Gene Symbol | Gene ID | Gene Info |
---|---|---|
Tal1
|
ENSMUSG00000028717.6 | Tal1 |
Gene | Promoter | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Tal1 | chr4_115057217_115057403 | 128 | 0.953287 | -0.81 | 5.3e-02 | Click! |
Tal1 | chr4_115038337_115038488 | 18014 | 0.136464 | -0.70 | 1.2e-01 | Click! |
Tal1 | chr4_115052725_115052890 | 3619 | 0.190933 | 0.65 | 1.6e-01 | Click! |
Tal1 | chr4_115056928_115057092 | 428 | 0.800090 | 0.35 | 5.0e-01 | Click! |
Tal1 | chr4_115058382_115058573 | 666 | 0.650356 | -0.20 | 7.1e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr12_103706206_103706382 | 2.09 |
Gm5656 |
predicted gene 5656 |
1675 |
0.22 |
chr7_140775065_140775305 | 2.08 |
Gm29799 |
predicted gene, 29799 |
9330 |
0.09 |
chr5_90424675_90424898 | 1.89 |
Gm43363 |
predicted gene 43363 |
27513 |
0.13 |
chr13_31619653_31619819 | 1.88 |
Gm11378 |
predicted gene 11378 |
568 |
0.66 |
chr7_130059814_130059979 | 1.64 |
Gm23847 |
predicted gene, 23847 |
24802 |
0.24 |
chr9_75425950_75426101 | 1.47 |
Leo1 |
Leo1, Paf1/RNA polymerase II complex component |
15499 |
0.11 |
chr6_117577757_117577908 | 1.44 |
Gm9946 |
predicted gene 9946 |
10160 |
0.2 |
chr15_67017761_67017917 | 1.42 |
Gm31342 |
predicted gene, 31342 |
22219 |
0.18 |
chr3_27729149_27729300 | 1.34 |
Fndc3b |
fibronectin type III domain containing 3B |
17917 |
0.26 |
chr13_97453178_97453337 | 1.30 |
Gm8756 |
predicted gene 8756 |
5820 |
0.18 |
chr8_115089778_115090403 | 1.30 |
Gm22556 |
predicted gene, 22556 |
37177 |
0.23 |
chr4_81591457_81591882 | 1.28 |
Gm11411 |
predicted gene 11411 |
104772 |
0.07 |
chr6_50890819_50891330 | 1.27 |
G930045G22Rik |
RIKEN cDNA G930045G22 gene |
12997 |
0.17 |
chr8_36746047_36746383 | 1.23 |
Dlc1 |
deleted in liver cancer 1 |
13161 |
0.28 |
chr13_43908419_43908579 | 1.23 |
Gm23117 |
predicted gene, 23117 |
35697 |
0.13 |
chrX_75402806_75402960 | 1.23 |
Cmc4 |
C-x(9)-C motif containing 4 |
7029 |
0.11 |
chr9_33101315_33101483 | 1.22 |
Gm32171 |
predicted gene, 32171 |
49893 |
0.13 |
chr10_68168093_68168385 | 1.18 |
Arid5b |
AT rich interactive domain 5B (MRF1-like) |
31613 |
0.21 |
chr5_87379872_87380058 | 1.18 |
Gm21049 |
predicted gene, 21049 |
45 |
0.95 |
chr9_63702505_63702656 | 1.17 |
Smad3 |
SMAD family member 3 |
9389 |
0.23 |
chr1_155112239_155112390 | 1.15 |
Ier5 |
immediate early response 5 |
12678 |
0.14 |
chr17_43329514_43329873 | 1.09 |
Adgrf5 |
adhesion G protein-coupled receptor F5 |
30758 |
0.19 |
chr14_45452880_45453061 | 1.09 |
Gm34250 |
predicted gene, 34250 |
5897 |
0.13 |
chr15_11054061_11054248 | 1.09 |
Adamts12 |
a disintegrin-like and metallopeptidase (reprolysin type) with thrombospondin type 1 motif, 12 |
10636 |
0.18 |
chr7_132572852_132573003 | 1.09 |
Oat |
ornithine aminotransferase |
2791 |
0.22 |
chr15_93917829_93917998 | 1.08 |
9430014N10Rik |
RIKEN cDNA 9430014N10 gene |
9198 |
0.25 |
chr6_119139630_119139800 | 1.08 |
Cacna1c |
calcium channel, voltage-dependent, L type, alpha 1C subunit |
31142 |
0.19 |
chr11_106515077_106515244 | 1.06 |
Gm22711 |
predicted gene, 22711 |
13915 |
0.14 |
chr10_3523296_3523476 | 1.05 |
Iyd |
iodotyrosine deiodinase |
16854 |
0.25 |
chr2_152360316_152360514 | 1.05 |
Gm14165 |
predicted gene 14165 |
6800 |
0.09 |
chr17_12740313_12740487 | 1.05 |
Airn |
antisense Igf2r RNA |
911 |
0.49 |
chr19_33480626_33480777 | 1.04 |
Lipo5 |
lipase, member O5 |
7510 |
0.16 |
chr15_100112289_100112692 | 1.03 |
4930478M13Rik |
RIKEN cDNA 4930478M13 gene |
4329 |
0.17 |
chr10_125850464_125850650 | 1.03 |
Lrig3 |
leucine-rich repeats and immunoglobulin-like domains 3 |
115611 |
0.07 |
chr2_134872444_134872595 | 1.02 |
Gm14036 |
predicted gene 14036 |
68570 |
0.12 |
chr1_72830155_72830306 | 1.02 |
Igfbp2 |
insulin-like growth factor binding protein 2 |
4908 |
0.25 |
chr1_95451015_95451173 | 1.00 |
Gm15427 |
predicted pseudogene 15427 |
47527 |
0.17 |
chr11_107451126_107451291 | 1.00 |
Pitpnc1 |
phosphatidylinositol transfer protein, cytoplasmic 1 |
19491 |
0.11 |
chr16_85541732_85541897 | 1.00 |
Cyyr1 |
cysteine and tyrosine-rich protein 1 |
8603 |
0.23 |
chr17_47329074_47329231 | 1.00 |
Trerf1 |
transcriptional regulating factor 1 |
35083 |
0.1 |
chr17_24000452_24000718 | 0.99 |
Prss22 |
protease, serine 22 |
2485 |
0.11 |
chr7_140770591_140771104 | 0.99 |
Cyp2e1 |
cytochrome P450, family 2, subfamily e, polypeptide 1 |
6366 |
0.09 |
chr12_79532159_79532332 | 0.98 |
Rad51b |
RAD51 paralog B |
204892 |
0.02 |
chr6_118968987_118969152 | 0.98 |
Cacna1c |
calcium channel, voltage-dependent, L type, alpha 1C subunit |
110938 |
0.07 |
chr18_33292965_33293129 | 0.98 |
Stard4 |
StAR-related lipid transfer (START) domain containing 4 |
79185 |
0.1 |
chr2_152359606_152359999 | 0.97 |
Gm14165 |
predicted gene 14165 |
6187 |
0.1 |
chr2_132654710_132655013 | 0.97 |
Rpl23a-ps4 |
ribosomal protein L23A, pseudogene 4 |
7381 |
0.12 |
chr7_79259257_79259413 | 0.97 |
Gm31510 |
predicted gene, 31510 |
13476 |
0.14 |
chr10_80019088_80019267 | 0.96 |
Arhgap45 |
Rho GTPase activating protein 45 |
476 |
0.6 |
chr11_95709547_95709712 | 0.95 |
Zfp652 |
zinc finger protein 652 |
3044 |
0.16 |
chr1_71623755_71623963 | 0.95 |
Fn1 |
fibronectin 1 |
485 |
0.82 |
chr12_71430131_71430651 | 0.94 |
1700083H02Rik |
RIKEN cDNA 1700083H02 gene |
46183 |
0.12 |
chr1_156813617_156813768 | 0.94 |
Ralgps2 |
Ral GEF with PH domain and SH3 binding motif 2 |
124 |
0.95 |
chr15_99715718_99715969 | 0.94 |
Gpd1 |
glycerol-3-phosphate dehydrogenase 1 (soluble) |
1672 |
0.16 |
chr12_108856815_108857551 | 0.92 |
Gm22079 |
predicted gene, 22079 |
5486 |
0.1 |
chr8_125133982_125134146 | 0.92 |
Disc1 |
disrupted in schizophrenia 1 |
46077 |
0.14 |
chr11_62487069_62487231 | 0.91 |
Gm12278 |
predicted gene 12278 |
4353 |
0.13 |
chr3_65541657_65541826 | 0.91 |
Tiparp |
TCDD-inducible poly(ADP-ribose) polymerase |
4299 |
0.15 |
chr19_39286940_39287122 | 0.91 |
Cyp2c29 |
cytochrome P450, family 2, subfamily c, polypeptide 29 |
43 |
0.98 |
chr15_9602541_9602716 | 0.90 |
Il7r |
interleukin 7 receptor |
72452 |
0.11 |
chr9_102890195_102890346 | 0.90 |
Ryk |
receptor-like tyrosine kinase |
8285 |
0.18 |
chr10_86161840_86162013 | 0.89 |
Gm15990 |
predicted gene 15990 |
36099 |
0.14 |
chr7_130654632_130654811 | 0.89 |
4930513N20Rik |
RIKEN cDNA 4930513N20 gene |
329 |
0.88 |
chr5_121950251_121950441 | 0.89 |
Cux2 |
cut-like homeobox 2 |
25425 |
0.15 |
chr17_72904064_72904328 | 0.89 |
Lbh |
limb-bud and heart |
14109 |
0.23 |
chr16_72721196_72721355 | 0.89 |
Robo1 |
roundabout guidance receptor 1 |
58071 |
0.17 |
chr14_46403981_46404149 | 0.88 |
Bmp4 |
bone morphogenetic protein 4 |
13396 |
0.13 |
chr16_95382384_95382615 | 0.88 |
Gm31641 |
predicted gene, 31641 |
26823 |
0.2 |
chr19_4436418_4436609 | 0.87 |
A930001C03Rik |
RIKEN cDNA A930001C03 gene |
2490 |
0.17 |
chr2_147949006_147949209 | 0.87 |
9030622O22Rik |
RIKEN cDNA 9030622O22 gene |
27078 |
0.2 |
chr14_25451238_25451399 | 0.87 |
Zmiz1os1 |
Zmiz1 opposite strand 1 |
6480 |
0.14 |
chr7_79358682_79358833 | 0.87 |
Rlbp1 |
retinaldehyde binding protein 1 |
18946 |
0.13 |
chr8_18770899_18771050 | 0.87 |
Angpt2 |
angiopoietin 2 |
29412 |
0.16 |
chr10_123588527_123588968 | 0.86 |
Gm19169 |
predicted gene, 19169 |
5159 |
0.33 |
chr10_3591899_3592052 | 0.86 |
Iyd |
iodotyrosine deiodinase |
51687 |
0.16 |
chr18_55506021_55506172 | 0.86 |
Gm37337 |
predicted gene, 37337 |
11018 |
0.3 |
chr2_102717685_102717841 | 0.86 |
Slc1a2 |
solute carrier family 1 (glial high affinity glutamate transporter), member 2 |
1211 |
0.54 |
chr4_55750022_55750212 | 0.85 |
Gm12506 |
predicted gene 12506 |
144968 |
0.04 |
chr11_61275239_61275390 | 0.85 |
Aldh3a2 |
aldehyde dehydrogenase family 3, subfamily A2 |
7850 |
0.17 |
chr3_138241530_138241694 | 0.85 |
0610031O16Rik |
RIKEN cDNA 0610031O16 gene |
1207 |
0.32 |
chr9_25460856_25461181 | 0.85 |
Gm8049 |
predicted gene 8049 |
10556 |
0.2 |
chr19_28520868_28521034 | 0.85 |
Glis3 |
GLIS family zinc finger 3 |
19469 |
0.24 |
chr16_91736910_91737079 | 0.84 |
Itsn1 |
intersectin 1 (SH3 domain protein 1A) |
6760 |
0.15 |
chr13_28654991_28655297 | 0.84 |
Mir6368 |
microRNA 6368 |
55729 |
0.15 |
chr10_112973744_112973931 | 0.84 |
Gm47519 |
predicted gene, 47519 |
13649 |
0.17 |
chr13_111295092_111295280 | 0.84 |
Actbl2 |
actin, beta-like 2 |
40173 |
0.13 |
chr2_50824872_50825029 | 0.83 |
Gm13498 |
predicted gene 13498 |
84734 |
0.1 |
chr11_77782498_77782668 | 0.83 |
Gm10277 |
predicted gene 10277 |
5164 |
0.15 |
chr11_86916732_86916927 | 0.83 |
Ypel2 |
yippee like 2 |
55195 |
0.11 |
chr6_99153668_99154006 | 0.82 |
Foxp1 |
forkhead box P1 |
9181 |
0.29 |
chr5_90872752_90873224 | 0.82 |
Cxcl1 |
chemokine (C-X-C motif) ligand 1 |
18253 |
0.11 |
chr7_129793665_129794087 | 0.81 |
Gm44778 |
predicted gene 44778 |
39170 |
0.2 |
chr6_35253418_35253775 | 0.81 |
1810058I24Rik |
RIKEN cDNA 1810058I24 gene |
864 |
0.54 |
chr4_109445534_109445717 | 0.81 |
Ttc39a |
tetratricopeptide repeat domain 39A |
24683 |
0.14 |
chr1_82971656_82971807 | 0.80 |
Gm47955 |
predicted gene, 47955 |
11445 |
0.09 |
chr2_26162793_26162961 | 0.80 |
Tmem250-ps |
transmembrane protein 250, pseudogene |
22356 |
0.1 |
chr11_44168297_44168448 | 0.80 |
Gm12154 |
predicted gene 12154 |
98837 |
0.08 |
chr4_104908553_104908715 | 0.80 |
Fyb2 |
FYN binding protein 2 |
4822 |
0.23 |
chr2_147944279_147944645 | 0.80 |
9030622O22Rik |
RIKEN cDNA 9030622O22 gene |
31723 |
0.18 |
chr19_36731141_36731447 | 0.80 |
Ppp1r3c |
protein phosphatase 1, regulatory subunit 3C |
5359 |
0.23 |
chr11_58127658_58127830 | 0.79 |
Gm12246 |
predicted gene 12246 |
1676 |
0.23 |
chr5_25054101_25054285 | 0.79 |
Prkag2 |
protein kinase, AMP-activated, gamma 2 non-catalytic subunit |
46449 |
0.11 |
chr8_36210015_36210228 | 0.79 |
Gm35520 |
predicted gene, 35520 |
21749 |
0.14 |
chr1_171565956_171566129 | 0.79 |
Cd244a |
CD244 molecule A |
6848 |
0.1 |
chr8_71511767_71511946 | 0.79 |
Plvap |
plasmalemma vesicle associated protein |
104 |
0.91 |
chr3_121891484_121891663 | 0.78 |
Gm42593 |
predicted gene 42593 |
28731 |
0.14 |
chr13_40882739_40882904 | 0.78 |
Gcnt2 |
glucosaminyl (N-acetyl) transferase 2, I-branching enzyme |
4372 |
0.12 |
chr3_95643059_95643376 | 0.78 |
E330034L11Rik |
RIKEN cDNA E330034L11 gene |
3913 |
0.12 |
chr13_29637964_29638136 | 0.78 |
Cdkal1 |
CDK5 regulatory subunit associated protein 1-like 1 |
120596 |
0.06 |
chr7_145025581_145025765 | 0.78 |
Ccnd1 |
cyclin D1 |
85748 |
0.07 |
chr1_87803823_87803974 | 0.78 |
Sag |
S-antigen, retina and pineal gland (arrestin) |
218 |
0.9 |
chr5_75962137_75962467 | 0.78 |
Kdr |
kinase insert domain protein receptor |
16156 |
0.17 |
chr6_87428535_87428790 | 0.78 |
Bmp10 |
bone morphogenetic protein 10 |
332 |
0.85 |
chr2_104130173_104130336 | 0.78 |
A930018P22Rik |
RIKEN cDNA A930018P22 gene |
7485 |
0.14 |
chr1_38242754_38242912 | 0.78 |
Gm16150 |
predicted gene 16150 |
3133 |
0.27 |
chr11_78832959_78833144 | 0.78 |
Lyrm9 |
LYR motif containing 9 |
6422 |
0.18 |
chr9_30613779_30614132 | 0.77 |
Gm47716 |
predicted gene, 47716 |
18632 |
0.24 |
chr10_71193417_71193760 | 0.77 |
1700113B09Rik |
RIKEN cDNA 1700113B09 gene |
8157 |
0.13 |
chr19_23487540_23487709 | 0.77 |
Mamdc2 |
MAM domain containing 2 |
39182 |
0.14 |
chr8_125337571_125337768 | 0.77 |
Gm16237 |
predicted gene 16237 |
110346 |
0.06 |
chr4_129792930_129793081 | 0.76 |
Ptp4a2 |
protein tyrosine phosphatase 4a2 |
18214 |
0.12 |
chr11_45255693_45255855 | 0.76 |
Gm12161 |
predicted gene 12161 |
25180 |
0.18 |
chr10_127181491_127181642 | 0.76 |
Slc26a10 |
solute carrier family 26, member 10 |
921 |
0.33 |
chr6_56919800_56919965 | 0.76 |
Nt5c3 |
5'-nucleotidase, cytosolic III |
3842 |
0.15 |
chr9_113121756_113121929 | 0.76 |
Gm36251 |
predicted gene, 36251 |
1187 |
0.61 |
chr5_76079702_76079873 | 0.76 |
Gm6051 |
predicted gene 6051 |
19024 |
0.16 |
chr18_63463560_63463749 | 0.75 |
Gm23581 |
predicted gene, 23581 |
44515 |
0.11 |
chr11_94274186_94274507 | 0.75 |
Gm21885 |
predicted gene, 21885 |
7527 |
0.15 |
chr1_157450125_157450340 | 0.75 |
Cryzl2 |
crystallin zeta like 2 |
8345 |
0.15 |
chr12_71428108_71428285 | 0.75 |
1700083H02Rik |
RIKEN cDNA 1700083H02 gene |
43988 |
0.13 |
chr9_116873050_116873366 | 0.75 |
Rbms3 |
RNA binding motif, single stranded interacting protein |
50389 |
0.18 |
chr2_38126183_38126415 | 0.75 |
Gm44291 |
predicted gene, 44291 |
19003 |
0.19 |
chr3_64420378_64420548 | 0.74 |
Vmn2r4 |
vomeronasal 2, receptor 4 |
5095 |
0.14 |
chr11_58948705_58948871 | 0.74 |
H2bu2 |
H2B.U histone 2 |
132 |
0.88 |
chr2_59665232_59665392 | 0.74 |
Tanc1 |
tetratricopeptide repeat, ankyrin repeat and coiled-coil containing 1 |
18501 |
0.25 |
chr6_142459207_142459594 | 0.74 |
Gys2 |
glycogen synthase 2 |
13709 |
0.16 |
chr11_16908621_16908873 | 0.74 |
Egfr |
epidermal growth factor receptor |
3562 |
0.23 |
chr15_85808829_85809412 | 0.74 |
Cdpf1 |
cysteine rich, DPF motif domain containing 1 |
1970 |
0.24 |
chr15_89497756_89497950 | 0.74 |
Gm41381 |
predicted gene, 41381 |
96 |
0.93 |
chr6_115465780_115466186 | 0.74 |
Gm44079 |
predicted gene, 44079 |
993 |
0.54 |
chr9_71832409_71832565 | 0.74 |
Gm27220 |
predicted gene 27220 |
4950 |
0.15 |
chr6_126035696_126035896 | 0.73 |
Ntf3 |
neurotrophin 3 |
129164 |
0.05 |
chr13_73696660_73696811 | 0.73 |
Slc6a19os |
solute carrier family 6 (neurotransmitter transporter), member 19, opposite strand |
3091 |
0.18 |
chr1_128103080_128103239 | 0.73 |
Zranb3 |
zinc finger, RAN-binding domain containing 3 |
112 |
0.53 |
chr11_70572487_70572638 | 0.73 |
Mink1 |
misshapen-like kinase 1 (zebrafish) |
9492 |
0.07 |
chr17_47445492_47445785 | 0.72 |
1700001C19Rik |
RIKEN cDNA 1700001C19 gene |
8262 |
0.12 |
chr10_5593553_5593753 | 0.72 |
Myct1 |
myc target 1 |
122 |
0.97 |
chr8_35211753_35211929 | 0.72 |
Gm34474 |
predicted gene, 34474 |
6797 |
0.15 |
chr1_54684346_54684705 | 0.72 |
4930444A19Rik |
RIKEN cDNA 4930444A19 gene |
2796 |
0.25 |
chr8_46737511_46737696 | 0.72 |
Gm16675 |
predicted gene, 16675 |
1905 |
0.25 |
chr1_20863907_20864073 | 0.72 |
Gm24723 |
predicted gene, 24723 |
21324 |
0.1 |
chr3_42887586_42887930 | 0.71 |
Gm38044 |
predicted gene, 38044 |
302159 |
0.01 |
chr9_52003605_52003767 | 0.71 |
Gm6981 |
predicted pseudogene 6981 |
405 |
0.84 |
chr4_45474566_45475016 | 0.71 |
Shb |
src homology 2 domain-containing transforming protein B |
8011 |
0.17 |
chr13_54988316_54988535 | 0.71 |
Unc5a |
unc-5 netrin receptor A |
8114 |
0.16 |
chr16_10690376_10690801 | 0.71 |
Gm15558 |
predicted gene 15558 |
7049 |
0.18 |
chr18_68062030_68062202 | 0.71 |
Gm41764 |
predicted gene, 41764 |
56258 |
0.13 |
chr17_50161482_50161633 | 0.71 |
Rftn1 |
raftlin lipid raft linker 1 |
28940 |
0.13 |
chr1_180356921_180357197 | 0.71 |
Gm37033 |
predicted gene, 37033 |
590 |
0.65 |
chr8_36645004_36645227 | 0.71 |
Dlc1 |
deleted in liver cancer 1 |
31172 |
0.22 |
chr9_32519674_32519894 | 0.70 |
Gm37474 |
predicted gene, 37474 |
7174 |
0.12 |
chr3_64570436_64570598 | 0.70 |
Vmn2r6 |
vomeronasal 2, receptor 6 |
4687 |
0.16 |
chr12_27823461_27823643 | 0.70 |
Gm45941 |
predicted gene, 45941 |
122490 |
0.06 |
chr6_128504617_128505108 | 0.70 |
Pzp |
PZP, alpha-2-macroglobulin like |
9639 |
0.09 |
chr12_71431449_71431600 | 0.70 |
1700083H02Rik |
RIKEN cDNA 1700083H02 gene |
47316 |
0.12 |
chr17_73839522_73839982 | 0.70 |
Gm4948 |
predicted gene 4948 |
31598 |
0.14 |
chr13_56571544_56571919 | 0.70 |
Lect2 |
leukocyte cell-derived chemotaxin 2 |
23229 |
0.14 |
chr7_63896940_63897109 | 0.70 |
Gm27252 |
predicted gene 27252 |
491 |
0.75 |
chr2_75202592_75202875 | 0.70 |
Gm13653 |
predicted gene 13653 |
10456 |
0.15 |
chr8_116463211_116463376 | 0.70 |
Gm5357 |
predicted gene 5357 |
25893 |
0.21 |
chr6_88203102_88203291 | 0.69 |
Gata2 |
GATA binding protein 2 |
1249 |
0.34 |
chr9_64789406_64789584 | 0.69 |
Dennd4a |
DENN/MADD domain containing 4A |
21845 |
0.17 |
chr7_19695332_19695494 | 0.69 |
Apoe |
apolipoprotein E |
2218 |
0.12 |
chr16_23056284_23056437 | 0.69 |
Kng1 |
kininogen 1 |
1505 |
0.19 |
chr4_71669047_71669417 | 0.69 |
Gm11231 |
predicted gene 11231 |
8781 |
0.3 |
chr3_142757820_142758243 | 0.69 |
Gtf2b |
general transcription factor IIB |
7014 |
0.12 |
chr12_69757882_69758048 | 0.69 |
Mir681 |
microRNA 681 |
5979 |
0.14 |
chr2_12189127_12189278 | 0.68 |
Itga8 |
integrin alpha 8 |
4110 |
0.28 |
chr7_145041280_145041599 | 0.68 |
Ccnd1 |
cyclin D1 |
101514 |
0.06 |
chr11_31822628_31822789 | 0.68 |
D630024D03Rik |
RIKEN cDNA D630024D03 gene |
1765 |
0.37 |
chr3_138227155_138227332 | 0.68 |
Adh7 |
alcohol dehydrogenase 7 (class IV), mu or sigma polypeptide |
808 |
0.51 |
chr14_73123868_73124235 | 0.68 |
Rcbtb2 |
regulator of chromosome condensation (RCC1) and BTB (POZ) domain containing protein 2 |
1014 |
0.57 |
chr9_32761430_32761581 | 0.68 |
Gm27240 |
predicted gene 27240 |
50334 |
0.11 |
chr1_72045190_72045349 | 0.68 |
4930556G22Rik |
RIKEN cDNA 4930556G22 gene |
6538 |
0.18 |
chr2_163555484_163555653 | 0.68 |
Hnf4a |
hepatic nuclear factor 4, alpha |
5485 |
0.14 |
chr19_53890337_53890577 | 0.68 |
Pdcd4 |
programmed cell death 4 |
1774 |
0.29 |
chr7_111726929_111727297 | 0.67 |
Galnt18 |
polypeptide N-acetylgalactosaminyltransferase 18 |
52864 |
0.15 |
chr14_16806291_16806442 | 0.67 |
Rarb |
retinoic acid receptor, beta |
12639 |
0.29 |
chr9_43225133_43225294 | 0.67 |
Oaf |
out at first homolog |
121 |
0.95 |
chr19_42551158_42551329 | 0.67 |
Gm16541 |
predicted gene 16541 |
11852 |
0.18 |
chr6_71236030_71236205 | 0.67 |
Smyd1 |
SET and MYND domain containing 1 |
19243 |
0.1 |
chr2_3771544_3771776 | 0.67 |
Fam107b |
family with sequence similarity 107, member B |
952 |
0.57 |
chr17_35320421_35320585 | 0.67 |
H2-Q1 |
histocompatibility 2, Q region locus 1 |
44 |
0.93 |
chr1_184072575_184072786 | 0.67 |
Dusp10 |
dual specificity phosphatase 10 |
38299 |
0.17 |
chr15_25945393_25945754 | 0.67 |
Mir7212 |
microRNA 7212 |
2654 |
0.25 |
chr10_75044491_75044663 | 0.67 |
Rab36 |
RAB36, member RAS oncogene family |
6354 |
0.16 |
chr14_20081120_20081302 | 0.67 |
Saysd1 |
SAYSVFN motif domain containing 1 |
1972 |
0.31 |
chr1_54840038_54840202 | 0.66 |
Ankrd44 |
ankyrin repeat domain 44 |
26677 |
0.18 |
chr11_20370399_20370788 | 0.66 |
Gm12033 |
predicted gene 12033 |
34580 |
0.15 |
chr13_108462646_108462822 | 0.66 |
Pde4d |
phosphodiesterase 4D, cAMP specific |
12725 |
0.27 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 1.2 | GO:0071288 | cellular response to mercury ion(GO:0071288) |
0.3 | 1.0 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
0.3 | 0.8 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
0.2 | 0.7 | GO:0006868 | glutamine transport(GO:0006868) |
0.2 | 0.7 | GO:2000054 | negative regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000054) |
0.2 | 0.8 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
0.2 | 0.6 | GO:0034196 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
0.2 | 0.7 | GO:0044332 | Wnt signaling pathway involved in dorsal/ventral axis specification(GO:0044332) |
0.2 | 1.1 | GO:0070327 | thyroid hormone transport(GO:0070327) |
0.2 | 0.7 | GO:0001907 | killing by symbiont of host cells(GO:0001907) disruption by symbiont of host cell(GO:0044004) |
0.2 | 0.5 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
0.2 | 0.5 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
0.2 | 0.5 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
0.2 | 0.8 | GO:0009115 | xanthine catabolic process(GO:0009115) |
0.2 | 0.8 | GO:2000138 | positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
0.1 | 0.4 | GO:0097296 | activation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:0097296) |
0.1 | 0.4 | GO:0010911 | regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) |
0.1 | 0.4 | GO:0006068 | ethanol catabolic process(GO:0006068) |
0.1 | 0.6 | GO:0070777 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
0.1 | 0.6 | GO:0034214 | protein hexamerization(GO:0034214) |
0.1 | 0.4 | GO:0060700 | regulation of ribonuclease activity(GO:0060700) |
0.1 | 0.4 | GO:0061031 | endodermal digestive tract morphogenesis(GO:0061031) |
0.1 | 0.4 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.1 | 0.5 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
0.1 | 0.4 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
0.1 | 0.4 | GO:0018894 | dibenzo-p-dioxin metabolic process(GO:0018894) |
0.1 | 0.6 | GO:0010871 | negative regulation of receptor biosynthetic process(GO:0010871) |
0.1 | 0.7 | GO:0033152 | immunoglobulin V(D)J recombination(GO:0033152) |
0.1 | 1.4 | GO:0036120 | cellular response to platelet-derived growth factor stimulus(GO:0036120) |
0.1 | 0.3 | GO:0032439 | endosome localization(GO:0032439) |
0.1 | 0.5 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
0.1 | 0.3 | GO:0070537 | histone H2A K63-linked deubiquitination(GO:0070537) |
0.1 | 0.6 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
0.1 | 0.3 | GO:0061625 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
0.1 | 0.4 | GO:0048014 | Tie signaling pathway(GO:0048014) |
0.1 | 0.1 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
0.1 | 0.5 | GO:0033132 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
0.1 | 0.3 | GO:0060397 | JAK-STAT cascade involved in growth hormone signaling pathway(GO:0060397) |
0.1 | 0.3 | GO:0000189 | MAPK import into nucleus(GO:0000189) |
0.1 | 0.5 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
0.1 | 0.4 | GO:0046909 | intermembrane transport(GO:0046909) |
0.1 | 0.3 | GO:0043578 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
0.1 | 0.1 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
0.1 | 0.1 | GO:0060154 | cellular process regulating host cell cycle in response to virus(GO:0060154) |
0.1 | 0.9 | GO:0032000 | positive regulation of fatty acid beta-oxidation(GO:0032000) |
0.1 | 0.3 | GO:0021823 | cerebral cortex tangential migration using cell-cell interactions(GO:0021823) postnatal olfactory bulb interneuron migration(GO:0021827) |
0.1 | 0.3 | GO:0071879 | positive regulation of adrenergic receptor signaling pathway(GO:0071879) |
0.1 | 0.8 | GO:0071073 | positive regulation of phospholipid biosynthetic process(GO:0071073) |
0.1 | 0.1 | GO:0010511 | regulation of phosphatidylinositol biosynthetic process(GO:0010511) |
0.1 | 0.4 | GO:0051031 | tRNA transport(GO:0051031) |
0.1 | 0.3 | GO:0043133 | hindgut contraction(GO:0043133) regulation of hindgut contraction(GO:0043134) |
0.1 | 0.3 | GO:2001170 | negative regulation of ATP biosynthetic process(GO:2001170) |
0.1 | 0.2 | GO:0009750 | response to fructose(GO:0009750) cellular response to fructose stimulus(GO:0071332) |
0.1 | 0.3 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
0.1 | 0.5 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
0.1 | 0.1 | GO:0003192 | mitral valve formation(GO:0003192) |
0.1 | 0.2 | GO:0070672 | response to interleukin-15(GO:0070672) |
0.1 | 0.3 | GO:0097503 | sialylation(GO:0097503) |
0.1 | 0.3 | GO:0038161 | prolactin signaling pathway(GO:0038161) |
0.1 | 0.4 | GO:0052405 | negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
0.1 | 0.3 | GO:0003134 | BMP signaling pathway involved in heart induction(GO:0003130) endodermal-mesodermal cell signaling(GO:0003133) endodermal-mesodermal cell signaling involved in heart induction(GO:0003134) |
0.1 | 0.3 | GO:0030167 | proteoglycan catabolic process(GO:0030167) |
0.1 | 0.2 | GO:1900086 | positive regulation of peptidyl-tyrosine autophosphorylation(GO:1900086) |
0.1 | 0.4 | GO:0032596 | protein transport into membrane raft(GO:0032596) |
0.1 | 0.3 | GO:0048478 | replication fork protection(GO:0048478) |
0.1 | 0.3 | GO:0090160 | Golgi to lysosome transport(GO:0090160) |
0.1 | 0.3 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
0.1 | 0.3 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
0.1 | 0.3 | GO:0015888 | thiamine transport(GO:0015888) |
0.1 | 0.3 | GO:0010520 | regulation of reciprocal meiotic recombination(GO:0010520) |
0.1 | 0.2 | GO:0010725 | regulation of primitive erythrocyte differentiation(GO:0010725) |
0.1 | 0.1 | GO:0003051 | angiotensin-mediated drinking behavior(GO:0003051) |
0.1 | 0.2 | GO:0007525 | somatic muscle development(GO:0007525) |
0.1 | 0.1 | GO:0002434 | immune complex clearance(GO:0002434) |
0.1 | 0.2 | GO:0071502 | cellular response to temperature stimulus(GO:0071502) |
0.1 | 0.2 | GO:2000721 | positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
0.1 | 0.2 | GO:1900368 | regulation of RNA interference(GO:1900368) |
0.1 | 0.3 | GO:0050713 | negative regulation of interleukin-1 beta secretion(GO:0050713) |
0.1 | 0.2 | GO:0001692 | histamine metabolic process(GO:0001692) |
0.1 | 0.5 | GO:0060613 | fat pad development(GO:0060613) |
0.1 | 0.3 | GO:0035087 | siRNA loading onto RISC involved in RNA interference(GO:0035087) |
0.1 | 0.1 | GO:0002740 | negative regulation of cytokine secretion involved in immune response(GO:0002740) |
0.1 | 0.3 | GO:0023021 | termination of signal transduction(GO:0023021) |
0.1 | 0.5 | GO:0036289 | peptidyl-serine autophosphorylation(GO:0036289) |
0.1 | 0.3 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
0.1 | 0.2 | GO:0010796 | regulation of multivesicular body size(GO:0010796) |
0.1 | 0.2 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.1 | 0.2 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
0.1 | 0.1 | GO:0007403 | glial cell fate determination(GO:0007403) |
0.1 | 0.1 | GO:0006714 | sesquiterpenoid metabolic process(GO:0006714) |
0.1 | 0.1 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
0.1 | 0.3 | GO:0071286 | cellular response to magnesium ion(GO:0071286) |
0.1 | 0.2 | GO:1903416 | response to glycoside(GO:1903416) |
0.1 | 0.2 | GO:0060164 | regulation of timing of neuron differentiation(GO:0060164) |
0.1 | 0.1 | GO:0044800 | fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
0.1 | 0.4 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
0.1 | 0.3 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
0.1 | 0.2 | GO:0003289 | atrial septum primum morphogenesis(GO:0003289) |
0.1 | 0.2 | GO:0051344 | negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
0.1 | 0.3 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
0.1 | 0.2 | GO:0003166 | bundle of His development(GO:0003166) |
0.1 | 0.3 | GO:0007296 | vitellogenesis(GO:0007296) |
0.1 | 0.3 | GO:0006742 | NADP catabolic process(GO:0006742) |
0.1 | 0.3 | GO:0001927 | exocyst assembly(GO:0001927) |
0.1 | 0.3 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
0.1 | 0.1 | GO:0045634 | regulation of melanocyte differentiation(GO:0045634) |
0.1 | 0.1 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
0.1 | 0.4 | GO:0046321 | positive regulation of fatty acid oxidation(GO:0046321) |
0.1 | 0.4 | GO:0070995 | NADPH oxidation(GO:0070995) |
0.1 | 0.4 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
0.1 | 0.3 | GO:1904754 | positive regulation of vascular associated smooth muscle cell migration(GO:1904754) |
0.1 | 0.3 | GO:0045636 | positive regulation of melanocyte differentiation(GO:0045636) |
0.1 | 0.2 | GO:0001712 | ectodermal cell fate commitment(GO:0001712) |
0.1 | 0.1 | GO:0006680 | glucosylceramide catabolic process(GO:0006680) |
0.1 | 0.3 | GO:0060083 | smooth muscle contraction involved in micturition(GO:0060083) |
0.1 | 0.1 | GO:0072144 | glomerular mesangial cell differentiation(GO:0072008) glomerular mesangial cell development(GO:0072144) |
0.1 | 0.8 | GO:0007202 | activation of phospholipase C activity(GO:0007202) |
0.1 | 0.2 | GO:0060268 | negative regulation of respiratory burst(GO:0060268) |
0.1 | 0.1 | GO:1903984 | positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
0.1 | 0.2 | GO:1901552 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
0.1 | 0.2 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
0.1 | 0.2 | GO:0061101 | neuroendocrine cell differentiation(GO:0061101) |
0.1 | 0.4 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
0.1 | 0.1 | GO:0072191 | ureter smooth muscle development(GO:0072191) ureter smooth muscle cell differentiation(GO:0072193) |
0.1 | 0.1 | GO:0045472 | response to ether(GO:0045472) |
0.1 | 0.8 | GO:0030502 | negative regulation of bone mineralization(GO:0030502) |
0.1 | 0.2 | GO:0002430 | complement receptor mediated signaling pathway(GO:0002430) |
0.1 | 0.3 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
0.1 | 0.2 | GO:0048597 | post-embryonic camera-type eye morphogenesis(GO:0048597) |
0.1 | 0.2 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
0.1 | 0.1 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
0.1 | 0.2 | GO:1904996 | positive regulation of leukocyte adhesion to vascular endothelial cell(GO:1904996) |
0.1 | 0.3 | GO:2000394 | positive regulation of lamellipodium morphogenesis(GO:2000394) |
0.1 | 0.2 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
0.1 | 0.1 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.1 | 0.3 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
0.1 | 0.1 | GO:0060988 | lipid tube assembly(GO:0060988) |
0.1 | 0.2 | GO:0003072 | regulation of blood vessel size by renin-angiotensin(GO:0002034) renal control of peripheral vascular resistance involved in regulation of systemic arterial blood pressure(GO:0003072) |
0.1 | 0.1 | GO:0010535 | positive regulation of activation of JAK2 kinase activity(GO:0010535) |
0.1 | 0.2 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.1 | 0.3 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.1 | 0.5 | GO:0002693 | positive regulation of cellular extravasation(GO:0002693) |
0.1 | 0.2 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
0.1 | 0.1 | GO:0070947 | neutrophil mediated killing of fungus(GO:0070947) |
0.1 | 0.3 | GO:0072711 | response to hydroxyurea(GO:0072710) cellular response to hydroxyurea(GO:0072711) |
0.1 | 0.2 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
0.1 | 0.2 | GO:0061198 | fungiform papilla formation(GO:0061198) |
0.1 | 0.1 | GO:0060330 | regulation of response to interferon-gamma(GO:0060330) |
0.1 | 0.1 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
0.1 | 0.2 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
0.1 | 0.5 | GO:0034116 | positive regulation of heterotypic cell-cell adhesion(GO:0034116) |
0.1 | 0.2 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
0.1 | 0.4 | GO:0006072 | glycerol-3-phosphate metabolic process(GO:0006072) |
0.1 | 0.2 | GO:0035963 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
0.1 | 0.4 | GO:0072673 | lamellipodium morphogenesis(GO:0072673) |
0.1 | 0.1 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
0.1 | 0.1 | GO:0032097 | positive regulation of response to food(GO:0032097) positive regulation of appetite(GO:0032100) |
0.1 | 0.5 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) |
0.1 | 0.2 | GO:0022417 | protein maturation by protein folding(GO:0022417) |
0.1 | 0.2 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
0.1 | 0.2 | GO:0070842 | aggresome assembly(GO:0070842) |
0.1 | 0.2 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
0.0 | 0.3 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
0.0 | 0.1 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
0.0 | 0.0 | GO:1990314 | cellular response to insulin-like growth factor stimulus(GO:1990314) |
0.0 | 0.1 | GO:0031944 | negative regulation of glucocorticoid metabolic process(GO:0031944) negative regulation of glucocorticoid biosynthetic process(GO:0031947) negative regulation of aldosterone metabolic process(GO:0032345) negative regulation of aldosterone biosynthetic process(GO:0032348) negative regulation of cortisol biosynthetic process(GO:2000065) |
0.0 | 0.2 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
0.0 | 0.0 | GO:1904504 | regulation of lipophagy(GO:1904502) positive regulation of lipophagy(GO:1904504) |
0.0 | 0.7 | GO:0008272 | sulfate transport(GO:0008272) |
0.0 | 0.0 | GO:0097490 | trunk segmentation(GO:0035290) trunk neural crest cell migration(GO:0036484) ventral trunk neural crest cell migration(GO:0036486) sympathetic neuron projection extension(GO:0097490) sympathetic neuron projection guidance(GO:0097491) |
0.0 | 0.5 | GO:0051601 | exocyst localization(GO:0051601) |
0.0 | 0.3 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
0.0 | 0.1 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
0.0 | 0.4 | GO:0002589 | regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002589) |
0.0 | 0.3 | GO:0090232 | positive regulation of spindle checkpoint(GO:0090232) |
0.0 | 0.1 | GO:0032788 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
0.0 | 0.0 | GO:0022028 | tangential migration from the subventricular zone to the olfactory bulb(GO:0022028) |
0.0 | 0.2 | GO:0060023 | soft palate development(GO:0060023) |
0.0 | 0.0 | GO:0015755 | fructose transport(GO:0015755) |
0.0 | 0.2 | GO:0019249 | lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
0.0 | 0.6 | GO:0002710 | negative regulation of T cell mediated immunity(GO:0002710) |
0.0 | 0.3 | GO:0045627 | positive regulation of T-helper 1 cell differentiation(GO:0045627) |
0.0 | 0.1 | GO:2000664 | positive regulation of interleukin-5 secretion(GO:2000664) positive regulation of interleukin-13 secretion(GO:2000667) |
0.0 | 0.1 | GO:0016344 | meiotic chromosome movement towards spindle pole(GO:0016344) |
0.0 | 0.1 | GO:0090071 | regulation of ribosome biogenesis(GO:0090069) negative regulation of ribosome biogenesis(GO:0090071) |
0.0 | 0.1 | GO:0000710 | meiotic mismatch repair(GO:0000710) |
0.0 | 0.3 | GO:0045648 | positive regulation of erythrocyte differentiation(GO:0045648) |
0.0 | 0.0 | GO:0045590 | negative regulation of regulatory T cell differentiation(GO:0045590) |
0.0 | 0.1 | GO:0042374 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
0.0 | 0.2 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
0.0 | 0.2 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.0 | 0.2 | GO:0031284 | positive regulation of guanylate cyclase activity(GO:0031284) |
0.0 | 0.2 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.0 | 0.1 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
0.0 | 0.1 | GO:1901475 | pyruvate transmembrane transport(GO:1901475) |
0.0 | 0.1 | GO:0045080 | positive regulation of chemokine biosynthetic process(GO:0045080) |
0.0 | 0.1 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
0.0 | 0.1 | GO:1990791 | dorsal root ganglion development(GO:1990791) |
0.0 | 0.1 | GO:0001555 | oocyte growth(GO:0001555) |
0.0 | 0.0 | GO:0071503 | response to heparin(GO:0071503) cellular response to heparin(GO:0071504) |
0.0 | 0.2 | GO:0032328 | alanine transport(GO:0032328) |
0.0 | 0.3 | GO:0090050 | positive regulation of cell migration involved in sprouting angiogenesis(GO:0090050) |
0.0 | 0.1 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
0.0 | 0.1 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
0.0 | 0.1 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
0.0 | 0.1 | GO:0072276 | glomerulus vasculature morphogenesis(GO:0072103) glomerular capillary formation(GO:0072104) metanephric glomerulus morphogenesis(GO:0072275) metanephric glomerulus vasculature morphogenesis(GO:0072276) metanephric glomerular capillary formation(GO:0072277) |
0.0 | 0.1 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
0.0 | 0.1 | GO:0021593 | rhombomere morphogenesis(GO:0021593) |
0.0 | 0.1 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.0 | 0.2 | GO:0016139 | glycoside catabolic process(GO:0016139) |
0.0 | 0.4 | GO:0060394 | negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
0.0 | 0.3 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
0.0 | 0.1 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
0.0 | 0.1 | GO:1900113 | negative regulation of histone H3-K9 trimethylation(GO:1900113) |
0.0 | 0.3 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.0 | 0.1 | GO:0031282 | regulation of guanylate cyclase activity(GO:0031282) |
0.0 | 0.2 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
0.0 | 0.0 | GO:0000101 | sulfur amino acid transport(GO:0000101) |
0.0 | 0.2 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
0.0 | 0.1 | GO:0000430 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) |
0.0 | 0.1 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
0.0 | 0.1 | GO:1901838 | positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
0.0 | 0.1 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.0 | 0.3 | GO:0090520 | sphingolipid mediated signaling pathway(GO:0090520) |
0.0 | 1.2 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
0.0 | 0.1 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
0.0 | 0.0 | GO:1902075 | cellular response to salt(GO:1902075) |
0.0 | 0.1 | GO:1901674 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
0.0 | 0.1 | GO:0050904 | diapedesis(GO:0050904) |
0.0 | 0.1 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
0.0 | 0.2 | GO:0035811 | negative regulation of urine volume(GO:0035811) |
0.0 | 0.0 | GO:0003032 | detection of oxygen(GO:0003032) |
0.0 | 0.1 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
0.0 | 1.2 | GO:0003333 | amino acid transmembrane transport(GO:0003333) |
0.0 | 0.2 | GO:0051697 | protein delipidation(GO:0051697) |
0.0 | 0.1 | GO:0099624 | regulation of atrial cardiac muscle cell membrane repolarization(GO:0060372) atrial cardiac muscle cell membrane repolarization(GO:0099624) |
0.0 | 0.2 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
0.0 | 1.1 | GO:0042832 | defense response to protozoan(GO:0042832) |
0.0 | 0.0 | GO:0003273 | cell migration involved in endocardial cushion formation(GO:0003273) |
0.0 | 0.1 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
0.0 | 0.0 | GO:0042091 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
0.0 | 0.4 | GO:0006309 | apoptotic DNA fragmentation(GO:0006309) |
0.0 | 0.0 | GO:0050717 | positive regulation of interleukin-1 alpha secretion(GO:0050717) |
0.0 | 0.3 | GO:0008300 | isoprenoid catabolic process(GO:0008300) |
0.0 | 0.0 | GO:2000662 | interleukin-5 secretion(GO:0072603) interleukin-13 secretion(GO:0072611) regulation of interleukin-5 secretion(GO:2000662) regulation of interleukin-13 secretion(GO:2000665) |
0.0 | 0.2 | GO:0035865 | response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
0.0 | 0.1 | GO:0021773 | striatal medium spiny neuron differentiation(GO:0021773) |
0.0 | 0.0 | GO:1902896 | terminal web assembly(GO:1902896) |
0.0 | 0.0 | GO:0002442 | serotonin production involved in inflammatory response(GO:0002351) serotonin secretion involved in inflammatory response(GO:0002442) serotonin secretion by platelet(GO:0002554) |
0.0 | 0.1 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
0.0 | 0.1 | GO:1904238 | pericyte cell differentiation(GO:1904238) |
0.0 | 0.3 | GO:0036010 | protein localization to endosome(GO:0036010) |
0.0 | 0.1 | GO:0046103 | inosine biosynthetic process(GO:0046103) |
0.0 | 0.1 | GO:0009106 | lipoate metabolic process(GO:0009106) |
0.0 | 0.1 | GO:2000973 | regulation of pro-B cell differentiation(GO:2000973) |
0.0 | 0.2 | GO:0048711 | positive regulation of astrocyte differentiation(GO:0048711) |
0.0 | 0.1 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
0.0 | 0.0 | GO:0090027 | negative regulation of monocyte chemotaxis(GO:0090027) |
0.0 | 0.1 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
0.0 | 0.1 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
0.0 | 0.3 | GO:1902547 | regulation of vascular endothelial growth factor signaling pathway(GO:1900746) regulation of cellular response to vascular endothelial growth factor stimulus(GO:1902547) |
0.0 | 0.1 | GO:0072413 | signal transduction involved in mitotic cell cycle checkpoint(GO:0072413) signal transduction involved in mitotic DNA damage checkpoint(GO:1902402) signal transduction involved in mitotic DNA integrity checkpoint(GO:1902403) |
0.0 | 0.1 | GO:0060594 | mammary gland specification(GO:0060594) |
0.0 | 0.0 | GO:0044340 | canonical Wnt signaling pathway involved in regulation of cell proliferation(GO:0044340) |
0.0 | 0.1 | GO:1903977 | positive regulation of glial cell migration(GO:1903977) |
0.0 | 0.4 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
0.0 | 0.1 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
0.0 | 0.1 | GO:0061643 | chemorepulsion of axon(GO:0061643) |
0.0 | 0.1 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
0.0 | 0.1 | GO:0034395 | regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
0.0 | 0.1 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
0.0 | 0.3 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
0.0 | 0.1 | GO:0002669 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
0.0 | 0.0 | GO:0002840 | T cell mediated immune response to tumor cell(GO:0002424) regulation of T cell mediated immune response to tumor cell(GO:0002840) |
0.0 | 0.0 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.0 | 0.1 | GO:2000425 | regulation of apoptotic cell clearance(GO:2000425) |
0.0 | 0.1 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
0.0 | 0.1 | GO:0006059 | hexitol metabolic process(GO:0006059) |
0.0 | 0.3 | GO:0033623 | regulation of integrin activation(GO:0033623) |
0.0 | 0.1 | GO:0060312 | regulation of blood vessel remodeling(GO:0060312) |
0.0 | 0.2 | GO:0016081 | synaptic vesicle docking(GO:0016081) |
0.0 | 0.1 | GO:0007386 | compartment pattern specification(GO:0007386) |
0.0 | 0.2 | GO:0045725 | positive regulation of glycogen biosynthetic process(GO:0045725) |
0.0 | 0.1 | GO:0090272 | negative regulation of fibroblast growth factor production(GO:0090272) |
0.0 | 0.1 | GO:0009756 | carbohydrate mediated signaling(GO:0009756) hexose mediated signaling(GO:0009757) sugar mediated signaling pathway(GO:0010182) glucose mediated signaling pathway(GO:0010255) |
0.0 | 0.2 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
0.0 | 0.1 | GO:0044838 | cell quiescence(GO:0044838) |
0.0 | 0.1 | GO:0032058 | positive regulation of translational initiation in response to stress(GO:0032058) |
0.0 | 0.5 | GO:0008210 | estrogen metabolic process(GO:0008210) |
0.0 | 0.2 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
0.0 | 0.5 | GO:0035855 | megakaryocyte development(GO:0035855) |
0.0 | 0.3 | GO:2001224 | positive regulation of neuron migration(GO:2001224) |
0.0 | 0.1 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
0.0 | 0.1 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
0.0 | 0.2 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.0 | 0.1 | GO:0016137 | glycoside metabolic process(GO:0016137) |
0.0 | 0.1 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
0.0 | 0.1 | GO:0050847 | progesterone receptor signaling pathway(GO:0050847) |
0.0 | 0.2 | GO:0086066 | atrial cardiac muscle cell action potential(GO:0086014) atrial cardiac muscle cell to AV node cell signaling(GO:0086026) atrial cardiac muscle cell to AV node cell communication(GO:0086066) |
0.0 | 0.1 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
0.0 | 0.3 | GO:0034063 | stress granule assembly(GO:0034063) |
0.0 | 0.1 | GO:2001185 | regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
0.0 | 0.1 | GO:0071799 | response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
0.0 | 0.1 | GO:0043504 | mitochondrial DNA repair(GO:0043504) |
0.0 | 0.2 | GO:0017014 | protein nitrosylation(GO:0017014) |
0.0 | 0.1 | GO:0035457 | cellular response to interferon-alpha(GO:0035457) |
0.0 | 0.5 | GO:0003298 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
0.0 | 0.1 | GO:2000523 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
0.0 | 0.1 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
0.0 | 0.1 | GO:0050872 | white fat cell differentiation(GO:0050872) |
0.0 | 0.1 | GO:0035768 | cell chemotaxis to fibroblast growth factor(GO:0035766) endothelial cell chemotaxis to fibroblast growth factor(GO:0035768) regulation of cell chemotaxis to fibroblast growth factor(GO:1904847) regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000544) |
0.0 | 0.3 | GO:0033617 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
0.0 | 0.1 | GO:0061144 | alveolar secondary septum development(GO:0061144) |
0.0 | 0.4 | GO:0006349 | regulation of gene expression by genetic imprinting(GO:0006349) |
0.0 | 0.2 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
0.0 | 0.1 | GO:0060167 | regulation of adenosine receptor signaling pathway(GO:0060167) |
0.0 | 0.0 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
0.0 | 0.1 | GO:1900227 | positive regulation of NLRP3 inflammasome complex assembly(GO:1900227) |
0.0 | 0.1 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
0.0 | 0.1 | GO:0010694 | positive regulation of alkaline phosphatase activity(GO:0010694) |
0.0 | 0.0 | GO:0003347 | epicardial cell to mesenchymal cell transition(GO:0003347) |
0.0 | 0.1 | GO:0061577 | calcium ion transmembrane transport via high voltage-gated calcium channel(GO:0061577) |
0.0 | 0.1 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
0.0 | 0.2 | GO:0032099 | negative regulation of appetite(GO:0032099) |
0.0 | 0.1 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
0.0 | 0.1 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
0.0 | 0.2 | GO:0070561 | vitamin D receptor signaling pathway(GO:0070561) |
0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.1 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
0.0 | 0.0 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
0.0 | 0.4 | GO:0045974 | negative regulation of translation, ncRNA-mediated(GO:0040033) regulation of translation, ncRNA-mediated(GO:0045974) |
0.0 | 0.2 | GO:0071910 | determination of liver left/right asymmetry(GO:0071910) |
0.0 | 0.1 | GO:1901873 | regulation of post-translational protein modification(GO:1901873) negative regulation of post-translational protein modification(GO:1901874) |
0.0 | 0.0 | GO:0048631 | regulation of skeletal muscle tissue growth(GO:0048631) |
0.0 | 0.0 | GO:0009189 | deoxyribonucleoside diphosphate biosynthetic process(GO:0009189) |
0.0 | 0.1 | GO:0033600 | negative regulation of mammary gland epithelial cell proliferation(GO:0033600) |
0.0 | 0.0 | GO:0019364 | pyridine nucleotide catabolic process(GO:0019364) |
0.0 | 0.0 | GO:0035740 | CD8-positive, alpha-beta T cell proliferation(GO:0035740) |
0.0 | 0.1 | GO:0044331 | cell-cell adhesion mediated by cadherin(GO:0044331) |
0.0 | 0.2 | GO:0035924 | cellular response to vascular endothelial growth factor stimulus(GO:0035924) |
0.0 | 0.2 | GO:0086036 | regulation of cardiac muscle cell membrane potential(GO:0086036) |
0.0 | 0.3 | GO:0030859 | polarized epithelial cell differentiation(GO:0030859) |
0.0 | 0.1 | GO:0015886 | heme transport(GO:0015886) |
0.0 | 0.1 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
0.0 | 0.3 | GO:0072505 | divalent inorganic anion homeostasis(GO:0072505) |
0.0 | 0.1 | GO:0071225 | cellular response to muramyl dipeptide(GO:0071225) |
0.0 | 0.1 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
0.0 | 0.1 | GO:0030916 | otic vesicle formation(GO:0030916) |
0.0 | 0.1 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
0.0 | 0.2 | GO:0042407 | cristae formation(GO:0042407) |
0.0 | 0.2 | GO:0016540 | protein autoprocessing(GO:0016540) |
0.0 | 0.0 | GO:1900222 | negative regulation of beta-amyloid clearance(GO:1900222) |
0.0 | 0.1 | GO:0006702 | androgen biosynthetic process(GO:0006702) |
0.0 | 0.2 | GO:0032986 | nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
0.0 | 0.0 | GO:1902416 | positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
0.0 | 0.2 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
0.0 | 0.1 | GO:0031086 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.0 | 0.1 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
0.0 | 0.0 | GO:0036023 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) |
0.0 | 0.0 | GO:0090240 | positive regulation of histone H4 acetylation(GO:0090240) |
0.0 | 0.0 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
0.0 | 0.0 | GO:0002019 | regulation of renal output by angiotensin(GO:0002019) |
0.0 | 0.1 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
0.0 | 0.2 | GO:0031340 | positive regulation of vesicle fusion(GO:0031340) |
0.0 | 0.1 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
0.0 | 0.0 | GO:0016259 | selenocysteine metabolic process(GO:0016259) |
0.0 | 0.4 | GO:0090162 | establishment of epithelial cell polarity(GO:0090162) |
0.0 | 0.1 | GO:0002666 | positive regulation of T cell tolerance induction(GO:0002666) |
0.0 | 0.1 | GO:1902109 | negative regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902109) |
0.0 | 0.2 | GO:1902993 | positive regulation of beta-amyloid formation(GO:1902004) positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
0.0 | 0.1 | GO:0015919 | peroxisomal membrane transport(GO:0015919) protein import into peroxisome membrane(GO:0045046) |
0.0 | 0.1 | GO:1902606 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
0.0 | 0.1 | GO:0071442 | positive regulation of histone H3-K14 acetylation(GO:0071442) |
0.0 | 0.1 | GO:0019287 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
0.0 | 0.0 | GO:0044026 | DNA hypermethylation(GO:0044026) |
0.0 | 0.1 | GO:0002035 | brain renin-angiotensin system(GO:0002035) |
0.0 | 0.4 | GO:0034260 | negative regulation of GTPase activity(GO:0034260) |
0.0 | 0.1 | GO:0010637 | negative regulation of mitochondrial fusion(GO:0010637) |
0.0 | 0.2 | GO:0035455 | response to interferon-alpha(GO:0035455) |
0.0 | 0.1 | GO:0043396 | corticotropin-releasing hormone secretion(GO:0043396) regulation of corticotropin-releasing hormone secretion(GO:0043397) positive regulation of corticotropin-releasing hormone secretion(GO:0051466) |
0.0 | 0.1 | GO:0002331 | pre-B cell allelic exclusion(GO:0002331) |
0.0 | 0.4 | GO:0032515 | negative regulation of phosphoprotein phosphatase activity(GO:0032515) |
0.0 | 0.3 | GO:0046838 | phosphorylated carbohydrate dephosphorylation(GO:0046838) inositol phosphate dephosphorylation(GO:0046855) |
0.0 | 0.1 | GO:0060019 | radial glial cell differentiation(GO:0060019) |
0.0 | 0.1 | GO:2000359 | regulation of binding of sperm to zona pellucida(GO:2000359) |
0.0 | 0.1 | GO:0006532 | aspartate biosynthetic process(GO:0006532) |
0.0 | 0.1 | GO:0009138 | pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
0.0 | 0.1 | GO:2000272 | negative regulation of receptor activity(GO:2000272) |
0.0 | 0.1 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
0.0 | 0.2 | GO:0070269 | pyroptosis(GO:0070269) |
0.0 | 0.1 | GO:0033632 | regulation of cell-cell adhesion mediated by integrin(GO:0033632) |
0.0 | 0.3 | GO:0043383 | negative T cell selection(GO:0043383) |
0.0 | 0.3 | GO:0050884 | neuromuscular process controlling posture(GO:0050884) |
0.0 | 0.1 | GO:0019695 | choline metabolic process(GO:0019695) |
0.0 | 0.1 | GO:0051611 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
0.0 | 0.1 | GO:0035990 | tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
0.0 | 0.1 | GO:0030917 | midbrain-hindbrain boundary development(GO:0030917) |
0.0 | 0.1 | GO:1902287 | semaphorin-plexin signaling pathway involved in axon guidance(GO:1902287) |
0.0 | 0.1 | GO:0030242 | pexophagy(GO:0030242) |
0.0 | 0.1 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
0.0 | 0.1 | GO:0048341 | paraxial mesoderm formation(GO:0048341) |
0.0 | 0.1 | GO:0035984 | response to trichostatin A(GO:0035983) cellular response to trichostatin A(GO:0035984) |
0.0 | 0.0 | GO:0002074 | extraocular skeletal muscle development(GO:0002074) |
0.0 | 0.1 | GO:0045409 | negative regulation of interleukin-6 biosynthetic process(GO:0045409) |
0.0 | 0.2 | GO:0098764 | meiotic prophase I(GO:0007128) prophase(GO:0051324) meiotic cell cycle phase(GO:0098762) meiosis I cell cycle phase(GO:0098764) |
0.0 | 0.1 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
0.0 | 0.3 | GO:0060576 | intestinal epithelial cell development(GO:0060576) |
0.0 | 0.2 | GO:0060539 | diaphragm development(GO:0060539) |
0.0 | 0.0 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
0.0 | 0.0 | GO:0014057 | positive regulation of acetylcholine secretion, neurotransmission(GO:0014057) |
0.0 | 0.1 | GO:0014063 | negative regulation of serotonin secretion(GO:0014063) |
0.0 | 0.0 | GO:0071139 | resolution of recombination intermediates(GO:0071139) |
0.0 | 0.1 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
0.0 | 0.1 | GO:0060911 | cardiac cell fate commitment(GO:0060911) |
0.0 | 0.1 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
0.0 | 0.1 | GO:0001660 | fever generation(GO:0001660) |
0.0 | 0.1 | GO:0032713 | negative regulation of interleukin-4 production(GO:0032713) |
0.0 | 0.1 | GO:2000644 | regulation of receptor catabolic process(GO:2000644) |
0.0 | 0.2 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.0 | 0.2 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
0.0 | 0.0 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
0.0 | 0.0 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
0.0 | 0.1 | GO:0060766 | negative regulation of androgen receptor signaling pathway(GO:0060766) |
0.0 | 0.1 | GO:0070914 | UV-damage excision repair(GO:0070914) |
0.0 | 0.1 | GO:0010898 | positive regulation of triglyceride catabolic process(GO:0010898) |
0.0 | 0.2 | GO:0009226 | nucleotide-sugar biosynthetic process(GO:0009226) |
0.0 | 0.1 | GO:0060718 | chorionic trophoblast cell differentiation(GO:0060718) |
0.0 | 0.0 | GO:1902915 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
0.0 | 0.0 | GO:0051970 | negative regulation of transmission of nerve impulse(GO:0051970) |
0.0 | 0.3 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
0.0 | 0.1 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.0 | 0.0 | GO:0018992 | germ-line sex determination(GO:0018992) |
0.0 | 0.1 | GO:0033148 | positive regulation of intracellular estrogen receptor signaling pathway(GO:0033148) |
0.0 | 0.0 | GO:0031953 | negative regulation of protein autophosphorylation(GO:0031953) |
0.0 | 0.1 | GO:0051126 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) negative regulation of actin nucleation(GO:0051126) |
0.0 | 0.1 | GO:0060333 | interferon-gamma-mediated signaling pathway(GO:0060333) |
0.0 | 0.0 | GO:0002930 | trabecular meshwork development(GO:0002930) |
0.0 | 0.2 | GO:0006027 | glycosaminoglycan catabolic process(GO:0006027) |
0.0 | 0.0 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.0 | 0.2 | GO:0061088 | sequestering of zinc ion(GO:0032119) regulation of sequestering of zinc ion(GO:0061088) |
0.0 | 0.0 | GO:0044791 | modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) |
0.0 | 0.0 | GO:0070671 | response to interleukin-12(GO:0070671) |
0.0 | 0.0 | GO:0030421 | defecation(GO:0030421) |
0.0 | 0.0 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
0.0 | 0.1 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
0.0 | 0.3 | GO:0060008 | Sertoli cell differentiation(GO:0060008) |
0.0 | 0.1 | GO:0009624 | response to nematode(GO:0009624) |
0.0 | 0.0 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
0.0 | 0.0 | GO:1903599 | positive regulation of mitophagy(GO:1903599) |
0.0 | 0.0 | GO:0003241 | growth involved in heart morphogenesis(GO:0003241) |
0.0 | 0.0 | GO:0002925 | positive regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002925) |
0.0 | 0.0 | GO:0034436 | glycoprotein transport(GO:0034436) |
0.0 | 0.0 | GO:0010841 | regulation of circadian sleep/wake cycle, wakefulness(GO:0010840) positive regulation of circadian sleep/wake cycle, wakefulness(GO:0010841) circadian sleep/wake cycle, wakefulness(GO:0042746) |
0.0 | 0.0 | GO:1901492 | positive regulation of lymphangiogenesis(GO:1901492) |
0.0 | 0.1 | GO:0090394 | negative regulation of excitatory postsynaptic potential(GO:0090394) |
0.0 | 0.1 | GO:0035413 | positive regulation of catenin import into nucleus(GO:0035413) |
0.0 | 0.1 | GO:0072530 | purine nucleoside transmembrane transport(GO:0015860) purine-containing compound transmembrane transport(GO:0072530) nucleoside transmembrane transport(GO:1901642) |
0.0 | 0.1 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
0.0 | 0.0 | GO:0090296 | regulation of mitochondrial DNA replication(GO:0090296) |
0.0 | 0.0 | GO:1990928 | response to amino acid starvation(GO:1990928) |
0.0 | 0.1 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.0 | 0.0 | GO:0001957 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
0.0 | 0.1 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
0.0 | 0.2 | GO:1902751 | positive regulation of G2/M transition of mitotic cell cycle(GO:0010971) positive regulation of cell cycle G2/M phase transition(GO:1902751) |
0.0 | 0.1 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
0.0 | 0.1 | GO:0046010 | positive regulation of circadian sleep/wake cycle, non-REM sleep(GO:0046010) |
0.0 | 0.3 | GO:0006085 | acetyl-CoA biosynthetic process(GO:0006085) |
0.0 | 0.2 | GO:0070189 | kynurenine metabolic process(GO:0070189) |
0.0 | 0.0 | GO:0010746 | regulation of plasma membrane long-chain fatty acid transport(GO:0010746) |
0.0 | 0.2 | GO:0015701 | bicarbonate transport(GO:0015701) |
0.0 | 0.0 | GO:1902003 | regulation of beta-amyloid formation(GO:1902003) |
0.0 | 0.1 | GO:1900864 | mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
0.0 | 0.6 | GO:0007339 | binding of sperm to zona pellucida(GO:0007339) |
0.0 | 0.1 | GO:0022605 | oogenesis stage(GO:0022605) |
0.0 | 0.1 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
0.0 | 0.2 | GO:0090128 | regulation of synapse maturation(GO:0090128) |
0.0 | 0.1 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
0.0 | 0.1 | GO:2000821 | regulation of grooming behavior(GO:2000821) |
0.0 | 0.0 | GO:0003223 | ventricular compact myocardium morphogenesis(GO:0003223) |
0.0 | 0.1 | GO:0060484 | lung-associated mesenchyme development(GO:0060484) |
0.0 | 0.0 | GO:0060264 | regulation of respiratory burst involved in inflammatory response(GO:0060264) |
0.0 | 0.1 | GO:0035036 | sperm-egg recognition(GO:0035036) |
0.0 | 0.0 | GO:0042253 | granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0042253) regulation of granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0045423) |
0.0 | 0.2 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
0.0 | 0.1 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
0.0 | 0.0 | GO:0048840 | otolith development(GO:0048840) |
0.0 | 0.5 | GO:0050853 | B cell receptor signaling pathway(GO:0050853) |
0.0 | 0.1 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
0.0 | 0.2 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
0.0 | 0.0 | GO:0032730 | positive regulation of interleukin-1 alpha production(GO:0032730) |
0.0 | 0.1 | GO:0048333 | mesodermal cell differentiation(GO:0048333) |
0.0 | 0.0 | GO:0043096 | purine nucleobase salvage(GO:0043096) adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
0.0 | 0.1 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.0 | 0.0 | GO:2001280 | positive regulation of prostaglandin biosynthetic process(GO:0031394) positive regulation of unsaturated fatty acid biosynthetic process(GO:2001280) |
0.0 | 0.2 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
0.0 | 0.0 | GO:0006083 | acetate metabolic process(GO:0006083) |
0.0 | 0.0 | GO:0014738 | regulation of muscle hyperplasia(GO:0014738) muscle hyperplasia(GO:0014900) |
0.0 | 0.2 | GO:0033008 | positive regulation of mast cell activation involved in immune response(GO:0033008) positive regulation of mast cell degranulation(GO:0043306) |
0.0 | 0.1 | GO:0060263 | regulation of respiratory burst(GO:0060263) |
0.0 | 0.1 | GO:0048023 | positive regulation of melanin biosynthetic process(GO:0048023) positive regulation of secondary metabolite biosynthetic process(GO:1900378) |
0.0 | 0.1 | GO:0000022 | mitotic spindle elongation(GO:0000022) mitotic spindle midzone assembly(GO:0051256) |
0.0 | 0.1 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
0.0 | 0.1 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
0.0 | 0.1 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
0.0 | 0.1 | GO:0051043 | regulation of membrane protein ectodomain proteolysis(GO:0051043) |
0.0 | 0.2 | GO:0007213 | G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) |
0.0 | 0.0 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
0.0 | 0.1 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
0.0 | 0.0 | GO:0032096 | negative regulation of response to food(GO:0032096) |
0.0 | 0.0 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
0.0 | 0.1 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.0 | 0.1 | GO:0007135 | meiosis II(GO:0007135) |
0.0 | 0.0 | GO:1903371 | regulation of endoplasmic reticulum tubular network organization(GO:1903371) |
0.0 | 0.1 | GO:0033005 | positive regulation of mast cell activation(GO:0033005) |
0.0 | 0.1 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
0.0 | 0.0 | GO:0030222 | eosinophil differentiation(GO:0030222) |
0.0 | 0.1 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
0.0 | 0.1 | GO:0032790 | ribosome disassembly(GO:0032790) |
0.0 | 0.1 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
0.0 | 0.0 | GO:0051385 | response to mineralocorticoid(GO:0051385) |
0.0 | 0.1 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
0.0 | 0.1 | GO:0046208 | spermine catabolic process(GO:0046208) |
0.0 | 0.1 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.0 | 0.1 | GO:0034435 | steroid esterification(GO:0034433) sterol esterification(GO:0034434) cholesterol esterification(GO:0034435) |
0.0 | 0.0 | GO:0090579 | transcriptional activation by promoter-enhancer looping(GO:0071733) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
0.0 | 0.1 | GO:0060872 | semicircular canal development(GO:0060872) |
0.0 | 0.0 | GO:0050955 | thermoception(GO:0050955) |
0.0 | 0.0 | GO:2000680 | regulation of rubidium ion transport(GO:2000680) |
0.0 | 0.1 | GO:0051013 | microtubule severing(GO:0051013) |
0.0 | 0.0 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
0.0 | 0.1 | GO:0001542 | ovulation from ovarian follicle(GO:0001542) |
0.0 | 0.1 | GO:0072540 | T-helper 17 cell lineage commitment(GO:0072540) |
0.0 | 0.1 | GO:1904378 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
0.0 | 0.2 | GO:0034389 | lipid particle organization(GO:0034389) |
0.0 | 0.1 | GO:0043320 | natural killer cell degranulation(GO:0043320) |
0.0 | 0.0 | GO:0042693 | muscle cell fate commitment(GO:0042693) |
0.0 | 0.4 | GO:1902017 | regulation of cilium assembly(GO:1902017) |
0.0 | 0.2 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
0.0 | 0.1 | GO:0061055 | myotome development(GO:0061055) |
0.0 | 0.2 | GO:0007413 | axonal fasciculation(GO:0007413) |
0.0 | 0.0 | GO:0097694 | establishment of RNA localization to telomere(GO:0097694) |
0.0 | 0.0 | GO:0000492 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
0.0 | 0.0 | GO:0033686 | positive regulation of luteinizing hormone secretion(GO:0033686) |
0.0 | 0.1 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
0.0 | 0.1 | GO:0042435 | indole-containing compound biosynthetic process(GO:0042435) |
0.0 | 0.0 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
0.0 | 0.0 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
0.0 | 0.0 | GO:0042167 | heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
0.0 | 0.0 | GO:0072592 | oxygen metabolic process(GO:0072592) |
0.0 | 0.0 | GO:0071871 | response to epinephrine(GO:0071871) cellular response to epinephrine stimulus(GO:0071872) |
0.0 | 0.1 | GO:0006706 | steroid catabolic process(GO:0006706) |
0.0 | 0.0 | GO:0042523 | positive regulation of tyrosine phosphorylation of Stat5 protein(GO:0042523) |
0.0 | 0.1 | GO:0030826 | regulation of cGMP biosynthetic process(GO:0030826) |
0.0 | 0.2 | GO:0015727 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
0.0 | 0.1 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
0.0 | 0.0 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
0.0 | 0.0 | GO:0045918 | negative regulation of cytolysis(GO:0045918) |
0.0 | 0.1 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
0.0 | 0.0 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
0.0 | 0.0 | GO:0050975 | sensory perception of touch(GO:0050975) |
0.0 | 0.0 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.0 | 0.2 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
0.0 | 0.0 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.0 | 0.5 | GO:0002474 | antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
0.0 | 0.1 | GO:0045603 | positive regulation of endothelial cell differentiation(GO:0045603) |
0.0 | 0.1 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
0.0 | 0.1 | GO:0048251 | elastic fiber assembly(GO:0048251) |
0.0 | 0.0 | GO:0018916 | nitrobenzene metabolic process(GO:0018916) |
0.0 | 0.0 | GO:0032511 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
0.0 | 0.1 | GO:0006566 | threonine metabolic process(GO:0006566) |
0.0 | 0.1 | GO:2000651 | positive regulation of sodium ion transmembrane transporter activity(GO:2000651) |
0.0 | 0.0 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
0.0 | 0.0 | GO:0001757 | somite specification(GO:0001757) |
0.0 | 0.0 | GO:0000436 | carbon catabolite regulation of transcription from RNA polymerase II promoter(GO:0000429) carbon catabolite activation of transcription from RNA polymerase II promoter(GO:0000436) |
0.0 | 0.0 | GO:1901856 | negative regulation of cellular respiration(GO:1901856) |
0.0 | 0.1 | GO:1902093 | positive regulation of sperm motility(GO:1902093) |
0.0 | 0.0 | GO:0010986 | positive regulation of lipoprotein particle clearance(GO:0010986) |
0.0 | 0.0 | GO:0071313 | cellular response to caffeine(GO:0071313) cellular response to purine-containing compound(GO:0071415) |
0.0 | 0.1 | GO:0010226 | response to lithium ion(GO:0010226) |
0.0 | 0.0 | GO:0033629 | negative regulation of cell adhesion mediated by integrin(GO:0033629) |
0.0 | 0.1 | GO:0019262 | N-acetylneuraminate catabolic process(GO:0019262) |
0.0 | 0.0 | GO:1905049 | regulation of metalloendopeptidase activity(GO:1904683) negative regulation of metalloendopeptidase activity(GO:1904684) negative regulation of metallopeptidase activity(GO:1905049) |
0.0 | 0.1 | GO:0008211 | glucocorticoid metabolic process(GO:0008211) |
0.0 | 0.0 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
0.0 | 0.1 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
0.0 | 0.1 | GO:0034982 | mitochondrial protein processing(GO:0034982) |
0.0 | 0.1 | GO:1900037 | regulation of cellular response to hypoxia(GO:1900037) |
0.0 | 0.0 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
0.0 | 0.0 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
0.0 | 0.1 | GO:0015813 | L-glutamate transport(GO:0015813) |
0.0 | 0.1 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
0.0 | 0.3 | GO:0006688 | glycosphingolipid biosynthetic process(GO:0006688) |
0.0 | 0.0 | GO:0002576 | platelet degranulation(GO:0002576) |
0.0 | 0.3 | GO:0007340 | acrosome reaction(GO:0007340) |
0.0 | 0.0 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
0.0 | 0.0 | GO:0035625 | receptor transactivation(GO:0035624) epidermal growth factor-activated receptor transactivation by G-protein coupled receptor signaling pathway(GO:0035625) |
0.0 | 0.0 | GO:0002328 | pro-B cell differentiation(GO:0002328) |
0.0 | 0.0 | GO:0014049 | positive regulation of glutamate secretion(GO:0014049) |
0.0 | 0.1 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
0.0 | 0.0 | GO:0046543 | development of secondary female sexual characteristics(GO:0046543) |
0.0 | 0.0 | GO:0010587 | miRNA catabolic process(GO:0010587) |
0.0 | 0.0 | GO:0003174 | mitral valve development(GO:0003174) |
0.0 | 0.1 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
0.0 | 0.1 | GO:0035646 | endosome to melanosome transport(GO:0035646) endosome to pigment granule transport(GO:0043485) pigment granule maturation(GO:0048757) |
0.0 | 0.1 | GO:0006515 | misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
0.0 | 0.0 | GO:1905098 | negative regulation of guanyl-nucleotide exchange factor activity(GO:1905098) |
0.0 | 0.0 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
0.0 | 0.0 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
0.0 | 0.1 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.0 | 0.2 | GO:0010762 | regulation of fibroblast migration(GO:0010762) |
0.0 | 0.0 | GO:0015824 | proline transport(GO:0015824) |
0.0 | 0.2 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
0.0 | 0.1 | GO:0036089 | cleavage furrow formation(GO:0036089) |
0.0 | 0.1 | GO:0000957 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
0.0 | 0.0 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
0.0 | 0.0 | GO:0032667 | interleukin-23 production(GO:0032627) regulation of interleukin-23 production(GO:0032667) |
0.0 | 0.1 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
0.0 | 0.0 | GO:0043482 | cellular pigment accumulation(GO:0043482) |
0.0 | 0.1 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
0.0 | 0.2 | GO:0035335 | peptidyl-tyrosine dephosphorylation(GO:0035335) |
0.0 | 0.1 | GO:0090042 | tubulin deacetylation(GO:0090042) |
0.0 | 0.2 | GO:0046627 | negative regulation of insulin receptor signaling pathway(GO:0046627) |
0.0 | 0.0 | GO:0007468 | regulation of rhodopsin gene expression(GO:0007468) |
0.0 | 0.0 | GO:0048630 | skeletal muscle tissue growth(GO:0048630) |
0.0 | 0.0 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
0.0 | 0.1 | GO:0006687 | glycosphingolipid metabolic process(GO:0006687) |
0.0 | 0.0 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
0.0 | 0.0 | GO:1904751 | regulation of protein localization to nucleolus(GO:1904749) positive regulation of protein localization to nucleolus(GO:1904751) |
0.0 | 0.1 | GO:0000478 | endonucleolytic cleavage involved in rRNA processing(GO:0000478) |
0.0 | 0.1 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
0.0 | 0.0 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
0.0 | 0.0 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.0 | 0.1 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.0 | 0.0 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
0.0 | 0.1 | GO:0033136 | serine phosphorylation of STAT3 protein(GO:0033136) |
0.0 | 0.1 | GO:0048671 | negative regulation of collateral sprouting(GO:0048671) |
0.0 | 0.0 | GO:0033622 | integrin activation(GO:0033622) |
0.0 | 0.0 | GO:0003278 | apoptotic process involved in heart morphogenesis(GO:0003278) |
0.0 | 0.0 | GO:0009597 | detection of virus(GO:0009597) |
0.0 | 0.1 | GO:0042104 | positive regulation of activated T cell proliferation(GO:0042104) |
0.0 | 0.0 | GO:0048539 | bone marrow development(GO:0048539) |
0.0 | 0.0 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
0.0 | 0.0 | GO:0097119 | postsynaptic density protein 95 clustering(GO:0097119) |
0.0 | 0.0 | GO:0002857 | positive regulation of natural killer cell mediated immune response to tumor cell(GO:0002857) positive regulation of natural killer cell mediated cytotoxicity directed against tumor cell target(GO:0002860) |
0.0 | 0.1 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.0 | 0.0 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
0.0 | 0.1 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
0.0 | 0.1 | GO:0018231 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
0.0 | 0.0 | GO:0016188 | synaptic vesicle maturation(GO:0016188) |
0.0 | 0.0 | GO:2001025 | positive regulation of response to drug(GO:2001025) |
0.0 | 0.0 | GO:0009133 | nucleoside diphosphate biosynthetic process(GO:0009133) |
0.0 | 0.0 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
0.0 | 0.0 | GO:0072553 | terminal button organization(GO:0072553) |
0.0 | 0.0 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
0.0 | 0.0 | GO:0032808 | lacrimal gland development(GO:0032808) |
0.0 | 0.0 | GO:0071636 | positive regulation of transforming growth factor beta production(GO:0071636) |
0.0 | 0.1 | GO:1900264 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.0 | 0.0 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
0.0 | 0.0 | GO:0002645 | positive regulation of tolerance induction(GO:0002645) |
0.0 | 0.1 | GO:0006020 | inositol metabolic process(GO:0006020) |
0.0 | 0.2 | GO:0050873 | brown fat cell differentiation(GO:0050873) |
0.0 | 0.0 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
0.0 | 0.1 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
0.0 | 0.0 | GO:1901836 | regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901836) |
0.0 | 0.0 | GO:0090206 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
0.0 | 0.0 | GO:1904707 | positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
0.0 | 0.0 | GO:0030091 | protein repair(GO:0030091) |
0.0 | 0.1 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
0.0 | 0.1 | GO:0016926 | protein desumoylation(GO:0016926) |
0.0 | 0.0 | GO:0033631 | cell-cell adhesion mediated by integrin(GO:0033631) |
0.0 | 0.0 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
0.0 | 0.0 | GO:0033184 | positive regulation of histone ubiquitination(GO:0033184) regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
0.0 | 0.1 | GO:0032968 | positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
0.0 | 0.0 | GO:0033280 | response to vitamin D(GO:0033280) |
0.0 | 0.0 | GO:0070827 | chromatin maintenance(GO:0070827) |
0.0 | 0.1 | GO:0031571 | mitotic G1 DNA damage checkpoint(GO:0031571) |
0.0 | 0.0 | GO:0014732 | skeletal muscle atrophy(GO:0014732) |
0.0 | 0.0 | GO:0016264 | gap junction assembly(GO:0016264) |
0.0 | 0.0 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
0.0 | 0.1 | GO:0097120 | receptor localization to synapse(GO:0097120) |
0.0 | 0.0 | GO:0002159 | desmosome assembly(GO:0002159) |
0.0 | 0.0 | GO:2000852 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
0.0 | 0.2 | GO:0019835 | cytolysis(GO:0019835) |
0.0 | 0.0 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
0.0 | 0.1 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
0.0 | 0.0 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
0.0 | 0.1 | GO:0007141 | male meiosis I(GO:0007141) |
0.0 | 0.0 | GO:0042161 | lipoprotein modification(GO:0042160) lipoprotein oxidation(GO:0042161) |
0.0 | 0.0 | GO:0035902 | response to immobilization stress(GO:0035902) |
0.0 | 0.0 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
0.0 | 0.0 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
0.0 | 0.0 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
0.0 | 0.0 | GO:0014724 | regulation of twitch skeletal muscle contraction(GO:0014724) |
0.0 | 0.0 | GO:0046884 | follicle-stimulating hormone secretion(GO:0046884) |
0.0 | 0.0 | GO:0070366 | regulation of hepatocyte differentiation(GO:0070366) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 0.9 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.2 | 1.5 | GO:0005577 | fibrinogen complex(GO:0005577) |
0.2 | 0.8 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.1 | 0.7 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.1 | 1.1 | GO:0046581 | intercellular canaliculus(GO:0046581) |
0.1 | 0.8 | GO:0034992 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
0.1 | 0.6 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
0.1 | 0.3 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
0.1 | 0.5 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.1 | 0.3 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
0.1 | 0.3 | GO:0071141 | SMAD protein complex(GO:0071141) |
0.1 | 1.2 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
0.1 | 0.1 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
0.1 | 0.2 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.1 | 0.2 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
0.1 | 0.4 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.1 | 0.3 | GO:0000322 | storage vacuole(GO:0000322) |
0.1 | 0.2 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.1 | 0.5 | GO:0020005 | symbiont-containing vacuole membrane(GO:0020005) |
0.1 | 0.5 | GO:0045179 | apical cortex(GO:0045179) |
0.1 | 0.2 | GO:0097452 | GAIT complex(GO:0097452) |
0.1 | 0.3 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
0.1 | 0.3 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.1 | 1.0 | GO:0000145 | exocyst(GO:0000145) |
0.1 | 0.3 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.1 | 0.8 | GO:0016514 | SWI/SNF complex(GO:0016514) |
0.1 | 0.1 | GO:0020003 | symbiont-containing vacuole(GO:0020003) |
0.1 | 0.8 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.1 | 0.1 | GO:0071438 | invadopodium membrane(GO:0071438) |
0.1 | 0.3 | GO:0008091 | spectrin(GO:0008091) |
0.1 | 0.2 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
0.1 | 0.2 | GO:0020018 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
0.1 | 0.2 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
0.1 | 0.2 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
0.1 | 0.2 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
0.0 | 0.2 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
0.0 | 0.2 | GO:0072557 | IPAF inflammasome complex(GO:0072557) |
0.0 | 0.2 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.0 | 0.1 | GO:0048179 | activin receptor complex(GO:0048179) |
0.0 | 0.1 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
0.0 | 0.3 | GO:0031209 | SCAR complex(GO:0031209) |
0.0 | 0.3 | GO:0005845 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.0 | 0.2 | GO:0071797 | LUBAC complex(GO:0071797) |
0.0 | 0.3 | GO:0000801 | central element(GO:0000801) |
0.0 | 0.2 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
0.0 | 0.7 | GO:0030673 | axolemma(GO:0030673) |
0.0 | 0.2 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.0 | 0.1 | GO:0046691 | intracellular canaliculus(GO:0046691) |
0.0 | 0.2 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.0 | 0.1 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
0.0 | 0.2 | GO:0016589 | NURF complex(GO:0016589) |
0.0 | 0.4 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.0 | 0.1 | GO:0005642 | annulate lamellae(GO:0005642) |
0.0 | 0.2 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.0 | 0.4 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
0.0 | 0.3 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.0 | 0.2 | GO:0044194 | cytolytic granule(GO:0044194) |
0.0 | 0.1 | GO:0097443 | sorting endosome(GO:0097443) |
0.0 | 0.2 | GO:0061617 | MICOS complex(GO:0061617) |
0.0 | 0.1 | GO:0071203 | WASH complex(GO:0071203) |
0.0 | 0.2 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
0.0 | 0.5 | GO:0031528 | microvillus membrane(GO:0031528) |
0.0 | 0.5 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
0.0 | 0.2 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
0.0 | 0.3 | GO:0032591 | dendritic spine membrane(GO:0032591) |
0.0 | 0.0 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.0 | 0.2 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
0.0 | 0.3 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.0 | 0.1 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
0.0 | 0.3 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
0.0 | 0.2 | GO:0000788 | nuclear nucleosome(GO:0000788) |
0.0 | 0.0 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
0.0 | 0.0 | GO:1990812 | growth cone filopodium(GO:1990812) |
0.0 | 0.8 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.0 | 0.3 | GO:0031527 | filopodium membrane(GO:0031527) |
0.0 | 0.1 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
0.0 | 0.3 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
0.0 | 0.2 | GO:0098645 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
0.0 | 0.1 | GO:0071942 | XPC complex(GO:0071942) |
0.0 | 0.2 | GO:0070531 | BRCA1-A complex(GO:0070531) |
0.0 | 0.2 | GO:0005638 | lamin filament(GO:0005638) |
0.0 | 0.1 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
0.0 | 2.5 | GO:0044853 | plasma membrane raft(GO:0044853) |
0.0 | 0.4 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
0.0 | 0.3 | GO:0031932 | TORC2 complex(GO:0031932) |
0.0 | 0.0 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
0.0 | 0.1 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
0.0 | 0.0 | GO:0032437 | cuticular plate(GO:0032437) |
0.0 | 0.3 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
0.0 | 0.3 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.0 | 0.1 | GO:0005726 | perichromatin fibrils(GO:0005726) |
0.0 | 0.2 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
0.0 | 0.3 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
0.0 | 0.1 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.0 | 0.1 | GO:0009279 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
0.0 | 0.2 | GO:0000812 | Swr1 complex(GO:0000812) |
0.0 | 0.3 | GO:0031512 | motile primary cilium(GO:0031512) |
0.0 | 0.1 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
0.0 | 0.1 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
0.0 | 0.0 | GO:0005608 | laminin-3 complex(GO:0005608) |
0.0 | 0.1 | GO:0044354 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.0 | 0.0 | GO:0032127 | dense core granule membrane(GO:0032127) |
0.0 | 0.1 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.0 | 0.1 | GO:1990393 | 3M complex(GO:1990393) |
0.0 | 0.1 | GO:0071953 | elastic fiber(GO:0071953) |
0.0 | 0.1 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
0.0 | 0.3 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
0.0 | 0.0 | GO:0005879 | axonemal microtubule(GO:0005879) |
0.0 | 0.1 | GO:0097342 | ripoptosome(GO:0097342) |
0.0 | 0.1 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
0.0 | 0.1 | GO:0030056 | hemidesmosome(GO:0030056) |
0.0 | 0.1 | GO:0005767 | secondary lysosome(GO:0005767) |
0.0 | 0.2 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.0 | 0.1 | GO:0061700 | GATOR2 complex(GO:0061700) |
0.0 | 0.1 | GO:0016342 | catenin complex(GO:0016342) |
0.0 | 0.2 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.0 | 0.1 | GO:0001674 | female germ cell nucleus(GO:0001674) |
0.0 | 0.8 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
0.0 | 0.1 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.0 | 0.4 | GO:0043596 | nuclear replication fork(GO:0043596) |
0.0 | 0.1 | GO:0005745 | m-AAA complex(GO:0005745) |
0.0 | 0.1 | GO:0005796 | Golgi lumen(GO:0005796) |
0.0 | 1.1 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
0.0 | 0.5 | GO:0031941 | filamentous actin(GO:0031941) |
0.0 | 0.2 | GO:0072546 | ER membrane protein complex(GO:0072546) |
0.0 | 0.1 | GO:0001940 | male pronucleus(GO:0001940) |
0.0 | 0.3 | GO:0051233 | spindle midzone(GO:0051233) |
0.0 | 0.1 | GO:0031010 | ISWI-type complex(GO:0031010) |
0.0 | 0.1 | GO:0071565 | nBAF complex(GO:0071565) |
0.0 | 0.3 | GO:0060077 | inhibitory synapse(GO:0060077) |
0.0 | 0.1 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.0 | 0.1 | GO:0005916 | fascia adherens(GO:0005916) |
0.0 | 0.0 | GO:0030312 | external encapsulating structure(GO:0030312) |
0.0 | 0.0 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.0 | 0.3 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.0 | 0.0 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
0.0 | 0.0 | GO:0043511 | inhibin complex(GO:0043511) |
0.0 | 0.2 | GO:0043196 | varicosity(GO:0043196) |
0.0 | 0.0 | GO:0030894 | replisome(GO:0030894) |
0.0 | 0.1 | GO:0033162 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
0.0 | 0.1 | GO:0031091 | platelet alpha granule(GO:0031091) |
0.0 | 0.1 | GO:0032797 | SMN complex(GO:0032797) |
0.0 | 0.2 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
0.0 | 0.3 | GO:0005922 | connexon complex(GO:0005922) |
0.0 | 0.1 | GO:0005688 | U6 snRNP(GO:0005688) |
0.0 | 0.1 | GO:0033263 | CORVET complex(GO:0033263) |
0.0 | 0.1 | GO:0031045 | dense core granule(GO:0031045) |
0.0 | 0.6 | GO:0032432 | actin filament bundle(GO:0032432) |
0.0 | 0.0 | GO:0038201 | TOR complex(GO:0038201) |
0.0 | 0.1 | GO:0097542 | ciliary tip(GO:0097542) |
0.0 | 0.0 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
0.0 | 0.6 | GO:0005844 | polysome(GO:0005844) |
0.0 | 0.0 | GO:0033647 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
0.0 | 0.2 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
0.0 | 0.2 | GO:0070822 | Sin3-type complex(GO:0070822) |
0.0 | 0.0 | GO:0036396 | MIS complex(GO:0036396) |
0.0 | 0.0 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
0.0 | 0.1 | GO:0032300 | mismatch repair complex(GO:0032300) |
0.0 | 0.0 | GO:0070876 | SOSS complex(GO:0070876) |
0.0 | 0.0 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
0.0 | 0.1 | GO:0097470 | ribbon synapse(GO:0097470) |
0.0 | 0.1 | GO:0032039 | integrator complex(GO:0032039) |
0.0 | 0.7 | GO:0001750 | photoreceptor outer segment(GO:0001750) |
0.0 | 0.0 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.0 | 0.3 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
0.0 | 0.0 | GO:0061702 | inflammasome complex(GO:0061702) |
0.0 | 0.2 | GO:0032809 | neuronal cell body membrane(GO:0032809) |
0.0 | 0.0 | GO:0044327 | dendritic spine head(GO:0044327) |
0.0 | 0.1 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
0.0 | 0.0 | GO:0001651 | dense fibrillar component(GO:0001651) |
0.0 | 0.0 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
0.0 | 0.0 | GO:0044308 | axonal spine(GO:0044308) |
0.0 | 0.1 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.0 | 0.0 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
0.0 | 0.1 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
0.0 | 0.0 | GO:0097255 | R2TP complex(GO:0097255) |
0.0 | 0.1 | GO:0033178 | proton-transporting two-sector ATPase complex, catalytic domain(GO:0033178) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 0.4 | GO:0016726 | xanthine dehydrogenase activity(GO:0004854) oxidoreductase activity, acting on CH or CH2 groups, NAD or NADP as acceptor(GO:0016726) |
0.3 | 0.8 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
0.2 | 0.7 | GO:0015186 | L-asparagine transmembrane transporter activity(GO:0015182) L-glutamine transmembrane transporter activity(GO:0015186) |
0.2 | 1.4 | GO:0033695 | oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
0.2 | 0.9 | GO:0045340 | mercury ion binding(GO:0045340) |
0.2 | 0.6 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
0.2 | 0.6 | GO:0008390 | testosterone 16-alpha-hydroxylase activity(GO:0008390) |
0.2 | 0.9 | GO:0016623 | aldehyde oxidase activity(GO:0004031) oxidoreductase activity, acting on the aldehyde or oxo group of donors, oxygen as acceptor(GO:0016623) |
0.2 | 0.8 | GO:0042609 | CD4 receptor binding(GO:0042609) |
0.2 | 0.5 | GO:0061513 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
0.2 | 0.6 | GO:0031433 | telethonin binding(GO:0031433) |
0.2 | 0.6 | GO:0002046 | opsin binding(GO:0002046) |
0.2 | 0.8 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
0.1 | 0.4 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.1 | 0.4 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
0.1 | 0.4 | GO:0045503 | dynein light chain binding(GO:0045503) |
0.1 | 0.4 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.1 | 0.4 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
0.1 | 0.6 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
0.1 | 0.2 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
0.1 | 0.3 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
0.1 | 0.3 | GO:0070996 | type 1 melanocortin receptor binding(GO:0070996) |
0.1 | 0.3 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
0.1 | 0.3 | GO:0070840 | dynein complex binding(GO:0070840) |
0.1 | 0.7 | GO:0018660 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
0.1 | 0.3 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.1 | 0.3 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.1 | 0.3 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
0.1 | 0.4 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.1 | 0.4 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
0.1 | 0.7 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
0.1 | 0.3 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
0.1 | 0.6 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
0.1 | 1.0 | GO:0017166 | vinculin binding(GO:0017166) |
0.1 | 0.5 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
0.1 | 0.5 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
0.1 | 0.6 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
0.1 | 0.2 | GO:1990460 | leptin receptor binding(GO:1990460) |
0.1 | 0.3 | GO:0086007 | voltage-gated calcium channel activity involved in cardiac muscle cell action potential(GO:0086007) |
0.1 | 0.4 | GO:0090482 | vitamin transmembrane transporter activity(GO:0090482) |
0.1 | 1.0 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.1 | 0.2 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.1 | 0.3 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.1 | 0.2 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
0.1 | 0.2 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.1 | 0.2 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
0.1 | 0.2 | GO:0003865 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) cholestenone 5-alpha-reductase activity(GO:0047751) |
0.1 | 0.2 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
0.1 | 0.7 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) |
0.1 | 0.3 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
0.1 | 0.5 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
0.1 | 0.1 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) |
0.1 | 0.3 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
0.1 | 0.2 | GO:0043891 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
0.1 | 0.8 | GO:0042608 | T cell receptor binding(GO:0042608) |
0.1 | 0.2 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
0.1 | 0.5 | GO:0036310 | annealing helicase activity(GO:0036310) |
0.1 | 0.2 | GO:0004103 | choline kinase activity(GO:0004103) |
0.1 | 0.1 | GO:0004065 | arylsulfatase activity(GO:0004065) |
0.1 | 0.2 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
0.1 | 0.2 | GO:0061665 | SUMO ligase activity(GO:0061665) |
0.1 | 0.2 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
0.1 | 0.2 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
0.1 | 0.4 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
0.1 | 0.5 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.1 | 0.4 | GO:0036122 | BMP binding(GO:0036122) |
0.1 | 0.5 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.1 | 0.2 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.1 | 0.3 | GO:0004457 | lactate dehydrogenase activity(GO:0004457) |
0.1 | 0.2 | GO:0043919 | 4-hydroxybenzoate octaprenyltransferase activity(GO:0008412) protoheme IX farnesyltransferase activity(GO:0008495) (S)-2,3-di-O-geranylgeranylglyceryl phosphate synthase activity(GO:0043888) cadaverine aminopropyltransferase activity(GO:0043918) agmatine aminopropyltransferase activity(GO:0043919) 1,4-dihydroxy-2-naphthoate octaprenyltransferase activity(GO:0046428) trans-pentaprenyltranstransferase activity(GO:0048045) ATP dimethylallyltransferase activity(GO:0052622) ADP dimethylallyltransferase activity(GO:0052623) |
0.1 | 0.7 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.1 | 0.2 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.1 | 0.2 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.1 | 0.2 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.1 | 0.2 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
0.1 | 0.4 | GO:0050544 | arachidonic acid binding(GO:0050544) |
0.1 | 0.2 | GO:0051434 | BH3 domain binding(GO:0051434) |
0.1 | 0.2 | GO:0015106 | bicarbonate transmembrane transporter activity(GO:0015106) |
0.1 | 0.3 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
0.1 | 1.1 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.1 | 0.6 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.1 | 0.2 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.1 | 0.7 | GO:0008271 | secondary active sulfate transmembrane transporter activity(GO:0008271) |
0.1 | 0.5 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.1 | 0.3 | GO:0019211 | phosphatase activator activity(GO:0019211) |
0.1 | 0.3 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
0.1 | 0.2 | GO:0070061 | fructose binding(GO:0070061) |
0.1 | 0.2 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
0.0 | 0.2 | GO:0043140 | ATP-dependent 3'-5' DNA helicase activity(GO:0043140) |
0.0 | 0.5 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
0.0 | 0.1 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
0.0 | 0.0 | GO:0043398 | HLH domain binding(GO:0043398) |
0.0 | 0.4 | GO:0016889 | endodeoxyribonuclease activity, producing 3'-phosphomonoesters(GO:0016889) |
0.0 | 0.2 | GO:0010853 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
0.0 | 0.1 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
0.0 | 0.2 | GO:1990239 | steroid hormone binding(GO:1990239) |
0.0 | 0.2 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
0.0 | 0.1 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.0 | 0.1 | GO:0035671 | enone reductase activity(GO:0035671) |
0.0 | 1.0 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.0 | 0.0 | GO:0015116 | sulfate transmembrane transporter activity(GO:0015116) |
0.0 | 0.1 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
0.0 | 0.4 | GO:0034046 | poly(G) binding(GO:0034046) |
0.0 | 0.2 | GO:0034452 | dynactin binding(GO:0034452) |
0.0 | 0.1 | GO:0004942 | anaphylatoxin receptor activity(GO:0004942) |
0.0 | 0.1 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.0 | 0.2 | GO:0001727 | lipid kinase activity(GO:0001727) |
0.0 | 0.2 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
0.0 | 0.2 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.0 | 0.1 | GO:0016901 | oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
0.0 | 0.1 | GO:0047391 | alkylglycerophosphoethanolamine phosphodiesterase activity(GO:0047391) |
0.0 | 0.2 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
0.0 | 0.3 | GO:0004303 | estradiol 17-beta-dehydrogenase activity(GO:0004303) |
0.0 | 0.6 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
0.0 | 0.2 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
0.0 | 0.3 | GO:0019992 | diacylglycerol binding(GO:0019992) |
0.0 | 0.3 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.0 | 0.1 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
0.0 | 0.3 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
0.0 | 0.1 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.0 | 0.2 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
0.0 | 0.1 | GO:0032142 | single guanine insertion binding(GO:0032142) |
0.0 | 0.1 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
0.0 | 0.4 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.0 | 0.2 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.0 | 0.1 | GO:0015232 | heme transporter activity(GO:0015232) |
0.0 | 0.1 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
0.0 | 0.1 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.0 | 0.1 | GO:0005534 | galactose binding(GO:0005534) |
0.0 | 0.1 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
0.0 | 0.1 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
0.0 | 0.1 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
0.0 | 0.1 | GO:0016212 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
0.0 | 0.1 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
0.0 | 0.1 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
0.0 | 0.1 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
0.0 | 0.9 | GO:0045296 | cadherin binding(GO:0045296) |
0.0 | 0.3 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
0.0 | 0.6 | GO:0019825 | oxygen binding(GO:0019825) |
0.0 | 0.1 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.0 | 0.1 | GO:0016530 | metallochaperone activity(GO:0016530) |
0.0 | 0.0 | GO:0018636 | phenanthrene 9,10-monooxygenase activity(GO:0018636) |
0.0 | 0.3 | GO:0070700 | BMP receptor binding(GO:0070700) |
0.0 | 0.1 | GO:0030984 | kininogen binding(GO:0030984) |
0.0 | 0.1 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
0.0 | 0.2 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
0.0 | 0.5 | GO:0008143 | poly(A) binding(GO:0008143) |
0.0 | 0.1 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.0 | 0.5 | GO:0016780 | phosphotransferase activity, for other substituted phosphate groups(GO:0016780) |
0.0 | 0.2 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.0 | 0.2 | GO:0050815 | phosphoserine binding(GO:0050815) |
0.0 | 0.1 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
0.0 | 0.2 | GO:0004630 | phospholipase D activity(GO:0004630) |
0.0 | 0.1 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
0.0 | 0.1 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
0.0 | 0.1 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
0.0 | 0.1 | GO:0001224 | RNA polymerase II transcription cofactor binding(GO:0001224) |
0.0 | 0.1 | GO:0070878 | primary miRNA binding(GO:0070878) |
0.0 | 0.1 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
0.0 | 0.2 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
0.0 | 0.1 | GO:0015189 | arginine transmembrane transporter activity(GO:0015181) L-lysine transmembrane transporter activity(GO:0015189) |
0.0 | 0.4 | GO:0005536 | glucose binding(GO:0005536) |
0.0 | 0.2 | GO:0030957 | Tat protein binding(GO:0030957) |
0.0 | 0.4 | GO:0001618 | virus receptor activity(GO:0001618) |
0.0 | 0.1 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
0.0 | 0.1 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
0.0 | 0.1 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
0.0 | 0.1 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.0 | 0.1 | GO:0070513 | death domain binding(GO:0070513) |
0.0 | 0.1 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
0.0 | 0.3 | GO:0004407 | histone deacetylase activity(GO:0004407) |
0.0 | 0.1 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
0.0 | 0.1 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
0.0 | 0.5 | GO:0008483 | transaminase activity(GO:0008483) |
0.0 | 0.2 | GO:0070492 | oligosaccharide binding(GO:0070492) |
0.0 | 0.4 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.0 | 0.1 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
0.0 | 0.1 | GO:0051733 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) |
0.0 | 0.4 | GO:0043422 | protein kinase B binding(GO:0043422) |
0.0 | 0.2 | GO:0001013 | RNA polymerase I regulatory region DNA binding(GO:0001013) |
0.0 | 0.3 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.0 | 0.0 | GO:0016769 | transferase activity, transferring nitrogenous groups(GO:0016769) |
0.0 | 0.1 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.0 | 0.3 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
0.0 | 0.1 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
0.0 | 0.1 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
0.0 | 0.1 | GO:0004370 | glycerol kinase activity(GO:0004370) |
0.0 | 0.5 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
0.0 | 0.3 | GO:0032041 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
0.0 | 0.1 | GO:0003933 | GTP cyclohydrolase activity(GO:0003933) |
0.0 | 0.5 | GO:0008242 | omega peptidase activity(GO:0008242) |
0.0 | 0.2 | GO:0015651 | quaternary ammonium group transmembrane transporter activity(GO:0015651) |
0.0 | 0.2 | GO:0016215 | acyl-CoA desaturase activity(GO:0016215) |
0.0 | 0.2 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.0 | 0.3 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
0.0 | 0.1 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
0.0 | 0.4 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
0.0 | 0.1 | GO:0051425 | PTB domain binding(GO:0051425) |
0.0 | 0.1 | GO:0015288 | porin activity(GO:0015288) |
0.0 | 0.0 | GO:0000099 | sulfur amino acid transmembrane transporter activity(GO:0000099) |
0.0 | 0.1 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
0.0 | 0.0 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
0.0 | 0.1 | GO:0043237 | laminin-1 binding(GO:0043237) |
0.0 | 0.1 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
0.0 | 0.9 | GO:0050840 | extracellular matrix binding(GO:0050840) |
0.0 | 0.1 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.0 | 0.1 | GO:0005499 | vitamin D binding(GO:0005499) |
0.0 | 0.2 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.0 | 0.1 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.0 | 0.1 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
0.0 | 0.1 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
0.0 | 0.2 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
0.0 | 0.7 | GO:0015485 | cholesterol binding(GO:0015485) |
0.0 | 0.1 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
0.0 | 0.0 | GO:0016717 | oxidoreductase activity, acting on paired donors, with oxidation of a pair of donors resulting in the reduction of molecular oxygen to two molecules of water(GO:0016717) |
0.0 | 0.2 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.0 | 0.1 | GO:0017040 | ceramidase activity(GO:0017040) |
0.0 | 0.1 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
0.0 | 0.5 | GO:0004118 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) photoreceptor cyclic-nucleotide phosphodiesterase activity(GO:0004120) 7,8-dihydro-D-neopterin 2',3'-cyclic phosphate phosphodiesterase activity(GO:0044688) inositol phosphosphingolipid phospholipase activity(GO:0052712) inositol phosphorylceramide phospholipase activity(GO:0052713) mannosyl-inositol phosphorylceramide phospholipase activity(GO:0052714) mannosyl-diinositol phosphorylceramide phospholipase activity(GO:0052715) |
0.0 | 0.2 | GO:0038191 | neuropilin binding(GO:0038191) |
0.0 | 0.1 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
0.0 | 0.2 | GO:0019841 | retinol binding(GO:0019841) |
0.0 | 0.1 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
0.0 | 0.1 | GO:1990715 | mRNA CDS binding(GO:1990715) |
0.0 | 0.1 | GO:0046848 | hydroxyapatite binding(GO:0046848) |
0.0 | 0.0 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.0 | 0.1 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
0.0 | 0.1 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
0.0 | 0.1 | GO:0009041 | uridylate kinase activity(GO:0009041) |
0.0 | 0.1 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
0.0 | 0.2 | GO:0018447 | pinocarveol dehydrogenase activity(GO:0018446) chloral hydrate dehydrogenase activity(GO:0018447) hydroxymethylmethylsilanediol oxidase activity(GO:0018448) 1-phenylethanol dehydrogenase activity(GO:0018449) myrtenol dehydrogenase activity(GO:0018450) cis-1,2-dihydroxy-1,2-dihydro-8-carboxynaphthalene dehydrogenase activity(GO:0034522) 3-hydroxy-4-methyloctanoyl-CoA dehydrogenase activity(GO:0034582) 2-hydroxy-4-isopropenylcyclohexane-1-carboxyl-CoA dehydrogenase activity(GO:0034778) cis-9,10-dihydroanthracene-9,10-diol dehydrogenase activity(GO:0034817) citronellol dehydrogenase activity(GO:0034821) naphthyl-2-hydroxymethyl-succinyl-CoA dehydrogenase activity(GO:0034847) 2,4,4-trimethyl-1-pentanol dehydrogenase activity(GO:0034863) 2,4,4-trimethyl-3-hydroxypentanoyl-CoA dehydrogenase activity(GO:0034868) 1-hydroxy-4,4-dimethylpentan-3-one dehydrogenase activity(GO:0034871) endosulfan diol dehydrogenase activity(GO:0034891) endosulfan hydroxyether dehydrogenase activity(GO:0034901) 3-hydroxy-2-methylhexanoyl-CoA dehydrogenase activity(GO:0034918) 3-hydroxy-2,6-dimethyl-5-methylene-heptanoyl-CoA dehydrogenase activity(GO:0034944) versicolorin reductase activity(GO:0042469) ketoreductase activity(GO:0045703) |
0.0 | 0.1 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
0.0 | 0.1 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.0 | 0.1 | GO:0097617 | annealing activity(GO:0097617) |
0.0 | 0.1 | GO:0033142 | progesterone receptor binding(GO:0033142) |
0.0 | 0.2 | GO:0048038 | quinone binding(GO:0048038) |
0.0 | 0.1 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.0 | 0.1 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
0.0 | 0.2 | GO:0003993 | acid phosphatase activity(GO:0003993) |
0.0 | 0.1 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.0 | 0.1 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
0.0 | 0.1 | GO:0015180 | L-alanine transmembrane transporter activity(GO:0015180) alanine transmembrane transporter activity(GO:0022858) |
0.0 | 0.1 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
0.0 | 0.5 | GO:0043914 | NADPH:sulfur oxidoreductase activity(GO:0043914) |
0.0 | 0.2 | GO:0015166 | polyol transmembrane transporter activity(GO:0015166) |
0.0 | 0.0 | GO:0004337 | geranyltranstransferase activity(GO:0004337) |
0.0 | 0.3 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.0 | 0.1 | GO:0030275 | LRR domain binding(GO:0030275) |
0.0 | 0.2 | GO:0031005 | filamin binding(GO:0031005) |
0.0 | 0.0 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
0.0 | 0.1 | GO:0008494 | translation activator activity(GO:0008494) |
0.0 | 0.2 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
0.0 | 0.0 | GO:0070052 | collagen V binding(GO:0070052) |
0.0 | 0.1 | GO:0004556 | alpha-amylase activity(GO:0004556) |
0.0 | 0.1 | GO:0048495 | Roundabout binding(GO:0048495) |
0.0 | 0.1 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.0 | 0.1 | GO:0019961 | interferon binding(GO:0019961) |
0.0 | 0.0 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.0 | 0.1 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
0.0 | 0.1 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.0 | 0.1 | GO:0019808 | polyamine binding(GO:0019808) |
0.0 | 0.1 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
0.0 | 0.1 | GO:0035241 | protein-arginine omega-N monomethyltransferase activity(GO:0035241) |
0.0 | 0.0 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
0.0 | 0.1 | GO:0016443 | bidentate ribonuclease III activity(GO:0016443) |
0.0 | 0.0 | GO:0019237 | centromeric DNA binding(GO:0019237) |
0.0 | 0.0 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.0 | 0.1 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
0.0 | 0.1 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
0.0 | 0.2 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
0.0 | 0.1 | GO:0008121 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.0 | 0.0 | GO:1901611 | phosphatidylglycerol binding(GO:1901611) cardiolipin binding(GO:1901612) |
0.0 | 0.0 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
0.0 | 0.7 | GO:0003743 | translation initiation factor activity(GO:0003743) |
0.0 | 0.1 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
0.0 | 0.1 | GO:0004966 | galanin receptor activity(GO:0004966) |
0.0 | 0.0 | GO:0031994 | insulin-like growth factor I binding(GO:0031994) |
0.0 | 0.1 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
0.0 | 0.2 | GO:0005351 | sugar:proton symporter activity(GO:0005351) |
0.0 | 0.2 | GO:0035591 | signaling adaptor activity(GO:0035591) |
0.0 | 0.1 | GO:0003796 | lysozyme activity(GO:0003796) |
0.0 | 0.1 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
0.0 | 0.0 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
0.0 | 0.1 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
0.0 | 0.1 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
0.0 | 0.2 | GO:0031434 | mitogen-activated protein kinase kinase binding(GO:0031434) |
0.0 | 0.0 | GO:0031127 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
0.0 | 0.1 | GO:0017070 | U6 snRNA binding(GO:0017070) |
0.0 | 0.1 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
0.0 | 0.0 | GO:0030881 | beta-2-microglobulin binding(GO:0030881) |
0.0 | 0.0 | GO:0019002 | GMP binding(GO:0019002) |
0.0 | 0.0 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
0.0 | 0.1 | GO:0016933 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
0.0 | 0.0 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
0.0 | 0.1 | GO:0031690 | adrenergic receptor binding(GO:0031690) |
0.0 | 0.0 | GO:0035877 | death effector domain binding(GO:0035877) |
0.0 | 0.1 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.0 | 0.1 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
0.0 | 0.2 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
0.0 | 0.0 | GO:0004115 | 3',5'-cyclic-AMP phosphodiesterase activity(GO:0004115) |
0.0 | 0.1 | GO:0008745 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) peptidoglycan receptor activity(GO:0016019) |
0.0 | 0.1 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.0 | 0.0 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.0 | 0.4 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
0.0 | 0.1 | GO:0034713 | type I transforming growth factor beta receptor binding(GO:0034713) |
0.0 | 0.1 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
0.0 | 0.1 | GO:0030553 | cGMP binding(GO:0030553) |
0.0 | 0.1 | GO:0001134 | transcription factor activity, transcription factor recruiting(GO:0001134) |
0.0 | 0.0 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
0.0 | 0.1 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
0.0 | 0.7 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
0.0 | 0.0 | GO:0015193 | L-proline transmembrane transporter activity(GO:0015193) |
0.0 | 0.5 | GO:0004869 | cysteine-type endopeptidase inhibitor activity(GO:0004869) |
0.0 | 0.0 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.0 | 0.2 | GO:0022829 | wide pore channel activity(GO:0022829) |
0.0 | 0.0 | GO:0034191 | apolipoprotein A-I receptor binding(GO:0034191) |
0.0 | 0.2 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
0.0 | 0.0 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
0.0 | 0.2 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.0 | 0.0 | GO:0032405 | MutLalpha complex binding(GO:0032405) |
0.0 | 1.3 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
0.0 | 0.1 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
0.0 | 0.0 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
0.0 | 0.0 | GO:0030172 | troponin C binding(GO:0030172) |
0.0 | 0.1 | GO:0008432 | JUN kinase binding(GO:0008432) |
0.0 | 0.0 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
0.0 | 0.0 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
0.0 | 0.3 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
0.0 | 0.0 | GO:0019863 | IgE binding(GO:0019863) |
0.0 | 0.2 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
0.0 | 0.1 | GO:0005003 | ephrin receptor activity(GO:0005003) |
0.0 | 0.1 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
0.0 | 0.1 | GO:0019864 | IgG binding(GO:0019864) |
0.0 | 0.0 | GO:0043912 | D-lysine oxidase activity(GO:0043912) |
0.0 | 0.1 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
0.0 | 0.0 | GO:0016997 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
0.0 | 0.1 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.0 | 0.1 | GO:0016854 | racemase and epimerase activity(GO:0016854) |
0.0 | 0.0 | GO:0016421 | CoA carboxylase activity(GO:0016421) ligase activity, forming carbon-carbon bonds(GO:0016885) |
0.0 | 0.0 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
0.0 | 0.1 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
0.0 | 0.1 | GO:0050649 | testosterone 6-beta-hydroxylase activity(GO:0050649) |
0.0 | 0.0 | GO:0004802 | transketolase activity(GO:0004802) |
0.0 | 0.0 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.0 | 0.0 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.0 | 0.2 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
0.0 | 0.0 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
0.0 | 0.1 | GO:0015026 | coreceptor activity(GO:0015026) |
0.0 | 0.0 | GO:0004558 | alpha-1,4-glucosidase activity(GO:0004558) |
0.0 | 0.0 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
0.0 | 0.0 | GO:0070699 | type II activin receptor binding(GO:0070699) |
0.0 | 0.1 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
0.0 | 0.3 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
0.0 | 0.0 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
0.0 | 0.3 | GO:0019894 | kinesin binding(GO:0019894) |
0.0 | 0.1 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.0 | 0.1 | GO:0001595 | angiotensin receptor activity(GO:0001595) |
0.0 | 0.2 | GO:0005537 | mannose binding(GO:0005537) |
0.0 | 0.0 | GO:0017116 | single-stranded DNA-dependent ATP-dependent DNA helicase activity(GO:0017116) |
0.0 | 0.1 | GO:0005521 | lamin binding(GO:0005521) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 1.4 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.1 | 0.4 | PID FGF PATHWAY | FGF signaling pathway |
0.1 | 2.8 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
0.1 | 0.6 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.1 | 0.3 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
0.1 | 1.0 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
0.1 | 0.1 | PID S1P S1P1 PATHWAY | S1P1 pathway |
0.0 | 0.5 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
0.0 | 0.3 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.0 | 0.5 | PID S1P S1P2 PATHWAY | S1P2 pathway |
0.0 | 0.1 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
0.0 | 0.2 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
0.0 | 0.2 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
0.0 | 0.7 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
0.0 | 0.1 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
0.0 | 1.3 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
0.0 | 0.4 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.0 | 1.5 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
0.0 | 1.4 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.0 | 0.2 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.0 | 0.6 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
0.0 | 0.2 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.0 | 0.2 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
0.0 | 0.2 | PID AURORA A PATHWAY | Aurora A signaling |
0.0 | 0.2 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.0 | 0.2 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.0 | 1.0 | PID BMP PATHWAY | BMP receptor signaling |
0.0 | 0.1 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
0.0 | 0.4 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
0.0 | 1.1 | PID RAC1 PATHWAY | RAC1 signaling pathway |
0.0 | 0.2 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
0.0 | 0.0 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
0.0 | 0.3 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
0.0 | 1.0 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
0.0 | 0.1 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.0 | 0.9 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.0 | 0.2 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
0.0 | 0.0 | ST B CELL ANTIGEN RECEPTOR | B Cell Antigen Receptor |
0.0 | 0.1 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.0 | 0.2 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.0 | 0.2 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.0 | 0.1 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.0 | 0.3 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
0.0 | 0.0 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
0.0 | 0.5 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
0.0 | 0.0 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
0.0 | 0.1 | PID ALK2 PATHWAY | ALK2 signaling events |
0.0 | 0.0 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.0 | 0.0 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
0.0 | 0.3 | PID RAS PATHWAY | Regulation of Ras family activation |
0.0 | 0.3 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.0 | 0.3 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
0.0 | 0.0 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
0.0 | 0.2 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
0.0 | 0.5 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
0.0 | 0.3 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.0 | 0.1 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
0.0 | 0.2 | PID EPHA FWDPATHWAY | EPHA forward signaling |
0.0 | 0.0 | PID IL27 PATHWAY | IL27-mediated signaling events |
0.0 | 0.1 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.0 | 0.7 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
0.0 | 0.1 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.0 | 0.0 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 0.7 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
0.1 | 1.7 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
0.1 | 1.3 | REACTOME GRB2 SOS PROVIDES LINKAGE TO MAPK SIGNALING FOR INTERGRINS | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
0.1 | 1.1 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.1 | 0.2 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
0.1 | 0.1 | REACTOME ARMS MEDIATED ACTIVATION | Genes involved in ARMS-mediated activation |
0.1 | 1.2 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
0.1 | 0.6 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
0.1 | 1.2 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
0.0 | 0.6 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
0.0 | 0.2 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.0 | 0.1 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
0.0 | 1.4 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
0.0 | 0.0 | REACTOME CTLA4 INHIBITORY SIGNALING | Genes involved in CTLA4 inhibitory signaling |
0.0 | 1.0 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.0 | 0.4 | REACTOME FATTY ACID TRIACYLGLYCEROL AND KETONE BODY METABOLISM | Genes involved in Fatty acid, triacylglycerol, and ketone body metabolism |
0.0 | 0.7 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
0.0 | 1.0 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
0.0 | 0.4 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
0.0 | 0.1 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
0.0 | 0.3 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
0.0 | 1.2 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
0.0 | 0.0 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
0.0 | 0.1 | REACTOME KERATAN SULFATE KERATIN METABOLISM | Genes involved in Keratan sulfate/keratin metabolism |
0.0 | 0.5 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
0.0 | 0.6 | REACTOME NUCLEAR EVENTS KINASE AND TRANSCRIPTION FACTOR ACTIVATION | Genes involved in Nuclear Events (kinase and transcription factor activation) |
0.0 | 0.3 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.0 | 0.3 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
0.0 | 0.6 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.0 | 0.0 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.0 | 0.3 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
0.0 | 0.3 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
0.0 | 0.0 | REACTOME RIG I MDA5 MEDIATED INDUCTION OF IFN ALPHA BETA PATHWAYS | Genes involved in RIG-I/MDA5 mediated induction of IFN-alpha/beta pathways |
0.0 | 0.2 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
0.0 | 0.1 | REACTOME SIGNALING BY WNT | Genes involved in Signaling by Wnt |
0.0 | 0.1 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.0 | 0.1 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
0.0 | 1.3 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
0.0 | 0.1 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
0.0 | 0.1 | REACTOME COSTIMULATION BY THE CD28 FAMILY | Genes involved in Costimulation by the CD28 family |
0.0 | 0.2 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
0.0 | 0.2 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
0.0 | 0.4 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
0.0 | 0.2 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
0.0 | 0.1 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
0.0 | 0.4 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.0 | 0.2 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.0 | 0.2 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
0.0 | 0.3 | REACTOME NRIF SIGNALS CELL DEATH FROM THE NUCLEUS | Genes involved in NRIF signals cell death from the nucleus |
0.0 | 0.2 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.0 | 0.5 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
0.0 | 0.3 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
0.0 | 0.1 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.0 | 0.5 | REACTOME AMYLOIDS | Genes involved in Amyloids |
0.0 | 0.6 | REACTOME REGULATION OF GLUCOKINASE BY GLUCOKINASE REGULATORY PROTEIN | Genes involved in Regulation of Glucokinase by Glucokinase Regulatory Protein |
0.0 | 0.0 | REACTOME P130CAS LINKAGE TO MAPK SIGNALING FOR INTEGRINS | Genes involved in p130Cas linkage to MAPK signaling for integrins |
0.0 | 0.3 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
0.0 | 0.2 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.0 | 0.3 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
0.0 | 0.1 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.0 | 0.1 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
0.0 | 0.2 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.0 | 0.1 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.0 | 0.3 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
0.0 | 0.2 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
0.0 | 0.3 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
0.0 | 0.1 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
0.0 | 0.7 | REACTOME REGULATION OF WATER BALANCE BY RENAL AQUAPORINS | Genes involved in Regulation of Water Balance by Renal Aquaporins |
0.0 | 0.1 | REACTOME INTEGRATION OF ENERGY METABOLISM | Genes involved in Integration of energy metabolism |
0.0 | 0.1 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.0 | 0.2 | REACTOME SIGNALING BY FGFR1 MUTANTS | Genes involved in Signaling by FGFR1 mutants |
0.0 | 0.2 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
0.0 | 0.2 | REACTOME ACTIVATION OF IRF3 IRF7 MEDIATED BY TBK1 IKK EPSILON | Genes involved in Activation of IRF3/IRF7 mediated by TBK1/IKK epsilon |
0.0 | 0.2 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.0 | 0.5 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
0.0 | 0.2 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.0 | 0.0 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
0.0 | 0.1 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.0 | 0.2 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.0 | 0.2 | REACTOME INTERFERON GAMMA SIGNALING | Genes involved in Interferon gamma signaling |
0.0 | 0.1 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
0.0 | 0.2 | REACTOME INWARDLY RECTIFYING K CHANNELS | Genes involved in Inwardly rectifying K+ channels |
0.0 | 0.1 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
0.0 | 0.3 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
0.0 | 0.4 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
0.0 | 0.0 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
0.0 | 0.3 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
0.0 | 0.1 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.0 | 0.2 | REACTOME EICOSANOID LIGAND BINDING RECEPTORS | Genes involved in Eicosanoid ligand-binding receptors |
0.0 | 0.2 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
0.0 | 0.2 | REACTOME AMINO ACID AND OLIGOPEPTIDE SLC TRANSPORTERS | Genes involved in Amino acid and oligopeptide SLC transporters |
0.0 | 0.1 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.0 | 0.1 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
0.0 | 0.2 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.0 | 0.1 | REACTOME G PROTEIN BETA GAMMA SIGNALLING | Genes involved in G-protein beta:gamma signalling |
0.0 | 0.1 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
0.0 | 0.0 | REACTOME SIGNALING BY ERBB2 | Genes involved in Signaling by ERBB2 |
0.0 | 0.3 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.0 | 0.3 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.0 | 0.1 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
0.0 | 0.0 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
0.0 | 0.1 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
0.0 | 0.1 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
0.0 | 0.1 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
0.0 | 0.0 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |