 | 0.1 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
0.0 | 0.1 | GO:0000832 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
0.0 | 0.1 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
0.0 | 0.0 | GO:0004676 | 3-phosphoinositide-dependent protein kinase activity(GO:0004676) |
0.0 | 0.1 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
0.0 | 0.1 | GO:0031419 | cobalamin binding(GO:0031419) |
0.0 | 0.2 | GO:0043426 | MRF binding(GO:0043426) |
0.0 | 0.6 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
0.0 | 0.2 | GO:0019215 | intermediate filament binding(GO:0019215) |
0.0 | 0.1 | GO:0016896 | 3'-5'-exoribonuclease activity(GO:0000175) exoribonuclease activity, producing 5'-phosphomonoesters(GO:0016896) |
0.0 | 1.0 | GO:0046332 | SMAD binding(GO:0046332) |
0.0 | 0.1 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.0 | 0.1 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
0.0 | 0.2 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.0 | 0.1 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
0.0 | 0.2 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.0 | 0.1 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
0.0 | 0.1 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.0 | 0.1 | GO:0005024 | transforming growth factor beta-activated receptor activity(GO:0005024) |
0.0 | 0.7 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
0.0 | 0.2 | GO:0034869 | 2-oxoglutaryl-CoA thioesterase activity(GO:0034843) 2,4,4-trimethyl-3-oxopentanoyl-CoA thioesterase activity(GO:0034869) 3-isopropylbut-3-enoyl-CoA thioesterase activity(GO:0034946) glutaryl-CoA hydrolase activity(GO:0044466) |
0.0 | 0.5 | GO:0030331 | estrogen receptor binding(GO:0030331) |
0.0 | 0.7 | GO:0004693 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
0.0 | 0.1 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
0.0 | 0.1 | GO:0034452 | dynactin binding(GO:0034452) |
0.0 | 0.2 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
0.0 | 0.2 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
0.0 | 0.1 | GO:0044548 | S100 protein binding(GO:0044548) |
0.0 | 0.1 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
0.0 | 0.8 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
0.0 | 0.1 | GO:0043140 | ATP-dependent 3'-5' DNA helicase activity(GO:0043140) |
0.0 | 0.1 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
0.0 | 0.2 | GO:0044213 | intronic transcription regulatory region DNA binding(GO:0044213) |
0.0 | 0.0 | GO:0070878 | primary miRNA binding(GO:0070878) |
0.0 | 0.0 | GO:0042171 | lysophosphatidic acid acyltransferase activity(GO:0042171) |
0.0 | 0.1 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
0.0 | 0.0 | GO:0008948 | oxaloacetate decarboxylase activity(GO:0008948) |
0.0 | 0.1 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.0 | 0.0 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
0.0 | 0.1 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
0.0 | 0.1 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
0.0 | 0.1 | GO:0004967 | glucagon receptor activity(GO:0004967) |
0.0 | 0.0 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.0 | 0.0 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
0.0 | 0.0 | GO:0035175 | histone kinase activity (H3-S10 specific)(GO:0035175) |
0.0 | 0.1 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.0 | 0.0 | GO:0034875 | oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
0.0 | 0.1 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.0 | 0.1 | GO:0008745 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) peptidoglycan receptor activity(GO:0016019) |
0.0 | 0.1 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
0.0 | 0.1 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
0.0 | 0.2 | GO:0004033 | aldo-keto reductase (NADP) activity(GO:0004033) |
0.0 | 0.0 | GO:0001016 | RNA polymerase III regulatory region DNA binding(GO:0001016) |
0.0 | 0.1 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.0 | 0.1 | GO:0008430 | selenium binding(GO:0008430) |
0.0 | 0.2 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
0.0 | 0.1 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
0.0 | 0.3 | GO:0017025 | TBP-class protein binding(GO:0017025) |
0.0 | 0.4 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
0.0 | 0.1 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
0.0 | 0.5 | GO:0052771 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
0.0 | 0.1 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
0.0 | 0.4 | GO:0070566 | adenylyltransferase activity(GO:0070566) |
0.0 | 0.2 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
0.0 | 0.0 | GO:0008865 | fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
0.0 | 0.1 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
0.0 | 0.0 | GO:0008169 | C-methyltransferase activity(GO:0008169) 2-polyprenyl-6-methoxy-1,4-benzoquinone methyltransferase activity(GO:0008425) quinone cofactor methyltransferase activity(GO:0030580) |
0.0 | 0.1 | GO:0004977 | melanocortin receptor activity(GO:0004977) |
0.0 | 0.1 | GO:0036310 | annealing helicase activity(GO:0036310) |
0.0 | 0.0 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.0 | 0.1 | GO:0008418 | protein-N-terminal asparagine amidohydrolase activity(GO:0008418) UDP-3-O-[3-hydroxymyristoyl] N-acetylglucosamine deacetylase activity(GO:0008759) iprodione amidohydrolase activity(GO:0018748) (3,5-dichlorophenylurea)acetate amidohydrolase activity(GO:0018749) 4'-(2-hydroxyisopropyl)phenylurea amidohydrolase activity(GO:0034571) didemethylisoproturon amidohydrolase activity(GO:0034573) N-isopropylacetanilide amidohydrolase activity(GO:0034576) N-cyclohexylformamide amidohydrolase activity(GO:0034781) isonicotinic acid hydrazide hydrolase activity(GO:0034876) cis-aconitamide amidase activity(GO:0034882) gamma-N-formylaminovinylacetate hydrolase activity(GO:0034885) N2-acetyl-L-lysine deacetylase activity(GO:0043747) O-succinylbenzoate synthase activity(GO:0043748) indoleacetamide hydrolase activity(GO:0043864) N-acetylcitrulline deacetylase activity(GO:0043909) N-acetylgalactosamine-6-phosphate deacetylase activity(GO:0047419) diacetylchitobiose deacetylase activity(GO:0052773) chitooligosaccharide deacetylase activity(GO:0052790) |
0.0 | 1.2 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
0.0 | 0.3 | GO:0031369 | translation initiation factor binding(GO:0031369) |
0.0 | 0.1 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.0 | 0.1 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.0 | 0.1 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
0.0 | 0.0 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
0.0 | 1.5 | GO:0036459 | thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) ubiquitinyl hydrolase activity(GO:0101005) |
0.0 | 0.4 | GO:0051059 | NF-kappaB binding(GO:0051059) |
0.0 | 0.0 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.0 | 0.3 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
0.0 | 0.7 | GO:0008907 | integrase activity(GO:0008907) T/G mismatch-specific endonuclease activity(GO:0043765) retroviral integrase activity(GO:0044823) retroviral 3' processing activity(GO:0044824) |
0.0 | 0.1 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.0 | 0.2 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
0.0 | 0.2 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
0.0 | 0.3 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
0.0 | 0.1 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.0 | 0.8 | GO:0002039 | p53 binding(GO:0002039) |
0.0 | 0.2 | GO:0005521 | lamin binding(GO:0005521) |
0.0 | 0.2 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
0.0 | 0.1 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
0.0 | 0.2 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.0 | 0.1 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
0.0 | 0.1 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
0.0 | 0.1 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.0 | 0.5 | GO:0031491 | nucleosome binding(GO:0031491) |
0.0 | 0.1 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
0.0 | 0.3 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.0 | 0.3 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
0.0 | 0.2 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
0.0 | 0.2 | GO:0019789 | SUMO transferase activity(GO:0019789) |
0.0 | 0.1 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
0.0 | 0.3 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.0 | 0.0 | GO:0008271 | secondary active sulfate transmembrane transporter activity(GO:0008271) |
0.0 | 0.4 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
0.0 | 0.0 | GO:0003880 | protein C-terminal carboxyl O-methyltransferase activity(GO:0003880) |
0.0 | 0.1 | GO:0051731 | polynucleotide 5'-hydroxyl-kinase activity(GO:0051731) ATP-dependent polynucleotide kinase activity(GO:0051734) |
0.0 | 0.1 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.0 | 0.2 | GO:0008080 | N-acetyltransferase activity(GO:0008080) |
0.0 | 0.1 | GO:0102345 | 3-hydroxy-behenoyl-CoA dehydratase activity(GO:0102344) 3-hydroxy-lignoceroyl-CoA dehydratase activity(GO:0102345) |
0.0 | 0.1 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.0 | 0.1 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
0.0 | 0.0 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
0.0 | 0.0 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.0 | 0.0 | GO:0097506 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
0.0 | 0.1 | GO:0060590 | ATPase regulator activity(GO:0060590) |
0.0 | 0.4 | GO:0043738 | N-ethylmaleimide reductase activity(GO:0008748) reduced coenzyme F420 dehydrogenase activity(GO:0043738) sulfur oxygenase reductase activity(GO:0043826) malolactic enzyme activity(GO:0043883) epoxyqueuosine reductase activity(GO:0052693) |
0.0 | 0.2 | GO:0008327 | methyl-CpG binding(GO:0008327) |
0.0 | 0.7 | GO:0005254 | chloride channel activity(GO:0005254) |
0.0 | 0.0 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.0 | 0.4 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.0 | 0.0 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.0 | 0.1 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
0.0 | 0.0 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
0.0 | 0.0 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
0.0 | 0.6 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
0.0 | 0.0 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
0.0 | 0.3 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
0.0 | 0.1 | GO:0004065 | arylsulfatase activity(GO:0004065) |
0.0 | 0.0 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
0.0 | 0.1 | GO:0016594 | glycine binding(GO:0016594) |
0.0 | 0.1 | GO:0046625 | sphingolipid binding(GO:0046625) |
0.0 | 0.0 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.0 | 0.0 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
0.0 | 0.3 | GO:0042169 | SH2 domain binding(GO:0042169) |
0.0 | 0.1 | GO:0050700 | CARD domain binding(GO:0050700) |
0.0 | 0.0 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
0.0 | 0.1 | GO:0035254 | glutamate receptor binding(GO:0035254) |
0.0 | 0.0 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
0.0 | 0.1 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
0.0 | 0.0 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
0.0 | 0.0 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) |
0.0 | 0.0 | GO:0046979 | TAP1 binding(GO:0046978) TAP2 binding(GO:0046979) |
0.0 | 0.1 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.0 | 0.1 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.0 | 0.1 | GO:0030332 | cyclin binding(GO:0030332) |
0.0 | 0.3 | GO:0070063 | RNA polymerase binding(GO:0070063) |
0.0 | 0.0 | GO:0002046 | opsin binding(GO:0002046) |
0.0 | 0.1 | GO:0003720 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
0.0 | 0.0 | GO:0016015 | morphogen activity(GO:0016015) |
0.0 | 0.0 | GO:0004376 | glycolipid mannosyltransferase activity(GO:0004376) |
0.0 | 2.5 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.0 | 0.6 | GO:0048306 | calcium-dependent protein binding(GO:0048306) |
0.0 | 0.1 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
0.0 | 1.6 | GO:0008022 | protein C-terminus binding(GO:0008022) |
0.0 | 0.0 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
0.0 | 0.0 | GO:0070052 | collagen V binding(GO:0070052) |
0.0 | 0.0 | GO:0051373 | FATZ binding(GO:0051373) |
0.0 | 0.2 | GO:0005537 | mannose binding(GO:0005537) |
0.0 | 0.1 | GO:0036374 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
0.0 | 0.5 | GO:0005518 | collagen binding(GO:0005518) |
0.0 | 0.2 | GO:0030506 | ankyrin binding(GO:0030506) |
0.0 | 0.0 | GO:0004772 | sterol O-acyltransferase activity(GO:0004772) |
0.0 | 0.0 | GO:0050780 | dopamine receptor binding(GO:0050780) |
0.0 | 2.1 | GO:0008236 | serine-type peptidase activity(GO:0008236) |
0.0 | 0.1 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.0 | 0.1 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
0.0 | 0.0 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
0.0 | 0.1 | GO:0001972 | retinoic acid binding(GO:0001972) |
0.0 | 0.0 | GO:0035877 | death effector domain binding(GO:0035877) |
0.0 | 0.3 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
0.0 | 0.0 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
0.0 | 0.2 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.0 | 0.0 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.0 | 0.0 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
0.0 | 0.1 | GO:0016712 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced flavin or flavoprotein as one donor, and incorporation of one atom of oxygen(GO:0016712) |
0.0 | 0.1 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.0 | 0.7 | GO:0008174 | mRNA methyltransferase activity(GO:0008174) |
0.0 | 0.0 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.0 | 0.1 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 4.6 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.1 | 4.6 | PID IL1 PATHWAY | IL1-mediated signaling events |
0.1 | 1.4 | PID ALK2 PATHWAY | ALK2 signaling events |
0.1 | 1.1 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.1 | 1.0 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
0.1 | 2.5 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.1 | 1.7 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
0.1 | 0.3 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.1 | 0.1 | ST B CELL ANTIGEN RECEPTOR | B Cell Antigen Receptor |
0.1 | 3.1 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
0.1 | 0.3 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
0.1 | 0.2 | PID S1P S1P4 PATHWAY | S1P4 pathway |
0.1 | 1.0 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
0.1 | 0.4 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
0.1 | 0.9 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.1 | 0.7 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.1 | 0.7 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
0.1 | 0.7 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.1 | 2.6 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.1 | 0.2 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
0.1 | 1.3 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
0.1 | 0.6 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.1 | 2.5 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.1 | 0.2 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
0.1 | 0.7 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
0.1 | 1.1 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
0.0 | 1.0 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.0 | 0.2 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
0.0 | 1.2 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
0.0 | 0.4 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.0 | 0.2 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.0 | 0.6 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.0 | 1.6 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
0.0 | 0.1 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.0 | 1.6 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
0.0 | 1.2 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.0 | 0.3 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.0 | 0.1 | ST GAQ PATHWAY | G alpha q Pathway |
0.0 | 1.0 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
0.0 | 0.3 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
0.0 | 1.0 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
0.0 | 0.6 | PID RHOA PATHWAY | RhoA signaling pathway |
0.0 | 0.1 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
0.0 | 0.9 | SIG CHEMOTAXIS | Genes related to chemotaxis |
0.0 | 0.2 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.0 | 0.8 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.0 | 1.2 | PID P73PATHWAY | p73 transcription factor network |
0.0 | 0.4 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
0.0 | 0.0 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.0 | 0.2 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
0.0 | 0.0 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.0 | 0.2 | PID ATR PATHWAY | ATR signaling pathway |
0.0 | 0.4 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.0 | 0.2 | PID FOXO PATHWAY | FoxO family signaling |
0.0 | 0.2 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.0 | 0.1 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.0 | 0.2 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
0.0 | 0.1 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.0 | 0.2 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
0.0 | 0.2 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
0.0 | 0.1 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
0.0 | 0.2 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
0.0 | 0.5 | PID MTOR 4PATHWAY | mTOR signaling pathway |
0.0 | 0.1 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.0 | 0.0 | PID IL5 PATHWAY | IL5-mediated signaling events |
0.0 | 0.1 | PID ALK1 PATHWAY | ALK1 signaling events |
0.0 | 0.1 | ST STAT3 PATHWAY | STAT3 Pathway |
0.0 | 0.3 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
0.0 | 0.1 | PID FGF PATHWAY | FGF signaling pathway |
0.0 | 0.1 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
0.0 | 0.3 | PID LKB1 PATHWAY | LKB1 signaling events |
0.0 | 0.2 | PID EPHA FWDPATHWAY | EPHA forward signaling |
0.0 | 0.6 | WNT SIGNALING | Genes related to Wnt-mediated signal transduction |
0.0 | 0.2 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
0.0 | 0.2 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.0 | 0.2 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
0.0 | 0.0 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.0 | 0.1 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.0 | 0.2 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
0.0 | 0.4 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.0 | 0.1 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
0.0 | 0.1 | PID IL23 PATHWAY | IL23-mediated signaling events |
0.0 | 0.1 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
0.0 | 2.1 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
0.0 | 0.1 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 5.1 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.2 | 1.7 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.2 | 2.6 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.2 | 1.9 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
0.2 | 1.8 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.2 | 1.7 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
0.2 | 1.8 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
0.2 | 1.1 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.1 | 1.6 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
0.1 | 0.3 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
0.1 | 1.5 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.1 | 1.6 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.1 | 0.9 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.1 | 1.6 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
0.1 | 1.8 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.1 | 2.3 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.1 | 0.8 | REACTOME NRIF SIGNALS CELL DEATH FROM THE NUCLEUS | Genes involved in NRIF signals cell death from the nucleus |
0.1 | 1.1 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.1 | 0.6 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
0.1 | 1.8 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
0.1 | 2.4 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.1 | 1.0 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.1 | 0.9 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.1 | 0.3 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
0.1 | 1.5 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
0.1 | 3.2 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
0.1 | 1.1 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
0.1 | 1.4 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
0.1 | 1.0 | REACTOME N GLYCAN TRIMMING IN THE ER AND CALNEXIN CALRETICULIN CYCLE | Genes involved in N-glycan trimming in the ER and Calnexin/Calreticulin cycle |
0.1 | 3.2 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.1 | 1.4 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
0.1 | 0.9 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.1 | 0.8 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.1 | 1.0 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.1 | 0.7 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
0.1 | 0.8 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
0.1 | 0.1 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
0.1 | 0.2 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.1 | 0.2 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
0.1 | 0.5 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
0.1 | 1.7 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
0.1 | 0.3 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
0.1 | 0.5 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.1 | 0.6 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
0.1 | 1.4 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
0.1 | 0.8 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.1 | 0.6 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.1 | 0.4 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.1 | 0.2 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.1 | 0.5 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
0.1 | 0.6 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.0 | 0.6 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
0.0 | 0.3 | REACTOME ENERGY DEPENDENT REGULATION OF MTOR BY LKB1 AMPK | Genes involved in Energy dependent regulation of mTOR by LKB1-AMPK |
0.0 | 0.4 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
0.0 | 0.3 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.0 | 2.0 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.0 | 0.8 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
0.0 | 0.1 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
0.0 | 0.6 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.0 | 0.1 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
0.0 | 0.5 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
0.0 | 0.3 | REACTOME PKB MEDIATED EVENTS | Genes involved in PKB-mediated events |
0.0 | 0.2 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
0.0 | 0.5 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.0 | 0.1 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.0 | 0.5 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
0.0 | 0.2 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.0 | 0.4 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
0.0 | 0.6 | REACTOME RNA POL III CHAIN ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
0.0 | 0.2 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
0.0 | 0.6 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.0 | 0.0 | REACTOME CDK MEDIATED PHOSPHORYLATION AND REMOVAL OF CDC6 | Genes involved in CDK-mediated phosphorylation and removal of Cdc6 |
0.0 | 0.3 | REACTOME FRS2 MEDIATED CASCADE | Genes involved in FRS2-mediated cascade |
0.0 | 1.9 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
0.0 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
0.0 | 0.6 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.0 | 1.5 | REACTOME CELL JUNCTION ORGANIZATION | Genes involved in Cell junction organization |
0.0 | 0.9 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
0.0 | 0.4 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
0.0 | 0.4 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
0.0 | 1.0 | REACTOME MRNA 3 END PROCESSING | Genes involved in mRNA 3'-end processing |
0.0 | 0.3 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
0.0 | 0.6 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
0.0 | 0.7 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.0 | 0.4 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
0.0 | 0.3 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
0.0 | 0.9 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
0.0 | 0.5 | REACTOME CYCLIN E ASSOCIATED EVENTS DURING G1 S TRANSITION | Genes involved in Cyclin E associated events during G1/S transition |
0.0 | 0.5 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
0.0 | 0.2 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
0.0 | 0.3 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
0.0 | 0.2 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
0.0 | 0.1 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
0.0 | 0.3 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.0 | 0.7 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
0.0 | 0.5 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.0 | 0.1 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
0.0 | 0.1 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
0.0 | 0.0 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
0.0 | 0.1 | REACTOME RESOLUTION OF AP SITES VIA THE MULTIPLE NUCLEOTIDE PATCH REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the multiple-nucleotide patch replacement pathway |
0.0 | 0.5 | REACTOME PHASE II CONJUGATION | Genes involved in Phase II conjugation |
0.0 | 0.3 | REACTOME AMYLOIDS | Genes involved in Amyloids |
0.0 | 0.2 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.0 | 0.1 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.0 | 0.2 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
0.0 | 0.3 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
0.0 | 0.6 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
0.0 | 0.4 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
0.0 | 2.7 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
0.0 | 0.3 | REACTOME IL 2 SIGNALING | Genes involved in Interleukin-2 signaling |
0.0 | 0.2 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
0.0 | 0.2 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.0 | 0.2 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
0.0 | 0.4 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
0.0 | 0.2 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.0 | 0.1 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
0.0 | 0.1 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
0.0 | 0.3 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
0.0 | 0.1 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
0.0 | 0.3 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
0.0 | 0.4 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
0.0 | 0.3 | REACTOME RNA POL I RNA POL III AND MITOCHONDRIAL TRANSCRIPTION | Genes involved in RNA Polymerase I, RNA Polymerase III, and Mitochondrial Transcription |
0.0 | 0.3 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
0.0 | 0.1 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
0.0 | 0.0 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
0.0 | 0.5 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
0.0 | 0.1 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
0.0 | 0.9 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
0.0 | 0.1 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.0 | 0.0 | REACTOME P53 DEPENDENT G1 DNA DAMAGE RESPONSE | Genes involved in p53-Dependent G1 DNA Damage Response |
0.0 | 0.2 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
0.0 | 0.0 | REACTOME KINESINS | Genes involved in Kinesins |
0.0 | 0.4 | REACTOME CELL DEATH SIGNALLING VIA NRAGE NRIF AND NADE | Genes involved in Cell death signalling via NRAGE, NRIF and NADE |
0.0 | 0.7 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |