Gene Symbol | Gene ID | Gene Info |
---|---|---|
Ubp1
|
ENSMUSG00000009741.8 | Ubp1 |
Gene | Promoter | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Ubp1 | chr9_113930617_113930792 | 230 | 0.940334 | -0.95 | 3.2e-03 | Click! |
Ubp1 | chr9_113932488_113932702 | 941 | 0.605196 | 0.93 | 7.4e-03 | Click! |
Ubp1 | chr9_113930805_113930974 | 45 | 0.979536 | -0.93 | 7.9e-03 | Click! |
Ubp1 | chr9_113931950_113932415 | 528 | 0.804244 | 0.90 | 1.3e-02 | Click! |
Ubp1 | chr9_113919450_113919676 | 11371 | 0.212773 | 0.81 | 5.2e-02 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr19_4024247_4024692 | 5.54 |
Gstp1 |
glutathione S-transferase, pi 1 |
11524 |
0.06 |
chr12_104346326_104346873 | 2.77 |
Serpina3k |
serine (or cysteine) peptidase inhibitor, clade A, member 3K |
8113 |
0.12 |
chr19_44399005_44399361 | 2.33 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
7507 |
0.15 |
chr1_97786980_97787162 | 2.07 |
Gin1 |
gypsy retrotransposon integrase 1 |
9672 |
0.19 |
chr2_31517780_31518546 | 1.81 |
Ass1 |
argininosuccinate synthetase 1 |
327 |
0.88 |
chr5_36630320_36630829 | 1.80 |
D5Ertd579e |
DNA segment, Chr 5, ERATO Doi 579, expressed |
9319 |
0.13 |
chr11_28696545_28697113 | 1.77 |
2810471M01Rik |
RIKEN cDNA 2810471M01 gene |
15265 |
0.17 |
chr8_35383605_35384049 | 1.72 |
Ppp1r3b |
protein phosphatase 1, regulatory subunit 3B |
7167 |
0.17 |
chr6_108665497_108666008 | 1.68 |
Bhlhe40 |
basic helix-loop-helix family, member e40 |
2706 |
0.23 |
chr4_15023934_15024314 | 1.65 |
Gm11844 |
predicted gene 11844 |
1542 |
0.5 |
chr7_63922331_63923024 | 1.62 |
Klf13 |
Kruppel-like factor 13 |
2193 |
0.22 |
chr5_125524109_125525122 | 1.58 |
Tmem132b |
transmembrane protein 132B |
7159 |
0.16 |
chr1_21250942_21251436 | 1.57 |
Gsta3 |
glutathione S-transferase, alpha 3 |
2332 |
0.18 |
chr7_98352590_98353259 | 1.56 |
Tsku |
tsukushi, small leucine rich proteoglycan |
7155 |
0.18 |
chr8_35216693_35216844 | 1.50 |
Gm34474 |
predicted gene, 34474 |
1870 |
0.27 |
chr14_75192862_75193407 | 1.48 |
Lcp1 |
lymphocyte cytosolic protein 1 |
2805 |
0.21 |
chr13_31506338_31507020 | 1.47 |
Foxq1 |
forkhead box Q1 |
49455 |
0.1 |
chr7_98380899_98381253 | 1.47 |
Tsku |
tsukushi, small leucine rich proteoglycan |
19748 |
0.14 |
chr9_30851911_30852248 | 1.40 |
Adamts15 |
a disintegrin-like and metallopeptidase (reprolysin type) with thrombospondin type 1 motif, 15 |
57578 |
0.11 |
chr1_21260733_21261242 | 1.35 |
Gsta3 |
glutathione S-transferase, alpha 3 |
7466 |
0.11 |
chr16_77636531_77636682 | 1.34 |
Mir125b-2 |
microRNA 125b-2 |
9667 |
0.1 |
chr8_93168995_93169226 | 1.34 |
Ces1d |
carboxylesterase 1D |
865 |
0.51 |
chr19_40178466_40178780 | 1.33 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
8663 |
0.16 |
chr3_95881097_95881422 | 1.32 |
Ciart |
circadian associated repressor of transcription |
13 |
0.94 |
chr4_102806758_102806909 | 1.27 |
Sgip1 |
SH3-domain GRB2-like (endophilin) interacting protein 1 |
46308 |
0.16 |
chr13_60479839_60480430 | 1.26 |
Gm48500 |
predicted gene, 48500 |
1164 |
0.45 |
chr17_45880763_45881199 | 1.26 |
4930542M03Rik |
RIKEN cDNA 4930542M03 gene |
471 |
0.78 |
chr8_35387028_35387898 | 1.24 |
Ppp1r3b |
protein phosphatase 1, regulatory subunit 3B |
10803 |
0.16 |
chr3_97645176_97645416 | 1.24 |
Prkab2 |
protein kinase, AMP-activated, beta 2 non-catalytic subunit |
12897 |
0.12 |
chr17_26724491_26724642 | 1.20 |
Crebrf |
CREB3 regulatory factor |
8842 |
0.16 |
chr8_10040748_10040899 | 1.19 |
Tnfsf13b |
tumor necrosis factor (ligand) superfamily, member 13b |
9505 |
0.16 |
chr3_87620282_87621117 | 1.18 |
Arhgef11 |
Rho guanine nucleotide exchange factor (GEF) 11 |
1938 |
0.27 |
chr3_107793813_107794000 | 1.18 |
Gm43233 |
predicted gene 43233 |
12050 |
0.12 |
chr8_36269996_36270164 | 1.17 |
Lonrf1 |
LON peptidase N-terminal domain and ring finger 1 |
20564 |
0.19 |
chr6_149168171_149168324 | 1.15 |
Amn1 |
antagonist of mitotic exit network 1 |
5124 |
0.16 |
chr1_21267631_21267791 | 1.14 |
Gm28836 |
predicted gene 28836 |
3882 |
0.13 |
chr12_104343910_104344587 | 1.14 |
Serpina3k |
serine (or cysteine) peptidase inhibitor, clade A, member 3K |
5762 |
0.12 |
chr5_28305015_28305175 | 1.12 |
Rbm33 |
RNA binding motif protein 33 |
12026 |
0.24 |
chr2_160805166_160805505 | 1.12 |
Gm11447 |
predicted gene 11447 |
40278 |
0.11 |
chr8_93164567_93164980 | 1.11 |
Ces1d |
carboxylesterase 1D |
5202 |
0.15 |
chr1_67182326_67182537 | 1.11 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
59405 |
0.11 |
chr17_28693946_28694132 | 1.10 |
Mapk14 |
mitogen-activated protein kinase 14 |
1471 |
0.29 |
chr11_101063788_101064400 | 1.10 |
Naglu |
alpha-N-acetylglucosaminidase (Sanfilippo disease IIIB) |
5918 |
0.09 |
chr5_125515518_125515904 | 1.09 |
Aacs |
acetoacetyl-CoA synthetase |
468 |
0.77 |
chr2_84637297_84637592 | 1.08 |
Ctnnd1 |
catenin (cadherin associated protein), delta 1 |
661 |
0.54 |
chr1_21259122_21259550 | 1.08 |
Gsta3 |
glutathione S-transferase, alpha 3 |
5815 |
0.12 |
chr19_44396138_44396537 | 1.07 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
10353 |
0.14 |
chr9_48737793_48738215 | 1.07 |
Zbtb16 |
zinc finger and BTB domain containing 16 |
97941 |
0.07 |
chr7_70514791_70515356 | 1.06 |
Gm44811 |
predicted gene 44811 |
16149 |
0.13 |
chr12_16620178_16620509 | 1.05 |
Lpin1 |
lipin 1 |
9377 |
0.19 |
chr3_142853253_142853404 | 1.05 |
Pkn2 |
protein kinase N2 |
2407 |
0.22 |
chr3_89133157_89133825 | 1.05 |
Pklr |
pyruvate kinase liver and red blood cell |
2651 |
0.11 |
chr19_44400900_44401269 | 1.05 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
5606 |
0.16 |
chr3_100536474_100536643 | 1.04 |
Gm42868 |
predicted gene 42868 |
39129 |
0.11 |
chr3_97636100_97636462 | 1.04 |
Fmo5 |
flavin containing monooxygenase 5 |
7398 |
0.14 |
chr7_98347884_98348073 | 1.04 |
Tsku |
tsukushi, small leucine rich proteoglycan |
12101 |
0.17 |
chr5_36661483_36661772 | 1.04 |
Gm24878 |
predicted gene, 24878 |
4885 |
0.15 |
chr1_21262098_21262745 | 1.04 |
Gsta3 |
glutathione S-transferase, alpha 3 |
8900 |
0.11 |
chr2_35051138_35051731 | 1.02 |
Hc |
hemolytic complement |
10004 |
0.16 |
chr2_32524726_32524892 | 1.01 |
Gm13412 |
predicted gene 13412 |
222 |
0.87 |
chr4_131722484_131723038 | 1.00 |
Gm16080 |
predicted gene 16080 |
12253 |
0.19 |
chr8_24450048_24450420 | 1.00 |
Gm44620 |
predicted gene 44620 |
3137 |
0.2 |
chr12_57515437_57515691 | 1.00 |
Gm2568 |
predicted gene 2568 |
5060 |
0.18 |
chr12_79436402_79436553 | 0.98 |
Rad51b |
RAD51 paralog B |
109124 |
0.06 |
chr7_44240460_44240817 | 0.98 |
1700028J19Rik |
RIKEN cDNA 1700028J19 gene |
4454 |
0.05 |
chr3_133740753_133740929 | 0.98 |
Gm6135 |
prediticted gene 6135 |
50663 |
0.13 |
chr1_130732065_130732290 | 0.98 |
AA986860 |
expressed sequence AA986860 |
67 |
0.94 |
chr19_7191764_7192280 | 0.98 |
Otub1 |
OTU domain, ubiquitin aldehyde binding 1 |
8442 |
0.13 |
chr10_81414361_81414714 | 0.97 |
Mir1191b |
microRNA 1191b |
1760 |
0.13 |
chr6_72125643_72125794 | 0.97 |
4933431G14Rik |
RIKEN cDNA 4933431G14 gene |
2521 |
0.19 |
chr5_36661211_36661362 | 0.97 |
Gm24878 |
predicted gene, 24878 |
5226 |
0.15 |
chr1_183954188_183954558 | 0.97 |
Gm38108 |
predicted gene, 38108 |
25968 |
0.18 |
chr2_26588564_26589214 | 0.97 |
Egfl7 |
EGF-like domain 7 |
346 |
0.71 |
chr6_143857686_143858000 | 0.96 |
Sox5 |
SRY (sex determining region Y)-box 5 |
89245 |
0.09 |
chr12_32246180_32246331 | 0.96 |
Gm33308 |
predicted gene, 33308 |
4 |
0.98 |
chrY_90794490_90794856 | 0.96 |
Gm47283 |
predicted gene, 47283 |
4222 |
0.21 |
chr4_149980056_149980645 | 0.96 |
H6pd |
hexose-6-phosphate dehydrogenase (glucose 1-dehydrogenase) |
20915 |
0.13 |
chr9_55279483_55279657 | 0.96 |
Nrg4 |
neuregulin 4 |
4002 |
0.21 |
chr3_97639903_97640190 | 0.96 |
Fmo5 |
flavin containing monooxygenase 5 |
11163 |
0.13 |
chr3_89147597_89148051 | 0.95 |
Hcn3 |
hyperpolarization-activated, cyclic nucleotide-gated K+ 3 |
3390 |
0.09 |
chr15_84133579_84133730 | 0.95 |
Gm33432 |
predicted gene, 33432 |
6350 |
0.11 |
chr3_84225078_84225432 | 0.94 |
Trim2 |
tripartite motif-containing 2 |
4366 |
0.27 |
chr2_33370578_33371002 | 0.94 |
Ralgps1 |
Ral GEF with PH domain and SH3 binding motif 1 |
639 |
0.68 |
chr9_55541381_55541949 | 0.94 |
Isl2 |
insulin related protein 2 (islet 2) |
458 |
0.61 |
chr17_83838220_83838652 | 0.94 |
Haao |
3-hydroxyanthranilate 3,4-dioxygenase |
2468 |
0.26 |
chr2_31486504_31487152 | 0.93 |
Ass1 |
argininosuccinate synthetase 1 |
10944 |
0.18 |
chr3_18212716_18212867 | 0.93 |
Cyp7b1 |
cytochrome P450, family 7, subfamily b, polypeptide 1 |
30547 |
0.17 |
chr3_88419826_88419999 | 0.93 |
Slc25a44 |
solute carrier family 25, member 44 |
5195 |
0.08 |
chr12_76557721_76557913 | 0.93 |
Plekhg3 |
pleckstrin homology domain containing, family G (with RhoGef domain) member 3 |
4421 |
0.16 |
chrX_146018404_146018575 | 0.93 |
Gm6447 |
predicted gene 6447 |
24198 |
0.17 |
chr3_130634058_130634674 | 0.92 |
Etnppl |
ethanolamine phosphate phospholyase |
7846 |
0.17 |
chr5_130301045_130301196 | 0.92 |
Tyw1 |
tRNA-yW synthesizing protein 1 homolog (S. cerevisiae) |
42190 |
0.1 |
chrX_135681086_135681344 | 0.92 |
Tcp11x2 |
t-complex 11 family, X-linked 2 |
12575 |
0.12 |
chr7_27452561_27452934 | 0.92 |
Blvrb |
biliverdin reductase B (flavin reductase (NADPH)) |
303 |
0.79 |
chr7_113961588_113961904 | 0.92 |
Gm45615 |
predicted gene 45615 |
125152 |
0.05 |
chr16_14950426_14950577 | 0.92 |
Gm33696 |
predicted gene, 33696 |
41382 |
0.14 |
chr6_85811288_85811473 | 0.91 |
Nat8f6 |
N-acetyltransferase 8 (GCN5-related) family member 6 |
1517 |
0.21 |
chr3_97649987_97650151 | 0.91 |
Prkab2 |
protein kinase, AMP-activated, beta 2 non-catalytic subunit |
8124 |
0.13 |
chr8_40272665_40272835 | 0.91 |
Fgf20 |
fibroblast growth factor 20 |
14203 |
0.2 |
chr16_93342815_93342978 | 0.91 |
1810053B23Rik |
RIKEN cDNA 1810053B23 gene |
10293 |
0.18 |
chr2_110313570_110313949 | 0.91 |
Bbox1 |
butyrobetaine (gamma), 2-oxoglutarate dioxygenase 1 (gamma-butyrobetaine hydroxylase) |
801 |
0.69 |
chr1_162892140_162892544 | 0.90 |
Fmo2 |
flavin containing monooxygenase 2 |
5827 |
0.19 |
chr10_80577672_80578424 | 0.90 |
Klf16 |
Kruppel-like factor 16 |
727 |
0.41 |
chr19_44393747_44393961 | 0.90 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
12836 |
0.14 |
chr5_40690611_40690784 | 0.90 |
Gm23022 |
predicted gene, 23022 |
284768 |
0.01 |
chr8_24506282_24506451 | 0.90 |
9130214F15Rik |
RIKEN cDNA 9130214F15 gene |
64 |
0.97 |
chr19_20540260_20540664 | 0.90 |
C730002L08Rik |
RIKEN cDNA C730002L08 gene |
174 |
0.96 |
chr1_184606489_184606640 | 0.90 |
Rpl21-ps1 |
ribosomal protein 21, pseudogene 1 |
10684 |
0.15 |
chr2_127370047_127370378 | 0.89 |
Adra2b |
adrenergic receptor, alpha 2b |
6926 |
0.15 |
chr7_67655765_67656129 | 0.89 |
Ttc23 |
tetratricopeptide repeat domain 23 |
500 |
0.72 |
chr11_12475688_12476059 | 0.89 |
Cobl |
cordon-bleu WH2 repeat |
10913 |
0.3 |
chr6_51709759_51710069 | 0.89 |
Gm38811 |
predicted gene, 38811 |
1167 |
0.59 |
chr7_114361745_114361949 | 0.88 |
4933406I18Rik |
RIKEN cDNA 4933406I18 gene |
53174 |
0.12 |
chr2_31519719_31520357 | 0.88 |
Ass1 |
argininosuccinate synthetase 1 |
1548 |
0.36 |
chr16_44726977_44727139 | 0.87 |
Nepro |
nucleolus and neural progenitor protein |
61 |
0.97 |
chr12_104087776_104088197 | 0.87 |
Serpina4-ps1 |
serine (or cysteine) peptidase inhibitor, clade A, member 4, pseudogene 1 |
7337 |
0.1 |
chr15_96930772_96930923 | 0.87 |
Rpl10a-ps3 |
ribosomal protein L10A, pseudogene 3 |
7442 |
0.28 |
chr15_95835869_95836082 | 0.87 |
Gm17546 |
predicted gene, 17546 |
5903 |
0.16 |
chr15_38289568_38289758 | 0.87 |
Klf10 |
Kruppel-like factor 10 |
9176 |
0.12 |
chr19_44401904_44402310 | 0.87 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
4583 |
0.17 |
chrX_140540252_140540544 | 0.87 |
Tsc22d3 |
TSC22 domain family, member 3 |
2270 |
0.32 |
chr9_74892080_74892501 | 0.86 |
Onecut1 |
one cut domain, family member 1 |
25806 |
0.14 |
chr7_97413837_97414007 | 0.86 |
Thrsp |
thyroid hormone responsive |
3597 |
0.16 |
chr15_3476580_3476767 | 0.86 |
Ghr |
growth hormone receptor |
5029 |
0.32 |
chr7_98351056_98351207 | 0.86 |
Tsku |
tsukushi, small leucine rich proteoglycan |
8948 |
0.17 |
chr2_150913728_150914090 | 0.86 |
Gins1 |
GINS complex subunit 1 (Psf1 homolog) |
1090 |
0.37 |
chr1_85600758_85601340 | 0.86 |
Sp140 |
Sp140 nuclear body protein |
346 |
0.73 |
chr2_31760146_31760511 | 0.86 |
Abl1 |
c-abl oncogene 1, non-receptor tyrosine kinase |
155 |
0.95 |
chr17_33932704_33933052 | 0.86 |
Rgl2 |
ral guanine nucleotide dissociation stimulator-like 2 |
747 |
0.27 |
chr7_24927963_24928117 | 0.86 |
Arhgef1 |
Rho guanine nucleotide exchange factor (GEF) 1 |
4677 |
0.1 |
chr7_12979741_12980348 | 0.86 |
Zfp446 |
zinc finger protein 446 |
524 |
0.55 |
chr15_58995280_58995901 | 0.85 |
4930544F09Rik |
RIKEN cDNA 4930544F09 gene |
11454 |
0.17 |
chr6_85810872_85811030 | 0.85 |
Nat8f6 |
N-acetyltransferase 8 (GCN5-related) family member 6 |
1088 |
0.31 |
chr6_70874912_70875301 | 0.85 |
Eif2ak3 |
eukaryotic translation initiation factor 2 alpha kinase 3 |
3455 |
0.18 |
chr1_9548225_9548667 | 0.84 |
Adhfe1 |
alcohol dehydrogenase, iron containing, 1 |
327 |
0.83 |
chr4_121078016_121078199 | 0.84 |
Zmpste24 |
zinc metallopeptidase, STE24 |
369 |
0.74 |
chr14_55724403_55725378 | 0.84 |
Rabggta |
Rab geranylgeranyl transferase, a subunit |
2627 |
0.1 |
chr11_28694241_28694518 | 0.84 |
2810471M01Rik |
RIKEN cDNA 2810471M01 gene |
12815 |
0.17 |
chr15_41685709_41685874 | 0.84 |
Oxr1 |
oxidation resistance 1 |
24813 |
0.25 |
chr11_5911362_5911596 | 0.84 |
Gck |
glucokinase |
3645 |
0.14 |
chr11_28684227_28684558 | 0.84 |
2810471M01Rik |
RIKEN cDNA 2810471M01 gene |
2828 |
0.27 |
chr11_5899422_5899614 | 0.83 |
Myl7 |
myosin, light polypeptide 7, regulatory |
736 |
0.5 |
chr6_24610042_24610446 | 0.83 |
Lmod2 |
leiomodin 2 (cardiac) |
12482 |
0.14 |
chr1_180390300_180390701 | 0.83 |
Gm36933 |
predicted gene, 36933 |
14056 |
0.13 |
chr13_112478013_112478164 | 0.83 |
Il6st |
interleukin 6 signal transducer |
3042 |
0.23 |
chr11_8502871_8503215 | 0.83 |
Tns3 |
tensin 3 |
34368 |
0.23 |
chr11_72609282_72609433 | 0.83 |
Ube2g1 |
ubiquitin-conjugating enzyme E2G 1 |
2038 |
0.25 |
chr16_37874612_37874787 | 0.83 |
Lrrc58 |
leucine rich repeat containing 58 |
6310 |
0.14 |
chrX_145769946_145770202 | 0.83 |
Gm15058 |
predicted gene 15058 |
16118 |
0.23 |
chr14_76557245_76557396 | 0.83 |
Serp2 |
stress-associated endoplasmic reticulum protein family member 2 |
431 |
0.85 |
chr6_125231341_125231662 | 0.82 |
Vamp1 |
vesicle-associated membrane protein 1 |
225 |
0.58 |
chr9_74973055_74973400 | 0.82 |
Fam214a |
family with sequence similarity 214, member A |
2884 |
0.27 |
chr18_75375074_75375506 | 0.82 |
Smad7 |
SMAD family member 7 |
376 |
0.88 |
chr9_77744429_77744594 | 0.82 |
Gclc |
glutamate-cysteine ligase, catalytic subunit |
10024 |
0.13 |
chr14_62909739_62909890 | 0.82 |
n-R5s47 |
nuclear encoded rRNA 5S 47 |
40100 |
0.09 |
chr5_99474871_99475183 | 0.82 |
Gm35172 |
predicted gene, 35172 |
33362 |
0.17 |
chr1_88072784_88073115 | 0.82 |
Ugt1a9 |
UDP glucuronosyltransferase 1 family, polypeptide A9 |
2149 |
0.12 |
chr6_15257797_15258150 | 0.82 |
Foxp2 |
forkhead box P2 |
3690 |
0.38 |
chr1_162857733_162858080 | 0.81 |
Fmo1 |
flavin containing monooxygenase 1 |
1808 |
0.33 |
chr4_53384770_53385134 | 0.81 |
Gm12496 |
predicted gene 12496 |
19078 |
0.2 |
chr6_55169879_55170107 | 0.80 |
Inmt |
indolethylamine N-methyltransferase |
5021 |
0.18 |
chr8_91494941_91495092 | 0.80 |
Gm45289 |
predicted gene 45289 |
1997 |
0.25 |
chr3_115819747_115820078 | 0.80 |
Dph5 |
diphthamide biosynthesis 5 |
67925 |
0.08 |
chr3_62404931_62405082 | 0.80 |
Arhgef26 |
Rho guanine nucleotide exchange factor (GEF) 26 |
14662 |
0.25 |
chr11_68854403_68854915 | 0.80 |
Ndel1 |
nudE neurodevelopment protein 1 like 1 |
1524 |
0.3 |
chr12_86915968_86916119 | 0.80 |
Cipc |
CLOCK interacting protein, circadian |
31000 |
0.13 |
chr11_86256906_86257226 | 0.80 |
Ints2 |
integrator complex subunit 2 |
274 |
0.91 |
chr9_106231818_106232229 | 0.79 |
Alas1 |
aminolevulinic acid synthase 1 |
5061 |
0.11 |
chr1_21255692_21256129 | 0.79 |
Gsta3 |
glutathione S-transferase, alpha 3 |
2389 |
0.17 |
chr6_96154266_96154425 | 0.79 |
1700123L14Rik |
RIKEN cDNA 1700123L14 gene |
11898 |
0.25 |
chr9_122056238_122056617 | 0.79 |
Gm39465 |
predicted gene, 39465 |
4964 |
0.13 |
chr7_100993375_100993782 | 0.79 |
P2ry2 |
purinergic receptor P2Y, G-protein coupled 2 |
10309 |
0.14 |
chr3_116965009_116965232 | 0.79 |
4930455H04Rik |
RIKEN cDNA 4930455H04 gene |
3147 |
0.18 |
chr4_63251381_63251799 | 0.79 |
Mir455 |
microRNA 455 |
5261 |
0.19 |
chr3_136048376_136048532 | 0.79 |
Gm5281 |
predicted gene 5281 |
3234 |
0.26 |
chr1_67213641_67214357 | 0.79 |
Gm15668 |
predicted gene 15668 |
35201 |
0.17 |
chr11_28690043_28690210 | 0.79 |
2810471M01Rik |
RIKEN cDNA 2810471M01 gene |
8562 |
0.19 |
chr8_24397781_24398404 | 0.79 |
Gm30692 |
predicted gene, 30692 |
14087 |
0.15 |
chr2_85037355_85037904 | 0.79 |
Ssrp1 |
structure specific recognition protein 1 |
96 |
0.6 |
chr7_30942773_30943144 | 0.78 |
Hamp |
hepcidin antimicrobial peptide |
1074 |
0.25 |
chr3_101572198_101572792 | 0.78 |
Atp1a1 |
ATPase, Na+/K+ transporting, alpha 1 polypeptide |
5065 |
0.19 |
chr8_93193941_93194092 | 0.78 |
Gm45909 |
predicted gene 45909 |
2658 |
0.19 |
chr19_44397401_44397552 | 0.78 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
9214 |
0.14 |
chr11_120813788_120814608 | 0.78 |
Fasn |
fatty acid synthase |
1257 |
0.26 |
chr7_97414019_97414355 | 0.78 |
Thrsp |
thyroid hormone responsive |
3332 |
0.16 |
chr8_25786056_25786325 | 0.78 |
Lsm1 |
LSM1 homolog, mRNA degradation associated |
603 |
0.46 |
chr9_119150860_119151284 | 0.78 |
Acaa1b |
acetyl-Coenzyme A acyltransferase 1B |
1009 |
0.39 |
chr3_95879412_95879563 | 0.77 |
Ciart |
circadian associated repressor of transcription |
1759 |
0.16 |
chr6_85835242_85835411 | 0.77 |
Nat8 |
N-acetyltransferase 8 (GCN5-related) |
3244 |
0.11 |
chr2_31483571_31483901 | 0.77 |
Ass1 |
argininosuccinate synthetase 1 |
13529 |
0.18 |
chr10_88201239_88201853 | 0.77 |
Washc3 |
WASH complex subunit 3 |
283 |
0.88 |
chr6_48429245_48429448 | 0.77 |
Gm24325 |
predicted gene, 24325 |
8577 |
0.1 |
chr11_75737051_75737202 | 0.77 |
Ywhae |
tyrosine 3-monooxygenase/tryptophan 5-monooxygenase activation protein, epsilon polypeptide |
3978 |
0.19 |
chr4_53201741_53202070 | 0.77 |
4930412L05Rik |
RIKEN cDNA 4930412L05 gene |
15656 |
0.18 |
chr8_93185590_93185741 | 0.76 |
Gm45909 |
predicted gene 45909 |
5693 |
0.14 |
chr9_106238027_106238241 | 0.76 |
Alas1 |
aminolevulinic acid synthase 1 |
596 |
0.58 |
chr18_12549768_12549925 | 0.76 |
Gm22340 |
predicted gene, 22340 |
28691 |
0.13 |
chr16_11051504_11051692 | 0.76 |
Gm18724 |
predicted gene, 18724 |
4694 |
0.11 |
chr1_63112731_63113827 | 0.76 |
Ino80dos |
INO80 complex subunit D, opposite strand |
201 |
0.84 |
chr8_41373789_41374214 | 0.76 |
Asah1 |
N-acylsphingosine amidohydrolase 1 |
634 |
0.78 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.6 | 4.8 | GO:0010046 | response to mycotoxin(GO:0010046) |
1.5 | 4.4 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
1.0 | 3.9 | GO:0046449 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
0.9 | 3.6 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
0.8 | 3.4 | GO:1903964 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.8 | 2.5 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
0.6 | 1.9 | GO:0032380 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
0.6 | 1.9 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
0.6 | 3.6 | GO:0021960 | anterior commissure morphogenesis(GO:0021960) |
0.6 | 1.8 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
0.6 | 1.8 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
0.6 | 6.2 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.6 | 1.7 | GO:0006068 | ethanol catabolic process(GO:0006068) |
0.5 | 2.7 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
0.5 | 2.1 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
0.5 | 1.4 | GO:0060523 | prostate epithelial cord elongation(GO:0060523) |
0.5 | 4.1 | GO:0055091 | phospholipid homeostasis(GO:0055091) |
0.5 | 1.4 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
0.4 | 1.3 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
0.4 | 1.2 | GO:0001996 | positive regulation of heart rate by epinephrine-norepinephrine(GO:0001996) |
0.4 | 1.6 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
0.4 | 1.5 | GO:0030035 | microspike assembly(GO:0030035) |
0.4 | 1.1 | GO:0021553 | olfactory nerve development(GO:0021553) |
0.4 | 1.1 | GO:1904380 | endoplasmic reticulum mannose trimming(GO:1904380) |
0.4 | 1.1 | GO:0034287 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
0.4 | 1.5 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
0.4 | 1.1 | GO:0031087 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.4 | 2.5 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
0.4 | 1.1 | GO:0060125 | negative regulation of growth hormone secretion(GO:0060125) |
0.3 | 1.0 | GO:0015842 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
0.3 | 1.3 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
0.3 | 1.0 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
0.3 | 0.6 | GO:2000809 | positive regulation of synaptic vesicle clustering(GO:2000809) |
0.3 | 0.6 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
0.3 | 0.9 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
0.3 | 0.6 | GO:0042524 | negative regulation of tyrosine phosphorylation of Stat5 protein(GO:0042524) |
0.3 | 0.3 | GO:0070103 | regulation of interleukin-6-mediated signaling pathway(GO:0070103) |
0.3 | 0.9 | GO:0046271 | phenylpropanoid metabolic process(GO:0009698) phenylpropanoid catabolic process(GO:0046271) |
0.3 | 0.9 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.3 | 0.9 | GO:0061368 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
0.3 | 0.6 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
0.3 | 0.8 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
0.3 | 0.8 | GO:0036023 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) |
0.3 | 0.5 | GO:0060486 | Clara cell differentiation(GO:0060486) |
0.3 | 2.1 | GO:0052697 | xenobiotic glucuronidation(GO:0052697) |
0.3 | 1.3 | GO:0032237 | activation of store-operated calcium channel activity(GO:0032237) |
0.3 | 1.9 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.3 | 1.1 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
0.3 | 0.8 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
0.3 | 0.5 | GO:1900045 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
0.3 | 0.3 | GO:0070672 | response to interleukin-15(GO:0070672) |
0.3 | 0.8 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
0.3 | 0.5 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
0.3 | 1.8 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
0.3 | 0.8 | GO:0042167 | heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
0.3 | 1.5 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
0.3 | 1.0 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
0.3 | 0.8 | GO:0021699 | cerebellar cortex maturation(GO:0021699) |
0.2 | 0.2 | GO:0071492 | cellular response to UV-A(GO:0071492) |
0.2 | 1.0 | GO:0039689 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
0.2 | 0.7 | GO:0034137 | positive regulation of toll-like receptor 2 signaling pathway(GO:0034137) |
0.2 | 0.2 | GO:0046100 | hypoxanthine metabolic process(GO:0046100) hypoxanthine biosynthetic process(GO:0046101) |
0.2 | 0.7 | GO:0060748 | tertiary branching involved in mammary gland duct morphogenesis(GO:0060748) |
0.2 | 0.2 | GO:0001997 | positive regulation of the force of heart contraction by epinephrine-norepinephrine(GO:0001997) positive regulation of the force of heart contraction by chemical signal(GO:0003099) |
0.2 | 1.4 | GO:0015074 | DNA integration(GO:0015074) |
0.2 | 0.5 | GO:0048696 | regulation of collateral sprouting in absence of injury(GO:0048696) |
0.2 | 0.9 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
0.2 | 0.7 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
0.2 | 0.7 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
0.2 | 1.3 | GO:0001547 | antral ovarian follicle growth(GO:0001547) |
0.2 | 1.1 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
0.2 | 0.7 | GO:0070447 | positive regulation of oligodendrocyte progenitor proliferation(GO:0070447) |
0.2 | 1.1 | GO:0042737 | drug catabolic process(GO:0042737) |
0.2 | 0.4 | GO:0034310 | primary alcohol catabolic process(GO:0034310) |
0.2 | 0.9 | GO:0044791 | modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) |
0.2 | 0.6 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.2 | 0.9 | GO:0042660 | positive regulation of cell fate specification(GO:0042660) |
0.2 | 0.4 | GO:0046098 | guanine metabolic process(GO:0046098) |
0.2 | 0.6 | GO:1901535 | regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
0.2 | 0.6 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
0.2 | 0.2 | GO:0061724 | lipophagy(GO:0061724) |
0.2 | 0.4 | GO:0006015 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
0.2 | 0.4 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.2 | 0.8 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
0.2 | 0.6 | GO:0003331 | regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
0.2 | 0.6 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
0.2 | 1.2 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
0.2 | 0.6 | GO:1903660 | regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
0.2 | 1.2 | GO:0097011 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) |
0.2 | 0.6 | GO:0042851 | L-alanine metabolic process(GO:0042851) |
0.2 | 0.6 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
0.2 | 1.0 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
0.2 | 1.0 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
0.2 | 1.0 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.2 | 0.6 | GO:0006562 | proline catabolic process(GO:0006562) |
0.2 | 1.6 | GO:0032959 | inositol trisphosphate biosynthetic process(GO:0032959) |
0.2 | 0.8 | GO:0035459 | cargo loading into vesicle(GO:0035459) |
0.2 | 0.4 | GO:0060745 | mammary gland branching involved in pregnancy(GO:0060745) |
0.2 | 0.7 | GO:0030647 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.2 | 0.9 | GO:0060509 | Type I pneumocyte differentiation(GO:0060509) |
0.2 | 0.4 | GO:1900133 | regulation of renin secretion into blood stream(GO:1900133) |
0.2 | 0.2 | GO:0035973 | aggrephagy(GO:0035973) |
0.2 | 0.7 | GO:0061641 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
0.2 | 0.7 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
0.2 | 0.6 | GO:0035511 | oxidative DNA demethylation(GO:0035511) |
0.2 | 0.6 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
0.2 | 0.2 | GO:0010728 | regulation of hydrogen peroxide biosynthetic process(GO:0010728) |
0.2 | 0.5 | GO:0003289 | septum primum development(GO:0003284) atrial septum primum morphogenesis(GO:0003289) |
0.2 | 1.1 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
0.2 | 2.2 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.2 | 0.2 | GO:0008090 | retrograde axonal transport(GO:0008090) |
0.2 | 2.2 | GO:0045722 | positive regulation of gluconeogenesis(GO:0045722) |
0.2 | 0.4 | GO:0050427 | 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
0.2 | 0.4 | GO:1902965 | regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
0.2 | 0.4 | GO:0010963 | regulation of L-arginine import(GO:0010963) |
0.2 | 1.4 | GO:0034312 | diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
0.2 | 0.5 | GO:0071798 | response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
0.2 | 0.3 | GO:2000587 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
0.2 | 0.9 | GO:0015781 | nucleotide-sugar transport(GO:0015780) pyrimidine nucleotide-sugar transport(GO:0015781) |
0.2 | 0.5 | GO:0071394 | cellular response to testosterone stimulus(GO:0071394) |
0.2 | 0.2 | GO:1901631 | positive regulation of presynaptic membrane organization(GO:1901631) |
0.2 | 0.5 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
0.2 | 0.9 | GO:0051136 | regulation of NK T cell differentiation(GO:0051136) positive regulation of NK T cell differentiation(GO:0051138) |
0.2 | 1.7 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
0.2 | 2.0 | GO:0006750 | glutathione biosynthetic process(GO:0006750) |
0.2 | 0.3 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
0.2 | 0.7 | GO:0018214 | protein carboxylation(GO:0018214) |
0.2 | 0.3 | GO:0009826 | unidimensional cell growth(GO:0009826) |
0.2 | 0.2 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.2 | 0.6 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
0.2 | 0.2 | GO:0060916 | mesenchymal cell proliferation involved in lung development(GO:0060916) |
0.2 | 0.6 | GO:0003383 | apical constriction(GO:0003383) |
0.2 | 0.8 | GO:1903887 | motile primary cilium assembly(GO:1903887) |
0.2 | 0.5 | GO:0002386 | immune response in mucosal-associated lymphoid tissue(GO:0002386) |
0.2 | 0.3 | GO:0002572 | pro-T cell differentiation(GO:0002572) |
0.2 | 0.5 | GO:0097167 | circadian regulation of translation(GO:0097167) |
0.2 | 0.5 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
0.2 | 0.2 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
0.2 | 1.3 | GO:0000467 | exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) |
0.2 | 0.6 | GO:0036135 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
0.2 | 0.5 | GO:2001274 | negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
0.2 | 0.3 | GO:1903371 | regulation of endoplasmic reticulum tubular network organization(GO:1903371) |
0.2 | 0.3 | GO:1903999 | negative regulation of eating behavior(GO:1903999) |
0.2 | 0.5 | GO:1902953 | positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
0.2 | 0.3 | GO:0090365 | regulation of mRNA modification(GO:0090365) |
0.2 | 0.3 | GO:2000468 | regulation of peroxidase activity(GO:2000468) |
0.2 | 0.6 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
0.2 | 0.3 | GO:1904023 | regulation of fermentation(GO:0043465) regulation of NAD metabolic process(GO:1902688) regulation of glucose catabolic process to lactate via pyruvate(GO:1904023) |
0.2 | 0.2 | GO:0014834 | skeletal muscle satellite cell maintenance involved in skeletal muscle regeneration(GO:0014834) |
0.2 | 0.3 | GO:0031296 | B cell costimulation(GO:0031296) |
0.2 | 0.8 | GO:0060059 | embryonic retina morphogenesis in camera-type eye(GO:0060059) |
0.2 | 1.2 | GO:0045607 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
0.2 | 0.5 | GO:0060468 | prevention of polyspermy(GO:0060468) |
0.2 | 0.6 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
0.1 | 1.0 | GO:0071379 | cellular response to prostaglandin stimulus(GO:0071379) cellular response to prostaglandin E stimulus(GO:0071380) |
0.1 | 1.2 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
0.1 | 0.3 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
0.1 | 0.9 | GO:0010875 | positive regulation of cholesterol efflux(GO:0010875) |
0.1 | 0.1 | GO:0072361 | regulation of glycolytic process by regulation of transcription from RNA polymerase II promoter(GO:0072361) |
0.1 | 0.3 | GO:2000729 | positive regulation of mesenchymal cell proliferation involved in ureter development(GO:2000729) |
0.1 | 0.4 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
0.1 | 0.4 | GO:0002154 | thyroid hormone mediated signaling pathway(GO:0002154) regulation of thyroid hormone mediated signaling pathway(GO:0002155) |
0.1 | 0.4 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
0.1 | 0.4 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
0.1 | 0.4 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
0.1 | 0.3 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
0.1 | 0.6 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
0.1 | 0.3 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
0.1 | 0.6 | GO:0035627 | ceramide transport(GO:0035627) |
0.1 | 0.9 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
0.1 | 0.3 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
0.1 | 0.4 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
0.1 | 1.1 | GO:0043651 | linoleic acid metabolic process(GO:0043651) |
0.1 | 0.8 | GO:0071267 | amino acid salvage(GO:0043102) L-methionine biosynthetic process(GO:0071265) L-methionine salvage(GO:0071267) |
0.1 | 0.4 | GO:0021603 | cranial nerve formation(GO:0021603) |
0.1 | 0.6 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
0.1 | 0.1 | GO:0045541 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
0.1 | 0.4 | GO:0072039 | regulation of mesenchymal cell apoptotic process involved in nephron morphogenesis(GO:0072039) negative regulation of mesenchymal cell apoptotic process involved in nephron morphogenesis(GO:0072040) mesenchymal cell apoptotic process involved in nephron morphogenesis(GO:1901145) regulation of somatic stem cell population maintenance(GO:1904672) negative regulation of somatic stem cell population maintenance(GO:1904673) |
0.1 | 1.6 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
0.1 | 0.1 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
0.1 | 0.1 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
0.1 | 0.7 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
0.1 | 0.9 | GO:0046085 | adenosine metabolic process(GO:0046085) |
0.1 | 0.3 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
0.1 | 0.4 | GO:0030397 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
0.1 | 0.9 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
0.1 | 0.5 | GO:0032201 | telomere maintenance via semi-conservative replication(GO:0032201) |
0.1 | 0.3 | GO:0000432 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) |
0.1 | 0.4 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
0.1 | 0.4 | GO:1901740 | negative regulation of myoblast fusion(GO:1901740) |
0.1 | 0.4 | GO:0002439 | chronic inflammatory response to antigenic stimulus(GO:0002439) |
0.1 | 0.3 | GO:0030908 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
0.1 | 0.9 | GO:0006265 | DNA topological change(GO:0006265) |
0.1 | 0.4 | GO:0018343 | protein farnesylation(GO:0018343) |
0.1 | 0.5 | GO:0030202 | heparin metabolic process(GO:0030202) |
0.1 | 0.4 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
0.1 | 0.4 | GO:2001184 | positive regulation of interleukin-12 secretion(GO:2001184) |
0.1 | 0.1 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
0.1 | 0.6 | GO:0060484 | lung-associated mesenchyme development(GO:0060484) |
0.1 | 0.4 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
0.1 | 0.8 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
0.1 | 0.9 | GO:0031065 | positive regulation of histone deacetylation(GO:0031065) |
0.1 | 0.4 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
0.1 | 0.4 | GO:0060112 | generation of ovulation cycle rhythm(GO:0060112) |
0.1 | 0.6 | GO:0046628 | positive regulation of insulin receptor signaling pathway(GO:0046628) |
0.1 | 0.9 | GO:0008354 | germ cell migration(GO:0008354) |
0.1 | 0.5 | GO:0045356 | positive regulation of interferon-alpha biosynthetic process(GO:0045356) |
0.1 | 0.6 | GO:0071476 | cellular hypotonic response(GO:0071476) |
0.1 | 0.6 | GO:0001957 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
0.1 | 0.5 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
0.1 | 0.5 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
0.1 | 0.4 | GO:0046469 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
0.1 | 0.2 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.1 | 1.2 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
0.1 | 0.5 | GO:0008355 | olfactory learning(GO:0008355) |
0.1 | 0.1 | GO:0033629 | negative regulation of cell adhesion mediated by integrin(GO:0033629) |
0.1 | 0.8 | GO:0046643 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
0.1 | 0.5 | GO:0060353 | regulation of cell adhesion molecule production(GO:0060353) |
0.1 | 0.5 | GO:0009642 | response to light intensity(GO:0009642) |
0.1 | 0.8 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
0.1 | 0.4 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.1 | 0.4 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.1 | 0.1 | GO:0002339 | B cell selection(GO:0002339) |
0.1 | 1.4 | GO:0048148 | behavioral response to cocaine(GO:0048148) |
0.1 | 0.3 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.1 | 2.3 | GO:0006783 | heme biosynthetic process(GO:0006783) |
0.1 | 0.3 | GO:0071926 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
0.1 | 0.3 | GO:0046477 | glycosylceramide catabolic process(GO:0046477) |
0.1 | 0.2 | GO:2000832 | negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
0.1 | 0.3 | GO:0015889 | cobalamin transport(GO:0015889) |
0.1 | 0.1 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
0.1 | 0.6 | GO:0070874 | negative regulation of glycogen metabolic process(GO:0070874) |
0.1 | 0.2 | GO:0033578 | protein glycosylation in Golgi(GO:0033578) |
0.1 | 0.3 | GO:0014717 | regulation of satellite cell activation involved in skeletal muscle regeneration(GO:0014717) satellite cell activation involved in skeletal muscle regeneration(GO:0014901) |
0.1 | 0.3 | GO:0048207 | vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
0.1 | 0.3 | GO:0015770 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.1 | 0.2 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
0.1 | 0.2 | GO:0048840 | otolith development(GO:0048840) |
0.1 | 0.3 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
0.1 | 0.7 | GO:0015871 | choline transport(GO:0015871) |
0.1 | 0.2 | GO:0009169 | ribonucleoside monophosphate catabolic process(GO:0009158) purine ribonucleoside monophosphate catabolic process(GO:0009169) |
0.1 | 0.2 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
0.1 | 0.2 | GO:0032484 | Ral protein signal transduction(GO:0032484) |
0.1 | 0.7 | GO:0060628 | regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
0.1 | 0.8 | GO:0046146 | tetrahydrobiopterin metabolic process(GO:0046146) |
0.1 | 0.7 | GO:1902188 | positive regulation of viral release from host cell(GO:1902188) |
0.1 | 0.4 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
0.1 | 0.8 | GO:0002072 | optic cup morphogenesis involved in camera-type eye development(GO:0002072) |
0.1 | 1.9 | GO:0071353 | cellular response to interleukin-4(GO:0071353) |
0.1 | 1.0 | GO:0008343 | adult feeding behavior(GO:0008343) |
0.1 | 0.9 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
0.1 | 0.1 | GO:0045349 | interferon-alpha biosynthetic process(GO:0045349) regulation of interferon-alpha biosynthetic process(GO:0045354) |
0.1 | 0.6 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.1 | 0.4 | GO:0090315 | negative regulation of protein targeting to membrane(GO:0090315) |
0.1 | 0.3 | GO:0030576 | Cajal body organization(GO:0030576) |
0.1 | 0.1 | GO:0060164 | regulation of timing of neuron differentiation(GO:0060164) |
0.1 | 0.3 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.1 | 0.2 | GO:1904684 | negative regulation of metalloendopeptidase activity(GO:1904684) negative regulation of metallopeptidase activity(GO:1905049) |
0.1 | 2.0 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
0.1 | 0.4 | GO:2001225 | regulation of chloride transport(GO:2001225) |
0.1 | 0.3 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.1 | 0.8 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.1 | 0.7 | GO:0098598 | vocal learning(GO:0042297) imitative learning(GO:0098596) learned vocalization behavior or vocal learning(GO:0098598) |
0.1 | 0.6 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
0.1 | 0.1 | GO:0042321 | negative regulation of circadian sleep/wake cycle, sleep(GO:0042321) |
0.1 | 0.2 | GO:0061010 | gall bladder development(GO:0061010) |
0.1 | 0.1 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
0.1 | 0.9 | GO:0045056 | transcytosis(GO:0045056) |
0.1 | 0.2 | GO:0001834 | trophectodermal cell proliferation(GO:0001834) |
0.1 | 0.2 | GO:0070375 | ERK5 cascade(GO:0070375) |
0.1 | 0.1 | GO:0045914 | negative regulation of catecholamine metabolic process(GO:0045914) negative regulation of dopamine metabolic process(GO:0045963) |
0.1 | 0.2 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.1 | 0.3 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
0.1 | 0.4 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
0.1 | 0.1 | GO:0060352 | cell adhesion molecule production(GO:0060352) |
0.1 | 0.6 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
0.1 | 0.2 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
0.1 | 0.1 | GO:0021943 | formation of radial glial scaffolds(GO:0021943) |
0.1 | 0.2 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
0.1 | 0.3 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
0.1 | 1.1 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
0.1 | 1.2 | GO:0017144 | drug metabolic process(GO:0017144) |
0.1 | 0.6 | GO:0042219 | cellular modified amino acid catabolic process(GO:0042219) |
0.1 | 0.1 | GO:0009445 | putrescine metabolic process(GO:0009445) |
0.1 | 0.8 | GO:1900364 | negative regulation of mRNA polyadenylation(GO:1900364) |
0.1 | 0.7 | GO:0070189 | kynurenine metabolic process(GO:0070189) |
0.1 | 0.2 | GO:0043970 | histone H3-K9 acetylation(GO:0043970) |
0.1 | 0.8 | GO:0042795 | snRNA transcription from RNA polymerase II promoter(GO:0042795) |
0.1 | 0.1 | GO:0033015 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) |
0.1 | 0.3 | GO:0031052 | programmed DNA elimination(GO:0031049) chromosome breakage(GO:0031052) |
0.1 | 0.4 | GO:0009438 | methylglyoxal metabolic process(GO:0009438) |
0.1 | 0.5 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
0.1 | 0.2 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
0.1 | 0.1 | GO:0046083 | adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
0.1 | 0.3 | GO:0043974 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
0.1 | 0.2 | GO:0000255 | allantoin metabolic process(GO:0000255) |
0.1 | 0.3 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
0.1 | 0.3 | GO:0031627 | telomeric loop formation(GO:0031627) |
0.1 | 0.2 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
0.1 | 0.6 | GO:0036089 | cleavage furrow formation(GO:0036089) |
0.1 | 0.3 | GO:0034141 | positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
0.1 | 0.1 | GO:2000670 | positive regulation of dendritic cell apoptotic process(GO:2000670) |
0.1 | 0.1 | GO:0006714 | sesquiterpenoid metabolic process(GO:0006714) |
0.1 | 0.4 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
0.1 | 2.1 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
0.1 | 0.3 | GO:0006670 | sphingosine metabolic process(GO:0006670) |
0.1 | 0.3 | GO:0061083 | regulation of protein refolding(GO:0061083) negative regulation of protein refolding(GO:0061084) |
0.1 | 0.4 | GO:0097461 | ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) |
0.1 | 0.3 | GO:0010040 | response to iron(II) ion(GO:0010040) |
0.1 | 0.2 | GO:0019086 | late viral transcription(GO:0019086) |
0.1 | 0.3 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.1 | 0.1 | GO:0051602 | response to electrical stimulus(GO:0051602) |
0.1 | 0.3 | GO:0021882 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) |
0.1 | 0.7 | GO:0006271 | DNA strand elongation involved in DNA replication(GO:0006271) |
0.1 | 0.1 | GO:0010958 | regulation of amino acid import(GO:0010958) |
0.1 | 0.2 | GO:0061153 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
0.1 | 0.5 | GO:0019740 | nitrogen utilization(GO:0019740) |
0.1 | 0.1 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.1 | 0.2 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.1 | 0.5 | GO:0071397 | cellular response to cholesterol(GO:0071397) |
0.1 | 0.1 | GO:0010901 | regulation of very-low-density lipoprotein particle remodeling(GO:0010901) |
0.1 | 0.4 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
0.1 | 0.4 | GO:0014870 | response to inactivity(GO:0014854) response to muscle inactivity(GO:0014870) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
0.1 | 1.0 | GO:0006743 | ubiquinone metabolic process(GO:0006743) |
0.1 | 0.4 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
0.1 | 0.5 | GO:0051683 | establishment of Golgi localization(GO:0051683) |
0.1 | 0.4 | GO:0002317 | plasma cell differentiation(GO:0002317) |
0.1 | 0.1 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
0.1 | 0.1 | GO:0036315 | cellular response to sterol(GO:0036315) |
0.1 | 0.4 | GO:0060283 | negative regulation of oocyte development(GO:0060283) |
0.1 | 0.4 | GO:2000035 | regulation of stem cell division(GO:2000035) |
0.1 | 0.7 | GO:0006622 | protein targeting to lysosome(GO:0006622) |
0.1 | 0.2 | GO:0021747 | cochlear nucleus development(GO:0021747) |
0.1 | 0.6 | GO:0060742 | epithelial cell differentiation involved in prostate gland development(GO:0060742) |
0.1 | 0.5 | GO:0051503 | adenine nucleotide transport(GO:0051503) |
0.1 | 0.4 | GO:0060405 | regulation of penile erection(GO:0060405) |
0.1 | 0.4 | GO:0031034 | myosin filament assembly(GO:0031034) |
0.1 | 0.2 | GO:0033762 | response to glucagon(GO:0033762) |
0.1 | 0.3 | GO:0030070 | insulin processing(GO:0030070) |
0.1 | 0.4 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
0.1 | 0.3 | GO:0016553 | base conversion or substitution editing(GO:0016553) |
0.1 | 0.3 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
0.1 | 0.1 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
0.1 | 0.5 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
0.1 | 0.5 | GO:0035280 | miRNA loading onto RISC involved in gene silencing by miRNA(GO:0035280) |
0.1 | 0.8 | GO:0042659 | regulation of cell fate specification(GO:0042659) |
0.1 | 0.3 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
0.1 | 0.3 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
0.1 | 0.3 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
0.1 | 0.3 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
0.1 | 0.1 | GO:0045842 | positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
0.1 | 0.2 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
0.1 | 0.5 | GO:0086013 | membrane repolarization during cardiac muscle cell action potential(GO:0086013) |
0.1 | 0.2 | GO:0086023 | adrenergic receptor signaling pathway involved in heart process(GO:0086023) |
0.1 | 0.1 | GO:1903909 | positive regulation of postsynaptic membrane organization(GO:1901628) regulation of receptor clustering(GO:1903909) regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904393) positive regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904395) |
0.1 | 0.5 | GO:0006777 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
0.1 | 0.1 | GO:1901725 | regulation of histone deacetylase activity(GO:1901725) |
0.1 | 0.2 | GO:0006393 | termination of mitochondrial transcription(GO:0006393) |
0.1 | 0.2 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
0.1 | 0.3 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
0.1 | 0.1 | GO:0099515 | actin filament-based transport(GO:0099515) |
0.1 | 0.3 | GO:0043101 | purine-containing compound salvage(GO:0043101) |
0.1 | 0.3 | GO:1904469 | positive regulation of tumor necrosis factor secretion(GO:1904469) |
0.1 | 0.6 | GO:0032958 | inositol phosphate biosynthetic process(GO:0032958) |
0.1 | 0.3 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
0.1 | 0.4 | GO:0044794 | positive regulation by host of viral process(GO:0044794) |
0.1 | 0.2 | GO:0035521 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
0.1 | 0.2 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
0.1 | 0.1 | GO:0051771 | negative regulation of nitric-oxide synthase biosynthetic process(GO:0051771) |
0.1 | 0.2 | GO:0072718 | response to cisplatin(GO:0072718) |
0.1 | 0.1 | GO:0030859 | polarized epithelial cell differentiation(GO:0030859) |
0.1 | 0.2 | GO:1903599 | positive regulation of mitophagy(GO:1903599) |
0.1 | 0.2 | GO:1904861 | excitatory synapse assembly(GO:1904861) |
0.1 | 0.2 | GO:0035523 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
0.1 | 0.3 | GO:0060613 | fat pad development(GO:0060613) |
0.1 | 0.4 | GO:0039702 | viral budding via host ESCRT complex(GO:0039702) |
0.1 | 0.2 | GO:0090135 | actin filament branching(GO:0090135) |
0.1 | 0.2 | GO:0070885 | negative regulation of calcineurin-NFAT signaling cascade(GO:0070885) |
0.1 | 0.7 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
0.1 | 0.3 | GO:0071494 | cellular response to UV-C(GO:0071494) |
0.1 | 0.1 | GO:0061038 | uterus morphogenesis(GO:0061038) |
0.1 | 0.6 | GO:0048742 | regulation of skeletal muscle fiber development(GO:0048742) |
0.1 | 0.1 | GO:1903059 | regulation of protein lipidation(GO:1903059) |
0.1 | 0.2 | GO:2000780 | negative regulation of double-strand break repair(GO:2000780) |
0.1 | 0.2 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
0.1 | 0.3 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
0.1 | 0.1 | GO:2000479 | regulation of cAMP-dependent protein kinase activity(GO:2000479) |
0.1 | 0.3 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
0.1 | 0.2 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
0.1 | 0.2 | GO:1902226 | regulation of macrophage colony-stimulating factor signaling pathway(GO:1902226) regulation of response to macrophage colony-stimulating factor(GO:1903969) regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903972) |
0.1 | 0.6 | GO:0043116 | negative regulation of vascular permeability(GO:0043116) |
0.1 | 0.4 | GO:2000773 | negative regulation of cellular senescence(GO:2000773) |
0.1 | 0.5 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
0.1 | 0.4 | GO:0006983 | ER overload response(GO:0006983) |
0.1 | 0.3 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.1 | 0.1 | GO:0030223 | neutrophil differentiation(GO:0030223) |
0.1 | 0.5 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
0.1 | 0.2 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
0.1 | 0.2 | GO:0019087 | transformation of host cell by virus(GO:0019087) |
0.1 | 0.5 | GO:0006013 | mannose metabolic process(GO:0006013) |
0.1 | 0.1 | GO:0070914 | UV-damage excision repair(GO:0070914) |
0.1 | 0.4 | GO:0043278 | response to isoquinoline alkaloid(GO:0014072) response to morphine(GO:0043278) |
0.1 | 0.4 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
0.1 | 0.2 | GO:0032439 | endosome localization(GO:0032439) |
0.1 | 0.1 | GO:2000823 | regulation of androgen receptor activity(GO:2000823) |
0.1 | 0.1 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
0.1 | 0.2 | GO:0060510 | Type II pneumocyte differentiation(GO:0060510) |
0.1 | 1.0 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
0.1 | 0.4 | GO:0051013 | microtubule severing(GO:0051013) |
0.1 | 0.2 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.1 | 0.2 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
0.1 | 0.7 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
0.1 | 0.1 | GO:2000143 | negative regulation of transcription initiation from RNA polymerase II promoter(GO:0060633) negative regulation of DNA-templated transcription, initiation(GO:2000143) |
0.1 | 0.7 | GO:0097320 | membrane tubulation(GO:0097320) |
0.1 | 0.1 | GO:0051582 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
0.1 | 0.2 | GO:0035246 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) peptidyl-arginine N-methylation(GO:0035246) peptidyl-arginine omega-N-methylation(GO:0035247) |
0.1 | 0.1 | GO:0070535 | histone H2A K63-linked ubiquitination(GO:0070535) |
0.1 | 0.1 | GO:0033182 | regulation of histone ubiquitination(GO:0033182) |
0.1 | 0.3 | GO:0090166 | Golgi disassembly(GO:0090166) |
0.1 | 0.3 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
0.1 | 0.2 | GO:0046719 | regulation by virus of viral protein levels in host cell(GO:0046719) |
0.1 | 0.4 | GO:0048752 | semicircular canal morphogenesis(GO:0048752) |
0.1 | 0.1 | GO:0006901 | vesicle coating(GO:0006901) |
0.1 | 0.2 | GO:1904528 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
0.1 | 0.1 | GO:0036216 | response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
0.1 | 0.2 | GO:0015747 | urate transport(GO:0015747) |
0.1 | 0.1 | GO:0060029 | convergent extension involved in organogenesis(GO:0060029) |
0.1 | 0.2 | GO:1990034 | calcium ion export from cell(GO:1990034) |
0.1 | 0.3 | GO:0009650 | UV protection(GO:0009650) |
0.1 | 0.4 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.1 | 0.1 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
0.1 | 0.4 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
0.1 | 0.2 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
0.1 | 0.4 | GO:0090051 | negative regulation of cell migration involved in sprouting angiogenesis(GO:0090051) |
0.1 | 0.2 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
0.1 | 0.2 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
0.1 | 0.5 | GO:0035095 | behavioral response to nicotine(GO:0035095) |
0.1 | 0.1 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.1 | 0.3 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
0.1 | 0.1 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
0.1 | 0.3 | GO:0035360 | positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
0.1 | 0.9 | GO:0046132 | pyrimidine ribonucleotide biosynthetic process(GO:0009220) pyrimidine ribonucleoside biosynthetic process(GO:0046132) |
0.1 | 0.3 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
0.1 | 0.7 | GO:0039529 | RIG-I signaling pathway(GO:0039529) |
0.1 | 1.1 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
0.1 | 0.3 | GO:0060903 | positive regulation of meiosis I(GO:0060903) |
0.1 | 0.2 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
0.1 | 0.1 | GO:1900363 | regulation of mRNA polyadenylation(GO:1900363) |
0.1 | 0.1 | GO:0032025 | response to cobalt ion(GO:0032025) |
0.1 | 0.2 | GO:0007638 | mechanosensory behavior(GO:0007638) |
0.1 | 0.4 | GO:0042759 | long-chain fatty acid biosynthetic process(GO:0042759) |
0.1 | 0.1 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
0.1 | 0.7 | GO:0009214 | cyclic nucleotide catabolic process(GO:0009214) |
0.1 | 0.2 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
0.1 | 0.2 | GO:1900060 | negative regulation of ceramide biosynthetic process(GO:1900060) |
0.1 | 0.1 | GO:0035482 | gastric motility(GO:0035482) |
0.1 | 2.3 | GO:0033139 | regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033139) |
0.1 | 0.1 | GO:0060051 | negative regulation of protein glycosylation(GO:0060051) |
0.1 | 0.2 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
0.1 | 0.1 | GO:1902488 | cholangiocyte apoptotic process(GO:1902488) regulation of cholangiocyte apoptotic process(GO:1904192) negative regulation of cholangiocyte apoptotic process(GO:1904193) |
0.1 | 0.4 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.1 | 0.3 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
0.1 | 0.2 | GO:0031126 | snoRNA 3'-end processing(GO:0031126) |
0.1 | 0.1 | GO:1900740 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
0.1 | 0.1 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
0.1 | 0.3 | GO:0046618 | drug export(GO:0046618) |
0.1 | 0.5 | GO:0015824 | proline transport(GO:0015824) |
0.1 | 0.5 | GO:0006108 | malate metabolic process(GO:0006108) |
0.1 | 0.1 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
0.1 | 0.3 | GO:1990564 | protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
0.1 | 0.1 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
0.1 | 0.3 | GO:0042447 | hormone catabolic process(GO:0042447) |
0.1 | 1.3 | GO:1901099 | negative regulation of signal transduction in absence of ligand(GO:1901099) negative regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001240) |
0.1 | 2.5 | GO:0006888 | ER to Golgi vesicle-mediated transport(GO:0006888) |
0.1 | 0.3 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.1 | 0.1 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
0.1 | 0.1 | GO:0071866 | regulation of apoptotic process in bone marrow(GO:0071865) negative regulation of apoptotic process in bone marrow(GO:0071866) |
0.1 | 0.5 | GO:0002024 | diet induced thermogenesis(GO:0002024) adaptive thermogenesis(GO:1990845) |
0.1 | 2.0 | GO:0035019 | somatic stem cell population maintenance(GO:0035019) |
0.1 | 0.1 | GO:0014873 | response to muscle activity involved in regulation of muscle adaptation(GO:0014873) |
0.1 | 0.2 | GO:0014022 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
0.1 | 0.1 | GO:0090344 | negative regulation of cell aging(GO:0090344) |
0.1 | 0.3 | GO:0061051 | positive regulation of cell growth involved in cardiac muscle cell development(GO:0061051) |
0.1 | 0.1 | GO:0003162 | atrioventricular node development(GO:0003162) |
0.1 | 0.2 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
0.1 | 0.5 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
0.1 | 0.1 | GO:0014042 | positive regulation of neuron maturation(GO:0014042) |
0.1 | 0.2 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
0.1 | 0.4 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
0.1 | 0.3 | GO:0016127 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
0.1 | 0.2 | GO:0018317 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
0.1 | 0.3 | GO:0045416 | positive regulation of interleukin-8 biosynthetic process(GO:0045416) |
0.1 | 0.2 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
0.1 | 0.1 | GO:1902513 | regulation of organelle transport along microtubule(GO:1902513) |
0.1 | 0.1 | GO:0034427 | nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
0.1 | 0.1 | GO:0019184 | nonribosomal peptide biosynthetic process(GO:0019184) |
0.1 | 0.9 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
0.1 | 0.8 | GO:0070884 | regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
0.1 | 0.1 | GO:1903224 | regulation of endodermal cell differentiation(GO:1903224) |
0.1 | 0.2 | GO:0060768 | epithelial cell proliferation involved in prostate gland development(GO:0060767) regulation of epithelial cell proliferation involved in prostate gland development(GO:0060768) negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
0.1 | 0.2 | GO:0048102 | autophagic cell death(GO:0048102) |
0.1 | 0.6 | GO:0051290 | protein heterotetramerization(GO:0051290) |
0.1 | 0.5 | GO:0014041 | regulation of neuron maturation(GO:0014041) |
0.1 | 0.1 | GO:0019042 | viral latency(GO:0019042) |
0.1 | 0.2 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
0.1 | 0.2 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
0.1 | 0.1 | GO:1900157 | regulation of bone mineralization involved in bone maturation(GO:1900157) |
0.1 | 0.2 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
0.1 | 0.1 | GO:1901069 | guanosine-containing compound catabolic process(GO:1901069) |
0.1 | 0.1 | GO:1902916 | positive regulation of protein polyubiquitination(GO:1902916) |
0.1 | 0.2 | GO:0031999 | negative regulation of fatty acid beta-oxidation(GO:0031999) |
0.1 | 0.1 | GO:0061072 | iris morphogenesis(GO:0061072) |
0.1 | 0.5 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.1 | 0.2 | GO:1900037 | regulation of cellular response to hypoxia(GO:1900037) |
0.1 | 0.5 | GO:0007210 | serotonin receptor signaling pathway(GO:0007210) |
0.1 | 1.2 | GO:0006376 | mRNA splice site selection(GO:0006376) |
0.1 | 0.4 | GO:0017121 | phospholipid scrambling(GO:0017121) |
0.1 | 0.1 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
0.1 | 0.1 | GO:1900368 | regulation of RNA interference(GO:1900368) |
0.1 | 0.1 | GO:0048022 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
0.1 | 0.1 | GO:0043174 | nucleoside salvage(GO:0043174) |
0.1 | 0.1 | GO:1903069 | regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903069) |
0.1 | 0.2 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
0.1 | 0.1 | GO:0033088 | negative regulation of immature T cell proliferation in thymus(GO:0033088) |
0.1 | 0.5 | GO:0006335 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
0.1 | 0.9 | GO:0045475 | locomotor rhythm(GO:0045475) |
0.1 | 0.1 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
0.1 | 0.6 | GO:0006878 | cellular copper ion homeostasis(GO:0006878) |
0.1 | 0.3 | GO:0048680 | positive regulation of axon regeneration(GO:0048680) |
0.1 | 0.1 | GO:0061043 | regulation of vascular wound healing(GO:0061043) |
0.1 | 0.1 | GO:0071042 | nuclear polyadenylation-dependent mRNA catabolic process(GO:0071042) polyadenylation-dependent mRNA catabolic process(GO:0071047) |
0.1 | 0.1 | GO:0043144 | snoRNA processing(GO:0043144) |
0.1 | 0.2 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) |
0.1 | 0.1 | GO:0031937 | positive regulation of chromatin silencing(GO:0031937) |
0.1 | 0.1 | GO:2001027 | negative regulation of endothelial cell chemotaxis(GO:2001027) |
0.1 | 1.6 | GO:0045471 | response to ethanol(GO:0045471) |
0.1 | 0.7 | GO:0045116 | protein neddylation(GO:0045116) |
0.1 | 0.2 | GO:0002884 | negative regulation of hypersensitivity(GO:0002884) |
0.1 | 0.2 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
0.1 | 0.1 | GO:1904742 | regulation of telomeric DNA binding(GO:1904742) |
0.1 | 0.3 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
0.1 | 0.2 | GO:2000675 | negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
0.1 | 0.1 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
0.1 | 0.3 | GO:0051639 | actin filament network formation(GO:0051639) |
0.1 | 0.1 | GO:0015746 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.1 | 0.2 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.1 | 0.9 | GO:0016180 | snRNA processing(GO:0016180) |
0.1 | 0.1 | GO:0036394 | amylase secretion(GO:0036394) |
0.1 | 0.2 | GO:0035022 | positive regulation of Rac protein signal transduction(GO:0035022) |
0.1 | 0.4 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
0.1 | 0.2 | GO:0015744 | succinate transport(GO:0015744) |
0.1 | 0.6 | GO:0019430 | removal of superoxide radicals(GO:0019430) |
0.1 | 0.2 | GO:0042518 | negative regulation of tyrosine phosphorylation of Stat3 protein(GO:0042518) |
0.1 | 0.1 | GO:0043416 | regulation of skeletal muscle tissue regeneration(GO:0043416) |
0.1 | 0.2 | GO:0035020 | regulation of Rac protein signal transduction(GO:0035020) |
0.1 | 1.4 | GO:0034605 | cellular response to heat(GO:0034605) |
0.1 | 0.3 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
0.1 | 0.2 | GO:1903011 | negative regulation of bone development(GO:1903011) |
0.1 | 0.1 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
0.1 | 0.3 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
0.1 | 0.1 | GO:0046607 | positive regulation of centrosome cycle(GO:0046607) |
0.1 | 0.2 | GO:0060287 | epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
0.1 | 0.4 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
0.1 | 0.1 | GO:0072173 | metanephric tubule morphogenesis(GO:0072173) |
0.1 | 0.1 | GO:1901985 | positive regulation of protein acetylation(GO:1901985) |
0.1 | 0.2 | GO:0045345 | MHC class I biosynthetic process(GO:0045341) regulation of MHC class I biosynthetic process(GO:0045343) positive regulation of MHC class I biosynthetic process(GO:0045345) |
0.1 | 0.1 | GO:0072553 | terminal button organization(GO:0072553) |
0.1 | 0.5 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
0.1 | 0.1 | GO:0006069 | ethanol metabolic process(GO:0006067) ethanol oxidation(GO:0006069) |
0.1 | 0.1 | GO:0046487 | glyoxylate metabolic process(GO:0046487) |
0.1 | 0.2 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
0.1 | 0.1 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
0.1 | 0.2 | GO:2000543 | positive regulation of gastrulation(GO:2000543) |
0.1 | 0.2 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
0.1 | 0.1 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
0.1 | 0.1 | GO:0050955 | thermoception(GO:0050955) |
0.1 | 0.2 | GO:2000288 | positive regulation of myoblast proliferation(GO:2000288) |
0.1 | 0.1 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
0.1 | 0.1 | GO:0034436 | glycoprotein transport(GO:0034436) |
0.1 | 0.1 | GO:0042374 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
0.1 | 0.2 | GO:0045651 | positive regulation of macrophage differentiation(GO:0045651) |
0.1 | 0.3 | GO:1903779 | regulation of cardiac conduction(GO:1903779) |
0.1 | 0.2 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
0.1 | 0.1 | GO:0042525 | tyrosine phosphorylation of Stat6 protein(GO:0042505) regulation of tyrosine phosphorylation of Stat6 protein(GO:0042525) |
0.1 | 0.1 | GO:0090027 | negative regulation of monocyte chemotaxis(GO:0090027) |
0.1 | 0.1 | GO:0034633 | retinol transport(GO:0034633) isoprenoid transport(GO:0046864) terpenoid transport(GO:0046865) |
0.1 | 0.6 | GO:0030033 | microvillus assembly(GO:0030033) |
0.1 | 0.2 | GO:0035357 | peroxisome proliferator activated receptor signaling pathway(GO:0035357) |
0.1 | 0.1 | GO:2000987 | regulation of fear response(GO:1903365) positive regulation of fear response(GO:1903367) regulation of behavioral fear response(GO:2000822) positive regulation of behavioral fear response(GO:2000987) |
0.1 | 0.2 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
0.1 | 0.8 | GO:0006805 | xenobiotic metabolic process(GO:0006805) |
0.1 | 0.7 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
0.1 | 0.2 | GO:0042168 | heme metabolic process(GO:0042168) |
0.1 | 0.2 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
0.1 | 0.3 | GO:0007000 | nucleolus organization(GO:0007000) |
0.1 | 0.2 | GO:0046416 | D-amino acid catabolic process(GO:0019478) D-amino acid metabolic process(GO:0046416) |
0.1 | 0.1 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
0.1 | 0.2 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
0.1 | 0.3 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
0.1 | 0.5 | GO:0007096 | regulation of exit from mitosis(GO:0007096) |
0.1 | 0.4 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.1 | 0.2 | GO:0046684 | response to pyrethroid(GO:0046684) |
0.0 | 0.1 | GO:2000680 | regulation of rubidium ion transport(GO:2000680) |
0.0 | 0.1 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
0.0 | 0.2 | GO:0070474 | positive regulation of uterine smooth muscle contraction(GO:0070474) |
0.0 | 0.1 | GO:0071374 | cellular response to parathyroid hormone stimulus(GO:0071374) |
0.0 | 0.1 | GO:0061110 | dense core granule biogenesis(GO:0061110) |
0.0 | 0.2 | GO:0043461 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
0.0 | 0.9 | GO:0035418 | protein localization to synapse(GO:0035418) |
0.0 | 0.6 | GO:0015693 | magnesium ion transport(GO:0015693) |
0.0 | 0.2 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
0.0 | 0.2 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
0.0 | 0.2 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
0.0 | 0.6 | GO:0048490 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
0.0 | 1.3 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
0.0 | 0.3 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
0.0 | 0.3 | GO:0018342 | protein prenylation(GO:0018342) prenylation(GO:0097354) |
0.0 | 0.2 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
0.0 | 0.4 | GO:0045579 | positive regulation of B cell differentiation(GO:0045579) |
0.0 | 0.1 | GO:0061626 | pharyngeal arch artery morphogenesis(GO:0061626) |
0.0 | 0.1 | GO:2000302 | positive regulation of synaptic vesicle exocytosis(GO:2000302) |
0.0 | 0.1 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
0.0 | 0.1 | GO:0070662 | mast cell proliferation(GO:0070662) regulation of mast cell proliferation(GO:0070666) positive regulation of mast cell proliferation(GO:0070668) |
0.0 | 0.2 | GO:0006107 | oxaloacetate metabolic process(GO:0006107) |
0.0 | 0.3 | GO:0006379 | mRNA cleavage(GO:0006379) |
0.0 | 0.3 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
0.0 | 0.2 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
0.0 | 0.1 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
0.0 | 0.8 | GO:0030488 | tRNA methylation(GO:0030488) |
0.0 | 0.2 | GO:0090308 | regulation of methylation-dependent chromatin silencing(GO:0090308) |
0.0 | 0.1 | GO:0048341 | paraxial mesoderm formation(GO:0048341) |
0.0 | 0.2 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
0.0 | 0.1 | GO:0023041 | neuronal signal transduction(GO:0023041) |
0.0 | 0.4 | GO:1901984 | negative regulation of protein acetylation(GO:1901984) negative regulation of peptidyl-lysine acetylation(GO:2000757) |
0.0 | 0.0 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
0.0 | 0.1 | GO:0045656 | negative regulation of monocyte differentiation(GO:0045656) |
0.0 | 0.3 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
0.0 | 0.3 | GO:0031297 | replication fork processing(GO:0031297) |
0.0 | 0.1 | GO:0000076 | DNA replication checkpoint(GO:0000076) |
0.0 | 0.4 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
0.0 | 0.0 | GO:0072205 | metanephric collecting duct development(GO:0072205) |
0.0 | 0.2 | GO:0035372 | protein localization to microtubule(GO:0035372) |
0.0 | 0.1 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
0.0 | 0.2 | GO:0097210 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
0.0 | 0.3 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
0.0 | 1.3 | GO:0045839 | negative regulation of mitotic nuclear division(GO:0045839) |
0.0 | 0.2 | GO:0048733 | sebaceous gland development(GO:0048733) |
0.0 | 0.4 | GO:1904293 | negative regulation of ERAD pathway(GO:1904293) |
0.0 | 0.3 | GO:0043586 | tongue development(GO:0043586) |
0.0 | 0.2 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
0.0 | 0.0 | GO:2000662 | interleukin-5 secretion(GO:0072603) interleukin-13 secretion(GO:0072611) regulation of interleukin-5 secretion(GO:2000662) positive regulation of interleukin-5 secretion(GO:2000664) regulation of interleukin-13 secretion(GO:2000665) positive regulation of interleukin-13 secretion(GO:2000667) |
0.0 | 0.5 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
0.0 | 0.0 | GO:0009301 | snRNA transcription(GO:0009301) |
0.0 | 0.1 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
0.0 | 0.5 | GO:0045070 | positive regulation of viral genome replication(GO:0045070) |
0.0 | 0.2 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
0.0 | 0.0 | GO:0032512 | regulation of protein phosphatase type 2B activity(GO:0032512) negative regulation of protein phosphatase type 2B activity(GO:0032513) |
0.0 | 0.2 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
0.0 | 0.3 | GO:0002082 | regulation of oxidative phosphorylation(GO:0002082) |
0.0 | 0.0 | GO:0033092 | positive regulation of immature T cell proliferation in thymus(GO:0033092) |
0.0 | 0.3 | GO:0032933 | response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
0.0 | 0.5 | GO:0006465 | signal peptide processing(GO:0006465) |
0.0 | 0.0 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
0.0 | 0.0 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
0.0 | 0.1 | GO:0071044 | histone mRNA catabolic process(GO:0071044) |
0.0 | 0.4 | GO:0000154 | rRNA modification(GO:0000154) |
0.0 | 0.0 | GO:0060751 | branch elongation involved in mammary gland duct branching(GO:0060751) |
0.0 | 0.1 | GO:1901626 | regulation of postsynaptic membrane organization(GO:1901626) |
0.0 | 0.3 | GO:0098734 | protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
0.0 | 0.1 | GO:1903423 | positive regulation of synaptic vesicle recycling(GO:1903423) |
0.0 | 0.0 | GO:0042182 | ketone catabolic process(GO:0042182) |
0.0 | 0.1 | GO:0009125 | nucleoside monophosphate catabolic process(GO:0009125) |
0.0 | 0.2 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
0.0 | 0.0 | GO:0002904 | positive regulation of B cell apoptotic process(GO:0002904) |
0.0 | 0.6 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
0.0 | 0.2 | GO:0030071 | regulation of mitotic metaphase/anaphase transition(GO:0030071) regulation of metaphase/anaphase transition of cell cycle(GO:1902099) |
0.0 | 0.3 | GO:0000338 | protein deneddylation(GO:0000338) |
0.0 | 0.2 | GO:0016115 | terpenoid catabolic process(GO:0016115) |
0.0 | 0.3 | GO:0048671 | negative regulation of collateral sprouting(GO:0048671) |
0.0 | 1.7 | GO:0030512 | negative regulation of transforming growth factor beta receptor signaling pathway(GO:0030512) negative regulation of cellular response to transforming growth factor beta stimulus(GO:1903845) |
0.0 | 0.7 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
0.0 | 0.3 | GO:0016540 | protein autoprocessing(GO:0016540) |
0.0 | 0.2 | GO:0006290 | pyrimidine dimer repair(GO:0006290) |
0.0 | 0.1 | GO:0009838 | abscission(GO:0009838) |
0.0 | 0.0 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
0.0 | 0.0 | GO:0015705 | iodide transport(GO:0015705) |
0.0 | 0.0 | GO:0045605 | negative regulation of epidermal cell differentiation(GO:0045605) |
0.0 | 0.1 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
0.0 | 0.1 | GO:0060897 | neural plate regionalization(GO:0060897) |
0.0 | 0.2 | GO:0042789 | mRNA transcription from RNA polymerase II promoter(GO:0042789) |
0.0 | 0.2 | GO:0051547 | regulation of keratinocyte migration(GO:0051547) positive regulation of keratinocyte migration(GO:0051549) |
0.0 | 0.1 | GO:0071725 | response to triacyl bacterial lipopeptide(GO:0071725) cellular response to triacyl bacterial lipopeptide(GO:0071727) |
0.0 | 0.2 | GO:0001539 | cilium or flagellum-dependent cell motility(GO:0001539) cilium-dependent cell motility(GO:0060285) |
0.0 | 0.1 | GO:0030920 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.0 | 1.6 | GO:0006892 | post-Golgi vesicle-mediated transport(GO:0006892) |
0.0 | 0.2 | GO:0045199 | maintenance of epithelial cell apical/basal polarity(GO:0045199) |
0.0 | 0.1 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
0.0 | 0.1 | GO:0006116 | NADH oxidation(GO:0006116) |
0.0 | 0.2 | GO:0022904 | respiratory electron transport chain(GO:0022904) |
0.0 | 0.4 | GO:0032801 | receptor catabolic process(GO:0032801) |
0.0 | 0.2 | GO:0097070 | ductus arteriosus closure(GO:0097070) |
0.0 | 0.1 | GO:0042256 | mature ribosome assembly(GO:0042256) |
0.0 | 0.0 | GO:0060019 | radial glial cell differentiation(GO:0060019) |
0.0 | 0.2 | GO:0035635 | entry of bacterium into host cell(GO:0035635) regulation of entry of bacterium into host cell(GO:2000535) |
0.0 | 0.1 | GO:0032607 | interferon-alpha production(GO:0032607) |
0.0 | 0.2 | GO:2000310 | regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
0.0 | 0.0 | GO:1901896 | positive regulation of calcium-transporting ATPase activity(GO:1901896) |
0.0 | 0.1 | GO:0021892 | cerebral cortex GABAergic interneuron differentiation(GO:0021892) |
0.0 | 0.4 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.0 | 0.2 | GO:0035510 | DNA dealkylation(GO:0035510) |
0.0 | 0.0 | GO:0035799 | ureter maturation(GO:0035799) |
0.0 | 0.3 | GO:0006590 | thyroid hormone generation(GO:0006590) |
0.0 | 0.2 | GO:0006071 | glycerol metabolic process(GO:0006071) |
0.0 | 0.1 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.0 | 0.2 | GO:1990001 | inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
0.0 | 0.1 | GO:0090598 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
0.0 | 0.2 | GO:0032306 | regulation of prostaglandin secretion(GO:0032306) |
0.0 | 0.2 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
0.0 | 0.0 | GO:0016074 | snoRNA metabolic process(GO:0016074) |
0.0 | 0.0 | GO:1903333 | regulation of protein folding(GO:1903332) negative regulation of protein folding(GO:1903333) |
0.0 | 0.1 | GO:0021684 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
0.0 | 0.1 | GO:0016584 | nucleosome positioning(GO:0016584) |
0.0 | 0.1 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
0.0 | 0.5 | GO:0006400 | tRNA modification(GO:0006400) |
0.0 | 1.8 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
0.0 | 0.5 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
0.0 | 0.2 | GO:0071850 | mitotic cell cycle arrest(GO:0071850) |
0.0 | 0.3 | GO:0070166 | enamel mineralization(GO:0070166) |
0.0 | 0.3 | GO:0006691 | leukotriene metabolic process(GO:0006691) |
0.0 | 0.1 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.0 | 0.3 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
0.0 | 0.1 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.0 | 0.1 | GO:0014075 | response to amine(GO:0014075) |
0.0 | 0.1 | GO:0032788 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
0.0 | 0.0 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
0.0 | 0.2 | GO:0090141 | positive regulation of mitochondrial fission(GO:0090141) |
0.0 | 0.0 | GO:2000807 | regulation of synaptic vesicle clustering(GO:2000807) |
0.0 | 0.0 | GO:0060166 | olfactory pit development(GO:0060166) |
0.0 | 0.1 | GO:0003010 | voluntary skeletal muscle contraction(GO:0003010) twitch skeletal muscle contraction(GO:0014721) |
0.0 | 0.1 | GO:0002424 | T cell mediated immune response to tumor cell(GO:0002424) regulation of T cell mediated immune response to tumor cell(GO:0002840) |
0.0 | 0.3 | GO:0061339 | establishment of monopolar cell polarity(GO:0061162) establishment or maintenance of monopolar cell polarity(GO:0061339) |
0.0 | 0.2 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
0.0 | 0.1 | GO:0042921 | glucocorticoid receptor signaling pathway(GO:0042921) |
0.0 | 0.2 | GO:0045176 | apical protein localization(GO:0045176) |
0.0 | 0.2 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
0.0 | 0.2 | GO:0061003 | positive regulation of dendritic spine morphogenesis(GO:0061003) |
0.0 | 0.1 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
0.0 | 0.2 | GO:0071625 | vocalization behavior(GO:0071625) |
0.0 | 0.7 | GO:2000785 | regulation of autophagosome assembly(GO:2000785) |
0.0 | 0.1 | GO:0002175 | protein localization to paranode region of axon(GO:0002175) |
0.0 | 0.1 | GO:0098795 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
0.0 | 0.1 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
0.0 | 0.1 | GO:1902774 | late endosome to lysosome transport(GO:1902774) |
0.0 | 0.0 | GO:0002826 | negative regulation of T-helper 1 type immune response(GO:0002826) |
0.0 | 0.3 | GO:0002115 | store-operated calcium entry(GO:0002115) |
0.0 | 0.1 | GO:0019614 | catechol-containing compound catabolic process(GO:0019614) catecholamine catabolic process(GO:0042424) |
0.0 | 0.1 | GO:0019471 | 4-hydroxyproline metabolic process(GO:0019471) |
0.0 | 0.0 | GO:0035090 | maintenance of cell polarity(GO:0030011) maintenance of apical/basal cell polarity(GO:0035090) |
0.0 | 0.0 | GO:0032971 | regulation of muscle filament sliding(GO:0032971) |
0.0 | 1.4 | GO:0008033 | tRNA processing(GO:0008033) |
0.0 | 0.2 | GO:0043153 | entrainment of circadian clock by photoperiod(GO:0043153) |
0.0 | 0.0 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
0.0 | 0.1 | GO:0051461 | regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
0.0 | 0.5 | GO:2000758 | positive regulation of peptidyl-lysine acetylation(GO:2000758) |
0.0 | 0.0 | GO:0006059 | hexitol metabolic process(GO:0006059) |
0.0 | 0.1 | GO:0021530 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
0.0 | 0.5 | GO:0043171 | peptide catabolic process(GO:0043171) |
0.0 | 0.4 | GO:0060009 | Sertoli cell development(GO:0060009) |
0.0 | 0.2 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) |
0.0 | 0.0 | GO:2000291 | regulation of myoblast proliferation(GO:2000291) |
0.0 | 0.1 | GO:0014054 | positive regulation of gamma-aminobutyric acid secretion(GO:0014054) |
0.0 | 0.1 | GO:0070129 | regulation of mitochondrial translation(GO:0070129) |
0.0 | 0.3 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
0.0 | 0.1 | GO:1990123 | L-glutamate(1-) import into cell(GO:1903802) L-glutamate import into cell(GO:1990123) |
0.0 | 0.2 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.0 | 0.1 | GO:0035336 | long-chain fatty-acyl-CoA metabolic process(GO:0035336) |
0.0 | 0.3 | GO:0051382 | kinetochore assembly(GO:0051382) |
0.0 | 0.3 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
0.0 | 0.2 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
0.0 | 0.1 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
0.0 | 0.6 | GO:0019432 | triglyceride biosynthetic process(GO:0019432) |
0.0 | 0.4 | GO:0034067 | protein localization to Golgi apparatus(GO:0034067) |
0.0 | 0.1 | GO:0009414 | response to water deprivation(GO:0009414) |
0.0 | 0.1 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
0.0 | 0.0 | GO:1902804 | negative regulation of synaptic vesicle transport(GO:1902804) |
0.0 | 0.0 | GO:0070093 | negative regulation of glucagon secretion(GO:0070093) |
0.0 | 0.1 | GO:1902172 | keratinocyte apoptotic process(GO:0097283) regulation of keratinocyte apoptotic process(GO:1902172) |
0.0 | 0.1 | GO:0051025 | negative regulation of immunoglobulin secretion(GO:0051025) |
0.0 | 0.1 | GO:0052204 | modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
0.0 | 0.7 | GO:0033120 | positive regulation of RNA splicing(GO:0033120) |
0.0 | 0.1 | GO:0032696 | negative regulation of interleukin-13 production(GO:0032696) |
0.0 | 0.1 | GO:2000197 | regulation of mRNA export from nucleus(GO:0010793) regulation of ribonucleoprotein complex localization(GO:2000197) |
0.0 | 0.0 | GO:0061620 | glycolytic process through glucose-6-phosphate(GO:0061620) |
0.0 | 0.1 | GO:0060671 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
0.0 | 0.1 | GO:0042511 | positive regulation of tyrosine phosphorylation of Stat1 protein(GO:0042511) |
0.0 | 0.1 | GO:0043247 | protection from non-homologous end joining at telomere(GO:0031848) telomere maintenance in response to DNA damage(GO:0043247) |
0.0 | 0.1 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
0.0 | 0.0 | GO:0044766 | multi-organism transport(GO:0044766) multi-organism localization(GO:1902579) |
0.0 | 0.0 | GO:0006296 | nucleotide-excision repair, DNA incision, 5'-to lesion(GO:0006296) |
0.0 | 0.1 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
0.0 | 0.1 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
0.0 | 1.0 | GO:0048024 | regulation of mRNA splicing, via spliceosome(GO:0048024) |
0.0 | 0.2 | GO:0030049 | muscle filament sliding(GO:0030049) |
0.0 | 0.1 | GO:0009649 | entrainment of circadian clock(GO:0009649) |
0.0 | 0.4 | GO:0006828 | manganese ion transport(GO:0006828) |
0.0 | 0.1 | GO:0002215 | defense response to nematode(GO:0002215) |
0.0 | 0.1 | GO:0035425 | autocrine signaling(GO:0035425) |
0.0 | 0.1 | GO:0072393 | microtubule anchoring at centrosome(GO:0034454) microtubule anchoring at microtubule organizing center(GO:0072393) |
0.0 | 0.1 | GO:0046959 | habituation(GO:0046959) |
0.0 | 0.1 | GO:0032799 | low-density lipoprotein receptor particle metabolic process(GO:0032799) |
0.0 | 0.8 | GO:0048168 | regulation of neuronal synaptic plasticity(GO:0048168) |
0.0 | 0.8 | GO:0016925 | protein sumoylation(GO:0016925) |
0.0 | 0.2 | GO:0006103 | 2-oxoglutarate metabolic process(GO:0006103) |
0.0 | 0.1 | GO:1902534 | single-organism membrane invagination(GO:1902534) |
0.0 | 0.1 | GO:0006057 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) |
0.0 | 0.3 | GO:0007080 | mitotic metaphase plate congression(GO:0007080) |
0.0 | 0.2 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
0.0 | 0.0 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
0.0 | 0.2 | GO:0000103 | sulfate assimilation(GO:0000103) |
0.0 | 0.0 | GO:0050746 | regulation of lipoprotein metabolic process(GO:0050746) |
0.0 | 0.1 | GO:2000425 | regulation of apoptotic cell clearance(GO:2000425) |
0.0 | 0.0 | GO:0021523 | somatic motor neuron differentiation(GO:0021523) |
0.0 | 0.1 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
0.0 | 0.0 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
0.0 | 0.4 | GO:0034620 | cellular response to unfolded protein(GO:0034620) |
0.0 | 0.1 | GO:0006517 | protein deglycosylation(GO:0006517) |
0.0 | 0.1 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
0.0 | 0.1 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
0.0 | 0.1 | GO:0060279 | regulation of ovulation(GO:0060278) positive regulation of ovulation(GO:0060279) |
0.0 | 0.0 | GO:0046655 | folic acid metabolic process(GO:0046655) |
0.0 | 0.1 | GO:0002786 | regulation of antimicrobial peptide production(GO:0002784) regulation of antibacterial peptide production(GO:0002786) |
0.0 | 0.0 | GO:1901894 | regulation of calcium-transporting ATPase activity(GO:1901894) |
0.0 | 0.1 | GO:0030167 | proteoglycan catabolic process(GO:0030167) |
0.0 | 0.2 | GO:0043921 | modulation by host of viral transcription(GO:0043921) modulation of transcription in other organism involved in symbiotic interaction(GO:0052312) modulation by host of symbiont transcription(GO:0052472) |
0.0 | 0.3 | GO:0052695 | cellular glucuronidation(GO:0052695) |
0.0 | 0.1 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
0.0 | 0.2 | GO:0019227 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
0.0 | 0.0 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
0.0 | 0.3 | GO:0042026 | protein refolding(GO:0042026) |
0.0 | 0.1 | GO:0060134 | prepulse inhibition(GO:0060134) |
0.0 | 0.1 | GO:0009086 | methionine biosynthetic process(GO:0009086) |
0.0 | 0.2 | GO:0021521 | ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
0.0 | 0.0 | GO:2000836 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
0.0 | 0.2 | GO:0042407 | cristae formation(GO:0042407) |
0.0 | 0.1 | GO:0060235 | lens induction in camera-type eye(GO:0060235) |
0.0 | 0.4 | GO:0045747 | positive regulation of Notch signaling pathway(GO:0045747) |
0.0 | 0.3 | GO:0006032 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
0.0 | 0.6 | GO:0000184 | nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
0.0 | 0.2 | GO:0060259 | regulation of feeding behavior(GO:0060259) |
0.0 | 0.1 | GO:0001835 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
0.0 | 0.1 | GO:1904970 | brush border assembly(GO:1904970) |
0.0 | 1.4 | GO:0010923 | negative regulation of phosphatase activity(GO:0010923) |
0.0 | 0.0 | GO:0051665 | membrane raft localization(GO:0051665) |
0.0 | 0.1 | GO:0043691 | reverse cholesterol transport(GO:0043691) |
0.0 | 0.0 | GO:0090187 | positive regulation of pancreatic juice secretion(GO:0090187) |
0.0 | 0.1 | GO:0009223 | pyrimidine deoxyribonucleotide catabolic process(GO:0009223) |
0.0 | 0.1 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
0.0 | 0.1 | GO:0008292 | acetylcholine biosynthetic process(GO:0008292) acetate ester biosynthetic process(GO:1900620) |
0.0 | 0.0 | GO:0090394 | negative regulation of excitatory postsynaptic potential(GO:0090394) |
0.0 | 0.1 | GO:0018243 | protein O-linked glycosylation via threonine(GO:0018243) |
0.0 | 0.0 | GO:0048478 | replication fork protection(GO:0048478) |
0.0 | 0.2 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
0.0 | 0.1 | GO:0009249 | protein lipoylation(GO:0009249) |
0.0 | 0.1 | GO:0071500 | cellular response to nitrosative stress(GO:0071500) |
0.0 | 0.3 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
0.0 | 0.0 | GO:0046533 | negative regulation of photoreceptor cell differentiation(GO:0046533) retinal rod cell differentiation(GO:0060221) |
0.0 | 0.1 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
0.0 | 0.1 | GO:0038089 | positive regulation of cell migration by vascular endothelial growth factor signaling pathway(GO:0038089) |
0.0 | 0.0 | GO:0021823 | cerebral cortex tangential migration using cell-cell interactions(GO:0021823) postnatal olfactory bulb interneuron migration(GO:0021827) |
0.0 | 0.1 | GO:0060440 | trachea formation(GO:0060440) |
0.0 | 0.2 | GO:0010640 | regulation of platelet-derived growth factor receptor signaling pathway(GO:0010640) |
0.0 | 0.1 | GO:0045945 | positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
0.0 | 0.0 | GO:0021586 | pons maturation(GO:0021586) |
0.0 | 0.2 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
0.0 | 0.1 | GO:1902414 | protein localization to cell junction(GO:1902414) |
0.0 | 0.1 | GO:1900273 | positive regulation of long-term synaptic potentiation(GO:1900273) |
0.0 | 0.0 | GO:0032596 | protein transport into membrane raft(GO:0032596) |
0.0 | 0.1 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
0.0 | 0.3 | GO:0042773 | ATP synthesis coupled electron transport(GO:0042773) |
0.0 | 0.0 | GO:0070989 | oxidative demethylation(GO:0070989) |
0.0 | 0.1 | GO:0032808 | lacrimal gland development(GO:0032808) |
0.0 | 0.1 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
0.0 | 0.1 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.1 | GO:0045896 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
0.0 | 0.1 | GO:0032506 | cytokinetic process(GO:0032506) |
0.0 | 0.1 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.0 | 0.0 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
0.0 | 0.1 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
0.0 | 0.3 | GO:0016578 | histone deubiquitination(GO:0016578) |
0.0 | 0.3 | GO:0032456 | endocytic recycling(GO:0032456) |
0.0 | 0.1 | GO:0045741 | positive regulation of epidermal growth factor-activated receptor activity(GO:0045741) |
0.0 | 0.0 | GO:0002727 | natural killer cell cytokine production(GO:0002370) regulation of natural killer cell cytokine production(GO:0002727) |
0.0 | 0.1 | GO:0060449 | bud elongation involved in lung branching(GO:0060449) |
0.0 | 0.1 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
0.0 | 0.0 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
0.0 | 0.1 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
0.0 | 0.5 | GO:0006284 | base-excision repair(GO:0006284) |
0.0 | 0.1 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
0.0 | 0.1 | GO:0043584 | nose development(GO:0043584) |
0.0 | 0.0 | GO:0098828 | positive regulation of inhibitory postsynaptic potential(GO:0097151) modulation of inhibitory postsynaptic potential(GO:0098828) |
0.0 | 0.0 | GO:0055070 | copper ion homeostasis(GO:0055070) |
0.0 | 0.3 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
0.0 | 0.0 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
0.0 | 0.3 | GO:0006826 | iron ion transport(GO:0006826) |
0.0 | 0.1 | GO:0022616 | DNA strand elongation(GO:0022616) |
0.0 | 0.3 | GO:0006096 | glycolytic process(GO:0006096) |
0.0 | 0.0 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
0.0 | 0.2 | GO:0032331 | negative regulation of chondrocyte differentiation(GO:0032331) |
0.0 | 0.1 | GO:1903573 | negative regulation of response to endoplasmic reticulum stress(GO:1903573) |
0.0 | 0.1 | GO:0045724 | positive regulation of cilium assembly(GO:0045724) |
0.0 | 0.0 | GO:0033683 | nucleotide-excision repair, DNA incision(GO:0033683) |
0.0 | 0.0 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
0.0 | 0.0 | GO:0060027 | convergent extension involved in gastrulation(GO:0060027) |
0.0 | 0.1 | GO:0010841 | positive regulation of circadian sleep/wake cycle, wakefulness(GO:0010841) |
0.0 | 0.4 | GO:0018345 | protein palmitoylation(GO:0018345) |
0.0 | 0.2 | GO:0043330 | response to exogenous dsRNA(GO:0043330) |
0.0 | 0.1 | GO:0019388 | galactose catabolic process(GO:0019388) |
0.0 | 0.1 | GO:0042448 | progesterone metabolic process(GO:0042448) |
0.0 | 0.0 | GO:1901970 | positive regulation of mitotic sister chromatid separation(GO:1901970) |
0.0 | 0.1 | GO:1900107 | regulation of nodal signaling pathway(GO:1900107) |
0.0 | 0.0 | GO:0002576 | platelet degranulation(GO:0002576) |
0.0 | 0.0 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
0.0 | 0.2 | GO:0030970 | retrograde protein transport, ER to cytosol(GO:0030970) |
0.0 | 0.0 | GO:1903671 | negative regulation of sprouting angiogenesis(GO:1903671) |
0.0 | 0.1 | GO:0060999 | positive regulation of dendritic spine development(GO:0060999) |
0.0 | 0.1 | GO:0032230 | positive regulation of synaptic transmission, GABAergic(GO:0032230) |
0.0 | 0.1 | GO:0032060 | bleb assembly(GO:0032060) |
0.0 | 0.0 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
0.0 | 0.1 | GO:0051767 | nitric-oxide synthase biosynthetic process(GO:0051767) regulation of nitric-oxide synthase biosynthetic process(GO:0051769) |
0.0 | 0.1 | GO:0022900 | electron transport chain(GO:0022900) |
0.0 | 0.5 | GO:0006418 | tRNA aminoacylation for protein translation(GO:0006418) |
0.0 | 0.0 | GO:0090191 | negative regulation of branching involved in ureteric bud morphogenesis(GO:0090191) |
0.0 | 0.0 | GO:0046125 | pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
0.0 | 0.0 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
0.0 | 0.1 | GO:0007262 | STAT protein import into nucleus(GO:0007262) |
0.0 | 0.3 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
0.0 | 0.1 | GO:2000074 | regulation of type B pancreatic cell development(GO:2000074) |
0.0 | 0.0 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
0.0 | 0.0 | GO:0034239 | regulation of macrophage fusion(GO:0034239) |
0.0 | 0.1 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
0.0 | 0.0 | GO:0090244 | Wnt signaling pathway involved in somitogenesis(GO:0090244) |
0.0 | 0.0 | GO:0008216 | spermidine metabolic process(GO:0008216) |
0.0 | 0.1 | GO:0045003 | DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
0.0 | 0.1 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
0.0 | 0.1 | GO:0061370 | testosterone biosynthetic process(GO:0061370) |
0.0 | 0.1 | GO:0090214 | spongiotrophoblast layer developmental growth(GO:0090214) |
0.0 | 0.0 | GO:0033058 | directional locomotion(GO:0033058) |
0.0 | 0.0 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
0.0 | 0.1 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
0.0 | 0.6 | GO:0051298 | centrosome duplication(GO:0051298) |
0.0 | 0.0 | GO:0002074 | extraocular skeletal muscle development(GO:0002074) |
0.0 | 0.1 | GO:0030885 | regulation of myeloid dendritic cell activation(GO:0030885) |
0.0 | 0.0 | GO:0010966 | regulation of phosphate transport(GO:0010966) |
0.0 | 0.1 | GO:0003310 | pancreatic A cell differentiation(GO:0003310) |
0.0 | 0.1 | GO:0009452 | 7-methylguanosine RNA capping(GO:0009452) RNA capping(GO:0036260) |
0.0 | 0.2 | GO:0008053 | mitochondrial fusion(GO:0008053) |
0.0 | 0.0 | GO:0048934 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
0.0 | 0.0 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
0.0 | 0.0 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
0.0 | 0.1 | GO:0034627 | 'de novo' NAD biosynthetic process(GO:0034627) |
0.0 | 0.1 | GO:0046836 | glycolipid transport(GO:0046836) |
0.0 | 0.0 | GO:0014827 | intestine smooth muscle contraction(GO:0014827) |
0.0 | 0.1 | GO:0007379 | segment specification(GO:0007379) |
0.0 | 0.1 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
0.0 | 0.1 | GO:0015722 | canalicular bile acid transport(GO:0015722) |
0.0 | 0.1 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
0.0 | 0.0 | GO:0035337 | fatty-acyl-CoA metabolic process(GO:0035337) |
0.0 | 0.2 | GO:0060218 | hematopoietic stem cell differentiation(GO:0060218) |
0.0 | 0.1 | GO:0060081 | membrane hyperpolarization(GO:0060081) |
0.0 | 0.0 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
0.0 | 0.0 | GO:0032898 | neurotrophin production(GO:0032898) |
0.0 | 0.0 | GO:0060618 | nipple development(GO:0060618) |
0.0 | 0.4 | GO:0006334 | nucleosome assembly(GO:0006334) |
0.0 | 0.1 | GO:0072501 | cellular divalent inorganic anion homeostasis(GO:0072501) |
0.0 | 0.0 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
0.0 | 0.3 | GO:0009166 | nucleotide catabolic process(GO:0009166) |
0.0 | 0.1 | GO:1901741 | positive regulation of myoblast fusion(GO:1901741) |
0.0 | 0.0 | GO:0010578 | regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010578) positive regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010579) |
0.0 | 0.0 | GO:0036491 | regulation of translation in response to endoplasmic reticulum stress(GO:0036490) regulation of translation initiation in response to endoplasmic reticulum stress(GO:0036491) eiF2alpha phosphorylation in response to endoplasmic reticulum stress(GO:0036492) |
0.0 | 0.0 | GO:0002930 | trabecular meshwork development(GO:0002930) |
0.0 | 0.0 | GO:0051546 | keratinocyte migration(GO:0051546) |
0.0 | 0.0 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
0.0 | 0.0 | GO:0003418 | growth plate cartilage chondrocyte differentiation(GO:0003418) |
0.0 | 0.2 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
0.0 | 0.0 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
0.0 | 0.3 | GO:0015986 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
0.0 | 0.0 | GO:0035795 | negative regulation of mitochondrial membrane permeability(GO:0035795) |
0.0 | 0.0 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
0.0 | 0.0 | GO:0045602 | negative regulation of endothelial cell differentiation(GO:0045602) |
0.0 | 0.3 | GO:0048240 | sperm capacitation(GO:0048240) |
0.0 | 0.1 | GO:0000722 | telomere maintenance via recombination(GO:0000722) |
0.0 | 0.1 | GO:0050962 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
0.0 | 0.0 | GO:0033085 | negative regulation of T cell differentiation in thymus(GO:0033085) |
0.0 | 0.0 | GO:0006824 | cobalt ion transport(GO:0006824) |
0.0 | 0.0 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
0.0 | 0.0 | GO:0060438 | trachea development(GO:0060438) |
0.0 | 0.2 | GO:0007143 | female meiotic division(GO:0007143) |
0.0 | 0.0 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
0.0 | 0.0 | GO:1901673 | regulation of mitotic spindle assembly(GO:1901673) |
0.0 | 0.0 | GO:0032367 | intracellular cholesterol transport(GO:0032367) |
0.0 | 0.0 | GO:0006303 | double-strand break repair via nonhomologous end joining(GO:0006303) |
0.0 | 0.1 | GO:0090103 | cochlea morphogenesis(GO:0090103) |
0.0 | 0.0 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.0 | 0.0 | GO:0051088 | PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
0.0 | 0.2 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
0.0 | 0.1 | GO:2000300 | regulation of synaptic vesicle exocytosis(GO:2000300) |
0.0 | 0.0 | GO:0060687 | regulation of branching involved in prostate gland morphogenesis(GO:0060687) |
0.0 | 0.0 | GO:0014029 | neural crest formation(GO:0014029) |
0.0 | 0.2 | GO:0043968 | histone H2A acetylation(GO:0043968) |
0.0 | 0.1 | GO:0045217 | cell-cell junction maintenance(GO:0045217) |
0.0 | 1.4 | GO:0042787 | protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0042787) |
0.0 | 0.0 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.0 | 0.0 | GO:0006119 | oxidative phosphorylation(GO:0006119) |
0.0 | 0.1 | GO:0030836 | positive regulation of actin filament depolymerization(GO:0030836) |
0.0 | 0.0 | GO:0003344 | pericardium morphogenesis(GO:0003344) |
0.0 | 0.1 | GO:0032329 | serine transport(GO:0032329) |
0.0 | 0.0 | GO:0001927 | exocyst assembly(GO:0001927) |
0.0 | 0.1 | GO:0021952 | central nervous system projection neuron axonogenesis(GO:0021952) |
0.0 | 0.0 | GO:0032594 | protein transport within lipid bilayer(GO:0032594) |
0.0 | 0.1 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
0.0 | 0.0 | GO:0071233 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
0.0 | 0.0 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
0.0 | 0.0 | GO:0030222 | eosinophil differentiation(GO:0030222) |
0.0 | 0.0 | GO:0006655 | phosphatidylglycerol biosynthetic process(GO:0006655) phosphatidylglycerol metabolic process(GO:0046471) |
0.0 | 0.1 | GO:0046835 | carbohydrate phosphorylation(GO:0046835) |
0.0 | 0.0 | GO:0045917 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
0.0 | 0.0 | GO:2000412 | thymocyte migration(GO:0072679) regulation of thymocyte migration(GO:2000410) positive regulation of thymocyte migration(GO:2000412) |
0.0 | 0.0 | GO:2000463 | positive regulation of excitatory postsynaptic potential(GO:2000463) |
0.0 | 0.1 | GO:0007141 | male meiosis I(GO:0007141) |
0.0 | 0.1 | GO:0048665 | neuron fate specification(GO:0048665) |
0.0 | 0.1 | GO:0046349 | amino sugar biosynthetic process(GO:0046349) |
0.0 | 0.0 | GO:0007199 | G-protein coupled receptor signaling pathway coupled to cGMP nucleotide second messenger(GO:0007199) |
0.0 | 0.1 | GO:0043044 | ATP-dependent chromatin remodeling(GO:0043044) |
0.0 | 0.0 | GO:1900227 | positive regulation of NLRP3 inflammasome complex assembly(GO:1900227) |
0.0 | 0.0 | GO:0007468 | regulation of rhodopsin gene expression(GO:0007468) |
0.0 | 0.0 | GO:0070235 | regulation of activation-induced cell death of T cells(GO:0070235) |
0.0 | 0.0 | GO:0060525 | prostate glandular acinus development(GO:0060525) |
0.0 | 0.0 | GO:0016056 | rhodopsin mediated signaling pathway(GO:0016056) |
0.0 | 0.0 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
0.0 | 0.0 | GO:0046952 | ketone body catabolic process(GO:0046952) |
0.0 | 0.0 | GO:0032277 | negative regulation of gonadotropin secretion(GO:0032277) |
0.0 | 0.0 | GO:0048550 | negative regulation of pinocytosis(GO:0048550) |
0.0 | 0.5 | GO:0035914 | skeletal muscle cell differentiation(GO:0035914) |
0.0 | 0.0 | GO:0097050 | type B pancreatic cell apoptotic process(GO:0097050) |
0.0 | 0.0 | GO:0045901 | positive regulation of translational elongation(GO:0045901) |
0.0 | 0.1 | GO:0050435 | beta-amyloid metabolic process(GO:0050435) |
0.0 | 0.0 | GO:0060157 | urinary bladder development(GO:0060157) |
0.0 | 0.0 | GO:0035791 | platelet-derived growth factor receptor-beta signaling pathway(GO:0035791) |
0.0 | 0.0 | GO:0002361 | CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0002361) |
0.0 | 0.1 | GO:0031116 | positive regulation of microtubule polymerization(GO:0031116) |
0.0 | 0.0 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.0 | 0.0 | GO:0046337 | phosphatidylethanolamine metabolic process(GO:0046337) |
0.0 | 0.0 | GO:2000767 | positive regulation of cytoplasmic translation(GO:2000767) |
0.0 | 0.1 | GO:0006270 | DNA replication initiation(GO:0006270) |
0.0 | 0.1 | GO:0032012 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.0 | 0.0 | GO:0051256 | mitotic spindle elongation(GO:0000022) mitotic spindle midzone assembly(GO:0051256) |
0.0 | 0.0 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.8 | 4.1 | GO:0031094 | platelet dense tubular network(GO:0031094) |
0.5 | 5.8 | GO:0070852 | cell body fiber(GO:0070852) |
0.4 | 1.9 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.3 | 1.3 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.3 | 2.4 | GO:0042587 | glycogen granule(GO:0042587) |
0.3 | 1.5 | GO:0005579 | membrane attack complex(GO:0005579) |
0.3 | 0.8 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.3 | 2.0 | GO:0016342 | catenin complex(GO:0016342) |
0.3 | 1.0 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.2 | 0.7 | GO:0097413 | Lewy body(GO:0097413) |
0.2 | 0.2 | GO:0055087 | Ski complex(GO:0055087) |
0.2 | 0.7 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
0.2 | 0.9 | GO:0071203 | WASH complex(GO:0071203) |
0.2 | 0.7 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.2 | 1.0 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.2 | 3.1 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
0.2 | 0.8 | GO:0045293 | mRNA editing complex(GO:0045293) |
0.2 | 0.2 | GO:0045239 | tricarboxylic acid cycle enzyme complex(GO:0045239) |
0.2 | 0.8 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.2 | 0.4 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.2 | 0.8 | GO:0030127 | COPII vesicle coat(GO:0030127) |
0.2 | 0.9 | GO:0001651 | dense fibrillar component(GO:0001651) |
0.2 | 0.7 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.2 | 0.5 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
0.2 | 1.2 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.2 | 0.7 | GO:0032021 | NELF complex(GO:0032021) |
0.2 | 0.2 | GO:0097513 | myosin II filament(GO:0097513) |
0.2 | 0.5 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.1 | 0.6 | GO:0070545 | PeBoW complex(GO:0070545) |
0.1 | 0.4 | GO:0071942 | XPC complex(GO:0071942) |
0.1 | 0.6 | GO:0097433 | dense body(GO:0097433) |
0.1 | 0.4 | GO:0046691 | intracellular canaliculus(GO:0046691) |
0.1 | 0.4 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
0.1 | 0.6 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
0.1 | 2.0 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.1 | 0.4 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
0.1 | 0.7 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
0.1 | 1.4 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.1 | 1.3 | GO:0030126 | COPI vesicle coat(GO:0030126) |
0.1 | 0.6 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.1 | 0.5 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.1 | 0.5 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.1 | 0.5 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.1 | 0.3 | GO:1990423 | RZZ complex(GO:1990423) |
0.1 | 0.3 | GO:0048179 | activin receptor complex(GO:0048179) |
0.1 | 0.3 | GO:0000811 | GINS complex(GO:0000811) |
0.1 | 0.1 | GO:0035061 | interchromatin granule(GO:0035061) |
0.1 | 0.8 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.1 | 0.2 | GO:0008328 | ionotropic glutamate receptor complex(GO:0008328) neurotransmitter receptor complex(GO:0098878) |
0.1 | 0.6 | GO:0001650 | fibrillar center(GO:0001650) |
0.1 | 0.3 | GO:0032444 | activin responsive factor complex(GO:0032444) |
0.1 | 0.3 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.1 | 0.5 | GO:0043202 | lysosomal lumen(GO:0043202) |
0.1 | 0.3 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
0.1 | 5.8 | GO:0005811 | lipid particle(GO:0005811) |
0.1 | 0.7 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.1 | 0.9 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.1 | 0.8 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
0.1 | 0.5 | GO:0089701 | U2AF(GO:0089701) |
0.1 | 1.7 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.1 | 1.9 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
0.1 | 1.9 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.1 | 1.2 | GO:0005583 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.1 | 0.5 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.1 | 0.8 | GO:0005845 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.1 | 0.3 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
0.1 | 0.3 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.1 | 0.7 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.1 | 3.3 | GO:0031672 | A band(GO:0031672) |
0.1 | 0.4 | GO:1990745 | EARP complex(GO:1990745) |
0.1 | 3.7 | GO:0030964 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
0.1 | 0.3 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
0.1 | 0.4 | GO:0042825 | TAP complex(GO:0042825) |
0.1 | 0.3 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
0.1 | 0.1 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
0.1 | 0.1 | GO:0042824 | MHC class I peptide loading complex(GO:0042824) |
0.1 | 0.4 | GO:0005915 | zonula adherens(GO:0005915) |
0.1 | 0.4 | GO:0033269 | internode region of axon(GO:0033269) |
0.1 | 0.4 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.1 | 0.3 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.1 | 0.1 | GO:0098827 | endoplasmic reticulum subcompartment(GO:0098827) |
0.1 | 0.5 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
0.1 | 0.3 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.1 | 0.4 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.1 | 1.8 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
0.1 | 0.7 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
0.1 | 0.5 | GO:0000445 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
0.1 | 0.2 | GO:0097427 | microtubule bundle(GO:0097427) |
0.1 | 0.2 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.1 | 0.4 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
0.1 | 0.6 | GO:0017059 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
0.1 | 1.2 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.1 | 0.2 | GO:0071256 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
0.1 | 0.3 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.1 | 0.9 | GO:0032426 | stereocilium tip(GO:0032426) |
0.1 | 0.5 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.1 | 0.5 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.1 | 1.0 | GO:0001891 | phagocytic cup(GO:0001891) |
0.1 | 0.7 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.1 | 0.8 | GO:0035102 | PRC1 complex(GO:0035102) |
0.1 | 0.1 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
0.1 | 0.3 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.1 | 0.9 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.1 | 0.6 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.1 | 0.2 | GO:0016939 | kinesin II complex(GO:0016939) |
0.1 | 0.5 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.1 | 0.7 | GO:0032797 | SMN complex(GO:0032797) |
0.1 | 0.6 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.1 | 0.2 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.1 | 0.3 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
0.1 | 0.4 | GO:0070847 | core mediator complex(GO:0070847) |
0.1 | 0.2 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
0.1 | 1.1 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.1 | 3.0 | GO:0031903 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
0.1 | 0.5 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
0.1 | 0.6 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
0.1 | 0.5 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
0.1 | 0.2 | GO:0005827 | polar microtubule(GO:0005827) |
0.1 | 1.5 | GO:0005719 | nuclear euchromatin(GO:0005719) |
0.1 | 0.2 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.1 | 0.8 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.1 | 0.6 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.1 | 0.3 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
0.1 | 0.2 | GO:0005712 | chiasma(GO:0005712) |
0.1 | 0.2 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
0.1 | 0.2 | GO:0044326 | dendritic spine neck(GO:0044326) |
0.1 | 0.2 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.1 | 0.2 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.1 | 0.3 | GO:0042575 | DNA polymerase complex(GO:0042575) |
0.1 | 0.8 | GO:0060293 | P granule(GO:0043186) pole plasm(GO:0045495) germ plasm(GO:0060293) |
0.1 | 0.5 | GO:0031143 | pseudopodium(GO:0031143) |
0.1 | 0.2 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
0.1 | 0.1 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
0.1 | 2.6 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.1 | 0.1 | GO:0043219 | lateral loop(GO:0043219) |
0.1 | 0.3 | GO:0001940 | male pronucleus(GO:0001940) |
0.1 | 0.6 | GO:0032039 | integrator complex(GO:0032039) |
0.1 | 0.5 | GO:0045263 | proton-transporting ATP synthase complex, coupling factor F(o)(GO:0045263) |
0.1 | 0.1 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
0.1 | 0.5 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.1 | 0.6 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
0.1 | 0.3 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
0.1 | 0.1 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.1 | 0.1 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.1 | 0.1 | GO:1904115 | axon cytoplasm(GO:1904115) |
0.1 | 0.2 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
0.1 | 0.1 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
0.1 | 0.3 | GO:0031415 | NatA complex(GO:0031415) |
0.1 | 1.3 | GO:0030315 | T-tubule(GO:0030315) |
0.1 | 0.2 | GO:0035189 | Rb-E2F complex(GO:0035189) |
0.1 | 0.3 | GO:0036128 | CatSper complex(GO:0036128) |
0.1 | 0.7 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.1 | 0.6 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
0.1 | 0.3 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
0.1 | 0.2 | GO:0045298 | tubulin complex(GO:0045298) |
0.1 | 0.2 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.1 | 0.6 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
0.1 | 1.1 | GO:0036379 | striated muscle thin filament(GO:0005865) myofilament(GO:0036379) |
0.1 | 0.4 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.1 | 0.3 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.1 | 0.2 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.0 | 0.1 | GO:0031298 | replication fork protection complex(GO:0031298) |
0.0 | 0.1 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
0.0 | 0.1 | GO:0043259 | laminin-10 complex(GO:0043259) |
0.0 | 0.3 | GO:0032009 | early phagosome(GO:0032009) |
0.0 | 0.3 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.0 | 0.3 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
0.0 | 0.0 | GO:0000938 | GARP complex(GO:0000938) |
0.0 | 0.2 | GO:1990716 | axonemal central apparatus(GO:1990716) |
0.0 | 4.1 | GO:0030176 | integral component of endoplasmic reticulum membrane(GO:0030176) |
0.0 | 0.5 | GO:0016580 | Sin3 complex(GO:0016580) |
0.0 | 0.5 | GO:0001527 | microfibril(GO:0001527) |
0.0 | 5.4 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
0.0 | 0.4 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
0.0 | 0.1 | GO:0043203 | axon hillock(GO:0043203) |
0.0 | 0.2 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
0.0 | 0.6 | GO:0010369 | chromocenter(GO:0010369) |
0.0 | 1.1 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.0 | 0.1 | GO:0042555 | MCM complex(GO:0042555) |
0.0 | 0.1 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.0 | 0.5 | GO:0005686 | U2 snRNP(GO:0005686) |
0.0 | 1.1 | GO:0035869 | ciliary transition zone(GO:0035869) |
0.0 | 0.1 | GO:0005879 | axonemal microtubule(GO:0005879) |
0.0 | 0.4 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.0 | 0.6 | GO:0045120 | pronucleus(GO:0045120) |
0.0 | 0.1 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
0.0 | 0.1 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
0.0 | 1.4 | GO:0031201 | SNARE complex(GO:0031201) |
0.0 | 0.2 | GO:0097209 | epidermal lamellar body(GO:0097209) |
0.0 | 0.0 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.0 | 0.1 | GO:0044354 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.0 | 0.2 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.0 | 1.0 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
0.0 | 0.9 | GO:0032420 | stereocilium(GO:0032420) |
0.0 | 1.2 | GO:0045171 | intercellular bridge(GO:0045171) |
0.0 | 0.1 | GO:0030904 | retromer complex(GO:0030904) |
0.0 | 0.1 | GO:0098536 | deuterosome(GO:0098536) |
0.0 | 0.0 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.0 | 0.3 | GO:0000124 | SAGA complex(GO:0000124) |
0.0 | 0.0 | GO:0000780 | condensed nuclear chromosome, centromeric region(GO:0000780) |
0.0 | 0.3 | GO:0005883 | neurofilament(GO:0005883) |
0.0 | 2.8 | GO:0036064 | ciliary basal body(GO:0036064) |
0.0 | 0.5 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.0 | 0.0 | GO:0005767 | secondary lysosome(GO:0005767) |
0.0 | 0.2 | GO:0016528 | sarcoplasm(GO:0016528) |
0.0 | 0.9 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
0.0 | 0.2 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
0.0 | 0.2 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.0 | 0.2 | GO:0032584 | growth cone membrane(GO:0032584) |
0.0 | 1.0 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.0 | 0.1 | GO:0030870 | Mre11 complex(GO:0030870) |
0.0 | 0.2 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.0 | 0.1 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
0.0 | 0.1 | GO:1990130 | Iml1 complex(GO:1990130) |
0.0 | 0.8 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
0.0 | 0.7 | GO:0005746 | mitochondrial respiratory chain(GO:0005746) |
0.0 | 0.1 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
0.0 | 4.3 | GO:0005759 | mitochondrial matrix(GO:0005759) |
0.0 | 0.3 | GO:0005640 | nuclear outer membrane(GO:0005640) |
0.0 | 0.1 | GO:0044308 | axonal spine(GO:0044308) |
0.0 | 0.2 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.0 | 0.5 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
0.0 | 0.2 | GO:0016011 | dystroglycan complex(GO:0016011) |
0.0 | 0.6 | GO:0097228 | sperm principal piece(GO:0097228) |
0.0 | 0.1 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
0.0 | 0.1 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
0.0 | 0.0 | GO:0034464 | BBSome(GO:0034464) |
0.0 | 1.8 | GO:0016605 | PML body(GO:0016605) |
0.0 | 0.6 | GO:0045335 | phagocytic vesicle(GO:0045335) |
0.0 | 0.1 | GO:0036449 | microtubule minus-end(GO:0036449) |
0.0 | 0.3 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
0.0 | 0.2 | GO:0020005 | symbiont-containing vacuole membrane(GO:0020005) |
0.0 | 0.1 | GO:0097208 | alveolar lamellar body(GO:0097208) |
0.0 | 0.1 | GO:0030689 | Noc complex(GO:0030689) |
0.0 | 1.6 | GO:0005643 | nuclear pore(GO:0005643) |
0.0 | 0.2 | GO:0002177 | manchette(GO:0002177) |
0.0 | 0.1 | GO:0033270 | paranode region of axon(GO:0033270) |
0.0 | 5.6 | GO:0019898 | extrinsic component of membrane(GO:0019898) |
0.0 | 0.2 | GO:0031931 | TORC1 complex(GO:0031931) |
0.0 | 0.3 | GO:0032806 | carboxy-terminal domain protein kinase complex(GO:0032806) |
0.0 | 0.3 | GO:0048786 | presynaptic active zone(GO:0048786) |
0.0 | 0.1 | GO:0005955 | calcineurin complex(GO:0005955) |
0.0 | 0.1 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.0 | 0.1 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
0.0 | 0.2 | GO:0033263 | CORVET complex(GO:0033263) |
0.0 | 0.5 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.0 | 0.1 | GO:0061617 | MICOS complex(GO:0061617) |
0.0 | 0.1 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
0.0 | 0.1 | GO:0030478 | actin cap(GO:0030478) |
0.0 | 0.5 | GO:1990752 | microtubule end(GO:1990752) |
0.0 | 0.5 | GO:0016235 | aggresome(GO:0016235) |
0.0 | 0.1 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
0.0 | 0.3 | GO:0044295 | axonal growth cone(GO:0044295) |
0.0 | 0.6 | GO:0005876 | spindle microtubule(GO:0005876) |
0.0 | 0.1 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
0.0 | 0.2 | GO:0000242 | pericentriolar material(GO:0000242) |
0.0 | 0.3 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.0 | 0.1 | GO:0034706 | sodium channel complex(GO:0034706) |
0.0 | 1.0 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
0.0 | 0.2 | GO:0035631 | CD40 receptor complex(GO:0035631) |
0.0 | 0.3 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
0.0 | 0.1 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
0.0 | 0.4 | GO:0000777 | condensed chromosome kinetochore(GO:0000777) |
0.0 | 0.2 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.0 | 0.2 | GO:0042589 | zymogen granule membrane(GO:0042589) |
0.0 | 0.1 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.0 | 0.1 | GO:0071953 | elastic fiber(GO:0071953) |
0.0 | 0.2 | GO:0000782 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
0.0 | 0.1 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.0 | 0.2 | GO:0005652 | nuclear lamina(GO:0005652) |
0.0 | 0.1 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
0.0 | 0.1 | GO:0034448 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.0 | 1.3 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
0.0 | 0.0 | GO:0032389 | MutLalpha complex(GO:0032389) |
0.0 | 0.9 | GO:0055037 | recycling endosome(GO:0055037) |
0.0 | 0.2 | GO:0000421 | autophagosome membrane(GO:0000421) |
0.0 | 0.3 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
0.0 | 0.1 | GO:0071986 | Ragulator complex(GO:0071986) |
0.0 | 0.0 | GO:0033648 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
0.0 | 0.1 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.0 | 0.1 | GO:0043194 | axon initial segment(GO:0043194) |
0.0 | 0.1 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.0 | 0.0 | GO:0061574 | ASAP complex(GO:0061574) |
0.0 | 23.1 | GO:0005783 | endoplasmic reticulum(GO:0005783) |
0.0 | 0.4 | GO:0060170 | ciliary membrane(GO:0060170) |
0.0 | 0.1 | GO:0097422 | tubular endosome(GO:0097422) |
0.0 | 0.2 | GO:0031902 | late endosome membrane(GO:0031902) |
0.0 | 1.7 | GO:0005769 | early endosome(GO:0005769) |
0.0 | 1.6 | GO:0005802 | trans-Golgi network(GO:0005802) |
0.0 | 0.0 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
0.0 | 0.1 | GO:0000346 | transcription export complex(GO:0000346) |
0.0 | 1.3 | GO:0008021 | synaptic vesicle(GO:0008021) |
0.0 | 0.1 | GO:0097342 | ripoptosome(GO:0097342) |
0.0 | 0.1 | GO:0001652 | granular component(GO:0001652) |
0.0 | 0.1 | GO:0090543 | Flemming body(GO:0090543) |
0.0 | 0.1 | GO:0031983 | vesicle lumen(GO:0031983) |
0.0 | 0.1 | GO:0031045 | dense core granule(GO:0031045) |
0.0 | 0.4 | GO:0031941 | filamentous actin(GO:0031941) |
0.0 | 0.2 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
0.0 | 0.6 | GO:0036126 | sperm flagellum(GO:0036126) |
0.0 | 0.0 | GO:0005642 | annulate lamellae(GO:0005642) |
0.0 | 0.1 | GO:0036156 | inner dynein arm(GO:0036156) |
0.0 | 0.1 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
0.0 | 1.1 | GO:0030016 | myofibril(GO:0030016) |
0.0 | 0.0 | GO:0072687 | meiotic spindle(GO:0072687) |
0.0 | 0.2 | GO:0032154 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
0.0 | 0.1 | GO:0071014 | post-mRNA release spliceosomal complex(GO:0071014) |
0.0 | 1.1 | GO:0016607 | nuclear speck(GO:0016607) |
0.0 | 0.9 | GO:0015934 | large ribosomal subunit(GO:0015934) |
0.0 | 0.1 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
0.0 | 0.0 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
0.0 | 0.1 | GO:0008278 | cohesin complex(GO:0008278) |
0.0 | 0.6 | GO:0030496 | midbody(GO:0030496) |
0.0 | 0.9 | GO:0005840 | ribosome(GO:0005840) |
0.0 | 0.0 | GO:0090576 | RNA polymerase III transcription factor complex(GO:0090576) |
0.0 | 0.6 | GO:0000784 | nuclear chromosome, telomeric region(GO:0000784) |
0.0 | 0.0 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
0.0 | 0.0 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
0.0 | 0.2 | GO:0071339 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
0.0 | 0.1 | GO:0070382 | exocytic vesicle(GO:0070382) |
0.0 | 0.0 | GO:0071437 | invadopodium(GO:0071437) |
0.0 | 0.1 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
0.0 | 0.1 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
0.0 | 0.2 | GO:0000781 | chromosome, telomeric region(GO:0000781) |
0.0 | 0.1 | GO:0043189 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
0.0 | 0.0 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.0 | 0.4 | GO:0000776 | kinetochore(GO:0000776) |
0.0 | 0.0 | GO:0044393 | microspike(GO:0044393) |
0.0 | 0.0 | GO:0071817 | MMXD complex(GO:0071817) |
0.0 | 0.6 | GO:0005819 | spindle(GO:0005819) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.8 | 3.4 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
0.8 | 2.5 | GO:0004771 | sterol esterase activity(GO:0004771) |
0.8 | 1.6 | GO:0070644 | vitamin D response element binding(GO:0070644) |
0.8 | 2.3 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.7 | 2.2 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.7 | 2.2 | GO:0038181 | bile acid receptor activity(GO:0038181) |
0.7 | 2.1 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
0.7 | 2.0 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
0.6 | 5.5 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.6 | 1.7 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
0.5 | 3.1 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
0.5 | 1.5 | GO:0032190 | acrosin binding(GO:0032190) |
0.5 | 1.4 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
0.5 | 2.3 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
0.4 | 1.3 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.4 | 1.3 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
0.4 | 1.3 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.4 | 1.6 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.4 | 1.9 | GO:0017040 | ceramidase activity(GO:0017040) |
0.4 | 1.9 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
0.3 | 1.0 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
0.3 | 1.3 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.3 | 1.3 | GO:0032564 | dATP binding(GO:0032564) |
0.3 | 1.0 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
0.3 | 4.1 | GO:0015643 | toxic substance binding(GO:0015643) |
0.3 | 1.0 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
0.3 | 2.0 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
0.3 | 1.7 | GO:0016151 | nickel cation binding(GO:0016151) |
0.3 | 0.8 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
0.3 | 0.5 | GO:0016428 | tRNA (cytosine) methyltransferase activity(GO:0016427) tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
0.3 | 0.8 | GO:0031686 | A1 adenosine receptor binding(GO:0031686) |
0.3 | 0.8 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.3 | 0.8 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.3 | 0.3 | GO:0016531 | copper chaperone activity(GO:0016531) superoxide dismutase copper chaperone activity(GO:0016532) |
0.3 | 1.0 | GO:0071614 | linoleic acid epoxygenase activity(GO:0071614) |
0.2 | 1.5 | GO:0004064 | arylesterase activity(GO:0004064) |
0.2 | 0.7 | GO:0055100 | adiponectin binding(GO:0055100) |
0.2 | 0.2 | GO:0030792 | methylarsonite methyltransferase activity(GO:0030792) |
0.2 | 0.2 | GO:0016426 | tRNA (adenine) methyltransferase activity(GO:0016426) tRNA (adenine-N1-)-methyltransferase activity(GO:0016429) |
0.2 | 0.5 | GO:0042281 | dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase activity(GO:0042281) |
0.2 | 1.0 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
0.2 | 7.7 | GO:0052767 | prenylcysteine methylesterase activity(GO:0010296) 1-oxa-2-oxocycloheptane lactonase activity(GO:0018731) sulfolactone hydrolase activity(GO:0018732) butyrolactone hydrolase activity(GO:0018734) endosulfan lactone lactonase activity(GO:0034892) L-ascorbate 6-phosphate lactonase activity(GO:0035460) Ser-tRNA(Thr) hydrolase activity(GO:0043905) Ala-tRNA(Pro) hydrolase activity(GO:0043906) Cys-tRNA(Pro) hydrolase activity(GO:0043907) Ser(Gly)-tRNA(Ala) hydrolase activity(GO:0043908) all-trans-retinyl-palmitate hydrolase, all-trans-retinol forming activity(GO:0047376) mannosyl-oligosaccharide 1,6-alpha-mannosidase activity(GO:0052767) mannosyl-oligosaccharide 1,3-alpha-mannosidase activity(GO:0052768) methyl indole-3-acetate esterase activity(GO:0080030) methyl salicylate esterase activity(GO:0080031) methyl jasmonate esterase activity(GO:0080032) |
0.2 | 1.8 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.2 | 0.2 | GO:0046921 | alpha-(1->6)-fucosyltransferase activity(GO:0046921) |
0.2 | 0.9 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
0.2 | 0.2 | GO:0003896 | DNA primase activity(GO:0003896) |
0.2 | 1.7 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.2 | 0.6 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.2 | 2.3 | GO:0070411 | I-SMAD binding(GO:0070411) |
0.2 | 0.6 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
0.2 | 1.4 | GO:0046790 | virion binding(GO:0046790) |
0.2 | 2.8 | GO:0070402 | NADPH binding(GO:0070402) |
0.2 | 0.6 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
0.2 | 1.0 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.2 | 1.0 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
0.2 | 0.8 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
0.2 | 0.6 | GO:0004802 | transketolase activity(GO:0004802) |
0.2 | 0.8 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.2 | 0.6 | GO:0008142 | oxysterol binding(GO:0008142) |
0.2 | 0.4 | GO:0008545 | JUN kinase kinase activity(GO:0008545) |
0.2 | 0.6 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.2 | 3.9 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.2 | 0.6 | GO:0035514 | DNA demethylase activity(GO:0035514) |
0.2 | 0.5 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.2 | 0.5 | GO:0004096 | catalase activity(GO:0004096) |
0.2 | 2.7 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
0.2 | 0.9 | GO:0052723 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
0.2 | 0.5 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
0.2 | 1.2 | GO:0000339 | RNA cap binding(GO:0000339) |
0.2 | 0.5 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.2 | 0.7 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.2 | 1.7 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
0.2 | 0.3 | GO:1901612 | cardiolipin binding(GO:1901612) |
0.2 | 0.5 | GO:0030350 | iron-responsive element binding(GO:0030350) |
0.2 | 1.0 | GO:0043426 | MRF binding(GO:0043426) |
0.2 | 1.5 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.2 | 0.8 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
0.2 | 0.3 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
0.2 | 1.2 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.2 | 1.0 | GO:0002054 | nucleobase binding(GO:0002054) |
0.2 | 5.6 | GO:0016749 | N-succinyltransferase activity(GO:0016749) |
0.2 | 0.5 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
0.2 | 0.5 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
0.2 | 3.2 | GO:0003785 | actin monomer binding(GO:0003785) |
0.2 | 0.5 | GO:0030911 | TPR domain binding(GO:0030911) |
0.2 | 0.6 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.2 | 1.6 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.2 | 0.5 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.2 | 0.8 | GO:0003997 | acyl-CoA oxidase activity(GO:0003997) |
0.1 | 1.6 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.1 | 0.3 | GO:0016300 | tRNA (uracil) methyltransferase activity(GO:0016300) |
0.1 | 0.6 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.1 | 0.6 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
0.1 | 0.3 | GO:0051990 | (R)-2-hydroxyglutarate dehydrogenase activity(GO:0051990) |
0.1 | 0.4 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.1 | 0.4 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
0.1 | 0.3 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
0.1 | 3.2 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
0.1 | 0.8 | GO:0033695 | oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
0.1 | 0.6 | GO:0004030 | aldehyde dehydrogenase [NAD(P)+] activity(GO:0004030) |
0.1 | 0.7 | GO:0005346 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) |
0.1 | 0.4 | GO:0035939 | microsatellite binding(GO:0035939) |
0.1 | 0.8 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
0.1 | 0.4 | GO:0004705 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
0.1 | 0.5 | GO:0097001 | ceramide binding(GO:0097001) |
0.1 | 0.3 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
0.1 | 0.4 | GO:0034927 | fluorene oxygenase activity(GO:0018585) mono-butyltin dioxygenase activity(GO:0018586) tri-n-butyltin dioxygenase activity(GO:0018588) di-n-butyltin dioxygenase activity(GO:0018589) methylsilanetriol hydroxylase activity(GO:0018590) methyl tertiary butyl ether 3-monooxygenase activity(GO:0018591) 4-nitrocatechol 4-monooxygenase activity(GO:0018592) 4-chlorophenoxyacetate monooxygenase activity(GO:0018593) tert-butanol 2-monooxygenase activity(GO:0018594) alpha-pinene monooxygenase activity(GO:0018595) dimethylsilanediol hydroxylase activity(GO:0018596) ammonia monooxygenase activity(GO:0018597) hydroxymethylsilanetriol oxidase activity(GO:0018598) 2-hydroxyisobutyrate 3-monooxygenase activity(GO:0018599) alpha-pinene dehydrogenase activity(GO:0018600) bisphenol A hydroxylase B activity(GO:0034559) 2,2-bis(4-hydroxyphenyl)-1-propanol hydroxylase activity(GO:0034562) 9-fluorenone-3,4-dioxygenase activity(GO:0034786) anthracene 9,10-dioxygenase activity(GO:0034816) 2-(methylthio)benzothiazole monooxygenase activity(GO:0034857) 2-hydroxybenzothiazole monooxygenase activity(GO:0034858) benzothiazole monooxygenase activity(GO:0034859) 2,6-dihydroxybenzothiazole monooxygenase activity(GO:0034862) pinacolone 5-monooxygenase activity(GO:0034870) thioacetamide S-oxygenase activity(GO:0034873) thioacetamide S-oxide S-oxygenase activity(GO:0034874) endosulfan monooxygenase I activity(GO:0034888) N-nitrodimethylamine hydroxylase activity(GO:0034893) 4-(1-ethyl-1,4-dimethyl-pentyl)phenol monoxygenase activity(GO:0034897) endosulfan ether monooxygenase activity(GO:0034903) pyrene 4,5-monooxygenase activity(GO:0034925) pyrene 1,2-monooxygenase activity(GO:0034927) 1-hydroxypyrene 6,7-monooxygenase activity(GO:0034928) 1-hydroxypyrene 7,8-monooxygenase activity(GO:0034929) phenylboronic acid monooxygenase activity(GO:0034950) spheroidene monooxygenase activity(GO:0043823) |
0.1 | 0.5 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
0.1 | 0.5 | GO:0008430 | selenium binding(GO:0008430) |
0.1 | 0.4 | GO:0050693 | LBD domain binding(GO:0050693) |
0.1 | 1.5 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.1 | 1.4 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
0.1 | 0.5 | GO:0004083 | bisphosphoglycerate 2-phosphatase activity(GO:0004083) |
0.1 | 0.6 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
0.1 | 0.4 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
0.1 | 0.4 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.1 | 0.4 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
0.1 | 0.3 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
0.1 | 0.5 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
0.1 | 0.6 | GO:0022820 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
0.1 | 0.9 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.1 | 0.1 | GO:0031559 | oxidosqualene cyclase activity(GO:0031559) |
0.1 | 0.4 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
0.1 | 0.4 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.1 | 0.4 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
0.1 | 1.3 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
0.1 | 0.7 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
0.1 | 0.9 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
0.1 | 0.8 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
0.1 | 0.3 | GO:0015154 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
0.1 | 0.8 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.1 | 2.5 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
0.1 | 1.5 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
0.1 | 0.3 | GO:0034191 | apolipoprotein A-I receptor binding(GO:0034191) |
0.1 | 0.2 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
0.1 | 0.2 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
0.1 | 0.2 | GO:0033677 | DNA/RNA helicase activity(GO:0033677) |
0.1 | 0.1 | GO:0015927 | trehalase activity(GO:0015927) |
0.1 | 0.2 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
0.1 | 0.2 | GO:0033265 | choline binding(GO:0033265) |
0.1 | 0.5 | GO:0035197 | siRNA binding(GO:0035197) |
0.1 | 0.4 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.1 | 0.2 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
0.1 | 0.3 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
0.1 | 0.5 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
0.1 | 0.5 | GO:0070728 | leucine binding(GO:0070728) |
0.1 | 1.8 | GO:0005112 | Notch binding(GO:0005112) |
0.1 | 0.1 | GO:0000009 | alpha-1,6-mannosyltransferase activity(GO:0000009) |
0.1 | 0.3 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
0.1 | 1.2 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
0.1 | 0.7 | GO:0008097 | 5S rRNA binding(GO:0008097) |
0.1 | 0.7 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.1 | 0.4 | GO:0036374 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
0.1 | 0.4 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.1 | 0.4 | GO:0051880 | G-quadruplex DNA binding(GO:0051880) |
0.1 | 0.4 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.1 | 1.5 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
0.1 | 0.5 | GO:0000146 | microfilament motor activity(GO:0000146) |
0.1 | 0.6 | GO:0050733 | RS domain binding(GO:0050733) |
0.1 | 0.2 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) |
0.1 | 0.3 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.1 | 0.4 | GO:0052851 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
0.1 | 0.2 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
0.1 | 3.0 | GO:0042169 | SH2 domain binding(GO:0042169) |
0.1 | 2.2 | GO:0052715 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) photoreceptor cyclic-nucleotide phosphodiesterase activity(GO:0004120) 7,8-dihydro-D-neopterin 2',3'-cyclic phosphate phosphodiesterase activity(GO:0044688) inositol phosphosphingolipid phospholipase activity(GO:0052712) inositol phosphorylceramide phospholipase activity(GO:0052713) mannosyl-inositol phosphorylceramide phospholipase activity(GO:0052714) mannosyl-diinositol phosphorylceramide phospholipase activity(GO:0052715) |
0.1 | 0.4 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
0.1 | 0.3 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.1 | 1.7 | GO:0016864 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
0.1 | 0.7 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
0.1 | 0.1 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
0.1 | 0.4 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
0.1 | 0.2 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.1 | 0.5 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
0.1 | 0.3 | GO:0019864 | IgG binding(GO:0019864) |
0.1 | 0.1 | GO:0019187 | beta-1,4-mannosyltransferase activity(GO:0019187) |
0.1 | 0.3 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.1 | 0.4 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
0.1 | 1.0 | GO:0004787 | thiamine-pyrophosphatase activity(GO:0004787) UDP-2,3-diacylglucosamine hydrolase activity(GO:0008758) dATP pyrophosphohydrolase activity(GO:0008828) dihydroneopterin monophosphate phosphatase activity(GO:0019176) dihydroneopterin triphosphate pyrophosphohydrolase activity(GO:0019177) dTTP diphosphatase activity(GO:0036218) phosphocholine hydrolase activity(GO:0044606) |
0.1 | 0.3 | GO:0004359 | glutaminase activity(GO:0004359) |
0.1 | 0.5 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
0.1 | 0.9 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
0.1 | 0.6 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.1 | 0.4 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
0.1 | 0.3 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.1 | 0.3 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
0.1 | 1.2 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.1 | 0.3 | GO:0019862 | IgA binding(GO:0019862) |
0.1 | 0.2 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.1 | 0.2 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
0.1 | 1.4 | GO:0004889 | acetylcholine-activated cation-selective channel activity(GO:0004889) |
0.1 | 0.9 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
0.1 | 2.0 | GO:0016645 | oxidoreductase activity, acting on the CH-NH group of donors(GO:0016645) |
0.1 | 1.4 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
0.1 | 0.1 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
0.1 | 0.9 | GO:0005523 | tropomyosin binding(GO:0005523) |
0.1 | 0.1 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
0.1 | 0.2 | GO:0030519 | snoRNP binding(GO:0030519) |
0.1 | 0.2 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
0.1 | 1.2 | GO:0032183 | SUMO binding(GO:0032183) |
0.1 | 0.2 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
0.1 | 0.8 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
0.1 | 0.5 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
0.1 | 0.8 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.1 | 0.2 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
0.1 | 0.8 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.1 | 0.2 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
0.1 | 0.1 | GO:0008169 | C-methyltransferase activity(GO:0008169) 2-polyprenyl-6-methoxy-1,4-benzoquinone methyltransferase activity(GO:0008425) quinone cofactor methyltransferase activity(GO:0030580) |
0.1 | 0.2 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
0.1 | 1.2 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
0.1 | 0.2 | GO:0035671 | enone reductase activity(GO:0035671) |
0.1 | 0.2 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
0.1 | 0.5 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
0.1 | 0.2 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
0.1 | 0.4 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
0.1 | 0.2 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
0.1 | 0.2 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
0.1 | 0.2 | GO:0051379 | alpha2-adrenergic receptor activity(GO:0004938) epinephrine binding(GO:0051379) |
0.1 | 0.5 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
0.1 | 0.2 | GO:0097016 | L27 domain binding(GO:0097016) |
0.1 | 0.8 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.1 | 0.2 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.1 | 1.1 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
0.1 | 1.0 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
0.1 | 0.2 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
0.1 | 0.2 | GO:0004103 | choline kinase activity(GO:0004103) |
0.1 | 0.3 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
0.1 | 0.1 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
0.1 | 0.3 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
0.1 | 0.2 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.1 | 2.1 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
0.1 | 2.2 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
0.1 | 1.4 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.1 | 0.2 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.1 | 0.2 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.1 | 0.1 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
0.1 | 0.3 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.1 | 0.3 | GO:0070191 | methionine-R-sulfoxide reductase activity(GO:0070191) |
0.1 | 0.3 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
0.1 | 0.4 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.1 | 0.9 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
0.1 | 0.6 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.1 | 0.3 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.1 | 0.4 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
0.1 | 0.1 | GO:0035198 | miRNA binding(GO:0035198) |
0.1 | 0.3 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
0.1 | 0.2 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
0.1 | 0.4 | GO:0016289 | CoA hydrolase activity(GO:0016289) |
0.1 | 0.1 | GO:0046848 | hydroxyapatite binding(GO:0046848) |
0.1 | 0.7 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
0.1 | 0.5 | GO:0031432 | titin binding(GO:0031432) |
0.1 | 0.5 | GO:0003988 | acetyl-CoA C-acyltransferase activity(GO:0003988) |
0.1 | 0.1 | GO:0015141 | succinate transmembrane transporter activity(GO:0015141) |
0.1 | 0.1 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
0.1 | 0.1 | GO:0017153 | sodium:dicarboxylate symporter activity(GO:0017153) |
0.1 | 0.1 | GO:0008905 | mannose-phosphate guanylyltransferase activity(GO:0008905) |
0.1 | 0.1 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.1 | 0.1 | GO:0036137 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
0.1 | 0.3 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.1 | 0.3 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
0.1 | 0.3 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.1 | 0.3 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.1 | 0.5 | GO:0004779 | sulfate adenylyltransferase activity(GO:0004779) |
0.1 | 0.4 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
0.1 | 0.2 | GO:0008147 | structural constituent of bone(GO:0008147) |
0.1 | 1.0 | GO:0008252 | nucleotidase activity(GO:0008252) |
0.1 | 0.1 | GO:0008948 | oxaloacetate decarboxylase activity(GO:0008948) |
0.1 | 0.2 | GO:0003910 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
0.1 | 1.9 | GO:0070888 | E-box binding(GO:0070888) |
0.1 | 0.2 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.1 | 0.2 | GO:0004028 | 3-chloroallyl aldehyde dehydrogenase activity(GO:0004028) |
0.1 | 0.1 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.1 | 0.3 | GO:0050815 | phosphoserine binding(GO:0050815) |
0.1 | 0.2 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
0.1 | 0.3 | GO:1990254 | keratin filament binding(GO:1990254) |
0.1 | 0.6 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.1 | 0.7 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
0.1 | 0.6 | GO:0043733 | alkylbase DNA N-glycosylase activity(GO:0003905) DNA-3-methylbase glycosylase activity(GO:0043733) |
0.1 | 0.2 | GO:0016790 | thiolester hydrolase activity(GO:0016790) |
0.1 | 0.9 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.1 | 1.0 | GO:0043295 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
0.1 | 0.2 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.1 | 0.1 | GO:0005338 | nucleotide-sugar transmembrane transporter activity(GO:0005338) |
0.1 | 1.2 | GO:0004364 | glutathione transferase activity(GO:0004364) |
0.1 | 0.4 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
0.1 | 0.2 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.1 | 0.5 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.1 | 0.5 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.1 | 0.1 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
0.1 | 5.7 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
0.1 | 0.1 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
0.1 | 0.5 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
0.1 | 0.3 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.1 | 0.2 | GO:0032453 | histone demethylase activity (H3-K4 specific)(GO:0032453) |
0.1 | 0.2 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.1 | 0.5 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.1 | 0.7 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
0.1 | 0.6 | GO:0004955 | prostaglandin receptor activity(GO:0004955) |
0.1 | 0.3 | GO:0030274 | LIM domain binding(GO:0030274) |
0.1 | 0.2 | GO:0048030 | disaccharide binding(GO:0048030) |
0.1 | 0.2 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
0.1 | 0.1 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.1 | 0.1 | GO:0035870 | dITP diphosphatase activity(GO:0035870) |
0.1 | 0.3 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
0.1 | 0.1 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
0.1 | 0.2 | GO:2001070 | starch binding(GO:2001070) |
0.1 | 0.4 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.1 | 0.2 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.1 | 0.1 | GO:0035175 | histone kinase activity (H3-S10 specific)(GO:0035175) |
0.1 | 0.1 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.1 | 0.6 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
0.1 | 0.2 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.1 | 0.1 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
0.1 | 0.2 | GO:0008251 | tRNA-specific adenosine deaminase activity(GO:0008251) |
0.1 | 0.2 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
0.1 | 0.2 | GO:0016896 | 3'-5'-exoribonuclease activity(GO:0000175) exoribonuclease activity, producing 5'-phosphomonoesters(GO:0016896) |
0.1 | 0.4 | GO:0003720 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
0.1 | 0.4 | GO:0004952 | dopamine neurotransmitter receptor activity(GO:0004952) |
0.1 | 0.2 | GO:0070137 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
0.1 | 0.4 | GO:0001223 | transcription coactivator binding(GO:0001223) |
0.1 | 0.1 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.1 | 0.2 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
0.1 | 0.2 | GO:1990239 | steroid hormone binding(GO:1990239) |
0.1 | 0.2 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
0.1 | 0.5 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.1 | 0.1 | GO:0004844 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
0.1 | 0.4 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
0.1 | 0.2 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.1 | 0.3 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.0 | 0.2 | GO:0016443 | bidentate ribonuclease III activity(GO:0016443) |
0.0 | 0.4 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
0.0 | 1.2 | GO:0051059 | NF-kappaB binding(GO:0051059) |
0.0 | 0.6 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
0.0 | 0.2 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
0.0 | 0.3 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
0.0 | 0.1 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.0 | 0.3 | GO:0004549 | tRNA-specific ribonuclease activity(GO:0004549) |
0.0 | 0.3 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.0 | 1.1 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
0.0 | 0.1 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
0.0 | 0.1 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
0.0 | 0.1 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
0.0 | 0.8 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
0.0 | 0.3 | GO:0008494 | translation activator activity(GO:0008494) |
0.0 | 0.2 | GO:0071253 | connexin binding(GO:0071253) |
0.0 | 0.4 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
0.0 | 0.2 | GO:0016936 | galactoside binding(GO:0016936) |
0.0 | 0.2 | GO:0019808 | polyamine binding(GO:0019808) |
0.0 | 0.3 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.0 | 0.3 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
0.0 | 0.1 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.0 | 0.2 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.0 | 0.5 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
0.0 | 0.2 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
0.0 | 1.2 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
0.0 | 0.2 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.0 | 0.3 | GO:0004112 | cyclic-nucleotide phosphodiesterase activity(GO:0004112) |
0.0 | 0.2 | GO:0004673 | protein histidine kinase activity(GO:0004673) |
0.0 | 0.1 | GO:0004724 | magnesium-dependent protein serine/threonine phosphatase activity(GO:0004724) |
0.0 | 0.1 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
0.0 | 0.4 | GO:0031386 | protein tag(GO:0031386) |
0.0 | 0.0 | GO:0030284 | estrogen receptor activity(GO:0030284) |
0.0 | 0.1 | GO:0043175 | RNA polymerase core enzyme binding(GO:0043175) |
0.0 | 0.2 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
0.0 | 0.1 | GO:0047623 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
0.0 | 0.3 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
0.0 | 0.1 | GO:0005119 | smoothened binding(GO:0005119) |
0.0 | 0.9 | GO:0004129 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.0 | 0.7 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
0.0 | 0.0 | GO:0034416 | bisphosphoglycerate phosphatase activity(GO:0034416) |
0.0 | 0.3 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
0.0 | 0.3 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.0 | 0.1 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
0.0 | 0.9 | GO:0016763 | transferase activity, transferring pentosyl groups(GO:0016763) |
0.0 | 0.2 | GO:0070052 | collagen V binding(GO:0070052) |
0.0 | 0.3 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
0.0 | 0.3 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
0.0 | 0.1 | GO:0016015 | morphogen activity(GO:0016015) |
0.0 | 1.0 | GO:0070330 | aromatase activity(GO:0070330) |
0.0 | 0.4 | GO:0070990 | snRNP binding(GO:0070990) |
0.0 | 0.2 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
0.0 | 3.2 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
0.0 | 0.5 | GO:0016860 | intramolecular oxidoreductase activity(GO:0016860) |
0.0 | 0.2 | GO:0030515 | snoRNA binding(GO:0030515) |
0.0 | 0.1 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.0 | 0.7 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
0.0 | 0.1 | GO:0071553 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
0.0 | 0.2 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.0 | 0.1 | GO:0015166 | polyol transmembrane transporter activity(GO:0015166) |
0.0 | 0.1 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
0.0 | 0.2 | GO:0019763 | immunoglobulin receptor activity(GO:0019763) |
0.0 | 0.1 | GO:0000403 | Y-form DNA binding(GO:0000403) |
0.0 | 0.9 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
0.0 | 0.3 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.0 | 0.3 | GO:0098599 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
0.0 | 0.2 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) |
0.0 | 0.1 | GO:0018503 | enoyl-[acyl-carrier-protein] reductase activity(GO:0016631) 2,3-dihydroxy-2,3-dihydro-phenylpropionate dehydrogenase activity(GO:0018498) cis-2,3-dihydrodiol DDT dehydrogenase activity(GO:0018499) trans-9R,10R-dihydrodiolphenanthrene dehydrogenase activity(GO:0018500) cis-chlorobenzene dihydrodiol dehydrogenase activity(GO:0018501) 2,5-dichloro-2,5-cyclohexadiene-1,4-diol dehydrogenase activity(GO:0018502) trans-1,2-dihydrodiolphenanthrene dehydrogenase activity(GO:0018503) 3,4-dihydroxy-3,4-dihydrofluorene dehydrogenase activity(GO:0034790) benzo(a)pyrene-trans-11,12-dihydrodiol dehydrogenase activity(GO:0034805) benzo(a)pyrene-cis-4,5-dihydrodiol dehydrogenase activity(GO:0034809) citronellyl-CoA dehydrogenase activity(GO:0034824) menthone dehydrogenase activity(GO:0034838) phthalate 3,4-cis-dihydrodiol dehydrogenase activity(GO:0034912) cinnamate reductase activity(GO:0043786) NADPH-dependent curcumin reductase activity(GO:0052849) NADPH-dependent dihydrocurcumin reductase activity(GO:0052850) |
0.0 | 0.1 | GO:0001640 | adenylate cyclase inhibiting G-protein coupled glutamate receptor activity(GO:0001640) |
0.0 | 0.1 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
0.0 | 0.2 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
0.0 | 0.2 | GO:0005113 | patched binding(GO:0005113) |
0.0 | 0.2 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
0.0 | 0.2 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.0 | 0.7 | GO:0036002 | pre-mRNA binding(GO:0036002) |
0.0 | 0.5 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
0.0 | 0.2 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
0.0 | 0.3 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.0 | 0.5 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
0.0 | 0.4 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.0 | 0.7 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
0.0 | 0.7 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
0.0 | 0.3 | GO:0008469 | histone-arginine N-methyltransferase activity(GO:0008469) |
0.0 | 0.2 | GO:0004331 | fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
0.0 | 0.3 | GO:0071617 | lysophospholipid acyltransferase activity(GO:0071617) |
0.0 | 0.5 | GO:0015924 | mannosyl-oligosaccharide mannosidase activity(GO:0015924) |
0.0 | 0.1 | GO:0000026 | alpha-1,2-mannosyltransferase activity(GO:0000026) |
0.0 | 0.3 | GO:0004576 | oligosaccharyl transferase activity(GO:0004576) |
0.0 | 0.3 | GO:0004568 | chitinase activity(GO:0004568) |
0.0 | 1.6 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
0.0 | 0.3 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
0.0 | 0.1 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
0.0 | 0.1 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
0.0 | 0.1 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
0.0 | 0.1 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.0 | 0.3 | GO:0016595 | glutamate binding(GO:0016595) |
0.0 | 0.0 | GO:0004809 | tRNA (guanine-N2-)-methyltransferase activity(GO:0004809) |
0.0 | 0.1 | GO:0031685 | adenosine receptor binding(GO:0031685) |
0.0 | 0.7 | GO:0005227 | calcium activated cation channel activity(GO:0005227) |
0.0 | 0.1 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.0 | 0.1 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
0.0 | 0.1 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
0.0 | 0.1 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
0.0 | 1.4 | GO:0035326 | enhancer binding(GO:0035326) |
0.0 | 1.7 | GO:0019843 | rRNA binding(GO:0019843) |
0.0 | 0.3 | GO:0008200 | ion channel inhibitor activity(GO:0008200) |
0.0 | 0.4 | GO:0042162 | telomeric DNA binding(GO:0042162) |
0.0 | 0.1 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
0.0 | 0.4 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
0.0 | 0.4 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
0.0 | 0.7 | GO:0015459 | potassium channel regulator activity(GO:0015459) |
0.0 | 0.1 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.0 | 0.8 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
0.0 | 0.1 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
0.0 | 0.4 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
0.0 | 0.1 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.0 | 1.1 | GO:0005109 | frizzled binding(GO:0005109) |
0.0 | 0.1 | GO:0043398 | HLH domain binding(GO:0043398) |
0.0 | 0.8 | GO:0004033 | aldo-keto reductase (NADP) activity(GO:0004033) |
0.0 | 0.0 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
0.0 | 0.1 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
0.0 | 0.1 | GO:0043495 | protein anchor(GO:0043495) |
0.0 | 0.4 | GO:0015250 | water channel activity(GO:0015250) |
0.0 | 0.1 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
0.0 | 0.0 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.0 | 0.2 | GO:0102336 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
0.0 | 0.8 | GO:0016667 | oxidoreductase activity, acting on a sulfur group of donors(GO:0016667) |
0.0 | 0.1 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
0.0 | 0.1 | GO:0070878 | primary miRNA binding(GO:0070878) |
0.0 | 0.1 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
0.0 | 0.1 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
0.0 | 0.1 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
0.0 | 0.5 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.0 | 0.1 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.0 | 0.3 | GO:0003707 | steroid hormone receptor activity(GO:0003707) |
0.0 | 0.3 | GO:0004879 | RNA polymerase II transcription factor activity, ligand-activated sequence-specific DNA binding(GO:0004879) transcription factor activity, direct ligand regulated sequence-specific DNA binding(GO:0098531) |
0.0 | 1.9 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
0.0 | 0.1 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
0.0 | 0.1 | GO:0004946 | bombesin receptor activity(GO:0004946) |
0.0 | 0.1 | GO:0031628 | opioid receptor binding(GO:0031628) |
0.0 | 1.3 | GO:0008237 | metallopeptidase activity(GO:0008237) |
0.0 | 0.4 | GO:0005246 | calcium channel regulator activity(GO:0005246) |
0.0 | 0.1 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
0.0 | 0.1 | GO:0036310 | annealing helicase activity(GO:0036310) |
0.0 | 0.3 | GO:0005521 | lamin binding(GO:0005521) |
0.0 | 0.1 | GO:0019002 | GMP binding(GO:0019002) |
0.0 | 0.3 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
0.0 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.0 | 0.1 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
0.0 | 0.1 | GO:0015665 | alcohol transmembrane transporter activity(GO:0015665) |
0.0 | 5.2 | GO:0001077 | transcriptional activator activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001077) |
0.0 | 0.0 | GO:0070324 | thyroid hormone binding(GO:0070324) |
0.0 | 0.1 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.0 | 0.0 | GO:0033142 | progesterone receptor binding(GO:0033142) |
0.0 | 0.0 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
0.0 | 0.3 | GO:0030955 | potassium ion binding(GO:0030955) |
0.0 | 0.1 | GO:0046978 | TAP1 binding(GO:0046978) TAP2 binding(GO:0046979) |
0.0 | 0.1 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
0.0 | 0.1 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.0 | 0.1 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
0.0 | 0.0 | GO:0043559 | insulin binding(GO:0043559) |
0.0 | 0.0 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
0.0 | 0.1 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
0.0 | 0.1 | GO:0004659 | prenyltransferase activity(GO:0004659) |
0.0 | 0.1 | GO:0034711 | inhibin binding(GO:0034711) |
0.0 | 0.1 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.0 | 0.9 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
0.0 | 0.0 | GO:0098988 | G-protein coupled glutamate receptor activity(GO:0098988) |
0.0 | 0.0 | GO:0004559 | alpha-mannosidase activity(GO:0004559) |
0.0 | 0.2 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.0 | 0.3 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
0.0 | 2.5 | GO:0001227 | transcriptional repressor activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001227) |
0.0 | 0.1 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
0.0 | 0.2 | GO:0005522 | profilin binding(GO:0005522) |
0.0 | 0.2 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
0.0 | 0.1 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
0.0 | 0.6 | GO:0061733 | peptide-lysine-N-acetyltransferase activity(GO:0061733) |
0.0 | 0.0 | GO:0051870 | methotrexate binding(GO:0051870) |
0.0 | 0.1 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
0.0 | 0.7 | GO:0002039 | p53 binding(GO:0002039) |
0.0 | 0.0 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.0 | 0.1 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
0.0 | 0.9 | GO:0035064 | methylated histone binding(GO:0035064) |
0.0 | 0.1 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
0.0 | 0.1 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
0.0 | 0.1 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
0.0 | 0.4 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.0 | 0.1 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.0 | 0.2 | GO:0046977 | TAP binding(GO:0046977) |
0.0 | 0.2 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.0 | 0.1 | GO:0005499 | vitamin D binding(GO:0005499) |
0.0 | 0.0 | GO:0017116 | single-stranded DNA-dependent ATP-dependent DNA helicase activity(GO:0017116) |
0.0 | 0.1 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.0 | 0.0 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
0.0 | 0.2 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
0.0 | 0.4 | GO:0030332 | cyclin binding(GO:0030332) |
0.0 | 0.1 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
0.0 | 0.3 | GO:0042805 | actinin binding(GO:0042805) |
0.0 | 0.1 | GO:0038100 | nodal binding(GO:0038100) |
0.0 | 0.1 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
0.0 | 0.0 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
0.0 | 0.0 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
0.0 | 0.1 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.0 | 0.1 | GO:0089720 | caspase binding(GO:0089720) |
0.0 | 0.3 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
0.0 | 0.3 | GO:0030506 | ankyrin binding(GO:0030506) |
0.0 | 0.0 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
0.0 | 0.6 | GO:0019209 | kinase activator activity(GO:0019209) |
0.0 | 0.1 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.0 | 0.1 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
0.0 | 0.1 | GO:0004556 | alpha-amylase activity(GO:0004556) |
0.0 | 0.1 | GO:0003880 | protein C-terminal carboxyl O-methyltransferase activity(GO:0003880) |
0.0 | 0.0 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.0 | 0.1 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.0 | 0.2 | GO:0008080 | N-acetyltransferase activity(GO:0008080) |
0.0 | 13.5 | GO:0044822 | poly(A) RNA binding(GO:0044822) |
0.0 | 0.0 | GO:0031013 | troponin I binding(GO:0031013) |
0.0 | 0.2 | GO:0005248 | voltage-gated sodium channel activity(GO:0005248) voltage-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1905030) |
0.0 | 0.1 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
0.0 | 0.1 | GO:0008174 | mRNA methyltransferase activity(GO:0008174) |
0.0 | 0.0 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
0.0 | 0.1 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
0.0 | 0.1 | GO:0061665 | SUMO ligase activity(GO:0061665) |
0.0 | 0.0 | GO:0070699 | type II activin receptor binding(GO:0070699) |
0.0 | 0.1 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.0 | 0.2 | GO:0046961 | proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
0.0 | 0.1 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.0 | 1.1 | GO:0051015 | actin filament binding(GO:0051015) |
0.0 | 0.0 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
0.0 | 0.0 | GO:0004954 | prostanoid receptor activity(GO:0004954) |
0.0 | 0.5 | GO:0008188 | neuropeptide receptor activity(GO:0008188) |
0.0 | 0.1 | GO:0031705 | bombesin receptor binding(GO:0031705) |
0.0 | 0.0 | GO:0000182 | rDNA binding(GO:0000182) |
0.0 | 0.4 | GO:0008170 | N-methyltransferase activity(GO:0008170) |
0.0 | 0.0 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.0 | 0.1 | GO:0008066 | glutamate receptor activity(GO:0008066) |
0.0 | 0.1 | GO:0009881 | photoreceptor activity(GO:0009881) |
0.0 | 0.2 | GO:0034792 | sulfonate dioxygenase activity(GO:0000907) 2,4-dichlorophenoxyacetate alpha-ketoglutarate dioxygenase activity(GO:0018602) hypophosphite dioxygenase activity(GO:0034792) gibberellin 2-beta-dioxygenase activity(GO:0045543) C-19 gibberellin 2-beta-dioxygenase activity(GO:0052634) C-20 gibberellin 2-beta-dioxygenase activity(GO:0052635) |
0.0 | 0.1 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
0.0 | 0.0 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.0 | 0.0 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
0.0 | 0.3 | GO:0043621 | protein self-association(GO:0043621) |
0.0 | 0.0 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
0.0 | 0.1 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
0.0 | 0.1 | GO:0005351 | sugar:proton symporter activity(GO:0005351) |
0.0 | 0.1 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) |
0.0 | 0.0 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.0 | 0.1 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
0.0 | 0.0 | GO:0015295 | solute:proton symporter activity(GO:0015295) |
0.0 | 0.1 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
0.0 | 0.1 | GO:0004931 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.0 | 0.1 | GO:0016706 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, 2-oxoglutarate as one donor, and incorporation of one atom each of oxygen into both donors(GO:0016706) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 7.6 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.2 | 7.9 | ST ADRENERGIC | Adrenergic Pathway |
0.2 | 1.5 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.1 | 0.8 | PID S1P S1P4 PATHWAY | S1P4 pathway |
0.1 | 5.2 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
0.1 | 1.2 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.1 | 4.1 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.1 | 1.7 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.1 | 4.9 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.1 | 0.3 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
0.1 | 2.3 | PID ALK1 PATHWAY | ALK1 signaling events |
0.1 | 6.5 | PID P73PATHWAY | p73 transcription factor network |
0.1 | 0.7 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
0.1 | 0.6 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
0.1 | 0.3 | ST G ALPHA I PATHWAY | G alpha i Pathway |
0.1 | 0.3 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
0.1 | 2.1 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.1 | 0.1 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
0.1 | 0.2 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.1 | 1.8 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
0.1 | 0.1 | PID ERBB4 PATHWAY | ErbB4 signaling events |
0.1 | 1.2 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
0.1 | 1.7 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.1 | 1.1 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.1 | 1.3 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
0.1 | 0.5 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
0.1 | 0.9 | PID AURORA A PATHWAY | Aurora A signaling |
0.1 | 1.8 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
0.1 | 2.4 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
0.1 | 0.6 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.1 | 1.0 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
0.1 | 1.3 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
0.0 | 0.6 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.0 | 0.0 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
0.0 | 0.0 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
0.0 | 0.9 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.0 | 0.3 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.0 | 0.8 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
0.0 | 1.6 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
0.0 | 1.2 | PID P53 REGULATION PATHWAY | p53 pathway |
0.0 | 0.2 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
0.0 | 1.0 | PID BARD1 PATHWAY | BARD1 signaling events |
0.0 | 0.3 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
0.0 | 1.1 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
0.0 | 1.0 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
0.0 | 0.8 | PID TNF PATHWAY | TNF receptor signaling pathway |
0.0 | 0.5 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
0.0 | 0.2 | PID IL2 1PATHWAY | IL2-mediated signaling events |
0.0 | 0.1 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
0.0 | 0.2 | PID IL27 PATHWAY | IL27-mediated signaling events |
0.0 | 0.1 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
0.0 | 0.7 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.0 | 0.6 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.0 | 0.2 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.0 | 0.2 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.0 | 0.1 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.0 | 0.1 | PID S1P S1P3 PATHWAY | S1P3 pathway |
0.0 | 0.6 | PID LKB1 PATHWAY | LKB1 signaling events |
0.0 | 0.4 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
0.0 | 0.7 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
0.0 | 0.3 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.0 | 0.1 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
0.0 | 0.1 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.0 | 0.9 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.0 | 0.7 | PID SHP2 PATHWAY | SHP2 signaling |
0.0 | 0.2 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.0 | 0.3 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.0 | 0.3 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
0.0 | 0.3 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
0.0 | 0.0 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.0 | 0.2 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.0 | 0.2 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
0.0 | 0.4 | ST INTEGRIN SIGNALING PATHWAY | Integrin Signaling Pathway |
0.0 | 0.5 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.0 | 0.1 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
0.0 | 0.1 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
0.0 | 0.1 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
0.0 | 0.4 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
0.0 | 0.1 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.0 | 0.0 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.0 | 0.1 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
0.0 | 0.0 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
0.0 | 0.0 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.0 | 0.1 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
0.0 | 0.1 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.0 | 0.2 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
0.0 | 0.0 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
0.0 | 0.0 | PID IL3 PATHWAY | IL3-mediated signaling events |
0.0 | 0.2 | PID ATM PATHWAY | ATM pathway |
0.0 | 0.2 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
0.0 | 0.1 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
0.0 | 0.3 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
0.0 | 0.0 | PID S1P S1P2 PATHWAY | S1P2 pathway |
0.0 | 0.1 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 0.6 | REACTOME SIGNALING BY EGFR IN CANCER | Genes involved in Signaling by EGFR in Cancer |
0.3 | 1.8 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
0.3 | 4.6 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
0.2 | 3.5 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.2 | 0.7 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
0.2 | 2.4 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
0.2 | 0.2 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
0.2 | 2.0 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
0.2 | 1.4 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.2 | 1.9 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
0.2 | 3.4 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
0.2 | 1.7 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
0.2 | 3.0 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
0.2 | 1.1 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
0.2 | 0.2 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
0.2 | 2.3 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.2 | 3.6 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.2 | 2.3 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.1 | 1.6 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.1 | 1.1 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
0.1 | 5.0 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
0.1 | 1.2 | REACTOME PROLONGED ERK ACTIVATION EVENTS | Genes involved in Prolonged ERK activation events |
0.1 | 1.3 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
0.1 | 0.6 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
0.1 | 1.4 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
0.1 | 1.1 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.1 | 2.3 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
0.1 | 0.4 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.1 | 1.5 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
0.1 | 1.2 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
0.1 | 0.4 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
0.1 | 2.1 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.1 | 2.0 | REACTOME BIOLOGICAL OXIDATIONS | Genes involved in Biological oxidations |
0.1 | 4.2 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.1 | 0.8 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.1 | 1.0 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
0.1 | 0.8 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.1 | 0.3 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
0.1 | 2.3 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.1 | 0.4 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
0.1 | 0.2 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
0.1 | 0.8 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.1 | 0.7 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.1 | 1.5 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.1 | 0.1 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
0.1 | 1.1 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
0.1 | 4.8 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
0.1 | 1.1 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
0.1 | 0.8 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.1 | 0.8 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.1 | 0.8 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
0.1 | 1.0 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
0.1 | 0.2 | REACTOME INHIBITION OF THE PROTEOLYTIC ACTIVITY OF APC C REQUIRED FOR THE ONSET OF ANAPHASE BY MITOTIC SPINDLE CHECKPOINT COMPONENTS | Genes involved in Inhibition of the proteolytic activity of APC/C required for the onset of anaphase by mitotic spindle checkpoint components |
0.1 | 0.1 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
0.1 | 0.7 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
0.1 | 1.4 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.1 | 0.7 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.1 | 1.2 | REACTOME G1 PHASE | Genes involved in G1 Phase |
0.1 | 1.8 | REACTOME SEMA4D IN SEMAPHORIN SIGNALING | Genes involved in Sema4D in semaphorin signaling |
0.1 | 0.1 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
0.1 | 0.5 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
0.1 | 1.1 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
0.1 | 0.9 | REACTOME PKB MEDIATED EVENTS | Genes involved in PKB-mediated events |
0.1 | 2.7 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.1 | 0.9 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.1 | 0.6 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.1 | 0.5 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.1 | 0.1 | REACTOME N GLYCAN TRIMMING IN THE ER AND CALNEXIN CALRETICULIN CYCLE | Genes involved in N-glycan trimming in the ER and Calnexin/Calreticulin cycle |
0.1 | 0.4 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
0.1 | 0.6 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
0.1 | 0.4 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.1 | 0.5 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.1 | 0.2 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
0.1 | 1.2 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
0.1 | 1.8 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
0.1 | 0.3 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.1 | 0.4 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
0.1 | 0.8 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.1 | 0.7 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
0.1 | 0.4 | REACTOME FORMATION OF RNA POL II ELONGATION COMPLEX | Genes involved in Formation of RNA Pol II elongation complex |
0.1 | 0.4 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
0.0 | 1.6 | REACTOME MRNA 3 END PROCESSING | Genes involved in mRNA 3'-end processing |
0.0 | 0.4 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
0.0 | 0.3 | REACTOME RESOLUTION OF AP SITES VIA THE MULTIPLE NUCLEOTIDE PATCH REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the multiple-nucleotide patch replacement pathway |
0.0 | 0.6 | REACTOME REGULATION OF APOPTOSIS | Genes involved in Regulation of Apoptosis |
0.0 | 7.0 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
0.0 | 0.1 | REACTOME ADP SIGNALLING THROUGH P2RY12 | Genes involved in ADP signalling through P2Y purinoceptor 12 |
0.0 | 0.9 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
0.0 | 0.5 | REACTOME CYCLIN E ASSOCIATED EVENTS DURING G1 S TRANSITION | Genes involved in Cyclin E associated events during G1/S transition |
0.0 | 1.4 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
0.0 | 0.5 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
0.0 | 0.4 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.0 | 0.3 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
0.0 | 0.4 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
0.0 | 0.3 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.0 | 0.6 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
0.0 | 1.0 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.0 | 1.1 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
0.0 | 0.9 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.0 | 0.5 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
0.0 | 0.5 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.0 | 0.1 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
0.0 | 0.0 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
0.0 | 0.3 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
0.0 | 0.3 | REACTOME TGF BETA RECEPTOR SIGNALING ACTIVATES SMADS | Genes involved in TGF-beta receptor signaling activates SMADs |
0.0 | 0.1 | REACTOME TRANSPORT OF RIBONUCLEOPROTEINS INTO THE HOST NUCLEUS | Genes involved in Transport of Ribonucleoproteins into the Host Nucleus |
0.0 | 1.2 | REACTOME TRNA AMINOACYLATION | Genes involved in tRNA Aminoacylation |
0.0 | 0.6 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
0.0 | 0.2 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
0.0 | 0.1 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
0.0 | 0.9 | REACTOME ASPARAGINE N LINKED GLYCOSYLATION | Genes involved in Asparagine N-linked glycosylation |
0.0 | 0.2 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
0.0 | 0.1 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
0.0 | 0.3 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
0.0 | 0.7 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.0 | 2.5 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
0.0 | 0.5 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
0.0 | 0.4 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
0.0 | 0.4 | REACTOME IL 2 SIGNALING | Genes involved in Interleukin-2 signaling |
0.0 | 0.4 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
0.0 | 0.1 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
0.0 | 0.6 | REACTOME PROTEIN FOLDING | Genes involved in Protein folding |
0.0 | 2.1 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
0.0 | 0.2 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.0 | 0.2 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.0 | 0.6 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
0.0 | 0.2 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
0.0 | 0.5 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
0.0 | 0.6 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
0.0 | 0.4 | REACTOME KINESINS | Genes involved in Kinesins |
0.0 | 2.8 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
0.0 | 0.1 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
0.0 | 0.1 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
0.0 | 0.6 | REACTOME RNA POL III TRANSCRIPTION | Genes involved in RNA Polymerase III Transcription |
0.0 | 0.2 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
0.0 | 0.2 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
0.0 | 0.0 | REACTOME SIGNALING BY NOTCH4 | Genes involved in Signaling by NOTCH4 |
0.0 | 0.3 | REACTOME ION CHANNEL TRANSPORT | Genes involved in Ion channel transport |
0.0 | 0.2 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
0.0 | 0.1 | REACTOME IL 3 5 AND GM CSF SIGNALING | Genes involved in Interleukin-3, 5 and GM-CSF signaling |
0.0 | 0.1 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
0.0 | 0.2 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
0.0 | 0.1 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.0 | 0.7 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
0.0 | 0.2 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
0.0 | 0.1 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.0 | 0.0 | REACTOME ACETYLCHOLINE BINDING AND DOWNSTREAM EVENTS | Genes involved in Acetylcholine Binding And Downstream Events |
0.0 | 0.3 | REACTOME NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Neurotransmitter Release Cycle |
0.0 | 0.4 | REACTOME DNA REPAIR | Genes involved in DNA Repair |
0.0 | 0.3 | REACTOME RNA POL I RNA POL III AND MITOCHONDRIAL TRANSCRIPTION | Genes involved in RNA Polymerase I, RNA Polymerase III, and Mitochondrial Transcription |
0.0 | 0.1 | REACTOME INCRETIN SYNTHESIS SECRETION AND INACTIVATION | Genes involved in Incretin Synthesis, Secretion, and Inactivation |
0.0 | 0.1 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
0.0 | 0.4 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
0.0 | 0.0 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.0 | 0.0 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
0.0 | 0.1 | REACTOME TRAF6 MEDIATED INDUCTION OF TAK1 COMPLEX | Genes involved in TRAF6 mediated induction of TAK1 complex |
0.0 | 0.1 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
0.0 | 0.1 | REACTOME M G1 TRANSITION | Genes involved in M/G1 Transition |