Gene Symbol | Gene ID | Gene Info |
---|---|---|
Tead3
|
ENSMUSG00000002249.11 | Tead3 |
Tead4
|
ENSMUSG00000030353.9 | Tead4 |
Gene | Promoter | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Tead3 | chr17_28350412_28350637 | 76 | 0.942495 | -0.71 | 1.1e-01 | Click! |
Tead3 | chr17_28350868_28351168 | 201 | 0.880904 | -0.53 | 2.8e-01 | Click! |
Tead3 | chr17_28350210_28350403 | 40 | 0.950576 | -0.41 | 4.2e-01 | Click! |
Tead3 | chr17_28349957_28350158 | 289 | 0.816706 | -0.35 | 4.9e-01 | Click! |
Tead3 | chr17_28351189_28351340 | 447 | 0.683583 | -0.30 | 5.6e-01 | Click! |
Tead4 | chr6_128300759_128300982 | 47 | 0.942209 | 0.86 | 3.0e-02 | Click! |
Tead4 | chr6_128300445_128300614 | 209 | 0.860174 | -0.36 | 4.9e-01 | Click! |
Tead4 | chr6_128277584_128278095 | 2262 | 0.161614 | -0.26 | 6.2e-01 | Click! |
Tead4 | chr6_128277317_128277468 | 1815 | 0.195311 | -0.22 | 6.8e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr7_45710445_45711101 | 2.27 |
Sphk2 |
sphingosine kinase 2 |
2670 |
0.09 |
chr8_80263585_80263752 | 2.03 |
Gm45430 |
predicted gene 45430 |
68469 |
0.12 |
chr8_5025910_5026084 | 1.93 |
n-R5s93 |
nuclear encoded rRNA 5S 93 |
43380 |
0.14 |
chr9_74326904_74327074 | 1.86 |
Gm24141 |
predicted gene, 24141 |
35621 |
0.16 |
chr1_61971987_61972299 | 1.78 |
Gm29640 |
predicted gene 29640 |
9064 |
0.27 |
chr14_103463834_103464050 | 1.76 |
Gm34907 |
predicted gene, 34907 |
23 |
0.98 |
chr14_116442003_116442157 | 1.75 |
Gm38045 |
predicted gene, 38045 |
308135 |
0.01 |
chr13_46051322_46051732 | 1.52 |
Gm45949 |
predicted gene, 45949 |
9070 |
0.25 |
chr12_103996630_103996801 | 1.52 |
Gm28577 |
predicted gene 28577 |
136 |
0.92 |
chr3_133759501_133760150 | 1.49 |
Gm6135 |
prediticted gene 6135 |
31679 |
0.18 |
chr7_84457901_84458052 | 1.45 |
Gm45175 |
predicted gene 45175 |
13425 |
0.16 |
chr7_45705992_45706174 | 1.39 |
Dbp |
D site albumin promoter binding protein |
799 |
0.31 |
chr19_40176010_40176194 | 1.36 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
11184 |
0.15 |
chr8_111366920_111367091 | 1.36 |
Fa2h |
fatty acid 2-hydroxylase |
528 |
0.74 |
chr2_122251478_122251672 | 1.32 |
Sord |
sorbitol dehydrogenase |
16826 |
0.1 |
chr19_40159590_40159741 | 1.31 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
27621 |
0.14 |
chr4_43558445_43558602 | 1.29 |
Tln1 |
talin 1 |
63 |
0.93 |
chr15_7201350_7201501 | 1.27 |
Egflam |
EGF-like, fibronectin type III and laminin G domains |
21644 |
0.23 |
chr5_125524109_125525122 | 1.24 |
Tmem132b |
transmembrane protein 132B |
7159 |
0.16 |
chr5_144258484_144258651 | 1.20 |
2900089D17Rik |
RIKEN cDNA 2900089D17 gene |
2381 |
0.19 |
chr17_73186030_73186181 | 1.19 |
Gm9311 |
predicted gene 9311 |
5580 |
0.19 |
chr1_40217644_40217810 | 1.18 |
Il1r1 |
interleukin 1 receptor, type I |
7353 |
0.21 |
chr3_64420378_64420548 | 1.13 |
Vmn2r4 |
vomeronasal 2, receptor 4 |
5095 |
0.14 |
chr2_72195124_72195563 | 1.13 |
Rapgef4 |
Rap guanine nucleotide exchange factor (GEF) 4 |
3456 |
0.24 |
chr18_7657709_7657860 | 1.11 |
Mpp7 |
membrane protein, palmitoylated 7 (MAGUK p55 subfamily member 7) |
30918 |
0.17 |
chr7_107574446_107574681 | 1.10 |
Olfml1 |
olfactomedin-like 1 |
6797 |
0.16 |
chr4_102635310_102635477 | 1.10 |
Pde4b |
phosphodiesterase 4B, cAMP specific |
45550 |
0.17 |
chr1_127899545_127899941 | 1.08 |
Rab3gap1 |
RAB3 GTPase activating protein subunit 1 |
1170 |
0.47 |
chr2_126916345_126916504 | 1.08 |
Sppl2a |
signal peptide peptidase like 2A |
3921 |
0.19 |
chr3_121805740_121806017 | 1.08 |
Abcd3 |
ATP-binding cassette, sub-family D (ALD), member 3 |
9031 |
0.12 |
chr11_16805061_16805227 | 1.07 |
Egfros |
epidermal growth factor receptor, opposite strand |
25558 |
0.18 |
chr11_60249007_60249158 | 1.07 |
Tom1l2 |
target of myb1-like 2 (chicken) |
3413 |
0.16 |
chr11_16588986_16589143 | 1.05 |
Gm12663 |
predicted gene 12663 |
47002 |
0.12 |
chr19_8097849_8098000 | 1.04 |
Slc22a28 |
solute carrier family 22, member 28 |
34058 |
0.16 |
chr1_68780689_68780840 | 1.03 |
Gm37061 |
predicted gene, 37061 |
19037 |
0.25 |
chr9_86630726_86630877 | 1.01 |
Me1 |
malic enzyme 1, NADP(+)-dependent, cytosolic |
12064 |
0.15 |
chr1_21250628_21250912 | 1.00 |
Gsta3 |
glutathione S-transferase, alpha 3 |
2751 |
0.16 |
chr11_52447346_52447527 | 0.99 |
Gm12209 |
predicted gene 12209 |
31667 |
0.13 |
chr11_5911144_5911324 | 0.97 |
Gck |
glucokinase |
3890 |
0.14 |
chr2_169274428_169274663 | 0.97 |
9430093N23Rik |
RIKEN cDNA 9430093N23 gene |
39554 |
0.18 |
chr6_146261172_146261370 | 0.96 |
Gm44086 |
predicted gene, 44086 |
9709 |
0.23 |
chr2_128141129_128141302 | 0.96 |
Bcl2l11 |
BCL2-like 11 (apoptosis facilitator) |
13084 |
0.21 |
chr17_32935115_32935289 | 0.95 |
Cyp4f13 |
cytochrome P450, family 4, subfamily f, polypeptide 13 |
4194 |
0.12 |
chrX_129413614_129413812 | 0.93 |
Gm14986 |
predicted gene 14986 |
104813 |
0.07 |
chr11_16854764_16854960 | 0.93 |
Egfr |
epidermal growth factor receptor |
23288 |
0.17 |
chr11_88173046_88173197 | 0.93 |
Cuedc1 |
CUE domain containing 1 |
9182 |
0.18 |
chr11_94134838_94135040 | 0.93 |
B230206L02Rik |
RIKEN cDNA B230206L02 gene |
721 |
0.69 |
chr10_87883611_87883967 | 0.93 |
Igf1os |
insulin-like growth factor 1, opposite strand |
20408 |
0.18 |
chr6_145863813_145864067 | 0.93 |
Gm43909 |
predicted gene, 43909 |
643 |
0.6 |
chr13_31511172_31511336 | 0.92 |
Foxq1 |
forkhead box Q1 |
44880 |
0.1 |
chr10_91321221_91321411 | 0.92 |
Gm47082 |
predicted gene, 47082 |
10971 |
0.22 |
chr8_61324011_61324162 | 0.92 |
1700001D01Rik |
RIKEN cDNA 1700001D01 gene |
35214 |
0.14 |
chr5_125528257_125528432 | 0.91 |
Tmem132b |
transmembrane protein 132B |
3430 |
0.21 |
chr3_84298294_84298452 | 0.91 |
Trim2 |
tripartite motif-containing 2 |
6368 |
0.27 |
chr11_31747321_31747521 | 0.90 |
Gm38061 |
predicted gene, 38061 |
48773 |
0.13 |
chr2_26309864_26310015 | 0.90 |
Gpsm1 |
G-protein signalling modulator 1 (AGS3-like, C. elegans) |
5576 |
0.11 |
chr7_79837381_79837566 | 0.90 |
Anpep |
alanyl (membrane) aminopeptidase |
4879 |
0.12 |
chr6_51702536_51702687 | 0.90 |
Gm38811 |
predicted gene, 38811 |
8470 |
0.26 |
chr4_139252070_139252425 | 0.87 |
Capzb |
capping protein (actin filament) muscle Z-line, beta |
18864 |
0.13 |
chr4_128636057_128636208 | 0.87 |
Gm12958 |
predicted gene 12958 |
1339 |
0.38 |
chr10_91261198_91261441 | 0.87 |
Gm18705 |
predicted gene, 18705 |
1975 |
0.31 |
chr3_57471128_57471279 | 0.87 |
Tm4sf4 |
transmembrane 4 superfamily member 4 |
45889 |
0.13 |
chr2_163038300_163038466 | 0.87 |
Ift52 |
intraflagellar transport 52 |
15940 |
0.11 |
chr5_51452144_51452310 | 0.86 |
Gm42614 |
predicted gene 42614 |
32078 |
0.15 |
chr12_104083020_104083260 | 0.86 |
Serpina4-ps1 |
serine (or cysteine) peptidase inhibitor, clade A, member 4, pseudogene 1 |
2491 |
0.16 |
chr7_144928968_144929143 | 0.85 |
Ccnd1 |
cyclin D1 |
9142 |
0.12 |
chr18_52479162_52479313 | 0.85 |
Srfbp1 |
serum response factor binding protein 1 |
3858 |
0.22 |
chr18_79032313_79032478 | 0.84 |
Setbp1 |
SET binding protein 1 |
76996 |
0.12 |
chr15_3463620_3463812 | 0.84 |
Ghr |
growth hormone receptor |
7928 |
0.3 |
chr7_64057280_64057473 | 0.83 |
Gm20670 |
predicted gene 20670 |
226 |
0.92 |
chr19_40164076_40164449 | 0.83 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
23024 |
0.14 |
chr6_136954641_136954792 | 0.83 |
Pde6h |
phosphodiesterase 6H, cGMP-specific, cone, gamma |
183 |
0.93 |
chr9_99167096_99167251 | 0.83 |
Pik3cb |
phosphatidylinositol-4,5-bisphosphate 3-kinase catalytic subunit beta |
26552 |
0.13 |
chr3_64570436_64570598 | 0.82 |
Vmn2r6 |
vomeronasal 2, receptor 6 |
4687 |
0.16 |
chr2_26459484_26459672 | 0.82 |
Gm13568 |
predicted gene 13568 |
2434 |
0.14 |
chr2_137153906_137154280 | 0.82 |
Jag1 |
jagged 1 |
37449 |
0.18 |
chr6_119352128_119352530 | 0.81 |
Cacna2d4 |
calcium channel, voltage-dependent, alpha 2/delta subunit 4 |
19767 |
0.17 |
chr4_102605309_102605498 | 0.81 |
Pde4b |
phosphodiesterase 4B, cAMP specific |
15560 |
0.27 |
chr3_18139372_18139553 | 0.80 |
Gm23686 |
predicted gene, 23686 |
38163 |
0.16 |
chr12_86948719_86948887 | 0.80 |
Cipc |
CLOCK interacting protein, circadian |
1313 |
0.41 |
chr4_150427704_150427878 | 0.79 |
Rere |
arginine glutamic acid dipeptide (RE) repeats |
21397 |
0.21 |
chr9_74873778_74874078 | 0.79 |
Onecut1 |
one cut domain, family member 1 |
7444 |
0.16 |
chr13_50007545_50007696 | 0.79 |
Gm6554 |
predicted gene 6554 |
5362 |
0.14 |
chr18_33849458_33849609 | 0.78 |
Epb41l4a |
erythrocyte membrane protein band 4.1 like 4a |
16739 |
0.21 |
chr4_70521535_70521760 | 0.77 |
Megf9 |
multiple EGF-like-domains 9 |
13281 |
0.3 |
chr7_99194154_99194305 | 0.76 |
Gm45012 |
predicted gene 45012 |
8137 |
0.13 |
chr6_55169879_55170107 | 0.75 |
Inmt |
indolethylamine N-methyltransferase |
5021 |
0.18 |
chr11_6021859_6022054 | 0.75 |
Camk2b |
calcium/calmodulin-dependent protein kinase II, beta |
21508 |
0.15 |
chr2_163037922_163038123 | 0.75 |
Ift52 |
intraflagellar transport 52 |
15579 |
0.11 |
chr2_77527013_77527164 | 0.75 |
Zfp385b |
zinc finger protein 385B |
7470 |
0.28 |
chr11_16817302_16817617 | 0.75 |
Egfros |
epidermal growth factor receptor, opposite strand |
13243 |
0.21 |
chr2_35646782_35646998 | 0.75 |
Dab2ip |
disabled 2 interacting protein |
14460 |
0.22 |
chr17_46054574_46054727 | 0.74 |
Vegfa |
vascular endothelial growth factor A |
22281 |
0.12 |
chr10_24595287_24595581 | 0.74 |
Ccn2 |
cellular communication network factor 2 |
8 |
0.86 |
chr5_30545835_30545997 | 0.74 |
Cib4 |
calcium and integrin binding family member 4 |
80 |
0.96 |
chr7_116273445_116273610 | 0.74 |
Plekha7 |
pleckstrin homology domain containing, family A member 7 |
9099 |
0.16 |
chr2_170351585_170351736 | 0.74 |
Bcas1 |
breast carcinoma amplified sequence 1 |
1865 |
0.32 |
chr11_16868019_16868198 | 0.74 |
Egfr |
epidermal growth factor receptor |
10042 |
0.2 |
chr16_49657272_49657456 | 0.74 |
Ift57 |
intraflagellar transport 57 |
41869 |
0.2 |
chr4_115905048_115905213 | 0.73 |
6430628N08Rik |
RIKEN cDNA 6430628N08 gene |
14464 |
0.11 |
chr15_3524128_3524292 | 0.73 |
Ghr |
growth hormone receptor |
52566 |
0.15 |
chr2_117123852_117124056 | 0.73 |
Spred1 |
sprouty protein with EVH-1 domain 1, related sequence |
2316 |
0.34 |
chr1_83900189_83900548 | 0.73 |
4933436I20Rik |
RIKEN cDNA 4933436I20 gene |
11203 |
0.23 |
chr8_4339060_4339219 | 0.72 |
Ccl25 |
chemokine (C-C motif) ligand 25 |
6880 |
0.11 |
chr11_16853828_16853979 | 0.72 |
Egfros |
epidermal growth factor receptor, opposite strand |
23201 |
0.17 |
chr1_55202115_55202266 | 0.72 |
Rftn2 |
raftlin family member 2 |
4299 |
0.16 |
chr19_40241408_40241559 | 0.72 |
Pdlim1 |
PDZ and LIM domain 1 (elfin) |
10678 |
0.15 |
chr4_122959046_122959235 | 0.72 |
Mfsd2a |
major facilitator superfamily domain containing 2A |
850 |
0.49 |
chr17_35152151_35152302 | 0.71 |
Prrc2a |
proline-rich coiled-coil 2A |
1033 |
0.18 |
chr8_117667774_117667955 | 0.71 |
Sdr42e1 |
short chain dehydrogenase/reductase family 42E, member 1 |
3683 |
0.18 |
chr6_97291320_97291471 | 0.71 |
Frmd4b |
FERM domain containing 4B |
134 |
0.97 |
chr13_31340004_31340178 | 0.71 |
Gm11373 |
predicted gene 11373 |
9324 |
0.16 |
chr9_76552994_76553228 | 0.70 |
Fam83b |
family with sequence similarity 83, member B |
7307 |
0.27 |
chr15_98734151_98734335 | 0.70 |
Fkbp11 |
FK506 binding protein 11 |
6045 |
0.1 |
chr13_44409176_44409378 | 0.70 |
Gm33958 |
predicted gene, 33958 |
18160 |
0.15 |
chr13_50780420_50780571 | 0.70 |
Gm2654 |
predicted gene 2654 |
5649 |
0.21 |
chr4_72945838_72945998 | 0.70 |
Gm25653 |
predicted gene, 25653 |
39580 |
0.16 |
chr2_6780614_6780803 | 0.70 |
Celf2 |
CUGBP, Elav-like family member 2 |
58492 |
0.14 |
chr8_46902999_46903150 | 0.70 |
1700011L03Rik |
RIKEN cDNA 1700011L03 gene |
45725 |
0.12 |
chr17_57224886_57225407 | 0.69 |
C3 |
complement component 3 |
2319 |
0.17 |
chr12_57650772_57650931 | 0.69 |
Ttc6 |
tetratricopeptide repeat domain 6 |
1436 |
0.35 |
chr14_76800394_76800719 | 0.69 |
Gm30246 |
predicted gene, 30246 |
19729 |
0.17 |
chr9_106242173_106242324 | 0.68 |
Alas1 |
aminolevulinic acid synthase 1 |
1386 |
0.26 |
chr18_33435778_33435929 | 0.68 |
Nrep |
neuronal regeneration related protein |
27582 |
0.18 |
chr8_11777355_11777551 | 0.68 |
Arhgef7 |
Rho guanine nucleotide exchange factor (GEF7) |
5074 |
0.15 |
chr6_141853734_141854027 | 0.68 |
Slco1a4 |
solute carrier organic anion transporter family, member 1a4 |
198 |
0.95 |
chr2_58785851_58786309 | 0.68 |
Upp2 |
uridine phosphorylase 2 |
20755 |
0.19 |
chr7_131449527_131449705 | 0.68 |
Gm18600 |
predicted gene, 18600 |
7396 |
0.1 |
chr14_98816721_98816872 | 0.67 |
Gm27034 |
predicted gene, 27034 |
101983 |
0.06 |
chr16_43234125_43234650 | 0.67 |
Zbtb20 |
zinc finger and BTB domain containing 20 |
1493 |
0.45 |
chr12_37050724_37050882 | 0.67 |
Gm48617 |
predicted gene, 48617 |
1586 |
0.37 |
chr12_73355030_73355336 | 0.66 |
Gm48653 |
predicted gene, 48653 |
102 |
0.96 |
chr6_149344317_149344633 | 0.65 |
Gm15782 |
predicted gene 15782 |
9351 |
0.14 |
chr10_89467439_89467590 | 0.65 |
Gas2l3 |
growth arrest-specific 2 like 3 |
23547 |
0.19 |
chr12_16536781_16536932 | 0.65 |
Lpin1 |
lipin 1 |
25182 |
0.22 |
chr6_42360337_42360550 | 0.65 |
Zyx |
zyxin |
5306 |
0.09 |
chr8_66494561_66494830 | 0.65 |
Gm32568 |
predicted gene, 32568 |
364 |
0.85 |
chr6_91729163_91729481 | 0.64 |
Slc6a6 |
solute carrier family 6 (neurotransmitter transporter, taurine), member 6 |
4363 |
0.16 |
chr10_38136267_38136418 | 0.64 |
Gm31378 |
predicted gene, 31378 |
14281 |
0.19 |
chr4_139631622_139632150 | 0.64 |
Aldh4a1 |
aldehyde dehydrogenase 4 family, member A1 |
8777 |
0.14 |
chr19_26709232_26709383 | 0.64 |
Smarca2 |
SWI/SNF related, matrix associated, actin dependent regulator of chromatin, subfamily a, member 2 |
1241 |
0.55 |
chr11_16829553_16829792 | 0.64 |
Egfros |
epidermal growth factor receptor, opposite strand |
1030 |
0.59 |
chr16_23173764_23173915 | 0.63 |
B630019A10Rik |
RIKEN cDNA B630019A10 gene |
1441 |
0.21 |
chr8_84650202_84650366 | 0.63 |
Cacna1a |
calcium channel, voltage-dependent, P/Q type, alpha 1A subunit |
11293 |
0.1 |
chr3_129551702_129551883 | 0.63 |
Elovl6 |
ELOVL family member 6, elongation of long chain fatty acids (yeast) |
588 |
0.72 |
chr2_85351619_85351794 | 0.63 |
Olfr988 |
olfactory receptor 988 |
2294 |
0.18 |
chrX_109505622_109505789 | 0.63 |
Gm4784 |
predicted gene 4784 |
113540 |
0.07 |
chr7_14428724_14428875 | 0.63 |
Sult2a8 |
sulfotransferase family 2A, dehydroepiandrosterone (DHEA)-preferring, member 8 |
7648 |
0.17 |
chr18_75493574_75493749 | 0.63 |
Gm10532 |
predicted gene 10532 |
20984 |
0.24 |
chr8_70026061_70026212 | 0.63 |
Mau2 |
MAU2 sister chromatid cohesion factor |
8378 |
0.11 |
chr6_38845278_38845447 | 0.62 |
Hipk2 |
homeodomain interacting protein kinase 2 |
8051 |
0.22 |
chr4_123912549_123912724 | 0.62 |
Gm12905 |
predicted gene 12905 |
4633 |
0.11 |
chr13_115090695_115090877 | 0.62 |
Pelo |
pelota mRNA surveillance and ribosome rescue factor |
600 |
0.58 |
chr8_93107832_93108041 | 0.62 |
Ces1c |
carboxylesterase 1C |
16593 |
0.14 |
chr9_107669610_107669906 | 0.62 |
Slc38a3 |
solute carrier family 38, member 3 |
228 |
0.83 |
chr11_16848480_16848912 | 0.61 |
Egfros |
epidermal growth factor receptor, opposite strand |
17994 |
0.19 |
chr7_115671356_115671633 | 0.61 |
Sox6 |
SRY (sex determining region Y)-box 6 |
9129 |
0.32 |
chr2_52579266_52579417 | 0.61 |
Cacnb4 |
calcium channel, voltage-dependent, beta 4 subunit |
20774 |
0.18 |
chr18_8864151_8864321 | 0.61 |
Gm37148 |
predicted gene, 37148 |
63999 |
0.13 |
chr17_56780401_56780582 | 0.61 |
Rfx2 |
regulatory factor X, 2 (influences HLA class II expression) |
3213 |
0.14 |
chr4_141866976_141867165 | 0.61 |
Efhd2 |
EF hand domain containing 2 |
7850 |
0.11 |
chr5_125521738_125521899 | 0.61 |
Aacs |
acetoacetyl-CoA synthetase |
6575 |
0.16 |
chr2_122256897_122257048 | 0.61 |
Sord |
sorbitol dehydrogenase |
22223 |
0.09 |
chrX_98829514_98829665 | 0.61 |
Gm26000 |
predicted gene, 26000 |
14814 |
0.23 |
chr7_101267873_101268135 | 0.61 |
Fchsd2 |
FCH and double SH3 domains 2 |
8335 |
0.13 |
chr13_114683342_114683501 | 0.60 |
4930544M13Rik |
RIKEN cDNA 4930544M13 gene |
76184 |
0.09 |
chr14_57107820_57108112 | 0.60 |
Gjb2 |
gap junction protein, beta 2 |
3264 |
0.19 |
chr5_102011072_102011265 | 0.60 |
Wdfy3 |
WD repeat and FYVE domain containing 3 |
29610 |
0.16 |
chr19_21626908_21627090 | 0.60 |
1110059E24Rik |
RIKEN cDNA 1110059E24 gene |
3769 |
0.26 |
chr11_16816418_16816569 | 0.60 |
Egfros |
epidermal growth factor receptor, opposite strand |
14209 |
0.21 |
chr9_49514430_49514581 | 0.60 |
Gm11149 |
predicted gene 11149 |
3783 |
0.24 |
chr8_124182398_124182549 | 0.60 |
Gm3889 |
predicted gene 3889 |
22400 |
0.16 |
chr7_26106322_26106473 | 0.59 |
Gm29920 |
predicted gene, 29920 |
6081 |
0.15 |
chr1_21245041_21245248 | 0.59 |
Gsta3 |
glutathione S-transferase, alpha 3 |
4515 |
0.13 |
chr9_15525292_15525443 | 0.59 |
Smco4 |
single-pass membrane protein with coiled-coil domains 4 |
4508 |
0.2 |
chr15_58993520_58993677 | 0.59 |
4930544F09Rik |
RIKEN cDNA 4930544F09 gene |
9462 |
0.17 |
chr8_75350325_75350476 | 0.59 |
Umpk-ps |
uridine monophosphate kinase, pseudogene |
33402 |
0.12 |
chr4_22264008_22264159 | 0.59 |
Gm11882 |
predicted gene 11882 |
11750 |
0.25 |
chr12_32854938_32855089 | 0.59 |
Gm47948 |
predicted gene, 47948 |
23292 |
0.15 |
chr3_146604513_146604664 | 0.59 |
Uox |
urate oxidase |
5397 |
0.14 |
chr15_11011466_11011655 | 0.59 |
Slc45a2 |
solute carrier family 45, member 2 |
10839 |
0.16 |
chr11_90230795_90230946 | 0.58 |
Mmd |
monocyte to macrophage differentiation-associated |
18586 |
0.17 |
chr6_108256081_108256271 | 0.58 |
Itpr1 |
inositol 1,4,5-trisphosphate receptor 1 |
3218 |
0.33 |
chr16_81391768_81391919 | 0.58 |
Ncam2 |
neural cell adhesion molecule 2 |
73780 |
0.12 |
chr3_142439924_142440082 | 0.57 |
Pdlim5 |
PDZ and LIM domain 5 |
44307 |
0.13 |
chr3_138455131_138455312 | 0.57 |
Adh5 |
alcohol dehydrogenase 5 (class III), chi polypeptide |
816 |
0.51 |
chr12_32684197_32684365 | 0.57 |
Gm47937 |
predicted gene, 47937 |
10987 |
0.22 |
chr3_51251752_51251903 | 0.57 |
Elf2 |
E74-like factor 2 |
8414 |
0.13 |
chr14_105803498_105803761 | 0.57 |
Gm22406 |
predicted gene, 22406 |
13279 |
0.23 |
chr3_151880053_151880221 | 0.57 |
Gm43617 |
predicted gene 43617 |
7166 |
0.17 |
chr9_44709221_44709515 | 0.57 |
Phldb1 |
pleckstrin homology like domain, family B, member 1 |
941 |
0.33 |
chr15_97773204_97773381 | 0.57 |
Slc48a1 |
solute carrier family 48 (heme transporter), member 1 |
5228 |
0.13 |
chrX_51051695_51052016 | 0.57 |
Gm5387 |
predicted gene 5387 |
7892 |
0.22 |
chr8_114148783_114148961 | 0.57 |
Nudt7 |
nudix (nucleoside diphosphate linked moiety X)-type motif 7 |
15230 |
0.26 |
chr4_102511795_102511975 | 0.57 |
Pde4b |
phosphodiesterase 4B, cAMP specific |
41488 |
0.21 |
chr5_43309969_43310310 | 0.57 |
6030400A10Rik |
RIKEN cDNA 6030400A10 gene |
44982 |
0.11 |
chr6_71966855_71967024 | 0.57 |
Gm26628 |
predicted gene, 26628 |
3164 |
0.17 |
chr12_33193658_33193809 | 0.56 |
Atxn7l1os1 |
ataxin 7-like 1, opposite strand 1 |
35121 |
0.13 |
chr13_101683255_101683457 | 0.56 |
Pik3r1 |
phosphoinositide-3-kinase regulatory subunit 1 |
8987 |
0.23 |
chr19_40165502_40165757 | 0.56 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
21657 |
0.14 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.6 | 1.9 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
0.3 | 1.0 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
0.3 | 1.3 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.2 | 0.7 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
0.2 | 0.7 | GO:0006868 | glutamine transport(GO:0006868) |
0.2 | 1.2 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
0.2 | 0.5 | GO:1903371 | regulation of endoplasmic reticulum tubular network organization(GO:1903371) |
0.2 | 0.5 | GO:0006068 | ethanol catabolic process(GO:0006068) |
0.2 | 0.5 | GO:2000259 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
0.2 | 0.7 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
0.2 | 0.7 | GO:0072338 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
0.2 | 0.6 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
0.2 | 1.1 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
0.2 | 0.3 | GO:1902263 | apoptotic process involved in embryonic digit morphogenesis(GO:1902263) |
0.1 | 0.6 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
0.1 | 0.4 | GO:0060523 | prostate epithelial cord elongation(GO:0060523) |
0.1 | 0.7 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
0.1 | 0.4 | GO:0034395 | regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
0.1 | 0.1 | GO:0070672 | response to interleukin-15(GO:0070672) |
0.1 | 0.4 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
0.1 | 0.5 | GO:0021590 | cerebellum maturation(GO:0021590) |
0.1 | 0.4 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.1 | 0.3 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
0.1 | 0.5 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
0.1 | 0.4 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
0.1 | 0.2 | GO:0045608 | negative regulation of auditory receptor cell differentiation(GO:0045608) |
0.1 | 0.4 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
0.1 | 0.2 | GO:1905065 | positive regulation of vascular smooth muscle cell differentiation(GO:1905065) |
0.1 | 0.4 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
0.1 | 0.3 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
0.1 | 0.2 | GO:0007228 | positive regulation of hh target transcription factor activity(GO:0007228) |
0.1 | 0.4 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
0.1 | 0.3 | GO:0009730 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
0.1 | 0.3 | GO:0034454 | microtubule anchoring at centrosome(GO:0034454) |
0.1 | 0.3 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
0.1 | 0.3 | GO:1900222 | negative regulation of beta-amyloid clearance(GO:1900222) |
0.1 | 0.7 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.1 | 0.3 | GO:1902896 | terminal web assembly(GO:1902896) |
0.1 | 0.4 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
0.1 | 0.1 | GO:0097252 | oligodendrocyte apoptotic process(GO:0097252) |
0.1 | 0.2 | GO:2000670 | positive regulation of dendritic cell apoptotic process(GO:2000670) |
0.1 | 0.4 | GO:0010626 | negative regulation of Schwann cell proliferation(GO:0010626) |
0.1 | 0.2 | GO:1902956 | regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902956) |
0.1 | 0.3 | GO:1903964 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.1 | 0.2 | GO:0006059 | hexitol metabolic process(GO:0006059) |
0.1 | 0.2 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.1 | 0.2 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
0.1 | 0.2 | GO:1904017 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
0.1 | 0.2 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
0.1 | 0.1 | GO:0060336 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
0.1 | 0.3 | GO:1904261 | regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904259) positive regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904261) basement membrane assembly involved in embryonic body morphogenesis(GO:2001197) |
0.1 | 0.5 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
0.1 | 0.5 | GO:0019367 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
0.1 | 0.2 | GO:0061144 | alveolar secondary septum development(GO:0061144) |
0.1 | 0.1 | GO:0045764 | positive regulation of cellular amino acid metabolic process(GO:0045764) |
0.1 | 0.3 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
0.1 | 0.2 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
0.1 | 0.2 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
0.1 | 0.5 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
0.1 | 0.3 | GO:0071286 | cellular response to magnesium ion(GO:0071286) |
0.1 | 0.2 | GO:0060620 | regulation of cholesterol import(GO:0060620) regulation of sterol import(GO:2000909) |
0.1 | 0.1 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
0.1 | 0.2 | GO:0071879 | positive regulation of adrenergic receptor signaling pathway(GO:0071879) |
0.1 | 0.1 | GO:0010963 | regulation of L-arginine import(GO:0010963) |
0.1 | 0.1 | GO:0003347 | epicardial cell to mesenchymal cell transition(GO:0003347) |
0.1 | 0.3 | GO:1903242 | regulation of cardiac muscle adaptation(GO:0010612) regulation of cardiac muscle hypertrophy in response to stress(GO:1903242) |
0.1 | 0.1 | GO:0043380 | regulation of memory T cell differentiation(GO:0043380) |
0.1 | 0.1 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
0.1 | 0.2 | GO:0044778 | meiotic DNA integrity checkpoint(GO:0044778) |
0.1 | 0.2 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
0.1 | 0.2 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
0.1 | 0.1 | GO:0071883 | activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) |
0.1 | 0.3 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
0.1 | 0.2 | GO:0038171 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
0.1 | 0.2 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
0.1 | 0.1 | GO:0071394 | cellular response to testosterone stimulus(GO:0071394) |
0.1 | 0.3 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
0.1 | 1.6 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
0.1 | 0.3 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
0.1 | 0.3 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
0.1 | 0.1 | GO:0052151 | induction of programmed cell death(GO:0012502) positive regulation of apoptotic process in other organism(GO:0044533) positive regulation by symbiont of host programmed cell death(GO:0052042) positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052330) positive regulation by organism of apoptotic process in other organism involved in symbiotic interaction(GO:0052501) positive regulation of apoptotic process by virus(GO:0060139) |
0.1 | 0.5 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
0.1 | 0.2 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
0.1 | 0.2 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
0.1 | 0.2 | GO:0032819 | positive regulation of natural killer cell proliferation(GO:0032819) |
0.1 | 0.2 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
0.1 | 0.2 | GO:0032430 | positive regulation of phospholipase A2 activity(GO:0032430) |
0.1 | 0.2 | GO:0044597 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.1 | 0.1 | GO:0060397 | JAK-STAT cascade involved in growth hormone signaling pathway(GO:0060397) |
0.1 | 0.1 | GO:0006046 | N-acetylglucosamine catabolic process(GO:0006046) |
0.1 | 0.3 | GO:0048669 | collateral sprouting in absence of injury(GO:0048669) |
0.1 | 0.3 | GO:0070327 | thyroid hormone transport(GO:0070327) |
0.1 | 0.2 | GO:1901492 | positive regulation of lymphangiogenesis(GO:1901492) |
0.1 | 0.1 | GO:0014732 | skeletal muscle atrophy(GO:0014732) |
0.1 | 0.3 | GO:0046512 | diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
0.1 | 0.3 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
0.1 | 0.2 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
0.1 | 0.3 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.1 | 0.2 | GO:0090230 | regulation of centromere complex assembly(GO:0090230) |
0.0 | 0.5 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.0 | 0.1 | GO:0071276 | cellular response to cadmium ion(GO:0071276) |
0.0 | 0.3 | GO:0045908 | negative regulation of vasodilation(GO:0045908) |
0.0 | 0.1 | GO:0072361 | regulation of glycolytic process by regulation of transcription from RNA polymerase II promoter(GO:0072361) |
0.0 | 0.3 | GO:1900746 | regulation of vascular endothelial growth factor signaling pathway(GO:1900746) |
0.0 | 0.0 | GO:0006714 | sesquiterpenoid metabolic process(GO:0006714) |
0.0 | 0.3 | GO:0046543 | development of secondary female sexual characteristics(GO:0046543) |
0.0 | 0.3 | GO:0002576 | platelet degranulation(GO:0002576) |
0.0 | 0.1 | GO:0070858 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
0.0 | 1.3 | GO:0008206 | bile acid metabolic process(GO:0008206) |
0.0 | 0.5 | GO:0032365 | intracellular lipid transport(GO:0032365) |
0.0 | 0.1 | GO:0021564 | vagus nerve development(GO:0021564) |
0.0 | 0.2 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
0.0 | 0.2 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
0.0 | 0.1 | GO:0032439 | endosome localization(GO:0032439) |
0.0 | 0.1 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
0.0 | 0.1 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
0.0 | 0.2 | GO:0035356 | cellular triglyceride homeostasis(GO:0035356) |
0.0 | 0.1 | GO:2001180 | negative regulation of interleukin-10 secretion(GO:2001180) |
0.0 | 0.8 | GO:0014850 | response to muscle activity(GO:0014850) |
0.0 | 0.1 | GO:0003289 | atrial septum primum morphogenesis(GO:0003289) |
0.0 | 0.1 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
0.0 | 0.3 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
0.0 | 0.1 | GO:0000087 | mitotic M phase(GO:0000087) |
0.0 | 0.7 | GO:1901186 | positive regulation of epidermal growth factor receptor signaling pathway(GO:0045742) positive regulation of ERBB signaling pathway(GO:1901186) |
0.0 | 0.1 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.0 | 0.2 | GO:0032532 | regulation of microvillus length(GO:0032532) |
0.0 | 0.3 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
0.0 | 0.2 | GO:0001880 | Mullerian duct regression(GO:0001880) |
0.0 | 0.0 | GO:0044004 | killing by symbiont of host cells(GO:0001907) disruption by symbiont of host cell(GO:0044004) |
0.0 | 0.1 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
0.0 | 0.5 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
0.0 | 0.1 | GO:0060154 | cellular process regulating host cell cycle in response to virus(GO:0060154) |
0.0 | 0.1 | GO:0060375 | regulation of mast cell differentiation(GO:0060375) |
0.0 | 0.9 | GO:0090162 | establishment of epithelial cell polarity(GO:0090162) |
0.0 | 0.1 | GO:0001927 | exocyst assembly(GO:0001927) |
0.0 | 0.2 | GO:0019087 | transformation of host cell by virus(GO:0019087) |
0.0 | 0.2 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.0 | 0.3 | GO:0034551 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
0.0 | 0.1 | GO:2000809 | positive regulation of synaptic vesicle clustering(GO:2000809) |
0.0 | 0.5 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
0.0 | 0.1 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
0.0 | 0.1 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) |
0.0 | 0.1 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.0 | 0.2 | GO:0060020 | Bergmann glial cell differentiation(GO:0060020) |
0.0 | 0.0 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
0.0 | 0.1 | GO:0061184 | positive regulation of dermatome development(GO:0061184) |
0.0 | 0.1 | GO:0061366 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
0.0 | 0.1 | GO:0008355 | olfactory learning(GO:0008355) |
0.0 | 0.1 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
0.0 | 0.0 | GO:0002019 | regulation of renal output by angiotensin(GO:0002019) |
0.0 | 0.2 | GO:1902031 | regulation of NADP metabolic process(GO:1902031) |
0.0 | 0.2 | GO:2000794 | positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) regulation of epithelial cell proliferation involved in lung morphogenesis(GO:2000794) |
0.0 | 0.1 | GO:2001171 | positive regulation of ATP biosynthetic process(GO:2001171) |
0.0 | 0.2 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
0.0 | 0.1 | GO:0040031 | snRNA modification(GO:0040031) |
0.0 | 0.4 | GO:0046855 | inositol phosphate dephosphorylation(GO:0046855) |
0.0 | 0.1 | GO:0051031 | tRNA transport(GO:0051031) |
0.0 | 0.1 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
0.0 | 0.1 | GO:0061624 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
0.0 | 0.1 | GO:0035973 | aggrephagy(GO:0035973) |
0.0 | 0.4 | GO:0015727 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
0.0 | 0.1 | GO:0030421 | defecation(GO:0030421) |
0.0 | 0.3 | GO:0019227 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
0.0 | 0.1 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
0.0 | 0.2 | GO:0032596 | protein transport into membrane raft(GO:0032596) |
0.0 | 0.1 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
0.0 | 0.2 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
0.0 | 0.1 | GO:0032058 | positive regulation of translational initiation in response to stress(GO:0032058) |
0.0 | 0.1 | GO:1903423 | positive regulation of synaptic vesicle recycling(GO:1903423) |
0.0 | 0.0 | GO:2000619 | negative regulation of histone H4-K16 acetylation(GO:2000619) |
0.0 | 0.0 | GO:0003162 | atrioventricular node development(GO:0003162) |
0.0 | 0.1 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
0.0 | 0.3 | GO:0006983 | ER overload response(GO:0006983) |
0.0 | 0.1 | GO:1905005 | regulation of epithelial to mesenchymal transition involved in endocardial cushion formation(GO:1905005) |
0.0 | 0.1 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
0.0 | 0.1 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
0.0 | 0.0 | GO:0010536 | positive regulation of activation of Janus kinase activity(GO:0010536) |
0.0 | 0.1 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
0.0 | 0.0 | GO:0010958 | regulation of amino acid import(GO:0010958) |
0.0 | 0.1 | GO:0071494 | cellular response to UV-C(GO:0071494) |
0.0 | 0.1 | GO:0033121 | regulation of purine nucleotide catabolic process(GO:0033121) |
0.0 | 0.1 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
0.0 | 0.1 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.0 | 0.1 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
0.0 | 0.2 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
0.0 | 0.1 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
0.0 | 0.1 | GO:0097240 | meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
0.0 | 0.1 | GO:0072307 | metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
0.0 | 0.1 | GO:0034086 | maintenance of sister chromatid cohesion(GO:0034086) maintenance of mitotic sister chromatid cohesion(GO:0034088) |
0.0 | 0.1 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
0.0 | 0.1 | GO:0060623 | regulation of chromosome condensation(GO:0060623) |
0.0 | 0.1 | GO:0070537 | histone H2A K63-linked deubiquitination(GO:0070537) |
0.0 | 0.1 | GO:0048254 | snoRNA localization(GO:0048254) |
0.0 | 0.1 | GO:0071798 | response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
0.0 | 0.1 | GO:0010748 | negative regulation of plasma membrane long-chain fatty acid transport(GO:0010748) |
0.0 | 0.2 | GO:0007614 | short-term memory(GO:0007614) |
0.0 | 0.1 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
0.0 | 0.1 | GO:0060023 | soft palate development(GO:0060023) |
0.0 | 0.1 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
0.0 | 0.1 | GO:0042977 | activation of JAK2 kinase activity(GO:0042977) |
0.0 | 0.1 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.0 | 0.1 | GO:0036072 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
0.0 | 0.0 | GO:2001181 | positive regulation of interleukin-10 secretion(GO:2001181) |
0.0 | 0.0 | GO:0061325 | cell proliferation involved in outflow tract morphogenesis(GO:0061325) |
0.0 | 0.1 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
0.0 | 0.1 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
0.0 | 0.1 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
0.0 | 0.1 | GO:0071651 | positive regulation of chemokine (C-C motif) ligand 5 production(GO:0071651) |
0.0 | 0.1 | GO:0002540 | leukotriene production involved in inflammatory response(GO:0002540) |
0.0 | 0.5 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
0.0 | 0.1 | GO:0015819 | lysine transport(GO:0015819) |
0.0 | 0.2 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
0.0 | 0.1 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
0.0 | 0.2 | GO:0032725 | positive regulation of granulocyte macrophage colony-stimulating factor production(GO:0032725) |
0.0 | 0.2 | GO:0006527 | arginine catabolic process(GO:0006527) |
0.0 | 0.1 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
0.0 | 0.1 | GO:0048208 | vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
0.0 | 0.1 | GO:0008078 | mesodermal cell migration(GO:0008078) |
0.0 | 0.0 | GO:0098763 | mitotic cell cycle phase(GO:0098763) |
0.0 | 0.1 | GO:0030916 | otic vesicle formation(GO:0030916) |
0.0 | 0.1 | GO:0021882 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) |
0.0 | 0.0 | GO:0021775 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
0.0 | 0.0 | GO:1901674 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
0.0 | 0.1 | GO:0002309 | T cell proliferation involved in immune response(GO:0002309) |
0.0 | 0.2 | GO:0000183 | chromatin silencing at rDNA(GO:0000183) |
0.0 | 0.0 | GO:0048597 | post-embryonic camera-type eye morphogenesis(GO:0048597) |
0.0 | 0.1 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.0 | 0.1 | GO:1904424 | regulation of GTP binding(GO:1904424) |
0.0 | 0.0 | GO:0032055 | negative regulation of translation in response to stress(GO:0032055) |
0.0 | 0.1 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
0.0 | 0.1 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
0.0 | 0.0 | GO:1901382 | chorionic trophoblast cell proliferation(GO:0097360) regulation of chorionic trophoblast cell proliferation(GO:1901382) |
0.0 | 0.1 | GO:0035814 | negative regulation of renal sodium excretion(GO:0035814) |
0.0 | 0.0 | GO:0002018 | renin-angiotensin regulation of aldosterone production(GO:0002018) |
0.0 | 0.1 | GO:0090140 | regulation of mitochondrial fission(GO:0090140) |
0.0 | 0.1 | GO:0006561 | proline biosynthetic process(GO:0006561) |
0.0 | 0.1 | GO:0033567 | DNA replication, Okazaki fragment processing(GO:0033567) |
0.0 | 0.2 | GO:0071361 | cellular response to ethanol(GO:0071361) |
0.0 | 0.3 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
0.0 | 0.1 | GO:0080009 | mRNA methylation(GO:0080009) |
0.0 | 0.1 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
0.0 | 0.2 | GO:0045176 | apical protein localization(GO:0045176) |
0.0 | 0.1 | GO:0097460 | ferrous iron import into cell(GO:0097460) |
0.0 | 0.0 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
0.0 | 0.2 | GO:0060033 | anatomical structure regression(GO:0060033) |
0.0 | 0.2 | GO:0010603 | regulation of cytoplasmic mRNA processing body assembly(GO:0010603) |
0.0 | 0.0 | GO:1903275 | positive regulation of sodium ion export(GO:1903275) positive regulation of sodium ion export from cell(GO:1903278) |
0.0 | 0.1 | GO:0036492 | regulation of translation in response to endoplasmic reticulum stress(GO:0036490) regulation of translation initiation in response to endoplasmic reticulum stress(GO:0036491) eiF2alpha phosphorylation in response to endoplasmic reticulum stress(GO:0036492) |
0.0 | 0.1 | GO:0060591 | chondroblast differentiation(GO:0060591) |
0.0 | 0.3 | GO:0007063 | regulation of sister chromatid cohesion(GO:0007063) |
0.0 | 0.0 | GO:0006549 | isoleucine metabolic process(GO:0006549) |
0.0 | 0.1 | GO:0021960 | anterior commissure morphogenesis(GO:0021960) |
0.0 | 0.1 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
0.0 | 0.1 | GO:0035811 | negative regulation of urine volume(GO:0035811) |
0.0 | 0.3 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
0.0 | 0.0 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
0.0 | 0.0 | GO:0045869 | negative regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045869) |
0.0 | 0.0 | GO:0035799 | ureter maturation(GO:0035799) |
0.0 | 0.0 | GO:1902730 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
0.0 | 0.1 | GO:0002072 | optic cup morphogenesis involved in camera-type eye development(GO:0002072) |
0.0 | 0.1 | GO:0009438 | methylglyoxal metabolic process(GO:0009438) |
0.0 | 0.1 | GO:0044090 | positive regulation of vacuole organization(GO:0044090) |
0.0 | 0.1 | GO:0002525 | acute inflammatory response to non-antigenic stimulus(GO:0002525) |
0.0 | 0.1 | GO:0048681 | negative regulation of axon regeneration(GO:0048681) |
0.0 | 0.0 | GO:0000189 | MAPK import into nucleus(GO:0000189) |
0.0 | 0.1 | GO:0070175 | positive regulation of enamel mineralization(GO:0070175) |
0.0 | 0.1 | GO:0098903 | regulation of membrane repolarization during action potential(GO:0098903) |
0.0 | 0.2 | GO:0000103 | sulfate assimilation(GO:0000103) |
0.0 | 0.0 | GO:0006901 | vesicle coating(GO:0006901) |
0.0 | 0.2 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.0 | 0.0 | GO:0072223 | metanephric glomerular mesangium development(GO:0072223) metanephric glomerular mesangial cell proliferation involved in metanephros development(GO:0072262) |
0.0 | 0.1 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
0.0 | 0.0 | GO:1902548 | negative regulation of cellular response to vascular endothelial growth factor stimulus(GO:1902548) |
0.0 | 0.1 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.0 | 0.0 | GO:0071649 | regulation of chemokine (C-C motif) ligand 5 production(GO:0071649) |
0.0 | 0.0 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
0.0 | 0.2 | GO:0097320 | membrane tubulation(GO:0097320) |
0.0 | 0.0 | GO:0038108 | negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) |
0.0 | 0.1 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
0.0 | 0.2 | GO:0033962 | cytoplasmic mRNA processing body assembly(GO:0033962) |
0.0 | 0.1 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.0 | 0.0 | GO:0003263 | cardioblast proliferation(GO:0003263) regulation of cardioblast proliferation(GO:0003264) regulation of secondary heart field cardioblast proliferation(GO:0003266) |
0.0 | 0.0 | GO:0043301 | negative regulation of leukocyte degranulation(GO:0043301) |
0.0 | 0.1 | GO:0061032 | visceral serous pericardium development(GO:0061032) |
0.0 | 0.1 | GO:1904378 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
0.0 | 0.1 | GO:0030917 | midbrain-hindbrain boundary development(GO:0030917) |
0.0 | 0.0 | GO:0006808 | regulation of nitrogen utilization(GO:0006808) |
0.0 | 0.1 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
0.0 | 0.1 | GO:0045404 | positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
0.0 | 0.0 | GO:0090148 | membrane fission(GO:0090148) |
0.0 | 0.0 | GO:0045722 | positive regulation of gluconeogenesis(GO:0045722) |
0.0 | 0.1 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
0.0 | 0.1 | GO:0046477 | glycosylceramide catabolic process(GO:0046477) |
0.0 | 0.1 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) negative regulation of actin nucleation(GO:0051126) |
0.0 | 0.0 | GO:0048682 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
0.0 | 0.1 | GO:0031443 | fast-twitch skeletal muscle fiber contraction(GO:0031443) |
0.0 | 0.1 | GO:0006048 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
0.0 | 0.1 | GO:0044351 | macropinocytosis(GO:0044351) |
0.0 | 0.0 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
0.0 | 0.0 | GO:1905214 | regulation of mRNA binding(GO:1902415) regulation of RNA binding(GO:1905214) |
0.0 | 0.1 | GO:0021684 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
0.0 | 0.0 | GO:0060435 | bronchiole development(GO:0060435) |
0.0 | 0.1 | GO:0071670 | smooth muscle cell chemotaxis(GO:0071670) |
0.0 | 0.1 | GO:0048619 | embryonic hindgut morphogenesis(GO:0048619) |
0.0 | 0.0 | GO:0051342 | regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051342) |
0.0 | 0.1 | GO:0060665 | regulation of branching involved in salivary gland morphogenesis by mesenchymal-epithelial signaling(GO:0060665) |
0.0 | 0.1 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
0.0 | 0.1 | GO:0060856 | establishment of blood-brain barrier(GO:0060856) |
0.0 | 0.0 | GO:0060437 | lung growth(GO:0060437) |
0.0 | 0.2 | GO:0047497 | establishment of mitochondrion localization, microtubule-mediated(GO:0034643) mitochondrion transport along microtubule(GO:0047497) |
0.0 | 0.1 | GO:0016264 | gap junction assembly(GO:0016264) |
0.0 | 0.1 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.0 | 0.1 | GO:0010832 | negative regulation of myotube differentiation(GO:0010832) |
0.0 | 0.1 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
0.0 | 0.1 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.0 | 0.1 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.0 | 0.1 | GO:0002434 | immune complex clearance(GO:0002434) |
0.0 | 0.0 | GO:0021603 | cranial nerve formation(GO:0021603) |
0.0 | 0.3 | GO:0003298 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
0.0 | 0.0 | GO:2000665 | interleukin-5 secretion(GO:0072603) interleukin-13 secretion(GO:0072611) regulation of interleukin-5 secretion(GO:2000662) regulation of interleukin-13 secretion(GO:2000665) |
0.0 | 0.0 | GO:0071351 | cellular response to interleukin-18(GO:0071351) |
0.0 | 0.1 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
0.0 | 0.0 | GO:0038109 | response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
0.0 | 0.1 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
0.0 | 0.1 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
0.0 | 0.1 | GO:0018095 | protein polyglutamylation(GO:0018095) |
0.0 | 0.0 | GO:0000255 | allantoin metabolic process(GO:0000255) |
0.0 | 0.1 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
0.0 | 0.0 | GO:0051890 | regulation of cardioblast differentiation(GO:0051890) |
0.0 | 0.2 | GO:0001675 | acrosome assembly(GO:0001675) |
0.0 | 0.0 | GO:0002468 | dendritic cell antigen processing and presentation(GO:0002468) regulation of dendritic cell antigen processing and presentation(GO:0002604) positive regulation of dendritic cell antigen processing and presentation(GO:0002606) |
0.0 | 0.1 | GO:0090141 | positive regulation of mitochondrial fission(GO:0090141) |
0.0 | 0.0 | GO:0097167 | circadian regulation of translation(GO:0097167) |
0.0 | 0.1 | GO:0071305 | cellular response to vitamin D(GO:0071305) |
0.0 | 0.0 | GO:0070571 | negative regulation of neuron projection regeneration(GO:0070571) |
0.0 | 0.1 | GO:1902004 | positive regulation of beta-amyloid formation(GO:1902004) positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
0.0 | 0.1 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
0.0 | 0.1 | GO:0040016 | embryonic cleavage(GO:0040016) |
0.0 | 0.0 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
0.0 | 0.0 | GO:0002154 | thyroid hormone mediated signaling pathway(GO:0002154) |
0.0 | 0.4 | GO:0031529 | ruffle organization(GO:0031529) |
0.0 | 0.0 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
0.0 | 0.5 | GO:0000381 | regulation of alternative mRNA splicing, via spliceosome(GO:0000381) |
0.0 | 0.1 | GO:0010040 | response to iron(II) ion(GO:0010040) |
0.0 | 0.0 | GO:0043553 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
0.0 | 0.1 | GO:0072364 | regulation of cellular ketone metabolic process by regulation of transcription from RNA polymerase II promoter(GO:0072364) |
0.0 | 0.1 | GO:0048251 | elastic fiber assembly(GO:0048251) |
0.0 | 0.3 | GO:0006308 | DNA catabolic process(GO:0006308) |
0.0 | 0.0 | GO:2000338 | chemokine (C-X-C motif) ligand 1 production(GO:0072566) regulation of chemokine (C-X-C motif) ligand 1 production(GO:2000338) |
0.0 | 0.0 | GO:0003273 | cell migration involved in endocardial cushion formation(GO:0003273) |
0.0 | 0.0 | GO:1904970 | brush border assembly(GO:1904970) |
0.0 | 0.0 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
0.0 | 0.1 | GO:0030578 | PML body organization(GO:0030578) |
0.0 | 0.0 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
0.0 | 0.0 | GO:0006768 | biotin metabolic process(GO:0006768) |
0.0 | 0.0 | GO:0090027 | negative regulation of monocyte chemotaxis(GO:0090027) |
0.0 | 0.2 | GO:0045060 | negative thymic T cell selection(GO:0045060) |
0.0 | 0.1 | GO:0048539 | bone marrow development(GO:0048539) |
0.0 | 0.0 | GO:0001555 | oocyte growth(GO:0001555) |
0.0 | 0.1 | GO:0052697 | xenobiotic glucuronidation(GO:0052697) |
0.0 | 0.0 | GO:0042376 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
0.0 | 0.3 | GO:0006883 | cellular sodium ion homeostasis(GO:0006883) |
0.0 | 0.0 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
0.0 | 0.1 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
0.0 | 0.1 | GO:0014053 | negative regulation of gamma-aminobutyric acid secretion(GO:0014053) |
0.0 | 0.0 | GO:0010746 | regulation of plasma membrane long-chain fatty acid transport(GO:0010746) |
0.0 | 0.0 | GO:0060155 | platelet dense granule organization(GO:0060155) |
0.0 | 0.2 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
0.0 | 0.0 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
0.0 | 0.0 | GO:0060126 | somatotropin secreting cell differentiation(GO:0060126) |
0.0 | 0.0 | GO:1900106 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
0.0 | 0.0 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
0.0 | 0.1 | GO:0006266 | DNA ligation(GO:0006266) |
0.0 | 0.0 | GO:0008050 | female courtship behavior(GO:0008050) |
0.0 | 0.0 | GO:0071609 | chemokine (C-C motif) ligand 5 production(GO:0071609) |
0.0 | 0.1 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
0.0 | 0.1 | GO:0035745 | T-helper 2 cell cytokine production(GO:0035745) |
0.0 | 0.1 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
0.0 | 0.0 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
0.0 | 0.0 | GO:2000510 | positive regulation of dendritic cell chemotaxis(GO:2000510) |
0.0 | 0.0 | GO:0072393 | microtubule anchoring at microtubule organizing center(GO:0072393) |
0.0 | 0.1 | GO:0035610 | protein side chain deglutamylation(GO:0035610) |
0.0 | 0.0 | GO:0046098 | guanine metabolic process(GO:0046098) |
0.0 | 0.1 | GO:0032328 | alanine transport(GO:0032328) |
0.0 | 0.1 | GO:0060161 | positive regulation of dopamine receptor signaling pathway(GO:0060161) |
0.0 | 0.1 | GO:0034351 | negative regulation of glial cell apoptotic process(GO:0034351) |
0.0 | 0.0 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
0.0 | 0.3 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
0.0 | 0.1 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.0 | 0.0 | GO:1901201 | regulation of extracellular matrix assembly(GO:1901201) |
0.0 | 0.0 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.0 | 0.1 | GO:0001973 | adenosine receptor signaling pathway(GO:0001973) |
0.0 | 0.0 | GO:0042256 | mature ribosome assembly(GO:0042256) |
0.0 | 0.0 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.0 | 0.0 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
0.0 | 0.2 | GO:0033119 | negative regulation of RNA splicing(GO:0033119) |
0.0 | 0.1 | GO:0043206 | extracellular fibril organization(GO:0043206) |
0.0 | 0.1 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
0.0 | 0.0 | GO:0010979 | regulation of vitamin D 24-hydroxylase activity(GO:0010979) positive regulation of vitamin D 24-hydroxylase activity(GO:0010980) |
0.0 | 0.0 | GO:0018343 | protein farnesylation(GO:0018343) |
0.0 | 0.0 | GO:0035865 | response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
0.0 | 0.0 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
0.0 | 0.1 | GO:0033689 | negative regulation of osteoblast proliferation(GO:0033689) |
0.0 | 0.2 | GO:0032012 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.0 | 0.0 | GO:0002159 | desmosome assembly(GO:0002159) |
0.0 | 0.0 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
0.0 | 0.5 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
0.0 | 0.1 | GO:0021785 | branchiomotor neuron axon guidance(GO:0021785) |
0.0 | 0.0 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
0.0 | 0.1 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.0 | 0.0 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
0.0 | 0.1 | GO:0070255 | regulation of mucus secretion(GO:0070255) |
0.0 | 0.1 | GO:0071918 | urea transmembrane transport(GO:0071918) |
0.0 | 0.1 | GO:0034453 | microtubule anchoring(GO:0034453) |
0.0 | 0.0 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
0.0 | 0.1 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
0.0 | 0.0 | GO:0006573 | valine metabolic process(GO:0006573) |
0.0 | 0.1 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.0 | 0.0 | GO:2000675 | negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
0.0 | 0.0 | GO:0070295 | renal water absorption(GO:0070295) |
0.0 | 0.3 | GO:0006446 | regulation of translational initiation(GO:0006446) |
0.0 | 0.0 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
0.0 | 0.1 | GO:0060037 | pharyngeal system development(GO:0060037) |
0.0 | 0.0 | GO:0048478 | replication fork protection(GO:0048478) |
0.0 | 0.2 | GO:0006471 | protein ADP-ribosylation(GO:0006471) |
0.0 | 0.1 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
0.0 | 0.0 | GO:0061196 | fungiform papilla development(GO:0061196) |
0.0 | 0.1 | GO:0055064 | chloride ion homeostasis(GO:0055064) |
0.0 | 0.1 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
0.0 | 0.1 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
0.0 | 0.1 | GO:0071157 | negative regulation of cell cycle arrest(GO:0071157) |
0.0 | 0.1 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
0.0 | 0.1 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.0 | 0.0 | GO:0002677 | negative regulation of chronic inflammatory response(GO:0002677) |
0.0 | 0.0 | GO:0046909 | intermembrane transport(GO:0046909) |
0.0 | 0.0 | GO:0032415 | regulation of sodium:proton antiporter activity(GO:0032415) |
0.0 | 0.0 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.0 | 0.2 | GO:0016486 | peptide hormone processing(GO:0016486) |
0.0 | 0.0 | GO:0014042 | positive regulation of neuron maturation(GO:0014042) |
0.0 | 0.0 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.0 | 0.0 | GO:0006670 | sphingosine metabolic process(GO:0006670) |
0.0 | 0.1 | GO:0097286 | iron ion import(GO:0097286) |
0.0 | 0.0 | GO:0002874 | chronic inflammatory response to antigenic stimulus(GO:0002439) regulation of chronic inflammatory response to antigenic stimulus(GO:0002874) |
0.0 | 0.0 | GO:0098787 | mRNA cleavage involved in mRNA processing(GO:0098787) pre-mRNA cleavage required for polyadenylation(GO:0098789) |
0.0 | 0.0 | GO:0031284 | positive regulation of guanylate cyclase activity(GO:0031284) |
0.0 | 0.0 | GO:1904469 | positive regulation of tumor necrosis factor secretion(GO:1904469) |
0.0 | 0.1 | GO:0035561 | regulation of chromatin binding(GO:0035561) |
0.0 | 0.1 | GO:0045213 | neurotransmitter receptor metabolic process(GO:0045213) |
0.0 | 0.0 | GO:0046950 | cellular ketone body metabolic process(GO:0046950) |
0.0 | 0.0 | GO:0050883 | musculoskeletal movement, spinal reflex action(GO:0050883) |
0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.0 | GO:0070831 | basement membrane assembly(GO:0070831) |
0.0 | 0.1 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
0.0 | 0.0 | GO:0014016 | neuroblast differentiation(GO:0014016) |
0.0 | 0.1 | GO:0050966 | detection of mechanical stimulus involved in sensory perception of pain(GO:0050966) |
0.0 | 0.0 | GO:0030202 | heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
0.0 | 0.1 | GO:0042754 | negative regulation of circadian rhythm(GO:0042754) |
0.0 | 0.0 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
0.0 | 0.0 | GO:2001169 | regulation of ATP biosynthetic process(GO:2001169) |
0.0 | 0.0 | GO:2000698 | positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) |
0.0 | 0.0 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.0 | 0.1 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
0.0 | 0.0 | GO:0010039 | response to iron ion(GO:0010039) |
0.0 | 0.2 | GO:0006783 | heme biosynthetic process(GO:0006783) |
0.0 | 0.2 | GO:0031648 | protein destabilization(GO:0031648) |
0.0 | 0.0 | GO:1904948 | midbrain dopaminergic neuron differentiation(GO:1904948) |
0.0 | 0.1 | GO:0019856 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
0.0 | 0.0 | GO:0002215 | defense response to nematode(GO:0002215) |
0.0 | 0.0 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
0.0 | 0.0 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
0.0 | 0.0 | GO:0043096 | purine nucleobase salvage(GO:0043096) |
0.0 | 0.0 | GO:0070989 | oxidative demethylation(GO:0070989) |
0.0 | 0.0 | GO:0061577 | calcium ion transmembrane transport via high voltage-gated calcium channel(GO:0061577) |
0.0 | 0.0 | GO:0010749 | regulation of nitric oxide mediated signal transduction(GO:0010749) |
0.0 | 0.0 | GO:0000101 | sulfur amino acid transport(GO:0000101) |
0.0 | 0.0 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.6 | 1.9 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.2 | 0.9 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.1 | 0.7 | GO:0031094 | platelet dense tubular network(GO:0031094) |
0.1 | 0.1 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
0.1 | 0.4 | GO:1990357 | terminal web(GO:1990357) |
0.1 | 0.4 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.1 | 0.3 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.1 | 1.0 | GO:0071564 | npBAF complex(GO:0071564) |
0.1 | 0.4 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.1 | 0.4 | GO:0097433 | dense body(GO:0097433) |
0.1 | 0.2 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
0.1 | 0.3 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.1 | 0.3 | GO:0036449 | microtubule minus-end(GO:0036449) |
0.1 | 0.2 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.1 | 0.2 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.1 | 0.2 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
0.1 | 0.4 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
0.1 | 0.3 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.1 | 1.1 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
0.1 | 0.3 | GO:0005915 | zonula adherens(GO:0005915) |
0.1 | 0.2 | GO:0044294 | dendritic growth cone(GO:0044294) |
0.1 | 0.2 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
0.1 | 0.3 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
0.1 | 0.3 | GO:0044292 | dendrite terminus(GO:0044292) |
0.1 | 0.2 | GO:0097441 | basilar dendrite(GO:0097441) |
0.1 | 0.4 | GO:0045180 | basal cortex(GO:0045180) |
0.1 | 0.8 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.0 | 0.1 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
0.0 | 0.5 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
0.0 | 0.2 | GO:0030478 | actin cap(GO:0030478) |
0.0 | 0.1 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
0.0 | 0.1 | GO:0048179 | activin receptor complex(GO:0048179) |
0.0 | 0.2 | GO:0071203 | WASH complex(GO:0071203) |
0.0 | 0.1 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
0.0 | 0.5 | GO:0030430 | host cell cytoplasm(GO:0030430) host cell cytoplasm part(GO:0033655) |
0.0 | 0.3 | GO:0097208 | alveolar lamellar body(GO:0097208) |
0.0 | 0.3 | GO:0000306 | extrinsic component of vacuolar membrane(GO:0000306) |
0.0 | 0.2 | GO:0071556 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) |
0.0 | 0.1 | GO:0061574 | ASAP complex(GO:0061574) |
0.0 | 0.1 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
0.0 | 0.2 | GO:0031983 | vesicle lumen(GO:0031983) |
0.0 | 0.1 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
0.0 | 0.1 | GO:0005827 | polar microtubule(GO:0005827) |
0.0 | 0.1 | GO:0005955 | calcineurin complex(GO:0005955) |
0.0 | 0.1 | GO:0031523 | Myb complex(GO:0031523) |
0.0 | 0.2 | GO:0001650 | fibrillar center(GO:0001650) |
0.0 | 0.1 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.0 | 0.1 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
0.0 | 0.3 | GO:0042405 | nuclear inclusion body(GO:0042405) |
0.0 | 0.2 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
0.0 | 0.5 | GO:0005614 | interstitial matrix(GO:0005614) |
0.0 | 0.1 | GO:0017133 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
0.0 | 0.1 | GO:0016514 | SWI/SNF complex(GO:0016514) |
0.0 | 0.1 | GO:0045293 | mRNA editing complex(GO:0045293) |
0.0 | 0.0 | GO:0000439 | core TFIIH complex(GO:0000439) |
0.0 | 0.1 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
0.0 | 0.1 | GO:0000322 | storage vacuole(GO:0000322) |
0.0 | 0.1 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
0.0 | 0.1 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.0 | 0.1 | GO:0033269 | internode region of axon(GO:0033269) |
0.0 | 0.1 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
0.0 | 0.2 | GO:0045179 | apical cortex(GO:0045179) |
0.0 | 0.1 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.0 | 0.2 | GO:0042587 | glycogen granule(GO:0042587) |
0.0 | 0.1 | GO:0097425 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
0.0 | 0.1 | GO:0070545 | PeBoW complex(GO:0070545) |
0.0 | 0.1 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.0 | 0.3 | GO:0031011 | Ino80 complex(GO:0031011) |
0.0 | 0.3 | GO:0043196 | varicosity(GO:0043196) |
0.0 | 0.1 | GO:0002142 | stereocilia ankle link complex(GO:0002142) |
0.0 | 0.0 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
0.0 | 0.1 | GO:0005726 | perichromatin fibrils(GO:0005726) |
0.0 | 0.1 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.0 | 0.1 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.0 | 0.1 | GO:0005845 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.0 | 0.2 | GO:0060091 | kinocilium(GO:0060091) |
0.0 | 0.1 | GO:0000788 | nuclear nucleosome(GO:0000788) |
0.0 | 0.2 | GO:0005675 | holo TFIIH complex(GO:0005675) |
0.0 | 0.6 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.0 | 0.1 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.0 | 0.1 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.0 | 0.4 | GO:0098644 | complex of collagen trimers(GO:0098644) |
0.0 | 0.0 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
0.0 | 0.1 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
0.0 | 0.1 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
0.0 | 0.1 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
0.0 | 0.1 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.0 | 0.1 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
0.0 | 1.2 | GO:0016605 | PML body(GO:0016605) |
0.0 | 0.0 | GO:0098827 | endoplasmic reticulum subcompartment(GO:0098827) |
0.0 | 0.1 | GO:0044299 | C-fiber(GO:0044299) |
0.0 | 0.1 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
0.0 | 0.2 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.0 | 0.1 | GO:0005579 | membrane attack complex(GO:0005579) |
0.0 | 0.1 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
0.0 | 0.0 | GO:0005608 | laminin-3 complex(GO:0005608) |
0.0 | 0.3 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.0 | 1.7 | GO:0001726 | ruffle(GO:0001726) |
0.0 | 0.1 | GO:0034448 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.0 | 0.1 | GO:0019908 | nuclear cyclin-dependent protein kinase holoenzyme complex(GO:0019908) |
0.0 | 0.1 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
0.0 | 0.1 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.0 | 0.6 | GO:0045271 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
0.0 | 0.0 | GO:0020016 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
0.0 | 0.1 | GO:0042824 | MHC class I peptide loading complex(GO:0042824) |
0.0 | 0.0 | GO:0097451 | glial limiting end-foot(GO:0097451) |
0.0 | 0.1 | GO:0042575 | DNA polymerase complex(GO:0042575) |
0.0 | 0.3 | GO:0005922 | connexon complex(GO:0005922) |
0.0 | 0.1 | GO:0031415 | NatA complex(GO:0031415) |
0.0 | 0.1 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
0.0 | 0.2 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
0.0 | 0.0 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
0.0 | 0.1 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
0.0 | 0.1 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
0.0 | 0.0 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
0.0 | 0.1 | GO:0044666 | MLL3/4 complex(GO:0044666) |
0.0 | 0.2 | GO:0090665 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
0.0 | 0.0 | GO:0035061 | interchromatin granule(GO:0035061) |
0.0 | 0.1 | GO:0097431 | mitotic spindle pole(GO:0097431) |
0.0 | 0.0 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
0.0 | 0.0 | GO:0043293 | apoptosome(GO:0043293) |
0.0 | 0.3 | GO:0031941 | filamentous actin(GO:0031941) |
0.0 | 0.2 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.0 | 0.1 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
0.0 | 0.0 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.0 | 0.1 | GO:0031932 | TORC2 complex(GO:0031932) |
0.0 | 0.2 | GO:0005719 | nuclear euchromatin(GO:0005719) |
0.0 | 0.3 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
0.0 | 0.0 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.6 | 1.9 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
0.5 | 1.0 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
0.2 | 0.6 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.2 | 1.2 | GO:0030274 | LIM domain binding(GO:0030274) |
0.2 | 0.6 | GO:0015186 | L-asparagine transmembrane transporter activity(GO:0015182) L-glutamine transmembrane transporter activity(GO:0015186) |
0.2 | 0.5 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
0.2 | 0.5 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.1 | 0.6 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
0.1 | 0.5 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.1 | 0.6 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.1 | 0.3 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
0.1 | 0.1 | GO:0050051 | leukotriene-B4 20-monooxygenase activity(GO:0050051) |
0.1 | 0.3 | GO:0031127 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
0.1 | 0.5 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.1 | 0.4 | GO:0071614 | linoleic acid epoxygenase activity(GO:0071614) |
0.1 | 0.4 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
0.1 | 0.7 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
0.1 | 0.4 | GO:0033142 | progesterone receptor binding(GO:0033142) |
0.1 | 0.5 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
0.1 | 0.3 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
0.1 | 0.3 | GO:0032190 | acrosin binding(GO:0032190) |
0.1 | 0.3 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.1 | 0.5 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
0.1 | 0.2 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.1 | 0.3 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
0.1 | 0.2 | GO:0038181 | bile acid receptor activity(GO:0038181) |
0.1 | 0.5 | GO:0102338 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
0.1 | 2.1 | GO:0004114 | 3',5'-cyclic-nucleotide phosphodiesterase activity(GO:0004114) |
0.1 | 0.3 | GO:0042731 | PH domain binding(GO:0042731) |
0.1 | 0.3 | GO:0016453 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
0.1 | 0.2 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.1 | 0.3 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
0.1 | 0.2 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
0.1 | 0.5 | GO:0034046 | poly(G) binding(GO:0034046) |
0.1 | 0.3 | GO:0035671 | enone reductase activity(GO:0035671) |
0.1 | 0.3 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
0.1 | 0.3 | GO:0016215 | acyl-CoA desaturase activity(GO:0016215) |
0.1 | 0.2 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
0.1 | 1.3 | GO:0052743 | inositol tetrakisphosphate phosphatase activity(GO:0052743) |
0.1 | 0.2 | GO:0004470 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) |
0.1 | 0.2 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.1 | 0.2 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
0.1 | 0.2 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.0 | 0.2 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.0 | 0.3 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
0.0 | 0.1 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.0 | 0.3 | GO:0016724 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.0 | 0.1 | GO:0031433 | telethonin binding(GO:0031433) |
0.0 | 0.1 | GO:0004082 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
0.0 | 0.9 | GO:0003785 | actin monomer binding(GO:0003785) |
0.0 | 1.1 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
0.0 | 0.3 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
0.0 | 0.2 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
0.0 | 0.2 | GO:0043426 | MRF binding(GO:0043426) |
0.0 | 0.2 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
0.0 | 0.5 | GO:0005522 | profilin binding(GO:0005522) |
0.0 | 0.1 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
0.0 | 0.2 | GO:0097001 | ceramide binding(GO:0097001) |
0.0 | 1.2 | GO:0043826 | N-ethylmaleimide reductase activity(GO:0008748) reduced coenzyme F420 dehydrogenase activity(GO:0043738) sulfur oxygenase reductase activity(GO:0043826) malolactic enzyme activity(GO:0043883) epoxyqueuosine reductase activity(GO:0052693) |
0.0 | 0.1 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
0.0 | 0.2 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) |
0.0 | 1.4 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
0.0 | 0.1 | GO:0004771 | sterol esterase activity(GO:0004771) |
0.0 | 0.1 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.0 | 0.1 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
0.0 | 0.2 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.0 | 0.1 | GO:0004477 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
0.0 | 0.1 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
0.0 | 0.6 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.0 | 0.1 | GO:0051434 | BH3 domain binding(GO:0051434) |
0.0 | 0.1 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.0 | 0.1 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.0 | 0.3 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.0 | 0.4 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
0.0 | 0.2 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
0.0 | 0.2 | GO:0001727 | lipid kinase activity(GO:0001727) |
0.0 | 0.2 | GO:0050700 | CARD domain binding(GO:0050700) |
0.0 | 0.2 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.0 | 0.2 | GO:0005113 | patched binding(GO:0005113) |
0.0 | 0.3 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
0.0 | 0.1 | GO:0016532 | superoxide dismutase copper chaperone activity(GO:0016532) |
0.0 | 0.1 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
0.0 | 0.1 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.0 | 0.1 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
0.0 | 0.3 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
0.0 | 0.2 | GO:0004445 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) |
0.0 | 0.1 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
0.0 | 0.2 | GO:0000182 | rDNA binding(GO:0000182) |
0.0 | 0.1 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
0.0 | 0.3 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.0 | 0.2 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.0 | 0.3 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.0 | 0.2 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
0.0 | 0.1 | GO:0070137 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
0.0 | 0.1 | GO:0061731 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
0.0 | 0.1 | GO:0034452 | dynactin binding(GO:0034452) |
0.0 | 0.2 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
0.0 | 0.1 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.0 | 0.1 | GO:0015205 | purine nucleobase transmembrane transporter activity(GO:0005345) pyrimidine nucleobase transmembrane transporter activity(GO:0005350) nucleobase transmembrane transporter activity(GO:0015205) |
0.0 | 0.1 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
0.0 | 0.1 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
0.0 | 0.1 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
0.0 | 0.1 | GO:0030284 | estrogen receptor activity(GO:0030284) |
0.0 | 0.7 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
0.0 | 0.3 | GO:0001161 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) |
0.0 | 0.1 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
0.0 | 0.6 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.0 | 0.1 | GO:0070698 | type I activin receptor binding(GO:0070698) |
0.0 | 0.1 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
0.0 | 0.8 | GO:0015485 | cholesterol binding(GO:0015485) |
0.0 | 0.0 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.0 | 0.0 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.0 | 0.2 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.0 | 1.0 | GO:0008392 | arachidonic acid epoxygenase activity(GO:0008392) |
0.0 | 0.1 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
0.0 | 0.0 | GO:0034416 | bisphosphoglycerate phosphatase activity(GO:0034416) |
0.0 | 0.2 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
0.0 | 0.1 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
0.0 | 0.4 | GO:0016780 | phosphotransferase activity, for other substituted phosphate groups(GO:0016780) |
0.0 | 0.0 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
0.0 | 0.1 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.0 | 0.1 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.0 | 0.2 | GO:0030371 | translation repressor activity(GO:0030371) |
0.0 | 0.2 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.0 | 0.1 | GO:0016889 | endodeoxyribonuclease activity, producing 3'-phosphomonoesters(GO:0016889) |
0.0 | 0.2 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.0 | 0.2 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.0 | 0.0 | GO:0004488 | methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
0.0 | 0.1 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.0 | 0.1 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.0 | 0.2 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.0 | 0.2 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.0 | 0.8 | GO:0016763 | transferase activity, transferring pentosyl groups(GO:0016763) |
0.0 | 0.1 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
0.0 | 0.1 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
0.0 | 0.1 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.0 | 0.2 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.0 | 0.0 | GO:0005415 | nucleoside:sodium symporter activity(GO:0005415) |
0.0 | 0.1 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
0.0 | 0.1 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.0 | 0.0 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
0.0 | 0.3 | GO:0008327 | methyl-CpG binding(GO:0008327) |
0.0 | 0.1 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.0 | 0.1 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
0.0 | 0.1 | GO:0035197 | siRNA binding(GO:0035197) |
0.0 | 0.1 | GO:0043515 | kinetochore binding(GO:0043515) |
0.0 | 0.0 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
0.0 | 0.0 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.0 | 0.0 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
0.0 | 0.1 | GO:0030519 | snoRNP binding(GO:0030519) |
0.0 | 0.7 | GO:0017046 | peptide hormone binding(GO:0017046) |
0.0 | 0.1 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
0.0 | 0.1 | GO:0016681 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.0 | 0.1 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
0.0 | 0.1 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
0.0 | 0.6 | GO:0043905 | prenylcysteine methylesterase activity(GO:0010296) 1-oxa-2-oxocycloheptane lactonase activity(GO:0018731) sulfolactone hydrolase activity(GO:0018732) butyrolactone hydrolase activity(GO:0018734) endosulfan lactone lactonase activity(GO:0034892) L-ascorbate 6-phosphate lactonase activity(GO:0035460) Ser-tRNA(Thr) hydrolase activity(GO:0043905) Ala-tRNA(Pro) hydrolase activity(GO:0043906) Cys-tRNA(Pro) hydrolase activity(GO:0043907) Ser(Gly)-tRNA(Ala) hydrolase activity(GO:0043908) all-trans-retinyl-palmitate hydrolase, all-trans-retinol forming activity(GO:0047376) mannosyl-oligosaccharide 1,6-alpha-mannosidase activity(GO:0052767) mannosyl-oligosaccharide 1,3-alpha-mannosidase activity(GO:0052768) methyl indole-3-acetate esterase activity(GO:0080030) methyl salicylate esterase activity(GO:0080031) methyl jasmonate esterase activity(GO:0080032) |
0.0 | 0.2 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.0 | 0.1 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
0.0 | 0.1 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.0 | 0.1 | GO:0031419 | cobalamin binding(GO:0031419) |
0.0 | 0.1 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
0.0 | 0.0 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
0.0 | 0.3 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.0 | 0.1 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
0.0 | 0.0 | GO:0001016 | RNA polymerase III regulatory region DNA binding(GO:0001016) |
0.0 | 0.1 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.0 | 0.2 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
0.0 | 0.1 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.0 | 0.1 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.0 | 0.2 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
0.0 | 0.2 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
0.0 | 0.1 | GO:0009374 | biotin binding(GO:0009374) |
0.0 | 0.0 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
0.0 | 0.0 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
0.0 | 0.2 | GO:0031690 | adrenergic receptor binding(GO:0031690) |
0.0 | 0.0 | GO:0016015 | morphogen activity(GO:0016015) |
0.0 | 0.2 | GO:0030552 | cAMP binding(GO:0030552) |
0.0 | 0.2 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.0 | 0.3 | GO:0031489 | myosin V binding(GO:0031489) |
0.0 | 0.1 | GO:0010858 | calcium-dependent protein kinase regulator activity(GO:0010858) |
0.0 | 0.0 | GO:0055100 | adiponectin binding(GO:0055100) |
0.0 | 0.0 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.0 | 0.0 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
0.0 | 0.1 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
0.0 | 0.0 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
0.0 | 0.1 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
0.0 | 0.0 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
0.0 | 0.1 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
0.0 | 0.2 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.0 | 0.1 | GO:0015181 | arginine transmembrane transporter activity(GO:0015181) L-lysine transmembrane transporter activity(GO:0015189) |
0.0 | 0.0 | GO:0070905 | serine binding(GO:0070905) |
0.0 | 0.3 | GO:0005537 | mannose binding(GO:0005537) |
0.0 | 0.2 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.0 | 0.0 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.0 | 0.5 | GO:0016749 | N-succinyltransferase activity(GO:0016749) |
0.0 | 0.1 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.0 | 0.0 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
0.0 | 0.0 | GO:0016751 | S-succinyltransferase activity(GO:0016751) |
0.0 | 0.0 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
0.0 | 0.3 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.0 | 0.1 | GO:0043912 | D-lysine oxidase activity(GO:0043912) |
0.0 | 0.1 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
0.0 | 0.1 | GO:0043140 | ATP-dependent 3'-5' DNA helicase activity(GO:0043140) |
0.0 | 0.1 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
0.0 | 0.0 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
0.0 | 0.2 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
0.0 | 0.1 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) |
0.0 | 0.1 | GO:0070700 | BMP receptor binding(GO:0070700) |
0.0 | 0.1 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
0.0 | 0.0 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
0.0 | 0.0 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
0.0 | 0.0 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.0 | 0.0 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
0.0 | 0.0 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.0 | 0.1 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.0 | 0.0 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
0.0 | 0.1 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.0 | 0.1 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.0 | 0.1 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.0 | 0.1 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.0 | 0.1 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.0 | 0.1 | GO:0003993 | acid phosphatase activity(GO:0003993) |
0.0 | 0.0 | GO:0004802 | transketolase activity(GO:0004802) |
0.0 | 0.1 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.0 | 0.1 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
0.0 | 0.0 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
0.0 | 0.1 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
0.0 | 0.1 | GO:0070061 | fructose binding(GO:0070061) |
0.0 | 0.0 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.0 | 0.1 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
0.0 | 0.0 | GO:1990239 | steroid hormone binding(GO:1990239) |
0.0 | 0.0 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
0.0 | 0.3 | GO:0004190 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
0.0 | 0.0 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.0 | 0.0 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
0.0 | 0.0 | GO:0032052 | bile acid binding(GO:0032052) |
0.0 | 0.0 | GO:1990715 | mRNA CDS binding(GO:1990715) |
0.0 | 0.1 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.0 | 0.5 | GO:0003743 | translation initiation factor activity(GO:0003743) |
0.0 | 0.0 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
0.0 | 0.3 | GO:0045502 | dynein binding(GO:0045502) |
0.0 | 0.2 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.0 | 0.0 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.0 | 0.0 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.0 | 0.0 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
0.0 | 0.1 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
0.0 | 0.1 | GO:0050815 | phosphoserine binding(GO:0050815) |
0.0 | 0.0 | GO:0031705 | bombesin receptor binding(GO:0031705) |
0.0 | 0.3 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.0 | 0.3 | GO:0008536 | Ran GTPase binding(GO:0008536) |
0.0 | 0.1 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.0 | 0.0 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
0.0 | 0.1 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
0.0 | 0.1 | GO:0008656 | cysteine-type endopeptidase activator activity involved in apoptotic process(GO:0008656) |
0.0 | 0.2 | GO:0042562 | hormone binding(GO:0042562) |
0.0 | 0.1 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.0 | 0.0 | GO:0097016 | L27 domain binding(GO:0097016) |
0.0 | 0.1 | GO:0017160 | Ral GTPase binding(GO:0017160) |
0.0 | 0.1 | GO:0005243 | gap junction channel activity(GO:0005243) |
0.0 | 0.1 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
0.0 | 0.3 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 3.3 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.1 | 1.4 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.1 | 1.4 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
0.1 | 0.2 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
0.0 | 0.0 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.0 | 1.1 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.0 | 0.3 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.0 | 0.1 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.0 | 0.3 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.0 | 1.4 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
0.0 | 2.3 | PID CMYB PATHWAY | C-MYB transcription factor network |
0.0 | 0.3 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.0 | 0.7 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
0.0 | 0.9 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.0 | 0.2 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.0 | 0.1 | PID S1P S1P3 PATHWAY | S1P3 pathway |
0.0 | 0.2 | PID ERBB1 RECEPTOR PROXIMAL PATHWAY | EGF receptor (ErbB1) signaling pathway |
0.0 | 0.5 | PID REELIN PATHWAY | Reelin signaling pathway |
0.0 | 0.0 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
0.0 | 0.0 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.0 | 0.4 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
0.0 | 0.5 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
0.0 | 0.6 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.0 | 0.2 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.0 | 0.2 | PID ALK2 PATHWAY | ALK2 signaling events |
0.0 | 0.1 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.0 | 0.1 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.0 | 0.3 | PID INSULIN PATHWAY | Insulin Pathway |
0.0 | 0.6 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.0 | 0.2 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.0 | 0.2 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
0.0 | 0.4 | PID FGF PATHWAY | FGF signaling pathway |
0.0 | 0.1 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
0.0 | 0.2 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.0 | 0.2 | PID SHP2 PATHWAY | SHP2 signaling |
0.0 | 0.2 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.0 | 0.1 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
0.0 | 0.4 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.0 | 0.3 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.0 | 0.1 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
0.0 | 0.1 | PID IL2 1PATHWAY | IL2-mediated signaling events |
0.0 | 0.1 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.0 | 0.1 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
0.0 | 0.2 | PID RAS PATHWAY | Regulation of Ras family activation |
0.0 | 0.1 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 2.6 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.1 | 1.3 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
0.1 | 0.2 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
0.1 | 0.7 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
0.1 | 0.6 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.0 | 0.3 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.0 | 1.2 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.0 | 0.1 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.0 | 0.3 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
0.0 | 0.1 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
0.0 | 0.1 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
0.0 | 0.2 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.0 | 0.4 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
0.0 | 0.4 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.0 | 1.1 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
0.0 | 0.6 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.0 | 0.5 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.0 | 0.1 | REACTOME DOWNSTREAM SIGNALING EVENTS OF B CELL RECEPTOR BCR | Genes involved in Downstream Signaling Events Of B Cell Receptor (BCR) |
0.0 | 0.4 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
0.0 | 0.4 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.0 | 0.4 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.0 | 0.3 | REACTOME SIGNALING BY NOTCH2 | Genes involved in Signaling by NOTCH2 |
0.0 | 0.2 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.0 | 0.3 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.0 | 0.3 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
0.0 | 0.6 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.0 | 0.3 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
0.0 | 0.7 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.0 | 0.2 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
0.0 | 0.1 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
0.0 | 0.5 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.0 | 0.4 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
0.0 | 0.6 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
0.0 | 0.3 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.0 | 0.4 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
0.0 | 0.1 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
0.0 | 0.2 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.0 | 0.0 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
0.0 | 0.1 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
0.0 | 0.7 | REACTOME INTERFERON GAMMA SIGNALING | Genes involved in Interferon gamma signaling |
0.0 | 0.2 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
0.0 | 0.1 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.0 | 0.3 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.0 | 0.2 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.0 | 0.4 | REACTOME INTEGRATION OF ENERGY METABOLISM | Genes involved in Integration of energy metabolism |
0.0 | 0.1 | REACTOME HYALURONAN METABOLISM | Genes involved in Hyaluronan metabolism |
0.0 | 0.3 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
0.0 | 0.1 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.0 | 0.5 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
0.0 | 0.1 | REACTOME SIGNALLING BY NGF | Genes involved in Signalling by NGF |
0.0 | 0.1 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
0.0 | 0.3 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
0.0 | 0.2 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.0 | 0.2 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.0 | 0.2 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
0.0 | 0.1 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
0.0 | 0.0 | REACTOME SIGNALING BY NOTCH3 | Genes involved in Signaling by NOTCH3 |
0.0 | 0.1 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
0.0 | 0.1 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
0.0 | 0.0 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
0.0 | 0.4 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
0.0 | 0.2 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
0.0 | 0.1 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
0.0 | 0.3 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.0 | 0.2 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
0.0 | 0.2 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.0 | 0.8 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
0.0 | 0.2 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.0 | 0.1 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
0.0 | 0.2 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
0.0 | 0.4 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
0.0 | 0.0 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
0.0 | 0.1 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.0 | 0.1 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
0.0 | 0.1 | REACTOME ADENYLATE CYCLASE INHIBITORY PATHWAY | Genes involved in Adenylate cyclase inhibitory pathway |
0.0 | 0.1 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.0 | 0.1 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
0.0 | 0.9 | REACTOME 3 UTR MEDIATED TRANSLATIONAL REGULATION | Genes involved in 3' -UTR-mediated translational regulation |
0.0 | 0.2 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |