Gene Symbol | Gene ID | Gene Info |
---|---|---|
Snai1
|
ENSMUSG00000042821.7 | Snai1 |
Zeb1
|
ENSMUSG00000024238.7 | Zeb1 |
Snai2
|
ENSMUSG00000022676.6 | Snai2 |
Gene | Promoter | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Snai1 | chr2_167543388_167543573 | 5285 | 0.128911 | -0.79 | 6.0e-02 | Click! |
Snai1 | chr2_167538011_167538171 | 104 | 0.942420 | -0.68 | 1.4e-01 | Click! |
Snai1 | chr2_167544067_167544218 | 5947 | 0.125319 | 0.14 | 7.9e-01 | Click! |
Snai1 | chr2_167537593_167537800 | 499 | 0.672707 | -0.14 | 7.9e-01 | Click! |
Snai1 | chr2_167537356_167537546 | 744 | 0.501112 | -0.05 | 9.2e-01 | Click! |
Snai2 | chr16_14701473_14701636 | 4298 | 0.285473 | 0.98 | 6.4e-04 | Click! |
Snai2 | chr16_14706434_14706585 | 657 | 0.777354 | 0.95 | 4.0e-03 | Click! |
Snai2 | chr16_14708011_14708162 | 2234 | 0.377560 | 0.87 | 2.3e-02 | Click! |
Snai2 | chr16_14707116_14707290 | 1351 | 0.523650 | 0.87 | 2.4e-02 | Click! |
Snai2 | chr16_14706016_14706206 | 259 | 0.942535 | 0.82 | 4.4e-02 | Click! |
Zeb1 | chr18_5600869_5601047 | 2786 | 0.181935 | -0.98 | 4.2e-04 | Click! |
Zeb1 | chr18_5593703_5593861 | 79 | 0.747135 | 0.94 | 5.5e-03 | Click! |
Zeb1 | chr18_5601910_5602113 | 1733 | 0.260354 | 0.92 | 9.7e-03 | Click! |
Zeb1 | chr18_5700478_5700820 | 30432 | 0.185656 | 0.90 | 1.4e-02 | Click! |
Zeb1 | chr18_5597337_5597512 | 3221 | 0.162409 | -0.90 | 1.4e-02 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr16_46463130_46463327 | 8.12 |
Nectin3 |
nectin cell adhesion molecule 3 |
14718 |
0.27 |
chr7_98352590_98353259 | 5.62 |
Tsku |
tsukushi, small leucine rich proteoglycan |
7155 |
0.18 |
chr8_125976536_125976742 | 5.02 |
Kcnk1 |
potassium channel, subfamily K, member 1 |
18531 |
0.19 |
chr18_12716045_12717219 | 4.74 |
Mir1948 |
microRNA 1948 |
1821 |
0.27 |
chr11_120807985_120808259 | 3.85 |
Fasn |
fatty acid synthase |
483 |
0.62 |
chr19_44401904_44402310 | 3.50 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
4583 |
0.17 |
chr2_33370578_33371002 | 3.44 |
Ralgps1 |
Ral GEF with PH domain and SH3 binding motif 1 |
639 |
0.68 |
chr2_31477347_31478122 | 3.07 |
Ass1 |
argininosuccinate synthetase 1 |
7527 |
0.19 |
chr10_79555012_79555447 | 2.92 |
Mier2 |
MIER family member 2 |
30 |
0.96 |
chr11_22372894_22373087 | 2.79 |
Rpsa-ps3 |
ribosomal protein SA, pseudogene 3 |
13302 |
0.21 |
chr1_21267840_21267991 | 2.78 |
Gm28836 |
predicted gene 28836 |
3678 |
0.13 |
chr9_44078514_44078710 | 2.75 |
Usp2 |
ubiquitin specific peptidase 2 |
6327 |
0.07 |
chr9_21837693_21838006 | 2.59 |
Angptl8 |
angiopoietin-like 8 |
2339 |
0.17 |
chr2_32525017_32525309 | 2.59 |
Gm13412 |
predicted gene 13412 |
132 |
0.92 |
chr8_46492911_46493695 | 2.56 |
Acsl1 |
acyl-CoA synthetase long-chain family member 1 |
471 |
0.78 |
chr16_10644168_10644607 | 2.47 |
Clec16a |
C-type lectin domain family 16, member A |
14327 |
0.18 |
chr2_164497738_164498153 | 2.39 |
Pigt |
phosphatidylinositol glycan anchor biosynthesis, class T |
384 |
0.71 |
chr7_131449527_131449705 | 2.37 |
Gm18600 |
predicted gene, 18600 |
7396 |
0.1 |
chr10_81414192_81414360 | 2.37 |
Mir1191b |
microRNA 1191b |
2021 |
0.11 |
chr7_97411671_97412103 | 2.36 |
Thrsp |
thyroid hormone responsive |
5632 |
0.13 |
chr5_125040097_125040498 | 2.26 |
Ncor2 |
nuclear receptor co-repressor 2 |
2515 |
0.25 |
chr6_90568297_90568448 | 2.22 |
Aldh1l1 |
aldehyde dehydrogenase 1 family, member L1 |
666 |
0.63 |
chr2_168080598_168080928 | 2.21 |
Pard6b |
par-6 family cell polarity regulator beta |
241 |
0.9 |
chr11_106249671_106250177 | 2.20 |
Ftsj3 |
FtsJ RNA methyltransferase homolog 3 (E. coli) |
774 |
0.42 |
chr11_60201956_60202762 | 2.11 |
Mir6922 |
microRNA 6922 |
32 |
0.63 |
chr7_99681276_99681427 | 2.10 |
Slco2b1 |
solute carrier organic anion transporter family, member 2b1 |
10418 |
0.1 |
chr5_125522928_125523080 | 2.08 |
Aacs |
acetoacetyl-CoA synthetase |
7761 |
0.16 |
chr12_104346326_104346873 | 2.07 |
Serpina3k |
serine (or cysteine) peptidase inhibitor, clade A, member 3K |
8113 |
0.12 |
chr7_97415349_97415810 | 2.06 |
Thrsp |
thyroid hormone responsive |
1940 |
0.23 |
chr8_10040748_10040899 | 2.02 |
Tnfsf13b |
tumor necrosis factor (ligand) superfamily, member 13b |
9505 |
0.16 |
chr7_66801636_66801787 | 2.02 |
Cers3 |
ceramide synthase 3 |
37542 |
0.13 |
chr1_91458255_91458771 | 2.01 |
Per2 |
period circadian clock 2 |
811 |
0.48 |
chr15_97908200_97908485 | 1.98 |
Vdr |
vitamin D (1,25-dihydroxyvitamin D3) receptor |
32 |
0.98 |
chr5_125524109_125525122 | 1.98 |
Tmem132b |
transmembrane protein 132B |
7159 |
0.16 |
chr11_5899022_5899202 | 1.97 |
Myl7 |
myosin, light polypeptide 7, regulatory |
330 |
0.8 |
chr7_98358819_98359055 | 1.95 |
Tsku |
tsukushi, small leucine rich proteoglycan |
1142 |
0.47 |
chr17_28519046_28519420 | 1.94 |
Gm49861 |
predicted gene, 49861 |
775 |
0.35 |
chr1_132586686_132587343 | 1.94 |
Nfasc |
neurofascin |
126 |
0.97 |
chr9_106785613_106786013 | 1.93 |
Rad54l2 |
RAD54 like 2 (S. cerevisiae) |
3363 |
0.19 |
chr3_144114277_144114432 | 1.93 |
Gm34078 |
predicted gene, 34078 |
21400 |
0.21 |
chr2_31491761_31492352 | 1.91 |
Ass1 |
argininosuccinate synthetase 1 |
5716 |
0.2 |
chr1_21265813_21266032 | 1.90 |
Gm28836 |
predicted gene 28836 |
5671 |
0.11 |
chr17_35896855_35897209 | 1.89 |
2310061I04Rik |
RIKEN cDNA 2310061I04 gene |
41 |
0.52 |
chr7_35754022_35754267 | 1.88 |
Dpy19l3 |
dpy-19-like 3 (C. elegans) |
211 |
0.94 |
chrX_140567606_140567780 | 1.87 |
AL683809.1 |
TSC22 domain family, member 3 (Tsc22d3), pseuodgene |
15906 |
0.17 |
chr1_67207008_67207510 | 1.87 |
Gm15668 |
predicted gene 15668 |
41941 |
0.15 |
chr13_74019761_74019928 | 1.86 |
Gm6263 |
predicted gene 6263 |
290 |
0.84 |
chr5_125061833_125062000 | 1.86 |
Ncor2 |
nuclear receptor co-repressor 2 |
3505 |
0.2 |
chr7_98387155_98387383 | 1.85 |
Tsku |
tsukushi, small leucine rich proteoglycan |
25941 |
0.12 |
chr2_31504934_31505459 | 1.85 |
Ass1 |
argininosuccinate synthetase 1 |
4470 |
0.21 |
chr8_36291368_36291583 | 1.81 |
Lonrf1 |
LON peptidase N-terminal domain and ring finger 1 |
41959 |
0.14 |
chr3_84285532_84285981 | 1.81 |
Trim2 |
tripartite motif-containing 2 |
14965 |
0.24 |
chr2_31501280_31501509 | 1.79 |
Ass1 |
argininosuccinate synthetase 1 |
668 |
0.69 |
chr19_37078496_37078665 | 1.79 |
Gm22714 |
predicted gene, 22714 |
70582 |
0.09 |
chr9_60982764_60983106 | 1.77 |
Gm5122 |
predicted gene 5122 |
30546 |
0.14 |
chr14_14019581_14019753 | 1.77 |
Atxn7 |
ataxin 7 |
6523 |
0.21 |
chr5_119676219_119676536 | 1.76 |
Tbx3 |
T-box 3 |
932 |
0.49 |
chr5_125479434_125479671 | 1.73 |
Gm27551 |
predicted gene, 27551 |
175 |
0.92 |
chr1_74018132_74018325 | 1.73 |
Tns1 |
tensin 1 |
1806 |
0.41 |
chr1_130715772_130716198 | 1.72 |
Pfkfb2 |
6-phosphofructo-2-kinase/fructose-2,6-biphosphatase 2 |
171 |
0.49 |
chr9_41328613_41328764 | 1.70 |
Mir100hg |
Mir100 Mirlet7a-2 Mir125b-1 cluster host gene |
78 |
0.97 |
chr2_70813245_70813396 | 1.70 |
Tlk1 |
tousled-like kinase 1 |
11908 |
0.21 |
chr9_49365685_49366095 | 1.69 |
Drd2 |
dopamine receptor D2 |
25263 |
0.2 |
chr1_51741438_51741641 | 1.68 |
Gm28055 |
predicted gene 28055 |
5404 |
0.23 |
chr13_96749686_96749877 | 1.68 |
Ankrd31 |
ankyrin repeat domain 31 |
1249 |
0.45 |
chr12_16534577_16534728 | 1.67 |
Lpin1 |
lipin 1 |
27386 |
0.22 |
chr11_120819185_120819682 | 1.66 |
Fasn |
fatty acid synthase |
3978 |
0.11 |
chr13_24981001_24981315 | 1.66 |
Mrs2 |
MRS2 magnesium transporter |
13641 |
0.14 |
chr18_12732086_12732318 | 1.66 |
Ttc39c |
tetratricopeptide repeat domain 39C |
2503 |
0.2 |
chr15_3470533_3470724 | 1.66 |
Ghr |
growth hormone receptor |
1016 |
0.68 |
chr17_10401671_10401822 | 1.66 |
A230009B12Rik |
RIKEN cDNA A230009B12 gene |
54470 |
0.13 |
chr3_51254730_51254881 | 1.65 |
Elf2 |
E74-like factor 2 |
5436 |
0.14 |
chr9_30906121_30906748 | 1.63 |
Adamts15 |
a disintegrin-like and metallopeptidase (reprolysin type) with thrombospondin type 1 motif, 15 |
3223 |
0.28 |
chr10_103035015_103035236 | 1.63 |
Gm17028 |
predicted gene 17028 |
4781 |
0.21 |
chrX_75673853_75674412 | 1.62 |
Gm15065 |
predicted gene 15065 |
31277 |
0.13 |
chr9_53301822_53302322 | 1.62 |
Exph5 |
exophilin 5 |
402 |
0.86 |
chr18_10180939_10181448 | 1.62 |
Rock1 |
Rho-associated coiled-coil containing protein kinase 1 |
599 |
0.64 |
chr19_59344610_59345004 | 1.62 |
Pdzd8 |
PDZ domain containing 8 |
973 |
0.48 |
chr1_74970898_74971209 | 1.61 |
Gm37744 |
predicted gene, 37744 |
16801 |
0.11 |
chr9_103211655_103212217 | 1.61 |
Trf |
transferrin |
70 |
0.97 |
chr7_29459356_29459516 | 1.60 |
Sipa1l3 |
signal-induced proliferation-associated 1 like 3 |
46016 |
0.11 |
chr2_26588564_26589214 | 1.60 |
Egfl7 |
EGF-like domain 7 |
346 |
0.71 |
chr12_24680102_24680312 | 1.60 |
Cys1 |
cystin 1 |
260 |
0.89 |
chr1_193231551_193231702 | 1.60 |
Hsd11b1 |
hydroxysteroid 11-beta dehydrogenase 1 |
7397 |
0.11 |
chr18_61911069_61911480 | 1.59 |
Ablim3 |
actin binding LIM protein family, member 3 |
549 |
0.77 |
chr4_135787434_135787634 | 1.58 |
Myom3 |
myomesin family, member 3 |
10656 |
0.14 |
chr5_150583363_150583627 | 1.57 |
N4bp2l1 |
NEDD4 binding protein 2-like 1 |
6504 |
0.09 |
chr7_97788226_97788577 | 1.57 |
Pak1 |
p21 (RAC1) activated kinase 1 |
140 |
0.96 |
chr8_84845741_84846480 | 1.57 |
Calr |
calreticulin |
716 |
0.34 |
chr2_34486208_34486368 | 1.56 |
Mapkap1 |
mitogen-activated protein kinase associated protein 1 |
41941 |
0.13 |
chr17_46019375_46019704 | 1.56 |
Vegfa |
vascular endothelial growth factor A |
1833 |
0.31 |
chr8_93192874_93193058 | 1.56 |
Gm45909 |
predicted gene 45909 |
1608 |
0.28 |
chr3_97637473_97637939 | 1.55 |
Fmo5 |
flavin containing monooxygenase 5 |
8823 |
0.13 |
chr17_56117251_56117740 | 1.55 |
Plin5 |
perilipin 5 |
101 |
0.92 |
chr19_46328692_46329074 | 1.54 |
Fbxl15 |
F-box and leucine-rich repeat protein 15 |
696 |
0.41 |
chr2_112595326_112595515 | 1.53 |
Gm44374 |
predicted gene, 44374 |
18610 |
0.17 |
chr16_91827669_91827852 | 1.53 |
Itsn1 |
intersectin 1 (SH3 domain protein 1A) |
223 |
0.93 |
chr4_53475197_53475646 | 1.53 |
Slc44a1 |
solute carrier family 44, member 1 |
34737 |
0.17 |
chr17_81376267_81376581 | 1.53 |
Gm50044 |
predicted gene, 50044 |
5591 |
0.28 |
chr1_21250942_21251436 | 1.53 |
Gsta3 |
glutathione S-transferase, alpha 3 |
2332 |
0.18 |
chr10_111490645_111490817 | 1.52 |
Nap1l1 |
nucleosome assembly protein 1-like 1 |
114 |
0.95 |
chr4_150572150_150572752 | 1.52 |
Rere |
arginine glutamic acid dipeptide (RE) repeats |
2794 |
0.27 |
chr7_98353281_98353473 | 1.52 |
Tsku |
tsukushi, small leucine rich proteoglycan |
6702 |
0.18 |
chr1_88491899_88492050 | 1.51 |
Glrp1 |
glutamine repeat protein 1 |
18092 |
0.14 |
chr8_70542281_70542550 | 1.51 |
Ell |
elongation factor RNA polymerase II |
2727 |
0.12 |
chr7_119022640_119022791 | 1.50 |
Gprc5b |
G protein-coupled receptor, family C, group 5, member B |
27504 |
0.18 |
chr9_23424090_23424241 | 1.50 |
Bmper |
BMP-binding endothelial regulator |
50233 |
0.19 |
chr11_120815283_120815743 | 1.50 |
Fasn |
fatty acid synthase |
58 |
0.94 |
chr6_119352584_119352747 | 1.50 |
Cacna2d4 |
calcium channel, voltage-dependent, alpha 2/delta subunit 4 |
20103 |
0.17 |
chr4_120681043_120681194 | 1.49 |
Cited4 |
Cbp/p300-interacting transactivator, with Glu/Asp-rich carboxy-terminal domain, 4 |
14546 |
0.14 |
chr8_84712053_84712451 | 1.49 |
Nfix |
nuclear factor I/X |
1816 |
0.2 |
chr4_63563687_63563861 | 1.49 |
Tmem268 |
transmembrane protein 268 |
3414 |
0.14 |
chr2_20583930_20584094 | 1.49 |
Etl4 |
enhancer trap locus 4 |
24077 |
0.25 |
chr6_90544095_90544270 | 1.48 |
Aldh1l1 |
aldehyde dehydrogenase 1 family, member L1 |
6607 |
0.15 |
chr9_44094238_44094412 | 1.48 |
Usp2 |
ubiquitin specific peptidase 2 |
1651 |
0.15 |
chr7_19702718_19703120 | 1.48 |
Tomm40 |
translocase of outer mitochondrial membrane 40 |
221 |
0.82 |
chr2_26609083_26609695 | 1.47 |
Agpat2 |
1-acylglycerol-3-phosphate O-acyltransferase 2 (lysophosphatidic acid acyltransferase, beta) |
4972 |
0.09 |
chr3_97635501_97635936 | 1.47 |
Fmo5 |
flavin containing monooxygenase 5 |
6835 |
0.14 |
chr3_94391090_94391241 | 1.46 |
Lingo4 |
leucine rich repeat and Ig domain containing 4 |
7352 |
0.07 |
chr1_131963604_131963963 | 1.46 |
Slc45a3 |
solute carrier family 45, member 3 |
816 |
0.35 |
chr9_108297063_108297481 | 1.46 |
Amt |
aminomethyltransferase |
350 |
0.72 |
chr15_36899476_36899627 | 1.45 |
Gm10384 |
predicted gene 10384 |
19735 |
0.14 |
chr1_60501628_60501779 | 1.44 |
Raph1 |
Ras association (RalGDS/AF-6) and pleckstrin homology domains 1 |
1562 |
0.34 |
chr11_69098275_69098686 | 1.44 |
Per1 |
period circadian clock 1 |
468 |
0.58 |
chr17_34733622_34734232 | 1.43 |
C4b |
complement component 4B (Chido blood group) |
2172 |
0.12 |
chr4_122960806_122960957 | 1.43 |
Mfsd2a |
major facilitator superfamily domain containing 2A |
271 |
0.63 |
chr12_104342354_104343298 | 1.43 |
Serpina3k |
serine (or cysteine) peptidase inhibitor, clade A, member 3K |
4340 |
0.13 |
chr14_61173133_61173377 | 1.43 |
Sacs |
sacsin |
265 |
0.93 |
chr11_120812894_120813176 | 1.42 |
Fasn |
fatty acid synthase |
2420 |
0.14 |
chr12_40574749_40574900 | 1.42 |
Dock4 |
dedicator of cytokinesis 4 |
128488 |
0.05 |
chrX_13461389_13461908 | 1.41 |
Nyx |
nyctalopin |
4462 |
0.22 |
chr8_109996628_109997116 | 1.41 |
Tat |
tyrosine aminotransferase |
6366 |
0.13 |
chr9_44088184_44088403 | 1.41 |
Usp2 |
ubiquitin specific peptidase 2 |
1103 |
0.24 |
chr17_24857304_24857579 | 1.41 |
Hagh |
hydroxyacyl glutathione hydrolase |
760 |
0.41 |
chr9_103214908_103215592 | 1.41 |
Trf |
transferrin |
3244 |
0.21 |
chr19_3451534_3452133 | 1.41 |
Ppp6r3 |
protein phosphatase 6, regulatory subunit 3 |
19172 |
0.12 |
chr1_182585215_182585532 | 1.41 |
Capn8 |
calpain 8 |
20335 |
0.16 |
chr19_44396138_44396537 | 1.41 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
10353 |
0.14 |
chr1_151325474_151325655 | 1.40 |
Gm10138 |
predicted gene 10138 |
18518 |
0.13 |
chr8_126970574_126970926 | 1.40 |
Rbm34 |
RNA binding motif protein 34 |
299 |
0.87 |
chr2_163551700_163552131 | 1.40 |
Hnf4a |
hepatic nuclear factor 4, alpha |
1832 |
0.25 |
chr15_60824417_60824711 | 1.39 |
9930014A18Rik |
RIKEN cDNA 9930014A18 gene |
223 |
0.76 |
chr11_120985654_120985867 | 1.39 |
Csnk1d |
casein kinase 1, delta |
5111 |
0.11 |
chr9_61366355_61366779 | 1.38 |
Gm10655 |
predicted gene 10655 |
5060 |
0.21 |
chr15_101975276_101975433 | 1.38 |
Krt78 |
keratin 78 |
21067 |
0.09 |
chr5_125526040_125526191 | 1.37 |
Tmem132b |
transmembrane protein 132B |
5659 |
0.17 |
chr12_79452698_79452917 | 1.37 |
Rad51b |
RAD51 paralog B |
125454 |
0.05 |
chr7_72298468_72299026 | 1.37 |
Mctp2 |
multiple C2 domains, transmembrane 2 |
7861 |
0.3 |
chr3_97632897_97633210 | 1.37 |
Fmo5 |
flavin containing monooxygenase 5 |
4170 |
0.16 |
chr1_21255692_21256129 | 1.36 |
Gsta3 |
glutathione S-transferase, alpha 3 |
2389 |
0.17 |
chr3_58685224_58685416 | 1.36 |
Siah2 |
siah E3 ubiquitin protein ligase 2 |
717 |
0.56 |
chr2_32524318_32524490 | 1.36 |
Gm13412 |
predicted gene 13412 |
627 |
0.55 |
chr8_105085399_105085758 | 1.36 |
Ces3b |
carboxylesterase 3B |
1815 |
0.21 |
chr12_32246180_32246331 | 1.36 |
Gm33308 |
predicted gene, 33308 |
4 |
0.98 |
chr18_80294645_80295296 | 1.36 |
Gm37015 |
predicted gene, 37015 |
8710 |
0.13 |
chr1_21248120_21248286 | 1.36 |
Gsta3 |
glutathione S-transferase, alpha 3 |
5318 |
0.12 |
chr8_53511862_53512333 | 1.35 |
Aga |
aspartylglucosaminidase |
299 |
0.9 |
chr16_18074643_18074794 | 1.35 |
Prodh |
proline dehydrogenase |
4504 |
0.15 |
chr8_123805341_123805997 | 1.35 |
Rab4a |
RAB4A, member RAS oncogene family |
316 |
0.79 |
chr1_16271768_16272085 | 1.34 |
Gm7568 |
predicted gene 7568 |
18297 |
0.19 |
chr9_106243206_106243629 | 1.34 |
Alas1 |
aminolevulinic acid synthase 1 |
217 |
0.88 |
chr8_93193292_93193577 | 1.34 |
Gm45909 |
predicted gene 45909 |
2076 |
0.23 |
chr8_105086924_105087135 | 1.34 |
Ces3b |
carboxylesterase 3B |
1590 |
0.23 |
chr11_113195163_113195314 | 1.33 |
2610035D17Rik |
RIKEN cDNA 2610035D17 gene |
6584 |
0.26 |
chr17_70661451_70661755 | 1.33 |
5031415H12Rik |
RIKEN cDNA 5031415H12 gene |
93979 |
0.07 |
chr1_21257119_21257270 | 1.33 |
Gsta3 |
glutathione S-transferase, alpha 3 |
3673 |
0.13 |
chr13_32802244_32802687 | 1.33 |
Wrnip1 |
Werner helicase interacting protein 1 |
349 |
0.49 |
chr5_3599835_3599986 | 1.32 |
Rbm48 |
RNA binding motif protein 48 |
3325 |
0.11 |
chr1_88107647_88108008 | 1.32 |
Ugt1a6b |
UDP glucuronosyltransferase 1 family, polypeptide A6B |
965 |
0.27 |
chr7_98428680_98428844 | 1.32 |
Gm44980 |
predicted gene 44980 |
8757 |
0.12 |
chr17_64644726_64644989 | 1.32 |
Man2a1 |
mannosidase 2, alpha 1 |
44121 |
0.17 |
chr2_155061918_155062357 | 1.32 |
Gm45609 |
predicted gene 45609 |
12044 |
0.13 |
chr14_56617767_56617918 | 1.32 |
Gm16573 |
predicted gene 16573 |
2655 |
0.22 |
chr7_128507149_128507333 | 1.32 |
Gm40457 |
predicted gene, 40457 |
7054 |
0.12 |
chr2_155056753_155056913 | 1.32 |
a |
nonagouti |
9218 |
0.14 |
chr8_83698330_83698690 | 1.32 |
Pkn1 |
protein kinase N1 |
587 |
0.6 |
chr19_44406005_44406525 | 1.32 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
425 |
0.79 |
chr11_90686948_90687471 | 1.32 |
Tom1l1 |
target of myb1-like 1 (chicken) |
370 |
0.89 |
chr7_63922331_63923024 | 1.31 |
Klf13 |
Kruppel-like factor 13 |
2193 |
0.22 |
chr7_63899596_63899952 | 1.31 |
Gm27252 |
predicted gene 27252 |
1800 |
0.28 |
chr1_63112731_63113827 | 1.31 |
Ino80dos |
INO80 complex subunit D, opposite strand |
201 |
0.84 |
chr2_31517245_31517771 | 1.30 |
Ass1 |
argininosuccinate synthetase 1 |
982 |
0.53 |
chr7_39811311_39811540 | 1.30 |
4930558N11Rik |
RIKEN cDNA 4930558N11 gene |
13683 |
0.16 |
chr2_71607777_71607946 | 1.30 |
Dlx2 |
distal-less homeobox 2 |
61107 |
0.09 |
chr1_133138744_133138900 | 1.30 |
Gm26616 |
predicted gene, 26616 |
7040 |
0.16 |
chr6_32392365_32392773 | 1.29 |
Plxna4os2 |
plexin A4, opposite strand 2 |
58601 |
0.14 |
chr4_139111164_139111346 | 1.29 |
Micos10 |
mitochondrial contact site and cristae organizing system subunit 10 |
12 |
0.97 |
chr19_44404842_44405075 | 1.29 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
1732 |
0.29 |
chr12_103991999_103992602 | 1.29 |
Serpina11 |
serine (or cysteine) peptidase inhibitor, clade A (alpha-1 antiproteinase, antitrypsin), member 11 |
2343 |
0.16 |
chr9_106716570_106716901 | 1.29 |
Rad54l2 |
RAD54 like 2 (S. cerevisiae) |
6136 |
0.17 |
chr1_180390300_180390701 | 1.28 |
Gm36933 |
predicted gene, 36933 |
14056 |
0.13 |
chr7_140723099_140723551 | 1.28 |
Olfr542-ps1 |
olfactory receptor 542, pseudogene 1 |
2043 |
0.18 |
chr6_72359339_72359501 | 1.28 |
Rnf181 |
ring finger protein 181 |
1647 |
0.2 |
chr11_120816891_120817395 | 1.27 |
Fasn |
fatty acid synthase |
1688 |
0.2 |
chr2_31521284_31521501 | 1.27 |
Ass1 |
argininosuccinate synthetase 1 |
2902 |
0.23 |
chr11_115905852_115906018 | 1.27 |
Recql5 |
RecQ protein-like 5 |
1318 |
0.24 |
chr3_127005584_127005971 | 1.27 |
Gm25501 |
predicted gene, 25501 |
408 |
0.76 |
chr7_98120366_98120726 | 1.26 |
Myo7a |
myosin VIIA |
1022 |
0.51 |
chr17_43106450_43106764 | 1.26 |
E130008D07Rik |
RIKEN cDNA E130008D07 gene |
51589 |
0.16 |
chr7_19557076_19557476 | 1.26 |
Ppp1r37 |
protein phosphatase 1, regulatory subunit 37 |
5800 |
0.09 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.4 | 7.2 | GO:0010046 | response to mycotoxin(GO:0010046) |
1.2 | 4.7 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
1.1 | 3.2 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
0.9 | 4.3 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
0.8 | 5.0 | GO:0021960 | anterior commissure morphogenesis(GO:0021960) |
0.8 | 3.3 | GO:0070447 | positive regulation of oligodendrocyte progenitor proliferation(GO:0070447) |
0.8 | 3.3 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.8 | 4.0 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
0.8 | 2.4 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
0.8 | 3.2 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
0.8 | 2.3 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
0.7 | 2.2 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
0.6 | 1.9 | GO:0010980 | regulation of vitamin D 24-hydroxylase activity(GO:0010979) positive regulation of vitamin D 24-hydroxylase activity(GO:0010980) |
0.6 | 1.8 | GO:0061535 | glutamate secretion, neurotransmission(GO:0061535) |
0.6 | 1.7 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.6 | 1.1 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
0.5 | 1.6 | GO:0035511 | oxidative DNA demethylation(GO:0035511) |
0.5 | 2.2 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
0.5 | 2.1 | GO:0003383 | apical constriction(GO:0003383) |
0.5 | 2.0 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
0.5 | 2.0 | GO:0071205 | protein localization to juxtaparanode region of axon(GO:0071205) |
0.5 | 3.0 | GO:0090205 | positive regulation of cholesterol biosynthetic process(GO:0045542) positive regulation of cholesterol metabolic process(GO:0090205) |
0.5 | 0.5 | GO:0072361 | regulation of glycolytic process by regulation of transcription from RNA polymerase II promoter(GO:0072361) |
0.5 | 1.9 | GO:0018406 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
0.5 | 1.9 | GO:0070272 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
0.4 | 1.3 | GO:0034287 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
0.4 | 1.3 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
0.4 | 2.1 | GO:0090110 | cargo loading into COPII-coated vesicle(GO:0090110) |
0.4 | 1.3 | GO:0035754 | B cell chemotaxis(GO:0035754) |
0.4 | 2.1 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
0.4 | 1.2 | GO:0015772 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.4 | 2.5 | GO:1903799 | negative regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903799) |
0.4 | 1.2 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
0.4 | 0.8 | GO:0021564 | vagus nerve development(GO:0021564) |
0.4 | 2.0 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
0.4 | 2.8 | GO:0044539 | long-chain fatty acid import(GO:0044539) |
0.4 | 1.6 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
0.4 | 1.2 | GO:0015842 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
0.4 | 1.6 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
0.4 | 1.2 | GO:0097167 | circadian regulation of translation(GO:0097167) |
0.4 | 9.7 | GO:0071353 | cellular response to interleukin-4(GO:0071353) |
0.4 | 1.1 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.4 | 1.1 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
0.4 | 1.1 | GO:0001996 | positive regulation of heart rate by epinephrine-norepinephrine(GO:0001996) |
0.3 | 1.4 | GO:0010510 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
0.3 | 0.3 | GO:0070914 | UV-damage excision repair(GO:0070914) |
0.3 | 1.0 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.3 | 1.4 | GO:0040009 | regulation of growth rate(GO:0040009) |
0.3 | 0.7 | GO:0061724 | lipophagy(GO:0061724) |
0.3 | 1.0 | GO:0031086 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.3 | 1.0 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
0.3 | 1.3 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
0.3 | 1.3 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
0.3 | 2.0 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.3 | 1.3 | GO:1903142 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
0.3 | 1.0 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
0.3 | 1.0 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
0.3 | 0.9 | GO:0060672 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
0.3 | 1.3 | GO:0034080 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
0.3 | 1.9 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
0.3 | 0.9 | GO:0006059 | hexitol metabolic process(GO:0006059) |
0.3 | 0.9 | GO:1900106 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
0.3 | 0.9 | GO:0006172 | ADP biosynthetic process(GO:0006172) |
0.3 | 0.3 | GO:0075509 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
0.3 | 2.1 | GO:0015868 | purine ribonucleotide transport(GO:0015868) |
0.3 | 0.6 | GO:0035459 | cargo loading into vesicle(GO:0035459) |
0.3 | 0.9 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.3 | 1.5 | GO:0060283 | negative regulation of oocyte development(GO:0060283) |
0.3 | 1.2 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
0.3 | 3.5 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.3 | 0.6 | GO:0046098 | guanine metabolic process(GO:0046098) |
0.3 | 1.4 | GO:0070427 | nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070427) |
0.3 | 0.8 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
0.3 | 1.1 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
0.3 | 0.8 | GO:0042524 | negative regulation of tyrosine phosphorylation of Stat5 protein(GO:0042524) |
0.3 | 0.8 | GO:0060931 | sinoatrial node cell development(GO:0060931) |
0.3 | 2.0 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
0.3 | 1.1 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.3 | 1.4 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
0.3 | 0.8 | GO:0060988 | lipid tube assembly(GO:0060988) |
0.3 | 4.1 | GO:0043153 | entrainment of circadian clock by photoperiod(GO:0043153) |
0.3 | 1.4 | GO:0006449 | regulation of translational termination(GO:0006449) |
0.3 | 3.3 | GO:0060856 | establishment of blood-brain barrier(GO:0060856) |
0.3 | 1.4 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
0.3 | 0.5 | GO:0032849 | positive regulation of cellular pH reduction(GO:0032849) |
0.3 | 1.1 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
0.3 | 0.5 | GO:0035973 | aggrephagy(GO:0035973) |
0.3 | 1.6 | GO:0001547 | antral ovarian follicle growth(GO:0001547) |
0.3 | 0.5 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.3 | 0.8 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
0.3 | 1.3 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
0.3 | 1.3 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
0.3 | 2.1 | GO:0046069 | cGMP catabolic process(GO:0046069) |
0.3 | 1.0 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
0.3 | 0.8 | GO:0038086 | VEGF-activated platelet-derived growth factor receptor signaling pathway(GO:0038086) positive regulation of cell proliferation by VEGF-activated platelet derived growth factor receptor signaling pathway(GO:0038091) |
0.3 | 2.8 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.3 | 1.3 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
0.3 | 0.3 | GO:0052472 | modulation by host of viral transcription(GO:0043921) modulation of transcription in other organism involved in symbiotic interaction(GO:0052312) modulation by host of symbiont transcription(GO:0052472) |
0.3 | 0.8 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
0.3 | 0.3 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
0.2 | 0.2 | GO:1904339 | negative regulation of dopaminergic neuron differentiation(GO:1904339) |
0.2 | 0.5 | GO:0060847 | endothelial cell fate specification(GO:0060847) |
0.2 | 0.7 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
0.2 | 1.7 | GO:0002634 | regulation of germinal center formation(GO:0002634) |
0.2 | 0.7 | GO:0042908 | xenobiotic transport(GO:0042908) |
0.2 | 0.5 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.2 | 0.5 | GO:0033122 | negative regulation of purine nucleotide catabolic process(GO:0033122) |
0.2 | 0.5 | GO:0046101 | hypoxanthine metabolic process(GO:0046100) hypoxanthine biosynthetic process(GO:0046101) |
0.2 | 1.0 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
0.2 | 0.2 | GO:2000832 | negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
0.2 | 1.4 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
0.2 | 0.7 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
0.2 | 4.5 | GO:0007020 | microtubule nucleation(GO:0007020) |
0.2 | 1.2 | GO:0015722 | canalicular bile acid transport(GO:0015722) |
0.2 | 0.9 | GO:0003186 | tricuspid valve morphogenesis(GO:0003186) tricuspid valve formation(GO:0003195) |
0.2 | 0.7 | GO:0002254 | kinin cascade(GO:0002254) |
0.2 | 0.9 | GO:0090168 | Golgi reassembly(GO:0090168) |
0.2 | 1.2 | GO:0055091 | phospholipid homeostasis(GO:0055091) |
0.2 | 0.9 | GO:0035627 | ceramide transport(GO:0035627) |
0.2 | 0.7 | GO:0061010 | gall bladder development(GO:0061010) |
0.2 | 0.7 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.2 | 1.1 | GO:0022417 | protein maturation by protein folding(GO:0022417) |
0.2 | 1.6 | GO:0034312 | diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
0.2 | 1.8 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
0.2 | 0.2 | GO:0034310 | primary alcohol catabolic process(GO:0034310) |
0.2 | 0.7 | GO:1904688 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
0.2 | 0.4 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
0.2 | 0.2 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
0.2 | 0.7 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
0.2 | 0.2 | GO:0010982 | regulation of high-density lipoprotein particle clearance(GO:0010982) |
0.2 | 1.3 | GO:0006642 | triglyceride mobilization(GO:0006642) |
0.2 | 0.2 | GO:0009180 | purine nucleoside diphosphate biosynthetic process(GO:0009136) purine ribonucleoside diphosphate biosynthetic process(GO:0009180) |
0.2 | 1.5 | GO:0032959 | inositol trisphosphate biosynthetic process(GO:0032959) |
0.2 | 0.4 | GO:0061643 | chemorepulsion of axon(GO:0061643) |
0.2 | 0.9 | GO:1904469 | positive regulation of tumor necrosis factor secretion(GO:1904469) |
0.2 | 0.4 | GO:0046061 | dATP catabolic process(GO:0046061) |
0.2 | 0.4 | GO:0001834 | trophectodermal cell proliferation(GO:0001834) |
0.2 | 0.6 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
0.2 | 0.6 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
0.2 | 1.1 | GO:0044791 | modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) |
0.2 | 0.4 | GO:1901096 | regulation of autophagosome maturation(GO:1901096) |
0.2 | 0.6 | GO:0090296 | regulation of mitochondrial DNA replication(GO:0090296) |
0.2 | 0.2 | GO:0010536 | positive regulation of activation of Janus kinase activity(GO:0010536) |
0.2 | 1.1 | GO:0060665 | regulation of branching involved in salivary gland morphogenesis by mesenchymal-epithelial signaling(GO:0060665) |
0.2 | 1.1 | GO:0071476 | cellular hypotonic response(GO:0071476) |
0.2 | 0.6 | GO:0010040 | response to iron(II) ion(GO:0010040) |
0.2 | 1.9 | GO:0008343 | adult feeding behavior(GO:0008343) |
0.2 | 1.3 | GO:0086013 | membrane repolarization during cardiac muscle cell action potential(GO:0086013) |
0.2 | 0.6 | GO:0061622 | glycolytic process through glucose-1-phosphate(GO:0061622) |
0.2 | 0.4 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
0.2 | 0.6 | GO:0045297 | mating plug formation(GO:0042628) post-mating behavior(GO:0045297) |
0.2 | 0.4 | GO:0010820 | positive regulation of T cell chemotaxis(GO:0010820) |
0.2 | 0.6 | GO:0019747 | regulation of isoprenoid metabolic process(GO:0019747) |
0.2 | 0.4 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
0.2 | 0.2 | GO:2000617 | positive regulation of histone H3-K9 acetylation(GO:2000617) |
0.2 | 0.2 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
0.2 | 0.2 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
0.2 | 1.2 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
0.2 | 0.6 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
0.2 | 1.0 | GO:0048069 | eye pigmentation(GO:0048069) |
0.2 | 1.0 | GO:1902255 | positive regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902255) |
0.2 | 0.6 | GO:0021699 | cerebellar cortex maturation(GO:0021699) |
0.2 | 0.2 | GO:0032741 | positive regulation of interleukin-18 production(GO:0032741) |
0.2 | 0.6 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
0.2 | 1.2 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
0.2 | 0.4 | GO:0000965 | mitochondrial RNA 3'-end processing(GO:0000965) |
0.2 | 0.6 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.2 | 0.4 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
0.2 | 0.4 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.2 | 0.6 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
0.2 | 0.8 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
0.2 | 1.2 | GO:0006477 | protein sulfation(GO:0006477) |
0.2 | 0.6 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
0.2 | 1.0 | GO:0014894 | response to inactivity(GO:0014854) response to muscle inactivity(GO:0014870) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
0.2 | 0.4 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
0.2 | 0.8 | GO:0090156 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) |
0.2 | 0.6 | GO:0006068 | ethanol catabolic process(GO:0006068) |
0.2 | 0.4 | GO:1902047 | polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) |
0.2 | 0.9 | GO:0009438 | methylglyoxal metabolic process(GO:0009438) |
0.2 | 1.5 | GO:0042795 | snRNA transcription from RNA polymerase II promoter(GO:0042795) |
0.2 | 1.3 | GO:0035280 | miRNA loading onto RISC involved in gene silencing by miRNA(GO:0035280) |
0.2 | 1.5 | GO:0015824 | proline transport(GO:0015824) |
0.2 | 0.2 | GO:2000670 | positive regulation of dendritic cell apoptotic process(GO:2000670) |
0.2 | 0.7 | GO:0006549 | isoleucine metabolic process(GO:0006549) |
0.2 | 0.4 | GO:0042518 | negative regulation of tyrosine phosphorylation of Stat3 protein(GO:0042518) |
0.2 | 0.6 | GO:0021912 | regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) |
0.2 | 0.5 | GO:0019478 | D-amino acid catabolic process(GO:0019478) |
0.2 | 0.5 | GO:0009698 | phenylpropanoid metabolic process(GO:0009698) phenylpropanoid catabolic process(GO:0046271) |
0.2 | 0.4 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
0.2 | 0.5 | GO:0000478 | endonucleolytic cleavage involved in rRNA processing(GO:0000478) |
0.2 | 0.4 | GO:0035790 | platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
0.2 | 1.1 | GO:0036089 | cleavage furrow formation(GO:0036089) |
0.2 | 0.5 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
0.2 | 0.7 | GO:0043097 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
0.2 | 0.9 | GO:0061042 | vascular wound healing(GO:0061042) |
0.2 | 1.1 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
0.2 | 0.9 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
0.2 | 0.2 | GO:0061419 | positive regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061419) |
0.2 | 0.5 | GO:0006562 | proline catabolic process(GO:0006562) |
0.2 | 0.9 | GO:0090166 | Golgi disassembly(GO:0090166) |
0.2 | 0.4 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
0.2 | 0.5 | GO:1903599 | positive regulation of mitophagy(GO:1903599) |
0.2 | 0.9 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
0.2 | 0.2 | GO:0010519 | negative regulation of phospholipase activity(GO:0010519) |
0.2 | 0.7 | GO:0071681 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
0.2 | 0.3 | GO:0045963 | negative regulation of catecholamine metabolic process(GO:0045914) negative regulation of dopamine metabolic process(GO:0045963) |
0.2 | 0.9 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
0.2 | 0.7 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
0.2 | 0.5 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
0.2 | 0.3 | GO:0038027 | apolipoprotein A-I-mediated signaling pathway(GO:0038027) |
0.2 | 0.3 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
0.2 | 0.5 | GO:0007529 | establishment of synaptic specificity at neuromuscular junction(GO:0007529) |
0.2 | 0.3 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
0.2 | 0.5 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.2 | 2.4 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.2 | 0.8 | GO:0033133 | positive regulation of glucokinase activity(GO:0033133) |
0.2 | 0.7 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
0.2 | 0.2 | GO:0019064 | fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
0.2 | 1.2 | GO:0035999 | tetrahydrofolate interconversion(GO:0035999) |
0.2 | 0.8 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.2 | 0.3 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.2 | 0.5 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
0.2 | 0.2 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.2 | 0.3 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) |
0.2 | 0.5 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
0.2 | 0.5 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
0.2 | 0.5 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
0.2 | 0.7 | GO:0033015 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) |
0.2 | 0.3 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
0.2 | 0.2 | GO:0009138 | pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
0.2 | 0.8 | GO:0019087 | transformation of host cell by virus(GO:0019087) |
0.2 | 0.8 | GO:0009181 | purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
0.2 | 0.6 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
0.2 | 0.5 | GO:2000836 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
0.2 | 0.5 | GO:0090427 | activation of meiosis(GO:0090427) |
0.2 | 1.0 | GO:0048341 | paraxial mesoderm formation(GO:0048341) |
0.2 | 0.2 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
0.2 | 0.5 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.2 | 0.3 | GO:0060331 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
0.2 | 0.5 | GO:2000646 | positive regulation of receptor catabolic process(GO:2000646) |
0.2 | 0.5 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
0.2 | 0.6 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
0.2 | 0.3 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
0.2 | 0.6 | GO:0045950 | negative regulation of mitotic recombination(GO:0045950) |
0.2 | 1.0 | GO:0048537 | mucosal-associated lymphoid tissue development(GO:0048537) Peyer's patch development(GO:0048541) |
0.2 | 0.3 | GO:0032484 | Ral protein signal transduction(GO:0032484) |
0.2 | 0.2 | GO:0040038 | polar body extrusion after meiotic divisions(GO:0040038) |
0.2 | 0.5 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
0.2 | 0.6 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
0.2 | 0.5 | GO:0033762 | response to glucagon(GO:0033762) |
0.2 | 0.5 | GO:0006013 | mannose metabolic process(GO:0006013) |
0.2 | 0.5 | GO:1900045 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
0.2 | 0.3 | GO:0046391 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
0.2 | 0.2 | GO:0021943 | formation of radial glial scaffolds(GO:0021943) |
0.2 | 0.3 | GO:0042117 | monocyte activation(GO:0042117) |
0.2 | 0.8 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.2 | 0.9 | GO:1902414 | protein localization to cell junction(GO:1902414) |
0.2 | 0.6 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
0.2 | 0.2 | GO:0006842 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.2 | 0.3 | GO:0010757 | negative regulation of plasminogen activation(GO:0010757) |
0.2 | 0.5 | GO:0045415 | negative regulation of interleukin-8 biosynthetic process(GO:0045415) |
0.2 | 0.5 | GO:0002924 | negative regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002924) |
0.2 | 0.6 | GO:0015691 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
0.2 | 0.5 | GO:0002069 | columnar/cuboidal epithelial cell maturation(GO:0002069) glandular epithelial cell maturation(GO:0002071) |
0.2 | 0.5 | GO:0021882 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) |
0.2 | 0.5 | GO:0010482 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
0.2 | 4.1 | GO:0070542 | response to fatty acid(GO:0070542) |
0.1 | 0.6 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
0.1 | 0.4 | GO:0097011 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) |
0.1 | 0.6 | GO:0045906 | negative regulation of vasoconstriction(GO:0045906) |
0.1 | 0.4 | GO:0042525 | tyrosine phosphorylation of Stat6 protein(GO:0042505) regulation of tyrosine phosphorylation of Stat6 protein(GO:0042525) |
0.1 | 0.6 | GO:0031999 | negative regulation of fatty acid beta-oxidation(GO:0031999) |
0.1 | 0.4 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
0.1 | 0.6 | GO:0010587 | miRNA catabolic process(GO:0010587) |
0.1 | 0.6 | GO:0071442 | positive regulation of histone H3-K14 acetylation(GO:0071442) |
0.1 | 0.6 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
0.1 | 1.9 | GO:0031167 | rRNA methylation(GO:0031167) |
0.1 | 1.6 | GO:0060088 | auditory receptor cell stereocilium organization(GO:0060088) |
0.1 | 0.6 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
0.1 | 0.4 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.1 | 0.6 | GO:0044038 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) |
0.1 | 0.4 | GO:0000087 | mitotic M phase(GO:0000087) |
0.1 | 1.0 | GO:0034088 | maintenance of sister chromatid cohesion(GO:0034086) maintenance of mitotic sister chromatid cohesion(GO:0034088) |
0.1 | 0.7 | GO:1902774 | late endosome to lysosome transport(GO:1902774) |
0.1 | 1.0 | GO:0021894 | cerebral cortex GABAergic interneuron development(GO:0021894) |
0.1 | 0.4 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
0.1 | 0.3 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
0.1 | 1.1 | GO:0006517 | protein deglycosylation(GO:0006517) |
0.1 | 1.1 | GO:0043144 | snoRNA processing(GO:0043144) |
0.1 | 0.1 | GO:0060051 | negative regulation of protein glycosylation(GO:0060051) |
0.1 | 0.1 | GO:0038109 | response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
0.1 | 0.4 | GO:0044597 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.1 | 0.4 | GO:0001998 | angiotensin mediated vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001998) |
0.1 | 0.4 | GO:0032304 | negative regulation of icosanoid secretion(GO:0032304) |
0.1 | 0.4 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
0.1 | 0.4 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
0.1 | 0.6 | GO:0051136 | regulation of NK T cell differentiation(GO:0051136) positive regulation of NK T cell differentiation(GO:0051138) |
0.1 | 0.3 | GO:1902302 | regulation of potassium ion export(GO:1902302) |
0.1 | 0.3 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
0.1 | 0.1 | GO:0090611 | ubiquitin-independent protein catabolic process via the multivesicular body sorting pathway(GO:0090611) |
0.1 | 0.4 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
0.1 | 0.4 | GO:0061684 | chaperone-mediated autophagy(GO:0061684) |
0.1 | 0.5 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
0.1 | 0.5 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
0.1 | 1.6 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
0.1 | 0.9 | GO:0035095 | behavioral response to nicotine(GO:0035095) |
0.1 | 1.2 | GO:0010826 | negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
0.1 | 0.3 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
0.1 | 0.1 | GO:0060921 | sinoatrial node cell differentiation(GO:0060921) |
0.1 | 0.9 | GO:0036315 | cellular response to sterol(GO:0036315) |
0.1 | 0.4 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.1 | 0.1 | GO:0033092 | positive regulation of immature T cell proliferation(GO:0033091) positive regulation of immature T cell proliferation in thymus(GO:0033092) |
0.1 | 0.4 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
0.1 | 0.3 | GO:0050427 | 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
0.1 | 2.2 | GO:0006783 | heme biosynthetic process(GO:0006783) |
0.1 | 0.1 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
0.1 | 0.1 | GO:0030578 | PML body organization(GO:0030578) |
0.1 | 0.4 | GO:1990168 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
0.1 | 0.4 | GO:0071233 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
0.1 | 0.4 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.1 | 0.4 | GO:0021826 | substrate-independent telencephalic tangential migration(GO:0021826) substrate-independent telencephalic tangential interneuron migration(GO:0021843) |
0.1 | 0.7 | GO:0072488 | ammonium transmembrane transport(GO:0072488) |
0.1 | 0.6 | GO:0015871 | choline transport(GO:0015871) |
0.1 | 0.9 | GO:0060055 | angiogenesis involved in wound healing(GO:0060055) |
0.1 | 0.3 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
0.1 | 1.2 | GO:0006337 | nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
0.1 | 0.5 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
0.1 | 0.5 | GO:0032237 | activation of store-operated calcium channel activity(GO:0032237) |
0.1 | 0.3 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
0.1 | 0.8 | GO:0000459 | exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) |
0.1 | 0.3 | GO:0016095 | polyprenol catabolic process(GO:0016095) |
0.1 | 1.3 | GO:2000757 | negative regulation of protein acetylation(GO:1901984) negative regulation of peptidyl-lysine acetylation(GO:2000757) |
0.1 | 2.1 | GO:0017144 | drug metabolic process(GO:0017144) |
0.1 | 0.3 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
0.1 | 0.9 | GO:0042759 | long-chain fatty acid biosynthetic process(GO:0042759) |
0.1 | 0.6 | GO:0098597 | observational learning(GO:0098597) |
0.1 | 0.4 | GO:0030046 | parallel actin filament bundle assembly(GO:0030046) |
0.1 | 0.7 | GO:0098734 | protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
0.1 | 0.4 | GO:0023041 | neuronal signal transduction(GO:0023041) |
0.1 | 0.7 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.1 | 0.5 | GO:0045714 | low-density lipoprotein particle receptor biosynthetic process(GO:0045713) regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045714) |
0.1 | 0.4 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) |
0.1 | 0.6 | GO:0051799 | negative regulation of hair follicle development(GO:0051799) |
0.1 | 0.2 | GO:2000425 | regulation of apoptotic cell clearance(GO:2000425) |
0.1 | 0.1 | GO:0051140 | regulation of NK T cell proliferation(GO:0051140) positive regulation of NK T cell proliferation(GO:0051142) |
0.1 | 0.5 | GO:0042701 | progesterone secretion(GO:0042701) |
0.1 | 0.5 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.1 | 0.5 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.1 | 0.6 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
0.1 | 0.1 | GO:2000409 | positive regulation of T cell extravasation(GO:2000409) |
0.1 | 0.4 | GO:0060907 | positive regulation of macrophage cytokine production(GO:0060907) |
0.1 | 0.4 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
0.1 | 0.1 | GO:0051409 | response to nitrosative stress(GO:0051409) |
0.1 | 0.6 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
0.1 | 0.2 | GO:0030576 | Cajal body organization(GO:0030576) |
0.1 | 0.5 | GO:1901970 | positive regulation of mitotic sister chromatid separation(GO:1901970) |
0.1 | 0.4 | GO:0090209 | negative regulation of triglyceride metabolic process(GO:0090209) |
0.1 | 0.5 | GO:1900736 | regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900736) |
0.1 | 0.1 | GO:2000173 | negative regulation of branching morphogenesis of a nerve(GO:2000173) |
0.1 | 0.5 | GO:0071494 | cellular response to UV-C(GO:0071494) |
0.1 | 0.1 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
0.1 | 0.4 | GO:0032971 | regulation of muscle filament sliding(GO:0032971) |
0.1 | 0.6 | GO:0061418 | regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061418) |
0.1 | 0.3 | GO:0043313 | regulation of neutrophil degranulation(GO:0043313) |
0.1 | 0.1 | GO:0042159 | lipoprotein catabolic process(GO:0042159) |
0.1 | 0.7 | GO:0042447 | hormone catabolic process(GO:0042447) |
0.1 | 0.3 | GO:0032439 | endosome localization(GO:0032439) |
0.1 | 0.3 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
0.1 | 0.3 | GO:0046208 | spermine catabolic process(GO:0046208) |
0.1 | 0.2 | GO:0032383 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
0.1 | 0.3 | GO:0048102 | autophagic cell death(GO:0048102) |
0.1 | 0.1 | GO:1904193 | cholangiocyte apoptotic process(GO:1902488) regulation of cholangiocyte apoptotic process(GO:1904192) negative regulation of cholangiocyte apoptotic process(GO:1904193) |
0.1 | 2.3 | GO:0046677 | response to antibiotic(GO:0046677) |
0.1 | 1.5 | GO:0001516 | prostaglandin biosynthetic process(GO:0001516) prostanoid biosynthetic process(GO:0046457) |
0.1 | 0.5 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
0.1 | 0.3 | GO:0045897 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
0.1 | 1.0 | GO:0002115 | store-operated calcium entry(GO:0002115) |
0.1 | 0.6 | GO:0052205 | modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) |
0.1 | 1.9 | GO:0043949 | regulation of cAMP-mediated signaling(GO:0043949) |
0.1 | 0.2 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
0.1 | 0.8 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
0.1 | 0.2 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
0.1 | 0.3 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
0.1 | 0.1 | GO:0006222 | UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
0.1 | 0.2 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
0.1 | 1.1 | GO:0071577 | zinc II ion transmembrane transport(GO:0071577) |
0.1 | 0.2 | GO:0002091 | negative regulation of receptor internalization(GO:0002091) |
0.1 | 1.5 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
0.1 | 0.3 | GO:0072318 | clathrin coat disassembly(GO:0072318) |
0.1 | 0.1 | GO:0045836 | positive regulation of meiotic nuclear division(GO:0045836) |
0.1 | 0.3 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
0.1 | 3.8 | GO:0061077 | chaperone-mediated protein folding(GO:0061077) |
0.1 | 1.0 | GO:0002566 | somatic diversification of immune receptors via somatic mutation(GO:0002566) somatic hypermutation of immunoglobulin genes(GO:0016446) |
0.1 | 0.1 | GO:0009188 | ribonucleoside diphosphate biosynthetic process(GO:0009188) |
0.1 | 0.5 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
0.1 | 1.0 | GO:0032211 | negative regulation of telomere maintenance via telomerase(GO:0032211) |
0.1 | 0.2 | GO:0046477 | glycosylceramide catabolic process(GO:0046477) |
0.1 | 0.1 | GO:0060633 | negative regulation of transcription initiation from RNA polymerase II promoter(GO:0060633) negative regulation of DNA-templated transcription, initiation(GO:2000143) |
0.1 | 0.4 | GO:0009838 | abscission(GO:0009838) |
0.1 | 0.2 | GO:0045060 | negative thymic T cell selection(GO:0045060) |
0.1 | 1.3 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
0.1 | 0.2 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
0.1 | 0.6 | GO:0007000 | nucleolus organization(GO:0007000) |
0.1 | 0.3 | GO:0044857 | plasma membrane raft assembly(GO:0044854) plasma membrane raft organization(GO:0044857) |
0.1 | 0.2 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) |
0.1 | 0.2 | GO:0007199 | G-protein coupled receptor signaling pathway coupled to cGMP nucleotide second messenger(GO:0007199) |
0.1 | 0.6 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
0.1 | 0.4 | GO:0070572 | positive regulation of neuron projection regeneration(GO:0070572) |
0.1 | 0.2 | GO:0033683 | nucleotide-excision repair, DNA incision(GO:0033683) |
0.1 | 0.5 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.1 | 0.2 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
0.1 | 0.6 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
0.1 | 0.4 | GO:0071638 | negative regulation of monocyte chemotactic protein-1 production(GO:0071638) |
0.1 | 0.2 | GO:0036166 | phenotypic switching(GO:0036166) |
0.1 | 0.1 | GO:0014874 | response to stimulus involved in regulation of muscle adaptation(GO:0014874) |
0.1 | 0.3 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
0.1 | 0.9 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
0.1 | 0.1 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
0.1 | 0.5 | GO:2000288 | positive regulation of myoblast proliferation(GO:2000288) |
0.1 | 3.3 | GO:0008088 | axo-dendritic transport(GO:0008088) |
0.1 | 0.1 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
0.1 | 1.0 | GO:0009226 | nucleotide-sugar biosynthetic process(GO:0009226) |
0.1 | 1.0 | GO:0006030 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
0.1 | 0.7 | GO:0042026 | protein refolding(GO:0042026) |
0.1 | 0.7 | GO:2000780 | negative regulation of double-strand break repair(GO:2000780) |
0.1 | 0.4 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
0.1 | 0.3 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
0.1 | 0.2 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
0.1 | 0.3 | GO:0019086 | late viral transcription(GO:0019086) |
0.1 | 0.2 | GO:0060279 | regulation of ovulation(GO:0060278) positive regulation of ovulation(GO:0060279) |
0.1 | 0.3 | GO:0014043 | negative regulation of neuron maturation(GO:0014043) |
0.1 | 0.5 | GO:0070932 | histone H3 deacetylation(GO:0070932) |
0.1 | 0.2 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
0.1 | 0.1 | GO:0006290 | pyrimidine dimer repair(GO:0006290) |
0.1 | 0.3 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
0.1 | 0.3 | GO:1903912 | negative regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:1903912) |
0.1 | 0.6 | GO:0046543 | development of secondary female sexual characteristics(GO:0046543) |
0.1 | 0.7 | GO:0048194 | Golgi vesicle budding(GO:0048194) |
0.1 | 0.5 | GO:0035357 | peroxisome proliferator activated receptor signaling pathway(GO:0035357) |
0.1 | 0.4 | GO:0007296 | vitellogenesis(GO:0007296) |
0.1 | 0.2 | GO:0014732 | skeletal muscle atrophy(GO:0014732) |
0.1 | 0.2 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
0.1 | 0.4 | GO:0071372 | response to follicle-stimulating hormone(GO:0032354) cellular response to follicle-stimulating hormone stimulus(GO:0071372) |
0.1 | 0.3 | GO:1905065 | positive regulation of vascular smooth muscle cell differentiation(GO:1905065) |
0.1 | 0.5 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.1 | 0.6 | GO:0043102 | amino acid salvage(GO:0043102) L-methionine biosynthetic process(GO:0071265) L-methionine salvage(GO:0071267) |
0.1 | 0.1 | GO:2000643 | positive regulation of early endosome to late endosome transport(GO:2000643) |
0.1 | 0.7 | GO:1901673 | regulation of mitotic spindle assembly(GO:1901673) |
0.1 | 0.4 | GO:0032819 | positive regulation of natural killer cell proliferation(GO:0032819) |
0.1 | 0.7 | GO:0018095 | protein polyglutamylation(GO:0018095) |
0.1 | 0.3 | GO:0097070 | ductus arteriosus closure(GO:0097070) |
0.1 | 0.1 | GO:0007262 | STAT protein import into nucleus(GO:0007262) |
0.1 | 0.5 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
0.1 | 0.4 | GO:0002467 | germinal center formation(GO:0002467) |
0.1 | 0.1 | GO:0050975 | sensory perception of touch(GO:0050975) |
0.1 | 1.0 | GO:0046548 | retinal rod cell development(GO:0046548) |
0.1 | 0.9 | GO:0045003 | DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
0.1 | 0.1 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
0.1 | 0.5 | GO:0070995 | NADPH oxidation(GO:0070995) |
0.1 | 0.2 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
0.1 | 0.7 | GO:0033169 | histone H3-K9 demethylation(GO:0033169) |
0.1 | 0.6 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
0.1 | 0.2 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
0.1 | 0.4 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
0.1 | 0.2 | GO:1902966 | regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
0.1 | 0.1 | GO:0046084 | adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
0.1 | 0.1 | GO:0014834 | skeletal muscle satellite cell maintenance involved in skeletal muscle regeneration(GO:0014834) |
0.1 | 0.3 | GO:0006336 | DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
0.1 | 0.3 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
0.1 | 0.3 | GO:0072366 | regulation of cellular ketone metabolic process by positive regulation of transcription from RNA polymerase II promoter(GO:0072366) |
0.1 | 0.2 | GO:0061051 | positive regulation of cell growth involved in cardiac muscle cell development(GO:0061051) |
0.1 | 0.4 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
0.1 | 0.5 | GO:0032725 | positive regulation of granulocyte macrophage colony-stimulating factor production(GO:0032725) |
0.1 | 0.4 | GO:0090085 | regulation of protein deubiquitination(GO:0090085) |
0.1 | 0.1 | GO:0021530 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
0.1 | 0.2 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
0.1 | 1.5 | GO:0007099 | centriole replication(GO:0007099) |
0.1 | 0.4 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
0.1 | 0.6 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
0.1 | 0.1 | GO:1902075 | cellular response to salt(GO:1902075) |
0.1 | 0.8 | GO:0006020 | inositol metabolic process(GO:0006020) |
0.1 | 0.2 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
0.1 | 0.3 | GO:0060510 | Type II pneumocyte differentiation(GO:0060510) |
0.1 | 0.1 | GO:0042762 | regulation of sulfur metabolic process(GO:0042762) |
0.1 | 0.2 | GO:0090148 | membrane fission(GO:0090148) |
0.1 | 0.4 | GO:0030259 | lipid glycosylation(GO:0030259) |
0.1 | 0.4 | GO:0090188 | negative regulation of pancreatic juice secretion(GO:0090188) |
0.1 | 0.3 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
0.1 | 0.3 | GO:0016093 | polyprenol metabolic process(GO:0016093) |
0.1 | 0.3 | GO:0009133 | nucleoside diphosphate biosynthetic process(GO:0009133) |
0.1 | 0.4 | GO:0031034 | myosin filament assembly(GO:0031034) |
0.1 | 0.7 | GO:0038093 | Fc receptor signaling pathway(GO:0038093) |
0.1 | 1.2 | GO:0032011 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.1 | 0.3 | GO:0030035 | microspike assembly(GO:0030035) |
0.1 | 0.3 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
0.1 | 0.1 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
0.1 | 0.4 | GO:0042448 | progesterone metabolic process(GO:0042448) |
0.1 | 0.5 | GO:0002072 | optic cup morphogenesis involved in camera-type eye development(GO:0002072) |
0.1 | 0.2 | GO:0070340 | detection of bacterial lipopeptide(GO:0070340) |
0.1 | 0.5 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
0.1 | 0.3 | GO:0046909 | intermembrane transport(GO:0046909) |
0.1 | 0.1 | GO:0018214 | protein carboxylation(GO:0018214) |
0.1 | 0.3 | GO:0006678 | glucosylceramide metabolic process(GO:0006678) |
0.1 | 0.3 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
0.1 | 0.3 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
0.1 | 0.5 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
0.1 | 0.5 | GO:0030859 | polarized epithelial cell differentiation(GO:0030859) |
0.1 | 0.3 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.1 | 0.3 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
0.1 | 0.9 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
0.1 | 0.3 | GO:0019042 | viral latency(GO:0019042) |
0.1 | 0.6 | GO:0006622 | protein targeting to lysosome(GO:0006622) |
0.1 | 0.7 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
0.1 | 0.8 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
0.1 | 0.1 | GO:0072553 | terminal button organization(GO:0072553) |
0.1 | 0.1 | GO:0042364 | water-soluble vitamin biosynthetic process(GO:0042364) |
0.1 | 0.4 | GO:0090308 | regulation of methylation-dependent chromatin silencing(GO:0090308) |
0.1 | 0.3 | GO:0022038 | corpus callosum development(GO:0022038) |
0.1 | 1.1 | GO:0045116 | protein neddylation(GO:0045116) |
0.1 | 0.2 | GO:0006553 | lysine metabolic process(GO:0006553) |
0.1 | 0.2 | GO:1904528 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
0.1 | 0.2 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
0.1 | 0.1 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
0.1 | 0.2 | GO:0090239 | regulation of histone H4 acetylation(GO:0090239) |
0.1 | 0.2 | GO:0051795 | regulation of catagen(GO:0051794) positive regulation of catagen(GO:0051795) |
0.1 | 0.2 | GO:0090370 | negative regulation of cholesterol efflux(GO:0090370) |
0.1 | 0.2 | GO:1903224 | regulation of endodermal cell differentiation(GO:1903224) |
0.1 | 0.4 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
0.1 | 0.2 | GO:0006655 | phosphatidylglycerol biosynthetic process(GO:0006655) |
0.1 | 0.2 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
0.1 | 0.4 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
0.1 | 0.5 | GO:0046473 | phosphatidic acid metabolic process(GO:0046473) |
0.1 | 0.5 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
0.1 | 1.4 | GO:0046834 | lipid phosphorylation(GO:0046834) |
0.1 | 0.1 | GO:0021523 | somatic motor neuron differentiation(GO:0021523) |
0.1 | 0.1 | GO:0097107 | postsynaptic density organization(GO:0097106) postsynaptic density assembly(GO:0097107) |
0.1 | 0.1 | GO:0090051 | negative regulation of cell migration involved in sprouting angiogenesis(GO:0090051) |
0.1 | 0.2 | GO:1903347 | negative regulation of bicellular tight junction assembly(GO:1903347) |
0.1 | 0.6 | GO:0042659 | regulation of cell fate specification(GO:0042659) |
0.1 | 0.4 | GO:0001553 | luteinization(GO:0001553) |
0.1 | 0.2 | GO:0046104 | thymidine metabolic process(GO:0046104) pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
0.1 | 0.2 | GO:1904058 | positive regulation of sensory perception of pain(GO:1904058) |
0.1 | 0.5 | GO:2000674 | regulation of type B pancreatic cell apoptotic process(GO:2000674) negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
0.1 | 0.2 | GO:0006707 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
0.1 | 0.2 | GO:0019530 | taurine metabolic process(GO:0019530) |
0.1 | 0.9 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
0.1 | 0.9 | GO:2000060 | positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
0.1 | 0.5 | GO:0042983 | amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
0.1 | 0.2 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
0.1 | 0.6 | GO:0060546 | negative regulation of necroptotic process(GO:0060546) |
0.1 | 0.2 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
0.1 | 0.2 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
0.1 | 0.2 | GO:1902990 | telomere maintenance via semi-conservative replication(GO:0032201) mitotic telomere maintenance via semi-conservative replication(GO:1902990) |
0.1 | 1.3 | GO:0060325 | face morphogenesis(GO:0060325) |
0.1 | 0.7 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
0.1 | 0.2 | GO:0071034 | CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
0.1 | 0.2 | GO:0032788 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
0.1 | 0.6 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
0.1 | 0.3 | GO:0042754 | negative regulation of circadian rhythm(GO:0042754) |
0.1 | 0.4 | GO:0051654 | establishment of mitochondrion localization(GO:0051654) |
0.1 | 0.9 | GO:0044065 | regulation of respiratory system process(GO:0044065) |
0.1 | 0.2 | GO:0002215 | defense response to nematode(GO:0002215) |
0.1 | 0.2 | GO:0006706 | steroid catabolic process(GO:0006706) |
0.1 | 0.2 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
0.1 | 0.2 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.1 | 0.8 | GO:1903206 | negative regulation of hydrogen peroxide-induced cell death(GO:1903206) |
0.1 | 0.5 | GO:0009396 | folic acid-containing compound biosynthetic process(GO:0009396) |
0.1 | 0.6 | GO:0090162 | establishment of epithelial cell polarity(GO:0090162) |
0.1 | 0.1 | GO:0018243 | protein O-linked glycosylation via threonine(GO:0018243) |
0.1 | 0.1 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
0.1 | 0.2 | GO:0072718 | response to cisplatin(GO:0072718) |
0.1 | 0.2 | GO:0071243 | cellular response to arsenic-containing substance(GO:0071243) |
0.1 | 0.3 | GO:1903772 | regulation of viral budding via host ESCRT complex(GO:1903772) |
0.1 | 0.2 | GO:2000586 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
0.1 | 0.2 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
0.1 | 0.1 | GO:0051573 | negative regulation of histone H3-K9 methylation(GO:0051573) |
0.1 | 0.1 | GO:0045410 | positive regulation of interleukin-6 biosynthetic process(GO:0045410) |
0.1 | 0.1 | GO:0071374 | cellular response to parathyroid hormone stimulus(GO:0071374) |
0.1 | 0.1 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
0.1 | 0.3 | GO:0036072 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
0.1 | 0.4 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.1 | 0.8 | GO:0000132 | establishment of mitotic spindle orientation(GO:0000132) |
0.1 | 0.1 | GO:0002740 | negative regulation of cytokine secretion involved in immune response(GO:0002740) |
0.1 | 0.4 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
0.1 | 0.1 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
0.1 | 0.2 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
0.1 | 0.5 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
0.1 | 0.1 | GO:0006598 | polyamine catabolic process(GO:0006598) |
0.1 | 0.1 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
0.1 | 0.1 | GO:1902992 | negative regulation of amyloid precursor protein catabolic process(GO:1902992) |
0.1 | 0.4 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.1 | 0.1 | GO:0060323 | head morphogenesis(GO:0060323) |
0.1 | 0.1 | GO:1904938 | dopaminergic neuron axon guidance(GO:0036514) serotonergic neuron axon guidance(GO:0036515) planar cell polarity pathway involved in axon guidance(GO:1904938) |
0.1 | 0.2 | GO:2000399 | negative regulation of T cell differentiation in thymus(GO:0033085) negative regulation of thymocyte aggregation(GO:2000399) |
0.1 | 1.9 | GO:0034394 | protein localization to cell surface(GO:0034394) |
0.1 | 0.1 | GO:0019364 | pyridine nucleotide catabolic process(GO:0019364) |
0.1 | 0.1 | GO:0010751 | negative regulation of nitric oxide mediated signal transduction(GO:0010751) |
0.1 | 1.4 | GO:0071173 | mitotic spindle assembly checkpoint(GO:0007094) spindle assembly checkpoint(GO:0071173) |
0.1 | 0.3 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
0.1 | 0.1 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
0.1 | 0.1 | GO:0048050 | post-embryonic eye morphogenesis(GO:0048050) |
0.1 | 0.6 | GO:0014883 | transition between fast and slow fiber(GO:0014883) |
0.1 | 0.1 | GO:0086023 | adrenergic receptor signaling pathway involved in heart process(GO:0086023) |
0.1 | 0.5 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
0.1 | 0.2 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
0.1 | 0.4 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
0.1 | 0.2 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
0.1 | 0.1 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.1 | 0.3 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
0.1 | 0.2 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
0.1 | 0.2 | GO:0048014 | Tie signaling pathway(GO:0048014) |
0.1 | 0.3 | GO:0032463 | negative regulation of protein homooligomerization(GO:0032463) |
0.1 | 0.3 | GO:2000391 | regulation of neutrophil extravasation(GO:2000389) positive regulation of neutrophil extravasation(GO:2000391) |
0.1 | 0.3 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
0.1 | 0.1 | GO:0071873 | response to norepinephrine(GO:0071873) |
0.1 | 0.3 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
0.1 | 0.1 | GO:0021514 | ventral spinal cord interneuron differentiation(GO:0021514) |
0.1 | 0.1 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
0.1 | 0.9 | GO:0035767 | endothelial cell chemotaxis(GO:0035767) |
0.1 | 0.2 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
0.1 | 0.1 | GO:0050961 | detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
0.1 | 0.1 | GO:0016074 | snoRNA metabolic process(GO:0016074) |
0.1 | 0.3 | GO:0042402 | cellular biogenic amine catabolic process(GO:0042402) |
0.1 | 0.2 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
0.1 | 0.5 | GO:0060037 | pharyngeal system development(GO:0060037) |
0.1 | 0.2 | GO:0006407 | rRNA export from nucleus(GO:0006407) |
0.1 | 0.3 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
0.1 | 0.3 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
0.1 | 0.2 | GO:0009186 | deoxyribonucleoside diphosphate metabolic process(GO:0009186) |
0.1 | 0.1 | GO:0010958 | regulation of amino acid import(GO:0010958) regulation of L-arginine import(GO:0010963) |
0.1 | 0.7 | GO:0006691 | leukotriene metabolic process(GO:0006691) |
0.1 | 0.1 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
0.1 | 0.2 | GO:0071028 | nuclear RNA surveillance(GO:0071027) nuclear mRNA surveillance(GO:0071028) |
0.1 | 0.3 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
0.1 | 1.1 | GO:0006270 | DNA replication initiation(GO:0006270) |
0.1 | 0.3 | GO:0035372 | protein localization to microtubule(GO:0035372) |
0.1 | 0.3 | GO:0001955 | blood vessel maturation(GO:0001955) |
0.1 | 0.8 | GO:0016180 | snRNA processing(GO:0016180) |
0.1 | 0.1 | GO:2000370 | positive regulation of clathrin-mediated endocytosis(GO:2000370) |
0.1 | 0.1 | GO:0032687 | negative regulation of interferon-alpha production(GO:0032687) |
0.1 | 0.1 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
0.1 | 0.1 | GO:2000321 | positive regulation of T-helper 17 cell differentiation(GO:2000321) |
0.1 | 0.4 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
0.1 | 0.1 | GO:0051124 | regulation of synaptic growth at neuromuscular junction(GO:0008582) synaptic growth at neuromuscular junction(GO:0051124) |
0.1 | 0.9 | GO:0006739 | NADP metabolic process(GO:0006739) |
0.1 | 0.8 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
0.1 | 0.2 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
0.1 | 1.2 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
0.1 | 0.2 | GO:0045200 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
0.1 | 0.1 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
0.1 | 0.2 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.1 | 0.2 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
0.1 | 0.1 | GO:1904338 | regulation of dopaminergic neuron differentiation(GO:1904338) |
0.1 | 0.1 | GO:0036023 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) |
0.1 | 0.3 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
0.1 | 0.3 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.1 | 0.1 | GO:0051036 | regulation of endosome size(GO:0051036) |
0.1 | 0.3 | GO:0015074 | DNA integration(GO:0015074) |
0.1 | 0.1 | GO:1903849 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
0.1 | 0.5 | GO:2001204 | regulation of osteoclast development(GO:2001204) |
0.1 | 0.1 | GO:0002930 | trabecular meshwork development(GO:0002930) |
0.1 | 0.2 | GO:0042746 | regulation of circadian sleep/wake cycle, wakefulness(GO:0010840) circadian sleep/wake cycle, wakefulness(GO:0042746) |
0.1 | 0.4 | GO:0006108 | malate metabolic process(GO:0006108) |
0.1 | 0.1 | GO:0051645 | Golgi localization(GO:0051645) |
0.1 | 0.2 | GO:0042219 | cellular modified amino acid catabolic process(GO:0042219) |
0.1 | 0.4 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.1 | 0.1 | GO:0006067 | ethanol metabolic process(GO:0006067) ethanol oxidation(GO:0006069) |
0.1 | 0.1 | GO:1901662 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
0.1 | 0.2 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
0.1 | 0.3 | GO:0016266 | O-glycan processing(GO:0016266) |
0.1 | 0.3 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
0.1 | 0.1 | GO:1900368 | regulation of RNA interference(GO:1900368) |
0.1 | 0.2 | GO:0034382 | chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
0.1 | 0.3 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
0.1 | 0.1 | GO:0033686 | positive regulation of luteinizing hormone secretion(GO:0033686) |
0.1 | 0.1 | GO:0045448 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
0.1 | 0.1 | GO:0060083 | smooth muscle contraction involved in micturition(GO:0060083) |
0.1 | 2.7 | GO:0006892 | post-Golgi vesicle-mediated transport(GO:0006892) |
0.1 | 0.2 | GO:0018101 | protein citrullination(GO:0018101) |
0.1 | 0.8 | GO:0031954 | positive regulation of protein autophosphorylation(GO:0031954) |
0.1 | 0.1 | GO:0002719 | negative regulation of cytokine production involved in immune response(GO:0002719) |
0.1 | 0.1 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
0.1 | 0.1 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.1 | 0.2 | GO:0060285 | cilium or flagellum-dependent cell motility(GO:0001539) cilium-dependent cell motility(GO:0060285) |
0.1 | 0.3 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
0.1 | 0.7 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
0.1 | 0.7 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
0.1 | 0.2 | GO:0071625 | vocalization behavior(GO:0071625) |
0.1 | 0.1 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
0.1 | 0.1 | GO:1900107 | regulation of nodal signaling pathway(GO:1900107) |
0.1 | 0.3 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
0.1 | 2.1 | GO:0007157 | heterophilic cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0007157) |
0.1 | 0.2 | GO:1990564 | protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
0.1 | 0.1 | GO:0061009 | common bile duct development(GO:0061009) |
0.1 | 0.2 | GO:0043247 | telomere maintenance in response to DNA damage(GO:0043247) |
0.1 | 0.2 | GO:0035336 | long-chain fatty-acyl-CoA metabolic process(GO:0035336) |
0.1 | 0.2 | GO:0071926 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
0.1 | 0.2 | GO:0051602 | response to electrical stimulus(GO:0051602) |
0.1 | 0.1 | GO:0071500 | cellular response to nitrosative stress(GO:0071500) |
0.1 | 0.2 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
0.1 | 0.2 | GO:0044154 | histone H3-K14 acetylation(GO:0044154) |
0.1 | 0.1 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
0.1 | 0.2 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
0.1 | 0.1 | GO:0033578 | protein glycosylation in Golgi(GO:0033578) |
0.1 | 0.2 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
0.1 | 0.1 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.1 | 0.1 | GO:0060770 | regulation of epithelial cell proliferation involved in prostate gland development(GO:0060768) negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
0.1 | 0.1 | GO:0030421 | defecation(GO:0030421) |
0.1 | 0.4 | GO:0007141 | male meiosis I(GO:0007141) |
0.1 | 0.7 | GO:0043403 | skeletal muscle tissue regeneration(GO:0043403) |
0.1 | 0.8 | GO:0051445 | regulation of meiotic cell cycle(GO:0051445) |
0.1 | 0.2 | GO:1902254 | negative regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902254) |
0.1 | 0.1 | GO:0043366 | beta selection(GO:0043366) |
0.1 | 0.1 | GO:0061082 | myeloid leukocyte cytokine production(GO:0061082) |
0.1 | 0.4 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
0.1 | 0.1 | GO:0034197 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
0.1 | 0.1 | GO:1902579 | multi-organism transport(GO:0044766) multi-organism localization(GO:1902579) |
0.1 | 0.7 | GO:0035019 | somatic stem cell population maintenance(GO:0035019) |
0.1 | 0.2 | GO:0032367 | intracellular cholesterol transport(GO:0032367) |
0.1 | 0.1 | GO:0001983 | baroreceptor response to increased systemic arterial blood pressure(GO:0001983) |
0.1 | 0.2 | GO:0061743 | motor learning(GO:0061743) |
0.1 | 0.7 | GO:0006465 | signal peptide processing(GO:0006465) |
0.1 | 0.2 | GO:0036010 | protein localization to endosome(GO:0036010) |
0.1 | 0.1 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
0.1 | 0.3 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
0.1 | 0.1 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
0.1 | 0.2 | GO:0000722 | telomere maintenance via recombination(GO:0000722) |
0.1 | 0.1 | GO:0090031 | positive regulation of steroid hormone biosynthetic process(GO:0090031) |
0.1 | 0.3 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
0.1 | 0.2 | GO:0009191 | ribonucleoside diphosphate catabolic process(GO:0009191) |
0.1 | 0.1 | GO:0021557 | oculomotor nerve development(GO:0021557) trochlear nerve development(GO:0021558) |
0.1 | 0.3 | GO:0051797 | regulation of hair follicle development(GO:0051797) |
0.1 | 0.2 | GO:0010544 | negative regulation of platelet activation(GO:0010544) |
0.1 | 0.1 | GO:1903416 | response to glycoside(GO:1903416) |
0.1 | 0.2 | GO:0090315 | negative regulation of protein targeting to membrane(GO:0090315) |
0.1 | 0.1 | GO:0090598 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
0.1 | 0.1 | GO:0042256 | mature ribosome assembly(GO:0042256) |
0.1 | 0.2 | GO:1902170 | cellular response to reactive nitrogen species(GO:1902170) |
0.1 | 0.1 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
0.1 | 0.2 | GO:0048669 | collateral sprouting in absence of injury(GO:0048669) |
0.1 | 1.0 | GO:0010507 | negative regulation of autophagy(GO:0010507) |
0.1 | 1.1 | GO:1903146 | regulation of mitophagy(GO:1903146) |
0.1 | 0.2 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.0 | 0.2 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
0.0 | 0.3 | GO:0001973 | adenosine receptor signaling pathway(GO:0001973) |
0.0 | 0.2 | GO:0061370 | testosterone biosynthetic process(GO:0061370) |
0.0 | 0.0 | GO:0001844 | protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:0001844) |
0.0 | 0.1 | GO:0045722 | positive regulation of gluconeogenesis(GO:0045722) |
0.0 | 0.1 | GO:0002326 | B cell lineage commitment(GO:0002326) |
0.0 | 0.1 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.0 | 0.3 | GO:0000103 | sulfate assimilation(GO:0000103) |
0.0 | 0.1 | GO:0032226 | positive regulation of synaptic transmission, dopaminergic(GO:0032226) |
0.0 | 0.3 | GO:0009650 | UV protection(GO:0009650) |
0.0 | 0.2 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
0.0 | 0.1 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
0.0 | 0.4 | GO:0046134 | pyrimidine nucleoside biosynthetic process(GO:0046134) |
0.0 | 1.8 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
0.0 | 1.3 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
0.0 | 0.2 | GO:0002002 | regulation of angiotensin levels in blood(GO:0002002) |
0.0 | 0.1 | GO:0022615 | protein to membrane docking(GO:0022615) |
0.0 | 0.3 | GO:0030157 | pancreatic juice secretion(GO:0030157) |
0.0 | 0.2 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
0.0 | 0.1 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
0.0 | 0.3 | GO:0019886 | antigen processing and presentation of exogenous peptide antigen via MHC class II(GO:0019886) |
0.0 | 0.6 | GO:0050908 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
0.0 | 0.2 | GO:0019695 | choline metabolic process(GO:0019695) |
0.0 | 0.1 | GO:0002118 | aggressive behavior(GO:0002118) |
0.0 | 0.1 | GO:0045683 | negative regulation of epidermal cell differentiation(GO:0045605) negative regulation of epidermis development(GO:0045683) |
0.0 | 0.1 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
0.0 | 0.2 | GO:0031643 | positive regulation of myelination(GO:0031643) |
0.0 | 0.6 | GO:0007143 | female meiotic division(GO:0007143) |
0.0 | 0.0 | GO:0021827 | cerebral cortex tangential migration using cell-cell interactions(GO:0021823) postnatal olfactory bulb interneuron migration(GO:0021827) |
0.0 | 0.1 | GO:0046959 | habituation(GO:0046959) |
0.0 | 0.3 | GO:0035510 | DNA dealkylation(GO:0035510) |
0.0 | 0.1 | GO:2000664 | positive regulation of interleukin-5 secretion(GO:2000664) positive regulation of interleukin-13 secretion(GO:2000667) |
0.0 | 0.0 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
0.0 | 0.0 | GO:0032616 | interleukin-13 production(GO:0032616) |
0.0 | 1.2 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
0.0 | 0.2 | GO:0043278 | response to isoquinoline alkaloid(GO:0014072) response to morphine(GO:0043278) |
0.0 | 0.0 | GO:1904738 | vascular associated smooth muscle cell migration(GO:1904738) regulation of vascular associated smooth muscle cell migration(GO:1904752) |
0.0 | 0.1 | GO:0070933 | histone H4 deacetylation(GO:0070933) |
0.0 | 0.2 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
0.0 | 0.0 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) |
0.0 | 0.7 | GO:0043171 | peptide catabolic process(GO:0043171) |
0.0 | 0.1 | GO:0002767 | immune response-inhibiting cell surface receptor signaling pathway(GO:0002767) |
0.0 | 0.8 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
0.0 | 0.2 | GO:0070172 | positive regulation of tooth mineralization(GO:0070172) |
0.0 | 0.1 | GO:0061153 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
0.0 | 0.0 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
0.0 | 0.4 | GO:0032967 | positive regulation of collagen biosynthetic process(GO:0032967) |
0.0 | 0.3 | GO:0034453 | microtubule anchoring(GO:0034453) |
0.0 | 0.7 | GO:0021952 | central nervous system projection neuron axonogenesis(GO:0021952) |
0.0 | 0.0 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
0.0 | 0.2 | GO:0060903 | positive regulation of meiosis I(GO:0060903) |
0.0 | 0.2 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
0.0 | 0.1 | GO:0010560 | positive regulation of glycoprotein biosynthetic process(GO:0010560) |
0.0 | 0.2 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
0.0 | 0.1 | GO:0031133 | regulation of axon diameter(GO:0031133) |
0.0 | 0.5 | GO:0048741 | skeletal muscle fiber development(GO:0048741) |
0.0 | 0.2 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
0.0 | 0.2 | GO:0045948 | positive regulation of translational initiation(GO:0045948) |
0.0 | 0.1 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
0.0 | 0.0 | GO:0050711 | negative regulation of interleukin-1 secretion(GO:0050711) |
0.0 | 0.1 | GO:0030422 | production of siRNA involved in RNA interference(GO:0030422) |
0.0 | 0.2 | GO:2000310 | regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
0.0 | 0.3 | GO:0042711 | maternal behavior(GO:0042711) |
0.0 | 0.1 | GO:0032957 | inositol trisphosphate metabolic process(GO:0032957) |
0.0 | 0.0 | GO:1902337 | regulation of apoptotic process involved in morphogenesis(GO:1902337) |
0.0 | 0.3 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
0.0 | 0.1 | GO:2000561 | regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000561) |
0.0 | 0.4 | GO:0007194 | negative regulation of adenylate cyclase activity(GO:0007194) |
0.0 | 0.2 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.0 | 0.1 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
0.0 | 0.1 | GO:2000465 | regulation of glycogen (starch) synthase activity(GO:2000465) |
0.0 | 0.5 | GO:0003416 | endochondral bone growth(GO:0003416) |
0.0 | 0.4 | GO:0002097 | tRNA wobble base modification(GO:0002097) |
0.0 | 0.1 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
0.0 | 0.2 | GO:0031116 | positive regulation of microtubule polymerization(GO:0031116) |
0.0 | 0.2 | GO:0042118 | endothelial cell activation(GO:0042118) |
0.0 | 0.2 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
0.0 | 0.4 | GO:0034243 | regulation of transcription elongation from RNA polymerase II promoter(GO:0034243) |
0.0 | 0.2 | GO:0006415 | translational termination(GO:0006415) |
0.0 | 0.1 | GO:0051571 | positive regulation of histone H3-K4 methylation(GO:0051571) |
0.0 | 0.0 | GO:0032252 | secretory granule localization(GO:0032252) |
0.0 | 0.0 | GO:0019388 | galactose catabolic process(GO:0019388) |
0.0 | 0.2 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
0.0 | 0.1 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
0.0 | 0.2 | GO:0032875 | regulation of DNA endoreduplication(GO:0032875) |
0.0 | 0.1 | GO:0051452 | intracellular pH reduction(GO:0051452) |
0.0 | 0.0 | GO:0032736 | positive regulation of interleukin-13 production(GO:0032736) |
0.0 | 0.5 | GO:0006904 | vesicle docking involved in exocytosis(GO:0006904) |
0.0 | 0.2 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
0.0 | 0.4 | GO:0031290 | retinal ganglion cell axon guidance(GO:0031290) |
0.0 | 0.1 | GO:0060710 | chorio-allantoic fusion(GO:0060710) |
0.0 | 0.1 | GO:2000857 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
0.0 | 0.3 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
0.0 | 0.5 | GO:0072661 | protein targeting to plasma membrane(GO:0072661) |
0.0 | 1.1 | GO:0006400 | tRNA modification(GO:0006400) |
0.0 | 0.0 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
0.0 | 0.1 | GO:0006498 | N-terminal protein lipidation(GO:0006498) |
0.0 | 0.2 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
0.0 | 1.4 | GO:0051865 | protein autoubiquitination(GO:0051865) |
0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.3 | GO:0043249 | erythrocyte maturation(GO:0043249) |
0.0 | 0.1 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
0.0 | 0.3 | GO:0032897 | negative regulation of viral transcription(GO:0032897) |
0.0 | 0.2 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
0.0 | 0.0 | GO:0010642 | negative regulation of platelet-derived growth factor receptor signaling pathway(GO:0010642) |
0.0 | 0.0 | GO:0035799 | ureter maturation(GO:0035799) |
0.0 | 0.1 | GO:0006983 | ER overload response(GO:0006983) |
0.0 | 0.3 | GO:0043206 | extracellular fibril organization(GO:0043206) |
0.0 | 0.1 | GO:0008608 | attachment of spindle microtubules to kinetochore(GO:0008608) |
0.0 | 0.1 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
0.0 | 0.0 | GO:1903587 | regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903587) |
0.0 | 0.5 | GO:0006182 | cGMP biosynthetic process(GO:0006182) |
0.0 | 0.2 | GO:0007274 | neuromuscular synaptic transmission(GO:0007274) |
0.0 | 0.1 | GO:0000042 | protein targeting to Golgi(GO:0000042) |
0.0 | 0.1 | GO:0006551 | leucine metabolic process(GO:0006551) |
0.0 | 0.0 | GO:0018195 | peptidyl-arginine modification(GO:0018195) peptidyl-arginine methylation(GO:0018216) |
0.0 | 0.1 | GO:0032230 | positive regulation of synaptic transmission, GABAergic(GO:0032230) |
0.0 | 0.2 | GO:0050651 | dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
0.0 | 0.5 | GO:0072583 | clathrin-mediated endocytosis(GO:0072583) |
0.0 | 1.4 | GO:0030490 | maturation of SSU-rRNA(GO:0030490) |
0.0 | 0.1 | GO:0051026 | chiasma assembly(GO:0051026) |
0.0 | 0.3 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
0.0 | 0.2 | GO:0035090 | maintenance of apical/basal cell polarity(GO:0035090) maintenance of epithelial cell apical/basal polarity(GO:0045199) |
0.0 | 0.1 | GO:0044351 | macropinocytosis(GO:0044351) |
0.0 | 0.2 | GO:0045197 | establishment or maintenance of epithelial cell apical/basal polarity(GO:0045197) |
0.0 | 0.1 | GO:0097211 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
0.0 | 0.2 | GO:0021521 | ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
0.0 | 0.5 | GO:0045069 | regulation of viral genome replication(GO:0045069) |
0.0 | 0.2 | GO:0097150 | neuronal stem cell population maintenance(GO:0097150) |
0.0 | 0.2 | GO:2000114 | regulation of establishment of cell polarity(GO:2000114) |
0.0 | 1.0 | GO:0045454 | cell redox homeostasis(GO:0045454) |
0.0 | 0.3 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
0.0 | 0.1 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
0.0 | 0.2 | GO:0006353 | DNA-templated transcription, termination(GO:0006353) |
0.0 | 0.4 | GO:0032461 | positive regulation of protein oligomerization(GO:0032461) |
0.0 | 0.1 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
0.0 | 0.9 | GO:0035456 | response to interferon-beta(GO:0035456) |
0.0 | 0.1 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
0.0 | 0.2 | GO:0042403 | thyroid hormone metabolic process(GO:0042403) |
0.0 | 0.0 | GO:1904751 | regulation of protein localization to nucleolus(GO:1904749) positive regulation of protein localization to nucleolus(GO:1904751) |
0.0 | 0.0 | GO:0002581 | negative regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002581) |
0.0 | 0.0 | GO:0051458 | corticotropin secretion(GO:0051458) |
0.0 | 0.0 | GO:0007228 | positive regulation of hh target transcription factor activity(GO:0007228) |
0.0 | 0.1 | GO:0072531 | pyrimidine-containing compound transmembrane transport(GO:0072531) nucleotide transmembrane transport(GO:1901679) |
0.0 | 0.0 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
0.0 | 0.3 | GO:0052697 | xenobiotic glucuronidation(GO:0052697) |
0.0 | 0.1 | GO:0051697 | protein delipidation(GO:0051697) |
0.0 | 0.1 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
0.0 | 0.1 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
0.0 | 0.1 | GO:0046643 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
0.0 | 0.1 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
0.0 | 0.1 | GO:0070828 | heterochromatin organization(GO:0070828) |
0.0 | 0.1 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
0.0 | 0.0 | GO:0006714 | sesquiterpenoid metabolic process(GO:0006714) |
0.0 | 0.2 | GO:0043584 | nose development(GO:0043584) |
0.0 | 0.2 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.0 | 0.0 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
0.0 | 0.1 | GO:0060914 | heart formation(GO:0060914) |
0.0 | 0.0 | GO:0008292 | acetylcholine biosynthetic process(GO:0008292) acetate ester biosynthetic process(GO:1900620) |
0.0 | 0.1 | GO:0032688 | negative regulation of interferon-beta production(GO:0032688) |
0.0 | 0.1 | GO:1904376 | negative regulation of protein localization to plasma membrane(GO:1903077) negative regulation of protein localization to cell periphery(GO:1904376) |
0.0 | 0.1 | GO:0044062 | regulation of excretion(GO:0044062) |
0.0 | 0.1 | GO:0032608 | interferon-beta production(GO:0032608) regulation of interferon-beta production(GO:0032648) |
0.0 | 0.1 | GO:0060287 | epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
0.0 | 0.3 | GO:0015012 | heparan sulfate proteoglycan biosynthetic process(GO:0015012) |
0.0 | 0.1 | GO:0032196 | transposition(GO:0032196) |
0.0 | 0.4 | GO:0006376 | mRNA splice site selection(GO:0006376) |
0.0 | 0.1 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.0 | 0.2 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
0.0 | 0.1 | GO:0015744 | succinate transport(GO:0015744) |
0.0 | 0.3 | GO:0046549 | retinal cone cell development(GO:0046549) |
0.0 | 1.0 | GO:0032543 | mitochondrial translation(GO:0032543) |
0.0 | 0.3 | GO:1901661 | quinone metabolic process(GO:1901661) |
0.0 | 0.4 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
0.0 | 0.2 | GO:0045063 | T-helper 1 cell differentiation(GO:0045063) |
0.0 | 0.1 | GO:0060017 | parathyroid gland development(GO:0060017) |
0.0 | 0.0 | GO:0051350 | negative regulation of lyase activity(GO:0051350) |
0.0 | 0.2 | GO:0010866 | regulation of triglyceride biosynthetic process(GO:0010866) |
0.0 | 0.1 | GO:0051305 | chromosome movement towards spindle pole(GO:0051305) |
0.0 | 0.2 | GO:0090005 | negative regulation of establishment of protein localization to plasma membrane(GO:0090005) |
0.0 | 0.1 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
0.0 | 0.3 | GO:0001709 | cell fate determination(GO:0001709) |
0.0 | 0.0 | GO:0048769 | sarcomerogenesis(GO:0048769) |
0.0 | 0.1 | GO:1901985 | positive regulation of protein acetylation(GO:1901985) |
0.0 | 0.0 | GO:0000960 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
0.0 | 0.0 | GO:0090467 | L-arginine import(GO:0043091) arginine import(GO:0090467) L-arginine transport(GO:1902023) |
0.0 | 0.1 | GO:1902534 | single-organism membrane invagination(GO:1902534) |
0.0 | 0.2 | GO:0007625 | grooming behavior(GO:0007625) |
0.0 | 0.4 | GO:0016578 | histone deubiquitination(GO:0016578) |
0.0 | 0.0 | GO:0042182 | ketone catabolic process(GO:0042182) |
0.0 | 0.3 | GO:0000186 | activation of MAPKK activity(GO:0000186) |
0.0 | 0.1 | GO:0090520 | sphingolipid mediated signaling pathway(GO:0090520) |
0.0 | 0.1 | GO:0060406 | positive regulation of penile erection(GO:0060406) |
0.0 | 0.1 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
0.0 | 0.3 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
0.0 | 0.0 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
0.0 | 0.6 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
0.0 | 0.2 | GO:0007210 | serotonin receptor signaling pathway(GO:0007210) |
0.0 | 0.8 | GO:0006661 | phosphatidylinositol biosynthetic process(GO:0006661) |
0.0 | 0.3 | GO:0035855 | megakaryocyte development(GO:0035855) |
0.0 | 0.3 | GO:0048169 | regulation of long-term neuronal synaptic plasticity(GO:0048169) |
0.0 | 0.6 | GO:0000184 | nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
0.0 | 0.1 | GO:0051764 | actin crosslink formation(GO:0051764) |
0.0 | 0.1 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
0.0 | 0.2 | GO:0045086 | positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
0.0 | 0.1 | GO:0002827 | positive regulation of T-helper 1 type immune response(GO:0002827) |
0.0 | 0.2 | GO:0098828 | modulation of inhibitory postsynaptic potential(GO:0098828) |
0.0 | 0.1 | GO:0061003 | positive regulation of dendritic spine morphogenesis(GO:0061003) |
0.0 | 0.1 | GO:0010626 | negative regulation of Schwann cell proliferation(GO:0010626) |
0.0 | 0.2 | GO:0007140 | male meiosis(GO:0007140) |
0.0 | 0.9 | GO:0031497 | chromatin assembly(GO:0031497) |
0.0 | 0.1 | GO:0010165 | response to X-ray(GO:0010165) |
0.0 | 0.2 | GO:0045953 | negative regulation of natural killer cell mediated cytotoxicity(GO:0045953) |
0.0 | 0.2 | GO:0015858 | nucleoside transport(GO:0015858) |
0.0 | 0.5 | GO:0034605 | cellular response to heat(GO:0034605) |
0.0 | 0.1 | GO:0070200 | establishment of protein localization to chromosome(GO:0070199) establishment of protein localization to telomere(GO:0070200) |
0.0 | 0.0 | GO:0090135 | actin filament branching(GO:0090135) |
0.0 | 0.2 | GO:0048665 | neuron fate specification(GO:0048665) |
0.0 | 0.0 | GO:2000463 | positive regulation of excitatory postsynaptic potential(GO:2000463) |
0.0 | 0.1 | GO:0001514 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
0.0 | 0.2 | GO:0046785 | microtubule polymerization(GO:0046785) |
0.0 | 0.3 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
0.0 | 0.4 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
0.0 | 0.1 | GO:1904948 | midbrain dopaminergic neuron differentiation(GO:1904948) |
0.0 | 0.2 | GO:0003334 | keratinocyte development(GO:0003334) |
0.0 | 0.0 | GO:0038003 | opioid receptor signaling pathway(GO:0038003) |
0.0 | 0.2 | GO:0030836 | positive regulation of actin filament depolymerization(GO:0030836) |
0.0 | 0.7 | GO:1902476 | chloride transmembrane transport(GO:1902476) |
0.0 | 0.0 | GO:0030222 | eosinophil differentiation(GO:0030222) |
0.0 | 0.5 | GO:0048791 | calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
0.0 | 0.1 | GO:0071498 | cellular response to fluid shear stress(GO:0071498) |
0.0 | 0.5 | GO:0048525 | negative regulation of viral process(GO:0048525) |
0.0 | 0.1 | GO:2000778 | positive regulation of interleukin-6 secretion(GO:2000778) |
0.0 | 0.4 | GO:0048873 | homeostasis of number of cells within a tissue(GO:0048873) |
0.0 | 0.0 | GO:0071025 | RNA surveillance(GO:0071025) |
0.0 | 0.8 | GO:0033141 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
0.0 | 0.0 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
0.0 | 0.2 | GO:0061088 | sequestering of zinc ion(GO:0032119) regulation of sequestering of zinc ion(GO:0061088) |
0.0 | 0.1 | GO:0048733 | sebaceous gland development(GO:0048733) |
0.0 | 0.1 | GO:0000154 | rRNA modification(GO:0000154) |
0.0 | 0.0 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
0.0 | 1.0 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
0.0 | 0.3 | GO:0006828 | manganese ion transport(GO:0006828) |
0.0 | 0.1 | GO:0046037 | GMP metabolic process(GO:0046037) |
0.0 | 0.3 | GO:0006493 | protein O-linked glycosylation(GO:0006493) |
0.0 | 0.1 | GO:0042348 | regulation of NF-kappaB import into nucleus(GO:0042345) NF-kappaB import into nucleus(GO:0042348) |
0.0 | 0.2 | GO:0007212 | dopamine receptor signaling pathway(GO:0007212) |
0.0 | 0.0 | GO:0051084 | 'de novo' protein folding(GO:0006458) 'de novo' posttranslational protein folding(GO:0051084) |
0.0 | 0.0 | GO:1905155 | positive regulation of phagocytosis, engulfment(GO:0060100) positive regulation of membrane invagination(GO:1905155) |
0.0 | 0.1 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
0.0 | 0.0 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
0.0 | 0.3 | GO:0030513 | positive regulation of BMP signaling pathway(GO:0030513) |
0.0 | 0.1 | GO:0045838 | positive regulation of membrane potential(GO:0045838) |
0.0 | 0.0 | GO:0006824 | cobalt ion transport(GO:0006824) |
0.0 | 0.2 | GO:0035066 | positive regulation of histone acetylation(GO:0035066) |
0.0 | 0.1 | GO:0048630 | skeletal muscle tissue growth(GO:0048630) |
0.0 | 0.2 | GO:0009048 | dosage compensation(GO:0007549) dosage compensation by inactivation of X chromosome(GO:0009048) |
0.0 | 0.1 | GO:1902260 | negative regulation of delayed rectifier potassium channel activity(GO:1902260) negative regulation of voltage-gated potassium channel activity(GO:1903817) |
0.0 | 0.0 | GO:0002025 | vasodilation by norepinephrine-epinephrine involved in regulation of systemic arterial blood pressure(GO:0002025) |
0.0 | 0.1 | GO:0045141 | meiotic telomere clustering(GO:0045141) |
0.0 | 0.1 | GO:0051299 | mitotic centrosome separation(GO:0007100) centrosome separation(GO:0051299) |
0.0 | 0.2 | GO:0048265 | response to pain(GO:0048265) |
0.0 | 0.6 | GO:0001938 | positive regulation of endothelial cell proliferation(GO:0001938) |
0.0 | 0.0 | GO:0010940 | positive regulation of necrotic cell death(GO:0010940) |
0.0 | 0.1 | GO:2000300 | regulation of synaptic vesicle exocytosis(GO:2000300) |
0.0 | 0.0 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
0.0 | 0.1 | GO:0009950 | dorsal/ventral axis specification(GO:0009950) |
0.0 | 0.0 | GO:0042636 | negative regulation of hair cycle(GO:0042636) |
0.0 | 0.0 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
0.0 | 0.0 | GO:0061072 | iris morphogenesis(GO:0061072) |
0.0 | 0.3 | GO:0045880 | positive regulation of smoothened signaling pathway(GO:0045880) |
0.0 | 0.0 | GO:1903795 | regulation of inorganic anion transmembrane transport(GO:1903795) |
0.0 | 0.0 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
0.0 | 0.0 | GO:1902074 | response to salt(GO:1902074) |
0.0 | 0.0 | GO:0051934 | dopamine uptake involved in synaptic transmission(GO:0051583) catecholamine uptake involved in synaptic transmission(GO:0051934) |
0.0 | 0.1 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.0 | 0.5 | GO:0090662 | energy coupled proton transmembrane transport, against electrochemical gradient(GO:0015988) ATP hydrolysis coupled proton transport(GO:0015991) ATP hydrolysis coupled transmembrane transport(GO:0090662) |
0.0 | 0.0 | GO:1903371 | regulation of endoplasmic reticulum tubular network organization(GO:1903371) |
0.0 | 0.0 | GO:0045409 | negative regulation of interleukin-6 biosynthetic process(GO:0045409) |
0.0 | 0.0 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
0.0 | 0.0 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
0.0 | 0.0 | GO:0048149 | behavioral response to ethanol(GO:0048149) |
0.0 | 0.1 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
0.0 | 0.1 | GO:0043496 | regulation of protein homodimerization activity(GO:0043496) |
0.0 | 0.0 | GO:1900377 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
0.0 | 0.1 | GO:1903232 | melanosome assembly(GO:1903232) |
0.0 | 0.0 | GO:0035065 | regulation of histone acetylation(GO:0035065) |
0.0 | 0.1 | GO:0030539 | male genitalia development(GO:0030539) |
0.0 | 0.0 | GO:0008209 | androgen metabolic process(GO:0008209) |
0.0 | 0.0 | GO:0046865 | retinol transport(GO:0034633) isoprenoid transport(GO:0046864) terpenoid transport(GO:0046865) |
0.0 | 0.1 | GO:0008207 | C21-steroid hormone metabolic process(GO:0008207) |
0.0 | 0.0 | GO:0033083 | regulation of immature T cell proliferation(GO:0033083) negative regulation of immature T cell proliferation(GO:0033087) |
0.0 | 0.0 | GO:0042228 | interleukin-8 biosynthetic process(GO:0042228) |
0.0 | 0.0 | GO:0050862 | positive regulation of T cell receptor signaling pathway(GO:0050862) |
0.0 | 0.1 | GO:0019720 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
0.0 | 0.7 | GO:0030512 | negative regulation of transforming growth factor beta receptor signaling pathway(GO:0030512) negative regulation of cellular response to transforming growth factor beta stimulus(GO:1903845) |
0.0 | 0.1 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
0.0 | 0.1 | GO:0045742 | positive regulation of epidermal growth factor receptor signaling pathway(GO:0045742) |
0.0 | 0.1 | GO:0035871 | protein K11-linked deubiquitination(GO:0035871) |
0.0 | 0.0 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
0.0 | 0.2 | GO:0061098 | positive regulation of protein tyrosine kinase activity(GO:0061098) |
0.0 | 0.1 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
0.0 | 0.0 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
0.0 | 0.0 | GO:0035106 | operant conditioning(GO:0035106) |
0.0 | 0.0 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
0.0 | 0.2 | GO:0061014 | positive regulation of mRNA catabolic process(GO:0061014) |
0.0 | 0.1 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
0.0 | 0.0 | GO:0002838 | negative regulation of response to tumor cell(GO:0002835) negative regulation of immune response to tumor cell(GO:0002838) |
0.0 | 1.6 | GO:0042787 | protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0042787) |
0.0 | 0.0 | GO:0042091 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
0.0 | 0.4 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
0.0 | 0.0 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
0.0 | 0.0 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
0.0 | 0.1 | GO:0045793 | positive regulation of cell size(GO:0045793) |
0.0 | 0.1 | GO:0007614 | short-term memory(GO:0007614) |
0.0 | 0.1 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
0.0 | 0.1 | GO:0000460 | maturation of 5.8S rRNA(GO:0000460) |
0.0 | 0.2 | GO:0043113 | receptor clustering(GO:0043113) |
0.0 | 0.1 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
0.0 | 0.1 | GO:0002052 | positive regulation of neuroblast proliferation(GO:0002052) |
0.0 | 0.0 | GO:1900016 | negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
0.0 | 0.0 | GO:0003222 | ventricular trabecula myocardium morphogenesis(GO:0003222) |
0.0 | 0.1 | GO:0002328 | pro-B cell differentiation(GO:0002328) |
0.0 | 0.1 | GO:0007062 | sister chromatid cohesion(GO:0007062) |
0.0 | 0.0 | GO:0032506 | cytokinetic process(GO:0032506) |
0.0 | 0.1 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
0.0 | 0.1 | GO:0050995 | negative regulation of lipid catabolic process(GO:0050995) |
0.0 | 0.1 | GO:0036065 | fucosylation(GO:0036065) |
0.0 | 0.0 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
0.0 | 0.1 | GO:0050930 | induction of positive chemotaxis(GO:0050930) |
0.0 | 0.0 | GO:0051901 | positive regulation of mitochondrial depolarization(GO:0051901) |
0.0 | 0.0 | GO:0000393 | spliceosomal conformational changes to generate catalytic conformation(GO:0000393) |
0.0 | 0.1 | GO:0009125 | nucleoside monophosphate catabolic process(GO:0009125) |
0.0 | 0.6 | GO:0030534 | adult behavior(GO:0030534) |
0.0 | 0.0 | GO:0090027 | negative regulation of monocyte chemotaxis(GO:0090027) |
0.0 | 0.2 | GO:0097031 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.0 | 0.0 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
0.0 | 0.0 | GO:0015705 | iodide transport(GO:0015705) |
0.0 | 0.2 | GO:0098781 | rRNA transcription(GO:0009303) ncRNA transcription(GO:0098781) |
0.0 | 0.0 | GO:0031443 | fast-twitch skeletal muscle fiber contraction(GO:0031443) |
0.0 | 0.0 | GO:0009106 | lipoate metabolic process(GO:0009106) |
0.0 | 0.3 | GO:0001656 | metanephros development(GO:0001656) |
0.0 | 0.9 | GO:0006457 | protein folding(GO:0006457) |
0.0 | 0.0 | GO:0019355 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
0.0 | 0.0 | GO:0051182 | coenzyme transport(GO:0051182) |
0.0 | 0.1 | GO:0001696 | gastric acid secretion(GO:0001696) |
0.0 | 0.2 | GO:0008333 | endosome to lysosome transport(GO:0008333) |
0.0 | 0.0 | GO:0035115 | embryonic forelimb morphogenesis(GO:0035115) |
0.0 | 0.1 | GO:0018027 | peptidyl-lysine dimethylation(GO:0018027) |
0.0 | 0.1 | GO:0018904 | glycerol ether metabolic process(GO:0006662) ether metabolic process(GO:0018904) |
0.0 | 0.0 | GO:0051105 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
0.0 | 0.1 | GO:0031641 | regulation of myelination(GO:0031641) |
0.0 | 0.0 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
0.0 | 0.1 | GO:0090200 | positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
0.0 | 0.0 | GO:0034398 | telomere tethering at nuclear periphery(GO:0034398) |
0.0 | 0.1 | GO:0035608 | protein deglutamylation(GO:0035608) |
0.0 | 0.0 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
0.0 | 0.1 | GO:0032329 | serine transport(GO:0032329) |
0.0 | 0.0 | GO:0009249 | protein lipoylation(GO:0009249) |
0.0 | 0.1 | GO:0090036 | regulation of protein kinase C signaling(GO:0090036) |
0.0 | 0.0 | GO:0034145 | positive regulation of toll-like receptor 4 signaling pathway(GO:0034145) |
0.0 | 0.0 | GO:2000194 | regulation of female gonad development(GO:2000194) |
0.0 | 0.0 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
0.0 | 0.0 | GO:0045213 | neurotransmitter receptor metabolic process(GO:0045213) |
0.0 | 0.0 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
0.0 | 0.0 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
0.0 | 0.1 | GO:0051231 | mitotic spindle elongation(GO:0000022) spindle elongation(GO:0051231) mitotic spindle midzone assembly(GO:0051256) |
0.0 | 0.1 | GO:0015800 | acidic amino acid transport(GO:0015800) |
0.0 | 0.0 | GO:0070268 | cornification(GO:0070268) |
0.0 | 0.2 | GO:0006910 | phagocytosis, recognition(GO:0006910) |
0.0 | 0.1 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
0.0 | 0.0 | GO:0035582 | sequestering of BMP in extracellular matrix(GO:0035582) |
0.0 | 0.6 | GO:1903749 | positive regulation of establishment of protein localization to mitochondrion(GO:1903749) |
0.0 | 0.1 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
0.0 | 0.0 | GO:0042078 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
0.0 | 0.0 | GO:2000252 | negative regulation of feeding behavior(GO:2000252) |
0.0 | 0.6 | GO:0010923 | negative regulation of phosphatase activity(GO:0010923) |
0.0 | 0.1 | GO:0048384 | retinoic acid receptor signaling pathway(GO:0048384) |
0.0 | 0.0 | GO:0035588 | G-protein coupled purinergic receptor signaling pathway(GO:0035588) |
0.0 | 0.0 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
0.0 | 0.0 | GO:0032071 | regulation of endodeoxyribonuclease activity(GO:0032071) |
0.0 | 0.1 | GO:0009084 | glutamine family amino acid biosynthetic process(GO:0009084) |
0.0 | 0.1 | GO:0044380 | protein localization to cytoskeleton(GO:0044380) |
0.0 | 0.0 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.0 | 0.0 | GO:0042090 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
0.0 | 0.1 | GO:0035305 | negative regulation of dephosphorylation(GO:0035305) |
0.0 | 0.0 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.0 | 0.0 | GO:0050966 | detection of mechanical stimulus involved in sensory perception of pain(GO:0050966) |
0.0 | 0.0 | GO:2000035 | regulation of stem cell division(GO:2000035) |
0.0 | 0.5 | GO:0001580 | detection of chemical stimulus involved in sensory perception of bitter taste(GO:0001580) |
0.0 | 0.0 | GO:0038089 | positive regulation of cell migration by vascular endothelial growth factor signaling pathway(GO:0038089) |
0.0 | 0.0 | GO:0019287 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
0.0 | 0.0 | GO:0032831 | positive regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032831) |
0.0 | 0.0 | GO:0034104 | negative regulation of tissue remodeling(GO:0034104) |
0.0 | 0.0 | GO:0048539 | bone marrow development(GO:0048539) |
0.0 | 0.0 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
0.0 | 0.0 | GO:2001046 | rubidium ion transport(GO:0035826) positive regulation of integrin-mediated signaling pathway(GO:2001046) |
0.0 | 0.0 | GO:0002325 | natural killer cell differentiation involved in immune response(GO:0002325) negative regulation of natural killer cell differentiation(GO:0032824) regulation of natural killer cell differentiation involved in immune response(GO:0032826) negative regulation of natural killer cell differentiation involved in immune response(GO:0032827) |
0.0 | 0.0 | GO:0010745 | negative regulation of macrophage derived foam cell differentiation(GO:0010745) |
0.0 | 0.0 | GO:0051096 | positive regulation of helicase activity(GO:0051096) |
0.0 | 0.3 | GO:0048477 | oogenesis(GO:0048477) |
0.0 | 0.0 | GO:0010966 | regulation of phosphate transport(GO:0010966) |
0.0 | 0.1 | GO:0015695 | organic cation transport(GO:0015695) |
0.0 | 0.1 | GO:0015816 | glycine transport(GO:0015816) |
0.0 | 0.0 | GO:0060920 | cardiac pacemaker cell differentiation(GO:0060920) |
0.0 | 0.0 | GO:0002361 | CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0002361) |
0.0 | 0.0 | GO:0070266 | necroptotic process(GO:0070266) |
0.0 | 0.0 | GO:0042481 | regulation of odontogenesis(GO:0042481) |
0.0 | 0.0 | GO:0010971 | positive regulation of G2/M transition of mitotic cell cycle(GO:0010971) |
0.0 | 0.0 | GO:0046520 | sphingoid biosynthetic process(GO:0046520) |
0.0 | 0.0 | GO:0045631 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
0.0 | 0.1 | GO:0060081 | membrane hyperpolarization(GO:0060081) |
0.0 | 0.0 | GO:0072584 | caveolin-mediated endocytosis(GO:0072584) |
0.0 | 0.0 | GO:0071542 | dopaminergic neuron differentiation(GO:0071542) |
0.0 | 0.0 | GO:0033227 | dsRNA transport(GO:0033227) |
0.0 | 0.1 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.1 | 3.2 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
1.0 | 8.3 | GO:0042587 | glycogen granule(GO:0042587) |
0.7 | 8.1 | GO:0070852 | cell body fiber(GO:0070852) |
0.6 | 3.0 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
0.6 | 3.0 | GO:0031094 | platelet dense tubular network(GO:0031094) |
0.6 | 1.7 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
0.5 | 2.8 | GO:0005915 | zonula adherens(GO:0005915) |
0.4 | 2.1 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.4 | 1.9 | GO:0001651 | dense fibrillar component(GO:0001651) |
0.4 | 1.1 | GO:0097441 | basilar dendrite(GO:0097441) |
0.4 | 1.8 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.3 | 1.0 | GO:0046691 | intracellular canaliculus(GO:0046691) |
0.3 | 0.9 | GO:0070552 | BRISC complex(GO:0070552) |
0.3 | 0.9 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.3 | 0.9 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
0.3 | 1.1 | GO:0008274 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
0.3 | 0.6 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
0.3 | 1.1 | GO:0033269 | internode region of axon(GO:0033269) |
0.3 | 1.9 | GO:0016342 | catenin complex(GO:0016342) |
0.3 | 0.8 | GO:0036449 | microtubule minus-end(GO:0036449) |
0.3 | 2.9 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
0.3 | 1.8 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
0.3 | 1.8 | GO:0016272 | prefoldin complex(GO:0016272) |
0.2 | 1.0 | GO:0030689 | Noc complex(GO:0030689) |
0.2 | 1.0 | GO:0031298 | replication fork protection complex(GO:0031298) |
0.2 | 1.0 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.2 | 1.1 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.2 | 1.1 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.2 | 1.3 | GO:0001940 | male pronucleus(GO:0001940) |
0.2 | 0.8 | GO:0030127 | COPII vesicle coat(GO:0030127) |
0.2 | 1.2 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.2 | 1.0 | GO:0005579 | membrane attack complex(GO:0005579) |
0.2 | 1.6 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
0.2 | 1.2 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
0.2 | 1.6 | GO:0071437 | invadopodium(GO:0071437) |
0.2 | 0.6 | GO:0071942 | XPC complex(GO:0071942) |
0.2 | 0.2 | GO:1990745 | EARP complex(GO:1990745) |
0.2 | 0.8 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.2 | 0.2 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
0.2 | 0.9 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
0.2 | 2.2 | GO:0032426 | stereocilium tip(GO:0032426) |
0.2 | 1.3 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.2 | 0.7 | GO:0032021 | NELF complex(GO:0032021) |
0.2 | 0.2 | GO:0055087 | Ski complex(GO:0055087) |
0.2 | 0.4 | GO:0030665 | clathrin-coated vesicle membrane(GO:0030665) |
0.2 | 6.4 | GO:0031672 | A band(GO:0031672) |
0.2 | 0.5 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.2 | 0.5 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
0.2 | 0.7 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.2 | 0.7 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.2 | 2.4 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) |
0.2 | 0.3 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
0.2 | 0.9 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.2 | 0.7 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.2 | 0.7 | GO:0032389 | MutLalpha complex(GO:0032389) |
0.2 | 1.7 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.2 | 1.3 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.2 | 1.0 | GO:0000347 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
0.2 | 0.6 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.2 | 2.1 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
0.2 | 0.5 | GO:0097413 | Lewy body(GO:0097413) |
0.2 | 0.3 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.2 | 0.3 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.2 | 1.9 | GO:0042575 | DNA polymerase complex(GO:0042575) |
0.2 | 1.7 | GO:0016580 | Sin3 complex(GO:0016580) |
0.2 | 1.8 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
0.2 | 0.5 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
0.2 | 0.5 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.1 | 0.4 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
0.1 | 0.4 | GO:0030136 | clathrin-coated vesicle(GO:0030136) |
0.1 | 1.3 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.1 | 0.6 | GO:0031502 | dolichyl-phosphate-mannose-protein mannosyltransferase complex(GO:0031502) |
0.1 | 0.6 | GO:0043159 | acrosomal matrix(GO:0043159) |
0.1 | 1.7 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.1 | 0.7 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
0.1 | 0.5 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.1 | 0.4 | GO:0046930 | pore complex(GO:0046930) |
0.1 | 0.7 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.1 | 2.3 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.1 | 5.3 | GO:0005747 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
0.1 | 0.9 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.1 | 0.3 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.1 | 0.5 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.1 | 0.1 | GO:0071012 | catalytic step 1 spliceosome(GO:0071012) |
0.1 | 4.2 | GO:0031903 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
0.1 | 0.4 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.1 | 0.2 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
0.1 | 0.5 | GO:0000835 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) |
0.1 | 0.8 | GO:0016591 | DNA-directed RNA polymerase II, holoenzyme(GO:0016591) |
0.1 | 1.6 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
0.1 | 0.7 | GO:0043034 | costamere(GO:0043034) |
0.1 | 0.6 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.1 | 0.3 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
0.1 | 0.3 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.1 | 0.3 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.1 | 3.0 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
0.1 | 0.8 | GO:0031931 | TORC1 complex(GO:0031931) |
0.1 | 0.4 | GO:0000125 | PCAF complex(GO:0000125) |
0.1 | 0.2 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
0.1 | 1.4 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.1 | 1.0 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.1 | 1.4 | GO:0097440 | apical dendrite(GO:0097440) |
0.1 | 2.7 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
0.1 | 0.4 | GO:0045298 | tubulin complex(GO:0045298) |
0.1 | 0.4 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
0.1 | 0.7 | GO:0005688 | U6 snRNP(GO:0005688) |
0.1 | 0.4 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
0.1 | 0.3 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
0.1 | 0.9 | GO:0044217 | other organism(GO:0044215) other organism cell(GO:0044216) other organism part(GO:0044217) |
0.1 | 0.9 | GO:0097208 | alveolar lamellar body(GO:0097208) |
0.1 | 0.4 | GO:0097651 | phosphatidylinositol 3-kinase complex, class I(GO:0097651) |
0.1 | 4.1 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.1 | 0.7 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.1 | 0.9 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
0.1 | 0.3 | GO:0000346 | transcription export complex(GO:0000346) |
0.1 | 0.1 | GO:0005712 | chiasma(GO:0005712) |
0.1 | 1.1 | GO:0030126 | COPI vesicle coat(GO:0030126) |
0.1 | 0.3 | GO:0031084 | BLOC-2 complex(GO:0031084) |
0.1 | 0.9 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.1 | 0.2 | GO:0032280 | symmetric synapse(GO:0032280) |
0.1 | 1.5 | GO:0032155 | cell division site(GO:0032153) cell division site part(GO:0032155) |
0.1 | 0.3 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.1 | 0.8 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.1 | 0.1 | GO:0005593 | FACIT collagen trimer(GO:0005593) collagen type IX trimer(GO:0005594) |
0.1 | 0.2 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
0.1 | 0.3 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.1 | 0.3 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
0.1 | 3.3 | GO:0045171 | intercellular bridge(GO:0045171) |
0.1 | 0.3 | GO:0045261 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
0.1 | 0.4 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.1 | 2.1 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
0.1 | 1.5 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.1 | 1.2 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
0.1 | 0.6 | GO:0045180 | basal cortex(GO:0045180) |
0.1 | 0.4 | GO:0036128 | CatSper complex(GO:0036128) |
0.1 | 0.2 | GO:0072687 | meiotic spindle(GO:0072687) |
0.1 | 0.8 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
0.1 | 0.8 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.1 | 0.4 | GO:0044294 | dendritic growth cone(GO:0044294) |
0.1 | 1.0 | GO:0031083 | BLOC-1 complex(GO:0031083) |
0.1 | 0.3 | GO:0000938 | GARP complex(GO:0000938) |
0.1 | 3.9 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
0.1 | 1.5 | GO:0031941 | filamentous actin(GO:0031941) |
0.1 | 0.2 | GO:0000923 | equatorial microtubule organizing center(GO:0000923) |
0.1 | 0.8 | GO:0097431 | mitotic spindle pole(GO:0097431) |
0.1 | 0.4 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.1 | 0.2 | GO:0001939 | female pronucleus(GO:0001939) |
0.1 | 0.6 | GO:0031143 | pseudopodium(GO:0031143) |
0.1 | 0.2 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
0.1 | 0.8 | GO:0072546 | ER membrane protein complex(GO:0072546) |
0.1 | 0.3 | GO:0071439 | clathrin complex(GO:0071439) |
0.1 | 0.6 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
0.1 | 0.7 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.1 | 0.3 | GO:0035339 | SPOTS complex(GO:0035339) |
0.1 | 3.2 | GO:0016459 | myosin complex(GO:0016459) |
0.1 | 1.1 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.1 | 0.6 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
0.1 | 1.9 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.1 | 0.3 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
0.1 | 2.5 | GO:0060170 | ciliary membrane(GO:0060170) |
0.1 | 0.5 | GO:0033263 | CORVET complex(GO:0033263) |
0.1 | 0.3 | GO:0061574 | ASAP complex(GO:0061574) |
0.1 | 0.2 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.1 | 0.3 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
0.1 | 0.3 | GO:0001739 | sex chromatin(GO:0001739) |
0.1 | 0.3 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
0.1 | 0.8 | GO:0044665 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
0.1 | 0.1 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
0.1 | 0.5 | GO:0005861 | troponin complex(GO:0005861) |
0.1 | 1.6 | GO:0097228 | sperm principal piece(GO:0097228) |
0.1 | 0.2 | GO:0005588 | collagen type V trimer(GO:0005588) |
0.1 | 0.3 | GO:0045293 | mRNA editing complex(GO:0045293) |
0.1 | 0.2 | GO:0032444 | activin responsive factor complex(GO:0032444) |
0.1 | 0.1 | GO:0071564 | npBAF complex(GO:0071564) |
0.1 | 0.1 | GO:0005642 | annulate lamellae(GO:0005642) |
0.1 | 0.5 | GO:0090576 | RNA polymerase III transcription factor complex(GO:0090576) |
0.1 | 3.3 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.1 | 0.1 | GO:1990423 | RZZ complex(GO:1990423) |
0.1 | 0.9 | GO:0090545 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
0.1 | 0.1 | GO:0033010 | paranodal junction(GO:0033010) |
0.1 | 0.3 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
0.1 | 0.3 | GO:0002177 | manchette(GO:0002177) |
0.1 | 3.4 | GO:0005811 | lipid particle(GO:0005811) |
0.1 | 0.8 | GO:0001891 | phagocytic cup(GO:0001891) |
0.1 | 0.3 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.1 | 0.2 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
0.1 | 0.4 | GO:0001674 | female germ cell nucleus(GO:0001674) |
0.1 | 0.1 | GO:0016939 | kinesin II complex(GO:0016939) |
0.1 | 0.3 | GO:0030478 | actin cap(GO:0030478) |
0.1 | 0.1 | GO:0030663 | COPI-coated vesicle membrane(GO:0030663) |
0.1 | 0.1 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.1 | 0.2 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
0.1 | 0.4 | GO:0035102 | PRC1 complex(GO:0035102) |
0.1 | 0.7 | GO:0032039 | integrator complex(GO:0032039) |
0.1 | 1.6 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
0.1 | 4.8 | GO:0070382 | exocytic vesicle(GO:0070382) |
0.1 | 0.2 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
0.1 | 0.9 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.1 | 0.3 | GO:0016589 | NURF complex(GO:0016589) |
0.1 | 0.3 | GO:0090543 | Flemming body(GO:0090543) |
0.1 | 2.9 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
0.1 | 0.4 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
0.1 | 0.4 | GO:0070847 | core mediator complex(GO:0070847) |
0.1 | 0.2 | GO:0070695 | FHF complex(GO:0070695) |
0.1 | 0.2 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
0.1 | 0.1 | GO:0019815 | B cell receptor complex(GO:0019815) |
0.1 | 0.2 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
0.1 | 0.2 | GO:0044308 | axonal spine(GO:0044308) |
0.1 | 4.3 | GO:0097014 | axoneme(GO:0005930) ciliary plasm(GO:0097014) |
0.1 | 0.3 | GO:0010369 | chromocenter(GO:0010369) |
0.1 | 0.9 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
0.1 | 0.1 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
0.1 | 0.7 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.1 | 0.4 | GO:0030867 | rough endoplasmic reticulum membrane(GO:0030867) |
0.1 | 0.9 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.1 | 0.9 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
0.1 | 0.5 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.1 | 0.1 | GO:0097451 | glial limiting end-foot(GO:0097451) |
0.1 | 1.8 | GO:0043198 | dendritic shaft(GO:0043198) |
0.1 | 0.1 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
0.1 | 0.4 | GO:0071014 | post-mRNA release spliceosomal complex(GO:0071014) |
0.1 | 0.2 | GO:0031983 | vesicle lumen(GO:0031983) |
0.1 | 0.9 | GO:0001673 | male germ cell nucleus(GO:0001673) |
0.1 | 0.7 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
0.1 | 1.0 | GO:0030904 | retromer complex(GO:0030904) |
0.1 | 0.2 | GO:0097342 | ripoptosome(GO:0097342) |
0.1 | 0.2 | GO:0071953 | elastic fiber(GO:0071953) |
0.1 | 0.6 | GO:0016514 | SWI/SNF complex(GO:0016514) |
0.1 | 0.2 | GO:0035748 | myelin sheath abaxonal region(GO:0035748) |
0.1 | 0.5 | GO:0031616 | spindle pole centrosome(GO:0031616) |
0.1 | 0.4 | GO:0031045 | dense core granule(GO:0031045) |
0.1 | 0.4 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.1 | 0.4 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.1 | 1.8 | GO:0030672 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
0.1 | 0.8 | GO:0005684 | U2-type spliceosomal complex(GO:0005684) |
0.0 | 0.1 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.0 | 0.3 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.0 | 0.1 | GO:0000805 | X chromosome(GO:0000805) |
0.0 | 0.1 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.0 | 0.3 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
0.0 | 5.6 | GO:0005770 | late endosome(GO:0005770) |
0.0 | 0.1 | GO:0043202 | lysosomal lumen(GO:0043202) |
0.0 | 2.1 | GO:0005761 | organellar ribosome(GO:0000313) mitochondrial ribosome(GO:0005761) |
0.0 | 0.1 | GO:0098827 | endoplasmic reticulum subcompartment(GO:0098827) |
0.0 | 0.3 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
0.0 | 0.1 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
0.0 | 0.0 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.0 | 0.3 | GO:0071546 | pi-body(GO:0071546) |
0.0 | 0.1 | GO:0070822 | Sin3-type complex(GO:0070822) |
0.0 | 4.0 | GO:0005759 | mitochondrial matrix(GO:0005759) |
0.0 | 0.3 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
0.0 | 0.5 | GO:0005675 | holo TFIIH complex(GO:0005675) |
0.0 | 0.2 | GO:0098536 | deuterosome(GO:0098536) |
0.0 | 0.3 | GO:0033061 | DNA recombinase mediator complex(GO:0033061) |
0.0 | 0.7 | GO:0005614 | interstitial matrix(GO:0005614) |
0.0 | 0.4 | GO:0005583 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.0 | 0.1 | GO:0097648 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
0.0 | 0.1 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.0 | 1.1 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.0 | 0.1 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.0 | 0.3 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
0.0 | 0.5 | GO:0060077 | inhibitory synapse(GO:0060077) |
0.0 | 0.2 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.0 | 1.5 | GO:0042641 | actomyosin(GO:0042641) |
0.0 | 2.1 | GO:0055037 | recycling endosome(GO:0055037) |
0.0 | 0.1 | GO:0044292 | dendrite terminus(GO:0044292) |
0.0 | 0.1 | GO:0045120 | pronucleus(GO:0045120) |
0.0 | 0.3 | GO:0019908 | nuclear cyclin-dependent protein kinase holoenzyme complex(GO:0019908) |
0.0 | 0.2 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.0 | 0.4 | GO:0035631 | CD40 receptor complex(GO:0035631) |
0.0 | 1.3 | GO:0005871 | kinesin complex(GO:0005871) |
0.0 | 0.5 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
0.0 | 0.1 | GO:0030008 | TRAPP complex(GO:0030008) |
0.0 | 0.0 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
0.0 | 0.1 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
0.0 | 0.4 | GO:0035371 | microtubule plus-end(GO:0035371) |
0.0 | 0.2 | GO:0000242 | pericentriolar material(GO:0000242) |
0.0 | 0.4 | GO:0030139 | endocytic vesicle(GO:0030139) |
0.0 | 0.5 | GO:0042734 | presynaptic membrane(GO:0042734) |
0.0 | 2.2 | GO:0090575 | RNA polymerase II transcription factor complex(GO:0090575) |
0.0 | 0.1 | GO:0089701 | U2AF(GO:0089701) |
0.0 | 0.1 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.0 | 0.0 | GO:0000109 | nucleotide-excision repair complex(GO:0000109) |
0.0 | 2.6 | GO:0043204 | perikaryon(GO:0043204) |
0.0 | 0.1 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
0.0 | 1.5 | GO:0005905 | clathrin-coated pit(GO:0005905) |
0.0 | 2.0 | GO:0005814 | centriole(GO:0005814) |
0.0 | 0.2 | GO:0031209 | SCAR complex(GO:0031209) |
0.0 | 0.1 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
0.0 | 0.6 | GO:0005839 | proteasome core complex(GO:0005839) |
0.0 | 0.3 | GO:0000124 | SAGA complex(GO:0000124) |
0.0 | 0.4 | GO:0030880 | RNA polymerase complex(GO:0030880) |
0.0 | 0.1 | GO:0060091 | kinocilium(GO:0060091) |
0.0 | 0.2 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
0.0 | 0.1 | GO:0042613 | MHC class II protein complex(GO:0042613) |
0.0 | 0.8 | GO:0045335 | phagocytic vesicle(GO:0045335) |
0.0 | 2.0 | GO:0031514 | motile cilium(GO:0031514) |
0.0 | 0.1 | GO:1990909 | Wnt signalosome(GO:1990909) |
0.0 | 1.6 | GO:0030532 | small nuclear ribonucleoprotein complex(GO:0030532) |
0.0 | 0.1 | GO:0001652 | granular component(GO:0001652) |
0.0 | 0.8 | GO:0016592 | mediator complex(GO:0016592) |
0.0 | 0.2 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
0.0 | 0.7 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
0.0 | 0.0 | GO:0097450 | astrocyte end-foot(GO:0097450) |
0.0 | 0.3 | GO:0015030 | Cajal body(GO:0015030) |
0.0 | 0.8 | GO:0000922 | spindle pole(GO:0000922) |
0.0 | 1.2 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
0.0 | 0.6 | GO:0005876 | spindle microtubule(GO:0005876) |
0.0 | 0.3 | GO:0001527 | microfibril(GO:0001527) |
0.0 | 1.0 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
0.0 | 0.2 | GO:0030660 | Golgi-associated vesicle membrane(GO:0030660) |
0.0 | 0.0 | GO:0030135 | coated vesicle(GO:0030135) |
0.0 | 0.3 | GO:0031011 | Ino80 complex(GO:0031011) |
0.0 | 0.2 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.0 | 0.1 | GO:0097452 | GAIT complex(GO:0097452) |
0.0 | 0.3 | GO:0005719 | nuclear euchromatin(GO:0005719) |
0.0 | 0.1 | GO:0048179 | activin receptor complex(GO:0048179) |
0.0 | 0.1 | GO:0043196 | varicosity(GO:0043196) |
0.0 | 0.1 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.0 | 0.1 | GO:0016528 | sarcoplasm(GO:0016528) |
0.0 | 0.3 | GO:0042470 | melanosome(GO:0042470) pigment granule(GO:0048770) |
0.0 | 2.2 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
0.0 | 0.1 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
0.0 | 0.2 | GO:0019814 | immunoglobulin complex(GO:0019814) immunoglobulin complex, circulating(GO:0042571) |
0.0 | 0.0 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
0.0 | 0.2 | GO:0036379 | striated muscle thin filament(GO:0005865) myofilament(GO:0036379) |
0.0 | 5.1 | GO:0005813 | centrosome(GO:0005813) |
0.0 | 23.9 | GO:0005783 | endoplasmic reticulum(GO:0005783) |
0.0 | 0.3 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
0.0 | 0.1 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
0.0 | 0.1 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
0.0 | 0.1 | GO:0005796 | Golgi lumen(GO:0005796) |
0.0 | 0.0 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.0 | 0.1 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
0.0 | 0.1 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.0 | 0.1 | GO:0042611 | MHC protein complex(GO:0042611) |
0.0 | 0.1 | GO:0070876 | SOSS complex(GO:0070876) |
0.0 | 0.2 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.0 | 1.4 | GO:0005681 | spliceosomal complex(GO:0005681) |
0.0 | 4.8 | GO:0005578 | proteinaceous extracellular matrix(GO:0005578) |
0.0 | 0.1 | GO:1990130 | Iml1 complex(GO:1990130) |
0.0 | 0.1 | GO:0033268 | node of Ranvier(GO:0033268) |
0.0 | 0.0 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
0.0 | 0.1 | GO:0036038 | MKS complex(GO:0036038) |
0.0 | 0.0 | GO:0043219 | lateral loop(GO:0043219) |
0.0 | 0.6 | GO:0030018 | Z disc(GO:0030018) |
0.0 | 0.5 | GO:0030426 | growth cone(GO:0030426) |
0.0 | 0.1 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.0 | 0.3 | GO:0001772 | immunological synapse(GO:0001772) |
0.0 | 0.0 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
0.0 | 0.8 | GO:0016607 | nuclear speck(GO:0016607) |
0.0 | 0.0 | GO:0044306 | neuron projection terminus(GO:0044306) |
0.0 | 0.0 | GO:0031261 | GINS complex(GO:0000811) DNA replication preinitiation complex(GO:0031261) |
0.0 | 0.1 | GO:0061700 | GATOR2 complex(GO:0061700) |
0.0 | 0.5 | GO:0045095 | keratin filament(GO:0045095) |
0.0 | 2.0 | GO:0030424 | axon(GO:0030424) |
0.0 | 0.1 | GO:0030673 | axolemma(GO:0030673) |
0.0 | 0.0 | GO:0070531 | BRCA1-A complex(GO:0070531) |
0.0 | 1.3 | GO:0045211 | postsynaptic membrane(GO:0045211) |
0.0 | 0.2 | GO:0034707 | chloride channel complex(GO:0034707) |
0.0 | 0.0 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.0 | 0.9 | GO:0070160 | occluding junction(GO:0070160) |
0.0 | 0.0 | GO:0034991 | nuclear meiotic cohesin complex(GO:0034991) |
0.0 | 0.0 | GO:0034706 | sodium channel complex(GO:0034706) |
0.0 | 0.0 | GO:0097209 | epidermal lamellar body(GO:0097209) |
0.0 | 0.3 | GO:0000776 | kinetochore(GO:0000776) |
0.0 | 1.5 | GO:0048471 | perinuclear region of cytoplasm(GO:0048471) |
0.0 | 0.7 | GO:0098852 | lysosomal membrane(GO:0005765) lytic vacuole membrane(GO:0098852) |
0.0 | 0.0 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.0 | 0.1 | GO:0000777 | condensed chromosome kinetochore(GO:0000777) |
0.0 | 5.7 | GO:0005794 | Golgi apparatus(GO:0005794) |
0.0 | 0.0 | GO:0044393 | microspike(GO:0044393) |
0.0 | 0.0 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.8 | 5.4 | GO:0070644 | vitamin D response element binding(GO:0070644) |
1.1 | 3.2 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
1.0 | 6.3 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
1.0 | 2.9 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
0.8 | 3.3 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
0.8 | 3.2 | GO:0047105 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
0.7 | 2.2 | GO:0004771 | sterol esterase activity(GO:0004771) |
0.7 | 2.2 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.7 | 2.9 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.7 | 7.4 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
0.6 | 1.9 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.6 | 1.9 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.6 | 1.8 | GO:0032190 | acrosin binding(GO:0032190) |
0.6 | 1.2 | GO:0038181 | bile acid receptor activity(GO:0038181) |
0.5 | 1.6 | GO:0035514 | DNA demethylase activity(GO:0035514) |
0.5 | 7.1 | GO:0015643 | toxic substance binding(GO:0015643) |
0.5 | 3.4 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
0.5 | 1.4 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.5 | 1.4 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
0.4 | 0.9 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) |
0.4 | 1.2 | GO:0015154 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
0.4 | 0.4 | GO:0018423 | protein C-terminal leucine carboxyl O-methyltransferase activity(GO:0018423) |
0.4 | 1.2 | GO:0032551 | UTP binding(GO:0002134) pyrimidine ribonucleoside binding(GO:0032551) |
0.4 | 1.2 | GO:0018598 | fluorene oxygenase activity(GO:0018585) mono-butyltin dioxygenase activity(GO:0018586) tri-n-butyltin dioxygenase activity(GO:0018588) di-n-butyltin dioxygenase activity(GO:0018589) methylsilanetriol hydroxylase activity(GO:0018590) methyl tertiary butyl ether 3-monooxygenase activity(GO:0018591) 4-nitrocatechol 4-monooxygenase activity(GO:0018592) 4-chlorophenoxyacetate monooxygenase activity(GO:0018593) tert-butanol 2-monooxygenase activity(GO:0018594) alpha-pinene monooxygenase activity(GO:0018595) dimethylsilanediol hydroxylase activity(GO:0018596) ammonia monooxygenase activity(GO:0018597) hydroxymethylsilanetriol oxidase activity(GO:0018598) 2-hydroxyisobutyrate 3-monooxygenase activity(GO:0018599) alpha-pinene dehydrogenase activity(GO:0018600) bisphenol A hydroxylase B activity(GO:0034559) 2,2-bis(4-hydroxyphenyl)-1-propanol hydroxylase activity(GO:0034562) 9-fluorenone-3,4-dioxygenase activity(GO:0034786) anthracene 9,10-dioxygenase activity(GO:0034816) 2-(methylthio)benzothiazole monooxygenase activity(GO:0034857) 2-hydroxybenzothiazole monooxygenase activity(GO:0034858) benzothiazole monooxygenase activity(GO:0034859) 2,6-dihydroxybenzothiazole monooxygenase activity(GO:0034862) pinacolone 5-monooxygenase activity(GO:0034870) thioacetamide S-oxygenase activity(GO:0034873) thioacetamide S-oxide S-oxygenase activity(GO:0034874) endosulfan monooxygenase I activity(GO:0034888) N-nitrodimethylamine hydroxylase activity(GO:0034893) 4-(1-ethyl-1,4-dimethyl-pentyl)phenol monoxygenase activity(GO:0034897) endosulfan ether monooxygenase activity(GO:0034903) pyrene 4,5-monooxygenase activity(GO:0034925) pyrene 1,2-monooxygenase activity(GO:0034927) 1-hydroxypyrene 6,7-monooxygenase activity(GO:0034928) 1-hydroxypyrene 7,8-monooxygenase activity(GO:0034929) phenylboronic acid monooxygenase activity(GO:0034950) spheroidene monooxygenase activity(GO:0043823) |
0.4 | 1.9 | GO:0017040 | ceramidase activity(GO:0017040) |
0.4 | 1.1 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
0.4 | 1.5 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
0.4 | 1.5 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
0.4 | 1.1 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
0.4 | 1.8 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
0.4 | 1.8 | GO:0000295 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) |
0.4 | 1.8 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
0.4 | 1.1 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
0.4 | 1.8 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
0.4 | 1.1 | GO:0035473 | lipase binding(GO:0035473) |
0.3 | 1.4 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
0.3 | 1.0 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.3 | 1.0 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
0.3 | 2.7 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
0.3 | 0.3 | GO:0004809 | tRNA (guanine-N2-)-methyltransferase activity(GO:0004809) |
0.3 | 1.3 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.3 | 0.9 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
0.3 | 0.9 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.3 | 0.9 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
0.3 | 2.8 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.3 | 1.5 | GO:0070728 | leucine binding(GO:0070728) |
0.3 | 3.2 | GO:0052811 | cobinamide kinase activity(GO:0008819) phytol kinase activity(GO:0010276) phenol kinase activity(GO:0018720) cyclin-dependent protein kinase activating kinase regulator activity(GO:0019914) inositol tetrakisphosphate 2-kinase activity(GO:0032942) heptose 7-phosphate kinase activity(GO:0033785) aminoglycoside phosphotransferase activity(GO:0034071) eukaryotic elongation factor-2 kinase regulator activity(GO:0042556) eukaryotic elongation factor-2 kinase activator activity(GO:0042557) LPPG:FO 2-phospho-L-lactate transferase activity(GO:0043743) cytidine kinase activity(GO:0043771) glycerate 2-kinase activity(GO:0043798) (S)-lactate 2-kinase activity(GO:0043841) phosphoserine:homoserine phosphotransferase activity(GO:0043899) L-seryl-tRNA(Sec) kinase activity(GO:0043915) phosphocholine transferase activity(GO:0044605) GTP-dependent polynucleotide kinase activity(GO:0051735) farnesol kinase activity(GO:0052668) CTP:2-trans,-6-trans-farnesol kinase activity(GO:0052669) geraniol kinase activity(GO:0052670) geranylgeraniol kinase activity(GO:0052671) CTP:geranylgeraniol kinase activity(GO:0052672) prenol kinase activity(GO:0052673) 1-phosphatidylinositol-5-kinase activity(GO:0052810) 1-phosphatidylinositol-3-phosphate 4-kinase activity(GO:0052811) phosphatidylinositol-3,4-bisphosphate 5-kinase activity(GO:0052812) inositol-3,4,6-trisphosphate 1-kinase activity(GO:0052835) inositol 5-diphosphate pentakisphosphate 5-kinase activity(GO:0052836) inositol diphosphate tetrakisphosphate kinase activity(GO:0052839) |
0.3 | 1.2 | GO:0031781 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
0.3 | 2.3 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
0.3 | 2.3 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.3 | 0.9 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
0.3 | 1.4 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.3 | 0.9 | GO:0004849 | uridine kinase activity(GO:0004849) |
0.3 | 0.8 | GO:0008142 | oxysterol binding(GO:0008142) |
0.3 | 0.5 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
0.3 | 1.3 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
0.3 | 1.1 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.3 | 0.8 | GO:0004705 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
0.3 | 0.8 | GO:0019862 | IgA binding(GO:0019862) |
0.3 | 0.3 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.3 | 1.3 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
0.3 | 0.3 | GO:0008905 | mannose-phosphate guanylyltransferase activity(GO:0008905) |
0.3 | 0.8 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
0.3 | 1.3 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.2 | 0.2 | GO:0000701 | purine-specific mismatch base pair DNA N-glycosylase activity(GO:0000701) |
0.2 | 0.2 | GO:0004331 | fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
0.2 | 0.7 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.2 | 0.9 | GO:0097001 | ceramide binding(GO:0097001) |
0.2 | 0.7 | GO:0004359 | glutaminase activity(GO:0004359) |
0.2 | 3.1 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
0.2 | 0.2 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.2 | 0.7 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.2 | 0.6 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.2 | 0.6 | GO:0016015 | morphogen activity(GO:0016015) |
0.2 | 0.6 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.2 | 0.6 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.2 | 0.4 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.2 | 0.6 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
0.2 | 0.4 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.2 | 0.2 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
0.2 | 0.8 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.2 | 1.6 | GO:0098599 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
0.2 | 1.2 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
0.2 | 0.6 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
0.2 | 1.6 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.2 | 0.6 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
0.2 | 0.6 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
0.2 | 2.0 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.2 | 0.6 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
0.2 | 1.0 | GO:0016151 | nickel cation binding(GO:0016151) |
0.2 | 0.4 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
0.2 | 1.9 | GO:0034713 | type I transforming growth factor beta receptor binding(GO:0034713) |
0.2 | 0.8 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.2 | 0.8 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.2 | 0.8 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
0.2 | 0.6 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
0.2 | 0.4 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
0.2 | 0.8 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.2 | 0.7 | GO:0004337 | geranyltranstransferase activity(GO:0004337) |
0.2 | 1.3 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
0.2 | 0.4 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
0.2 | 0.5 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
0.2 | 1.2 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
0.2 | 0.4 | GO:0030911 | TPR domain binding(GO:0030911) |
0.2 | 0.5 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
0.2 | 0.5 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
0.2 | 2.1 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.2 | 2.1 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.2 | 0.2 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.2 | 0.7 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
0.2 | 1.0 | GO:0015288 | porin activity(GO:0015288) |
0.2 | 0.5 | GO:0004103 | choline kinase activity(GO:0004103) |
0.2 | 0.8 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
0.2 | 1.0 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
0.2 | 0.5 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
0.2 | 3.0 | GO:0003756 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
0.2 | 0.8 | GO:0009378 | four-way junction helicase activity(GO:0009378) |
0.2 | 0.8 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
0.2 | 0.8 | GO:0001849 | complement component C1q binding(GO:0001849) |
0.2 | 1.2 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
0.2 | 0.5 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
0.2 | 0.5 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
0.2 | 1.1 | GO:0046790 | virion binding(GO:0046790) |
0.2 | 3.6 | GO:0003954 | NADH dehydrogenase activity(GO:0003954) |
0.2 | 0.2 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
0.2 | 0.5 | GO:0004619 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
0.2 | 0.3 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.2 | 0.8 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
0.2 | 1.0 | GO:0050733 | RS domain binding(GO:0050733) |
0.2 | 0.6 | GO:0032554 | purine deoxyribonucleotide binding(GO:0032554) |
0.2 | 1.0 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
0.2 | 2.7 | GO:0005112 | Notch binding(GO:0005112) |
0.2 | 0.6 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.2 | 0.5 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.2 | 2.0 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
0.2 | 0.2 | GO:0015142 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.2 | 0.2 | GO:0036137 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
0.2 | 0.5 | GO:0043559 | insulin binding(GO:0043559) |
0.2 | 0.2 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
0.2 | 1.7 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
0.2 | 0.5 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.2 | 0.5 | GO:0070137 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
0.1 | 1.3 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
0.1 | 1.0 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.1 | 1.9 | GO:0043274 | phospholipase binding(GO:0043274) |
0.1 | 0.6 | GO:0004488 | methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
0.1 | 0.6 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
0.1 | 0.4 | GO:0055100 | adiponectin binding(GO:0055100) |
0.1 | 0.4 | GO:0004967 | glucagon receptor activity(GO:0004967) |
0.1 | 1.9 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
0.1 | 0.6 | GO:0038100 | nodal binding(GO:0038100) |
0.1 | 1.4 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
0.1 | 1.3 | GO:0016004 | phospholipase activator activity(GO:0016004) |
0.1 | 0.6 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
0.1 | 0.8 | GO:0004017 | adenylate kinase activity(GO:0004017) |
0.1 | 0.4 | GO:0019864 | IgG binding(GO:0019864) |
0.1 | 0.4 | GO:0031686 | A1 adenosine receptor binding(GO:0031686) |
0.1 | 0.4 | GO:0031685 | adenosine receptor binding(GO:0031685) |
0.1 | 1.3 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
0.1 | 0.7 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.1 | 0.5 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
0.1 | 0.5 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
0.1 | 0.5 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.1 | 0.4 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.1 | 2.6 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
0.1 | 1.3 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.1 | 0.4 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.1 | 0.1 | GO:0001031 | RNA polymerase III type 1 promoter DNA binding(GO:0001030) RNA polymerase III type 2 promoter DNA binding(GO:0001031) RNA polymerase III type 3 promoter DNA binding(GO:0001032) 5S rDNA binding(GO:0080084) |
0.1 | 0.5 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.1 | 0.4 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
0.1 | 0.8 | GO:0043426 | MRF binding(GO:0043426) |
0.1 | 0.3 | GO:0004779 | sulfate adenylyltransferase activity(GO:0004779) |
0.1 | 0.3 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.1 | 0.9 | GO:0005113 | patched binding(GO:0005113) |
0.1 | 2.7 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
0.1 | 0.3 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
0.1 | 1.5 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.1 | 0.5 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
0.1 | 0.6 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.1 | 0.4 | GO:0004724 | magnesium-dependent protein serine/threonine phosphatase activity(GO:0004724) |
0.1 | 1.9 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
0.1 | 0.3 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
0.1 | 2.2 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
0.1 | 0.1 | GO:0034711 | inhibin binding(GO:0034711) |
0.1 | 0.3 | GO:0097016 | L27 domain binding(GO:0097016) |
0.1 | 1.9 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.1 | 0.1 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
0.1 | 0.7 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
0.1 | 1.0 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
0.1 | 0.5 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
0.1 | 0.4 | GO:0043515 | kinetochore binding(GO:0043515) |
0.1 | 0.4 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
0.1 | 0.2 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
0.1 | 1.7 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
0.1 | 0.5 | GO:0052795 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
0.1 | 0.4 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.1 | 1.1 | GO:0002162 | dystroglycan binding(GO:0002162) |
0.1 | 0.1 | GO:0032557 | pyrimidine ribonucleotide binding(GO:0032557) |
0.1 | 0.4 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
0.1 | 0.5 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
0.1 | 3.7 | GO:0080032 | prenylcysteine methylesterase activity(GO:0010296) 1-oxa-2-oxocycloheptane lactonase activity(GO:0018731) sulfolactone hydrolase activity(GO:0018732) butyrolactone hydrolase activity(GO:0018734) endosulfan lactone lactonase activity(GO:0034892) L-ascorbate 6-phosphate lactonase activity(GO:0035460) Ser-tRNA(Thr) hydrolase activity(GO:0043905) Ala-tRNA(Pro) hydrolase activity(GO:0043906) Cys-tRNA(Pro) hydrolase activity(GO:0043907) Ser(Gly)-tRNA(Ala) hydrolase activity(GO:0043908) all-trans-retinyl-palmitate hydrolase, all-trans-retinol forming activity(GO:0047376) mannosyl-oligosaccharide 1,6-alpha-mannosidase activity(GO:0052767) mannosyl-oligosaccharide 1,3-alpha-mannosidase activity(GO:0052768) methyl indole-3-acetate esterase activity(GO:0080030) methyl salicylate esterase activity(GO:0080031) methyl jasmonate esterase activity(GO:0080032) |
0.1 | 0.5 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
0.1 | 0.6 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
0.1 | 2.4 | GO:0003785 | actin monomer binding(GO:0003785) |
0.1 | 0.2 | GO:0030172 | troponin C binding(GO:0030172) |
0.1 | 1.7 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
0.1 | 1.1 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
0.1 | 0.2 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.1 | 0.2 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.1 | 0.7 | GO:0033695 | oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
0.1 | 0.2 | GO:0015141 | succinate transmembrane transporter activity(GO:0015141) |
0.1 | 0.5 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.1 | 0.9 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.1 | 0.3 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.1 | 1.6 | GO:0004844 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
0.1 | 0.3 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
0.1 | 0.8 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.1 | 0.3 | GO:0071253 | connexin binding(GO:0071253) |
0.1 | 0.3 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
0.1 | 0.8 | GO:0016679 | oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) |
0.1 | 0.7 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
0.1 | 0.4 | GO:0052834 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
0.1 | 0.1 | GO:0042281 | dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase activity(GO:0042281) |
0.1 | 1.2 | GO:0008061 | chitin binding(GO:0008061) |
0.1 | 0.4 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
0.1 | 0.2 | GO:0016300 | tRNA (uracil) methyltransferase activity(GO:0016300) |
0.1 | 0.9 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
0.1 | 0.3 | GO:0004096 | catalase activity(GO:0004096) |
0.1 | 0.8 | GO:0033677 | DNA/RNA helicase activity(GO:0033677) |
0.1 | 0.1 | GO:0035877 | death effector domain binding(GO:0035877) |
0.1 | 0.2 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
0.1 | 0.3 | GO:0019002 | GMP binding(GO:0019002) |
0.1 | 1.3 | GO:0017160 | Ral GTPase binding(GO:0017160) |
0.1 | 1.1 | GO:0015250 | water channel activity(GO:0015250) |
0.1 | 0.4 | GO:0052851 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
0.1 | 0.4 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.1 | 0.8 | GO:0051766 | inositol trisphosphate kinase activity(GO:0051766) |
0.1 | 0.5 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
0.1 | 1.9 | GO:0016645 | oxidoreductase activity, acting on the CH-NH group of donors(GO:0016645) |
0.1 | 0.6 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
0.1 | 2.5 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.1 | 0.3 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
0.1 | 0.1 | GO:0031404 | chloride ion binding(GO:0031404) |
0.1 | 0.7 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.1 | 1.3 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.1 | 2.9 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
0.1 | 0.3 | GO:1901612 | cardiolipin binding(GO:1901612) |
0.1 | 0.1 | GO:0043398 | HLH domain binding(GO:0043398) |
0.1 | 0.1 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
0.1 | 0.7 | GO:0019763 | immunoglobulin receptor activity(GO:0019763) |
0.1 | 0.4 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
0.1 | 0.6 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.1 | 0.3 | GO:0000182 | rDNA binding(GO:0000182) |
0.1 | 2.9 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
0.1 | 1.5 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
0.1 | 0.6 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.1 | 0.6 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
0.1 | 0.5 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) |
0.1 | 1.0 | GO:0035198 | miRNA binding(GO:0035198) |
0.1 | 0.4 | GO:0001640 | adenylate cyclase inhibiting G-protein coupled glutamate receptor activity(GO:0001640) |
0.1 | 5.3 | GO:0051082 | unfolded protein binding(GO:0051082) |
0.1 | 0.3 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
0.1 | 0.6 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
0.1 | 1.1 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
0.1 | 0.7 | GO:0008430 | selenium binding(GO:0008430) |
0.1 | 1.5 | GO:0008376 | acetylgalactosaminyltransferase activity(GO:0008376) |
0.1 | 0.6 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
0.1 | 4.2 | GO:0005548 | phospholipid transporter activity(GO:0005548) |
0.1 | 0.9 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
0.1 | 0.6 | GO:0046972 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
0.1 | 0.4 | GO:0015248 | sterol transporter activity(GO:0015248) |
0.1 | 0.5 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.1 | 0.6 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
0.1 | 0.2 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
0.1 | 0.3 | GO:0001164 | RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
0.1 | 1.8 | GO:0030332 | cyclin binding(GO:0030332) |
0.1 | 0.4 | GO:0016721 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
0.1 | 0.4 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
0.1 | 1.5 | GO:0004889 | acetylcholine-activated cation-selective channel activity(GO:0004889) |
0.1 | 0.5 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
0.1 | 2.5 | GO:0004177 | aminopeptidase activity(GO:0004177) |
0.1 | 0.4 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
0.1 | 0.3 | GO:0008443 | phosphofructokinase activity(GO:0008443) |
0.1 | 0.2 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
0.1 | 0.2 | GO:0050692 | DBD domain binding(GO:0050692) |
0.1 | 0.5 | GO:0034046 | poly(G) binding(GO:0034046) |
0.1 | 0.3 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.1 | 1.4 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.1 | 0.5 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.1 | 1.1 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
0.1 | 0.2 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
0.1 | 0.3 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
0.1 | 0.8 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.1 | 0.3 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
0.1 | 0.3 | GO:0035671 | enone reductase activity(GO:0035671) |
0.1 | 1.0 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
0.1 | 2.6 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
0.1 | 0.8 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
0.1 | 0.3 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.1 | 0.2 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
0.1 | 0.2 | GO:0070905 | serine binding(GO:0070905) |
0.1 | 0.2 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
0.1 | 0.1 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.1 | 0.2 | GO:0051990 | (R)-2-hydroxyglutarate dehydrogenase activity(GO:0051990) |
0.1 | 0.3 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
0.1 | 1.6 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
0.1 | 0.1 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
0.1 | 0.7 | GO:0070700 | BMP receptor binding(GO:0070700) |
0.1 | 0.4 | GO:0017070 | U6 snRNA binding(GO:0017070) |
0.1 | 0.2 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.1 | 0.2 | GO:0003909 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
0.1 | 0.2 | GO:0019107 | myristoyltransferase activity(GO:0019107) |
0.1 | 0.2 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
0.1 | 0.6 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
0.1 | 1.2 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
0.1 | 0.4 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.1 | 0.2 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
0.1 | 0.3 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.1 | 1.5 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
0.1 | 0.6 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
0.1 | 1.4 | GO:0005246 | calcium channel regulator activity(GO:0005246) |
0.1 | 0.6 | GO:0004029 | aldehyde dehydrogenase (NAD) activity(GO:0004029) |
0.1 | 1.5 | GO:0051059 | NF-kappaB binding(GO:0051059) |
0.1 | 1.4 | GO:0046961 | proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
0.1 | 0.3 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
0.1 | 1.0 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.1 | 0.1 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
0.1 | 0.3 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.1 | 0.1 | GO:0030619 | U1 snRNA binding(GO:0030619) |
0.1 | 2.5 | GO:0016749 | N-succinyltransferase activity(GO:0016749) |
0.1 | 2.1 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
0.1 | 0.2 | GO:0019961 | interferon binding(GO:0019961) |
0.1 | 1.6 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
0.1 | 0.7 | GO:0030169 | low-density lipoprotein particle binding(GO:0030169) |
0.1 | 0.1 | GO:0005119 | smoothened binding(GO:0005119) |
0.1 | 0.5 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.1 | 0.1 | GO:0030235 | nitric-oxide synthase regulator activity(GO:0030235) |
0.1 | 1.5 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
0.1 | 0.9 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
0.1 | 0.8 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.1 | 0.2 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.1 | 0.3 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
0.1 | 0.1 | GO:0016885 | ligase activity, forming carbon-carbon bonds(GO:0016885) |
0.1 | 1.0 | GO:0032183 | SUMO binding(GO:0032183) |
0.1 | 0.3 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.1 | 0.2 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
0.1 | 0.8 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
0.1 | 0.3 | GO:0001846 | opsonin binding(GO:0001846) |
0.1 | 2.5 | GO:0005109 | frizzled binding(GO:0005109) |
0.1 | 0.2 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
0.1 | 0.3 | GO:0070324 | thyroid hormone binding(GO:0070324) |
0.1 | 0.3 | GO:0032453 | histone demethylase activity (H3-K4 specific)(GO:0032453) |
0.1 | 0.2 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.1 | 0.8 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.1 | 0.2 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
0.1 | 0.1 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
0.1 | 0.1 | GO:0001016 | RNA polymerase III regulatory region DNA binding(GO:0001016) |
0.1 | 1.6 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
0.1 | 0.2 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
0.1 | 0.5 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
0.1 | 0.2 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
0.1 | 0.3 | GO:0031628 | opioid receptor binding(GO:0031628) |
0.1 | 0.2 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.1 | 0.6 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
0.1 | 0.1 | GO:0070538 | oleic acid binding(GO:0070538) |
0.1 | 0.4 | GO:0003720 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
0.1 | 0.3 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
0.1 | 0.6 | GO:0005523 | tropomyosin binding(GO:0005523) |
0.1 | 0.1 | GO:0004030 | aldehyde dehydrogenase [NAD(P)+] activity(GO:0004030) |
0.1 | 0.1 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.1 | 0.1 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.1 | 0.2 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.1 | 0.5 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
0.1 | 3.6 | GO:0000030 | mannosyltransferase activity(GO:0000030) |
0.1 | 0.2 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
0.1 | 0.2 | GO:0061731 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
0.1 | 1.0 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.1 | 0.1 | GO:0070034 | telomerase RNA binding(GO:0070034) |
0.1 | 0.4 | GO:0098634 | protein binding involved in cell-matrix adhesion(GO:0098634) |
0.1 | 0.7 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.1 | 0.4 | GO:0050700 | CARD domain binding(GO:0050700) |
0.1 | 0.8 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
0.1 | 1.7 | GO:0031490 | chromatin DNA binding(GO:0031490) |
0.1 | 1.6 | GO:0070330 | aromatase activity(GO:0070330) |
0.1 | 1.3 | GO:0016675 | oxidoreductase activity, acting on a heme group of donors(GO:0016675) |
0.1 | 1.0 | GO:0031593 | polyubiquitin binding(GO:0031593) |
0.1 | 2.3 | GO:0035064 | methylated histone binding(GO:0035064) |
0.1 | 0.6 | GO:0009881 | photoreceptor activity(GO:0009881) |
0.1 | 0.1 | GO:0070878 | primary miRNA binding(GO:0070878) |
0.1 | 0.2 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.1 | 0.3 | GO:0036002 | pre-mRNA binding(GO:0036002) |
0.1 | 0.3 | GO:0000146 | microfilament motor activity(GO:0000146) |
0.1 | 0.2 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
0.1 | 1.2 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.1 | 0.1 | GO:0018568 | 2,3-dihydroxy DDT 1,2-dioxygenase activity(GO:0018542) phenanthrene dioxygenase activity(GO:0018555) 2,2',3-trihydroxybiphenyl dioxygenase activity(GO:0018556) 1,2-dihydroxyfluorene 1,1-alpha-dioxygenase activity(GO:0018557) 5,6-dihydroxy-3-methyl-2-oxo-1,2-dihydroquinoline dioxygenase activity(GO:0018558) 1,1-dichloro-2-(dihydroxy-4-chlorophenyl)-(4-chlorophenyl)ethene 1,2-dioxygenase activity(GO:0018559) protocatechuate 3,4-dioxygenase type II activity(GO:0018560) 2'-aminobiphenyl-2,3-diol 1,2-dioxygenase activity(GO:0018561) 3,4-dihydroxyfluorene 4,4-alpha-dioxygenase activity(GO:0018562) 2,3-dihydroxy-ethylbenzene 1,2-dioxygenase activity(GO:0018563) carbazole 1,9a-dioxygenase activity(GO:0018564) dihydroxydibenzothiophene dioxygenase activity(GO:0018565) 1,2-dihydroxynaphthalene-6-sulfonate 1,8a-dioxygenase activity(GO:0018566) styrene dioxygenase activity(GO:0018567) 3,4-dihydroxyphenanthrene dioxygenase activity(GO:0018568) hydroquinone 1,2-dioxygenase activity(GO:0018569) p-cumate 2,3-dioxygenase activity(GO:0018570) 2,3-dihydroxy-p-cumate dioxygenase activity(GO:0018571) 3,5-dichlorocatechol 1,2-dioxygenase activity(GO:0018572) 2-aminophenol 1,6-dioxygenase activity(GO:0018573) 2,6-dichloro-p-hydroquinone 1,2-dioxygenase activity(GO:0018574) chlorocatechol 1,2-dioxygenase activity(GO:0018575) catechol dioxygenase activity(GO:0019114) dihydroxyfluorene dioxygenase activity(GO:0019117) 5-aminosalicylate dioxygenase activity(GO:0034543) 3-hydroxy-2-naphthoate 2,3-dioxygenase activity(GO:0034803) benzo(a)pyrene 11,12-dioxygenase activity(GO:0034806) benzo(a)pyrene 4,5-dioxygenase activity(GO:0034808) 4,5-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034810) benzo(a)pyrene 9,10-dioxygenase activity(GO:0034811) 9,10-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034812) benzo(a)pyrene 7,8-dioxygenase activity(GO:0034813) 7,8-dihydroxy benzo(a)pyrene dioxygenase activity(GO:0034814) 1,2-dihydroxy-5,6,7,8-tetrahydronaphthalene extradiol dioxygenase activity(GO:0034827) 2-mercaptobenzothiazole dioxygenase activity(GO:0034834) pyridine-3,4-diol dioxygenase activity(GO:0034895) pyrene dioxygenase activity(GO:0034920) 4,5-dihydroxypyrene dioxygenase activity(GO:0034922) phenanthrene-4-carboxylate dioxygenase activity(GO:0034934) tetrachlorobenzene dioxygenase activity(GO:0034935) 4,6-dichloro-3-methylcatechol 1,2-dioxygenase activity(GO:0034936) 2,3-dihydroxydiphenyl ether dioxygenase activity(GO:0034955) diphenyl ether 1,2-dioxygenase activity(GO:0034956) arachidonate 8(S)-lipoxygenase activity(GO:0036403) 4-hydroxycatechol 1,2-dioxygenase activity(GO:0047074) |
0.1 | 0.7 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.1 | 3.1 | GO:0035326 | enhancer binding(GO:0035326) |
0.1 | 0.1 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
0.1 | 0.1 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
0.1 | 0.4 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
0.1 | 0.3 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
0.1 | 0.1 | GO:0051723 | protein methylesterase activity(GO:0051723) |
0.1 | 0.1 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
0.1 | 0.4 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.1 | 0.1 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
0.1 | 0.3 | GO:0000339 | RNA cap binding(GO:0000339) |
0.1 | 0.8 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
0.1 | 0.1 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
0.1 | 0.6 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
0.1 | 0.1 | GO:0046921 | alpha-(1->6)-fucosyltransferase activity(GO:0046921) |
0.1 | 0.4 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.1 | 0.4 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.1 | 0.2 | GO:0016896 | 3'-5'-exoribonuclease activity(GO:0000175) exoribonuclease activity(GO:0004532) exoribonuclease activity, producing 5'-phosphomonoesters(GO:0016896) |
0.1 | 0.5 | GO:0008327 | methyl-CpG binding(GO:0008327) |
0.1 | 0.2 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
0.1 | 1.2 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
0.1 | 0.2 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) |
0.1 | 0.2 | GO:0008147 | structural constituent of bone(GO:0008147) |
0.1 | 0.1 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
0.1 | 0.4 | GO:0034802 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) phenanthrene 9,10-monooxygenase activity(GO:0018636) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
0.1 | 0.3 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.1 | 0.2 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.1 | 0.2 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
0.1 | 0.2 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
0.1 | 0.2 | GO:0005047 | signal recognition particle binding(GO:0005047) |
0.1 | 0.1 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
0.1 | 0.2 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
0.1 | 0.1 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
0.1 | 0.2 | GO:0019976 | interleukin-2 binding(GO:0019976) |
0.1 | 2.1 | GO:0004702 | receptor signaling protein serine/threonine kinase activity(GO:0004702) |
0.1 | 0.7 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
0.1 | 0.3 | GO:0004697 | protein kinase C activity(GO:0004697) |
0.1 | 0.8 | GO:0008483 | transaminase activity(GO:0008483) |
0.0 | 1.3 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
0.0 | 0.3 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.0 | 0.6 | GO:0052713 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) photoreceptor cyclic-nucleotide phosphodiesterase activity(GO:0004120) 7,8-dihydro-D-neopterin 2',3'-cyclic phosphate phosphodiesterase activity(GO:0044688) inositol phosphosphingolipid phospholipase activity(GO:0052712) inositol phosphorylceramide phospholipase activity(GO:0052713) mannosyl-inositol phosphorylceramide phospholipase activity(GO:0052714) mannosyl-diinositol phosphorylceramide phospholipase activity(GO:0052715) |
0.0 | 0.4 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
0.0 | 3.4 | GO:0030792 | methylarsonite methyltransferase activity(GO:0030792) |
0.0 | 2.9 | GO:0003724 | RNA helicase activity(GO:0003724) |
0.0 | 0.1 | GO:0043140 | ATP-dependent 3'-5' DNA helicase activity(GO:0043140) |
0.0 | 1.2 | GO:0052693 | N-ethylmaleimide reductase activity(GO:0008748) reduced coenzyme F420 dehydrogenase activity(GO:0043738) sulfur oxygenase reductase activity(GO:0043826) malolactic enzyme activity(GO:0043883) NADPH:sulfur oxidoreductase activity(GO:0043914) epoxyqueuosine reductase activity(GO:0052693) |
0.0 | 0.2 | GO:0018812 | 3-hydroxyacyl-CoA dehydratase activity(GO:0018812) |
0.0 | 0.2 | GO:0001223 | transcription coactivator binding(GO:0001223) |
0.0 | 0.1 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
0.0 | 0.4 | GO:0008301 | DNA binding, bending(GO:0008301) |
0.0 | 0.1 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
0.0 | 1.3 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
0.0 | 0.4 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
0.0 | 0.2 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
0.0 | 0.2 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
0.0 | 1.1 | GO:0008375 | acetylglucosaminyltransferase activity(GO:0008375) |
0.0 | 0.0 | GO:0016769 | transferase activity, transferring nitrogenous groups(GO:0016769) |
0.0 | 0.2 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
0.0 | 0.0 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
0.0 | 0.2 | GO:0044548 | S100 protein binding(GO:0044548) |
0.0 | 2.6 | GO:0003777 | microtubule motor activity(GO:0003777) |
0.0 | 0.1 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
0.0 | 0.9 | GO:0001540 | beta-amyloid binding(GO:0001540) |
0.0 | 0.1 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.0 | 0.0 | GO:0000405 | bubble DNA binding(GO:0000405) |
0.0 | 0.2 | GO:0048495 | Roundabout binding(GO:0048495) |
0.0 | 0.3 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
0.0 | 0.1 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
0.0 | 0.2 | GO:0016423 | tRNA (guanine) methyltransferase activity(GO:0016423) |
0.0 | 0.1 | GO:0051380 | norepinephrine binding(GO:0051380) |
0.0 | 0.6 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.0 | 0.3 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
0.0 | 0.5 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
0.0 | 0.2 | GO:0004954 | prostanoid receptor activity(GO:0004954) |
0.0 | 0.6 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
0.0 | 0.1 | GO:0052724 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
0.0 | 4.7 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
0.0 | 0.1 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
0.0 | 1.5 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
0.0 | 0.2 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
0.0 | 0.2 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
0.0 | 0.2 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
0.0 | 0.2 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.0 | 0.5 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
0.0 | 0.1 | GO:0031748 | D1 dopamine receptor binding(GO:0031748) |
0.0 | 1.3 | GO:0001104 | RNA polymerase II transcription cofactor activity(GO:0001104) |
0.0 | 0.7 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
0.0 | 0.3 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
0.0 | 0.1 | GO:0015925 | galactosidase activity(GO:0015925) |
0.0 | 1.7 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
0.0 | 0.1 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.0 | 0.2 | GO:0008948 | oxaloacetate decarboxylase activity(GO:0008948) |
0.0 | 0.1 | GO:0004112 | cyclic-nucleotide phosphodiesterase activity(GO:0004112) |
0.0 | 0.2 | GO:0031544 | peptidyl-proline 3-dioxygenase activity(GO:0031544) |
0.0 | 0.3 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) |
0.0 | 0.7 | GO:0042169 | SH2 domain binding(GO:0042169) |
0.0 | 0.5 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
0.0 | 0.1 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
0.0 | 0.2 | GO:0005534 | galactose binding(GO:0005534) |
0.0 | 0.7 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.0 | 0.2 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.0 | 0.1 | GO:0003747 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
0.0 | 0.2 | GO:0016505 | peptidase activator activity involved in apoptotic process(GO:0016505) |
0.0 | 0.1 | GO:0008143 | poly(A) binding(GO:0008143) |
0.0 | 0.0 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
0.0 | 0.0 | GO:0017153 | sodium:dicarboxylate symporter activity(GO:0017153) |
0.0 | 0.3 | GO:0048038 | quinone binding(GO:0048038) |
0.0 | 0.4 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
0.0 | 0.6 | GO:0097472 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
0.0 | 0.1 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.0 | 0.1 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
0.0 | 1.1 | GO:0001085 | RNA polymerase II transcription factor binding(GO:0001085) |
0.0 | 0.0 | GO:0034191 | apolipoprotein A-I receptor binding(GO:0034191) |
0.0 | 0.6 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
0.0 | 1.2 | GO:0043022 | ribosome binding(GO:0043022) |
0.0 | 0.1 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
0.0 | 0.3 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
0.0 | 0.1 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
0.0 | 0.1 | GO:0051434 | BH3 domain binding(GO:0051434) |
0.0 | 0.2 | GO:0034604 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
0.0 | 0.5 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.0 | 0.0 | GO:0016426 | tRNA (adenine) methyltransferase activity(GO:0016426) tRNA (adenine-N1-)-methyltransferase activity(GO:0016429) |
0.0 | 0.3 | GO:0015929 | hexosaminidase activity(GO:0015929) |
0.0 | 0.1 | GO:0071813 | lipoprotein particle binding(GO:0071813) protein-lipid complex binding(GO:0071814) |
0.0 | 0.4 | GO:0031489 | myosin V binding(GO:0031489) |
0.0 | 0.1 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.0 | 0.4 | GO:0008308 | voltage-gated anion channel activity(GO:0008308) |
0.0 | 0.4 | GO:0035254 | glutamate receptor binding(GO:0035254) |
0.0 | 0.8 | GO:0030276 | clathrin binding(GO:0030276) |
0.0 | 0.0 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
0.0 | 0.3 | GO:0070182 | DNA polymerase binding(GO:0070182) |
0.0 | 0.2 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
0.0 | 0.1 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.0 | 0.1 | GO:0031014 | troponin T binding(GO:0031014) |
0.0 | 0.1 | GO:0004966 | galanin receptor activity(GO:0004966) |
0.0 | 0.1 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.0 | 0.1 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.0 | 0.4 | GO:0030881 | beta-2-microglobulin binding(GO:0030881) |
0.0 | 0.2 | GO:0003680 | AT DNA binding(GO:0003680) |
0.0 | 0.7 | GO:0015485 | cholesterol binding(GO:0015485) |
0.0 | 0.3 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.0 | 0.6 | GO:0005546 | phosphatidylinositol-4,5-bisphosphate binding(GO:0005546) |
0.0 | 0.9 | GO:0004364 | glutathione transferase activity(GO:0004364) |
0.0 | 0.0 | GO:0008796 | bis(5'-nucleosyl)-tetraphosphatase activity(GO:0008796) |
0.0 | 0.2 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
0.0 | 0.0 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
0.0 | 0.0 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
0.0 | 0.5 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
0.0 | 0.6 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
0.0 | 0.2 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
0.0 | 0.8 | GO:0004864 | protein phosphatase inhibitor activity(GO:0004864) |
0.0 | 0.1 | GO:0030021 | extracellular matrix structural constituent conferring compression resistance(GO:0030021) structural constituent of tooth enamel(GO:0030345) |
0.0 | 0.1 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.0 | 0.1 | GO:0045545 | syndecan binding(GO:0045545) |
0.0 | 0.7 | GO:0043621 | protein self-association(GO:0043621) |
0.0 | 0.2 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
0.0 | 0.2 | GO:0045502 | dynein binding(GO:0045502) |
0.0 | 1.5 | GO:0042393 | histone binding(GO:0042393) |
0.0 | 0.2 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
0.0 | 0.3 | GO:0008026 | ATP-dependent helicase activity(GO:0008026) purine NTP-dependent helicase activity(GO:0070035) |
0.0 | 0.3 | GO:0042805 | actinin binding(GO:0042805) |
0.0 | 0.1 | GO:0034548 | N-cyclopropylmelamine deaminase activity(GO:0034547) N-cyclopropylammeline deaminase activity(GO:0034548) N-cyclopropylammelide alkylamino hydrolase activity(GO:0034549) 2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate deaminase activity(GO:0043723) tRNA-specific adenosine-37 deaminase activity(GO:0043829) archaeal-specific GTP cyclohydrolase activity(GO:0044682) tRNA-specific adenosine-34 deaminase activity(GO:0052717) |
0.0 | 1.0 | GO:0051219 | phosphoprotein binding(GO:0051219) |
0.0 | 0.4 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
0.0 | 0.2 | GO:0003727 | single-stranded RNA binding(GO:0003727) |
0.0 | 0.2 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
0.0 | 0.1 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
0.0 | 0.2 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
0.0 | 0.3 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
0.0 | 0.6 | GO:0005160 | transforming growth factor beta receptor binding(GO:0005160) |
0.0 | 0.1 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
0.0 | 4.8 | GO:0001077 | transcriptional activator activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001077) |
0.0 | 0.1 | GO:0042910 | xenobiotic-transporting ATPase activity(GO:0008559) xenobiotic transporter activity(GO:0042910) |
0.0 | 0.1 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
0.0 | 0.5 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.0 | 0.0 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
0.0 | 0.1 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.0 | 0.1 | GO:0042015 | interleukin-20 binding(GO:0042015) |
0.0 | 0.2 | GO:0015197 | peptide transporter activity(GO:0015197) |
0.0 | 1.7 | GO:0004725 | protein tyrosine phosphatase activity(GO:0004725) |
0.0 | 0.8 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
0.0 | 2.0 | GO:0003713 | transcription coactivator activity(GO:0003713) |
0.0 | 0.1 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.0 | 0.1 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
0.0 | 0.0 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
0.0 | 0.2 | GO:0043142 | single-stranded DNA-dependent ATPase activity(GO:0043142) |
0.0 | 0.1 | GO:0004945 | angiotensin type II receptor activity(GO:0004945) |
0.0 | 0.2 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
0.0 | 0.1 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
0.0 | 0.0 | GO:0015927 | trehalase activity(GO:0015927) |
0.0 | 0.0 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
0.0 | 4.8 | GO:0046982 | protein heterodimerization activity(GO:0046982) |
0.0 | 15.6 | GO:0044822 | poly(A) RNA binding(GO:0044822) |
0.0 | 0.2 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
0.0 | 0.6 | GO:0004386 | helicase activity(GO:0004386) |
0.0 | 0.1 | GO:0035174 | histone serine kinase activity(GO:0035174) |
0.0 | 0.1 | GO:0070052 | collagen V binding(GO:0070052) |
0.0 | 0.1 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
0.0 | 0.1 | GO:0004630 | phospholipase D activity(GO:0004630) |
0.0 | 0.0 | GO:0008865 | glucokinase activity(GO:0004340) hexokinase activity(GO:0004396) fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
0.0 | 0.0 | GO:0019104 | DNA N-glycosylase activity(GO:0019104) |
0.0 | 0.3 | GO:0015923 | mannosidase activity(GO:0015923) |
0.0 | 0.1 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
0.0 | 0.3 | GO:0015299 | solute:proton antiporter activity(GO:0015299) |
0.0 | 0.1 | GO:0016595 | glutamate binding(GO:0016595) |
0.0 | 0.1 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
0.0 | 0.3 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
0.0 | 0.1 | GO:0005338 | nucleotide-sugar transmembrane transporter activity(GO:0005338) |
0.0 | 0.1 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
0.0 | 0.0 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.0 | 0.0 | GO:0001161 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) intronic transcription regulatory region DNA binding(GO:0044213) |
0.0 | 0.4 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
0.0 | 0.0 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.0 | 0.1 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.0 | 0.0 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
0.0 | 0.0 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.0 | 0.1 | GO:0008502 | melatonin receptor activity(GO:0008502) |
0.0 | 0.0 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.0 | 0.0 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
0.0 | 0.3 | GO:0048306 | calcium-dependent protein binding(GO:0048306) |
0.0 | 0.1 | GO:0016937 | short-branched-chain-acyl-CoA dehydrogenase activity(GO:0016937) |
0.0 | 0.1 | GO:0038187 | signaling pattern recognition receptor activity(GO:0008329) pattern recognition receptor activity(GO:0038187) |
0.0 | 0.0 | GO:0070411 | I-SMAD binding(GO:0070411) |
0.0 | 0.2 | GO:0034062 | RNA polymerase activity(GO:0034062) |
0.0 | 0.1 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
0.0 | 0.0 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
0.0 | 0.0 | GO:0051373 | FATZ binding(GO:0051373) |
0.0 | 0.0 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
0.0 | 0.1 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
0.0 | 0.0 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
0.0 | 0.2 | GO:0017022 | myosin binding(GO:0017022) |
0.0 | 0.1 | GO:0016790 | thiolester hydrolase activity(GO:0016790) |
0.0 | 0.1 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
0.0 | 0.1 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
0.0 | 0.0 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
0.0 | 0.1 | GO:0016755 | transferase activity, transferring amino-acyl groups(GO:0016755) |
0.0 | 0.0 | GO:0071553 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
0.0 | 0.1 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.0 | 0.1 | GO:0008932 | lytic endotransglycosylase activity(GO:0008932) |
0.0 | 0.0 | GO:0004673 | protein histidine kinase activity(GO:0004673) |
0.0 | 0.0 | GO:1990254 | keratin filament binding(GO:1990254) |
0.0 | 0.0 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
0.0 | 0.0 | GO:0051870 | methotrexate binding(GO:0051870) |
0.0 | 0.2 | GO:0051018 | protein kinase A binding(GO:0051018) |
0.0 | 0.1 | GO:0071949 | FAD binding(GO:0071949) |
0.0 | 0.0 | GO:0031433 | telethonin binding(GO:0031433) |
0.0 | 0.2 | GO:0019707 | protein-cysteine S-acyltransferase activity(GO:0019707) |
0.0 | 0.0 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
0.0 | 0.8 | GO:0008017 | microtubule binding(GO:0008017) |
0.0 | 0.1 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.0 | 0.1 | GO:0042162 | telomeric DNA binding(GO:0042162) |
0.0 | 0.0 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 11.6 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.4 | 0.4 | PID ERBB4 PATHWAY | ErbB4 signaling events |
0.2 | 0.4 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
0.2 | 9.7 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
0.2 | 2.2 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.2 | 10.6 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
0.2 | 0.5 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
0.1 | 0.1 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
0.1 | 0.4 | PID ALK2 PATHWAY | ALK2 signaling events |
0.1 | 1.9 | PID S1P S1P2 PATHWAY | S1P2 pathway |
0.1 | 5.7 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
0.1 | 0.1 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.1 | 1.0 | PID ARF6 PATHWAY | Arf6 signaling events |
0.1 | 3.1 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.1 | 3.6 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
0.1 | 2.2 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.1 | 0.1 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
0.1 | 1.3 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.1 | 0.2 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.1 | 1.3 | ST B CELL ANTIGEN RECEPTOR | B Cell Antigen Receptor |
0.1 | 0.2 | PID CD40 PATHWAY | CD40/CD40L signaling |
0.1 | 1.0 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.1 | 0.2 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.1 | 0.8 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
0.1 | 0.2 | PID S1P S1P4 PATHWAY | S1P4 pathway |
0.1 | 2.0 | PID ALK1 PATHWAY | ALK1 signaling events |
0.1 | 0.3 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.1 | 1.4 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
0.1 | 0.4 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.1 | 0.4 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
0.1 | 2.7 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
0.1 | 0.6 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.1 | 0.2 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.1 | 1.0 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.1 | 0.6 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
0.1 | 0.6 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.1 | 1.5 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.1 | 2.0 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
0.1 | 0.6 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.1 | 0.1 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
0.1 | 3.9 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
0.1 | 0.5 | ST G ALPHA I PATHWAY | G alpha i Pathway |
0.1 | 1.7 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
0.1 | 1.6 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
0.1 | 1.4 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.1 | 0.5 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.1 | 0.4 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.1 | 0.8 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
0.1 | 0.3 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.1 | 1.0 | PID AURORA A PATHWAY | Aurora A signaling |
0.1 | 0.1 | PID IFNG PATHWAY | IFN-gamma pathway |
0.1 | 0.5 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
0.1 | 0.2 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.1 | 0.4 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
0.1 | 0.1 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.0 | 2.4 | PID P73PATHWAY | p73 transcription factor network |
0.0 | 1.0 | PID CONE PATHWAY | Visual signal transduction: Cones |
0.0 | 0.1 | ST GAQ PATHWAY | G alpha q Pathway |
0.0 | 0.0 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
0.0 | 0.7 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.0 | 1.4 | ST INTEGRIN SIGNALING PATHWAY | Integrin Signaling Pathway |
0.0 | 1.3 | PID NOTCH PATHWAY | Notch signaling pathway |
0.0 | 0.3 | PID IL27 PATHWAY | IL27-mediated signaling events |
0.0 | 1.1 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
0.0 | 1.0 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.0 | 0.8 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
0.0 | 0.3 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
0.0 | 0.0 | PID S1P S1P3 PATHWAY | S1P3 pathway |
0.0 | 0.2 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
0.0 | 1.1 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
0.0 | 1.2 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
0.0 | 0.8 | PID BARD1 PATHWAY | BARD1 signaling events |
0.0 | 1.4 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.0 | 0.6 | PID TNF PATHWAY | TNF receptor signaling pathway |
0.0 | 0.2 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
0.0 | 0.4 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.0 | 0.5 | PID BCR 5PATHWAY | BCR signaling pathway |
0.0 | 0.6 | PID FANCONI PATHWAY | Fanconi anemia pathway |
0.0 | 0.2 | ST GA13 PATHWAY | G alpha 13 Pathway |
0.0 | 0.2 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
0.0 | 0.2 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.0 | 0.2 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.0 | 0.5 | PID ATM PATHWAY | ATM pathway |
0.0 | 0.2 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
0.0 | 0.4 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
0.0 | 0.3 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
0.0 | 0.2 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
0.0 | 1.0 | PID AP1 PATHWAY | AP-1 transcription factor network |
0.0 | 0.6 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.0 | 0.0 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.0 | 0.6 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
0.0 | 0.3 | PID ARF 3PATHWAY | Arf1 pathway |
0.0 | 0.1 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
0.0 | 0.2 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
0.0 | 0.2 | PID SHP2 PATHWAY | SHP2 signaling |
0.0 | 0.1 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
0.0 | 0.0 | ST STAT3 PATHWAY | STAT3 Pathway |
0.0 | 0.2 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.0 | 4.6 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
0.0 | 0.1 | PID MYC PATHWAY | C-MYC pathway |
0.0 | 0.1 | SIG CHEMOTAXIS | Genes related to chemotaxis |
0.0 | 0.1 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
0.0 | 0.0 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
0.0 | 0.1 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
0.0 | 0.1 | PID ATR PATHWAY | ATR signaling pathway |
0.0 | 0.0 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.0 | 0.1 | PID IL1 PATHWAY | IL1-mediated signaling events |
0.0 | 0.1 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
0.0 | 0.1 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.0 | 0.3 | PID AURORA B PATHWAY | Aurora B signaling |
0.0 | 0.4 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
0.0 | 0.3 | PID IL4 2PATHWAY | IL4-mediated signaling events |
0.0 | 0.1 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.0 | 0.1 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
0.0 | 0.0 | PID S1P S1P1 PATHWAY | S1P1 pathway |
0.0 | 0.2 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
0.0 | 0.1 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.7 | 7.5 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
0.4 | 3.8 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.3 | 3.3 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
0.3 | 2.7 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.2 | 0.7 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
0.2 | 2.9 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.2 | 2.2 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.2 | 4.1 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.2 | 2.3 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.2 | 0.2 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.2 | 2.0 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.2 | 1.8 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.2 | 1.1 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
0.2 | 1.7 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.2 | 2.2 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.2 | 0.3 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
0.2 | 0.9 | REACTOME ADP SIGNALLING THROUGH P2RY1 | Genes involved in ADP signalling through P2Y purinoceptor 1 |
0.2 | 0.6 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.2 | 1.8 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
0.1 | 1.5 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
0.1 | 0.6 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
0.1 | 2.1 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.1 | 2.0 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.1 | 2.0 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.1 | 0.8 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
0.1 | 1.3 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
0.1 | 1.0 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.1 | 0.1 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
0.1 | 0.2 | REACTOME CYTOKINE SIGNALING IN IMMUNE SYSTEM | Genes involved in Cytokine Signaling in Immune system |
0.1 | 1.3 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
0.1 | 0.1 | REACTOME PROCESSIVE SYNTHESIS ON THE LAGGING STRAND | Genes involved in Processive synthesis on the lagging strand |
0.1 | 7.2 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
0.1 | 1.2 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
0.1 | 1.0 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
0.1 | 0.2 | REACTOME PI3K EVENTS IN ERBB2 SIGNALING | Genes involved in PI3K events in ERBB2 signaling |
0.1 | 0.8 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
0.1 | 2.0 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
0.1 | 1.0 | REACTOME SHC RELATED EVENTS | Genes involved in SHC-related events |
0.1 | 0.5 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
0.1 | 3.4 | REACTOME TRANSCRIPTIONAL ACTIVITY OF SMAD2 SMAD3 SMAD4 HETEROTRIMER | Genes involved in Transcriptional activity of SMAD2/SMAD3:SMAD4 heterotrimer |
0.1 | 1.4 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
0.1 | 1.7 | REACTOME RESOLUTION OF AP SITES VIA THE MULTIPLE NUCLEOTIDE PATCH REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the multiple-nucleotide patch replacement pathway |
0.1 | 2.3 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
0.1 | 1.9 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
0.1 | 0.3 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
0.1 | 1.2 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
0.1 | 4.4 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
0.1 | 2.1 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
0.1 | 3.4 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.1 | 0.8 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.1 | 4.1 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.1 | 1.2 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
0.1 | 5.6 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
0.1 | 0.4 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
0.1 | 0.8 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.1 | 1.7 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
0.1 | 0.7 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
0.1 | 1.2 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
0.1 | 0.8 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
0.1 | 0.3 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
0.1 | 0.6 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
0.1 | 1.2 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
0.1 | 1.2 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.1 | 1.0 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS | Genes involved in Synthesis of bile acids and bile salts |
0.1 | 1.5 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.1 | 0.9 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.1 | 0.5 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.1 | 1.1 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
0.1 | 3.3 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.1 | 1.6 | REACTOME KINESINS | Genes involved in Kinesins |
0.1 | 1.7 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
0.1 | 1.4 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
0.1 | 0.3 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
0.1 | 1.3 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
0.1 | 0.2 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
0.1 | 0.1 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF MITOTIC PROTEINS | Genes involved in APC/C:Cdc20 mediated degradation of mitotic proteins |
0.1 | 1.1 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
0.1 | 0.6 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.1 | 0.8 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.1 | 0.3 | REACTOME G BETA GAMMA SIGNALLING THROUGH PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
0.1 | 1.4 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.1 | 1.1 | REACTOME GAB1 SIGNALOSOME | Genes involved in GAB1 signalosome |
0.1 | 1.2 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
0.1 | 1.7 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.1 | 0.6 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
0.1 | 0.4 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
0.1 | 3.1 | REACTOME DNA REPAIR | Genes involved in DNA Repair |
0.1 | 0.7 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
0.1 | 0.8 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
0.1 | 2.9 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
0.1 | 0.1 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.1 | 0.7 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
0.1 | 1.4 | REACTOME PHASE II CONJUGATION | Genes involved in Phase II conjugation |
0.1 | 0.7 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.1 | 0.3 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
0.1 | 3.8 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
0.1 | 2.0 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
0.1 | 1.4 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
0.1 | 0.6 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
0.1 | 0.3 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
0.1 | 0.9 | REACTOME ACTIVATION OF THE PRE REPLICATIVE COMPLEX | Genes involved in Activation of the pre-replicative complex |
0.1 | 1.1 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.1 | 0.8 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.1 | 1.5 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
0.1 | 0.8 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
0.1 | 0.5 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.1 | 0.3 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF RAS | Genes involved in CREB phosphorylation through the activation of Ras |
0.1 | 0.4 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
0.1 | 0.2 | REACTOME SIGNAL AMPLIFICATION | Genes involved in Signal amplification |
0.1 | 0.7 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
0.0 | 0.5 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.0 | 0.5 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
0.0 | 0.1 | REACTOME SIGNALING BY WNT | Genes involved in Signaling by Wnt |
0.0 | 0.3 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
0.0 | 0.5 | REACTOME PURINE METABOLISM | Genes involved in Purine metabolism |
0.0 | 0.1 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
0.0 | 0.7 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
0.0 | 0.1 | REACTOME HIV INFECTION | Genes involved in HIV Infection |
0.0 | 0.4 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
0.0 | 0.8 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
0.0 | 0.8 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.0 | 2.1 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
0.0 | 1.1 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.0 | 0.4 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
0.0 | 0.4 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
0.0 | 0.9 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
0.0 | 0.3 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
0.0 | 0.4 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.0 | 0.6 | REACTOME SEMA4D IN SEMAPHORIN SIGNALING | Genes involved in Sema4D in semaphorin signaling |
0.0 | 1.2 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
0.0 | 0.1 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
0.0 | 0.2 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
0.0 | 4.0 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
0.0 | 0.7 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
0.0 | 0.5 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
0.0 | 0.1 | REACTOME REGULATION OF MITOTIC CELL CYCLE | Genes involved in Regulation of mitotic cell cycle |
0.0 | 0.4 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.0 | 0.4 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
0.0 | 1.2 | REACTOME MRNA 3 END PROCESSING | Genes involved in mRNA 3'-end processing |
0.0 | 0.3 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
0.0 | 0.1 | REACTOME HYALURONAN METABOLISM | Genes involved in Hyaluronan metabolism |
0.0 | 0.5 | REACTOME ASPARAGINE N LINKED GLYCOSYLATION | Genes involved in Asparagine N-linked glycosylation |
0.0 | 0.2 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.0 | 0.9 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
0.0 | 0.5 | REACTOME RNA POL II PRE TRANSCRIPTION EVENTS | Genes involved in RNA Polymerase II Pre-transcription Events |
0.0 | 1.2 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
0.0 | 0.2 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
0.0 | 1.1 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
0.0 | 0.1 | REACTOME RNA POL I TRANSCRIPTION | Genes involved in RNA Polymerase I Transcription |
0.0 | 0.3 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
0.0 | 0.4 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
0.0 | 0.6 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
0.0 | 0.0 | REACTOME CDT1 ASSOCIATION WITH THE CDC6 ORC ORIGIN COMPLEX | Genes involved in CDT1 association with the CDC6:ORC:origin complex |
0.0 | 0.1 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
0.0 | 0.3 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.0 | 0.1 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
0.0 | 0.0 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.0 | 0.1 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
0.0 | 1.6 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
0.0 | 0.3 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.0 | 0.5 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
0.0 | 0.3 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
0.0 | 0.5 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
0.0 | 0.9 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
0.0 | 0.7 | REACTOME CELL JUNCTION ORGANIZATION | Genes involved in Cell junction organization |
0.0 | 0.0 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
0.0 | 0.2 | REACTOME OPSINS | Genes involved in Opsins |
0.0 | 0.6 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
0.0 | 0.1 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
0.0 | 0.1 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
0.0 | 0.2 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
0.0 | 0.2 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
0.0 | 0.0 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
0.0 | 0.5 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
0.0 | 0.1 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
0.0 | 0.1 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
0.0 | 0.1 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
0.0 | 0.0 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
0.0 | 0.1 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.0 | 0.3 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
0.0 | 0.2 | REACTOME REGULATION OF MRNA STABILITY BY PROTEINS THAT BIND AU RICH ELEMENTS | Genes involved in Regulation of mRNA Stability by Proteins that Bind AU-rich Elements |
0.0 | 0.1 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
0.0 | 0.0 | REACTOME ORC1 REMOVAL FROM CHROMATIN | Genes involved in Orc1 removal from chromatin |
0.0 | 0.0 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
0.0 | 0.1 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
0.0 | 0.2 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
0.0 | 0.8 | REACTOME POTASSIUM CHANNELS | Genes involved in Potassium Channels |
0.0 | 0.1 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
0.0 | 0.0 | REACTOME FORMATION OF FIBRIN CLOT CLOTTING CASCADE | Genes involved in Formation of Fibrin Clot (Clotting Cascade) |
0.0 | 0.1 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
0.0 | 0.1 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
0.0 | 0.4 | REACTOME MYD88 MAL CASCADE INITIATED ON PLASMA MEMBRANE | Genes involved in MyD88:Mal cascade initiated on plasma membrane |
0.0 | 0.0 | REACTOME DEFENSINS | Genes involved in Defensins |
0.0 | 0.2 | REACTOME TOLL RECEPTOR CASCADES | Genes involved in Toll Receptor Cascades |
0.0 | 0.4 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
0.0 | 0.2 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.0 | 0.0 | REACTOME SCF BETA TRCP MEDIATED DEGRADATION OF EMI1 | Genes involved in SCF-beta-TrCP mediated degradation of Emi1 |
0.0 | 1.2 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
0.0 | 0.3 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
0.0 | 0.0 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
0.0 | 0.1 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |