| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Tcf4
|
ENSMUSG00000053477.9 | transcription factor 4 |
|
Mesp1
|
ENSMUSG00000030544.5 | mesoderm posterior 1 |
| CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|---|---|
| chr7_79792730_79792909 | Mesp1 | 969 | 0.349277 | 0.43 | 4.0e-01 | Click! |
| chr7_79792506_79792703 | Mesp1 | 1184 | 0.278166 | 0.38 | 4.6e-01 | Click! |
| chr7_79792969_79793298 | Mesp1 | 655 | 0.514039 | -0.25 | 6.3e-01 | Click! |
| chr7_79799158_79799311 | Mesp1 | 5446 | 0.105602 | 0.11 | 8.4e-01 | Click! |
| chr18_69666817_69667000 | Tcf4 | 10241 | 0.291511 | 0.89 | 1.9e-02 | Click! |
| chr18_69659921_69660072 | Tcf4 | 3329 | 0.363644 | 0.83 | 4.2e-02 | Click! |
| chr18_69693625_69693776 | Tcf4 | 11320 | 0.289791 | 0.77 | 7.1e-02 | Click! |
| chr18_69412712_69412880 | Tcf4 | 3101 | 0.366656 | 0.71 | 1.1e-01 | Click! |
| chr18_69393942_69394102 | Tcf4 | 21875 | 0.248722 | 0.68 | 1.4e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr16_46463130_46463327 | 3.64 |
Nectin3 |
nectin cell adhesion molecule 3 |
14718 |
0.27 |
| chr5_125522928_125523080 | 1.82 |
Aacs |
acetoacetyl-CoA synthetase |
7761 |
0.16 |
| chr7_45710445_45711101 | 1.66 |
Sphk2 |
sphingosine kinase 2 |
2670 |
0.09 |
| chr12_84290810_84291009 | 1.45 |
Ptgr2 |
prostaglandin reductase 2 |
5496 |
0.13 |
| chr9_74891211_74891440 | 1.06 |
Onecut1 |
one cut domain, family member 1 |
24841 |
0.14 |
| chr9_44085495_44085674 | 1.04 |
Usp2 |
ubiquitin specific peptidase 2 |
634 |
0.45 |
| chrX_140567606_140567780 | 0.97 |
AL683809.1 |
TSC22 domain family, member 3 (Tsc22d3), pseuodgene |
15906 |
0.17 |
| chr1_21267840_21267991 | 0.96 |
Gm28836 |
predicted gene 28836 |
3678 |
0.13 |
| chr5_125516699_125516857 | 0.93 |
Aacs |
acetoacetyl-CoA synthetase |
1535 |
0.34 |
| chr1_186325767_186325937 | 0.91 |
Gm37491 |
predicted gene, 37491 |
21463 |
0.24 |
| chr3_18161672_18161928 | 0.88 |
Gm23686 |
predicted gene, 23686 |
15825 |
0.23 |
| chr5_125523603_125523770 | 0.87 |
Tmem132b |
transmembrane protein 132B |
8088 |
0.16 |
| chr2_134495277_134495573 | 0.87 |
Hao1 |
hydroxyacid oxidase 1, liver |
58882 |
0.16 |
| chr9_74894770_74895613 | 0.84 |
Onecut1 |
one cut domain, family member 1 |
28707 |
0.13 |
| chr5_125526040_125526191 | 0.81 |
Tmem132b |
transmembrane protein 132B |
5659 |
0.17 |
| chr4_3321136_3321319 | 0.80 |
Gm11786 |
predicted gene 11786 |
5948 |
0.22 |
| chr11_120812894_120813176 | 0.79 |
Fasn |
fatty acid synthase |
2420 |
0.14 |
| chr2_155056753_155056913 | 0.78 |
a |
nonagouti |
9218 |
0.14 |
| chr11_120819185_120819682 | 0.77 |
Fasn |
fatty acid synthase |
3978 |
0.11 |
| chr6_119352584_119352747 | 0.75 |
Cacna2d4 |
calcium channel, voltage-dependent, alpha 2/delta subunit 4 |
20103 |
0.17 |
| chr8_105090981_105091315 | 0.75 |
Ces3b |
carboxylesterase 3B |
2529 |
0.16 |
| chr3_89142602_89142893 | 0.75 |
Pklr |
pyruvate kinase liver and red blood cell |
6124 |
0.07 |
| chr11_69098275_69098686 | 0.74 |
Per1 |
period circadian clock 1 |
468 |
0.58 |
| chr11_16826830_16827159 | 0.73 |
Egfros |
epidermal growth factor receptor, opposite strand |
3708 |
0.27 |
| chr12_104347211_104347391 | 0.72 |
Serpina3k |
serine (or cysteine) peptidase inhibitor, clade A, member 3K |
8815 |
0.12 |
| chr7_99681276_99681427 | 0.71 |
Slco2b1 |
solute carrier organic anion transporter family, member 2b1 |
10418 |
0.1 |
| chr17_43106450_43106764 | 0.71 |
E130008D07Rik |
RIKEN cDNA E130008D07 gene |
51589 |
0.16 |
| chr2_58773576_58773851 | 0.71 |
Upp2 |
uridine phosphorylase 2 |
8388 |
0.21 |
| chr17_71214957_71215123 | 0.69 |
Lpin2 |
lipin 2 |
10364 |
0.17 |
| chr9_49365685_49366095 | 0.69 |
Drd2 |
dopamine receptor D2 |
25263 |
0.2 |
| chr9_44088184_44088403 | 0.67 |
Usp2 |
ubiquitin specific peptidase 2 |
1103 |
0.24 |
| chr2_148017296_148017455 | 0.67 |
9030622O22Rik |
RIKEN cDNA 9030622O22 gene |
20895 |
0.16 |
| chr19_3451534_3452133 | 0.67 |
Ppp6r3 |
protein phosphatase 6, regulatory subunit 3 |
19172 |
0.12 |
| chr2_58771100_58771251 | 0.67 |
Upp2 |
uridine phosphorylase 2 |
5850 |
0.22 |
| chr10_68108745_68108896 | 0.67 |
Arid5b |
AT rich interactive domain 5B (MRF1-like) |
27806 |
0.19 |
| chr6_117765814_117765969 | 0.66 |
1700030F04Rik |
RIKEN cDNA 1700030F04 gene |
14122 |
0.17 |
| chr6_145853246_145853409 | 0.66 |
Gm43909 |
predicted gene, 43909 |
9970 |
0.17 |
| chr5_114528485_114528658 | 0.66 |
Gm13790 |
predicted gene 13790 |
22718 |
0.14 |
| chr2_33370578_33371002 | 0.66 |
Ralgps1 |
Ral GEF with PH domain and SH3 binding motif 1 |
639 |
0.68 |
| chr1_38128833_38129005 | 0.66 |
Rev1 |
REV1, DNA directed polymerase |
602 |
0.7 |
| chr7_98352590_98353259 | 0.66 |
Tsku |
tsukushi, small leucine rich proteoglycan |
7155 |
0.18 |
| chr1_21265813_21266032 | 0.66 |
Gm28836 |
predicted gene 28836 |
5671 |
0.11 |
| chr7_63899596_63899952 | 0.66 |
Gm27252 |
predicted gene 27252 |
1800 |
0.28 |
| chr9_30906121_30906748 | 0.65 |
Adamts15 |
a disintegrin-like and metallopeptidase (reprolysin type) with thrombospondin type 1 motif, 15 |
3223 |
0.28 |
| chr5_125040097_125040498 | 0.65 |
Ncor2 |
nuclear receptor co-repressor 2 |
2515 |
0.25 |
| chr2_167336792_167337118 | 0.64 |
B4galt5 |
UDP-Gal:betaGlcNAc beta 1,4-galactosyltransferase, polypeptide 5 |
12228 |
0.18 |
| chr9_41328613_41328764 | 0.63 |
Mir100hg |
Mir100 Mirlet7a-2 Mir125b-1 cluster host gene |
78 |
0.97 |
| chr14_59443633_59443793 | 0.63 |
Cab39l |
calcium binding protein 39-like |
2732 |
0.21 |
| chr8_68057735_68057886 | 0.63 |
Psd3 |
pleckstrin and Sec7 domain containing 3 |
4417 |
0.29 |
| chr10_24362567_24362800 | 0.63 |
Gm15271 |
predicted gene 15271 |
84807 |
0.08 |
| chr11_50324830_50325400 | 0.62 |
Canx |
calnexin |
558 |
0.65 |
| chr5_89491395_89491590 | 0.61 |
Gm6366 |
predicted gene 6366 |
8485 |
0.2 |
| chr3_18180036_18180240 | 0.61 |
Gm23686 |
predicted gene, 23686 |
2513 |
0.35 |
| chr1_91458255_91458771 | 0.61 |
Per2 |
period circadian clock 2 |
811 |
0.48 |
| chr11_16797325_16797505 | 0.61 |
Egfros |
epidermal growth factor receptor, opposite strand |
33287 |
0.16 |
| chr5_130010252_130010587 | 0.60 |
Asl |
argininosuccinate lyase |
4303 |
0.13 |
| chr1_60501628_60501779 | 0.60 |
Raph1 |
Ras association (RalGDS/AF-6) and pleckstrin homology domains 1 |
1562 |
0.34 |
| chr11_28684227_28684558 | 0.60 |
2810471M01Rik |
RIKEN cDNA 2810471M01 gene |
2828 |
0.27 |
| chr4_108059939_108060123 | 0.60 |
Scp2 |
sterol carrier protein 2, liver |
11332 |
0.13 |
| chr15_60824417_60824711 | 0.60 |
9930014A18Rik |
RIKEN cDNA 9930014A18 gene |
223 |
0.76 |
| chr7_63917442_63917645 | 0.60 |
E030018B13Rik |
RIKEN cDNA E030018B13 gene |
686 |
0.6 |
| chr5_122305939_122306109 | 0.60 |
Gm15842 |
predicted gene 15842 |
3602 |
0.14 |
| chr5_125501934_125502085 | 0.59 |
Aacs |
acetoacetyl-CoA synthetase |
4140 |
0.17 |
| chr2_148018276_148018427 | 0.59 |
9030622O22Rik |
RIKEN cDNA 9030622O22 gene |
19919 |
0.17 |
| chr11_120813788_120814608 | 0.59 |
Fasn |
fatty acid synthase |
1257 |
0.26 |
| chr8_95800469_95800620 | 0.59 |
4930513N10Rik |
RIKEN cDNA 4930513N10 gene |
6200 |
0.09 |
| chr12_104342354_104343298 | 0.58 |
Serpina3k |
serine (or cysteine) peptidase inhibitor, clade A, member 3K |
4340 |
0.13 |
| chr13_82201076_82201227 | 0.58 |
Gm48155 |
predicted gene, 48155 |
111394 |
0.07 |
| chr8_122324060_122324293 | 0.58 |
Zfpm1 |
zinc finger protein, multitype 1 |
9522 |
0.13 |
| chr2_52614255_52614574 | 0.58 |
Bloc1s2-ps |
biogenesis of lysosomal organelles complex-1, subunit 2, pseudogene |
5340 |
0.25 |
| chrX_161291880_161292049 | 0.58 |
Gm15262 |
predicted gene 15262 |
4508 |
0.25 |
| chr15_99041967_99042308 | 0.58 |
Tuba1c |
tubulin, alpha 1C |
11816 |
0.08 |
| chr8_12805253_12805404 | 0.57 |
Atp11a |
ATPase, class VI, type 11A |
6088 |
0.17 |
| chr17_46054574_46054727 | 0.57 |
Vegfa |
vascular endothelial growth factor A |
22281 |
0.12 |
| chr6_51678830_51679023 | 0.57 |
Gm38811 |
predicted gene, 38811 |
32155 |
0.18 |
| chr18_44545771_44545978 | 0.57 |
Mcc |
mutated in colorectal cancers |
26358 |
0.23 |
| chr9_44087034_44087185 | 0.57 |
Usp2 |
ubiquitin specific peptidase 2 |
81 |
0.91 |
| chr9_74705986_74706151 | 0.57 |
Gm27233 |
predicted gene 27233 |
3194 |
0.31 |
| chr2_31477347_31478122 | 0.57 |
Ass1 |
argininosuccinate synthetase 1 |
7527 |
0.19 |
| chr1_162987951_162988105 | 0.57 |
Fmo3 |
flavin containing monooxygenase 3 |
3500 |
0.2 |
| chr7_94427849_94428131 | 0.57 |
Gm44602 |
predicted gene 44602 |
47590 |
0.17 |
| chr1_130715772_130716198 | 0.56 |
Pfkfb2 |
6-phosphofructo-2-kinase/fructose-2,6-biphosphatase 2 |
171 |
0.49 |
| chr13_63291371_63291534 | 0.56 |
Aopep |
aminopeptidase O |
7341 |
0.08 |
| chr2_147989793_147989944 | 0.56 |
9030622O22Rik |
RIKEN cDNA 9030622O22 gene |
13683 |
0.21 |
| chr18_38881070_38881254 | 0.56 |
Gm5820 |
predicted gene 5820 |
11296 |
0.2 |
| chr2_154868249_154868417 | 0.56 |
Eif2s2 |
eukaryotic translation initiation factor 2, subunit 2 (beta) |
24449 |
0.17 |
| chr10_87861176_87861394 | 0.55 |
Igf1 |
insulin-like growth factor 1 |
44 |
0.97 |
| chr7_118698593_118698744 | 0.55 |
Gde1 |
glycerophosphodiester phosphodiesterase 1 |
6712 |
0.13 |
| chr15_39925743_39925924 | 0.55 |
Lrp12 |
low density lipoprotein-related protein 12 |
17857 |
0.17 |
| chr16_49775385_49775536 | 0.55 |
Gm15518 |
predicted gene 15518 |
23410 |
0.2 |
| chr2_32525017_32525309 | 0.55 |
Gm13412 |
predicted gene 13412 |
132 |
0.92 |
| chr8_84147166_84147595 | 0.55 |
Cc2d1a |
coiled-coil and C2 domain containing 1A |
485 |
0.42 |
| chr19_40221288_40221466 | 0.54 |
Pdlim1 |
PDZ and LIM domain 1 (elfin) |
1979 |
0.26 |
| chr12_40574749_40574900 | 0.54 |
Dock4 |
dedicator of cytokinesis 4 |
128488 |
0.05 |
| chr5_102620929_102621080 | 0.54 |
Arhgap24 |
Rho GTPase activating protein 24 |
103969 |
0.07 |
| chr3_18212929_18213080 | 0.54 |
Cyp7b1 |
cytochrome P450, family 7, subfamily b, polypeptide 1 |
30334 |
0.17 |
| chr15_81847424_81847575 | 0.54 |
Gm8444 |
predicted gene 8444 |
3786 |
0.11 |
| chr5_125493164_125493370 | 0.54 |
Aacs |
acetoacetyl-CoA synthetase |
12882 |
0.13 |
| chr3_129443031_129443205 | 0.54 |
Gm5712 |
predicted gene 5712 |
9445 |
0.17 |
| chr15_59008631_59008877 | 0.53 |
4930544F09Rik |
RIKEN cDNA 4930544F09 gene |
24618 |
0.16 |
| chr18_21286727_21286878 | 0.53 |
Garem1 |
GRB2 associated regulator of MAPK1 subtype 1 |
13321 |
0.17 |
| chr19_37457642_37457822 | 0.53 |
Gm23026 |
predicted gene, 23026 |
6014 |
0.13 |
| chr5_125484884_125485057 | 0.53 |
Gm27551 |
predicted gene, 27551 |
5593 |
0.14 |
| chr10_87884302_87884648 | 0.53 |
Igf1os |
insulin-like growth factor 1, opposite strand |
21094 |
0.18 |
| chr1_21255692_21256129 | 0.53 |
Gsta3 |
glutathione S-transferase, alpha 3 |
2389 |
0.17 |
| chr8_3050274_3050432 | 0.53 |
Gm44634 |
predicted gene 44634 |
5941 |
0.21 |
| chr3_107235103_107235636 | 0.53 |
Prok1 |
prokineticin 1 |
1892 |
0.24 |
| chr14_34328663_34328894 | 0.52 |
Glud1 |
glutamate dehydrogenase 1 |
116 |
0.93 |
| chr16_26678560_26678733 | 0.52 |
Il1rap |
interleukin 1 receptor accessory protein |
43788 |
0.18 |
| chr11_120807985_120808259 | 0.52 |
Fasn |
fatty acid synthase |
483 |
0.62 |
| chr7_16033747_16033941 | 0.52 |
Bicra |
BRD4 interacting chromatin remodeling complex associated protein |
14077 |
0.12 |
| chr1_163150756_163150961 | 0.52 |
Gm22434 |
predicted gene, 22434 |
32631 |
0.15 |
| chr5_86918463_86918614 | 0.52 |
Gm25211 |
predicted gene, 25211 |
2216 |
0.17 |
| chr15_58982379_58982687 | 0.52 |
4930544F09Rik |
RIKEN cDNA 4930544F09 gene |
1603 |
0.34 |
| chr8_93110072_93110255 | 0.51 |
Ces1c |
carboxylesterase 1C |
14366 |
0.14 |
| chr8_40881703_40881854 | 0.51 |
Slc7a2 |
solute carrier family 7 (cationic amino acid transporter, y+ system), member 2 |
6830 |
0.17 |
| chr15_3482247_3482450 | 0.51 |
Ghr |
growth hormone receptor |
10704 |
0.28 |
| chr17_57221711_57222046 | 0.51 |
C3 |
complement component 3 |
949 |
0.4 |
| chr7_34234031_34234465 | 0.51 |
Gm12758 |
predicted gene 12758 |
129 |
0.51 |
| chr15_7135727_7135925 | 0.51 |
Lifr |
LIF receptor alpha |
4716 |
0.31 |
| chr8_93192874_93193058 | 0.51 |
Gm45909 |
predicted gene 45909 |
1608 |
0.28 |
| chr3_94710144_94710297 | 0.51 |
Selenbp2 |
selenium binding protein 2 |
16561 |
0.1 |
| chr2_70813245_70813396 | 0.51 |
Tlk1 |
tousled-like kinase 1 |
11908 |
0.21 |
| chr15_58979084_58979584 | 0.51 |
4930544F09Rik |
RIKEN cDNA 4930544F09 gene |
4802 |
0.18 |
| chr11_16833180_16833362 | 0.51 |
Egfros |
epidermal growth factor receptor, opposite strand |
2569 |
0.31 |
| chr11_6158649_6158802 | 0.51 |
Rps15a-ps6 |
ribosomal protein S15A, pseudogene 6 |
14311 |
0.13 |
| chr4_63227025_63227191 | 0.50 |
Col27a1 |
collagen, type XXVII, alpha 1 |
7178 |
0.18 |
| chr5_130017966_130018117 | 0.50 |
Asl |
argininosuccinate lyase |
3319 |
0.15 |
| chr2_122260835_122261566 | 0.50 |
Duox2 |
dual oxidase 2 |
24369 |
0.09 |
| chr1_70927826_70928016 | 0.50 |
Gm16236 |
predicted gene 16236 |
112109 |
0.07 |
| chr9_44494634_44494926 | 0.50 |
Bcl9l |
B cell CLL/lymphoma 9-like |
3527 |
0.09 |
| chr14_17914680_17914831 | 0.50 |
Thrb |
thyroid hormone receptor beta |
48066 |
0.16 |
| chr4_148610779_148610962 | 0.50 |
Tardbp |
TAR DNA binding protein |
5268 |
0.11 |
| chr1_51741438_51741641 | 0.50 |
Gm28055 |
predicted gene 28055 |
5404 |
0.23 |
| chr11_120898760_120898937 | 0.49 |
Ccdc57 |
coiled-coil domain containing 57 |
12937 |
0.12 |
| chr4_141955631_141955810 | 0.49 |
Fhad1 |
forkhead-associated (FHA) phosphopeptide binding domain 1 |
1526 |
0.3 |
| chr3_51255928_51256079 | 0.49 |
Elf2 |
E74-like factor 2 |
4238 |
0.15 |
| chr15_3109577_3109743 | 0.49 |
Gm49222 |
predicted gene, 49222 |
5949 |
0.21 |
| chr13_24379587_24379846 | 0.49 |
Cmah |
cytidine monophospho-N-acetylneuraminic acid hydroxylase |
3633 |
0.16 |
| chr10_128397387_128397714 | 0.49 |
Gm17201 |
predicted gene 17201 |
1987 |
0.11 |
| chr19_38283394_38283545 | 0.49 |
Gm50141 |
predicted gene, 50141 |
4482 |
0.18 |
| chr3_144109828_144110050 | 0.49 |
Gm34078 |
predicted gene, 34078 |
25815 |
0.2 |
| chr2_84995821_84996178 | 0.49 |
Prg3 |
proteoglycan 3 |
7784 |
0.12 |
| chr12_57399208_57399392 | 0.49 |
Gm16246 |
predicted gene 16246 |
50820 |
0.13 |
| chr12_39372596_39372747 | 0.48 |
Gm47855 |
predicted gene, 47855 |
25885 |
0.22 |
| chr3_94705607_94705796 | 0.48 |
Selenbp2 |
selenium binding protein 2 |
12042 |
0.11 |
| chr1_36228499_36228653 | 0.48 |
Uggt1 |
UDP-glucose glycoprotein glucosyltransferase 1 |
15531 |
0.16 |
| chr8_68276819_68276981 | 0.48 |
Sh2d4a |
SH2 domain containing 4A |
333 |
0.89 |
| chr13_41813051_41813252 | 0.48 |
1700061E18Rik |
RIKEN cDNA 1700061E18 gene |
12368 |
0.15 |
| chr4_109805630_109805981 | 0.48 |
Faf1 |
Fas-associated factor 1 |
34980 |
0.17 |
| chr12_86918049_86918388 | 0.48 |
Cipc |
CLOCK interacting protein, circadian |
28825 |
0.13 |
| chr7_67647513_67647879 | 0.48 |
Ttc23 |
tetratricopeptide repeat domain 23 |
236 |
0.89 |
| chr4_54733562_54733749 | 0.47 |
Gm12477 |
predicted gene 12477 |
63463 |
0.11 |
| chr11_16831950_16832169 | 0.47 |
Egfros |
epidermal growth factor receptor, opposite strand |
1357 |
0.48 |
| chr17_47458004_47458157 | 0.47 |
1700001C19Rik |
RIKEN cDNA 1700001C19 gene |
20704 |
0.1 |
| chr1_67187795_67187968 | 0.47 |
Gm15668 |
predicted gene 15668 |
61319 |
0.11 |
| chr4_62723535_62723865 | 0.47 |
Gm11211 |
predicted gene 11211 |
3837 |
0.2 |
| chr5_151165596_151165747 | 0.47 |
Stard13 |
StAR-related lipid transfer (START) domain containing 13 |
24479 |
0.21 |
| chr17_71684422_71684641 | 0.47 |
Togaram2 |
TOG array regulator of axonemal microtubules 2 |
274 |
0.86 |
| chr16_18073227_18073378 | 0.46 |
Dgcr6 |
DiGeorge syndrome critical region gene 6 |
3822 |
0.16 |
| chr1_105991460_105991988 | 0.46 |
Zcchc2 |
zinc finger, CCHC domain containing 2 |
1035 |
0.4 |
| chr11_12475688_12476059 | 0.46 |
Cobl |
cordon-bleu WH2 repeat |
10913 |
0.3 |
| chr9_63328875_63329026 | 0.46 |
Map2k5 |
mitogen-activated protein kinase kinase 5 |
25807 |
0.18 |
| chr10_81414361_81414714 | 0.46 |
Mir1191b |
microRNA 1191b |
1760 |
0.13 |
| chr7_90141326_90141489 | 0.46 |
Gm45222 |
predicted gene 45222 |
4541 |
0.13 |
| chr7_45706938_45707229 | 0.46 |
Dbp |
D site albumin promoter binding protein |
21 |
0.92 |
| chr4_123232315_123232475 | 0.46 |
Heyl |
hairy/enhancer-of-split related with YRPW motif-like |
1161 |
0.34 |
| chr2_27694102_27694566 | 0.46 |
Rxra |
retinoid X receptor alpha |
14958 |
0.24 |
| chr7_80323533_80323753 | 0.46 |
Rccd1 |
RCC1 domain containing 1 |
477 |
0.65 |
| chr12_32764273_32764609 | 0.45 |
Gm18726 |
predicted gene, 18726 |
54280 |
0.11 |
| chr11_51494062_51494334 | 0.45 |
Col23a1 |
collagen, type XXIII, alpha 1 |
80234 |
0.07 |
| chr7_29459356_29459516 | 0.45 |
Sipa1l3 |
signal-induced proliferation-associated 1 like 3 |
46016 |
0.11 |
| chr2_15610043_15610194 | 0.45 |
Gm37595 |
predicted gene, 37595 |
79005 |
0.1 |
| chr19_20610582_20610763 | 0.45 |
Aldh1a1 |
aldehyde dehydrogenase family 1, subfamily A1 |
8711 |
0.22 |
| chr10_69267836_69267987 | 0.45 |
Rhobtb1 |
Rho-related BTB domain containing 1 |
2274 |
0.31 |
| chr2_32524318_32524490 | 0.45 |
Gm13412 |
predicted gene 13412 |
627 |
0.55 |
| chr8_93248524_93248675 | 0.45 |
Gm45727 |
predicted gene 45727 |
2576 |
0.2 |
| chr15_59044303_59044494 | 0.45 |
Mtss1 |
MTSS I-BAR domain containing 1 |
3801 |
0.26 |
| chr9_120017692_120017983 | 0.45 |
Xirp1 |
xin actin-binding repeat containing 1 |
661 |
0.52 |
| chr19_60580088_60580299 | 0.45 |
Gm25238 |
predicted gene, 25238 |
336 |
0.74 |
| chr15_82709377_82709576 | 0.45 |
Cyp2d38-ps |
cytochrome P450, family 2, subfamily d, member 38, pseudogene |
2123 |
0.15 |
| chr2_4929917_4930068 | 0.45 |
Phyh |
phytanoyl-CoA hydroxylase |
7491 |
0.13 |
| chr17_46016576_46016820 | 0.45 |
Vegfa |
vascular endothelial growth factor A |
4674 |
0.19 |
| chr7_141131727_141132148 | 0.45 |
Ptdss2 |
phosphatidylserine synthase 2 |
501 |
0.59 |
| chr17_28429327_28429723 | 0.45 |
Fkbp5 |
FK506 binding protein 5 |
896 |
0.41 |
| chr9_44078514_44078710 | 0.45 |
Usp2 |
ubiquitin specific peptidase 2 |
6327 |
0.07 |
| chr16_4643006_4643172 | 0.45 |
Dnaja3 |
DnaJ heat shock protein family (Hsp40) member A3 |
3100 |
0.14 |
| chr6_17485024_17485195 | 0.44 |
Met |
met proto-oncogene |
6132 |
0.24 |
| chr15_97908200_97908485 | 0.44 |
Vdr |
vitamin D (1,25-dihydroxyvitamin D3) receptor |
32 |
0.98 |
| chr19_3546321_3546498 | 0.44 |
Gm48683 |
predicted gene, 48683 |
19305 |
0.13 |
| chr17_25221603_25221754 | 0.44 |
Unkl |
unkempt family like zinc finger |
861 |
0.37 |
| chr9_74892937_74893252 | 0.44 |
Onecut1 |
one cut domain, family member 1 |
26610 |
0.14 |
| chr6_119354405_119354556 | 0.44 |
Cacna2d4 |
calcium channel, voltage-dependent, alpha 2/delta subunit 4 |
21918 |
0.17 |
| chr11_16794841_16795090 | 0.44 |
Egfros |
epidermal growth factor receptor, opposite strand |
35737 |
0.15 |
| chr16_26588053_26588220 | 0.44 |
Il1rap |
interleukin 1 receptor accessory protein |
6379 |
0.28 |
| chr11_21365109_21365315 | 0.44 |
Gm12043 |
predicted gene 12043 |
5188 |
0.15 |
| chr15_58970873_58971171 | 0.44 |
Mtss1 |
MTSS I-BAR domain containing 1 |
1517 |
0.34 |
| chr10_79555012_79555447 | 0.44 |
Mier2 |
MIER family member 2 |
30 |
0.96 |
| chr7_97415349_97415810 | 0.44 |
Thrsp |
thyroid hormone responsive |
1940 |
0.23 |
| chr16_76354348_76354578 | 0.44 |
Nrip1 |
nuclear receptor interacting protein 1 |
18574 |
0.19 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 1.6 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.3 | 0.8 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
| 0.2 | 0.7 | GO:1904193 | cholangiocyte apoptotic process(GO:1902488) regulation of cholangiocyte apoptotic process(GO:1904192) negative regulation of cholangiocyte apoptotic process(GO:1904193) |
| 0.2 | 0.8 | GO:0003383 | apical constriction(GO:0003383) |
| 0.2 | 0.6 | GO:2000259 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
| 0.2 | 0.6 | GO:0009732 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
| 0.2 | 0.6 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
| 0.2 | 0.6 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.2 | 0.5 | GO:0006068 | ethanol catabolic process(GO:0006068) |
| 0.2 | 0.5 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
| 0.2 | 0.5 | GO:0097167 | circadian regulation of translation(GO:0097167) |
| 0.2 | 0.5 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
| 0.2 | 1.0 | GO:0060978 | angiogenesis involved in coronary vascular morphogenesis(GO:0060978) |
| 0.2 | 0.5 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
| 0.1 | 0.3 | GO:0071799 | response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
| 0.1 | 0.4 | GO:0010980 | regulation of vitamin D 24-hydroxylase activity(GO:0010979) positive regulation of vitamin D 24-hydroxylase activity(GO:0010980) |
| 0.1 | 0.5 | GO:0006538 | glutamate catabolic process(GO:0006538) |
| 0.1 | 0.5 | GO:0003186 | tricuspid valve morphogenesis(GO:0003186) tricuspid valve formation(GO:0003195) |
| 0.1 | 0.4 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
| 0.1 | 0.5 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
| 0.1 | 0.5 | GO:0061641 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.1 | 0.3 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
| 0.1 | 0.5 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
| 0.1 | 0.3 | GO:0034310 | primary alcohol catabolic process(GO:0034310) |
| 0.1 | 0.2 | GO:0035790 | platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
| 0.1 | 0.1 | GO:0090209 | negative regulation of triglyceride metabolic process(GO:0090209) |
| 0.1 | 0.4 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
| 0.1 | 0.7 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
| 0.1 | 0.4 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.1 | 0.3 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
| 0.1 | 0.3 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.1 | 0.3 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.1 | 0.5 | GO:0021960 | anterior commissure morphogenesis(GO:0021960) |
| 0.1 | 0.6 | GO:0090205 | positive regulation of cholesterol biosynthetic process(GO:0045542) positive regulation of cholesterol metabolic process(GO:0090205) |
| 0.1 | 0.3 | GO:0021564 | vagus nerve development(GO:0021564) |
| 0.1 | 0.3 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.1 | 0.4 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
| 0.1 | 0.3 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
| 0.1 | 0.4 | GO:0071276 | cellular response to cadmium ion(GO:0071276) |
| 0.1 | 0.2 | GO:0034395 | regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
| 0.1 | 0.3 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.1 | 0.4 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.1 | 0.2 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
| 0.1 | 0.3 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.1 | 0.1 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
| 0.1 | 0.2 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
| 0.1 | 0.3 | GO:0035513 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
| 0.1 | 0.3 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
| 0.1 | 0.3 | GO:0061010 | gall bladder development(GO:0061010) |
| 0.1 | 0.3 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
| 0.1 | 0.3 | GO:0051081 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
| 0.1 | 0.3 | GO:0032439 | endosome localization(GO:0032439) |
| 0.1 | 0.3 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
| 0.1 | 0.3 | GO:1905206 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
| 0.1 | 0.3 | GO:1902896 | terminal web assembly(GO:1902896) |
| 0.1 | 0.2 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
| 0.1 | 0.2 | GO:0097212 | lysosomal membrane organization(GO:0097212) |
| 0.1 | 0.2 | GO:1900045 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.1 | 0.2 | GO:1901033 | positive regulation of response to reactive oxygen species(GO:1901033) positive regulation of superoxide dismutase activity(GO:1901671) positive regulation of removal of superoxide radicals(GO:1904833) |
| 0.1 | 0.2 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
| 0.1 | 0.8 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.1 | 0.1 | GO:0072309 | mesenchymal stem cell maintenance involved in metanephric nephron morphogenesis(GO:0072309) |
| 0.1 | 0.3 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.1 | 0.8 | GO:0009404 | toxin metabolic process(GO:0009404) |
| 0.1 | 0.2 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.1 | 0.2 | GO:0071926 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
| 0.1 | 0.2 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
| 0.1 | 0.4 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
| 0.1 | 0.2 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
| 0.1 | 2.0 | GO:0006084 | acetyl-CoA metabolic process(GO:0006084) |
| 0.1 | 0.3 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
| 0.1 | 0.3 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 0.1 | 0.1 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
| 0.1 | 1.1 | GO:0043153 | entrainment of circadian clock by photoperiod(GO:0043153) |
| 0.1 | 0.4 | GO:1903798 | regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903798) |
| 0.1 | 0.3 | GO:0071280 | cellular response to copper ion(GO:0071280) |
| 0.1 | 0.4 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
| 0.1 | 0.3 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
| 0.1 | 0.2 | GO:0070375 | ERK5 cascade(GO:0070375) |
| 0.1 | 0.1 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.1 | 0.2 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
| 0.1 | 0.3 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.1 | 0.3 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
| 0.1 | 0.1 | GO:0019747 | regulation of isoprenoid metabolic process(GO:0019747) |
| 0.1 | 0.1 | GO:0070508 | sterol import(GO:0035376) cholesterol import(GO:0070508) |
| 0.1 | 0.4 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
| 0.1 | 0.3 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
| 0.1 | 0.2 | GO:0035482 | gastric motility(GO:0035482) |
| 0.1 | 0.1 | GO:0045764 | positive regulation of cellular amino acid metabolic process(GO:0045764) |
| 0.1 | 0.2 | GO:0021699 | cerebellar cortex maturation(GO:0021699) |
| 0.1 | 0.2 | GO:2000646 | positive regulation of receptor catabolic process(GO:2000646) |
| 0.1 | 0.2 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
| 0.1 | 0.2 | GO:0006001 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
| 0.1 | 0.1 | GO:0048290 | isotype switching to IgA isotypes(GO:0048290) regulation of isotype switching to IgA isotypes(GO:0048296) |
| 0.1 | 0.1 | GO:0031087 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.1 | 0.2 | GO:0090325 | regulation of locomotion involved in locomotory behavior(GO:0090325) |
| 0.1 | 0.2 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
| 0.1 | 0.4 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
| 0.1 | 0.4 | GO:0005513 | detection of calcium ion(GO:0005513) |
| 0.1 | 0.2 | GO:0010040 | response to iron(II) ion(GO:0010040) |
| 0.1 | 0.2 | GO:0006562 | proline catabolic process(GO:0006562) |
| 0.1 | 0.2 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.1 | 0.1 | GO:0060847 | endothelial cell fate specification(GO:0060847) |
| 0.1 | 0.3 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.1 | 0.2 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
| 0.1 | 0.1 | GO:1904023 | regulation of fermentation(GO:0043465) regulation of NAD metabolic process(GO:1902688) regulation of glucose catabolic process to lactate via pyruvate(GO:1904023) |
| 0.1 | 0.2 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
| 0.1 | 0.2 | GO:0060596 | mammary placode formation(GO:0060596) |
| 0.1 | 0.2 | GO:0021603 | cranial nerve formation(GO:0021603) |
| 0.1 | 0.3 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
| 0.1 | 0.3 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.1 | 0.3 | GO:1904259 | regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904259) positive regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904261) basement membrane assembly involved in embryonic body morphogenesis(GO:2001197) |
| 0.1 | 0.4 | GO:0055091 | phospholipid homeostasis(GO:0055091) |
| 0.1 | 0.2 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
| 0.1 | 0.2 | GO:0042706 | eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
| 0.1 | 0.3 | GO:0002072 | optic cup morphogenesis involved in camera-type eye development(GO:0002072) |
| 0.1 | 0.2 | GO:1901162 | serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
| 0.1 | 0.3 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
| 0.1 | 0.2 | GO:0090188 | negative regulation of pancreatic juice secretion(GO:0090188) |
| 0.1 | 0.3 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
| 0.1 | 0.2 | GO:0009838 | abscission(GO:0009838) |
| 0.1 | 0.3 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 0.1 | 0.4 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
| 0.1 | 0.2 | GO:0006059 | hexitol metabolic process(GO:0006059) |
| 0.1 | 0.2 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
| 0.1 | 0.1 | GO:0072718 | response to cisplatin(GO:0072718) |
| 0.1 | 0.3 | GO:0016266 | O-glycan processing(GO:0016266) |
| 0.0 | 0.2 | GO:0048069 | eye pigmentation(GO:0048069) |
| 0.0 | 0.1 | GO:1902988 | neurofibrillary tangle assembly(GO:1902988) regulation of neurofibrillary tangle assembly(GO:1902996) |
| 0.0 | 0.3 | GO:0090037 | positive regulation of protein kinase C signaling(GO:0090037) |
| 0.0 | 0.2 | GO:0072488 | ammonium transmembrane transport(GO:0072488) |
| 0.0 | 0.2 | GO:0006549 | isoleucine metabolic process(GO:0006549) |
| 0.0 | 0.0 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
| 0.0 | 0.1 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
| 0.0 | 0.1 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
| 0.0 | 0.2 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
| 0.0 | 0.1 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
| 0.0 | 0.4 | GO:0034312 | diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
| 0.0 | 0.1 | GO:0002215 | defense response to nematode(GO:0002215) |
| 0.0 | 0.3 | GO:1902221 | L-phenylalanine metabolic process(GO:0006558) L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
| 0.0 | 0.3 | GO:0051418 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.0 | 0.2 | GO:0060665 | regulation of branching involved in salivary gland morphogenesis by mesenchymal-epithelial signaling(GO:0060665) |
| 0.0 | 0.2 | GO:0051549 | regulation of keratinocyte migration(GO:0051547) positive regulation of keratinocyte migration(GO:0051549) |
| 0.0 | 0.1 | GO:0071233 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
| 0.0 | 0.4 | GO:0042795 | snRNA transcription from RNA polymerase II promoter(GO:0042795) |
| 0.0 | 0.1 | GO:0060671 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.0 | 0.2 | GO:0035754 | B cell chemotaxis(GO:0035754) |
| 0.0 | 0.1 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
| 0.0 | 0.3 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
| 0.0 | 0.2 | GO:0018317 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.0 | 0.0 | GO:0006714 | sesquiterpenoid metabolic process(GO:0006714) |
| 0.0 | 0.1 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
| 0.0 | 0.2 | GO:0042525 | tyrosine phosphorylation of Stat6 protein(GO:0042505) regulation of tyrosine phosphorylation of Stat6 protein(GO:0042525) |
| 0.0 | 0.2 | GO:0090427 | activation of meiosis(GO:0090427) |
| 0.0 | 0.2 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
| 0.0 | 0.0 | GO:0046100 | hypoxanthine metabolic process(GO:0046100) hypoxanthine biosynthetic process(GO:0046101) |
| 0.0 | 0.5 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.0 | 0.1 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 0.0 | 0.1 | GO:0006172 | ADP biosynthetic process(GO:0006172) |
| 0.0 | 0.1 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.0 | 0.2 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.0 | 0.2 | GO:0044539 | long-chain fatty acid import(GO:0044539) |
| 0.0 | 0.1 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
| 0.0 | 0.1 | GO:0019064 | fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
| 0.0 | 0.1 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.0 | 0.0 | GO:0006067 | ethanol metabolic process(GO:0006067) ethanol oxidation(GO:0006069) |
| 0.0 | 1.3 | GO:0070542 | response to fatty acid(GO:0070542) |
| 0.0 | 0.1 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.0 | 0.3 | GO:0006517 | protein deglycosylation(GO:0006517) |
| 0.0 | 0.1 | GO:0021943 | formation of radial glial scaffolds(GO:0021943) |
| 0.0 | 0.2 | GO:0042473 | outer ear morphogenesis(GO:0042473) |
| 0.0 | 0.1 | GO:0071895 | odontoblast differentiation(GO:0071895) |
| 0.0 | 0.2 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
| 0.0 | 0.3 | GO:0051503 | adenine nucleotide transport(GO:0051503) |
| 0.0 | 0.1 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.0 | 0.1 | GO:0071043 | CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
| 0.0 | 0.2 | GO:0060628 | regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
| 0.0 | 0.4 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
| 0.0 | 0.1 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
| 0.0 | 0.2 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
| 0.0 | 0.1 | GO:0034086 | maintenance of sister chromatid cohesion(GO:0034086) maintenance of mitotic sister chromatid cohesion(GO:0034088) |
| 0.0 | 0.1 | GO:0060696 | regulation of phospholipid catabolic process(GO:0060696) |
| 0.0 | 0.2 | GO:0021779 | oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
| 0.0 | 0.0 | GO:0097252 | oligodendrocyte apoptotic process(GO:0097252) |
| 0.0 | 0.2 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
| 0.0 | 0.1 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
| 0.0 | 0.2 | GO:1903352 | ornithine transport(GO:0015822) L-ornithine transmembrane transport(GO:1903352) |
| 0.0 | 0.4 | GO:0035095 | behavioral response to nicotine(GO:0035095) |
| 0.0 | 0.2 | GO:0045842 | positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
| 0.0 | 0.1 | GO:2000587 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
| 0.0 | 0.1 | GO:0007529 | establishment of synaptic specificity at neuromuscular junction(GO:0007529) |
| 0.0 | 0.1 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
| 0.0 | 0.3 | GO:0035459 | cargo loading into vesicle(GO:0035459) |
| 0.0 | 0.2 | GO:0033133 | positive regulation of glucokinase activity(GO:0033133) positive regulation of hexokinase activity(GO:1903301) |
| 0.0 | 0.1 | GO:0046098 | guanine metabolic process(GO:0046098) |
| 0.0 | 0.1 | GO:1902774 | late endosome to lysosome transport(GO:1902774) |
| 0.0 | 0.1 | GO:0033762 | response to glucagon(GO:0033762) |
| 0.0 | 0.2 | GO:0006449 | regulation of translational termination(GO:0006449) |
| 0.0 | 0.0 | GO:0043461 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
| 0.0 | 0.2 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.0 | 0.2 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.0 | 0.4 | GO:0016446 | somatic hypermutation of immunoglobulin genes(GO:0016446) |
| 0.0 | 0.3 | GO:0008343 | adult feeding behavior(GO:0008343) |
| 0.0 | 0.1 | GO:1902475 | L-glutamate transmembrane transport(GO:0089711) L-alpha-amino acid transmembrane transport(GO:1902475) |
| 0.0 | 0.1 | GO:0002175 | protein localization to paranode region of axon(GO:0002175) |
| 0.0 | 0.1 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
| 0.0 | 0.1 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
| 0.0 | 0.1 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
| 0.0 | 0.1 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
| 0.0 | 0.1 | GO:0061535 | glutamate secretion, neurotransmission(GO:0061535) |
| 0.0 | 0.1 | GO:0051795 | positive regulation of catagen(GO:0051795) |
| 0.0 | 0.0 | GO:1903897 | regulation of PERK-mediated unfolded protein response(GO:1903897) negative regulation of PERK-mediated unfolded protein response(GO:1903898) |
| 0.0 | 0.1 | GO:0033152 | immunoglobulin V(D)J recombination(GO:0033152) |
| 0.0 | 0.1 | GO:0038027 | apolipoprotein A-I-mediated signaling pathway(GO:0038027) |
| 0.0 | 0.1 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.0 | 0.1 | GO:0030576 | Cajal body organization(GO:0030576) |
| 0.0 | 0.1 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
| 0.0 | 0.1 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
| 0.0 | 0.1 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
| 0.0 | 0.1 | GO:0023021 | termination of signal transduction(GO:0023021) |
| 0.0 | 0.1 | GO:0044597 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.0 | 0.2 | GO:0071763 | nuclear membrane organization(GO:0071763) |
| 0.0 | 0.2 | GO:0048537 | mucosal-associated lymphoid tissue development(GO:0048537) Peyer's patch development(GO:0048541) |
| 0.0 | 0.1 | GO:0009698 | phenylpropanoid metabolic process(GO:0009698) phenylpropanoid catabolic process(GO:0046271) |
| 0.0 | 0.5 | GO:0050908 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| 0.0 | 0.1 | GO:0090168 | Golgi reassembly(GO:0090168) |
| 0.0 | 0.0 | GO:0032741 | positive regulation of interleukin-18 production(GO:0032741) |
| 0.0 | 0.1 | GO:1990034 | calcium ion export from cell(GO:1990034) |
| 0.0 | 0.1 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.0 | 0.1 | GO:0045950 | negative regulation of mitotic recombination(GO:0045950) |
| 0.0 | 0.2 | GO:0051639 | actin filament network formation(GO:0051639) |
| 0.0 | 0.4 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
| 0.0 | 0.2 | GO:0014894 | response to inactivity(GO:0014854) response to muscle inactivity(GO:0014870) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
| 0.0 | 0.1 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
| 0.0 | 0.1 | GO:0032849 | positive regulation of cellular pH reduction(GO:0032849) |
| 0.0 | 0.3 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) |
| 0.0 | 0.2 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
| 0.0 | 0.1 | GO:0045578 | negative regulation of B cell differentiation(GO:0045578) |
| 0.0 | 0.1 | GO:0070447 | positive regulation of oligodendrocyte progenitor proliferation(GO:0070447) |
| 0.0 | 0.1 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
| 0.0 | 0.2 | GO:0015824 | proline transport(GO:0015824) |
| 0.0 | 0.3 | GO:0006336 | DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
| 0.0 | 0.0 | GO:0061642 | chemoattraction of axon(GO:0061642) |
| 0.0 | 0.0 | GO:0003289 | atrial septum primum morphogenesis(GO:0003289) |
| 0.0 | 0.2 | GO:2000675 | negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
| 0.0 | 0.1 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
| 0.0 | 0.1 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
| 0.0 | 0.1 | GO:0019478 | D-amino acid catabolic process(GO:0019478) |
| 0.0 | 0.2 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
| 0.0 | 0.3 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
| 0.0 | 0.5 | GO:0006376 | mRNA splice site selection(GO:0006376) |
| 0.0 | 0.1 | GO:0060283 | negative regulation of oocyte development(GO:0060283) |
| 0.0 | 0.2 | GO:0007000 | nucleolus organization(GO:0007000) |
| 0.0 | 0.3 | GO:2000010 | positive regulation of protein localization to cell surface(GO:2000010) |
| 0.0 | 0.1 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
| 0.0 | 0.2 | GO:0048194 | Golgi vesicle budding(GO:0048194) |
| 0.0 | 0.1 | GO:0050651 | dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
| 0.0 | 0.1 | GO:0061643 | chemorepulsion of axon(GO:0061643) |
| 0.0 | 0.2 | GO:0002634 | regulation of germinal center formation(GO:0002634) |
| 0.0 | 0.0 | GO:1901475 | pyruvate transmembrane transport(GO:1901475) |
| 0.0 | 0.1 | GO:0048341 | paraxial mesoderm formation(GO:0048341) |
| 0.0 | 0.4 | GO:0009226 | nucleotide-sugar biosynthetic process(GO:0009226) |
| 0.0 | 0.1 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
| 0.0 | 0.1 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
| 0.0 | 0.1 | GO:0045048 | protein insertion into ER membrane(GO:0045048) tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
| 0.0 | 0.1 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
| 0.0 | 0.3 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.0 | 0.2 | GO:0016127 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.0 | 0.1 | GO:0032077 | positive regulation of deoxyribonuclease activity(GO:0032077) |
| 0.0 | 0.1 | GO:0045200 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
| 0.0 | 0.2 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
| 0.0 | 0.1 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.0 | 0.1 | GO:0043974 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
| 0.0 | 0.1 | GO:0002767 | immune response-inhibiting cell surface receptor signaling pathway(GO:0002767) |
| 0.0 | 0.1 | GO:0006407 | rRNA export from nucleus(GO:0006407) |
| 0.0 | 0.3 | GO:0006857 | oligopeptide transport(GO:0006857) |
| 0.0 | 0.2 | GO:0007100 | mitotic centrosome separation(GO:0007100) |
| 0.0 | 0.1 | GO:0001957 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
| 0.0 | 0.1 | GO:2000870 | regulation of progesterone secretion(GO:2000870) |
| 0.0 | 0.1 | GO:1904469 | positive regulation of tumor necrosis factor secretion(GO:1904469) |
| 0.0 | 0.1 | GO:0060948 | cardiac vascular smooth muscle cell development(GO:0060948) |
| 0.0 | 0.2 | GO:0035871 | protein K11-linked deubiquitination(GO:0035871) |
| 0.0 | 0.1 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) |
| 0.0 | 0.1 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
| 0.0 | 0.2 | GO:0048671 | negative regulation of collateral sprouting(GO:0048671) |
| 0.0 | 0.1 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
| 0.0 | 0.2 | GO:0045792 | negative regulation of cell size(GO:0045792) |
| 0.0 | 0.1 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
| 0.0 | 0.1 | GO:2001181 | positive regulation of interleukin-10 secretion(GO:2001181) |
| 0.0 | 0.0 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
| 0.0 | 0.2 | GO:0006228 | UTP biosynthetic process(GO:0006228) |
| 0.0 | 0.1 | GO:0048597 | post-embryonic camera-type eye morphogenesis(GO:0048597) |
| 0.0 | 0.1 | GO:2001280 | positive regulation of prostaglandin biosynthetic process(GO:0031394) positive regulation of unsaturated fatty acid biosynthetic process(GO:2001280) |
| 0.0 | 0.1 | GO:0042447 | hormone catabolic process(GO:0042447) |
| 0.0 | 0.2 | GO:0008616 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.0 | 0.1 | GO:0051084 | 'de novo' protein folding(GO:0006458) 'de novo' posttranslational protein folding(GO:0051084) |
| 0.0 | 0.1 | GO:1900736 | regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900736) |
| 0.0 | 0.1 | GO:1904058 | positive regulation of sensory perception of pain(GO:1904058) |
| 0.0 | 0.7 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
| 0.0 | 0.1 | GO:0010841 | positive regulation of circadian sleep/wake cycle, wakefulness(GO:0010841) |
| 0.0 | 0.6 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
| 0.0 | 0.2 | GO:0030157 | pancreatic juice secretion(GO:0030157) |
| 0.0 | 0.1 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
| 0.0 | 0.1 | GO:0045349 | interferon-alpha biosynthetic process(GO:0045349) regulation of interferon-alpha biosynthetic process(GO:0045354) |
| 0.0 | 0.1 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.0 | 0.1 | GO:0051176 | positive regulation of sulfur metabolic process(GO:0051176) |
| 0.0 | 0.0 | GO:1900242 | regulation of synaptic vesicle endocytosis(GO:1900242) |
| 0.0 | 0.2 | GO:0046543 | development of secondary female sexual characteristics(GO:0046543) |
| 0.0 | 0.1 | GO:0071918 | urea transmembrane transport(GO:0071918) |
| 0.0 | 0.2 | GO:0061154 | endothelial tube morphogenesis(GO:0061154) |
| 0.0 | 0.2 | GO:0043923 | positive regulation by host of viral transcription(GO:0043923) |
| 0.0 | 0.1 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.0 | 0.1 | GO:0060368 | regulation of Fc receptor mediated stimulatory signaling pathway(GO:0060368) |
| 0.0 | 0.1 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
| 0.0 | 0.1 | GO:0006591 | ornithine metabolic process(GO:0006591) |
| 0.0 | 0.1 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
| 0.0 | 0.1 | GO:0033160 | positive regulation of protein import into nucleus, translocation(GO:0033160) |
| 0.0 | 0.1 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
| 0.0 | 0.1 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.0 | 0.1 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.0 | 0.1 | GO:0033630 | positive regulation of cell adhesion mediated by integrin(GO:0033630) |
| 0.0 | 0.1 | GO:0033625 | positive regulation of integrin activation(GO:0033625) |
| 0.0 | 0.1 | GO:0045416 | positive regulation of interleukin-8 biosynthetic process(GO:0045416) |
| 0.0 | 0.1 | GO:0016115 | diterpenoid catabolic process(GO:0016103) terpenoid catabolic process(GO:0016115) retinoic acid catabolic process(GO:0034653) |
| 0.0 | 0.2 | GO:0000467 | exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) |
| 0.0 | 0.1 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
| 0.0 | 1.1 | GO:0007157 | heterophilic cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0007157) |
| 0.0 | 0.0 | GO:0045226 | extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) |
| 0.0 | 0.0 | GO:0034197 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
| 0.0 | 0.2 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
| 0.0 | 0.0 | GO:1900127 | positive regulation of hyaluronan biosynthetic process(GO:1900127) |
| 0.0 | 0.0 | GO:0072205 | metanephric collecting duct development(GO:0072205) |
| 0.0 | 1.4 | GO:0010923 | negative regulation of phosphatase activity(GO:0010923) |
| 0.0 | 0.1 | GO:0006210 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
| 0.0 | 0.1 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
| 0.0 | 0.3 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.0 | 0.4 | GO:0006692 | prostanoid metabolic process(GO:0006692) prostaglandin metabolic process(GO:0006693) |
| 0.0 | 0.1 | GO:0023041 | neuronal signal transduction(GO:0023041) |
| 0.0 | 0.1 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
| 0.0 | 0.0 | GO:0042713 | sperm ejaculation(GO:0042713) |
| 0.0 | 0.9 | GO:0061077 | chaperone-mediated protein folding(GO:0061077) |
| 0.0 | 0.1 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
| 0.0 | 0.0 | GO:0009188 | ribonucleoside diphosphate biosynthetic process(GO:0009188) |
| 0.0 | 0.2 | GO:0006744 | ubiquinone biosynthetic process(GO:0006744) |
| 0.0 | 0.0 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
| 0.0 | 0.0 | GO:0006600 | creatine metabolic process(GO:0006600) |
| 0.0 | 0.0 | GO:0036166 | phenotypic switching(GO:0036166) |
| 0.0 | 0.1 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
| 0.0 | 0.1 | GO:0071476 | cellular hypotonic response(GO:0071476) |
| 0.0 | 0.4 | GO:0006783 | heme biosynthetic process(GO:0006783) |
| 0.0 | 0.0 | GO:0045351 | type I interferon biosynthetic process(GO:0045351) |
| 0.0 | 0.2 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
| 0.0 | 0.2 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
| 0.0 | 0.0 | GO:0032364 | oxygen homeostasis(GO:0032364) |
| 0.0 | 0.2 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.0 | 0.1 | GO:0006103 | 2-oxoglutarate metabolic process(GO:0006103) |
| 0.0 | 0.0 | GO:0006573 | valine metabolic process(GO:0006573) |
| 0.0 | 0.1 | GO:0032466 | negative regulation of cytokinesis(GO:0032466) |
| 0.0 | 0.3 | GO:0017144 | drug metabolic process(GO:0017144) |
| 0.0 | 0.2 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.0 | 0.1 | GO:2000780 | negative regulation of double-strand break repair(GO:2000780) |
| 0.0 | 0.0 | GO:0002924 | negative regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002924) |
| 0.0 | 0.1 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
| 0.0 | 0.0 | GO:0035973 | aggrephagy(GO:0035973) |
| 0.0 | 0.0 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.0 | 0.1 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
| 0.0 | 0.1 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
| 0.0 | 0.1 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
| 0.0 | 0.0 | GO:1903416 | response to glycoside(GO:1903416) |
| 0.0 | 0.1 | GO:0061727 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 0.0 | 0.1 | GO:0072393 | microtubule anchoring at microtubule organizing center(GO:0072393) |
| 0.0 | 0.0 | GO:0070885 | negative regulation of calcineurin-NFAT signaling cascade(GO:0070885) |
| 0.0 | 0.1 | GO:0030259 | lipid glycosylation(GO:0030259) |
| 0.0 | 0.0 | GO:0002370 | natural killer cell cytokine production(GO:0002370) regulation of natural killer cell cytokine production(GO:0002727) |
| 0.0 | 0.1 | GO:0070842 | aggresome assembly(GO:0070842) |
| 0.0 | 0.0 | GO:0052490 | negative regulation by symbiont of host apoptotic process(GO:0033668) negative regulation by symbiont of host programmed cell death(GO:0052041) negative regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052490) |
| 0.0 | 0.1 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
| 0.0 | 0.1 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
| 0.0 | 0.1 | GO:0036089 | cleavage furrow formation(GO:0036089) |
| 0.0 | 0.1 | GO:0035627 | ceramide transport(GO:0035627) |
| 0.0 | 0.1 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
| 0.0 | 0.1 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
| 0.0 | 0.1 | GO:1901660 | calcium ion export(GO:1901660) |
| 0.0 | 0.1 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
| 0.0 | 0.1 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
| 0.0 | 0.1 | GO:0015858 | nucleoside transport(GO:0015858) |
| 0.0 | 0.1 | GO:0051764 | actin crosslink formation(GO:0051764) |
| 0.0 | 0.3 | GO:0032011 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
| 0.0 | 0.1 | GO:0046208 | spermine catabolic process(GO:0046208) |
| 0.0 | 0.1 | GO:0006681 | galactosylceramide metabolic process(GO:0006681) |
| 0.0 | 0.2 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.0 | 0.4 | GO:0006308 | DNA catabolic process(GO:0006308) |
| 0.0 | 0.1 | GO:1900016 | negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
| 0.0 | 0.0 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
| 0.0 | 0.1 | GO:0060613 | fat pad development(GO:0060613) |
| 0.0 | 0.0 | GO:0060051 | negative regulation of protein glycosylation(GO:0060051) |
| 0.0 | 0.1 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
| 0.0 | 0.0 | GO:0055118 | negative regulation of cardiac muscle contraction(GO:0055118) |
| 0.0 | 0.1 | GO:1903849 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
| 0.0 | 0.2 | GO:0044065 | regulation of respiratory system process(GO:0044065) |
| 0.0 | 0.0 | GO:0044314 | protein K27-linked ubiquitination(GO:0044314) |
| 0.0 | 0.0 | GO:0010870 | positive regulation of receptor biosynthetic process(GO:0010870) |
| 0.0 | 0.0 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
| 0.0 | 0.1 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.0 | 0.1 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
| 0.0 | 0.5 | GO:0008333 | endosome to lysosome transport(GO:0008333) |
| 0.0 | 0.1 | GO:0035582 | sequestering of BMP in extracellular matrix(GO:0035582) |
| 0.0 | 0.0 | GO:2001180 | negative regulation of interleukin-10 secretion(GO:2001180) |
| 0.0 | 0.1 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
| 0.0 | 0.2 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
| 0.0 | 0.0 | GO:2000809 | positive regulation of synaptic vesicle clustering(GO:2000809) |
| 0.0 | 0.1 | GO:0070933 | histone H4 deacetylation(GO:0070933) |
| 0.0 | 0.2 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.0 | 0.1 | GO:0000087 | mitotic M phase(GO:0000087) |
| 0.0 | 0.1 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
| 0.0 | 0.1 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
| 0.0 | 0.1 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
| 0.0 | 0.1 | GO:0034427 | nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
| 0.0 | 0.1 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.0 | 0.1 | GO:0072093 | metanephric renal vesicle formation(GO:0072093) |
| 0.0 | 0.1 | GO:0039533 | regulation of MDA-5 signaling pathway(GO:0039533) positive regulation of MDA-5 signaling pathway(GO:1900245) |
| 0.0 | 0.0 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) |
| 0.0 | 0.0 | GO:0097694 | establishment of RNA localization to telomere(GO:0097694) |
| 0.0 | 0.1 | GO:0071494 | cellular response to UV-C(GO:0071494) |
| 0.0 | 0.0 | GO:0090296 | regulation of mitochondrial DNA replication(GO:0090296) |
| 0.0 | 0.1 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
| 0.0 | 0.1 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
| 0.0 | 0.1 | GO:0006222 | UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
| 0.0 | 0.0 | GO:0060331 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
| 0.0 | 0.0 | GO:1904688 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.0 | 0.0 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
| 0.0 | 0.1 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
| 0.0 | 0.0 | GO:0018243 | protein O-linked glycosylation via threonine(GO:0018243) |
| 0.0 | 0.1 | GO:0007020 | microtubule nucleation(GO:0007020) |
| 0.0 | 0.0 | GO:0006743 | ubiquinone metabolic process(GO:0006743) |
| 0.0 | 0.0 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
| 0.0 | 0.1 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
| 0.0 | 0.0 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.0 | 0.1 | GO:0060856 | establishment of blood-brain barrier(GO:0060856) |
| 0.0 | 0.0 | GO:0002118 | aggressive behavior(GO:0002118) |
| 0.0 | 0.1 | GO:1901339 | regulation of store-operated calcium channel activity(GO:1901339) |
| 0.0 | 0.2 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
| 0.0 | 0.0 | GO:0060988 | lipid tube assembly(GO:0060988) |
| 0.0 | 0.1 | GO:0045357 | interferon-beta biosynthetic process(GO:0045350) regulation of interferon-beta biosynthetic process(GO:0045357) |
| 0.0 | 0.1 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
| 0.0 | 0.0 | GO:0032788 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
| 0.0 | 0.1 | GO:0033603 | positive regulation of dopamine secretion(GO:0033603) |
| 0.0 | 0.1 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
| 0.0 | 0.1 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.0 | 0.0 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
| 0.0 | 0.2 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.0 | 0.1 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
| 0.0 | 0.1 | GO:2000674 | regulation of type B pancreatic cell apoptotic process(GO:2000674) |
| 0.0 | 0.0 | GO:0019086 | late viral transcription(GO:0019086) |
| 0.0 | 0.0 | GO:0072318 | clathrin coat disassembly(GO:0072318) |
| 0.0 | 0.0 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
| 0.0 | 0.1 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
| 0.0 | 0.2 | GO:0000132 | establishment of mitotic spindle orientation(GO:0000132) |
| 0.0 | 0.1 | GO:2001135 | regulation of endocytic recycling(GO:2001135) |
| 0.0 | 0.1 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.0 | 0.0 | GO:0032696 | negative regulation of interleukin-13 production(GO:0032696) |
| 0.0 | 0.0 | GO:0061684 | chaperone-mediated autophagy(GO:0061684) |
| 0.0 | 0.0 | GO:0034137 | positive regulation of toll-like receptor 2 signaling pathway(GO:0034137) |
| 0.0 | 0.0 | GO:1904751 | regulation of protein localization to nucleolus(GO:1904749) positive regulation of protein localization to nucleolus(GO:1904751) |
| 0.0 | 0.0 | GO:0002752 | cell surface pattern recognition receptor signaling pathway(GO:0002752) |
| 0.0 | 0.0 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
| 0.0 | 0.0 | GO:0006207 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
| 0.0 | 0.2 | GO:0043982 | histone H4-K5 acetylation(GO:0043981) histone H4-K8 acetylation(GO:0043982) |
| 0.0 | 0.1 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 0.0 | 0.1 | GO:0051770 | positive regulation of nitric-oxide synthase biosynthetic process(GO:0051770) |
| 0.0 | 0.0 | GO:0015868 | purine ribonucleotide transport(GO:0015868) |
| 0.0 | 0.0 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
| 0.0 | 0.1 | GO:0070189 | kynurenine metabolic process(GO:0070189) |
| 0.0 | 0.0 | GO:0032252 | secretory granule localization(GO:0032252) |
| 0.0 | 0.0 | GO:0072025 | distal convoluted tubule development(GO:0072025) DCT cell differentiation(GO:0072069) metanephric distal convoluted tubule development(GO:0072221) metanephric distal tubule development(GO:0072235) metanephric DCT cell differentiation(GO:0072240) |
| 0.0 | 0.1 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
| 0.0 | 0.1 | GO:0009128 | purine nucleoside monophosphate catabolic process(GO:0009128) |
| 0.0 | 0.1 | GO:0051654 | establishment of mitochondrion localization(GO:0051654) |
| 0.0 | 0.1 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
| 0.0 | 0.1 | GO:0060539 | diaphragm development(GO:0060539) |
| 0.0 | 0.0 | GO:0014012 | peripheral nervous system axon regeneration(GO:0014012) |
| 0.0 | 0.1 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) |
| 0.0 | 0.0 | GO:0002756 | MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
| 0.0 | 0.0 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.0 | 0.1 | GO:0060020 | Bergmann glial cell differentiation(GO:0060020) |
| 0.0 | 0.1 | GO:0060017 | parathyroid gland development(GO:0060017) |
| 0.0 | 0.0 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.0 | 0.1 | GO:0006561 | proline biosynthetic process(GO:0006561) |
| 0.0 | 0.0 | GO:0031269 | pseudopodium assembly(GO:0031269) |
| 0.0 | 0.1 | GO:0042590 | antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
| 0.0 | 0.0 | GO:2000389 | regulation of neutrophil extravasation(GO:2000389) positive regulation of neutrophil extravasation(GO:2000391) |
| 0.0 | 0.0 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
| 0.0 | 0.2 | GO:0007026 | negative regulation of microtubule depolymerization(GO:0007026) |
| 0.0 | 0.0 | GO:0060083 | smooth muscle contraction involved in micturition(GO:0060083) |
| 0.0 | 0.0 | GO:0061325 | cell proliferation involved in outflow tract morphogenesis(GO:0061325) |
| 0.0 | 0.0 | GO:2000409 | positive regulation of T cell extravasation(GO:2000409) |
| 0.0 | 0.1 | GO:0002031 | G-protein coupled receptor internalization(GO:0002031) |
| 0.0 | 0.1 | GO:0007512 | adult heart development(GO:0007512) |
| 0.0 | 0.1 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
| 0.0 | 0.1 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
| 0.0 | 0.1 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
| 0.0 | 0.1 | GO:0032525 | somite rostral/caudal axis specification(GO:0032525) |
| 0.0 | 0.1 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
| 0.0 | 0.1 | GO:0044789 | modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) |
| 0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.0 | GO:0046655 | folic acid metabolic process(GO:0046655) |
| 0.0 | 0.1 | GO:0014819 | regulation of skeletal muscle contraction(GO:0014819) |
| 0.0 | 0.0 | GO:0046469 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
| 0.0 | 0.0 | GO:0090148 | membrane fission(GO:0090148) |
| 0.0 | 0.1 | GO:0006415 | translational termination(GO:0006415) |
| 0.0 | 0.0 | GO:0071374 | cellular response to parathyroid hormone stimulus(GO:0071374) |
| 0.0 | 0.0 | GO:0086029 | Purkinje myocyte action potential(GO:0086017) Purkinje myocyte to ventricular cardiac muscle cell signaling(GO:0086029) Purkinje myocyte to ventricular cardiac muscle cell communication(GO:0086068) |
| 0.0 | 0.1 | GO:0060346 | bone trabecula formation(GO:0060346) |
| 0.0 | 0.0 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
| 0.0 | 0.1 | GO:0051657 | maintenance of organelle location(GO:0051657) |
| 0.0 | 0.2 | GO:0007141 | male meiosis I(GO:0007141) |
| 0.0 | 0.0 | GO:0060455 | negative regulation of gastric acid secretion(GO:0060455) |
| 0.0 | 0.1 | GO:0071392 | cellular response to estradiol stimulus(GO:0071392) |
| 0.0 | 0.1 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
| 0.0 | 0.0 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.0 | 0.0 | GO:0035935 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
| 0.0 | 0.0 | GO:2000510 | positive regulation of dendritic cell chemotaxis(GO:2000510) |
| 0.0 | 0.1 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
| 0.0 | 0.2 | GO:0019432 | triglyceride biosynthetic process(GO:0019432) |
| 0.0 | 0.0 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
| 0.0 | 0.0 | GO:0021986 | epithalamus development(GO:0021538) habenula development(GO:0021986) |
| 0.0 | 0.1 | GO:0055070 | copper ion homeostasis(GO:0055070) |
| 0.0 | 0.0 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
| 0.0 | 0.2 | GO:2000142 | regulation of DNA-templated transcription, initiation(GO:2000142) |
| 0.0 | 0.1 | GO:0000466 | maturation of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000466) |
| 0.0 | 0.1 | GO:0039702 | viral budding via host ESCRT complex(GO:0039702) |
| 0.0 | 0.0 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
| 0.0 | 0.1 | GO:0098734 | protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
| 0.0 | 0.1 | GO:0036010 | protein localization to endosome(GO:0036010) |
| 0.0 | 0.1 | GO:0008063 | Toll signaling pathway(GO:0008063) |
| 0.0 | 0.1 | GO:0071243 | cellular response to arsenic-containing substance(GO:0071243) |
| 0.0 | 0.0 | GO:0006106 | fumarate metabolic process(GO:0006106) |
| 0.0 | 0.5 | GO:0032543 | mitochondrial translation(GO:0032543) |
| 0.0 | 0.0 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
| 0.0 | 0.0 | GO:0003162 | atrioventricular node development(GO:0003162) |
| 0.0 | 0.0 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
| 0.0 | 0.1 | GO:0042403 | thyroid hormone metabolic process(GO:0042403) |
| 0.0 | 0.0 | GO:0014043 | negative regulation of neuron maturation(GO:0014043) |
| 0.0 | 0.1 | GO:1900264 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.0 | 0.0 | GO:0051697 | protein delipidation(GO:0051697) |
| 0.0 | 0.1 | GO:0045060 | negative thymic T cell selection(GO:0045060) |
| 0.0 | 0.0 | GO:0035751 | regulation of lysosomal lumen pH(GO:0035751) |
| 0.0 | 0.1 | GO:0070862 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) regulation of retrograde protein transport, ER to cytosol(GO:1904152) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
| 0.0 | 0.1 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
| 0.0 | 0.0 | GO:0097240 | meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
| 0.0 | 0.1 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
| 0.0 | 0.0 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
| 0.0 | 0.3 | GO:0008088 | axo-dendritic transport(GO:0008088) |
| 0.0 | 0.1 | GO:0006622 | protein targeting to lysosome(GO:0006622) |
| 0.0 | 0.0 | GO:0008355 | olfactory learning(GO:0008355) |
| 0.0 | 0.0 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
| 0.0 | 0.0 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.0 | 0.1 | GO:0060903 | positive regulation of meiosis I(GO:0060903) |
| 0.0 | 0.0 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.0 | 0.0 | GO:0071635 | negative regulation of transforming growth factor beta production(GO:0071635) |
| 0.0 | 0.1 | GO:0006691 | leukotriene metabolic process(GO:0006691) |
| 0.0 | 0.1 | GO:0043249 | erythrocyte maturation(GO:0043249) |
| 0.0 | 0.0 | GO:0031443 | fast-twitch skeletal muscle fiber contraction(GO:0031443) |
| 0.0 | 0.1 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
| 0.0 | 0.0 | GO:0033499 | galactose catabolic process via UDP-galactose(GO:0033499) glycolytic process through glucose-1-phosphate(GO:0061622) glycolytic process from galactose(GO:0061623) |
| 0.0 | 0.1 | GO:0016074 | snoRNA metabolic process(GO:0016074) |
| 0.0 | 0.0 | GO:0070235 | regulation of activation-induced cell death of T cells(GO:0070235) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 0.8 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
| 0.2 | 0.7 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
| 0.2 | 0.8 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
| 0.1 | 0.7 | GO:0045098 | type III intermediate filament(GO:0045098) |
| 0.1 | 1.1 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.1 | 0.4 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
| 0.1 | 0.3 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
| 0.1 | 0.3 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
| 0.1 | 0.5 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.1 | 0.4 | GO:0001651 | dense fibrillar component(GO:0001651) |
| 0.1 | 0.4 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.1 | 0.1 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
| 0.1 | 0.3 | GO:0044316 | cone cell pedicle(GO:0044316) |
| 0.1 | 0.2 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
| 0.1 | 0.2 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
| 0.1 | 0.4 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
| 0.1 | 0.2 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
| 0.1 | 0.1 | GO:1903349 | omegasome membrane(GO:1903349) |
| 0.1 | 0.2 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
| 0.1 | 0.4 | GO:0045180 | basal cortex(GO:0045180) |
| 0.1 | 0.2 | GO:1990357 | terminal web(GO:1990357) |
| 0.1 | 0.4 | GO:0016342 | catenin complex(GO:0016342) |
| 0.1 | 0.5 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.1 | 0.2 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
| 0.1 | 0.1 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
| 0.0 | 0.2 | GO:0008274 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
| 0.0 | 0.1 | GO:0035838 | growing cell tip(GO:0035838) |
| 0.0 | 0.2 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 0.0 | 0.0 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
| 0.0 | 0.2 | GO:0045261 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
| 0.0 | 0.2 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 0.0 | 0.5 | GO:0016580 | Sin3 complex(GO:0016580) |
| 0.0 | 0.2 | GO:0005579 | membrane attack complex(GO:0005579) |
| 0.0 | 0.1 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.0 | 0.1 | GO:0071942 | XPC complex(GO:0071942) |
| 0.0 | 0.2 | GO:0098536 | deuterosome(GO:0098536) |
| 0.0 | 0.1 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
| 0.0 | 0.1 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
| 0.0 | 0.3 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.0 | 0.4 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.0 | 0.3 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
| 0.0 | 0.1 | GO:0031094 | platelet dense tubular network(GO:0031094) |
| 0.0 | 0.1 | GO:0044232 | organelle membrane contact site(GO:0044232) |
| 0.0 | 1.7 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
| 0.0 | 0.4 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
| 0.0 | 0.1 | GO:0097441 | basilar dendrite(GO:0097441) |
| 0.0 | 0.1 | GO:0097651 | phosphatidylinositol 3-kinase complex, class I(GO:0097651) |
| 0.0 | 0.4 | GO:0031011 | Ino80 complex(GO:0031011) |
| 0.0 | 0.2 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
| 0.0 | 0.1 | GO:0043202 | lysosomal lumen(GO:0043202) |
| 0.0 | 0.8 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.0 | 0.1 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
| 0.0 | 0.2 | GO:0001940 | male pronucleus(GO:0001940) |
| 0.0 | 0.1 | GO:0097451 | glial limiting end-foot(GO:0097451) |
| 0.0 | 0.1 | GO:0045293 | mRNA editing complex(GO:0045293) |
| 0.0 | 0.1 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.0 | 0.5 | GO:0005614 | interstitial matrix(GO:0005614) |
| 0.0 | 0.1 | GO:0000923 | equatorial microtubule organizing center(GO:0000923) |
| 0.0 | 0.1 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
| 0.0 | 0.1 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.0 | 0.3 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.0 | 0.2 | GO:0045179 | apical cortex(GO:0045179) |
| 0.0 | 0.2 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.0 | 0.3 | GO:0032426 | stereocilium tip(GO:0032426) |
| 0.0 | 0.1 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.0 | 0.0 | GO:0000835 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) |
| 0.0 | 0.1 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 0.0 | 0.0 | GO:0055087 | Ski complex(GO:0055087) |
| 0.0 | 0.3 | GO:0030126 | COPI vesicle coat(GO:0030126) |
| 0.0 | 0.3 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.0 | 0.1 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.0 | 0.1 | GO:0097433 | dense body(GO:0097433) |
| 0.0 | 0.2 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.0 | 0.2 | GO:0071437 | invadopodium(GO:0071437) |
| 0.0 | 0.1 | GO:0005588 | collagen type V trimer(GO:0005588) |
| 0.0 | 0.4 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.0 | 0.3 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.0 | 0.2 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
| 0.0 | 0.1 | GO:0035748 | myelin sheath abaxonal region(GO:0035748) |
| 0.0 | 0.2 | GO:0046930 | pore complex(GO:0046930) |
| 0.0 | 0.3 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.0 | 0.4 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.0 | 0.1 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
| 0.0 | 0.2 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
| 0.0 | 0.3 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
| 0.0 | 0.1 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.0 | 0.1 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
| 0.0 | 0.1 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.0 | 0.2 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
| 0.0 | 0.1 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
| 0.0 | 0.2 | GO:0005675 | holo TFIIH complex(GO:0005675) |
| 0.0 | 0.1 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
| 0.0 | 0.1 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
| 0.0 | 0.1 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
| 0.0 | 0.1 | GO:1990909 | Wnt signalosome(GO:1990909) |
| 0.0 | 0.2 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.0 | 0.2 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
| 0.0 | 0.1 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
| 0.0 | 0.2 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.0 | 0.1 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
| 0.0 | 0.8 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
| 0.0 | 0.2 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.0 | 0.1 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.0 | 0.4 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
| 0.0 | 0.1 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.0 | 0.1 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
| 0.0 | 0.1 | GO:0032389 | MutLalpha complex(GO:0032389) |
| 0.0 | 0.4 | GO:0031941 | filamentous actin(GO:0031941) |
| 0.0 | 0.0 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
| 0.0 | 0.1 | GO:0000938 | GARP complex(GO:0000938) |
| 0.0 | 0.8 | GO:0000118 | histone deacetylase complex(GO:0000118) |
| 0.0 | 0.1 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.0 | 0.2 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
| 0.0 | 0.1 | GO:0016600 | flotillin complex(GO:0016600) |
| 0.0 | 0.0 | GO:0033647 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
| 0.0 | 0.2 | GO:0001741 | XY body(GO:0001741) |
| 0.0 | 0.2 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
| 0.0 | 0.1 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
| 0.0 | 0.1 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
| 0.0 | 0.0 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.0 | 0.6 | GO:0045271 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
| 0.0 | 0.1 | GO:0019908 | nuclear cyclin-dependent protein kinase holoenzyme complex(GO:0019908) |
| 0.0 | 0.6 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
| 0.0 | 0.1 | GO:0001652 | granular component(GO:0001652) |
| 0.0 | 0.6 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
| 0.0 | 0.4 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.0 | 0.1 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.0 | 0.1 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.0 | 0.1 | GO:1990130 | Iml1 complex(GO:1990130) |
| 0.0 | 0.1 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
| 0.0 | 0.2 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
| 0.0 | 0.1 | GO:0072687 | meiotic spindle(GO:0072687) |
| 0.0 | 0.2 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
| 0.0 | 0.1 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.0 | 0.0 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
| 0.0 | 0.0 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.0 | 0.1 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
| 0.0 | 0.0 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
| 0.0 | 0.0 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
| 0.0 | 0.0 | GO:0070939 | Dsl1p complex(GO:0070939) |
| 0.0 | 1.4 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
| 0.0 | 0.1 | GO:0000783 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
| 0.0 | 0.0 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
| 0.0 | 0.3 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
| 0.0 | 0.1 | GO:0072546 | ER membrane protein complex(GO:0072546) |
| 0.0 | 0.0 | GO:0045277 | respiratory chain complex IV(GO:0045277) |
| 0.0 | 0.1 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
| 0.0 | 0.1 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
| 0.0 | 0.0 | GO:0038037 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
| 0.0 | 0.1 | GO:0030867 | rough endoplasmic reticulum membrane(GO:0030867) |
| 0.0 | 0.0 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| 0.0 | 0.1 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 0.0 | 0.4 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.0 | 0.0 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.0 | 0.3 | GO:0031672 | A band(GO:0031672) |
| 0.0 | 0.0 | GO:0032133 | chromosome passenger complex(GO:0032133) |
| 0.0 | 0.0 | GO:0071953 | elastic fiber(GO:0071953) |
| 0.0 | 0.1 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
| 0.0 | 0.3 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 1.1 | GO:0070644 | vitamin D response element binding(GO:0070644) |
| 0.3 | 1.8 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
| 0.3 | 0.8 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
| 0.2 | 0.6 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.2 | 0.5 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
| 0.1 | 0.7 | GO:0070728 | leucine binding(GO:0070728) |
| 0.1 | 0.4 | GO:0070538 | oleic acid binding(GO:0070538) |
| 0.1 | 0.4 | GO:0016842 | amidine-lyase activity(GO:0016842) |
| 0.1 | 0.4 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
| 0.1 | 1.3 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
| 0.1 | 0.3 | GO:0004771 | sterol esterase activity(GO:0004771) |
| 0.1 | 0.4 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
| 0.1 | 0.3 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
| 0.1 | 0.6 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) |
| 0.1 | 0.3 | GO:0055100 | adiponectin binding(GO:0055100) |
| 0.1 | 0.3 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.1 | 0.3 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
| 0.1 | 0.5 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
| 0.1 | 0.3 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.1 | 0.4 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
| 0.1 | 0.4 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.1 | 0.3 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
| 0.1 | 0.4 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
| 0.1 | 0.3 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.1 | 0.3 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
| 0.1 | 0.5 | GO:0052630 | CTP:2,3-di-O-geranylgeranyl-sn-glycero-1-phosphate cytidyltransferase activity(GO:0043338) phospholactate guanylyltransferase activity(GO:0043814) ATP:coenzyme F420 adenylyltransferase activity(GO:0043910) UDP-N-acetylgalactosamine diphosphorylase activity(GO:0052630) |
| 0.1 | 0.7 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.1 | 0.4 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
| 0.1 | 1.6 | GO:0003785 | actin monomer binding(GO:0003785) |
| 0.1 | 0.3 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.1 | 0.3 | GO:0031781 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
| 0.1 | 0.2 | GO:1901612 | cardiolipin binding(GO:1901612) |
| 0.1 | 0.5 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
| 0.1 | 0.2 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
| 0.1 | 0.4 | GO:0005346 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) |
| 0.1 | 0.3 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.1 | 0.3 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
| 0.1 | 0.4 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.1 | 0.2 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
| 0.1 | 0.1 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.1 | 0.8 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
| 0.1 | 0.8 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.1 | 0.3 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
| 0.1 | 0.6 | GO:0016004 | phospholipase activator activity(GO:0016004) |
| 0.1 | 0.3 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
| 0.1 | 0.3 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.1 | 0.1 | GO:0033677 | DNA/RNA helicase activity(GO:0033677) |
| 0.1 | 0.3 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
| 0.1 | 0.2 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
| 0.1 | 0.4 | GO:0043140 | ATP-dependent 3'-5' DNA helicase activity(GO:0043140) |
| 0.1 | 0.2 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.1 | 0.1 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
| 0.1 | 0.1 | GO:0004331 | fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
| 0.1 | 1.3 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
| 0.1 | 0.2 | GO:0030350 | iron-responsive element binding(GO:0030350) |
| 0.1 | 0.6 | GO:0034713 | type I transforming growth factor beta receptor binding(GO:0034713) |
| 0.1 | 0.3 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
| 0.1 | 0.2 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
| 0.1 | 0.6 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
| 0.1 | 0.2 | GO:0035939 | microsatellite binding(GO:0035939) |
| 0.1 | 0.2 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
| 0.1 | 0.2 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
| 0.1 | 1.2 | GO:0030332 | cyclin binding(GO:0030332) |
| 0.1 | 0.2 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.1 | 0.2 | GO:0031127 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
| 0.1 | 0.2 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
| 0.1 | 0.2 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
| 0.1 | 0.2 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.1 | 0.2 | GO:0052795 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
| 0.1 | 0.2 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
| 0.0 | 0.0 | GO:0035514 | DNA demethylase activity(GO:0035514) |
| 0.0 | 0.2 | GO:0043559 | insulin binding(GO:0043559) |
| 0.0 | 0.3 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 0.0 | 0.2 | GO:0009374 | biotin binding(GO:0009374) |
| 0.0 | 0.1 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
| 0.0 | 0.1 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.0 | 0.2 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
| 0.0 | 0.2 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
| 0.0 | 0.1 | GO:0034816 | mono-butyltin dioxygenase activity(GO:0018586) tri-n-butyltin dioxygenase activity(GO:0018588) di-n-butyltin dioxygenase activity(GO:0018589) methylsilanetriol hydroxylase activity(GO:0018590) methyl tertiary butyl ether 3-monooxygenase activity(GO:0018591) 4-nitrocatechol 4-monooxygenase activity(GO:0018592) 4-chlorophenoxyacetate monooxygenase activity(GO:0018593) tert-butanol 2-monooxygenase activity(GO:0018594) alpha-pinene monooxygenase activity(GO:0018595) dimethylsilanediol hydroxylase activity(GO:0018596) ammonia monooxygenase activity(GO:0018597) hydroxymethylsilanetriol oxidase activity(GO:0018598) 2-hydroxyisobutyrate 3-monooxygenase activity(GO:0018599) alpha-pinene dehydrogenase activity(GO:0018600) bisphenol A hydroxylase B activity(GO:0034559) 2,2-bis(4-hydroxyphenyl)-1-propanol hydroxylase activity(GO:0034562) 9-fluorenone-3,4-dioxygenase activity(GO:0034786) anthracene 9,10-dioxygenase activity(GO:0034816) 2-(methylthio)benzothiazole monooxygenase activity(GO:0034857) 2-hydroxybenzothiazole monooxygenase activity(GO:0034858) benzothiazole monooxygenase activity(GO:0034859) 2,6-dihydroxybenzothiazole monooxygenase activity(GO:0034862) pinacolone 5-monooxygenase activity(GO:0034870) thioacetamide S-oxygenase activity(GO:0034873) thioacetamide S-oxide S-oxygenase activity(GO:0034874) endosulfan monooxygenase I activity(GO:0034888) N-nitrodimethylamine hydroxylase activity(GO:0034893) 4-(1-ethyl-1,4-dimethyl-pentyl)phenol monoxygenase activity(GO:0034897) endosulfan ether monooxygenase activity(GO:0034903) pyrene 4,5-monooxygenase activity(GO:0034925) pyrene 1,2-monooxygenase activity(GO:0034927) 1-hydroxypyrene 6,7-monooxygenase activity(GO:0034928) 1-hydroxypyrene 7,8-monooxygenase activity(GO:0034929) phenylboronic acid monooxygenase activity(GO:0034950) spheroidene monooxygenase activity(GO:0043823) |
| 0.0 | 0.2 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.0 | 0.1 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 0.0 | 0.1 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.0 | 0.2 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
| 0.0 | 0.2 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
| 0.0 | 0.6 | GO:0000701 | purine-specific mismatch base pair DNA N-glycosylase activity(GO:0000701) |
| 0.0 | 0.2 | GO:0038100 | nodal binding(GO:0038100) |
| 0.0 | 0.6 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
| 0.0 | 0.2 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.0 | 0.3 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.0 | 0.2 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
| 0.0 | 0.1 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.0 | 0.1 | GO:0015205 | purine nucleobase transmembrane transporter activity(GO:0005345) pyrimidine nucleobase transmembrane transporter activity(GO:0005350) nucleobase transmembrane transporter activity(GO:0015205) |
| 0.0 | 0.2 | GO:0032564 | dATP binding(GO:0032564) |
| 0.0 | 0.2 | GO:0004337 | geranyltranstransferase activity(GO:0004337) |
| 0.0 | 0.2 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.0 | 0.1 | GO:0032554 | purine deoxyribonucleotide binding(GO:0032554) |
| 0.0 | 0.2 | GO:0033695 | oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
| 0.0 | 0.2 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.0 | 0.2 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
| 0.0 | 0.1 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
| 0.0 | 0.1 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
| 0.0 | 0.2 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
| 0.0 | 0.3 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.0 | 0.1 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 0.0 | 0.3 | GO:0046790 | virion binding(GO:0046790) |
| 0.0 | 0.1 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
| 0.0 | 0.1 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.0 | 0.4 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.0 | 0.3 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.0 | 0.2 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.0 | 0.2 | GO:0015181 | arginine transmembrane transporter activity(GO:0015181) L-lysine transmembrane transporter activity(GO:0015189) |
| 0.0 | 0.2 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
| 0.0 | 0.0 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
| 0.0 | 0.5 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.0 | 0.4 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
| 0.0 | 0.3 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.0 | 0.1 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
| 0.0 | 0.2 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
| 0.0 | 0.1 | GO:0019862 | IgA binding(GO:0019862) |
| 0.0 | 0.2 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
| 0.0 | 0.3 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.0 | 0.3 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
| 0.0 | 1.1 | GO:0080030 | prenylcysteine methylesterase activity(GO:0010296) 1-oxa-2-oxocycloheptane lactonase activity(GO:0018731) sulfolactone hydrolase activity(GO:0018732) butyrolactone hydrolase activity(GO:0018734) endosulfan lactone lactonase activity(GO:0034892) L-ascorbate 6-phosphate lactonase activity(GO:0035460) Ser-tRNA(Thr) hydrolase activity(GO:0043905) Ala-tRNA(Pro) hydrolase activity(GO:0043906) Cys-tRNA(Pro) hydrolase activity(GO:0043907) Ser(Gly)-tRNA(Ala) hydrolase activity(GO:0043908) all-trans-retinyl-palmitate hydrolase, all-trans-retinol forming activity(GO:0047376) mannosyl-oligosaccharide 1,6-alpha-mannosidase activity(GO:0052767) mannosyl-oligosaccharide 1,3-alpha-mannosidase activity(GO:0052768) methyl indole-3-acetate esterase activity(GO:0080030) methyl salicylate esterase activity(GO:0080031) methyl jasmonate esterase activity(GO:0080032) |
| 0.0 | 0.4 | GO:0052836 | cobinamide kinase activity(GO:0008819) phytol kinase activity(GO:0010276) phenol kinase activity(GO:0018720) cyclin-dependent protein kinase activating kinase regulator activity(GO:0019914) inositol tetrakisphosphate 2-kinase activity(GO:0032942) heptose 7-phosphate kinase activity(GO:0033785) aminoglycoside phosphotransferase activity(GO:0034071) eukaryotic elongation factor-2 kinase regulator activity(GO:0042556) eukaryotic elongation factor-2 kinase activator activity(GO:0042557) LPPG:FO 2-phospho-L-lactate transferase activity(GO:0043743) cytidine kinase activity(GO:0043771) glycerate 2-kinase activity(GO:0043798) (S)-lactate 2-kinase activity(GO:0043841) phosphoserine:homoserine phosphotransferase activity(GO:0043899) L-seryl-tRNA(Sec) kinase activity(GO:0043915) phosphocholine transferase activity(GO:0044605) GTP-dependent polynucleotide kinase activity(GO:0051735) farnesol kinase activity(GO:0052668) CTP:2-trans,-6-trans-farnesol kinase activity(GO:0052669) geraniol kinase activity(GO:0052670) geranylgeraniol kinase activity(GO:0052671) CTP:geranylgeraniol kinase activity(GO:0052672) prenol kinase activity(GO:0052673) 1-phosphatidylinositol-5-kinase activity(GO:0052810) 1-phosphatidylinositol-3-phosphate 4-kinase activity(GO:0052811) phosphatidylinositol-3,4-bisphosphate 5-kinase activity(GO:0052812) inositol-3,4,6-trisphosphate 1-kinase activity(GO:0052835) inositol 5-diphosphate pentakisphosphate 5-kinase activity(GO:0052836) inositol diphosphate tetrakisphosphate kinase activity(GO:0052839) |
| 0.0 | 0.1 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.0 | 0.1 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
| 0.0 | 0.0 | GO:0008905 | mannose-phosphate guanylyltransferase activity(GO:0008905) |
| 0.0 | 0.1 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
| 0.0 | 0.2 | GO:0003910 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
| 0.0 | 0.2 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) |
| 0.0 | 0.2 | GO:0031685 | adenosine receptor binding(GO:0031685) |
| 0.0 | 0.1 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
| 0.0 | 0.1 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.0 | 0.1 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 0.0 | 0.3 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
| 0.0 | 0.5 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
| 0.0 | 0.1 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
| 0.0 | 0.4 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
| 0.0 | 0.3 | GO:0004955 | prostaglandin receptor activity(GO:0004955) |
| 0.0 | 0.2 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
| 0.0 | 0.0 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
| 0.0 | 0.0 | GO:0016653 | oxidoreductase activity, acting on NAD(P)H, heme protein as acceptor(GO:0016653) |
| 0.0 | 0.4 | GO:0043274 | phospholipase binding(GO:0043274) |
| 0.0 | 0.1 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
| 0.0 | 0.1 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
| 0.0 | 0.2 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
| 0.0 | 0.7 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
| 0.0 | 0.1 | GO:0016215 | acyl-CoA desaturase activity(GO:0016215) |
| 0.0 | 0.3 | GO:0043996 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
| 0.0 | 0.1 | GO:0032557 | pyrimidine ribonucleotide binding(GO:0032557) |
| 0.0 | 0.1 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.0 | 0.1 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
| 0.0 | 0.1 | GO:0042281 | dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase activity(GO:0042281) |
| 0.0 | 0.6 | GO:0003954 | NADH dehydrogenase activity(GO:0003954) |
| 0.0 | 0.2 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
| 0.0 | 0.1 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
| 0.0 | 0.1 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
| 0.0 | 0.1 | GO:0050692 | DBD domain binding(GO:0050692) |
| 0.0 | 0.1 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.0 | 0.3 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
| 0.0 | 0.2 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.0 | 0.2 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.0 | 0.1 | GO:2001070 | starch binding(GO:2001070) |
| 0.0 | 1.0 | GO:0016763 | transferase activity, transferring pentosyl groups(GO:0016763) |
| 0.0 | 0.1 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.0 | 0.1 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
| 0.0 | 0.2 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
| 0.0 | 0.2 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
| 0.0 | 0.4 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
| 0.0 | 0.1 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
| 0.0 | 0.1 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.0 | 0.0 | GO:0000009 | alpha-1,6-mannosyltransferase activity(GO:0000009) |
| 0.0 | 0.1 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
| 0.0 | 0.2 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.0 | 0.1 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
| 0.0 | 0.1 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.0 | 0.1 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
| 0.0 | 0.5 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
| 0.0 | 0.1 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.0 | 0.1 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
| 0.0 | 0.2 | GO:0008430 | selenium binding(GO:0008430) |
| 0.0 | 0.1 | GO:0015288 | porin activity(GO:0015288) |
| 0.0 | 0.7 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
| 0.0 | 0.3 | GO:0016799 | hydrolase activity, hydrolyzing N-glycosyl compounds(GO:0016799) |
| 0.0 | 0.0 | GO:0035877 | death effector domain binding(GO:0035877) |
| 0.0 | 0.1 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
| 0.0 | 0.1 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
| 0.0 | 0.1 | GO:0005536 | glucose binding(GO:0005536) |
| 0.0 | 0.1 | GO:0004967 | glucagon receptor activity(GO:0004967) |
| 0.0 | 0.1 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
| 0.0 | 0.2 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
| 0.0 | 0.1 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
| 0.0 | 0.1 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.0 | 0.1 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 0.0 | 0.3 | GO:0017160 | Ral GTPase binding(GO:0017160) |
| 0.0 | 0.1 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.0 | 0.3 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
| 0.0 | 0.1 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
| 0.0 | 0.1 | GO:0030572 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) |
| 0.0 | 0.0 | GO:0030911 | TPR domain binding(GO:0030911) |
| 0.0 | 0.4 | GO:0042166 | acetylcholine binding(GO:0042166) |
| 0.0 | 0.2 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.0 | 0.0 | GO:0005534 | galactose binding(GO:0005534) |
| 0.0 | 0.1 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
| 0.0 | 0.1 | GO:0019961 | interferon binding(GO:0019961) |
| 0.0 | 0.0 | GO:0098847 | sequence-specific single stranded DNA binding(GO:0098847) |
| 0.0 | 0.1 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
| 0.0 | 0.1 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
| 0.0 | 0.1 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.0 | 0.2 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.0 | 0.1 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
| 0.0 | 0.1 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
| 0.0 | 0.1 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.0 | 0.1 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.0 | 0.1 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
| 0.0 | 0.0 | GO:0097001 | ceramide binding(GO:0097001) |
| 0.0 | 0.5 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.0 | 0.2 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
| 0.0 | 0.1 | GO:1990239 | steroid hormone binding(GO:1990239) |
| 0.0 | 0.1 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.0 | 0.2 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
| 0.0 | 0.1 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
| 0.0 | 0.1 | GO:0002054 | nucleobase binding(GO:0002054) |
| 0.0 | 0.1 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
| 0.0 | 0.3 | GO:0005527 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.0 | 0.1 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
| 0.0 | 0.1 | GO:0016015 | morphogen activity(GO:0016015) |
| 0.0 | 0.0 | GO:0043398 | HLH domain binding(GO:0043398) |
| 0.0 | 0.1 | GO:0004966 | galanin receptor activity(GO:0004966) |
| 0.0 | 0.1 | GO:0070905 | serine binding(GO:0070905) |
| 0.0 | 0.1 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.0 | 0.1 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
| 0.0 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.0 | 0.1 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
| 0.0 | 0.1 | GO:0004017 | adenylate kinase activity(GO:0004017) |
| 0.0 | 0.1 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
| 0.0 | 0.5 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
| 0.0 | 0.5 | GO:0004364 | glutathione transferase activity(GO:0004364) |
| 0.0 | 0.4 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
| 0.0 | 0.7 | GO:0008392 | arachidonic acid epoxygenase activity(GO:0008392) |
| 0.0 | 0.1 | GO:0098505 | G-rich strand telomeric DNA binding(GO:0098505) |
| 0.0 | 0.1 | GO:0016443 | bidentate ribonuclease III activity(GO:0016443) |
| 0.0 | 0.3 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| 0.0 | 0.1 | GO:0048038 | quinone binding(GO:0048038) |
| 0.0 | 0.1 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
| 0.0 | 0.1 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
| 0.0 | 0.2 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
| 0.0 | 0.1 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
| 0.0 | 0.1 | GO:0005499 | vitamin D binding(GO:0005499) |
| 0.0 | 0.1 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.0 | 0.1 | GO:0031628 | opioid receptor binding(GO:0031628) |
| 0.0 | 0.1 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.0 | 0.6 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.0 | 0.1 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 0.0 | 0.0 | GO:0030172 | troponin C binding(GO:0030172) |
| 0.0 | 0.1 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.0 | 0.0 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
| 0.0 | 0.0 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
| 0.0 | 0.1 | GO:0019864 | IgG binding(GO:0019864) |
| 0.0 | 0.1 | GO:0050815 | phosphoserine binding(GO:0050815) |
| 0.0 | 0.2 | GO:0003756 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
| 0.0 | 0.1 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
| 0.0 | 0.0 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
| 0.0 | 0.1 | GO:0008948 | oxaloacetate decarboxylase activity(GO:0008948) |
| 0.0 | 0.0 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
| 0.0 | 0.1 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
| 0.0 | 0.1 | GO:0005042 | netrin receptor activity(GO:0005042) |
| 0.0 | 0.5 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
| 0.0 | 0.0 | GO:0032139 | dinucleotide insertion or deletion binding(GO:0032139) |
| 0.0 | 0.0 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
| 0.0 | 0.1 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.0 | 0.1 | GO:0052723 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
| 0.0 | 0.1 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
| 0.0 | 0.1 | GO:0042043 | neurexin family protein binding(GO:0042043) |
| 0.0 | 0.2 | GO:0016289 | CoA hydrolase activity(GO:0016289) |
| 0.0 | 0.1 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
| 0.0 | 0.1 | GO:0070403 | NAD+ binding(GO:0070403) |
| 0.0 | 0.0 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.0 | 0.0 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
| 0.0 | 0.0 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
| 0.0 | 0.1 | GO:0016721 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.0 | 0.0 | GO:0016151 | nickel cation binding(GO:0016151) |
| 0.0 | 0.2 | GO:0044769 | ATPase activity, coupled to transmembrane movement of ions, rotational mechanism(GO:0044769) |
| 0.0 | 0.1 | GO:0070492 | oligosaccharide binding(GO:0070492) |
| 0.0 | 0.0 | GO:0070191 | methionine-R-sulfoxide reductase activity(GO:0070191) |
| 0.0 | 0.3 | GO:0017046 | peptide hormone binding(GO:0017046) |
| 0.0 | 0.1 | GO:0034711 | inhibin binding(GO:0034711) |
| 0.0 | 0.1 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
| 0.0 | 0.3 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 0.0 | 0.1 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.0 | 0.0 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
| 0.0 | 0.1 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
| 0.0 | 0.1 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
| 0.0 | 0.1 | GO:0004556 | alpha-amylase activity(GO:0004556) |
| 0.0 | 0.0 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
| 0.0 | 0.2 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
| 0.0 | 0.1 | GO:1990254 | keratin filament binding(GO:1990254) |
| 0.0 | 0.1 | GO:0005113 | patched binding(GO:0005113) |
| 0.0 | 0.8 | GO:0008376 | acetylgalactosaminyltransferase activity(GO:0008376) |
| 0.0 | 0.1 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
| 0.0 | 0.0 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
| 0.0 | 0.1 | GO:0033170 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 0.0 | 0.1 | GO:0031005 | filamin binding(GO:0031005) |
| 0.0 | 0.0 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 0.0 | 0.1 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
| 0.0 | 0.1 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
| 0.0 | 0.1 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
| 0.0 | 0.1 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
| 0.0 | 0.1 | GO:0000339 | RNA cap binding(GO:0000339) |
| 0.0 | 0.1 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
| 0.0 | 0.0 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
| 0.0 | 0.1 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
| 0.0 | 0.1 | GO:0008079 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
| 0.0 | 0.0 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
| 0.0 | 0.4 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
| 0.0 | 0.0 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
| 0.0 | 0.1 | GO:0019200 | carbohydrate kinase activity(GO:0019200) |
| 0.0 | 0.1 | GO:0071949 | FAD binding(GO:0071949) |
| 0.0 | 0.2 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.0 | 0.1 | GO:0001640 | adenylate cyclase inhibiting G-protein coupled glutamate receptor activity(GO:0001640) |
| 0.0 | 0.0 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
| 0.0 | 0.0 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
| 0.0 | 0.0 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 0.0 | 0.0 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
| 0.0 | 0.1 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 0.0 | 0.1 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
| 0.0 | 0.0 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
| 0.0 | 0.0 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
| 0.0 | 0.3 | GO:0043914 | NADPH:sulfur oxidoreductase activity(GO:0043914) |
| 0.0 | 0.1 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.0 | 0.1 | GO:0016208 | AMP binding(GO:0016208) |
| 0.0 | 0.0 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
| 0.0 | 0.0 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
| 0.0 | 0.1 | GO:0032041 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
| 0.0 | 0.4 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
| 0.0 | 0.2 | GO:0008375 | acetylglucosaminyltransferase activity(GO:0008375) |
| 0.0 | 0.0 | GO:0070699 | type II activin receptor binding(GO:0070699) |
| 0.0 | 0.0 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
| 0.0 | 0.0 | GO:0097016 | L27 domain binding(GO:0097016) |
| 0.0 | 0.0 | GO:0001515 | opioid peptide activity(GO:0001515) |
| 0.0 | 0.1 | GO:0031419 | cobalamin binding(GO:0031419) |
| 0.0 | 0.0 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
| 0.0 | 0.3 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 1.5 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.1 | 1.7 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.0 | 1.4 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
| 0.0 | 0.6 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.0 | 2.1 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
| 0.0 | 0.2 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
| 0.0 | 0.4 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.0 | 0.3 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.0 | 0.2 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.0 | 0.5 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.0 | 0.1 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
| 0.0 | 0.7 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.0 | 0.1 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
| 0.0 | 0.0 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
| 0.0 | 0.2 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
| 0.0 | 0.5 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.0 | 0.3 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.0 | 0.4 | PID ARF 3PATHWAY | Arf1 pathway |
| 0.0 | 0.2 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
| 0.0 | 0.1 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
| 0.0 | 0.0 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.0 | 0.8 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 0.0 | 0.1 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
| 0.0 | 0.4 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
| 0.0 | 0.1 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
| 0.0 | 0.2 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.0 | 0.2 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
| 0.0 | 0.1 | PID INTEGRIN1 PATHWAY | Beta1 integrin cell surface interactions |
| 0.0 | 0.6 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
| 0.0 | 0.4 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.0 | 0.1 | ST G ALPHA I PATHWAY | G alpha i Pathway |
| 0.0 | 0.3 | PID INSULIN PATHWAY | Insulin Pathway |
| 0.0 | 0.1 | PID IL2 1PATHWAY | IL2-mediated signaling events |
| 0.0 | 0.4 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.0 | 0.1 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.0 | 0.6 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
| 0.0 | 0.4 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
| 0.0 | 0.0 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.0 | 0.1 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.0 | 0.5 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.0 | 0.2 | PID REELIN PATHWAY | Reelin signaling pathway |
| 0.0 | 0.2 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
| 0.0 | 0.2 | PID CONE PATHWAY | Visual signal transduction: Cones |
| 0.0 | 0.1 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.0 | 0.1 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.0 | 0.1 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
| 0.0 | 0.3 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
| 0.0 | 0.1 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.0 | 0.0 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
| 0.0 | 0.3 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 0.0 | 0.4 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
| 0.0 | 0.2 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
| 0.0 | 0.2 | PID BARD1 PATHWAY | BARD1 signaling events |
| 0.0 | 0.1 | PID EPO PATHWAY | EPO signaling pathway |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.2 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 0.1 | 1.5 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
| 0.1 | 0.7 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.1 | 0.9 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
| 0.1 | 1.2 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.1 | 0.2 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
| 0.1 | 0.7 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.1 | 0.7 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
| 0.1 | 0.5 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
| 0.1 | 0.6 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
| 0.1 | 0.6 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.0 | 0.0 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
| 0.0 | 0.0 | REACTOME CD28 CO STIMULATION | Genes involved in CD28 co-stimulation |
| 0.0 | 0.4 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.0 | 0.1 | REACTOME GLUCAGON SIGNALING IN METABOLIC REGULATION | Genes involved in Glucagon signaling in metabolic regulation |
| 0.0 | 0.3 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
| 0.0 | 0.5 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
| 0.0 | 0.3 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
| 0.0 | 0.6 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
| 0.0 | 0.0 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.0 | 0.2 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.0 | 0.5 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.0 | 1.7 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.0 | 1.2 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
| 0.0 | 0.4 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
| 0.0 | 0.3 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.0 | 0.1 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
| 0.0 | 0.3 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.0 | 0.3 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.0 | 0.5 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.0 | 0.4 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
| 0.0 | 0.5 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.0 | 0.1 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
| 0.0 | 0.6 | REACTOME KINESINS | Genes involved in Kinesins |
| 0.0 | 0.5 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
| 0.0 | 0.3 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
| 0.0 | 0.2 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
| 0.0 | 0.4 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
| 0.0 | 0.1 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.0 | 0.0 | REACTOME APC CDC20 MEDIATED DEGRADATION OF NEK2A | Genes involved in APC-Cdc20 mediated degradation of Nek2A |
| 0.0 | 0.6 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.0 | 0.1 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
| 0.0 | 0.1 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
| 0.0 | 0.1 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.0 | 1.0 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.0 | 0.2 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.0 | 1.0 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 0.0 | 0.1 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
| 0.0 | 0.3 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.0 | 0.4 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.0 | 0.7 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
| 0.0 | 0.4 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
| 0.0 | 0.3 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
| 0.0 | 0.3 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
| 0.0 | 0.1 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
| 0.0 | 0.2 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.0 | 0.3 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.0 | 0.0 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.0 | 0.2 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.0 | 0.1 | REACTOME TAK1 ACTIVATES NFKB BY PHOSPHORYLATION AND ACTIVATION OF IKKS COMPLEX | Genes involved in TAK1 activates NFkB by phosphorylation and activation of IKKs complex |
| 0.0 | 0.1 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
| 0.0 | 0.2 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
| 0.0 | 0.2 | REACTOME ACTIVATION OF IRF3 IRF7 MEDIATED BY TBK1 IKK EPSILON | Genes involved in Activation of IRF3/IRF7 mediated by TBK1/IKK epsilon |
| 0.0 | 0.2 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.0 | 0.2 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
| 0.0 | 0.5 | REACTOME REGULATION OF MRNA STABILITY BY PROTEINS THAT BIND AU RICH ELEMENTS | Genes involved in Regulation of mRNA Stability by Proteins that Bind AU-rich Elements |
| 0.0 | 0.2 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.0 | 0.1 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
| 0.0 | 0.1 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 0.0 | 0.1 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.0 | 0.1 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.0 | 0.0 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
| 0.0 | 0.7 | REACTOME AMINO ACID AND OLIGOPEPTIDE SLC TRANSPORTERS | Genes involved in Amino acid and oligopeptide SLC transporters |
| 0.0 | 0.2 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.0 | 0.5 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
| 0.0 | 0.2 | REACTOME VIRAL MESSENGER RNA SYNTHESIS | Genes involved in Viral Messenger RNA Synthesis |
| 0.0 | 0.1 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 0.0 | 0.5 | REACTOME MRNA 3 END PROCESSING | Genes involved in mRNA 3'-end processing |
| 0.0 | 0.5 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
| 0.0 | 0.2 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.0 | 0.3 | REACTOME PYRUVATE METABOLISM AND CITRIC ACID TCA CYCLE | Genes involved in Pyruvate metabolism and Citric Acid (TCA) cycle |
| 0.0 | 0.0 | REACTOME CDT1 ASSOCIATION WITH THE CDC6 ORC ORIGIN COMPLEX | Genes involved in CDT1 association with the CDC6:ORC:origin complex |
| 0.0 | 0.2 | REACTOME PHOSPHORYLATION OF THE APC C | Genes involved in Phosphorylation of the APC/C |
| 0.0 | 0.4 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
| 0.0 | 0.1 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
| 0.0 | 0.1 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
| 0.0 | 0.2 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.0 | 0.1 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.0 | 0.3 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
| 0.0 | 0.2 | REACTOME ACTIVATION OF THE PRE REPLICATIVE COMPLEX | Genes involved in Activation of the pre-replicative complex |
| 0.0 | 0.3 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.0 | 1.0 | REACTOME DNA REPAIR | Genes involved in DNA Repair |
| 0.0 | 0.1 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
| 0.0 | 0.0 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
| 0.0 | 0.0 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.0 | 0.1 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
| 0.0 | 0.2 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
| 0.0 | 0.2 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
| 0.0 | 0.1 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
| 0.0 | 0.1 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 0.0 | 0.0 | REACTOME ADP SIGNALLING THROUGH P2RY12 | Genes involved in ADP signalling through P2Y purinoceptor 12 |
| 0.0 | 0.1 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
| 0.0 | 0.6 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
| 0.0 | 0.3 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |