| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Twist1
|
ENSMUSG00000035799.5 | twist basic helix-loop-helix transcription factor 1 |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr13_60681580_60681975 | 4.17 |
Dapk1 |
death associated protein kinase 1 |
14636 |
0.17 |
| chr12_28899893_28900063 | 3.63 |
Gm31508 |
predicted gene, 31508 |
10251 |
0.18 |
| chr9_118232810_118233328 | 2.40 |
Gm17399 |
predicted gene, 17399 |
82838 |
0.08 |
| chr4_33243933_33244238 | 2.05 |
Pnrc1 |
proline-rich nuclear receptor coactivator 1 |
3490 |
0.21 |
| chr10_24103718_24103905 | 1.99 |
Taar8c |
trace amine-associated receptor 8C |
1899 |
0.18 |
| chr10_24097357_24097545 | 1.87 |
Taar8c |
trace amine-associated receptor 8C |
4461 |
0.1 |
| chr10_24074506_24074765 | 1.85 |
Taar8a |
trace amine-associated receptor 8A |
1865 |
0.16 |
| chr19_47304311_47304615 | 1.74 |
Sh3pxd2a |
SH3 and PX domains 2A |
10288 |
0.16 |
| chr9_21032221_21032372 | 1.56 |
Mir1900 |
microRNA 1900 |
32 |
0.44 |
| chr19_61057968_61058170 | 1.55 |
Gm22520 |
predicted gene, 22520 |
44524 |
0.12 |
| chr9_121911874_121912245 | 1.40 |
Cyp8b1 |
cytochrome P450, family 8, subfamily b, polypeptide 1 |
4246 |
0.1 |
| chr5_53049209_53049417 | 1.36 |
Slc34a2 |
solute carrier family 34 (sodium phosphate), member 2 |
39 |
0.6 |
| chr11_86994352_86994663 | 1.21 |
Ypel2 |
yippee like 2 |
800 |
0.57 |
| chr11_75435252_75435403 | 1.20 |
Serpinf2 |
serine (or cysteine) peptidase inhibitor, clade F, member 2 |
3573 |
0.1 |
| chr17_28278042_28278194 | 1.17 |
Ppard |
peroxisome proliferator activator receptor delta |
5999 |
0.12 |
| chr18_65042531_65042691 | 1.16 |
Nedd4l |
neural precursor cell expressed, developmentally down-regulated gene 4-like |
8308 |
0.23 |
| chr11_86985069_86985237 | 1.14 |
Ypel2 |
yippee like 2 |
8554 |
0.17 |
| chr5_114614028_114614179 | 1.14 |
Trpv4 |
transient receptor potential cation channel, subfamily V, member 4 |
16535 |
0.14 |
| chr17_56206751_56207150 | 1.13 |
Dpp9 |
dipeptidylpeptidase 9 |
2258 |
0.15 |
| chr3_104796399_104796698 | 1.12 |
Rhoc |
ras homolog family member C |
4565 |
0.1 |
| chr3_88121442_88121599 | 1.10 |
Iqgap3 |
IQ motif containing GTPase activating protein 3 |
14404 |
0.1 |
| chr8_10948313_10948490 | 1.09 |
Gm44955 |
predicted gene 44955 |
511 |
0.66 |
| chr1_39192284_39192607 | 1.09 |
Npas2 |
neuronal PAS domain protein 2 |
1286 |
0.45 |
| chr3_60057385_60057653 | 1.04 |
Sucnr1 |
succinate receptor 1 |
24350 |
0.14 |
| chr11_113600708_113600859 | 1.03 |
Sstr2 |
somatostatin receptor 2 |
18559 |
0.16 |
| chr10_59949625_59949807 | 1.03 |
Ddit4 |
DNA-damage-inducible transcript 4 |
2118 |
0.29 |
| chr8_10904318_10904469 | 1.01 |
Gm2814 |
predicted gene 2814 |
3835 |
0.12 |
| chr1_36537159_36537318 | 1.01 |
Ankrd23 |
ankyrin repeat domain 23 |
355 |
0.71 |
| chr8_120533900_120534066 | 0.99 |
Gse1 |
genetic suppressor element 1, coiled-coil protein |
1874 |
0.21 |
| chr4_33244314_33244465 | 0.98 |
Pnrc1 |
proline-rich nuclear receptor coactivator 1 |
3186 |
0.21 |
| chr11_51644012_51644188 | 0.98 |
N4bp3 |
NEDD4 binding protein 3 |
6720 |
0.12 |
| chr11_98456761_98456916 | 0.96 |
Grb7 |
growth factor receptor bound protein 7 |
3049 |
0.12 |
| chr13_60680911_60681084 | 0.96 |
Dapk1 |
death associated protein kinase 1 |
15416 |
0.17 |
| chr7_31074155_31074306 | 0.94 |
Fxyd3 |
FXYD domain-containing ion transport regulator 3 |
722 |
0.44 |
| chr4_83221216_83221400 | 0.92 |
Ttc39b |
tetratricopeptide repeat domain 39B |
11862 |
0.19 |
| chr16_11423758_11424122 | 0.92 |
Snx29 |
sorting nexin 29 |
3232 |
0.3 |
| chr4_145057432_145057591 | 0.91 |
Vps13d |
vacuolar protein sorting 13D |
687 |
0.77 |
| chr16_11423415_11423747 | 0.91 |
Snx29 |
sorting nexin 29 |
2873 |
0.32 |
| chr11_100939895_100940183 | 0.90 |
Stat3 |
signal transducer and activator of transcription 3 |
499 |
0.73 |
| chr11_115413035_115413484 | 0.90 |
Mrpl58 |
mitochondrial ribosomal protein L58 |
3099 |
0.1 |
| chr7_127805019_127805207 | 0.90 |
9430064I24Rik |
RIKEN cDNA 9430064I24 gene |
2351 |
0.11 |
| chr14_20319722_20320198 | 0.89 |
Nudt13 |
nudix (nucleoside diphosphate linked moiety X)-type motif 13 |
8531 |
0.12 |
| chr15_31279226_31279377 | 0.88 |
Gm49296 |
predicted gene, 49296 |
2788 |
0.19 |
| chr5_90893548_90893704 | 0.88 |
Gm22816 |
predicted gene, 22816 |
246 |
0.87 |
| chr5_134554086_134554240 | 0.88 |
Clip2 |
CAP-GLY domain containing linker protein 2 |
1729 |
0.19 |
| chr16_22683871_22684054 | 0.87 |
Gm8118 |
predicted gene 8118 |
2232 |
0.29 |
| chr15_100416348_100416511 | 0.87 |
Gm5475 |
predicted gene 5475 |
5718 |
0.12 |
| chr4_155245715_155246079 | 0.86 |
Faap20 |
Fanconi anemia core complex associated protein 20 |
3905 |
0.19 |
| chr15_74956189_74956380 | 0.86 |
Ly6e |
lymphocyte antigen 6 complex, locus E |
271 |
0.8 |
| chr11_77028533_77028854 | 0.86 |
Slc6a4 |
solute carrier family 6 (neurotransmitter transporter, serotonin), member 4 |
10516 |
0.12 |
| chr12_81856246_81856452 | 0.86 |
Pcnx |
pecanex homolog |
3674 |
0.24 |
| chr1_180226517_180226708 | 0.86 |
Psen2 |
presenilin 2 |
2956 |
0.19 |
| chr7_24595302_24595547 | 0.85 |
Zfp575 |
zinc finger protein 575 |
7783 |
0.08 |
| chr8_33867227_33867386 | 0.84 |
Rbpms |
RNA binding protein gene with multiple splicing |
13633 |
0.16 |
| chr13_63929610_63929934 | 0.83 |
Gm7695 |
predicted gene 7695 |
16749 |
0.18 |
| chr1_74304286_74304581 | 0.81 |
Tmbim1 |
transmembrane BAX inhibitor motif containing 1 |
28 |
0.94 |
| chr10_84811999_84812153 | 0.81 |
Gm24226 |
predicted gene, 24226 |
893 |
0.64 |
| chr2_60963495_60963646 | 0.81 |
Rbms1 |
RNA binding motif, single stranded interacting protein 1 |
378 |
0.89 |
| chr15_97821321_97821590 | 0.81 |
Hdac7 |
histone deacetylase 7 |
6592 |
0.16 |
| chr15_11394872_11395043 | 0.81 |
Tars |
threonyl-tRNA synthetase |
2687 |
0.35 |
| chr17_27781322_27781617 | 0.80 |
Rps2-ps9 |
ribosomal protein S2, pseudogene 9 |
2910 |
0.18 |
| chr6_54721053_54721252 | 0.80 |
Gm44008 |
predicted gene, 44008 |
27506 |
0.15 |
| chr8_119423599_119423760 | 0.79 |
Osgin1 |
oxidative stress induced growth inhibitor 1 |
10445 |
0.15 |
| chr15_101976947_101977179 | 0.79 |
Krt78 |
keratin 78 |
22776 |
0.09 |
| chr11_72243451_72243602 | 0.79 |
1700051A21Rik |
RIKEN cDNA 1700051A21 gene |
22895 |
0.09 |
| chr5_137741871_137742022 | 0.78 |
Nyap1 |
neuronal tyrosine-phosphorylated phosphoinositide 3-kinase adaptor 1 |
339 |
0.75 |
| chr12_108848054_108848397 | 0.77 |
Slc25a47 |
solute carrier family 25, member 47 |
2904 |
0.13 |
| chr8_94529970_94530144 | 0.77 |
Cpne2 |
copine II |
2933 |
0.18 |
| chr13_55810813_55810973 | 0.76 |
Gm47071 |
predicted gene, 47071 |
15357 |
0.12 |
| chr18_20982537_20982795 | 0.76 |
Rnf138 |
ring finger protein 138 |
18675 |
0.18 |
| chr12_99321084_99321235 | 0.75 |
Foxn3 |
forkhead box N3 |
8904 |
0.14 |
| chr17_31872209_31872373 | 0.75 |
Sik1 |
salt inducible kinase 1 |
16487 |
0.13 |
| chr1_184787877_184788084 | 0.75 |
Mtarc1 |
mitochondrial amidoxime reducing component 1 |
20873 |
0.13 |
| chr8_10938400_10938580 | 0.75 |
Gm45042 |
predicted gene 45042 |
8603 |
0.1 |
| chr4_144901641_144901842 | 0.74 |
Dhrs3 |
dehydrogenase/reductase (SDR family) member 3 |
8522 |
0.21 |
| chr10_61327652_61327821 | 0.73 |
Pald1 |
phosphatase domain containing, paladin 1 |
14591 |
0.12 |
| chr8_119419531_119419682 | 0.72 |
Osgin1 |
oxidative stress induced growth inhibitor 1 |
14518 |
0.14 |
| chr19_21106934_21107106 | 0.72 |
4930554I06Rik |
RIKEN cDNA 4930554I06 gene |
2310 |
0.37 |
| chr2_25485025_25485188 | 0.72 |
Lcn12 |
lipocalin 12 |
8326 |
0.07 |
| chr18_11210913_11211071 | 0.71 |
Gata6 |
GATA binding protein 6 |
151945 |
0.04 |
| chr17_24355260_24355582 | 0.70 |
Abca3 |
ATP-binding cassette, sub-family A (ABC1), member 3 |
3319 |
0.12 |
| chr16_5256363_5256535 | 0.70 |
Eef2kmt |
eukaryotic elongation factor 2 lysine methyltransferase |
466 |
0.65 |
| chr11_75434604_75434756 | 0.70 |
Serpinf2 |
serine (or cysteine) peptidase inhibitor, clade F, member 2 |
4220 |
0.09 |
| chr13_98594038_98594200 | 0.70 |
Gm4815 |
predicted gene 4815 |
19382 |
0.12 |
| chr13_34741813_34742140 | 0.70 |
Fam50b |
family with sequence similarity 50, member B |
2364 |
0.2 |
| chr2_30207473_30207636 | 0.69 |
Kyat1 |
kynurenine aminotransferase 1 |
1707 |
0.2 |
| chr13_60497168_60497319 | 0.69 |
A530001N23Rik |
RIKEN cDNA A530001N23 gene |
8435 |
0.17 |
| chr10_75044109_75044374 | 0.69 |
Rab36 |
RAB36, member RAS oncogene family |
6018 |
0.16 |
| chr2_167826073_167826251 | 0.69 |
1200007C13Rik |
RIKEN cDNA 1200007C13 gene |
7484 |
0.16 |
| chr17_26621555_26621771 | 0.69 |
Ergic1 |
endoplasmic reticulum-golgi intermediate compartment (ERGIC) 1 |
214 |
0.9 |
| chr3_81036876_81037038 | 0.68 |
Pdgfc |
platelet-derived growth factor, C polypeptide |
215 |
0.92 |
| chr2_30604630_30604792 | 0.68 |
Cstad |
CSA-conditional, T cell activation-dependent protein |
506 |
0.77 |
| chr15_36471981_36472313 | 0.67 |
Ankrd46 |
ankyrin repeat domain 46 |
24568 |
0.12 |
| chr16_10989648_10989826 | 0.67 |
Litaf |
LPS-induced TN factor |
3334 |
0.14 |
| chr15_79741187_79741771 | 0.67 |
Sun2 |
Sad1 and UNC84 domain containing 2 |
613 |
0.45 |
| chr3_131473184_131473335 | 0.67 |
Sgms2 |
sphingomyelin synthase 2 |
17220 |
0.23 |
| chr19_45003271_45003470 | 0.66 |
Twnk |
twinkle mtDNA helicase |
2293 |
0.15 |
| chr2_173185499_173185650 | 0.66 |
Pck1 |
phosphoenolpyruvate carboxykinase 1, cytosolic |
32492 |
0.13 |
| chr11_72256208_72256401 | 0.66 |
1700051A21Rik |
RIKEN cDNA 1700051A21 gene |
10117 |
0.1 |
| chr10_79534006_79534157 | 0.66 |
Plpp2 |
phospholipid phosphatase 2 |
285 |
0.84 |
| chr6_72028118_72028756 | 0.66 |
9130221F21Rik |
RIKEN cDNA 9130221F21 gene |
14091 |
0.13 |
| chr19_42611869_42612025 | 0.65 |
Loxl4 |
lysyl oxidase-like 4 |
825 |
0.63 |
| chr4_45448714_45448902 | 0.65 |
Shb |
src homology 2 domain-containing transforming protein B |
33994 |
0.11 |
| chr3_96102665_96102823 | 0.65 |
Otud7b |
OTU domain containing 7B |
1783 |
0.2 |
| chr1_39186773_39187108 | 0.65 |
Mir6349 |
microRNA 6349 |
52 |
0.98 |
| chr19_42602273_42602424 | 0.65 |
Loxl4 |
lysyl oxidase-like 4 |
973 |
0.55 |
| chr6_121160003_121160176 | 0.65 |
Pex26 |
peroxisomal biogenesis factor 26 |
23578 |
0.12 |
| chr9_55225732_55226034 | 0.64 |
Fbxo22 |
F-box protein 22 |
12220 |
0.16 |
| chr11_78409349_78409500 | 0.64 |
Slc13a2 |
solute carrier family 13 (sodium-dependent dicarboxylate transporter), member 2 |
12793 |
0.09 |
| chr8_105746150_105746318 | 0.64 |
Gfod2 |
glucose-fructose oxidoreductase domain containing 2 |
12362 |
0.09 |
| chr6_72214837_72215006 | 0.63 |
Atoh8 |
atonal bHLH transcription factor 8 |
19616 |
0.14 |
| chr1_72854483_72854969 | 0.63 |
Igfbp2 |
insulin-like growth factor binding protein 2 |
6027 |
0.23 |
| chr13_60681310_60681461 | 0.63 |
Dapk1 |
death associated protein kinase 1 |
15028 |
0.17 |
| chr7_110853928_110854130 | 0.63 |
Lyve1 |
lymphatic vessel endothelial hyaluronan receptor 1 |
8924 |
0.15 |
| chr16_22876773_22877151 | 0.62 |
Dnajb11 |
DnaJ heat shock protein family (Hsp40) member B11 |
7535 |
0.12 |
| chr5_145989777_145990157 | 0.62 |
Cyp3a25 |
cytochrome P450, family 3, subfamily a, polypeptide 25 |
1676 |
0.27 |
| chrX_162902296_162902497 | 0.62 |
Ctps2 |
cytidine 5'-triphosphate synthase 2 |
225 |
0.89 |
| chr8_119445523_119446899 | 0.62 |
Necab2 |
N-terminal EF-hand calcium binding protein 2 |
508 |
0.74 |
| chr5_92469533_92469703 | 0.62 |
Mir6415 |
microRNA 6415 |
11061 |
0.14 |
| chr2_33274814_33274965 | 0.62 |
Gm13537 |
predicted gene 13537 |
48282 |
0.11 |
| chr2_151927825_151928028 | 0.62 |
Angpt4 |
angiopoietin 4 |
16716 |
0.12 |
| chr2_69414943_69415101 | 0.61 |
Dhrs9 |
dehydrogenase/reductase (SDR family) member 9 |
34577 |
0.16 |
| chr6_125516398_125516591 | 0.61 |
Cd9 |
CD9 antigen |
21703 |
0.13 |
| chr1_84362730_84363074 | 0.61 |
Pid1 |
phosphotyrosine interaction domain containing 1 |
1278 |
0.54 |
| chr5_138760297_138760459 | 0.61 |
Fam20c |
family with sequence similarity 20, member C |
5291 |
0.21 |
| chr6_129538595_129538908 | 0.60 |
Gm44243 |
predicted gene, 44243 |
1470 |
0.2 |
| chr8_126613233_126613384 | 0.60 |
Irf2bp2 |
interferon regulatory factor 2 binding protein 2 |
19322 |
0.22 |
| chr10_127614613_127614967 | 0.60 |
Lrp1 |
low density lipoprotein receptor-related protein 1 |
6132 |
0.1 |
| chr17_28279922_28280073 | 0.59 |
Ppard |
peroxisome proliferator activator receptor delta |
7878 |
0.11 |
| chr8_70695342_70695652 | 0.59 |
Jund |
jun D proto-oncogene |
3452 |
0.09 |
| chr12_25213904_25214055 | 0.59 |
Gm47705 |
predicted gene, 47705 |
32211 |
0.15 |
| chr11_115303297_115303464 | 0.58 |
Otop2 |
otopetrin 2 |
3783 |
0.11 |
| chr4_148165003_148165154 | 0.58 |
Fbxo2 |
F-box protein 2 |
4457 |
0.12 |
| chr14_73475675_73476003 | 0.58 |
Gm4266 |
predicted gene 4266 |
17254 |
0.17 |
| chr8_117637336_117637505 | 0.58 |
Sdr42e1 |
short chain dehydrogenase/reductase family 42E, member 1 |
34127 |
0.12 |
| chr1_193271420_193271628 | 0.58 |
G0s2 |
G0/G1 switch gene 2 |
1693 |
0.19 |
| chr6_94357642_94357793 | 0.58 |
Gm19908 |
predicted gene, 19908 |
8183 |
0.21 |
| chr11_97531262_97531437 | 0.58 |
Srcin1 |
SRC kinase signaling inhibitor 1 |
5596 |
0.14 |
| chr3_121200941_121201336 | 0.57 |
Gm5710 |
predicted gene 5710 |
20041 |
0.13 |
| chr8_124282132_124282357 | 0.57 |
Galnt2 |
polypeptide N-acetylgalactosaminyltransferase 2 |
12859 |
0.16 |
| chr13_53069146_53069333 | 0.57 |
Gm48336 |
predicted gene, 48336 |
40321 |
0.16 |
| chr12_26403457_26403617 | 0.57 |
Rnf144a |
ring finger protein 144A |
2910 |
0.21 |
| chr12_28898423_28898586 | 0.57 |
Gm31508 |
predicted gene, 31508 |
11725 |
0.17 |
| chr12_26470014_26470183 | 0.56 |
Cmpk2 |
cytidine monophosphate (UMP-CMP) kinase 2, mitochondrial |
411 |
0.8 |
| chr9_92229087_92229238 | 0.56 |
Plscr1 |
phospholipid scramblase 1 |
20588 |
0.15 |
| chr15_89378320_89378514 | 0.56 |
Odf3b |
outer dense fiber of sperm tails 3B |
191 |
0.83 |
| chr15_64309233_64309403 | 0.56 |
Asap1 |
ArfGAP with SH3 domain, ankyrin repeat and PH domain1 |
2371 |
0.28 |
| chr19_3669127_3669720 | 0.56 |
Lrp5 |
low density lipoprotein receptor-related protein 5 |
17133 |
0.12 |
| chr7_73597261_73597435 | 0.56 |
Gm44734 |
predicted gene 44734 |
11600 |
0.11 |
| chr3_19986808_19986959 | 0.56 |
Cp |
ceruloplasmin |
662 |
0.69 |
| chr4_33292661_33293055 | 0.56 |
Pnrc1 |
proline-rich nuclear receptor coactivator 1 |
2695 |
0.24 |
| chr7_68717199_68717404 | 0.56 |
Gm44692 |
predicted gene 44692 |
9166 |
0.23 |
| chr12_3572503_3572654 | 0.56 |
Dtnb |
dystrobrevin, beta |
42 |
0.98 |
| chr15_61942367_61942518 | 0.56 |
Gm37947 |
predicted gene, 37947 |
40860 |
0.16 |
| chr4_145037079_145037530 | 0.55 |
Vps13d |
vacuolar protein sorting 13D |
13730 |
0.24 |
| chr11_117414876_117415032 | 0.55 |
Gm11729 |
predicted gene 11729 |
565 |
0.69 |
| chr6_54752527_54752678 | 0.55 |
Gm44008 |
predicted gene, 44008 |
58956 |
0.1 |
| chr8_114541036_114541418 | 0.55 |
Gm16116 |
predicted gene 16116 |
53673 |
0.14 |
| chr6_99173674_99173868 | 0.55 |
Foxp1 |
forkhead box P1 |
10753 |
0.29 |
| chr7_28829903_28830239 | 0.55 |
Ech1 |
enoyl coenzyme A hydratase 1, peroxisomal |
80 |
0.93 |
| chr1_119292285_119292453 | 0.55 |
Gm29456 |
predicted gene 29456 |
34464 |
0.14 |
| chr7_99181688_99181877 | 0.54 |
Dgat2 |
diacylglycerol O-acyltransferase 2 |
895 |
0.48 |
| chr8_14256341_14256516 | 0.54 |
Gm26184 |
predicted gene, 26184 |
16883 |
0.22 |
| chr4_59263301_59263491 | 0.54 |
Gm12596 |
predicted gene 12596 |
3345 |
0.25 |
| chr12_29054470_29054628 | 0.54 |
Gm23342 |
predicted gene, 23342 |
19255 |
0.21 |
| chr6_48016341_48016501 | 0.54 |
Zfp777 |
zinc finger protein 777 |
27822 |
0.1 |
| chr10_127745972_127746136 | 0.53 |
Gpr182 |
G protein-coupled receptor 182 |
5678 |
0.09 |
| chr4_149990872_149991171 | 0.53 |
H6pd |
hexose-6-phosphate dehydrogenase (glucose 1-dehydrogenase) |
10244 |
0.15 |
| chr17_56408228_56408542 | 0.53 |
Ptprs |
protein tyrosine phosphatase, receptor type, S |
6045 |
0.14 |
| chr7_143599041_143599206 | 0.53 |
Cars |
cysteinyl-tRNA synthetase |
558 |
0.5 |
| chr1_180216643_180216801 | 0.53 |
Gm37336 |
predicted gene, 37336 |
4321 |
0.16 |
| chr4_43423894_43424089 | 0.53 |
Rusc2 |
RUN and SH3 domain containing 2 |
400 |
0.74 |
| chr9_43637078_43637497 | 0.53 |
Gm29961 |
predicted gene, 29961 |
6791 |
0.18 |
| chr11_117966569_117966739 | 0.52 |
Socs3 |
suppressor of cytokine signaling 3 |
2532 |
0.21 |
| chr2_30363854_30364005 | 0.52 |
Miga2 |
mitoguardin 2 |
304 |
0.79 |
| chr3_123104065_123104239 | 0.52 |
Synpo2 |
synaptopodin 2 |
8658 |
0.16 |
| chr16_94694268_94694544 | 0.52 |
Gm41504 |
predicted gene, 41504 |
19497 |
0.16 |
| chr8_126474710_126474904 | 0.52 |
Tarbp1 |
TAR RNA binding protein 1 |
258 |
0.9 |
| chr19_46136477_46136807 | 0.52 |
Pitx3 |
paired-like homeodomain transcription factor 3 |
647 |
0.58 |
| chr12_76405211_76405366 | 0.52 |
Hspa2 |
heat shock protein 2 |
879 |
0.36 |
| chr17_25638577_25638735 | 0.52 |
Gm22645 |
predicted gene, 22645 |
55564 |
0.04 |
| chr9_74867912_74868067 | 0.51 |
Onecut1 |
one cut domain, family member 1 |
1505 |
0.34 |
| chr5_64802548_64802730 | 0.51 |
Klf3 |
Kruppel-like factor 3 (basic) |
749 |
0.44 |
| chr6_122249737_122249965 | 0.51 |
Mug-ps1 |
murinoglobulin, pseudogene 1 |
20791 |
0.13 |
| chr18_84038085_84038236 | 0.51 |
Tshz1 |
teashirt zinc finger family member 1 |
46915 |
0.11 |
| chr17_42916175_42916336 | 0.51 |
Cd2ap |
CD2-associated protein |
39590 |
0.19 |
| chr8_114438337_114438515 | 0.51 |
Wwox |
WW domain-containing oxidoreductase |
1229 |
0.51 |
| chr9_74528700_74528872 | 0.51 |
Gm28622 |
predicted gene 28622 |
32592 |
0.18 |
| chr10_69152060_69152451 | 0.51 |
Rhobtb1 |
Rho-related BTB domain containing 1 |
821 |
0.46 |
| chr2_167959698_167959868 | 0.51 |
Ptpn1 |
protein tyrosine phosphatase, non-receptor type 1 |
8735 |
0.17 |
| chr9_100370018_100370211 | 0.51 |
Gm34397 |
predicted gene, 34397 |
14932 |
0.18 |
| chr2_33355699_33355875 | 0.50 |
Gm25998 |
predicted gene, 25998 |
7259 |
0.17 |
| chr8_122856377_122856548 | 0.50 |
Cdh15 |
cadherin 15 |
8496 |
0.1 |
| chr9_108796660_108796845 | 0.50 |
Ip6k2 |
inositol hexaphosphate kinase 2 |
400 |
0.66 |
| chr3_83841601_83841954 | 0.50 |
Tlr2 |
toll-like receptor 2 |
10 |
0.98 |
| chr11_102767137_102767309 | 0.50 |
Adam11 |
a disintegrin and metallopeptidase domain 11 |
2544 |
0.18 |
| chr4_135948301_135948452 | 0.50 |
Hmgcl |
3-hydroxy-3-methylglutaryl-Coenzyme A lyase |
154 |
0.9 |
| chr4_150035468_150035643 | 0.50 |
Gm13067 |
predicted gene 13067 |
13458 |
0.12 |
| chr13_59842540_59842831 | 0.49 |
Gm34961 |
predicted gene, 34961 |
19419 |
0.1 |
| chr4_133093523_133093713 | 0.49 |
Ahdc1 |
AT hook, DNA binding motif, containing 1 |
27369 |
0.14 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 1.5 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
| 0.3 | 0.8 | GO:0010728 | regulation of hydrogen peroxide biosynthetic process(GO:0010728) |
| 0.2 | 0.7 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.2 | 0.7 | GO:0090292 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.2 | 0.6 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
| 0.2 | 0.8 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
| 0.2 | 0.9 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
| 0.2 | 0.5 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
| 0.2 | 0.5 | GO:1904220 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.2 | 0.5 | GO:0071727 | response to triacyl bacterial lipopeptide(GO:0071725) cellular response to triacyl bacterial lipopeptide(GO:0071727) |
| 0.2 | 0.7 | GO:0035995 | detection of muscle stretch(GO:0035995) |
| 0.2 | 0.5 | GO:0046075 | dTTP biosynthetic process(GO:0006235) pyrimidine deoxyribonucleoside triphosphate biosynthetic process(GO:0009212) dTTP metabolic process(GO:0046075) |
| 0.1 | 0.6 | GO:1904393 | regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904393) positive regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904395) |
| 0.1 | 0.6 | GO:1990169 | detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
| 0.1 | 0.4 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
| 0.1 | 0.5 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
| 0.1 | 0.4 | GO:0015744 | succinate transport(GO:0015744) |
| 0.1 | 0.6 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.1 | 0.4 | GO:0060137 | maternal process involved in parturition(GO:0060137) |
| 0.1 | 0.4 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
| 0.1 | 0.2 | GO:0051081 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
| 0.1 | 0.6 | GO:0009115 | xanthine catabolic process(GO:0009115) |
| 0.1 | 0.6 | GO:0019695 | choline metabolic process(GO:0019695) |
| 0.1 | 0.9 | GO:0060297 | regulation of sarcomere organization(GO:0060297) |
| 0.1 | 0.3 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
| 0.1 | 0.3 | GO:2000304 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
| 0.1 | 0.3 | GO:0090230 | regulation of centromere complex assembly(GO:0090230) |
| 0.1 | 0.3 | GO:0045472 | response to ether(GO:0045472) |
| 0.1 | 0.4 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 0.1 | 0.4 | GO:0051541 | elastin metabolic process(GO:0051541) |
| 0.1 | 0.4 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
| 0.1 | 0.3 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.1 | 0.5 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
| 0.1 | 0.3 | GO:0030242 | pexophagy(GO:0030242) |
| 0.1 | 0.4 | GO:1901679 | nucleotide transmembrane transport(GO:1901679) |
| 0.1 | 0.8 | GO:0035878 | nail development(GO:0035878) |
| 0.1 | 0.4 | GO:0034214 | protein hexamerization(GO:0034214) |
| 0.1 | 0.4 | GO:0052428 | negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
| 0.1 | 0.3 | GO:0019448 | cysteine catabolic process(GO:0009093) L-cysteine catabolic process(GO:0019448) L-cysteine metabolic process(GO:0046439) |
| 0.1 | 0.5 | GO:0035166 | post-embryonic hemopoiesis(GO:0035166) |
| 0.1 | 0.3 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
| 0.1 | 0.3 | GO:1901844 | regulation of cell communication by electrical coupling involved in cardiac conduction(GO:1901844) |
| 0.1 | 0.3 | GO:0051918 | negative regulation of fibrinolysis(GO:0051918) |
| 0.1 | 0.3 | GO:0006114 | glycerol biosynthetic process(GO:0006114) |
| 0.1 | 0.2 | GO:0034140 | negative regulation of toll-like receptor 3 signaling pathway(GO:0034140) |
| 0.1 | 0.5 | GO:0051775 | response to redox state(GO:0051775) |
| 0.1 | 0.4 | GO:0052805 | histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
| 0.1 | 0.2 | GO:0015760 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.1 | 0.2 | GO:1902990 | mitotic telomere maintenance via semi-conservative replication(GO:1902990) |
| 0.1 | 1.7 | GO:1902042 | negative regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902042) |
| 0.1 | 0.2 | GO:0045869 | negative regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045869) |
| 0.1 | 0.2 | GO:0090290 | positive regulation of osteoclast proliferation(GO:0090290) |
| 0.1 | 0.3 | GO:0043622 | cortical microtubule organization(GO:0043622) |
| 0.1 | 0.4 | GO:2001181 | positive regulation of interleukin-10 secretion(GO:2001181) |
| 0.1 | 0.3 | GO:0018916 | nitrobenzene metabolic process(GO:0018916) |
| 0.1 | 0.3 | GO:0010748 | negative regulation of plasma membrane long-chain fatty acid transport(GO:0010748) |
| 0.1 | 0.2 | GO:0035771 | interleukin-4-mediated signaling pathway(GO:0035771) |
| 0.1 | 0.2 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.1 | 0.1 | GO:0007403 | glial cell fate determination(GO:0007403) |
| 0.1 | 0.3 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
| 0.1 | 0.2 | GO:2001274 | negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
| 0.1 | 0.4 | GO:1901678 | iron coordination entity transport(GO:1901678) |
| 0.1 | 0.3 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) |
| 0.1 | 0.1 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
| 0.1 | 0.2 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
| 0.1 | 0.2 | GO:0010482 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
| 0.1 | 0.1 | GO:0002432 | granuloma formation(GO:0002432) |
| 0.1 | 0.5 | GO:0034374 | low-density lipoprotein particle remodeling(GO:0034374) |
| 0.1 | 0.5 | GO:2001185 | regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
| 0.1 | 0.2 | GO:0061030 | epithelial cell differentiation involved in mammary gland alveolus development(GO:0061030) |
| 0.1 | 0.5 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
| 0.1 | 0.2 | GO:1903898 | negative regulation of PERK-mediated unfolded protein response(GO:1903898) |
| 0.1 | 0.2 | GO:0048162 | preantral ovarian follicle growth(GO:0001546) multi-layer follicle stage(GO:0048162) |
| 0.1 | 0.3 | GO:1902894 | negative regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902894) |
| 0.1 | 0.2 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
| 0.1 | 0.1 | GO:0035984 | response to trichostatin A(GO:0035983) cellular response to trichostatin A(GO:0035984) |
| 0.1 | 0.2 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
| 0.1 | 0.5 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
| 0.1 | 0.3 | GO:0015884 | folic acid transport(GO:0015884) |
| 0.1 | 0.2 | GO:0010912 | regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) |
| 0.1 | 0.4 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
| 0.1 | 0.2 | GO:2000832 | negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
| 0.1 | 0.1 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
| 0.1 | 0.3 | GO:0015722 | canalicular bile acid transport(GO:0015722) |
| 0.1 | 0.2 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 0.2 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
| 0.1 | 0.2 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
| 0.1 | 0.2 | GO:0044034 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 0.1 | 0.2 | GO:1901030 | positive regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901030) |
| 0.1 | 0.2 | GO:2000110 | negative regulation of macrophage apoptotic process(GO:2000110) |
| 0.1 | 0.5 | GO:0007097 | nuclear migration(GO:0007097) |
| 0.1 | 0.2 | GO:0051791 | medium-chain fatty acid metabolic process(GO:0051791) |
| 0.1 | 0.2 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
| 0.1 | 0.1 | GO:1903750 | regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903750) negative regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903751) |
| 0.1 | 0.2 | GO:1903142 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
| 0.1 | 0.2 | GO:0070574 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.1 | 0.3 | GO:0045345 | MHC class I biosynthetic process(GO:0045341) regulation of MHC class I biosynthetic process(GO:0045343) positive regulation of MHC class I biosynthetic process(GO:0045345) |
| 0.1 | 0.3 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
| 0.1 | 0.1 | GO:0090081 | regulation of heart induction by regulation of canonical Wnt signaling pathway(GO:0090081) |
| 0.1 | 0.2 | GO:0098728 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.1 | 0.1 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
| 0.1 | 0.4 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) |
| 0.1 | 0.3 | GO:0072675 | multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
| 0.1 | 0.1 | GO:0051182 | coenzyme transport(GO:0051182) |
| 0.1 | 0.2 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
| 0.1 | 0.2 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
| 0.1 | 0.1 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
| 0.1 | 0.3 | GO:0010991 | negative regulation of SMAD protein complex assembly(GO:0010991) |
| 0.1 | 0.2 | GO:0070587 | negative regulation of heterotypic cell-cell adhesion(GO:0034115) regulation of cell-cell adhesion involved in gastrulation(GO:0070587) |
| 0.1 | 0.5 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
| 0.1 | 0.4 | GO:0042904 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 0.1 | 0.3 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
| 0.1 | 0.2 | GO:0060468 | prevention of polyspermy(GO:0060468) |
| 0.1 | 0.4 | GO:0031340 | positive regulation of vesicle fusion(GO:0031340) |
| 0.1 | 0.1 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
| 0.1 | 0.3 | GO:0001835 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
| 0.1 | 0.3 | GO:1903689 | regulation of wound healing, spreading of epidermal cells(GO:1903689) |
| 0.1 | 0.1 | GO:2000721 | positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
| 0.1 | 0.2 | GO:0048014 | Tie signaling pathway(GO:0048014) |
| 0.1 | 0.2 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.1 | 0.2 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
| 0.1 | 0.2 | GO:0045415 | negative regulation of interleukin-8 biosynthetic process(GO:0045415) |
| 0.1 | 0.6 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
| 0.1 | 0.2 | GO:0072310 | glomerular visceral epithelial cell development(GO:0072015) glomerular epithelial cell development(GO:0072310) |
| 0.1 | 0.1 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
| 0.1 | 0.1 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
| 0.1 | 0.3 | GO:0050651 | dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
| 0.0 | 0.1 | GO:0072197 | ureter morphogenesis(GO:0072197) |
| 0.0 | 0.2 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
| 0.0 | 0.2 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
| 0.0 | 0.1 | GO:0061511 | centriole elongation(GO:0061511) |
| 0.0 | 0.2 | GO:0014745 | negative regulation of muscle adaptation(GO:0014745) |
| 0.0 | 0.3 | GO:0090051 | negative regulation of cell migration involved in sprouting angiogenesis(GO:0090051) |
| 0.0 | 0.6 | GO:0006555 | methionine metabolic process(GO:0006555) |
| 0.0 | 0.3 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
| 0.0 | 0.3 | GO:0010310 | regulation of hydrogen peroxide metabolic process(GO:0010310) |
| 0.0 | 0.1 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
| 0.0 | 0.1 | GO:0048294 | negative regulation of isotype switching to IgE isotypes(GO:0048294) |
| 0.0 | 0.1 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
| 0.0 | 0.1 | GO:0038161 | prolactin signaling pathway(GO:0038161) |
| 0.0 | 0.4 | GO:0071493 | cellular response to UV-B(GO:0071493) |
| 0.0 | 0.2 | GO:0080009 | mRNA methylation(GO:0080009) |
| 0.0 | 0.3 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
| 0.0 | 0.2 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
| 0.0 | 0.1 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
| 0.0 | 0.2 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
| 0.0 | 0.1 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
| 0.0 | 0.0 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
| 0.0 | 0.1 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
| 0.0 | 0.0 | GO:2000586 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
| 0.0 | 0.0 | GO:0032201 | telomere maintenance via semi-conservative replication(GO:0032201) |
| 0.0 | 0.3 | GO:0060897 | neural plate anterior/posterior regionalization(GO:0021999) neural plate regionalization(GO:0060897) |
| 0.0 | 0.5 | GO:0042415 | norepinephrine metabolic process(GO:0042415) |
| 0.0 | 0.2 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
| 0.0 | 0.1 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
| 0.0 | 0.5 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
| 0.0 | 0.9 | GO:0048011 | neurotrophin TRK receptor signaling pathway(GO:0048011) |
| 0.0 | 0.3 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
| 0.0 | 0.2 | GO:0048702 | embryonic neurocranium morphogenesis(GO:0048702) |
| 0.0 | 0.0 | GO:0033088 | negative regulation of immature T cell proliferation in thymus(GO:0033088) |
| 0.0 | 0.1 | GO:0048295 | positive regulation of isotype switching to IgE isotypes(GO:0048295) |
| 0.0 | 0.1 | GO:0071455 | cellular response to increased oxygen levels(GO:0036295) cellular response to hyperoxia(GO:0071455) |
| 0.0 | 0.1 | GO:0003223 | ventricular compact myocardium morphogenesis(GO:0003223) |
| 0.0 | 0.1 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
| 0.0 | 0.0 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
| 0.0 | 0.2 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
| 0.0 | 0.3 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
| 0.0 | 0.3 | GO:0045603 | positive regulation of endothelial cell differentiation(GO:0045603) |
| 0.0 | 0.1 | GO:0002331 | pre-B cell allelic exclusion(GO:0002331) |
| 0.0 | 0.2 | GO:0006566 | threonine metabolic process(GO:0006566) |
| 0.0 | 0.5 | GO:0051895 | negative regulation of focal adhesion assembly(GO:0051895) |
| 0.0 | 0.1 | GO:0090086 | negative regulation of protein deubiquitination(GO:0090086) |
| 0.0 | 0.1 | GO:1903521 | apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
| 0.0 | 0.4 | GO:0048199 | vesicle targeting, to, from or within Golgi(GO:0048199) |
| 0.0 | 0.2 | GO:2000169 | regulation of peptidyl-cysteine S-nitrosylation(GO:2000169) |
| 0.0 | 0.1 | GO:0060355 | positive regulation of cell adhesion molecule production(GO:0060355) |
| 0.0 | 0.1 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
| 0.0 | 0.0 | GO:0034770 | histone H4-K20 methylation(GO:0034770) |
| 0.0 | 0.0 | GO:0072104 | glomerulus vasculature morphogenesis(GO:0072103) glomerular capillary formation(GO:0072104) metanephric glomerulus morphogenesis(GO:0072275) metanephric glomerulus vasculature morphogenesis(GO:0072276) metanephric glomerular capillary formation(GO:0072277) |
| 0.0 | 0.2 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
| 0.0 | 0.2 | GO:0033136 | serine phosphorylation of STAT3 protein(GO:0033136) |
| 0.0 | 0.0 | GO:2000040 | regulation of planar cell polarity pathway involved in axis elongation(GO:2000040) negative regulation of planar cell polarity pathway involved in axis elongation(GO:2000041) |
| 0.0 | 0.1 | GO:0070094 | positive regulation of glucagon secretion(GO:0070094) |
| 0.0 | 0.3 | GO:0071404 | cellular response to low-density lipoprotein particle stimulus(GO:0071404) |
| 0.0 | 0.1 | GO:0006768 | biotin metabolic process(GO:0006768) |
| 0.0 | 0.1 | GO:1903659 | regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
| 0.0 | 0.2 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
| 0.0 | 0.4 | GO:0002024 | diet induced thermogenesis(GO:0002024) adaptive thermogenesis(GO:1990845) |
| 0.0 | 0.1 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
| 0.0 | 0.4 | GO:0006817 | phosphate ion transport(GO:0006817) |
| 0.0 | 0.0 | GO:0045080 | positive regulation of chemokine biosynthetic process(GO:0045080) |
| 0.0 | 0.3 | GO:1902510 | regulation of apoptotic DNA fragmentation(GO:1902510) |
| 0.0 | 0.0 | GO:0006524 | alanine catabolic process(GO:0006524) pyruvate family amino acid catabolic process(GO:0009080) |
| 0.0 | 0.0 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
| 0.0 | 0.1 | GO:1902566 | regulation of eosinophil activation(GO:1902566) |
| 0.0 | 0.2 | GO:0060334 | regulation of interferon-gamma-mediated signaling pathway(GO:0060334) |
| 0.0 | 0.2 | GO:0014827 | intestine smooth muscle contraction(GO:0014827) |
| 0.0 | 0.0 | GO:2000698 | positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) |
| 0.0 | 0.2 | GO:0051204 | protein insertion into mitochondrial membrane(GO:0051204) |
| 0.0 | 0.0 | GO:1901970 | positive regulation of mitotic sister chromatid separation(GO:1901970) |
| 0.0 | 0.1 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.0 | 0.1 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.0 | 0.1 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
| 0.0 | 0.1 | GO:0051771 | negative regulation of nitric-oxide synthase biosynthetic process(GO:0051771) |
| 0.0 | 0.1 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.0 | 0.1 | GO:0030210 | heparin biosynthetic process(GO:0030210) |
| 0.0 | 0.1 | GO:0010637 | negative regulation of mitochondrial fusion(GO:0010637) |
| 0.0 | 0.1 | GO:0071286 | cellular response to magnesium ion(GO:0071286) |
| 0.0 | 0.1 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
| 0.0 | 0.0 | GO:0032025 | response to cobalt ion(GO:0032025) |
| 0.0 | 0.2 | GO:0006528 | asparagine metabolic process(GO:0006528) |
| 0.0 | 0.2 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
| 0.0 | 0.1 | GO:0060066 | oviduct development(GO:0060066) |
| 0.0 | 0.1 | GO:1904528 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
| 0.0 | 0.4 | GO:0002115 | store-operated calcium entry(GO:0002115) |
| 0.0 | 0.2 | GO:0042637 | catagen(GO:0042637) |
| 0.0 | 0.1 | GO:2001269 | positive regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001269) |
| 0.0 | 0.2 | GO:0098722 | asymmetric stem cell division(GO:0098722) |
| 0.0 | 0.1 | GO:0015825 | L-serine transport(GO:0015825) |
| 0.0 | 0.1 | GO:0002756 | MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
| 0.0 | 0.1 | GO:2000773 | negative regulation of cellular senescence(GO:2000773) |
| 0.0 | 0.1 | GO:0050955 | thermoception(GO:0050955) |
| 0.0 | 0.1 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
| 0.0 | 0.0 | GO:0055093 | response to increased oxygen levels(GO:0036296) response to hyperoxia(GO:0055093) |
| 0.0 | 0.2 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.0 | 0.1 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
| 0.0 | 0.1 | GO:2000553 | positive regulation of T-helper 2 cell cytokine production(GO:2000553) |
| 0.0 | 0.2 | GO:0090232 | positive regulation of spindle checkpoint(GO:0090232) |
| 0.0 | 0.3 | GO:0002934 | desmosome organization(GO:0002934) |
| 0.0 | 0.1 | GO:0019660 | fermentation(GO:0006113) glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
| 0.0 | 0.1 | GO:0048478 | replication fork protection(GO:0048478) |
| 0.0 | 0.0 | GO:0055118 | negative regulation of cardiac muscle contraction(GO:0055118) |
| 0.0 | 0.1 | GO:0006046 | N-acetylglucosamine catabolic process(GO:0006046) |
| 0.0 | 0.2 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
| 0.0 | 0.2 | GO:0006361 | transcription initiation from RNA polymerase I promoter(GO:0006361) |
| 0.0 | 0.2 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
| 0.0 | 0.2 | GO:0060770 | negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
| 0.0 | 0.1 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
| 0.0 | 0.1 | GO:0006106 | fumarate metabolic process(GO:0006106) |
| 0.0 | 0.1 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
| 0.0 | 0.1 | GO:1902608 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
| 0.0 | 0.2 | GO:0048752 | semicircular canal morphogenesis(GO:0048752) |
| 0.0 | 0.4 | GO:0006825 | copper ion transport(GO:0006825) |
| 0.0 | 0.3 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
| 0.0 | 0.1 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.0 | 0.1 | GO:0033499 | galactose catabolic process via UDP-galactose(GO:0033499) glycolytic process from galactose(GO:0061623) |
| 0.0 | 0.1 | GO:1902170 | cellular response to reactive nitrogen species(GO:1902170) |
| 0.0 | 0.0 | GO:0032762 | mast cell cytokine production(GO:0032762) |
| 0.0 | 0.2 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
| 0.0 | 0.2 | GO:0046415 | urate metabolic process(GO:0046415) |
| 0.0 | 0.1 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
| 0.0 | 0.2 | GO:0046218 | tryptophan catabolic process(GO:0006569) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) |
| 0.0 | 0.1 | GO:0015888 | thiamine transport(GO:0015888) |
| 0.0 | 0.6 | GO:0006221 | pyrimidine nucleotide biosynthetic process(GO:0006221) |
| 0.0 | 0.1 | GO:0042790 | transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:0042790) |
| 0.0 | 0.3 | GO:0051873 | disruption by host of symbiont cells(GO:0051852) killing by host of symbiont cells(GO:0051873) |
| 0.0 | 0.0 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
| 0.0 | 0.1 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
| 0.0 | 0.3 | GO:0060213 | regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
| 0.0 | 0.0 | GO:0071888 | macrophage apoptotic process(GO:0071888) regulation of macrophage apoptotic process(GO:2000109) |
| 0.0 | 0.1 | GO:0002282 | microglial cell activation involved in immune response(GO:0002282) |
| 0.0 | 0.1 | GO:2000054 | negative regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000054) |
| 0.0 | 0.1 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
| 0.0 | 0.2 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.0 | 0.1 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
| 0.0 | 0.1 | GO:1904378 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 0.0 | 0.1 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
| 0.0 | 0.1 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
| 0.0 | 0.7 | GO:0018023 | peptidyl-lysine trimethylation(GO:0018023) |
| 0.0 | 0.3 | GO:0061000 | negative regulation of dendritic spine development(GO:0061000) |
| 0.0 | 0.2 | GO:0050957 | equilibrioception(GO:0050957) |
| 0.0 | 0.0 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
| 0.0 | 0.0 | GO:0060061 | Spemann organizer formation(GO:0060061) |
| 0.0 | 0.0 | GO:0009078 | alanine metabolic process(GO:0006522) pyruvate family amino acid metabolic process(GO:0009078) |
| 0.0 | 0.1 | GO:0031507 | heterochromatin assembly(GO:0031507) |
| 0.0 | 0.0 | GO:0052204 | modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) |
| 0.0 | 0.1 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
| 0.0 | 0.1 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.0 | 0.1 | GO:0018103 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.0 | 0.2 | GO:1900264 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.0 | 0.2 | GO:0097237 | cellular response to toxic substance(GO:0097237) |
| 0.0 | 0.1 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
| 0.0 | 0.1 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.0 | 0.1 | GO:0071351 | cellular response to interleukin-18(GO:0071351) |
| 0.0 | 0.2 | GO:0086036 | regulation of cardiac muscle cell membrane potential(GO:0086036) |
| 0.0 | 0.4 | GO:0006098 | pentose-phosphate shunt(GO:0006098) |
| 0.0 | 0.1 | GO:2001267 | regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001267) |
| 0.0 | 0.1 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
| 0.0 | 0.1 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
| 0.0 | 0.1 | GO:0008291 | acetylcholine metabolic process(GO:0008291) acetate ester metabolic process(GO:1900619) |
| 0.0 | 0.1 | GO:1901797 | negative regulation of signal transduction by p53 class mediator(GO:1901797) negative regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902254) |
| 0.0 | 0.1 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
| 0.0 | 0.1 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
| 0.0 | 0.2 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
| 0.0 | 0.1 | GO:0090310 | negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
| 0.0 | 0.1 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
| 0.0 | 0.1 | GO:0009396 | folic acid-containing compound biosynthetic process(GO:0009396) |
| 0.0 | 0.0 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
| 0.0 | 0.1 | GO:0046836 | glycolipid transport(GO:0046836) |
| 0.0 | 0.2 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
| 0.0 | 0.1 | GO:0097195 | pilomotor reflex(GO:0097195) |
| 0.0 | 0.1 | GO:0043562 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.0 | 0.0 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
| 0.0 | 0.1 | GO:0006678 | glucosylceramide metabolic process(GO:0006678) |
| 0.0 | 0.1 | GO:2000323 | negative regulation of glucocorticoid receptor signaling pathway(GO:2000323) |
| 0.0 | 0.0 | GO:1902263 | apoptotic process involved in embryonic digit morphogenesis(GO:1902263) |
| 0.0 | 0.2 | GO:0034625 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.0 | 0.1 | GO:0090308 | regulation of methylation-dependent chromatin silencing(GO:0090308) |
| 0.0 | 0.1 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
| 0.0 | 0.1 | GO:0016576 | histone dephosphorylation(GO:0016576) |
| 0.0 | 0.1 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
| 0.0 | 0.3 | GO:0034063 | stress granule assembly(GO:0034063) |
| 0.0 | 0.1 | GO:0043619 | regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0043619) |
| 0.0 | 0.1 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
| 0.0 | 0.1 | GO:0032345 | negative regulation of aldosterone metabolic process(GO:0032345) negative regulation of aldosterone biosynthetic process(GO:0032348) negative regulation of cortisol biosynthetic process(GO:2000065) |
| 0.0 | 0.3 | GO:0072422 | signal transduction involved in cell cycle checkpoint(GO:0072395) signal transduction involved in DNA integrity checkpoint(GO:0072401) signal transduction involved in DNA damage checkpoint(GO:0072422) |
| 0.0 | 0.2 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
| 0.0 | 0.0 | GO:0044337 | canonical Wnt signaling pathway involved in positive regulation of apoptotic process(GO:0044337) |
| 0.0 | 0.1 | GO:0019720 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
| 0.0 | 0.0 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.0 | 0.1 | GO:0016139 | glycoside catabolic process(GO:0016139) |
| 0.0 | 0.1 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
| 0.0 | 0.0 | GO:0010901 | regulation of very-low-density lipoprotein particle remodeling(GO:0010901) |
| 0.0 | 0.1 | GO:0010898 | positive regulation of triglyceride catabolic process(GO:0010898) |
| 0.0 | 0.1 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
| 0.0 | 0.3 | GO:0006071 | glycerol metabolic process(GO:0006071) |
| 0.0 | 0.0 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
| 0.0 | 0.1 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
| 0.0 | 0.0 | GO:0061550 | cranial ganglion development(GO:0061550) trigeminal ganglion development(GO:0061551) |
| 0.0 | 0.1 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
| 0.0 | 0.2 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
| 0.0 | 0.1 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
| 0.0 | 0.5 | GO:0036075 | endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
| 0.0 | 0.1 | GO:2000254 | regulation of male germ cell proliferation(GO:2000254) |
| 0.0 | 0.1 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
| 0.0 | 0.1 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
| 0.0 | 0.0 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
| 0.0 | 0.1 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
| 0.0 | 0.0 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
| 0.0 | 0.0 | GO:0050904 | diapedesis(GO:0050904) |
| 0.0 | 0.1 | GO:0010917 | negative regulation of mitochondrial membrane potential(GO:0010917) |
| 0.0 | 0.2 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.0 | 0.1 | GO:0019532 | oxalate transport(GO:0019532) |
| 0.0 | 0.0 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
| 0.0 | 0.1 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.0 | 0.2 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
| 0.0 | 0.2 | GO:0039702 | viral budding via host ESCRT complex(GO:0039702) |
| 0.0 | 0.1 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
| 0.0 | 0.2 | GO:0070257 | positive regulation of mucus secretion(GO:0070257) |
| 0.0 | 0.1 | GO:0048069 | eye pigmentation(GO:0048069) |
| 0.0 | 0.3 | GO:0006349 | regulation of gene expression by genetic imprinting(GO:0006349) |
| 0.0 | 0.1 | GO:0007060 | male meiosis chromosome segregation(GO:0007060) |
| 0.0 | 0.1 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
| 0.0 | 0.0 | GO:0045590 | negative regulation of regulatory T cell differentiation(GO:0045590) |
| 0.0 | 0.1 | GO:0070885 | negative regulation of calcineurin-NFAT signaling cascade(GO:0070885) |
| 0.0 | 0.4 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
| 0.0 | 0.7 | GO:0016239 | positive regulation of macroautophagy(GO:0016239) |
| 0.0 | 0.1 | GO:0006930 | substrate-dependent cell migration, cell extension(GO:0006930) |
| 0.0 | 0.0 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
| 0.0 | 0.0 | GO:0015747 | urate transport(GO:0015747) |
| 0.0 | 0.1 | GO:0009629 | response to gravity(GO:0009629) |
| 0.0 | 0.2 | GO:0006577 | amino-acid betaine metabolic process(GO:0006577) |
| 0.0 | 0.1 | GO:0060398 | regulation of growth hormone receptor signaling pathway(GO:0060398) |
| 0.0 | 0.0 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
| 0.0 | 0.2 | GO:0042772 | DNA damage response, signal transduction resulting in transcription(GO:0042772) |
| 0.0 | 0.3 | GO:0032095 | regulation of response to food(GO:0032095) |
| 0.0 | 0.1 | GO:0071895 | odontoblast differentiation(GO:0071895) |
| 0.0 | 0.2 | GO:0009143 | nucleoside triphosphate catabolic process(GO:0009143) |
| 0.0 | 0.1 | GO:0046487 | glyoxylate metabolic process(GO:0046487) |
| 0.0 | 0.0 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
| 0.0 | 0.1 | GO:0060480 | lung goblet cell differentiation(GO:0060480) |
| 0.0 | 0.2 | GO:0000012 | single strand break repair(GO:0000012) |
| 0.0 | 0.0 | GO:0036481 | intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:0036481) |
| 0.0 | 0.1 | GO:0010993 | regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
| 0.0 | 0.1 | GO:0071318 | cellular response to ATP(GO:0071318) |
| 0.0 | 0.0 | GO:0019054 | modulation by virus of host process(GO:0019054) |
| 0.0 | 0.1 | GO:0060988 | lipid tube assembly(GO:0060988) |
| 0.0 | 0.0 | GO:0033599 | regulation of mammary gland epithelial cell proliferation(GO:0033599) |
| 0.0 | 0.1 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.0 | 0.1 | GO:0030300 | regulation of intestinal cholesterol absorption(GO:0030300) |
| 0.0 | 0.1 | GO:0098814 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
| 0.0 | 0.4 | GO:0032781 | positive regulation of ATPase activity(GO:0032781) |
| 0.0 | 0.1 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.0 | 0.0 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
| 0.0 | 0.0 | GO:0010796 | regulation of multivesicular body size(GO:0010796) |
| 0.0 | 0.1 | GO:0033184 | positive regulation of histone ubiquitination(GO:0033184) |
| 0.0 | 0.2 | GO:0042574 | retinal metabolic process(GO:0042574) |
| 0.0 | 0.1 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
| 0.0 | 0.1 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
| 0.0 | 0.1 | GO:0046541 | saliva secretion(GO:0046541) |
| 0.0 | 0.1 | GO:0015755 | fructose transport(GO:0015755) |
| 0.0 | 0.1 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
| 0.0 | 0.0 | GO:0045876 | positive regulation of sister chromatid cohesion(GO:0045876) |
| 0.0 | 0.2 | GO:0060765 | regulation of androgen receptor signaling pathway(GO:0060765) |
| 0.0 | 0.1 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
| 0.0 | 0.1 | GO:0021571 | rhombomere 5 development(GO:0021571) |
| 0.0 | 0.0 | GO:0060139 | induction of programmed cell death(GO:0012502) positive regulation of apoptotic process in other organism(GO:0044533) positive regulation by symbiont of host programmed cell death(GO:0052042) positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052330) positive regulation by organism of apoptotic process in other organism involved in symbiotic interaction(GO:0052501) positive regulation of apoptotic process by virus(GO:0060139) |
| 0.0 | 0.0 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
| 0.0 | 0.3 | GO:0051491 | positive regulation of filopodium assembly(GO:0051491) |
| 0.0 | 0.0 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
| 0.0 | 0.0 | GO:0001757 | somite specification(GO:0001757) |
| 0.0 | 0.2 | GO:0000303 | response to superoxide(GO:0000303) |
| 0.0 | 0.0 | GO:0070255 | regulation of mucus secretion(GO:0070255) |
| 0.0 | 0.0 | GO:0048382 | mesendoderm development(GO:0048382) |
| 0.0 | 0.0 | GO:0043321 | regulation of natural killer cell degranulation(GO:0043321) |
| 0.0 | 0.7 | GO:0006749 | glutathione metabolic process(GO:0006749) |
| 0.0 | 0.0 | GO:0060282 | positive regulation of oocyte development(GO:0060282) |
| 0.0 | 0.0 | GO:1900242 | regulation of synaptic vesicle endocytosis(GO:1900242) |
| 0.0 | 0.1 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.0 | 0.1 | GO:0033194 | response to hydroperoxide(GO:0033194) |
| 0.0 | 0.1 | GO:0098903 | regulation of membrane repolarization during action potential(GO:0098903) |
| 0.0 | 0.2 | GO:0046040 | IMP metabolic process(GO:0046040) |
| 0.0 | 0.0 | GO:0033861 | negative regulation of NAD(P)H oxidase activity(GO:0033861) |
| 0.0 | 0.1 | GO:0008215 | spermine metabolic process(GO:0008215) |
| 0.0 | 0.0 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
| 0.0 | 0.1 | GO:0044789 | modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) |
| 0.0 | 0.5 | GO:0043616 | keratinocyte proliferation(GO:0043616) |
| 0.0 | 0.2 | GO:0043518 | negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
| 0.0 | 0.0 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.0 | 0.1 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
| 0.0 | 0.1 | GO:0035279 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
| 0.0 | 0.1 | GO:0099558 | maintenance of synapse structure(GO:0099558) |
| 0.0 | 0.0 | GO:0002838 | negative regulation of response to tumor cell(GO:0002835) negative regulation of immune response to tumor cell(GO:0002838) |
| 0.0 | 0.0 | GO:0002765 | immune response-inhibiting signal transduction(GO:0002765) |
| 0.0 | 0.4 | GO:0002089 | lens morphogenesis in camera-type eye(GO:0002089) |
| 0.0 | 0.2 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.0 | 0.3 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
| 0.0 | 0.1 | GO:0042136 | neurotransmitter biosynthetic process(GO:0042136) |
| 0.0 | 0.0 | GO:0032789 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
| 0.0 | 0.0 | GO:0009972 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
| 0.0 | 0.1 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
| 0.0 | 0.1 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
| 0.0 | 0.0 | GO:0007529 | establishment of synaptic specificity at neuromuscular junction(GO:0007529) |
| 0.0 | 0.2 | GO:0001771 | immunological synapse formation(GO:0001771) |
| 0.0 | 0.1 | GO:0072095 | regulation of branch elongation involved in ureteric bud branching(GO:0072095) |
| 0.0 | 0.2 | GO:1904355 | positive regulation of telomere capping(GO:1904355) |
| 0.0 | 0.1 | GO:0097012 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) response to granulocyte macrophage colony-stimulating factor(GO:0097012) |
| 0.0 | 0.0 | GO:2000561 | regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000561) |
| 0.0 | 0.6 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
| 0.0 | 0.1 | GO:0060717 | chorion development(GO:0060717) extraembryonic membrane development(GO:1903867) |
| 0.0 | 0.1 | GO:0021800 | cerebral cortex tangential migration(GO:0021800) |
| 0.0 | 0.1 | GO:0033152 | immunoglobulin V(D)J recombination(GO:0033152) |
| 0.0 | 0.1 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
| 0.0 | 0.0 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.0 | 0.1 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
| 0.0 | 0.0 | GO:1904180 | negative regulation of membrane depolarization(GO:1904180) |
| 0.0 | 0.0 | GO:0051799 | negative regulation of hair follicle development(GO:0051799) |
| 0.0 | 0.1 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 0.0 | 0.2 | GO:0051205 | protein insertion into membrane(GO:0051205) |
| 0.0 | 0.0 | GO:0046134 | pyrimidine nucleoside biosynthetic process(GO:0046134) |
| 0.0 | 0.1 | GO:0060340 | positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
| 0.0 | 0.1 | GO:0017014 | protein nitrosylation(GO:0017014) |
| 0.0 | 0.1 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
| 0.0 | 0.1 | GO:0001842 | neural fold formation(GO:0001842) |
| 0.0 | 0.0 | GO:0003180 | aortic valve development(GO:0003176) aortic valve morphogenesis(GO:0003180) |
| 0.0 | 0.2 | GO:0031639 | plasminogen activation(GO:0031639) |
| 0.0 | 0.1 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.0 | 0.1 | GO:0051610 | serotonin uptake(GO:0051610) |
| 0.0 | 0.3 | GO:0071385 | cellular response to glucocorticoid stimulus(GO:0071385) |
| 0.0 | 0.1 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
| 0.0 | 0.2 | GO:0030828 | positive regulation of cGMP biosynthetic process(GO:0030828) |
| 0.0 | 0.1 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.0 | 0.5 | GO:0035456 | response to interferon-beta(GO:0035456) |
| 0.0 | 0.1 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
| 0.0 | 0.1 | GO:2001245 | regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
| 0.0 | 0.0 | GO:0035928 | rRNA import into mitochondrion(GO:0035928) |
| 0.0 | 0.2 | GO:0048488 | synaptic vesicle endocytosis(GO:0048488) |
| 0.0 | 0.2 | GO:0042036 | negative regulation of cytokine biosynthetic process(GO:0042036) |
| 0.0 | 0.0 | GO:0060084 | synaptic transmission involved in micturition(GO:0060084) |
| 0.0 | 0.0 | GO:0009155 | purine deoxyribonucleotide catabolic process(GO:0009155) |
| 0.0 | 0.0 | GO:0071500 | cellular response to nitrosative stress(GO:0071500) |
| 0.0 | 0.1 | GO:0032494 | response to peptidoglycan(GO:0032494) |
| 0.0 | 0.0 | GO:1902075 | cellular response to salt(GO:1902075) |
| 0.0 | 0.0 | GO:0071879 | positive regulation of adrenergic receptor signaling pathway(GO:0071879) |
| 0.0 | 0.0 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
| 0.0 | 0.0 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
| 0.0 | 0.0 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.0 | 0.0 | GO:0030885 | regulation of myeloid dendritic cell activation(GO:0030885) |
| 0.0 | 0.0 | GO:0042374 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
| 0.0 | 0.1 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
| 0.0 | 0.1 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.0 | 0.0 | GO:0019287 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.0 | 0.0 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
| 0.0 | 0.0 | GO:0070384 | Harderian gland development(GO:0070384) |
| 0.0 | 0.0 | GO:0032815 | negative regulation of natural killer cell activation(GO:0032815) |
| 0.0 | 0.0 | GO:0061643 | chemorepulsion of axon(GO:0061643) |
| 0.0 | 0.1 | GO:0042590 | antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
| 0.0 | 0.0 | GO:0035934 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
| 0.0 | 0.0 | GO:0016103 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
| 0.0 | 0.1 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
| 0.0 | 0.3 | GO:0006085 | acetyl-CoA biosynthetic process(GO:0006085) |
| 0.0 | 0.0 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
| 0.0 | 0.0 | GO:0044252 | negative regulation of multicellular organismal metabolic process(GO:0044252) |
| 0.0 | 0.1 | GO:0071670 | smooth muscle cell chemotaxis(GO:0071670) |
| 0.0 | 0.0 | GO:0071374 | cellular response to parathyroid hormone stimulus(GO:0071374) |
| 0.0 | 0.1 | GO:0070886 | positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
| 0.0 | 0.1 | GO:1900864 | mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
| 0.0 | 0.1 | GO:0006020 | inositol metabolic process(GO:0006020) |
| 0.0 | 0.0 | GO:0071847 | TNFSF11-mediated signaling pathway(GO:0071847) |
| 0.0 | 0.0 | GO:0090399 | replicative senescence(GO:0090399) |
| 0.0 | 0.1 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
| 0.0 | 0.0 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
| 0.0 | 0.0 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.0 | 0.0 | GO:0001302 | replicative cell aging(GO:0001302) |
| 0.0 | 0.0 | GO:1902033 | regulation of hematopoietic stem cell proliferation(GO:1902033) |
| 0.0 | 0.0 | GO:0010825 | positive regulation of centrosome duplication(GO:0010825) |
| 0.0 | 0.0 | GO:1903061 | positive regulation of protein lipidation(GO:1903061) |
| 0.0 | 0.0 | GO:0070782 | phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
| 0.0 | 0.0 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.0 | 0.2 | GO:2000785 | regulation of autophagosome assembly(GO:2000785) |
| 0.0 | 0.0 | GO:1904754 | positive regulation of vascular associated smooth muscle cell migration(GO:1904754) |
| 0.0 | 0.0 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
| 0.0 | 0.1 | GO:0032460 | negative regulation of protein oligomerization(GO:0032460) |
| 0.0 | 0.1 | GO:0051973 | positive regulation of telomerase activity(GO:0051973) |
| 0.0 | 0.1 | GO:0035988 | chondrocyte proliferation(GO:0035988) |
| 0.0 | 0.0 | GO:0097168 | mesenchymal stem cell proliferation(GO:0097168) |
| 0.0 | 0.1 | GO:0003105 | negative regulation of glomerular filtration(GO:0003105) |
| 0.0 | 0.0 | GO:0001951 | intestinal D-glucose absorption(GO:0001951) |
| 0.0 | 0.0 | GO:0036493 | positive regulation of translation in response to endoplasmic reticulum stress(GO:0036493) |
| 0.0 | 0.0 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
| 0.0 | 0.0 | GO:1904430 | negative regulation of t-circle formation(GO:1904430) |
| 0.0 | 0.1 | GO:0090201 | negative regulation of release of cytochrome c from mitochondria(GO:0090201) |
| 0.0 | 0.0 | GO:0030240 | skeletal muscle thin filament assembly(GO:0030240) |
| 0.0 | 0.1 | GO:0070314 | G1 to G0 transition(GO:0070314) |
| 0.0 | 0.0 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
| 0.0 | 0.0 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
| 0.0 | 0.1 | GO:0046349 | amino sugar biosynthetic process(GO:0046349) |
| 0.0 | 0.1 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
| 0.0 | 0.1 | GO:0045217 | cell-cell junction maintenance(GO:0045217) |
| 0.0 | 0.1 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
| 0.0 | 0.1 | GO:0097120 | receptor localization to synapse(GO:0097120) |
| 0.0 | 0.1 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) |
| 0.0 | 0.1 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.0 | 0.1 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
| 0.0 | 0.0 | GO:1904714 | regulation of chaperone-mediated autophagy(GO:1904714) |
| 0.0 | 0.2 | GO:0030521 | androgen receptor signaling pathway(GO:0030521) |
| 0.0 | 0.1 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
| 0.0 | 0.1 | GO:1902230 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902230) |
| 0.0 | 0.1 | GO:0061430 | bone trabecula morphogenesis(GO:0061430) |
| 0.0 | 0.1 | GO:0042713 | sperm ejaculation(GO:0042713) |
| 0.0 | 0.0 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
| 0.0 | 0.0 | GO:0071139 | resolution of recombination intermediates(GO:0071139) |
| 0.0 | 0.1 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
| 0.0 | 0.0 | GO:0009946 | proximal/distal axis specification(GO:0009946) |
| 0.0 | 0.0 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
| 0.0 | 0.1 | GO:0051295 | establishment of meiotic spindle localization(GO:0051295) |
| 0.0 | 0.2 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
| 0.0 | 0.0 | GO:2000535 | entry of bacterium into host cell(GO:0035635) regulation of entry of bacterium into host cell(GO:2000535) |
| 0.0 | 0.2 | GO:1900077 | negative regulation of cellular response to insulin stimulus(GO:1900077) |
| 0.0 | 0.1 | GO:0048680 | positive regulation of axon regeneration(GO:0048680) positive regulation of neuron projection regeneration(GO:0070572) |
| 0.0 | 0.0 | GO:0014842 | regulation of skeletal muscle satellite cell proliferation(GO:0014842) |
| 0.0 | 0.1 | GO:0046116 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.0 | 0.1 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 0.0 | 0.3 | GO:0006506 | GPI anchor biosynthetic process(GO:0006506) |
| 0.0 | 0.1 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.0 | 0.6 | GO:0032436 | positive regulation of proteasomal ubiquitin-dependent protein catabolic process(GO:0032436) |
| 0.0 | 0.0 | GO:0046831 | regulation of RNA export from nucleus(GO:0046831) |
| 0.0 | 0.3 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
| 0.0 | 0.0 | GO:2001198 | regulation of dendritic cell differentiation(GO:2001198) |
| 0.0 | 0.0 | GO:0045402 | interleukin-4 biosynthetic process(GO:0042097) regulation of interleukin-4 biosynthetic process(GO:0045402) positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
| 0.0 | 0.0 | GO:0003032 | detection of oxygen(GO:0003032) |
| 0.0 | 0.0 | GO:0032909 | transforming growth factor beta2 production(GO:0032906) regulation of transforming growth factor beta2 production(GO:0032909) |
| 0.0 | 0.1 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
| 0.0 | 0.0 | GO:2000618 | regulation of histone H4-K16 acetylation(GO:2000618) |
| 0.0 | 0.0 | GO:0000492 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
| 0.0 | 0.2 | GO:0021692 | cerebellar Purkinje cell layer morphogenesis(GO:0021692) |
| 0.0 | 0.3 | GO:0048843 | negative regulation of axon extension involved in axon guidance(GO:0048843) negative regulation of axon guidance(GO:1902668) |
| 0.0 | 0.2 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
| 0.0 | 0.0 | GO:0015867 | ATP transport(GO:0015867) |
| 0.0 | 0.2 | GO:0015701 | bicarbonate transport(GO:0015701) |
| 0.0 | 0.2 | GO:0045604 | regulation of epidermal cell differentiation(GO:0045604) |
| 0.0 | 0.1 | GO:0097284 | hepatocyte apoptotic process(GO:0097284) |
| 0.0 | 0.0 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
| 0.0 | 0.0 | GO:0045627 | positive regulation of T-helper 1 cell differentiation(GO:0045627) |
| 0.0 | 0.0 | GO:1903748 | negative regulation of establishment of protein localization to mitochondrion(GO:1903748) |
| 0.0 | 0.0 | GO:0009838 | abscission(GO:0009838) |
| 0.0 | 0.3 | GO:0046839 | phospholipid dephosphorylation(GO:0046839) |
| 0.0 | 0.0 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
| 0.0 | 0.0 | GO:0070350 | white fat cell proliferation(GO:0070343) regulation of white fat cell proliferation(GO:0070350) |
| 0.0 | 0.2 | GO:2001014 | regulation of skeletal muscle cell differentiation(GO:2001014) |
| 0.0 | 0.0 | GO:0002578 | negative regulation of antigen processing and presentation(GO:0002578) negative regulation of antigen processing and presentation of peptide antigen(GO:0002584) |
| 0.0 | 0.0 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
| 0.0 | 0.0 | GO:0035360 | positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
| 0.0 | 0.1 | GO:0017121 | phospholipid scrambling(GO:0017121) |
| 0.0 | 0.2 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.0 | 0.1 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
| 0.0 | 0.0 | GO:0046645 | positive regulation of gamma-delta T cell differentiation(GO:0045588) positive regulation of gamma-delta T cell activation(GO:0046645) |
| 0.0 | 0.2 | GO:0043392 | negative regulation of DNA binding(GO:0043392) |
| 0.0 | 0.0 | GO:0045897 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
| 0.0 | 0.1 | GO:0044819 | mitotic G1/S transition checkpoint(GO:0044819) |
| 0.0 | 0.1 | GO:0006501 | C-terminal protein lipidation(GO:0006501) |
| 0.0 | 0.1 | GO:0045955 | negative regulation of calcium ion-dependent exocytosis(GO:0045955) |
| 0.0 | 0.0 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
| 0.0 | 0.0 | GO:0071442 | positive regulation of histone H3-K14 acetylation(GO:0071442) |
| 0.0 | 0.1 | GO:0035518 | histone H2A monoubiquitination(GO:0035518) |
| 0.0 | 0.1 | GO:0006027 | glycosaminoglycan catabolic process(GO:0006027) |
| 0.0 | 0.0 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
| 0.0 | 0.0 | GO:0019081 | viral translation(GO:0019081) |
| 0.0 | 0.6 | GO:0010923 | negative regulation of phosphatase activity(GO:0010923) |
| 0.0 | 0.0 | GO:0048003 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
| 0.0 | 0.0 | GO:0008355 | olfactory learning(GO:0008355) |
| 0.0 | 0.0 | GO:0044778 | meiotic DNA integrity checkpoint(GO:0044778) |
| 0.0 | 0.0 | GO:0071462 | cellular response to water stimulus(GO:0071462) |
| 0.0 | 0.1 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
| 0.0 | 0.0 | GO:0090272 | negative regulation of fibroblast growth factor production(GO:0090272) |
| 0.0 | 0.2 | GO:0007026 | negative regulation of microtubule depolymerization(GO:0007026) |
| 0.0 | 0.0 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
| 0.0 | 0.3 | GO:0034605 | cellular response to heat(GO:0034605) |
| 0.0 | 0.0 | GO:1901798 | positive regulation of signal transduction by p53 class mediator(GO:1901798) |
| 0.0 | 0.1 | GO:1990776 | angiotensin-activated signaling pathway(GO:0038166) cellular response to angiotensin(GO:1904385) response to angiotensin(GO:1990776) |
| 0.0 | 0.1 | GO:0019240 | citrulline biosynthetic process(GO:0019240) |
| 0.0 | 0.0 | GO:0032829 | regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032829) |
| 0.0 | 0.0 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
| 0.0 | 0.3 | GO:1902476 | chloride transmembrane transport(GO:1902476) |
| 0.0 | 0.0 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
| 0.0 | 0.1 | GO:0014741 | negative regulation of muscle hypertrophy(GO:0014741) |
| 0.0 | 0.0 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
| 0.0 | 0.0 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
| 0.0 | 0.0 | GO:0030035 | microspike assembly(GO:0030035) |
| 0.0 | 0.1 | GO:0016056 | rhodopsin mediated signaling pathway(GO:0016056) |
| 0.0 | 0.0 | GO:0002309 | T cell proliferation involved in immune response(GO:0002309) |
| 0.0 | 0.0 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
| 0.0 | 0.0 | GO:0072319 | clathrin coat disassembly(GO:0072318) vesicle uncoating(GO:0072319) |
| 0.0 | 0.0 | GO:1903984 | regulation of TRAIL-activated apoptotic signaling pathway(GO:1903121) positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
| 0.0 | 0.1 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.5 | GO:0035355 | Toll-like receptor 2-Toll-like receptor 6 protein complex(GO:0035355) |
| 0.1 | 0.4 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
| 0.1 | 0.5 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
| 0.1 | 0.3 | GO:0035189 | Rb-E2F complex(GO:0035189) |
| 0.1 | 0.3 | GO:0044462 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
| 0.1 | 0.2 | GO:0036396 | MIS complex(GO:0036396) |
| 0.1 | 0.3 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
| 0.1 | 0.6 | GO:0030056 | hemidesmosome(GO:0030056) |
| 0.1 | 0.4 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.1 | 0.6 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.1 | 0.4 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.1 | 0.1 | GO:0032010 | phagolysosome(GO:0032010) |
| 0.1 | 0.2 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
| 0.1 | 0.2 | GO:0005767 | secondary lysosome(GO:0005767) |
| 0.1 | 0.2 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
| 0.1 | 0.2 | GO:0097443 | sorting endosome(GO:0097443) |
| 0.1 | 0.2 | GO:0036454 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
| 0.1 | 0.8 | GO:0031528 | microvillus membrane(GO:0031528) |
| 0.1 | 0.4 | GO:0005577 | fibrinogen complex(GO:0005577) |
| 0.1 | 0.1 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
| 0.1 | 0.4 | GO:0035748 | myelin sheath abaxonal region(GO:0035748) |
| 0.1 | 0.3 | GO:0032584 | growth cone membrane(GO:0032584) |
| 0.0 | 1.2 | GO:0008305 | integrin complex(GO:0008305) |
| 0.0 | 0.1 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
| 0.0 | 0.1 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.0 | 0.2 | GO:0044194 | cytolytic granule(GO:0044194) |
| 0.0 | 0.5 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.0 | 0.2 | GO:0036449 | microtubule minus-end(GO:0036449) |
| 0.0 | 0.2 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.0 | 0.8 | GO:0044217 | other organism(GO:0044215) other organism cell(GO:0044216) other organism part(GO:0044217) |
| 0.0 | 0.4 | GO:0036128 | CatSper complex(GO:0036128) |
| 0.0 | 0.2 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
| 0.0 | 0.1 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
| 0.0 | 0.5 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.0 | 0.2 | GO:0070820 | tertiary granule(GO:0070820) |
| 0.0 | 0.2 | GO:0042612 | MHC class I protein complex(GO:0042612) |
| 0.0 | 0.2 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
| 0.0 | 0.1 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
| 0.0 | 0.2 | GO:0008091 | spectrin(GO:0008091) |
| 0.0 | 0.2 | GO:0070847 | core mediator complex(GO:0070847) |
| 0.0 | 0.1 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
| 0.0 | 0.1 | GO:0005610 | laminin-5 complex(GO:0005610) |
| 0.0 | 0.6 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
| 0.0 | 0.2 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
| 0.0 | 0.2 | GO:0005796 | Golgi lumen(GO:0005796) |
| 0.0 | 0.1 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.0 | 0.3 | GO:0097539 | ciliary transition fiber(GO:0097539) |
| 0.0 | 0.2 | GO:0005688 | U6 snRNP(GO:0005688) |
| 0.0 | 0.2 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
| 0.0 | 0.2 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.0 | 1.3 | GO:0034707 | chloride channel complex(GO:0034707) |
| 0.0 | 0.1 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
| 0.0 | 0.1 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
| 0.0 | 0.2 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
| 0.0 | 0.1 | GO:1990923 | PET complex(GO:1990923) |
| 0.0 | 0.1 | GO:0031417 | NatC complex(GO:0031417) |
| 0.0 | 0.1 | GO:0045251 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
| 0.0 | 0.1 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
| 0.0 | 0.3 | GO:0017119 | Golgi transport complex(GO:0017119) |
| 0.0 | 0.4 | GO:0033391 | chromatoid body(GO:0033391) |
| 0.0 | 0.1 | GO:0061574 | ASAP complex(GO:0061574) |
| 0.0 | 0.1 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.0 | 0.2 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
| 0.0 | 0.1 | GO:0097513 | myosin II filament(GO:0097513) |
| 0.0 | 0.1 | GO:0072558 | NLRP1 inflammasome complex(GO:0072558) |
| 0.0 | 0.3 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
| 0.0 | 0.1 | GO:0030689 | Noc complex(GO:0030689) |
| 0.0 | 0.1 | GO:0005638 | lamin filament(GO:0005638) |
| 0.0 | 0.1 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
| 0.0 | 0.1 | GO:0030478 | actin cap(GO:0030478) |
| 0.0 | 0.3 | GO:0038201 | TOR complex(GO:0038201) |
| 0.0 | 0.1 | GO:0000811 | GINS complex(GO:0000811) |
| 0.0 | 0.2 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.0 | 0.2 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.0 | 0.4 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
| 0.0 | 0.4 | GO:0005605 | basal lamina(GO:0005605) |
| 0.0 | 0.2 | GO:0005883 | neurofilament(GO:0005883) |
| 0.0 | 0.1 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
| 0.0 | 0.1 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
| 0.0 | 0.0 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
| 0.0 | 0.3 | GO:0042599 | lamellar body(GO:0042599) |
| 0.0 | 0.1 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
| 0.0 | 0.1 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
| 0.0 | 0.2 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.0 | 0.2 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
| 0.0 | 0.1 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
| 0.0 | 0.1 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.0 | 0.1 | GO:0044326 | dendritic spine neck(GO:0044326) |
| 0.0 | 0.5 | GO:0034451 | centriolar satellite(GO:0034451) |
| 0.0 | 0.1 | GO:0000814 | ESCRT II complex(GO:0000814) |
| 0.0 | 0.1 | GO:0071547 | piP-body(GO:0071547) |
| 0.0 | 0.3 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.0 | 0.1 | GO:0034464 | BBSome(GO:0034464) |
| 0.0 | 0.2 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
| 0.0 | 0.1 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
| 0.0 | 0.5 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
| 0.0 | 0.1 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.0 | 0.1 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.0 | 0.1 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.0 | 0.0 | GO:0035838 | growing cell tip(GO:0035838) |
| 0.0 | 0.3 | GO:0000145 | exocyst(GO:0000145) |
| 0.0 | 0.1 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
| 0.0 | 0.0 | GO:0071141 | SMAD protein complex(GO:0071141) |
| 0.0 | 0.1 | GO:0034457 | Mpp10 complex(GO:0034457) |
| 0.0 | 0.1 | GO:0031523 | Myb complex(GO:0031523) |
| 0.0 | 0.3 | GO:0016010 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
| 0.0 | 0.6 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
| 0.0 | 0.1 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.0 | 0.1 | GO:0070531 | BRCA1-A complex(GO:0070531) |
| 0.0 | 0.7 | GO:0030864 | cortical actin cytoskeleton(GO:0030864) |
| 0.0 | 0.1 | GO:0005579 | membrane attack complex(GO:0005579) |
| 0.0 | 0.1 | GO:0036157 | outer dynein arm(GO:0036157) |
| 0.0 | 0.6 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
| 0.0 | 0.2 | GO:0033178 | proton-transporting two-sector ATPase complex, catalytic domain(GO:0033178) |
| 0.0 | 0.1 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.0 | 0.2 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
| 0.0 | 0.1 | GO:0002139 | stereocilia coupling link(GO:0002139) |
| 0.0 | 0.1 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.0 | 0.5 | GO:0005801 | cis-Golgi network(GO:0005801) |
| 0.0 | 0.0 | GO:0031261 | DNA replication preinitiation complex(GO:0031261) |
| 0.0 | 0.1 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
| 0.0 | 0.0 | GO:0045239 | tricarboxylic acid cycle enzyme complex(GO:0045239) |
| 0.0 | 0.2 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
| 0.0 | 0.3 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
| 0.0 | 0.0 | GO:1990761 | growth cone lamellipodium(GO:1990761) growth cone filopodium(GO:1990812) |
| 0.0 | 0.0 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.0 | 0.2 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
| 0.0 | 0.1 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.0 | 0.1 | GO:0005677 | chromatin silencing complex(GO:0005677) |
| 0.0 | 0.1 | GO:0043203 | axon hillock(GO:0043203) |
| 0.0 | 0.0 | GO:0035061 | interchromatin granule(GO:0035061) |
| 0.0 | 0.6 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
| 0.0 | 0.2 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.0 | 0.6 | GO:0031519 | PcG protein complex(GO:0031519) |
| 0.0 | 0.1 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.0 | 0.1 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
| 0.0 | 0.3 | GO:0035861 | site of double-strand break(GO:0035861) |
| 0.0 | 0.7 | GO:0031526 | brush border membrane(GO:0031526) |
| 0.0 | 0.1 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.0 | 0.1 | GO:0030130 | clathrin coat of trans-Golgi network vesicle(GO:0030130) |
| 0.0 | 0.0 | GO:0005712 | chiasma(GO:0005712) |
| 0.0 | 0.0 | GO:0042627 | chylomicron(GO:0042627) |
| 0.0 | 0.0 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.0 | 0.0 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.0 | 0.0 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
| 0.0 | 0.1 | GO:0031010 | ISWI-type complex(GO:0031010) |
| 0.0 | 0.1 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.0 | 0.0 | GO:0030125 | clathrin vesicle coat(GO:0030125) |
| 0.0 | 0.2 | GO:0002102 | podosome(GO:0002102) |
| 0.0 | 0.1 | GO:0033503 | HULC complex(GO:0033503) |
| 0.0 | 0.1 | GO:0001651 | dense fibrillar component(GO:0001651) |
| 0.0 | 0.1 | GO:0072546 | ER membrane protein complex(GO:0072546) |
| 0.0 | 0.3 | GO:0000152 | nuclear ubiquitin ligase complex(GO:0000152) |
| 0.0 | 0.1 | GO:0043194 | axon initial segment(GO:0043194) |
| 0.0 | 0.6 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
| 0.0 | 0.1 | GO:0044354 | pinosome(GO:0044352) macropinosome(GO:0044354) |
| 0.0 | 0.1 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.0 | 0.0 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 0.0 | 0.3 | GO:0055038 | recycling endosome membrane(GO:0055038) |
| 0.0 | 0.1 | GO:0031527 | filopodium membrane(GO:0031527) |
| 0.0 | 0.0 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.0 | 0.2 | GO:0031082 | BLOC complex(GO:0031082) |
| 0.0 | 0.0 | GO:0071546 | pi-body(GO:0071546) |
| 0.0 | 0.0 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
| 0.0 | 0.0 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.0 | 0.1 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
| 0.0 | 0.1 | GO:0005683 | U7 snRNP(GO:0005683) |
| 0.0 | 0.0 | GO:0071203 | WASH complex(GO:0071203) |
| 0.0 | 0.0 | GO:0097452 | GAIT complex(GO:0097452) |
| 0.0 | 0.1 | GO:0005753 | mitochondrial proton-transporting ATP synthase complex(GO:0005753) |
| 0.0 | 0.1 | GO:0000782 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
| 0.0 | 0.1 | GO:0000788 | nuclear nucleosome(GO:0000788) |
| 0.0 | 0.0 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
| 0.0 | 0.1 | GO:0000445 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
| 0.0 | 0.0 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
| 0.0 | 0.0 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
| 0.0 | 0.0 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
| 0.0 | 0.8 | GO:0005581 | collagen trimer(GO:0005581) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 0.8 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
| 0.3 | 0.8 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
| 0.2 | 3.3 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
| 0.2 | 0.6 | GO:0017153 | sodium:dicarboxylate symporter activity(GO:0017153) |
| 0.2 | 0.6 | GO:0004104 | cholinesterase activity(GO:0004104) |
| 0.2 | 1.2 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
| 0.2 | 0.5 | GO:0009041 | uridylate kinase activity(GO:0009041) |
| 0.2 | 0.6 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
| 0.1 | 0.1 | GO:0015141 | succinate transmembrane transporter activity(GO:0015141) |
| 0.1 | 0.4 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
| 0.1 | 0.7 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
| 0.1 | 0.4 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
| 0.1 | 0.4 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
| 0.1 | 1.5 | GO:0031994 | insulin-like growth factor I binding(GO:0031994) |
| 0.1 | 0.7 | GO:0016724 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
| 0.1 | 0.6 | GO:0016726 | xanthine dehydrogenase activity(GO:0004854) oxidoreductase activity, acting on CH or CH2 groups, NAD or NADP as acceptor(GO:0016726) |
| 0.1 | 0.8 | GO:0080014 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
| 0.1 | 0.8 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
| 0.1 | 0.4 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| 0.1 | 0.3 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) |
| 0.1 | 0.5 | GO:0071723 | lipopeptide binding(GO:0071723) |
| 0.1 | 0.7 | GO:0050649 | testosterone 6-beta-hydroxylase activity(GO:0050649) |
| 0.1 | 0.4 | GO:0070051 | fibrinogen binding(GO:0070051) |
| 0.1 | 0.7 | GO:0031432 | titin binding(GO:0031432) |
| 0.1 | 0.3 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
| 0.1 | 0.3 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
| 0.1 | 0.3 | GO:0033142 | progesterone receptor binding(GO:0033142) |
| 0.1 | 0.2 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
| 0.1 | 0.6 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 0.1 | 0.6 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.1 | 0.3 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
| 0.1 | 0.4 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
| 0.1 | 0.7 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
| 0.1 | 0.1 | GO:0004676 | 3-phosphoinositide-dependent protein kinase activity(GO:0004676) |
| 0.1 | 0.4 | GO:0016151 | nickel cation binding(GO:0016151) |
| 0.1 | 0.1 | GO:0030151 | molybdenum ion binding(GO:0030151) |
| 0.1 | 1.0 | GO:0005521 | lamin binding(GO:0005521) |
| 0.1 | 0.1 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
| 0.1 | 0.2 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
| 0.1 | 0.3 | GO:0015232 | heme transporter activity(GO:0015232) |
| 0.1 | 0.2 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
| 0.1 | 0.3 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
| 0.1 | 0.2 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
| 0.1 | 0.4 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) |
| 0.1 | 1.3 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
| 0.1 | 0.3 | GO:0008517 | folic acid transporter activity(GO:0008517) |
| 0.1 | 0.2 | GO:0015143 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
| 0.1 | 0.4 | GO:0018685 | alkane 1-monooxygenase activity(GO:0018685) |
| 0.1 | 0.4 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
| 0.1 | 0.3 | GO:0003933 | GTP cyclohydrolase activity(GO:0003933) |
| 0.1 | 0.1 | GO:0001226 | RNA polymerase II transcription corepressor binding(GO:0001226) |
| 0.1 | 0.3 | GO:0004457 | lactate dehydrogenase activity(GO:0004457) |
| 0.1 | 0.2 | GO:0004346 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
| 0.1 | 0.2 | GO:0015106 | bicarbonate transmembrane transporter activity(GO:0015106) |
| 0.1 | 0.3 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
| 0.1 | 1.6 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
| 0.1 | 0.7 | GO:0008432 | JUN kinase binding(GO:0008432) |
| 0.1 | 0.2 | GO:0019808 | polyamine binding(GO:0019808) |
| 0.1 | 0.3 | GO:0004985 | opioid receptor activity(GO:0004985) |
| 0.1 | 0.2 | GO:0016822 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 0.1 | 0.4 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
| 0.1 | 0.2 | GO:0097016 | L27 domain binding(GO:0097016) |
| 0.0 | 0.2 | GO:0017108 | 5'-flap endonuclease activity(GO:0017108) |
| 0.0 | 0.6 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.0 | 0.4 | GO:0033170 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 0.0 | 0.2 | GO:0046790 | virion binding(GO:0046790) |
| 0.0 | 0.2 | GO:0070061 | fructose binding(GO:0070061) |
| 0.0 | 0.1 | GO:0030984 | kininogen binding(GO:0030984) |
| 0.0 | 0.3 | GO:0004630 | phospholipase D activity(GO:0004630) |
| 0.0 | 0.2 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.0 | 0.1 | GO:0044390 | ubiquitin-like protein conjugating enzyme binding(GO:0044390) |
| 0.0 | 0.1 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
| 0.0 | 1.0 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
| 0.0 | 0.2 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.0 | 0.1 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
| 0.0 | 0.3 | GO:0003916 | DNA topoisomerase activity(GO:0003916) |
| 0.0 | 0.2 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
| 0.0 | 0.1 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
| 0.0 | 0.2 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.0 | 0.2 | GO:0043842 | Kdo transferase activity(GO:0043842) |
| 0.0 | 0.4 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
| 0.0 | 0.1 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
| 0.0 | 0.1 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.0 | 0.3 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.0 | 0.1 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
| 0.0 | 0.5 | GO:0005123 | death receptor binding(GO:0005123) |
| 0.0 | 0.1 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
| 0.0 | 0.1 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
| 0.0 | 0.3 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.0 | 0.2 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.0 | 0.2 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.0 | 0.2 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
| 0.0 | 0.8 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
| 0.0 | 0.4 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
| 0.0 | 0.1 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
| 0.0 | 0.0 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
| 0.0 | 0.2 | GO:0016453 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
| 0.0 | 0.1 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
| 0.0 | 0.2 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
| 0.0 | 0.2 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
| 0.0 | 0.5 | GO:0016594 | glycine binding(GO:0016594) |
| 0.0 | 0.2 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
| 0.0 | 0.4 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
| 0.0 | 0.2 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.0 | 0.2 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
| 0.0 | 0.2 | GO:0031849 | olfactory receptor binding(GO:0031849) |
| 0.0 | 0.1 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.0 | 0.1 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.0 | 0.1 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
| 0.0 | 0.2 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.0 | 0.1 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
| 0.0 | 0.3 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.0 | 0.5 | GO:0008143 | poly(A) binding(GO:0008143) |
| 0.0 | 0.0 | GO:0001013 | RNA polymerase I regulatory region DNA binding(GO:0001013) |
| 0.0 | 0.1 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
| 0.0 | 0.2 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
| 0.0 | 0.3 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.0 | 0.4 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
| 0.0 | 0.1 | GO:0034235 | GPI anchor binding(GO:0034235) |
| 0.0 | 0.1 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
| 0.0 | 0.1 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
| 0.0 | 0.1 | GO:0015057 | thrombin receptor activity(GO:0015057) |
| 0.0 | 0.5 | GO:0015026 | coreceptor activity(GO:0015026) |
| 0.0 | 0.2 | GO:0005534 | galactose binding(GO:0005534) |
| 0.0 | 0.1 | GO:0008502 | melatonin receptor activity(GO:0008502) |
| 0.0 | 0.4 | GO:0017166 | vinculin binding(GO:0017166) |
| 0.0 | 0.2 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
| 0.0 | 0.1 | GO:0019959 | interleukin-8 binding(GO:0019959) |
| 0.0 | 0.2 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.0 | 0.3 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
| 0.0 | 0.8 | GO:0016702 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of two atoms of oxygen(GO:0016702) |
| 0.0 | 0.1 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 0.0 | 0.1 | GO:0052760 | 4-methyloctanoyl-CoA dehydrogenase activity(GO:0034580) naphthyl-2-methyl-succinyl-CoA dehydrogenase activity(GO:0034845) 2-methylhexanoyl-CoA dehydrogenase activity(GO:0034916) propionyl-CoA dehydrogenase activity(GO:0043820) thiol-driven fumarate reductase activity(GO:0043830) coenzyme F420-dependent 2,4,6-trinitrophenol reductase activity(GO:0052758) coenzyme F420-dependent 2,4,6-trinitrophenol hydride reductase activity(GO:0052759) coenzyme F420-dependent 2,4-dinitrophenol reductase activity(GO:0052760) |
| 0.0 | 0.1 | GO:0038132 | neuregulin binding(GO:0038132) |
| 0.0 | 0.3 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.0 | 0.2 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
| 0.0 | 0.4 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
| 0.0 | 0.3 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
| 0.0 | 0.1 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
| 0.0 | 0.3 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.0 | 0.2 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
| 0.0 | 0.1 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
| 0.0 | 0.1 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 0.0 | 0.1 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.0 | 0.2 | GO:0019957 | C-C chemokine binding(GO:0019957) |
| 0.0 | 0.1 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
| 0.0 | 0.4 | GO:0004622 | lysophospholipase activity(GO:0004622) |
| 0.0 | 0.3 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
| 0.0 | 0.3 | GO:0004955 | prostaglandin receptor activity(GO:0004955) |
| 0.0 | 0.1 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
| 0.0 | 0.2 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.0 | 0.1 | GO:0016803 | ether hydrolase activity(GO:0016803) |
| 0.0 | 0.1 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
| 0.0 | 0.2 | GO:0102337 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.0 | 1.2 | GO:0005546 | phosphatidylinositol-4,5-bisphosphate binding(GO:0005546) |
| 0.0 | 0.1 | GO:0050692 | DBD domain binding(GO:0050692) |
| 0.0 | 0.1 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
| 0.0 | 0.1 | GO:0042015 | interleukin-20 binding(GO:0042015) |
| 0.0 | 0.1 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
| 0.0 | 0.2 | GO:0031559 | oxidosqualene cyclase activity(GO:0031559) |
| 0.0 | 0.1 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
| 0.0 | 0.5 | GO:0042056 | chemoattractant activity(GO:0042056) |
| 0.0 | 0.1 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
| 0.0 | 0.3 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
| 0.0 | 0.2 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
| 0.0 | 0.3 | GO:0043295 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
| 0.0 | 0.4 | GO:0005186 | pheromone activity(GO:0005186) |
| 0.0 | 0.3 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.0 | 0.1 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
| 0.0 | 0.0 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
| 0.0 | 0.1 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
| 0.0 | 0.1 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
| 0.0 | 0.1 | GO:0042301 | phosphate ion binding(GO:0042301) |
| 0.0 | 0.2 | GO:0051861 | glycolipid binding(GO:0051861) |
| 0.0 | 0.1 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 0.0 | 0.0 | GO:0004772 | sterol O-acyltransferase activity(GO:0004772) |
| 0.0 | 0.2 | GO:0009881 | photoreceptor activity(GO:0009881) |
| 0.0 | 0.1 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.0 | 0.6 | GO:0051990 | (R)-2-hydroxyglutarate dehydrogenase activity(GO:0051990) |
| 0.0 | 0.0 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
| 0.0 | 0.1 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
| 0.0 | 0.0 | GO:0034617 | tetrahydrobiopterin binding(GO:0034617) |
| 0.0 | 0.1 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
| 0.0 | 0.1 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
| 0.0 | 0.1 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
| 0.0 | 0.0 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
| 0.0 | 0.6 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
| 0.0 | 0.1 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
| 0.0 | 0.1 | GO:0018856 | 3-oxo-2-(2'-pentenyl)cyclopentane-1-octanoic acid CoA ligase activity(GO:0010435) 3-isopropenyl-6-oxoheptanoyl-CoA synthetase activity(GO:0018854) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA synthetase activity(GO:0018855) benzoyl acetate-CoA ligase activity(GO:0018856) 2,4-dichlorobenzoate-CoA ligase activity(GO:0018857) pivalate-CoA ligase activity(GO:0034783) cyclopropanecarboxylate-CoA ligase activity(GO:0034793) adipate-CoA ligase activity(GO:0034796) citronellyl-CoA ligase activity(GO:0034823) mentha-1,3-dione-CoA ligase activity(GO:0034841) thiophene-2-carboxylate-CoA ligase activity(GO:0034842) 2,4,4-trimethylpentanoate-CoA ligase activity(GO:0034865) cis-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034942) trans-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034943) branched-chain acyl-CoA synthetase (ADP-forming) activity(GO:0043759) aryl-CoA synthetase (ADP-forming) activity(GO:0043762) 3-hydroxypropionyl-CoA synthetase activity(GO:0043955) perillic acid:CoA ligase (ADP-forming) activity(GO:0052685) perillic acid:CoA ligase (AMP-forming) activity(GO:0052686) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (ADP-forming) activity(GO:0052687) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (AMP-forming) activity(GO:0052688) pristanate-CoA ligase activity(GO:0070251) malonyl-CoA synthetase activity(GO:0090409) |
| 0.0 | 0.2 | GO:0030881 | beta-2-microglobulin binding(GO:0030881) |
| 0.0 | 0.1 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
| 0.0 | 0.1 | GO:0015199 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
| 0.0 | 0.1 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
| 0.0 | 0.1 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.0 | 0.5 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
| 0.0 | 0.1 | GO:0035325 | Toll-like receptor binding(GO:0035325) |
| 0.0 | 0.0 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
| 0.0 | 0.1 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.0 | 0.1 | GO:0008430 | selenium binding(GO:0008430) |
| 0.0 | 0.0 | GO:0030523 | dihydrolipoamide S-acyltransferase activity(GO:0030523) |
| 0.0 | 0.1 | GO:0051380 | norepinephrine binding(GO:0051380) |
| 0.0 | 0.2 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
| 0.0 | 0.3 | GO:0001968 | fibronectin binding(GO:0001968) |
| 0.0 | 0.0 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
| 0.0 | 0.0 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.0 | 0.3 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
| 0.0 | 0.1 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.0 | 0.6 | GO:0050699 | WW domain binding(GO:0050699) |
| 0.0 | 0.1 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
| 0.0 | 0.1 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
| 0.0 | 0.0 | GO:0019107 | myristoyltransferase activity(GO:0019107) |
| 0.0 | 0.2 | GO:0001134 | transcription factor activity, transcription factor recruiting(GO:0001134) |
| 0.0 | 0.1 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
| 0.0 | 0.1 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
| 0.0 | 0.1 | GO:0030519 | snoRNP binding(GO:0030519) |
| 0.0 | 0.0 | GO:0001846 | opsonin binding(GO:0001846) |
| 0.0 | 0.1 | GO:1990188 | euchromatin binding(GO:1990188) |
| 0.0 | 0.2 | GO:0004707 | MAP kinase activity(GO:0004707) |
| 0.0 | 0.5 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.0 | 0.1 | GO:0004661 | protein geranylgeranyltransferase activity(GO:0004661) |
| 0.0 | 0.3 | GO:0001871 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
| 0.0 | 0.1 | GO:0070878 | primary miRNA binding(GO:0070878) |
| 0.0 | 0.2 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
| 0.0 | 0.1 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
| 0.0 | 0.1 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
| 0.0 | 0.4 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
| 0.0 | 0.0 | GO:0019770 | IgG receptor activity(GO:0019770) |
| 0.0 | 0.1 | GO:0015205 | purine nucleobase transmembrane transporter activity(GO:0005345) pyrimidine nucleobase transmembrane transporter activity(GO:0005350) nucleobase transmembrane transporter activity(GO:0015205) |
| 0.0 | 0.2 | GO:0031386 | protein tag(GO:0031386) |
| 0.0 | 0.2 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
| 0.0 | 0.2 | GO:0016780 | phosphotransferase activity, for other substituted phosphate groups(GO:0016780) |
| 0.0 | 0.1 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
| 0.0 | 1.1 | GO:0005254 | chloride channel activity(GO:0005254) |
| 0.0 | 0.2 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
| 0.0 | 0.1 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.0 | 0.1 | GO:0031433 | telethonin binding(GO:0031433) |
| 0.0 | 0.1 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.0 | 0.1 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
| 0.0 | 0.0 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
| 0.0 | 0.0 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
| 0.0 | 0.1 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
| 0.0 | 0.0 | GO:0019862 | IgA binding(GO:0019862) |
| 0.0 | 0.2 | GO:0099589 | G-protein coupled serotonin receptor activity(GO:0004993) serotonin receptor activity(GO:0099589) |
| 0.0 | 0.1 | GO:0016892 | endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
| 0.0 | 0.0 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
| 0.0 | 0.1 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) |
| 0.0 | 0.1 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.0 | 0.0 | GO:0000403 | Y-form DNA binding(GO:0000403) |
| 0.0 | 0.3 | GO:0045296 | cadherin binding(GO:0045296) |
| 0.0 | 0.1 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
| 0.0 | 0.1 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.0 | 0.4 | GO:0001540 | beta-amyloid binding(GO:0001540) |
| 0.0 | 0.0 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 0.0 | 0.1 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
| 0.0 | 0.2 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
| 0.0 | 0.1 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
| 0.0 | 0.2 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.0 | 0.0 | GO:0051718 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
| 0.0 | 0.3 | GO:0031369 | translation initiation factor binding(GO:0031369) |
| 0.0 | 0.1 | GO:0004028 | 3-chloroallyl aldehyde dehydrogenase activity(GO:0004028) |
| 0.0 | 0.0 | GO:0004942 | anaphylatoxin receptor activity(GO:0004942) |
| 0.0 | 0.0 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
| 0.0 | 0.2 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.0 | 0.1 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
| 0.0 | 0.0 | GO:0070991 | medium-chain-acyl-CoA dehydrogenase activity(GO:0070991) |
| 0.0 | 0.0 | GO:0034897 | mono-butyltin dioxygenase activity(GO:0018586) tri-n-butyltin dioxygenase activity(GO:0018588) di-n-butyltin dioxygenase activity(GO:0018589) methylsilanetriol hydroxylase activity(GO:0018590) methyl tertiary butyl ether 3-monooxygenase activity(GO:0018591) 4-nitrocatechol 4-monooxygenase activity(GO:0018592) 4-chlorophenoxyacetate monooxygenase activity(GO:0018593) tert-butanol 2-monooxygenase activity(GO:0018594) alpha-pinene monooxygenase activity(GO:0018595) dimethylsilanediol hydroxylase activity(GO:0018596) ammonia monooxygenase activity(GO:0018597) hydroxymethylsilanetriol oxidase activity(GO:0018598) 2-hydroxyisobutyrate 3-monooxygenase activity(GO:0018599) alpha-pinene dehydrogenase activity(GO:0018600) bisphenol A hydroxylase B activity(GO:0034559) 2,2-bis(4-hydroxyphenyl)-1-propanol hydroxylase activity(GO:0034562) 9-fluorenone-3,4-dioxygenase activity(GO:0034786) anthracene 9,10-dioxygenase activity(GO:0034816) 2-(methylthio)benzothiazole monooxygenase activity(GO:0034857) 2-hydroxybenzothiazole monooxygenase activity(GO:0034858) benzothiazole monooxygenase activity(GO:0034859) 2,6-dihydroxybenzothiazole monooxygenase activity(GO:0034862) pinacolone 5-monooxygenase activity(GO:0034870) thioacetamide S-oxygenase activity(GO:0034873) thioacetamide S-oxide S-oxygenase activity(GO:0034874) endosulfan monooxygenase I activity(GO:0034888) N-nitrodimethylamine hydroxylase activity(GO:0034893) 4-(1-ethyl-1,4-dimethyl-pentyl)phenol monoxygenase activity(GO:0034897) endosulfan ether monooxygenase activity(GO:0034903) pyrene 4,5-monooxygenase activity(GO:0034925) pyrene 1,2-monooxygenase activity(GO:0034927) 1-hydroxypyrene 6,7-monooxygenase activity(GO:0034928) 1-hydroxypyrene 7,8-monooxygenase activity(GO:0034929) phenylboronic acid monooxygenase activity(GO:0034950) spheroidene monooxygenase activity(GO:0043823) |
| 0.0 | 0.0 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) |
| 0.0 | 0.2 | GO:1990939 | ATP-dependent microtubule motor activity(GO:1990939) |
| 0.0 | 0.1 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
| 0.0 | 0.2 | GO:0001618 | virus receptor activity(GO:0001618) |
| 0.0 | 0.2 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
| 0.0 | 0.0 | GO:1901612 | cardiolipin binding(GO:1901612) |
| 0.0 | 0.0 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
| 0.0 | 0.1 | GO:0031013 | troponin I binding(GO:0031013) |
| 0.0 | 0.2 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.0 | 0.1 | GO:0060229 | lipase activator activity(GO:0060229) |
| 0.0 | 0.0 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.0 | 0.0 | GO:0022840 | leak channel activity(GO:0022840) narrow pore channel activity(GO:0022842) |
| 0.0 | 0.1 | GO:0032407 | MutSalpha complex binding(GO:0032407) |
| 0.0 | 0.0 | GO:0102007 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
| 0.0 | 0.0 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
| 0.0 | 0.1 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
| 0.0 | 0.0 | GO:0047623 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.0 | 0.1 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
| 0.0 | 0.3 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 0.0 | 0.1 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
| 0.0 | 0.0 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) |
| 0.0 | 0.3 | GO:0051721 | protein phosphatase 2A binding(GO:0051721) |
| 0.0 | 0.1 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
| 0.0 | 0.1 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
| 0.0 | 0.1 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
| 0.0 | 0.0 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
| 0.0 | 0.1 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
| 0.0 | 0.5 | GO:0044823 | integrase activity(GO:0008907) T/G mismatch-specific endonuclease activity(GO:0043765) retroviral integrase activity(GO:0044823) retroviral 3' processing activity(GO:0044824) |
| 0.0 | 0.0 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 0.0 | 0.1 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
| 0.0 | 0.1 | GO:0071949 | FAD binding(GO:0071949) |
| 0.0 | 0.0 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
| 0.0 | 1.1 | GO:0001046 | core promoter sequence-specific DNA binding(GO:0001046) |
| 0.0 | 0.3 | GO:0016414 | O-octanoyltransferase activity(GO:0016414) |
| 0.0 | 0.0 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
| 0.0 | 0.0 | GO:0004064 | arylesterase activity(GO:0004064) |
| 0.0 | 0.0 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
| 0.0 | 0.0 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.0 | 0.0 | GO:0010861 | thyroid hormone receptor activator activity(GO:0010861) |
| 0.0 | 0.0 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| 0.0 | 0.0 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
| 0.0 | 0.0 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
| 0.0 | 0.1 | GO:0015215 | nucleotide transmembrane transporter activity(GO:0015215) |
| 0.0 | 0.1 | GO:0046961 | proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
| 0.0 | 0.0 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
| 0.0 | 0.1 | GO:0016668 | oxidoreductase activity, acting on a sulfur group of donors, NAD(P) as acceptor(GO:0016668) |
| 0.0 | 0.1 | GO:0030492 | hemoglobin binding(GO:0030492) |
| 0.0 | 0.6 | GO:0043130 | ubiquitin binding(GO:0043130) |
| 0.0 | 0.1 | GO:0001161 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) |
| 0.0 | 0.0 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
| 0.0 | 0.3 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
| 0.0 | 0.1 | GO:0070891 | lipoteichoic acid binding(GO:0070891) |
| 0.0 | 0.2 | GO:0008373 | sialyltransferase activity(GO:0008373) |
| 0.0 | 0.0 | GO:0051733 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) |
| 0.0 | 0.1 | GO:0001848 | complement binding(GO:0001848) |
| 0.0 | 0.1 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 0.0 | 0.0 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 0.0 | 0.1 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.0 | 0.1 | GO:0048018 | receptor agonist activity(GO:0048018) |
| 0.0 | 0.0 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.0 | 0.1 | GO:0004673 | protein histidine kinase activity(GO:0004673) |
| 0.0 | 0.0 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
| 0.0 | 0.3 | GO:0005484 | SNAP receptor activity(GO:0005484) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 0.7 | ST STAT3 PATHWAY | STAT3 Pathway |
| 0.1 | 1.8 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
| 0.1 | 0.9 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.1 | 0.1 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
| 0.0 | 0.1 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.0 | 0.1 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.0 | 1.0 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
| 0.0 | 0.8 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
| 0.0 | 0.1 | PID S1P S1P2 PATHWAY | S1P2 pathway |
| 0.0 | 0.1 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.0 | 0.1 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.0 | 1.1 | PID IFNG PATHWAY | IFN-gamma pathway |
| 0.0 | 0.0 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.0 | 0.7 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.0 | 0.8 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
| 0.0 | 0.7 | PID ERBB4 PATHWAY | ErbB4 signaling events |
| 0.0 | 0.9 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.0 | 0.4 | PID ARF 3PATHWAY | Arf1 pathway |
| 0.0 | 0.1 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
| 0.0 | 0.4 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
| 0.0 | 0.2 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
| 0.0 | 0.4 | PID ATM PATHWAY | ATM pathway |
| 0.0 | 0.2 | PID EPHB FWD PATHWAY | EPHB forward signaling |
| 0.0 | 0.3 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
| 0.0 | 0.1 | PID IGF1 PATHWAY | IGF1 pathway |
| 0.0 | 0.3 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
| 0.0 | 0.2 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
| 0.0 | 0.2 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
| 0.0 | 0.2 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.0 | 0.4 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.0 | 0.7 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
| 0.0 | 0.3 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.0 | 0.1 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 0.0 | 0.1 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
| 0.0 | 0.4 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.0 | 0.2 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.0 | 0.3 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
| 0.0 | 0.6 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
| 0.0 | 0.2 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
| 0.0 | 0.1 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.0 | 0.1 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.0 | 0.1 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
| 0.0 | 0.1 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.0 | 0.1 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.0 | 0.3 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
| 0.0 | 0.4 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
| 0.0 | 0.6 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
| 0.0 | 0.2 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.0 | 0.1 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.0 | 0.5 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.0 | 0.1 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.0 | 0.1 | PID ENDOTHELIN PATHWAY | Endothelins |
| 0.0 | 0.1 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
| 0.0 | 0.3 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
| 0.0 | 0.3 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.0 | 0.6 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
| 0.0 | 0.2 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.0 | 0.1 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
| 0.0 | 0.2 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.0 | 0.0 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
| 0.0 | 0.5 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
| 0.0 | 0.0 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.0 | 0.2 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
| 0.0 | 0.2 | PID FOXO PATHWAY | FoxO family signaling |
| 0.0 | 0.0 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.0 | 0.1 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
| 0.0 | 0.2 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 1.2 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
| 0.1 | 0.5 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
| 0.1 | 0.8 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.1 | 0.5 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.1 | 0.5 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.1 | 0.7 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.1 | 0.8 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
| 0.0 | 0.4 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
| 0.0 | 0.7 | REACTOME GRB2 SOS PROVIDES LINKAGE TO MAPK SIGNALING FOR INTERGRINS | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
| 0.0 | 0.5 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
| 0.0 | 0.7 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.0 | 0.6 | REACTOME BOTULINUM NEUROTOXICITY | Genes involved in Botulinum neurotoxicity |
| 0.0 | 0.1 | REACTOME PROCESSING OF CAPPED INTRON CONTAINING PRE MRNA | Genes involved in Processing of Capped Intron-Containing Pre-mRNA |
| 0.0 | 0.2 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
| 0.0 | 0.4 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.0 | 0.5 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
| 0.0 | 0.7 | REACTOME LAGGING STRAND SYNTHESIS | Genes involved in Lagging Strand Synthesis |
| 0.0 | 0.4 | REACTOME SIGNALING BY NOTCH2 | Genes involved in Signaling by NOTCH2 |
| 0.0 | 0.5 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
| 0.0 | 0.2 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.0 | 0.1 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
| 0.0 | 0.2 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
| 0.0 | 0.5 | REACTOME PIP3 ACTIVATES AKT SIGNALING | Genes involved in PIP3 activates AKT signaling |
| 0.0 | 0.3 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
| 0.0 | 0.2 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
| 0.0 | 0.3 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.0 | 0.5 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.0 | 0.6 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.0 | 0.8 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
| 0.0 | 0.3 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.0 | 0.3 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.0 | 0.3 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
| 0.0 | 0.2 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.0 | 0.3 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
| 0.0 | 0.1 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
| 0.0 | 0.4 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 0.0 | 0.2 | REACTOME PI3K EVENTS IN ERBB4 SIGNALING | Genes involved in PI3K events in ERBB4 signaling |
| 0.0 | 0.1 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
| 0.0 | 0.2 | REACTOME PI3K AKT ACTIVATION | Genes involved in PI3K/AKT activation |
| 0.0 | 0.3 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.0 | 0.4 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
| 0.0 | 0.4 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
| 0.0 | 0.2 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.0 | 0.2 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
| 0.0 | 0.1 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.0 | 0.5 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
| 0.0 | 0.1 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
| 0.0 | 0.0 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
| 0.0 | 0.2 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
| 0.0 | 0.2 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.0 | 0.2 | REACTOME FORMATION OF FIBRIN CLOT CLOTTING CASCADE | Genes involved in Formation of Fibrin Clot (Clotting Cascade) |
| 0.0 | 0.2 | REACTOME ACTIVATION OF KAINATE RECEPTORS UPON GLUTAMATE BINDING | Genes involved in Activation of Kainate Receptors upon glutamate binding |
| 0.0 | 0.3 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
| 0.0 | 0.1 | REACTOME ACTIVATION OF CHAPERONES BY ATF6 ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
| 0.0 | 0.2 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
| 0.0 | 0.2 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
| 0.0 | 0.1 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.0 | 0.1 | REACTOME TRAF6 MEDIATED INDUCTION OF TAK1 COMPLEX | Genes involved in TRAF6 mediated induction of TAK1 complex |
| 0.0 | 0.4 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
| 0.0 | 0.1 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.0 | 0.1 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
| 0.0 | 0.4 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
| 0.0 | 0.4 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
| 0.0 | 0.1 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.0 | 0.0 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
| 0.0 | 0.3 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
| 0.0 | 0.3 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
| 0.0 | 0.1 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.0 | 0.0 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.0 | 0.1 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.0 | 0.2 | REACTOME BASE EXCISION REPAIR | Genes involved in Base Excision Repair |
| 0.0 | 0.2 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.0 | 0.0 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
| 0.0 | 0.1 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
| 0.0 | 0.3 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
| 0.0 | 0.1 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
| 0.0 | 0.1 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
| 0.0 | 0.0 | REACTOME REPAIR SYNTHESIS FOR GAP FILLING BY DNA POL IN TC NER | Genes involved in Repair synthesis for gap-filling by DNA polymerase in TC-NER |
| 0.0 | 0.1 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
| 0.0 | 0.1 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
| 0.0 | 0.3 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
| 0.0 | 0.1 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.0 | 0.1 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.0 | 0.1 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
| 0.0 | 0.2 | REACTOME SIGNALING BY NOTCH1 | Genes involved in Signaling by NOTCH1 |
| 0.0 | 0.0 | REACTOME P53 DEPENDENT G1 DNA DAMAGE RESPONSE | Genes involved in p53-Dependent G1 DNA Damage Response |
| 0.0 | 0.0 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
| 0.0 | 0.1 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.0 | 0.2 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.0 | 0.2 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
| 0.0 | 0.1 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.0 | 0.1 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |