Gene Symbol | Gene ID | Gene Info |
---|---|---|
Vsx2
|
ENSMUSG00000021239.6 | visual system homeobox 2 |
Dlx3
|
ENSMUSG00000001510.7 | distal-less homeobox 3 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
chr11_95118629_95118789 | Dlx3 | 1410 | 0.316731 | 0.78 | 6.9e-02 | Click! |
chr11_95106956_95107111 | Dlx3 | 13086 | 0.122389 | 0.77 | 7.6e-02 | Click! |
chr11_95117069_95117240 | Dlx3 | 2965 | 0.178090 | 0.76 | 8.1e-02 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr5_125526040_125526191 | 4.86 |
Tmem132b |
transmembrane protein 132B |
5659 |
0.17 |
chr17_81386211_81386362 | 2.72 |
Gm50044 |
predicted gene, 50044 |
15453 |
0.24 |
chr14_21435070_21435221 | 2.30 |
Gm25864 |
predicted gene, 25864 |
15329 |
0.19 |
chr2_113578462_113578613 | 2.22 |
Gm13964 |
predicted gene 13964 |
74503 |
0.09 |
chr4_148590620_148590972 | 2.11 |
Srm |
spermidine synthase |
707 |
0.49 |
chr2_18048778_18049088 | 2.04 |
Skida1 |
SKI/DACH domain containing 1 |
98 |
0.94 |
chr7_98380899_98381253 | 1.83 |
Tsku |
tsukushi, small leucine rich proteoglycan |
19748 |
0.14 |
chr3_51255928_51256079 | 1.83 |
Elf2 |
E74-like factor 2 |
4238 |
0.15 |
chr6_119404440_119404707 | 1.82 |
Adipor2 |
adiponectin receptor 2 |
12902 |
0.2 |
chr12_30200282_30200708 | 1.76 |
Sntg2 |
syntrophin, gamma 2 |
840 |
0.72 |
chr9_122848915_122849207 | 1.71 |
Gm47140 |
predicted gene, 47140 |
643 |
0.55 |
chr10_42230294_42230483 | 1.64 |
Foxo3 |
forkhead box O3 |
27978 |
0.22 |
chr6_72155996_72156358 | 1.64 |
Gm38832 |
predicted gene, 38832 |
6672 |
0.15 |
chr10_89563955_89564134 | 1.63 |
Gm48087 |
predicted gene, 48087 |
8325 |
0.2 |
chr4_135255267_135255418 | 1.63 |
Clic4 |
chloride intracellular channel 4 (mitochondrial) |
17472 |
0.14 |
chr6_58611375_58611579 | 1.52 |
Abcg2 |
ATP binding cassette subfamily G member 2 (Junior blood group) |
14806 |
0.19 |
chr10_42271611_42271917 | 1.51 |
Foxo3 |
forkhead box O3 |
4932 |
0.28 |
chr3_104234050_104234212 | 1.50 |
Magi3 |
membrane associated guanylate kinase, WW and PDZ domain containing 3 |
13757 |
0.12 |
chr6_66963164_66963414 | 1.48 |
Gm36816 |
predicted gene, 36816 |
45124 |
0.08 |
chr4_19713524_19713754 | 1.48 |
Wwp1 |
WW domain containing E3 ubiquitin protein ligase 1 |
4646 |
0.23 |
chr1_161260852_161261210 | 1.45 |
Prdx6 |
peroxiredoxin 6 |
9812 |
0.17 |
chr13_95792630_95792781 | 1.45 |
Iqgap2 |
IQ motif containing GTPase activating protein 2 |
28308 |
0.16 |
chr4_101198122_101198415 | 1.45 |
Gm24468 |
predicted gene, 24468 |
11504 |
0.14 |
chr5_92607049_92607221 | 1.43 |
Stbd1 |
starch binding domain 1 |
4067 |
0.19 |
chr5_123975512_123975863 | 1.39 |
Hip1r |
huntingtin interacting protein 1 related |
2059 |
0.19 |
chr2_31489958_31490302 | 1.39 |
Ass1 |
argininosuccinate synthetase 1 |
7642 |
0.19 |
chr1_51740463_51740849 | 1.38 |
Gm28055 |
predicted gene 28055 |
6287 |
0.22 |
chr13_36653443_36653619 | 1.37 |
Gm26395 |
predicted gene, 26395 |
874 |
0.58 |
chr13_52979672_52979858 | 1.33 |
Nfil3 |
nuclear factor, interleukin 3, regulated |
1308 |
0.43 |
chr10_87532342_87532676 | 1.32 |
Pah |
phenylalanine hydroxylase |
10482 |
0.2 |
chr7_30967090_30967447 | 1.20 |
Lsr |
lipolysis stimulated lipoprotein receptor |
6054 |
0.07 |
chr1_162892544_162892705 | 1.20 |
Fmo2 |
flavin containing monooxygenase 2 |
5860 |
0.19 |
chr17_79623322_79623479 | 1.19 |
Rmdn2 |
regulator of microtubule dynamics 2 |
1630 |
0.47 |
chr10_111583801_111583952 | 1.18 |
4933440J02Rik |
RIKEN cDNA 4933440J02 gene |
10397 |
0.16 |
chr11_120523107_120523310 | 1.18 |
Gm11789 |
predicted gene 11789 |
7346 |
0.07 |
chr18_66004765_66005080 | 1.17 |
Lman1 |
lectin, mannose-binding, 1 |
2283 |
0.22 |
chr11_80974932_80975087 | 1.17 |
Gm11416 |
predicted gene 11416 |
71785 |
0.1 |
chr19_44401346_44401497 | 1.17 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
5269 |
0.16 |
chr16_56279382_56279563 | 1.16 |
Impg2 |
interphotoreceptor matrix proteoglycan 2 |
9288 |
0.23 |
chr4_104871987_104872184 | 1.15 |
C8a |
complement component 8, alpha polypeptide |
4298 |
0.23 |
chr12_104341895_104342090 | 1.14 |
Serpina3k |
serine (or cysteine) peptidase inhibitor, clade A, member 3K |
3506 |
0.14 |
chr13_109635481_109635828 | 1.12 |
Pde4d |
phosphodiesterase 4D, cAMP specific |
2874 |
0.42 |
chr15_3430435_3430588 | 1.12 |
Ghr |
growth hormone receptor |
41133 |
0.19 |
chr15_3463467_3463618 | 1.08 |
Ghr |
growth hormone receptor |
8102 |
0.29 |
chr2_147993674_147993836 | 1.08 |
9030622O22Rik |
RIKEN cDNA 9030622O22 gene |
17570 |
0.2 |
chr6_108135683_108135868 | 1.08 |
Rpl36-ps12 |
ribosomal protein L36, pseudogene 12 |
4734 |
0.23 |
chr3_18167606_18167757 | 1.07 |
Gm23686 |
predicted gene, 23686 |
9944 |
0.24 |
chr8_80983213_80983373 | 1.07 |
Gm9725 |
predicted gene 9725 |
30283 |
0.13 |
chr14_105253704_105253870 | 1.06 |
Gm22290 |
predicted gene, 22290 |
3777 |
0.17 |
chrX_170020226_170020377 | 1.04 |
Erdr1 |
erythroid differentiation regulator 1 |
9557 |
0.18 |
chr11_50295296_50295447 | 1.04 |
Canx |
calnexin |
2948 |
0.16 |
chr5_107874706_107874894 | 1.04 |
Evi5 |
ecotropic viral integration site 5 |
244 |
0.86 |
chrX_68717266_68717440 | 1.03 |
Fmr1 |
fragile X mental retardation 1 |
5502 |
0.2 |
chr6_70874912_70875301 | 1.03 |
Eif2ak3 |
eukaryotic translation initiation factor 2 alpha kinase 3 |
3455 |
0.18 |
chr18_38370754_38370932 | 1.02 |
Gm4949 |
predicted gene 4949 |
10305 |
0.12 |
chr8_90831859_90832023 | 1.02 |
Chd9 |
chromodomain helicase DNA binding protein 9 |
3085 |
0.18 |
chr17_63370765_63370929 | 1.02 |
Gm24813 |
predicted gene, 24813 |
23176 |
0.18 |
chr7_115529118_115529280 | 1.01 |
Sox6 |
SRY (sex determining region Y)-box 6 |
68697 |
0.14 |
chr16_42998647_42998825 | 1.01 |
Ndufs5-ps |
NADH:ubiquinone oxidoreductase core subunit S5, pseudogene |
43105 |
0.16 |
chr16_6503702_6503861 | 1.01 |
Rbfox1 |
RNA binding protein, fox-1 homolog (C. elegans) 1 |
154643 |
0.05 |
chr1_23237656_23237879 | 1.00 |
Gm29506 |
predicted gene 29506 |
2094 |
0.23 |
chr16_10675930_10676129 | 1.00 |
Gm15558 |
predicted gene 15558 |
7510 |
0.18 |
chr11_67897406_67897564 | 1.00 |
Usp43 |
ubiquitin specific peptidase 43 |
20866 |
0.15 |
chr2_154827673_154827835 | 0.99 |
Raly |
hnRNP-associated with lethal yellow |
36039 |
0.12 |
chr13_4270161_4270342 | 0.99 |
Akr1c12 |
aldo-keto reductase family 1, member C12 |
9182 |
0.15 |
chr14_7834896_7835063 | 0.98 |
Flnb |
filamin, beta |
17022 |
0.15 |
chr1_97603062_97603228 | 0.98 |
AC099860.1 |
proline rich protein BstNI subfamily 4 (PRB4), pseudogene |
57686 |
0.11 |
chr13_44437957_44438156 | 0.97 |
1700029N11Rik |
RIKEN cDNA 1700029N11 gene |
1656 |
0.27 |
chr10_108162897_108163483 | 0.96 |
Ppp1r12a |
protein phosphatase 1, regulatory subunit 12A |
790 |
0.71 |
chr18_86383968_86384119 | 0.95 |
Neto1 |
neuropilin (NRP) and tolloid (TLL)-like 1 |
10909 |
0.24 |
chr6_32962622_32962773 | 0.95 |
Chchd3 |
coiled-coil-helix-coiled-coil-helix domain containing 3 |
65626 |
0.11 |
chr10_87870357_87870520 | 0.95 |
Igf1os |
insulin-like growth factor 1, opposite strand |
7057 |
0.21 |
chr7_115858420_115858571 | 0.93 |
Sox6 |
SRY (sex determining region Y)-box 6 |
1357 |
0.57 |
chr16_11109338_11109489 | 0.92 |
Txndc11 |
thioredoxin domain containing 11 |
13324 |
0.1 |
chr9_122865001_122865302 | 0.92 |
Zfp445 |
zinc finger protein 445 |
783 |
0.46 |
chr15_52378702_52379046 | 0.91 |
Gm41322 |
predicted gene, 41322 |
66248 |
0.1 |
chr5_129930268_129930468 | 0.91 |
Vkorc1l1 |
vitamin K epoxide reductase complex, subunit 1-like 1 |
11602 |
0.09 |
chr2_27706710_27707364 | 0.91 |
Rxra |
retinoid X receptor alpha |
2255 |
0.4 |
chr19_37507552_37507703 | 0.90 |
Exoc6 |
exocyst complex component 6 |
13252 |
0.16 |
chr9_115307686_115307849 | 0.90 |
Stt3b |
STT3, subunit of the oligosaccharyltransferase complex, homolog B (S. cerevisiae) |
2654 |
0.24 |
chr2_77522021_77522181 | 0.90 |
Zfp385b |
zinc finger protein 385B |
2483 |
0.38 |
chr19_21487417_21487631 | 0.90 |
Gda |
guanine deaminase |
14079 |
0.24 |
chr6_136532281_136532432 | 0.89 |
Atf7ip |
activating transcription factor 7 interacting protein |
571 |
0.69 |
chr9_106231818_106232229 | 0.89 |
Alas1 |
aminolevulinic acid synthase 1 |
5061 |
0.11 |
chr19_44394517_44394772 | 0.89 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
12046 |
0.14 |
chr1_40243335_40243486 | 0.89 |
Gm38070 |
predicted gene, 38070 |
5390 |
0.22 |
chr5_81583249_81583414 | 0.88 |
Gm43084 |
predicted gene 43084 |
47605 |
0.17 |
chr1_51751367_51751637 | 0.87 |
Gm28055 |
predicted gene 28055 |
4559 |
0.23 |
chr19_17599285_17599457 | 0.87 |
Gm17819 |
predicted gene, 17819 |
93392 |
0.08 |
chr8_108895943_108896094 | 0.87 |
Gm20686 |
predicted gene 20686 |
25856 |
0.18 |
chr3_107256063_107256233 | 0.86 |
Prok1 |
prokineticin 1 |
16441 |
0.12 |
chr2_67977965_67978321 | 0.85 |
Gm37964 |
predicted gene, 37964 |
79547 |
0.1 |
chr19_36909759_36909919 | 0.85 |
Fgfbp3 |
fibroblast growth factor binding protein 3 |
9760 |
0.18 |
chr4_15212980_15213172 | 0.85 |
Tmem64 |
transmembrane protein 64 |
52755 |
0.13 |
chr10_63040503_63040654 | 0.85 |
Pbld2 |
phenazine biosynthesis-like protein domain containing 2 |
13632 |
0.09 |
chr8_93190868_93191185 | 0.85 |
Gm45909 |
predicted gene 45909 |
332 |
0.84 |
chr3_129545820_129545971 | 0.85 |
Elovl6 |
ELOVL family member 6, elongation of long chain fatty acids (yeast) |
6485 |
0.17 |
chr17_49304784_49304935 | 0.85 |
Gm17830 |
predicted gene, 17830 |
7382 |
0.19 |
chr14_34359963_34360243 | 0.84 |
Fam25c |
family with sequence similarity 25, member C |
4670 |
0.12 |
chr8_62185245_62185446 | 0.83 |
Gm2961 |
predicted gene 2961 |
8867 |
0.27 |
chr10_18430798_18431011 | 0.83 |
Nhsl1 |
NHS-like 1 |
23229 |
0.21 |
chr8_93176743_93176912 | 0.82 |
Ces1d |
carboxylesterase 1D |
1538 |
0.3 |
chr18_60606060_60606525 | 0.82 |
Synpo |
synaptopodin |
3813 |
0.19 |
chr3_149234408_149234559 | 0.82 |
Gm10287 |
predicted gene 10287 |
8738 |
0.21 |
chr16_43408501_43408652 | 0.81 |
Gm15713 |
predicted gene 15713 |
11620 |
0.2 |
chr19_40153747_40153898 | 0.81 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
33464 |
0.13 |
chr19_21158185_21158336 | 0.81 |
AC106834.1 |
novel transcript |
12581 |
0.21 |
chrX_85053601_85053753 | 0.81 |
Dmd |
dystrophin, muscular dystrophy |
5264 |
0.33 |
chr3_102384557_102384708 | 0.81 |
Gm43245 |
predicted gene 43245 |
5375 |
0.21 |
chr8_40270513_40270891 | 0.81 |
Fgf20 |
fibroblast growth factor 20 |
16251 |
0.2 |
chr10_89505194_89505435 | 0.80 |
Nr1h4 |
nuclear receptor subfamily 1, group H, member 4 |
1335 |
0.49 |
chr5_20590046_20590233 | 0.80 |
Gm3544 |
predicted gene 3544 |
1543 |
0.45 |
chr15_35376790_35377221 | 0.79 |
Gm48960 |
predicted gene, 48960 |
3858 |
0.22 |
chr10_111367147_111367312 | 0.79 |
Gm40761 |
predicted gene, 40761 |
30105 |
0.16 |
chr14_17864277_17864546 | 0.79 |
Gm48320 |
predicted gene, 48320 |
93289 |
0.08 |
chr3_138282244_138282429 | 0.79 |
Adh1 |
alcohol dehydrogenase 1 (class I) |
4685 |
0.14 |
chr9_64175252_64175472 | 0.79 |
Snord16a |
small nucleolar RNA, C/D box 16A |
61 |
0.7 |
chr13_37854787_37854958 | 0.79 |
Rreb1 |
ras responsive element binding protein 1 |
3062 |
0.27 |
chr4_10459968_10460323 | 0.78 |
Gm11814 |
predicted gene 11814 |
20402 |
0.22 |
chr11_86599706_86599919 | 0.78 |
Vmp1 |
vacuole membrane protein 1 |
2451 |
0.23 |
chr16_41161594_41161767 | 0.78 |
Gm26381 |
predicted gene, 26381 |
56065 |
0.15 |
chr9_109966945_109967106 | 0.78 |
Map4 |
microtubule-associated protein 4 |
1992 |
0.21 |
chr3_28701950_28702157 | 0.78 |
Slc2a2 |
solute carrier family 2 (facilitated glucose transporter), member 2 |
4036 |
0.21 |
chr2_59159714_59159865 | 0.77 |
Ccdc148 |
coiled-coil domain containing 148 |
745 |
0.51 |
chr7_65902304_65902456 | 0.77 |
Pcsk6 |
proprotein convertase subtilisin/kexin type 6 |
39948 |
0.14 |
chr16_9670849_9671222 | 0.77 |
Grin2a |
glutamate receptor, ionotropic, NMDA2A (epsilon 1) |
126298 |
0.06 |
chr10_14977642_14977816 | 0.77 |
Gm23892 |
predicted gene, 23892 |
6941 |
0.26 |
chr5_102613938_102614120 | 0.76 |
Arhgap24 |
Rho GTPase activating protein 24 |
110944 |
0.07 |
chr1_13368915_13369352 | 0.76 |
Ncoa2 |
nuclear receptor coactivator 2 |
3296 |
0.16 |
chr5_30927421_30927588 | 0.76 |
Khk |
ketohexokinase |
3110 |
0.11 |
chr2_34805333_34805900 | 0.76 |
Fbxw2 |
F-box and WD-40 domain protein 2 |
3047 |
0.15 |
chr2_31513022_31513372 | 0.75 |
Ass1 |
argininosuccinate synthetase 1 |
5293 |
0.19 |
chr6_90499813_90499975 | 0.75 |
Gm44236 |
predicted gene, 44236 |
13408 |
0.1 |
chr10_87869030_87869196 | 0.75 |
Igf1os |
insulin-like growth factor 1, opposite strand |
5732 |
0.22 |
chr12_13724294_13724464 | 0.75 |
Gm4929 |
predicted gene 4929 |
29286 |
0.15 |
chr4_147433621_147433808 | 0.75 |
Gm13161 |
predicted gene 13161 |
9757 |
0.14 |
chr14_21114751_21114902 | 0.75 |
Adk |
adenosine kinase |
38674 |
0.17 |
chr5_45473645_45473810 | 0.75 |
Lap3 |
leucine aminopeptidase 3 |
19647 |
0.11 |
chr3_94696435_94696690 | 0.75 |
Selenbp2 |
selenium binding protein 2 |
2903 |
0.15 |
chr10_51722569_51722927 | 0.74 |
Rfx6 |
regulatory factor X, 6 |
28977 |
0.12 |
chr14_73524341_73524492 | 0.74 |
Nudt15 |
nudix (nucleoside diphosphate linked moiety X)-type motif 15 |
795 |
0.42 |
chr2_22670750_22670915 | 0.74 |
Gm23636 |
predicted gene, 23636 |
4174 |
0.17 |
chr14_55724403_55725378 | 0.73 |
Rabggta |
Rab geranylgeranyl transferase, a subunit |
2627 |
0.1 |
chr1_136569332_136569539 | 0.73 |
Gm33994 |
predicted gene, 33994 |
10042 |
0.13 |
chr13_46294747_46294952 | 0.73 |
Stmnd1 |
stathmin domain containing 1 |
21128 |
0.24 |
chr9_45958143_45958309 | 0.73 |
Sidt2 |
SID1 transmembrane family, member 2 |
2968 |
0.13 |
chr17_89646332_89646522 | 0.72 |
Gm50061 |
predicted gene, 50061 |
106099 |
0.08 |
chr3_42673626_42673810 | 0.72 |
Gm38044 |
predicted gene, 38044 |
88119 |
0.1 |
chr5_135036438_135036589 | 0.72 |
Stx1a |
syntaxin 1A (brain) |
998 |
0.3 |
chr13_35463284_35463451 | 0.72 |
Gm48703 |
predicted gene, 48703 |
67984 |
0.1 |
chr1_51750897_51751126 | 0.72 |
Gm28055 |
predicted gene 28055 |
4068 |
0.24 |
chr15_3462363_3462731 | 0.72 |
Ghr |
growth hormone receptor |
9097 |
0.29 |
chr14_89652024_89652190 | 0.72 |
Gm25415 |
predicted gene, 25415 |
54698 |
0.17 |
chr12_52448577_52448767 | 0.72 |
Gm47431 |
predicted gene, 47431 |
547 |
0.79 |
chr1_67227292_67227476 | 0.71 |
Gm15668 |
predicted gene 15668 |
21816 |
0.2 |
chr7_70481551_70481951 | 0.71 |
Gm7656 |
predicted gene 7656 |
9097 |
0.15 |
chr1_106176125_106176276 | 0.71 |
Phlpp1 |
PH domain and leucine rich repeat protein phosphatase 1 |
4448 |
0.2 |
chr16_97905608_97905790 | 0.71 |
C2cd2 |
C2 calcium-dependent domain containing 2 |
13418 |
0.17 |
chr9_74894770_74895613 | 0.71 |
Onecut1 |
one cut domain, family member 1 |
28707 |
0.13 |
chr16_92631807_92631997 | 0.71 |
Gm26626 |
predicted gene, 26626 |
19088 |
0.2 |
chr3_149662927_149663250 | 0.70 |
Gm31121 |
predicted gene, 31121 |
2692 |
0.43 |
chr7_114361745_114361949 | 0.69 |
4933406I18Rik |
RIKEN cDNA 4933406I18 gene |
53174 |
0.12 |
chr3_54756553_54756725 | 0.69 |
Smad9 |
SMAD family member 9 |
1057 |
0.44 |
chr2_134851877_134852227 | 0.69 |
Gm14036 |
predicted gene 14036 |
48103 |
0.15 |
chr1_154154148_154154315 | 0.69 |
A830008E24Rik |
RIKEN cDNA A830008E24 gene |
36280 |
0.14 |
chr15_9076174_9076325 | 0.69 |
Nadk2 |
NAD kinase 2, mitochondrial |
972 |
0.61 |
chr11_90664516_90664907 | 0.69 |
Tom1l1 |
target of myb1-like 1 (chicken) |
1399 |
0.43 |
chr3_18165162_18165350 | 0.69 |
Gm23686 |
predicted gene, 23686 |
12369 |
0.23 |
chr5_39163040_39163219 | 0.69 |
Gm40293 |
predicted gene, 40293 |
143955 |
0.04 |
chr11_97659274_97659453 | 0.69 |
Gm24158 |
predicted gene, 24158 |
964 |
0.26 |
chr2_10010192_10010382 | 0.69 |
C630004M23Rik |
RIKEN cDNA C630004M23 gene |
37551 |
0.1 |
chr4_134986138_134986324 | 0.69 |
Syf2 |
SYF2 homolog, RNA splicing factor (S. cerevisiae) |
55221 |
0.1 |
chr8_25786056_25786325 | 0.68 |
Lsm1 |
LSM1 homolog, mRNA degradation associated |
603 |
0.46 |
chr3_74532167_74532327 | 0.68 |
Gm37050 |
predicted gene, 37050 |
208255 |
0.03 |
chr6_142345778_142346191 | 0.68 |
Pyroxd1 |
pyridine nucleotide-disulphide oxidoreductase domain 1 |
306 |
0.86 |
chr6_144067128_144067279 | 0.68 |
Sox5os1 |
SRY (sex determining region Y)-box 5, opposite strand 1 |
45295 |
0.18 |
chr12_51274477_51274668 | 0.68 |
Rps11-ps4 |
ribosomal protein S11, pseudogene 4 |
22915 |
0.22 |
chr13_107542484_107542646 | 0.68 |
Gm32004 |
predicted gene, 32004 |
22758 |
0.2 |
chr14_101841283_101841436 | 0.67 |
Lmo7 |
LIM domain only 7 |
540 |
0.85 |
chr11_28690043_28690210 | 0.67 |
2810471M01Rik |
RIKEN cDNA 2810471M01 gene |
8562 |
0.19 |
chr4_137931021_137931190 | 0.67 |
Ece1 |
endothelin converting enzyme 1 |
17423 |
0.2 |
chr1_67162712_67162908 | 0.67 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
39784 |
0.16 |
chr9_44940562_44940729 | 0.67 |
Gm19121 |
predicted gene, 19121 |
15070 |
0.08 |
chr10_121349776_121349943 | 0.67 |
Gm48435 |
predicted gene, 48435 |
601 |
0.58 |
chr4_117095381_117095620 | 0.67 |
Ptch2 |
patched 2 |
575 |
0.53 |
chr9_41328613_41328764 | 0.66 |
Mir100hg |
Mir100 Mirlet7a-2 Mir125b-1 cluster host gene |
78 |
0.97 |
chr5_97075928_97076348 | 0.66 |
Paqr3 |
progestin and adipoQ receptor family member III |
21633 |
0.15 |
chr5_87254769_87254962 | 0.66 |
Ugt2b37 |
UDP glucuronosyltransferase 2 family, polypeptide B37 |
61 |
0.96 |
chr10_44701947_44702137 | 0.66 |
Gm47388 |
predicted gene, 47388 |
4862 |
0.13 |
chr11_100931218_100931481 | 0.66 |
Stat3 |
signal transducer and activator of transcription 3 |
8031 |
0.14 |
chr15_62336581_62336754 | 0.66 |
Pvt1 |
Pvt1 oncogene |
114064 |
0.07 |
chr5_33378895_33379065 | 0.65 |
Uvssa |
UV stimulated scaffold protein A |
208 |
0.93 |
chr3_75530671_75531016 | 0.65 |
Pdcd10 |
programmed cell death 10 |
9273 |
0.2 |
chr4_76962419_76962593 | 0.65 |
Gm23159 |
predicted gene, 23159 |
4008 |
0.29 |
chr9_45294208_45294524 | 0.65 |
Gm47964 |
predicted gene, 47964 |
7596 |
0.11 |
chr5_66067467_66067650 | 0.65 |
Gm43775 |
predicted gene 43775 |
5337 |
0.14 |
chr16_90223504_90223892 | 0.65 |
Sod1 |
superoxide dismutase 1, soluble |
2944 |
0.21 |
chr18_32560196_32560347 | 0.64 |
Gypc |
glycophorin C |
237 |
0.94 |
chr1_102517589_102517767 | 0.64 |
Gm20281 |
predicted gene, 20281 |
58756 |
0.14 |
chr10_24396476_24396638 | 0.64 |
Gm15271 |
predicted gene 15271 |
50933 |
0.14 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 1.6 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
0.3 | 1.0 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
0.3 | 1.0 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
0.3 | 0.9 | GO:0010046 | response to mycotoxin(GO:0010046) |
0.3 | 1.1 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
0.3 | 0.8 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
0.3 | 1.3 | GO:0021779 | oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
0.2 | 1.2 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
0.2 | 0.8 | GO:0046449 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
0.2 | 0.8 | GO:1905206 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
0.2 | 0.6 | GO:0070340 | detection of bacterial lipopeptide(GO:0070340) |
0.2 | 0.5 | GO:0070782 | phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
0.2 | 0.7 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.2 | 0.5 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
0.2 | 0.5 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
0.2 | 0.5 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
0.2 | 1.7 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.1 | 0.4 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
0.1 | 0.4 | GO:0006068 | ethanol catabolic process(GO:0006068) |
0.1 | 0.4 | GO:0009698 | phenylpropanoid metabolic process(GO:0009698) phenylpropanoid catabolic process(GO:0046271) |
0.1 | 0.3 | GO:0046098 | guanine metabolic process(GO:0046098) |
0.1 | 0.4 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.1 | 0.4 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
0.1 | 0.4 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
0.1 | 0.4 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.1 | 0.1 | GO:0032741 | positive regulation of interleukin-18 production(GO:0032741) |
0.1 | 0.5 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.1 | 0.4 | GO:1903232 | melanosome assembly(GO:1903232) |
0.1 | 0.7 | GO:0021960 | anterior commissure morphogenesis(GO:0021960) |
0.1 | 0.3 | GO:0006059 | hexitol metabolic process(GO:0006059) |
0.1 | 0.5 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
0.1 | 0.6 | GO:0006559 | L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
0.1 | 0.4 | GO:0090168 | Golgi reassembly(GO:0090168) |
0.1 | 0.6 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
0.1 | 0.6 | GO:0061042 | vascular wound healing(GO:0061042) |
0.1 | 0.1 | GO:1900157 | regulation of bone mineralization involved in bone maturation(GO:1900157) |
0.1 | 0.3 | GO:0032383 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
0.1 | 0.3 | GO:0035973 | aggrephagy(GO:0035973) |
0.1 | 0.3 | GO:0000430 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) |
0.1 | 0.1 | GO:0070672 | response to interleukin-15(GO:0070672) |
0.1 | 0.3 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
0.1 | 0.1 | GO:0043634 | polyadenylation-dependent ncRNA catabolic process(GO:0043634) nuclear ncRNA surveillance(GO:0071029) nuclear polyadenylation-dependent rRNA catabolic process(GO:0071035) nuclear polyadenylation-dependent ncRNA catabolic process(GO:0071046) |
0.1 | 0.3 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
0.1 | 0.6 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
0.1 | 0.3 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
0.1 | 0.2 | GO:0003162 | atrioventricular node development(GO:0003162) |
0.1 | 0.5 | GO:0046618 | drug export(GO:0046618) |
0.1 | 0.4 | GO:0042737 | drug catabolic process(GO:0042737) |
0.1 | 0.5 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
0.1 | 0.7 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
0.1 | 0.3 | GO:0061153 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
0.1 | 0.3 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.1 | 0.3 | GO:0060523 | prostate epithelial cord elongation(GO:0060523) |
0.1 | 0.3 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
0.1 | 0.3 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
0.1 | 0.2 | GO:0098700 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
0.1 | 0.3 | GO:0042524 | negative regulation of tyrosine phosphorylation of Stat5 protein(GO:0042524) |
0.1 | 0.3 | GO:1904528 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
0.1 | 0.9 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
0.1 | 0.2 | GO:0001998 | angiotensin mediated vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001998) |
0.1 | 0.2 | GO:0061419 | positive regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061419) |
0.1 | 0.2 | GO:0070669 | response to interleukin-2(GO:0070669) |
0.1 | 0.2 | GO:0006203 | dGTP catabolic process(GO:0006203) |
0.1 | 1.5 | GO:0052696 | flavonoid biosynthetic process(GO:0009813) flavonoid glucuronidation(GO:0052696) |
0.1 | 0.4 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
0.1 | 0.1 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
0.1 | 0.7 | GO:0009143 | nucleoside triphosphate catabolic process(GO:0009143) |
0.1 | 0.2 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.1 | 0.1 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
0.1 | 0.2 | GO:0009629 | response to gravity(GO:0009629) |
0.1 | 0.3 | GO:0019478 | D-amino acid catabolic process(GO:0019478) |
0.1 | 0.7 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
0.1 | 0.2 | GO:0002282 | microglial cell activation involved in immune response(GO:0002282) |
0.1 | 0.3 | GO:0034227 | tRNA thio-modification(GO:0034227) |
0.1 | 0.1 | GO:0021564 | vagus nerve development(GO:0021564) |
0.1 | 0.1 | GO:0048696 | regulation of collateral sprouting in absence of injury(GO:0048696) |
0.1 | 0.5 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
0.1 | 0.1 | GO:0061724 | lipophagy(GO:0061724) |
0.1 | 0.1 | GO:0051081 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
0.1 | 0.6 | GO:0010801 | negative regulation of peptidyl-threonine phosphorylation(GO:0010801) |
0.1 | 0.5 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
0.1 | 0.1 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
0.1 | 0.2 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) |
0.1 | 0.2 | GO:0007354 | zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
0.1 | 0.2 | GO:0072092 | ureteric bud invasion(GO:0072092) |
0.1 | 0.2 | GO:0034436 | glycoprotein transport(GO:0034436) |
0.1 | 0.2 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
0.1 | 0.2 | GO:0043201 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
0.1 | 0.2 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
0.1 | 0.3 | GO:0070874 | negative regulation of glycogen metabolic process(GO:0070874) |
0.1 | 0.3 | GO:0015871 | choline transport(GO:0015871) |
0.1 | 0.2 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.1 | 0.3 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
0.1 | 0.2 | GO:0071494 | cellular response to UV-C(GO:0071494) |
0.1 | 0.1 | GO:0003213 | cardiac right atrium morphogenesis(GO:0003213) |
0.1 | 0.2 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
0.1 | 0.2 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
0.1 | 0.2 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
0.1 | 0.3 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
0.1 | 0.2 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
0.1 | 0.1 | GO:0009188 | ribonucleoside diphosphate biosynthetic process(GO:0009188) |
0.1 | 0.2 | GO:0010916 | regulation of very-low-density lipoprotein particle clearance(GO:0010915) negative regulation of very-low-density lipoprotein particle clearance(GO:0010916) |
0.0 | 0.3 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.0 | 0.0 | GO:0046416 | D-amino acid metabolic process(GO:0046416) |
0.0 | 0.2 | GO:0006083 | acetate metabolic process(GO:0006083) |
0.0 | 0.1 | GO:0070103 | regulation of interleukin-6-mediated signaling pathway(GO:0070103) |
0.0 | 0.2 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
0.0 | 0.1 | GO:0006768 | biotin metabolic process(GO:0006768) |
0.0 | 0.1 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.0 | 0.1 | GO:0015747 | urate transport(GO:0015747) |
0.0 | 0.1 | GO:0061010 | gall bladder development(GO:0061010) |
0.0 | 0.2 | GO:0097343 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
0.0 | 0.4 | GO:0030432 | peristalsis(GO:0030432) |
0.0 | 0.1 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
0.0 | 0.1 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
0.0 | 0.1 | GO:0060051 | negative regulation of protein glycosylation(GO:0060051) |
0.0 | 0.2 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
0.0 | 0.2 | GO:1903689 | regulation of wound healing, spreading of epidermal cells(GO:1903689) |
0.0 | 0.1 | GO:0036022 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) |
0.0 | 0.2 | GO:0001880 | Mullerian duct regression(GO:0001880) |
0.0 | 0.1 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
0.0 | 0.2 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
0.0 | 0.6 | GO:0043486 | histone exchange(GO:0043486) |
0.0 | 0.1 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
0.0 | 0.1 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
0.0 | 0.2 | GO:0036135 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
0.0 | 0.1 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
0.0 | 0.3 | GO:0008063 | Toll signaling pathway(GO:0008063) |
0.0 | 0.3 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
0.0 | 0.2 | GO:0055091 | phospholipid homeostasis(GO:0055091) |
0.0 | 0.2 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
0.0 | 0.3 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
0.0 | 0.2 | GO:0034627 | 'de novo' NAD biosynthetic process(GO:0034627) |
0.0 | 0.1 | GO:1901492 | positive regulation of lymphangiogenesis(GO:1901492) |
0.0 | 0.1 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
0.0 | 0.3 | GO:0042759 | long-chain fatty acid biosynthetic process(GO:0042759) |
0.0 | 0.0 | GO:0060061 | Spemann organizer formation(GO:0060061) |
0.0 | 0.3 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
0.0 | 0.2 | GO:0034756 | regulation of iron ion transport(GO:0034756) |
0.0 | 0.1 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
0.0 | 0.1 | GO:0070350 | white fat cell proliferation(GO:0070343) regulation of white fat cell proliferation(GO:0070350) |
0.0 | 0.2 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
0.0 | 0.3 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
0.0 | 0.1 | GO:0072531 | pyrimidine-containing compound transmembrane transport(GO:0072531) |
0.0 | 0.6 | GO:0043586 | tongue development(GO:0043586) |
0.0 | 0.6 | GO:0045898 | regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045898) |
0.0 | 0.1 | GO:1902915 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
0.0 | 0.0 | GO:0009812 | flavonoid metabolic process(GO:0009812) |
0.0 | 0.6 | GO:0042744 | hydrogen peroxide catabolic process(GO:0042744) |
0.0 | 0.4 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
0.0 | 0.2 | GO:0060355 | positive regulation of cell adhesion molecule production(GO:0060355) |
0.0 | 0.1 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
0.0 | 0.7 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
0.0 | 0.1 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
0.0 | 0.4 | GO:0006517 | protein deglycosylation(GO:0006517) |
0.0 | 0.4 | GO:0007035 | vacuolar acidification(GO:0007035) |
0.0 | 0.0 | GO:0071139 | resolution of recombination intermediates(GO:0071139) |
0.0 | 0.2 | GO:0031642 | negative regulation of myelination(GO:0031642) |
0.0 | 0.1 | GO:0071051 | polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
0.0 | 0.1 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
0.0 | 0.3 | GO:0000459 | exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) |
0.0 | 0.1 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.0 | 0.1 | GO:2000670 | positive regulation of dendritic cell apoptotic process(GO:2000670) |
0.0 | 0.1 | GO:0048669 | collateral sprouting in absence of injury(GO:0048669) |
0.0 | 0.3 | GO:1903432 | TORC1 signaling(GO:0038202) regulation of TORC1 signaling(GO:1903432) negative regulation of TORC1 signaling(GO:1904262) |
0.0 | 0.4 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
0.0 | 0.1 | GO:0048208 | vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
0.0 | 0.0 | GO:2001180 | negative regulation of interleukin-10 secretion(GO:2001180) |
0.0 | 0.2 | GO:2001046 | positive regulation of integrin-mediated signaling pathway(GO:2001046) |
0.0 | 0.1 | GO:0071336 | regulation of hair follicle cell proliferation(GO:0071336) |
0.0 | 0.4 | GO:0045793 | positive regulation of cell size(GO:0045793) |
0.0 | 0.2 | GO:0014819 | regulation of skeletal muscle contraction(GO:0014819) |
0.0 | 0.1 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
0.0 | 0.4 | GO:0006670 | sphingosine metabolic process(GO:0006670) |
0.0 | 0.1 | GO:0090292 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
0.0 | 0.0 | GO:2000481 | positive regulation of cAMP-dependent protein kinase activity(GO:2000481) |
0.0 | 0.3 | GO:0046855 | inositol phosphate dephosphorylation(GO:0046855) |
0.0 | 0.2 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
0.0 | 0.2 | GO:1902166 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902166) |
0.0 | 0.1 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
0.0 | 0.1 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.0 | 0.2 | GO:0000012 | single strand break repair(GO:0000012) |
0.0 | 0.2 | GO:0042447 | hormone catabolic process(GO:0042447) |
0.0 | 0.0 | GO:0006067 | ethanol metabolic process(GO:0006067) ethanol oxidation(GO:0006069) |
0.0 | 0.5 | GO:0031954 | positive regulation of protein autophosphorylation(GO:0031954) |
0.0 | 0.2 | GO:0002115 | store-operated calcium entry(GO:0002115) |
0.0 | 0.2 | GO:0090037 | positive regulation of protein kinase C signaling(GO:0090037) |
0.0 | 0.1 | GO:1903999 | negative regulation of eating behavior(GO:1903999) |
0.0 | 0.1 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.0 | 0.1 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
0.0 | 0.1 | GO:0006538 | glutamate catabolic process(GO:0006538) |
0.0 | 0.1 | GO:0060744 | thelarche(GO:0042695) mammary gland branching involved in thelarche(GO:0060744) |
0.0 | 0.1 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
0.0 | 0.2 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
0.0 | 0.3 | GO:0031507 | heterochromatin assembly(GO:0031507) |
0.0 | 0.2 | GO:0090043 | tubulin deacetylation(GO:0090042) regulation of tubulin deacetylation(GO:0090043) |
0.0 | 0.1 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
0.0 | 0.2 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.0 | 0.0 | GO:0072364 | regulation of cellular ketone metabolic process by regulation of transcription from RNA polymerase II promoter(GO:0072364) |
0.0 | 0.1 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
0.0 | 0.4 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
0.0 | 0.1 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
0.0 | 0.1 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
0.0 | 0.3 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.0 | 0.0 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
0.0 | 0.3 | GO:0043651 | linoleic acid metabolic process(GO:0043651) |
0.0 | 0.3 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
0.0 | 0.1 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
0.0 | 0.3 | GO:0045607 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
0.0 | 0.0 | GO:0071492 | cellular response to UV-A(GO:0071492) |
0.0 | 0.2 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.0 | 0.1 | GO:0030202 | heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
0.0 | 0.0 | GO:0046084 | adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
0.0 | 0.2 | GO:1902177 | positive regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902177) |
0.0 | 0.2 | GO:1903242 | regulation of cardiac muscle adaptation(GO:0010612) regulation of cardiac muscle hypertrophy in response to stress(GO:1903242) |
0.0 | 0.1 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
0.0 | 0.2 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
0.0 | 0.1 | GO:0051657 | maintenance of organelle location(GO:0051657) |
0.0 | 0.1 | GO:0033600 | negative regulation of mammary gland epithelial cell proliferation(GO:0033600) |
0.0 | 0.1 | GO:0006573 | valine metabolic process(GO:0006573) |
0.0 | 0.1 | GO:0006562 | proline catabolic process(GO:0006562) |
0.0 | 0.2 | GO:0042795 | snRNA transcription from RNA polymerase II promoter(GO:0042795) |
0.0 | 0.2 | GO:0006677 | glycosylceramide metabolic process(GO:0006677) |
0.0 | 0.0 | GO:0045726 | positive regulation of integrin biosynthetic process(GO:0045726) |
0.0 | 0.1 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
0.0 | 0.1 | GO:0035754 | B cell chemotaxis(GO:0035754) |
0.0 | 0.2 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
0.0 | 0.1 | GO:0035054 | embryonic heart tube anterior/posterior pattern specification(GO:0035054) |
0.0 | 0.3 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
0.0 | 0.1 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
0.0 | 0.1 | GO:1901339 | regulation of store-operated calcium channel activity(GO:1901339) |
0.0 | 0.2 | GO:0001842 | neural fold formation(GO:0001842) |
0.0 | 0.1 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
0.0 | 0.1 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) |
0.0 | 0.1 | GO:1990928 | response to amino acid starvation(GO:1990928) |
0.0 | 0.3 | GO:0006622 | protein targeting to lysosome(GO:0006622) |
0.0 | 0.1 | GO:0019087 | transformation of host cell by virus(GO:0019087) |
0.0 | 0.1 | GO:0036394 | amylase secretion(GO:0036394) |
0.0 | 0.1 | GO:0033387 | putrescine biosynthetic process(GO:0009446) putrescine biosynthetic process from ornithine(GO:0033387) |
0.0 | 0.1 | GO:0021873 | forebrain neuroblast division(GO:0021873) |
0.0 | 0.1 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
0.0 | 0.5 | GO:0070670 | response to interleukin-4(GO:0070670) |
0.0 | 0.1 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
0.0 | 0.1 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
0.0 | 0.1 | GO:0023021 | termination of signal transduction(GO:0023021) |
0.0 | 0.1 | GO:0010870 | positive regulation of receptor biosynthetic process(GO:0010870) |
0.0 | 0.4 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
0.0 | 0.3 | GO:0030252 | growth hormone secretion(GO:0030252) |
0.0 | 0.1 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
0.0 | 0.1 | GO:1904016 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
0.0 | 0.1 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
0.0 | 0.2 | GO:0060020 | Bergmann glial cell differentiation(GO:0060020) |
0.0 | 0.1 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
0.0 | 0.2 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
0.0 | 0.1 | GO:0035672 | oligopeptide transmembrane transport(GO:0035672) |
0.0 | 1.0 | GO:0007584 | response to nutrient(GO:0007584) |
0.0 | 0.1 | GO:0048619 | embryonic hindgut morphogenesis(GO:0048619) |
0.0 | 0.1 | GO:0061727 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
0.0 | 0.1 | GO:0070094 | positive regulation of glucagon secretion(GO:0070094) |
0.0 | 0.1 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.0 | 0.0 | GO:0009078 | alanine metabolic process(GO:0006522) pyruvate family amino acid metabolic process(GO:0009078) L-alanine metabolic process(GO:0042851) |
0.0 | 0.2 | GO:0060544 | regulation of necroptotic process(GO:0060544) |
0.0 | 0.1 | GO:0038171 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
0.0 | 0.1 | GO:2000973 | regulation of pro-B cell differentiation(GO:2000973) |
0.0 | 0.1 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
0.0 | 0.1 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
0.0 | 0.1 | GO:0033058 | directional locomotion(GO:0033058) |
0.0 | 0.1 | GO:0045897 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
0.0 | 0.2 | GO:0031000 | response to caffeine(GO:0031000) |
0.0 | 0.1 | GO:2000389 | regulation of neutrophil extravasation(GO:2000389) positive regulation of neutrophil extravasation(GO:2000391) |
0.0 | 0.1 | GO:0006105 | succinate metabolic process(GO:0006105) |
0.0 | 0.0 | GO:0002930 | trabecular meshwork development(GO:0002930) |
0.0 | 0.4 | GO:0048026 | positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
0.0 | 0.1 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
0.0 | 0.0 | GO:0060916 | mesenchymal cell proliferation involved in lung development(GO:0060916) |
0.0 | 0.1 | GO:0048703 | embryonic viscerocranium morphogenesis(GO:0048703) |
0.0 | 0.3 | GO:0090005 | negative regulation of establishment of protein localization to plasma membrane(GO:0090005) |
0.0 | 0.1 | GO:0070857 | regulation of bile acid biosynthetic process(GO:0070857) |
0.0 | 0.1 | GO:0015867 | ATP transport(GO:0015867) |
0.0 | 0.1 | GO:0034091 | regulation of maintenance of sister chromatid cohesion(GO:0034091) regulation of maintenance of mitotic sister chromatid cohesion(GO:0034182) |
0.0 | 0.2 | GO:0051382 | kinetochore assembly(GO:0051382) |
0.0 | 0.0 | GO:0031443 | fast-twitch skeletal muscle fiber contraction(GO:0031443) |
0.0 | 0.1 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
0.0 | 0.1 | GO:0019934 | cGMP-mediated signaling(GO:0019934) |
0.0 | 0.2 | GO:0006750 | glutathione biosynthetic process(GO:0006750) |
0.0 | 0.1 | GO:0033227 | dsRNA transport(GO:0033227) |
0.0 | 0.1 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.0 | 0.1 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
0.0 | 0.0 | GO:0007529 | establishment of synaptic specificity at neuromuscular junction(GO:0007529) |
0.0 | 0.2 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.0 | 0.0 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
0.0 | 0.0 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
0.0 | 0.2 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
0.0 | 0.1 | GO:0051547 | regulation of keratinocyte migration(GO:0051547) positive regulation of keratinocyte migration(GO:0051549) |
0.0 | 0.0 | GO:0046015 | regulation of transcription by glucose(GO:0046015) |
0.0 | 0.1 | GO:0044314 | protein K27-linked ubiquitination(GO:0044314) |
0.0 | 0.0 | GO:0006570 | tyrosine metabolic process(GO:0006570) |
0.0 | 0.2 | GO:0000729 | DNA double-strand break processing(GO:0000729) |
0.0 | 0.1 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
0.0 | 0.1 | GO:0043144 | snoRNA processing(GO:0043144) |
0.0 | 0.1 | GO:0051124 | synaptic growth at neuromuscular junction(GO:0051124) |
0.0 | 0.0 | GO:1902996 | neurofibrillary tangle assembly(GO:1902988) regulation of neurofibrillary tangle assembly(GO:1902996) |
0.0 | 0.2 | GO:0006878 | cellular copper ion homeostasis(GO:0006878) |
0.0 | 0.0 | GO:1904339 | negative regulation of dopaminergic neuron differentiation(GO:1904339) |
0.0 | 0.0 | GO:0030423 | targeting of mRNA for destruction involved in RNA interference(GO:0030423) |
0.0 | 0.1 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
0.0 | 0.1 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
0.0 | 0.1 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
0.0 | 0.1 | GO:0003310 | pancreatic A cell differentiation(GO:0003310) |
0.0 | 0.0 | GO:1902101 | positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
0.0 | 0.1 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
0.0 | 0.1 | GO:0009068 | aspartate family amino acid catabolic process(GO:0009068) |
0.0 | 0.1 | GO:0033578 | protein glycosylation in Golgi(GO:0033578) |
0.0 | 0.1 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
0.0 | 0.0 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
0.0 | 0.1 | GO:0016344 | meiotic chromosome movement towards spindle pole(GO:0016344) |
0.0 | 0.1 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.0 | 0.0 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
0.0 | 0.0 | GO:1903802 | L-glutamate(1-) import into cell(GO:1903802) L-glutamate import into cell(GO:1990123) |
0.0 | 0.1 | GO:0070863 | positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
0.0 | 0.1 | GO:1903300 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
0.0 | 0.2 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
0.0 | 0.0 | GO:0060982 | coronary artery morphogenesis(GO:0060982) |
0.0 | 0.1 | GO:0071455 | cellular response to increased oxygen levels(GO:0036295) cellular response to hyperoxia(GO:0071455) |
0.0 | 0.2 | GO:0045176 | apical protein localization(GO:0045176) |
0.0 | 0.1 | GO:0007567 | parturition(GO:0007567) |
0.0 | 0.1 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
0.0 | 0.2 | GO:0006198 | cAMP catabolic process(GO:0006198) |
0.0 | 0.1 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.0 | 0.9 | GO:0045454 | cell redox homeostasis(GO:0045454) |
0.0 | 0.1 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
0.0 | 0.2 | GO:0098870 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.1 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
0.0 | 0.1 | GO:0021684 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
0.0 | 0.3 | GO:0015936 | coenzyme A metabolic process(GO:0015936) |
0.0 | 0.5 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
0.0 | 0.1 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) |
0.0 | 0.2 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
0.0 | 0.0 | GO:0003025 | regulation of systemic arterial blood pressure by baroreceptor feedback(GO:0003025) |
0.0 | 0.4 | GO:0046834 | lipid phosphorylation(GO:0046834) |
0.0 | 0.2 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
0.0 | 0.5 | GO:0018196 | peptidyl-asparagine modification(GO:0018196) |
0.0 | 0.2 | GO:0044247 | glycogen catabolic process(GO:0005980) glucan catabolic process(GO:0009251) cellular polysaccharide catabolic process(GO:0044247) |
0.0 | 0.1 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
0.0 | 0.0 | GO:2000645 | negative regulation of receptor catabolic process(GO:2000645) |
0.0 | 0.1 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
0.0 | 0.0 | GO:0022417 | protein maturation by protein folding(GO:0022417) |
0.0 | 0.1 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
0.0 | 0.1 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
0.0 | 0.1 | GO:0070814 | hydrogen sulfide biosynthetic process(GO:0070814) |
0.0 | 0.1 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
0.0 | 0.2 | GO:0003085 | negative regulation of systemic arterial blood pressure(GO:0003085) |
0.0 | 0.1 | GO:0002072 | optic cup morphogenesis involved in camera-type eye development(GO:0002072) |
0.0 | 0.1 | GO:0045217 | cell-cell junction maintenance(GO:0045217) |
0.0 | 0.0 | GO:0072093 | metanephric renal vesicle formation(GO:0072093) |
0.0 | 0.5 | GO:1903146 | regulation of mitophagy(GO:1903146) |
0.0 | 0.2 | GO:0017144 | drug metabolic process(GO:0017144) |
0.0 | 0.0 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
0.0 | 0.1 | GO:0044597 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.0 | 0.1 | GO:0061462 | protein localization to lysosome(GO:0061462) |
0.0 | 0.1 | GO:0097210 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
0.0 | 0.5 | GO:0033048 | negative regulation of mitotic sister chromatid segregation(GO:0033048) |
0.0 | 0.1 | GO:0048341 | paraxial mesoderm formation(GO:0048341) |
0.0 | 0.1 | GO:0043653 | mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
0.0 | 0.1 | GO:1903975 | regulation of glial cell migration(GO:1903975) |
0.0 | 0.1 | GO:1900060 | negative regulation of ceramide biosynthetic process(GO:1900060) |
0.0 | 0.1 | GO:0070266 | necroptotic process(GO:0070266) |
0.0 | 0.3 | GO:0006805 | xenobiotic metabolic process(GO:0006805) |
0.0 | 0.1 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.0 | 0.0 | GO:0002154 | thyroid hormone mediated signaling pathway(GO:0002154) |
0.0 | 0.1 | GO:0009249 | protein lipoylation(GO:0009249) |
0.0 | 0.0 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
0.0 | 0.0 | GO:0010881 | regulation of cardiac muscle contraction by regulation of the release of sequestered calcium ion(GO:0010881) |
0.0 | 0.1 | GO:1902414 | protein localization to cell junction(GO:1902414) |
0.0 | 0.1 | GO:0002934 | desmosome organization(GO:0002934) |
0.0 | 0.1 | GO:0070932 | histone H3 deacetylation(GO:0070932) |
0.0 | 0.1 | GO:0060352 | cell adhesion molecule production(GO:0060352) |
0.0 | 0.1 | GO:0008343 | adult feeding behavior(GO:0008343) |
0.0 | 0.0 | GO:0061366 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
0.0 | 0.1 | GO:0002679 | respiratory burst involved in defense response(GO:0002679) |
0.0 | 0.1 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
0.0 | 0.1 | GO:2000680 | regulation of rubidium ion transport(GO:2000680) regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
0.0 | 0.1 | GO:0045602 | negative regulation of endothelial cell differentiation(GO:0045602) |
0.0 | 0.0 | GO:0010940 | positive regulation of necrotic cell death(GO:0010940) |
0.0 | 0.0 | GO:1901509 | regulation of endothelial tube morphogenesis(GO:1901509) |
0.0 | 0.0 | GO:0097475 | motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) |
0.0 | 0.1 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
0.0 | 0.0 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
0.0 | 0.1 | GO:0034398 | telomere tethering at nuclear periphery(GO:0034398) |
0.0 | 0.0 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) |
0.0 | 0.1 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
0.0 | 0.1 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.0 | 0.1 | GO:0007638 | mechanosensory behavior(GO:0007638) |
0.0 | 0.2 | GO:0003334 | keratinocyte development(GO:0003334) |
0.0 | 0.1 | GO:1990564 | protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
0.0 | 0.1 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
0.0 | 0.0 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.0 | 0.2 | GO:0031573 | intra-S DNA damage checkpoint(GO:0031573) |
0.0 | 0.1 | GO:0000963 | mitochondrial RNA processing(GO:0000963) |
0.0 | 0.2 | GO:0001675 | acrosome assembly(GO:0001675) |
0.0 | 0.0 | GO:0000101 | sulfur amino acid transport(GO:0000101) |
0.0 | 0.1 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.0 | 0.0 | GO:0060112 | generation of ovulation cycle rhythm(GO:0060112) |
0.0 | 0.0 | GO:0035799 | ureter maturation(GO:0035799) |
0.0 | 0.0 | GO:0032367 | intracellular cholesterol transport(GO:0032367) |
0.0 | 0.1 | GO:1902969 | mitotic DNA replication(GO:1902969) |
0.0 | 0.0 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
0.0 | 0.0 | GO:1902263 | apoptotic process involved in embryonic digit morphogenesis(GO:1902263) |
0.0 | 0.0 | GO:0003222 | ventricular trabecula myocardium morphogenesis(GO:0003222) |
0.0 | 0.1 | GO:0030948 | negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
0.0 | 0.1 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.0 | 0.1 | GO:0015677 | copper ion import(GO:0015677) ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) |
0.0 | 0.1 | GO:0006098 | pentose-phosphate shunt(GO:0006098) |
0.0 | 0.2 | GO:0046033 | AMP metabolic process(GO:0046033) |
0.0 | 0.1 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
0.0 | 0.0 | GO:0046005 | positive regulation of circadian sleep/wake cycle, REM sleep(GO:0046005) |
0.0 | 0.0 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
0.0 | 0.1 | GO:0060591 | chondroblast differentiation(GO:0060591) |
0.0 | 0.1 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
0.0 | 0.0 | GO:0060672 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
0.0 | 0.1 | GO:0006000 | fructose metabolic process(GO:0006000) |
0.0 | 0.1 | GO:0018103 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
0.0 | 0.0 | GO:0006930 | substrate-dependent cell migration, cell extension(GO:0006930) |
0.0 | 0.1 | GO:0002176 | male germ cell proliferation(GO:0002176) germ cell proliferation(GO:0036093) |
0.0 | 0.0 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
0.0 | 0.1 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
0.0 | 0.1 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
0.0 | 0.1 | GO:0030311 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.0 | 0.1 | GO:0071361 | cellular response to ethanol(GO:0071361) |
0.0 | 0.0 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
0.0 | 0.1 | GO:0008340 | determination of adult lifespan(GO:0008340) |
0.0 | 0.3 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
0.0 | 0.1 | GO:0044829 | positive regulation by host of viral genome replication(GO:0044829) |
0.0 | 0.0 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
0.0 | 0.1 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
0.0 | 0.0 | GO:0003266 | cardioblast proliferation(GO:0003263) regulation of cardioblast proliferation(GO:0003264) regulation of secondary heart field cardioblast proliferation(GO:0003266) |
0.0 | 0.0 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
0.0 | 0.1 | GO:0080154 | regulation of fertilization(GO:0080154) |
0.0 | 0.1 | GO:0046325 | negative regulation of glucose import(GO:0046325) |
0.0 | 0.0 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
0.0 | 0.0 | GO:0014831 | gastro-intestinal system smooth muscle contraction(GO:0014831) |
0.0 | 0.1 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
0.0 | 0.1 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
0.0 | 0.1 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
0.0 | 0.0 | GO:0000957 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
0.0 | 0.0 | GO:0050955 | thermoception(GO:0050955) |
0.0 | 0.0 | GO:0035697 | CD8-positive, alpha-beta T cell extravasation(GO:0035697) |
0.0 | 0.1 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) |
0.0 | 0.0 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
0.0 | 0.1 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
0.0 | 0.1 | GO:0051204 | protein insertion into mitochondrial membrane(GO:0051204) |
0.0 | 0.1 | GO:0070314 | G1 to G0 transition(GO:0070314) |
0.0 | 0.0 | GO:0050883 | musculoskeletal movement, spinal reflex action(GO:0050883) |
0.0 | 0.1 | GO:0072488 | ammonium transmembrane transport(GO:0072488) |
0.0 | 0.2 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
0.0 | 0.1 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
0.0 | 0.0 | GO:0006290 | pyrimidine dimer repair(GO:0006290) |
0.0 | 0.0 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.0 | 0.1 | GO:0006691 | leukotriene metabolic process(GO:0006691) |
0.0 | 0.1 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
0.0 | 0.2 | GO:0036465 | synaptic vesicle recycling(GO:0036465) |
0.0 | 0.0 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
0.0 | 0.0 | GO:0097694 | establishment of RNA localization to telomere(GO:0097694) |
0.0 | 0.6 | GO:0031338 | regulation of vesicle fusion(GO:0031338) |
0.0 | 0.2 | GO:0006465 | signal peptide processing(GO:0006465) |
0.0 | 0.1 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
0.0 | 0.0 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
0.0 | 0.1 | GO:1900165 | negative regulation of interleukin-6 secretion(GO:1900165) |
0.0 | 0.1 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
0.0 | 0.0 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
0.0 | 0.0 | GO:0042045 | epithelial fluid transport(GO:0042045) |
0.0 | 0.1 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
0.0 | 0.1 | GO:0009186 | deoxyribonucleoside diphosphate metabolic process(GO:0009186) |
0.0 | 0.0 | GO:0035701 | hematopoietic stem cell migration(GO:0035701) |
0.0 | 0.1 | GO:1904376 | negative regulation of protein localization to plasma membrane(GO:1903077) negative regulation of protein localization to cell periphery(GO:1904376) |
0.0 | 0.1 | GO:0060539 | diaphragm development(GO:0060539) |
0.0 | 0.3 | GO:0003333 | amino acid transmembrane transport(GO:0003333) |
0.0 | 0.0 | GO:0032252 | secretory granule localization(GO:0032252) |
0.0 | 0.0 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
0.0 | 0.1 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
0.0 | 0.1 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
0.0 | 0.1 | GO:0070166 | enamel mineralization(GO:0070166) |
0.0 | 0.2 | GO:0072583 | clathrin-mediated endocytosis(GO:0072583) |
0.0 | 0.0 | GO:0042518 | negative regulation of tyrosine phosphorylation of Stat3 protein(GO:0042518) |
0.0 | 0.2 | GO:0015693 | magnesium ion transport(GO:0015693) |
0.0 | 0.0 | GO:0060948 | cardiac vascular smooth muscle cell development(GO:0060948) |
0.0 | 0.0 | GO:1902261 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
0.0 | 0.1 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
0.0 | 0.0 | GO:0015766 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.0 | 0.2 | GO:0006491 | N-glycan processing(GO:0006491) |
0.0 | 0.0 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
0.0 | 0.1 | GO:0045475 | locomotor rhythm(GO:0045475) |
0.0 | 0.0 | GO:0032304 | negative regulation of icosanoid secretion(GO:0032304) |
0.0 | 0.0 | GO:0030091 | protein repair(GO:0030091) |
0.0 | 0.0 | GO:0072683 | T cell extravasation(GO:0072683) |
0.0 | 0.1 | GO:0035313 | wound healing, spreading of epidermal cells(GO:0035313) |
0.0 | 0.1 | GO:0009396 | folic acid-containing compound biosynthetic process(GO:0009396) |
0.0 | 0.0 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
0.0 | 0.1 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.0 | 0.0 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.0 | 0.2 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
0.0 | 0.0 | GO:0010749 | regulation of nitric oxide mediated signal transduction(GO:0010749) |
0.0 | 0.0 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
0.0 | 0.1 | GO:0006968 | cellular defense response(GO:0006968) |
0.0 | 0.0 | GO:0071376 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
0.0 | 0.1 | GO:0048711 | positive regulation of astrocyte differentiation(GO:0048711) |
0.0 | 0.1 | GO:0015074 | DNA integration(GO:0015074) |
0.0 | 0.0 | GO:0061525 | hindgut development(GO:0061525) |
0.0 | 0.0 | GO:0019585 | uronic acid metabolic process(GO:0006063) glucuronate metabolic process(GO:0019585) |
0.0 | 0.0 | GO:0035928 | rRNA import into mitochondrion(GO:0035928) |
0.0 | 0.1 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.0 | 0.0 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
0.0 | 0.0 | GO:0071694 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
0.0 | 0.4 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
0.0 | 0.0 | GO:0045651 | positive regulation of macrophage differentiation(GO:0045651) |
0.0 | 0.0 | GO:0045722 | positive regulation of gluconeogenesis(GO:0045722) |
0.0 | 0.1 | GO:0010713 | negative regulation of collagen metabolic process(GO:0010713) negative regulation of collagen biosynthetic process(GO:0032966) |
0.0 | 0.2 | GO:0006783 | heme biosynthetic process(GO:0006783) |
0.0 | 0.9 | GO:0008033 | tRNA processing(GO:0008033) |
0.0 | 0.1 | GO:1902033 | regulation of hematopoietic stem cell proliferation(GO:1902033) |
0.0 | 0.0 | GO:0048143 | astrocyte activation(GO:0048143) |
0.0 | 0.0 | GO:0017121 | phospholipid scrambling(GO:0017121) |
0.0 | 0.1 | GO:2000463 | positive regulation of excitatory postsynaptic potential(GO:2000463) |
0.0 | 0.1 | GO:0042789 | mRNA transcription from RNA polymerase II promoter(GO:0042789) |
0.0 | 0.0 | GO:0006787 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) |
0.0 | 0.0 | GO:0019464 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.0 | 0.0 | GO:0010825 | positive regulation of centrosome duplication(GO:0010825) |
0.0 | 0.0 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
0.0 | 0.0 | GO:0009138 | pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
0.0 | 0.0 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
0.0 | 0.0 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
0.0 | 0.0 | GO:0060768 | regulation of epithelial cell proliferation involved in prostate gland development(GO:0060768) |
0.0 | 0.0 | GO:0035356 | cellular triglyceride homeostasis(GO:0035356) |
0.0 | 0.1 | GO:0035726 | common myeloid progenitor cell proliferation(GO:0035726) |
0.0 | 0.0 | GO:0051546 | keratinocyte migration(GO:0051546) |
0.0 | 0.0 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
0.0 | 0.0 | GO:0006046 | N-acetylglucosamine catabolic process(GO:0006046) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 0.6 | GO:0035355 | Toll-like receptor 2-Toll-like receptor 6 protein complex(GO:0035355) |
0.2 | 0.8 | GO:0005579 | membrane attack complex(GO:0005579) |
0.2 | 0.6 | GO:0016942 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
0.1 | 0.4 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.1 | 0.5 | GO:1990130 | Iml1 complex(GO:1990130) |
0.1 | 0.7 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.1 | 1.2 | GO:0070852 | cell body fiber(GO:0070852) |
0.1 | 0.5 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.1 | 0.3 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
0.1 | 0.2 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
0.1 | 0.2 | GO:0032444 | activin responsive factor complex(GO:0032444) |
0.1 | 0.2 | GO:0033647 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
0.1 | 0.6 | GO:0045263 | proton-transporting ATP synthase complex, coupling factor F(o)(GO:0045263) |
0.1 | 0.4 | GO:0000306 | extrinsic component of vacuolar membrane(GO:0000306) |
0.1 | 0.3 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.1 | 0.3 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.1 | 0.4 | GO:0033263 | CORVET complex(GO:0033263) |
0.1 | 0.2 | GO:0002142 | stereocilia ankle link complex(GO:0002142) |
0.1 | 0.6 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.1 | 0.2 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
0.0 | 0.2 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
0.0 | 0.2 | GO:0070876 | SOSS complex(GO:0070876) |
0.0 | 0.1 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
0.0 | 0.6 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.0 | 0.3 | GO:0016342 | catenin complex(GO:0016342) |
0.0 | 0.2 | GO:0033269 | internode region of axon(GO:0033269) |
0.0 | 0.2 | GO:0043202 | lysosomal lumen(GO:0043202) |
0.0 | 0.2 | GO:0070545 | PeBoW complex(GO:0070545) |
0.0 | 0.2 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.0 | 0.1 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
0.0 | 0.3 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.0 | 0.2 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.0 | 0.6 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.0 | 0.1 | GO:0031094 | platelet dense tubular network(GO:0031094) |
0.0 | 0.1 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
0.0 | 0.7 | GO:0043034 | costamere(GO:0043034) |
0.0 | 0.1 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.0 | 0.1 | GO:0005955 | calcineurin complex(GO:0005955) |
0.0 | 0.4 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
0.0 | 0.7 | GO:0005719 | nuclear euchromatin(GO:0005719) |
0.0 | 0.3 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.0 | 0.6 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.0 | 0.1 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
0.0 | 0.1 | GO:0016589 | NURF complex(GO:0016589) |
0.0 | 0.6 | GO:0000786 | nucleosome(GO:0000786) |
0.0 | 0.2 | GO:1904115 | axon cytoplasm(GO:1904115) |
0.0 | 0.3 | GO:0046930 | pore complex(GO:0046930) |
0.0 | 0.1 | GO:0016939 | kinesin II complex(GO:0016939) |
0.0 | 0.1 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.0 | 0.4 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.0 | 0.2 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.0 | 0.1 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
0.0 | 0.9 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.0 | 0.2 | GO:0032009 | early phagosome(GO:0032009) |
0.0 | 0.1 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.0 | 0.1 | GO:0097451 | glial limiting end-foot(GO:0097451) |
0.0 | 0.1 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
0.0 | 0.1 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.0 | 0.1 | GO:0030870 | Mre11 complex(GO:0030870) |
0.0 | 0.3 | GO:0097431 | mitotic spindle pole(GO:0097431) |
0.0 | 0.2 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.0 | 0.2 | GO:0042382 | paraspeckles(GO:0042382) |
0.0 | 0.1 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.0 | 0.1 | GO:0045009 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
0.0 | 0.1 | GO:0042583 | chromaffin granule(GO:0042583) |
0.0 | 0.2 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
0.0 | 0.3 | GO:0031616 | spindle pole centrosome(GO:0031616) |
0.0 | 0.1 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.0 | 0.2 | GO:0048500 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
0.0 | 0.3 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
0.0 | 0.2 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.0 | 0.4 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
0.0 | 0.1 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
0.0 | 0.2 | GO:0000124 | SAGA complex(GO:0000124) |
0.0 | 0.1 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.0 | 0.0 | GO:0000322 | storage vacuole(GO:0000322) |
0.0 | 0.2 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
0.0 | 0.1 | GO:1990357 | terminal web(GO:1990357) |
0.0 | 0.1 | GO:0061617 | MICOS complex(GO:0061617) |
0.0 | 0.1 | GO:0031298 | replication fork protection complex(GO:0031298) |
0.0 | 0.1 | GO:0097413 | Lewy body(GO:0097413) |
0.0 | 0.1 | GO:0008091 | spectrin(GO:0008091) |
0.0 | 0.1 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
0.0 | 0.1 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
0.0 | 0.0 | GO:0032133 | chromosome passenger complex(GO:0032133) |
0.0 | 0.1 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
0.0 | 0.1 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
0.0 | 0.1 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.0 | 0.1 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.0 | 0.1 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
0.0 | 0.1 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
0.0 | 0.2 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
0.0 | 0.1 | GO:0044232 | organelle membrane contact site(GO:0044232) |
0.0 | 0.2 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.0 | 0.4 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
0.0 | 0.1 | GO:0089701 | U2AF(GO:0089701) |
0.0 | 0.3 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
0.0 | 0.0 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.0 | 0.0 | GO:0000811 | GINS complex(GO:0000811) |
0.0 | 0.1 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
0.0 | 0.0 | GO:0005683 | U7 snRNP(GO:0005683) |
0.0 | 0.1 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.0 | 0.0 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
0.0 | 0.2 | GO:0030126 | COPI vesicle coat(GO:0030126) |
0.0 | 0.2 | GO:0010369 | chromocenter(GO:0010369) |
0.0 | 0.0 | GO:0000778 | condensed nuclear chromosome kinetochore(GO:0000778) |
0.0 | 0.1 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.0 | 0.1 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.0 | 0.2 | GO:0031083 | BLOC-1 complex(GO:0031083) |
0.0 | 0.2 | GO:0035102 | PRC1 complex(GO:0035102) |
0.0 | 0.0 | GO:0036449 | microtubule minus-end(GO:0036449) |
0.0 | 0.1 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
0.0 | 0.1 | GO:0045261 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
0.0 | 0.7 | GO:0031903 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
0.0 | 0.1 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
0.0 | 0.2 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
0.0 | 0.1 | GO:0035339 | SPOTS complex(GO:0035339) |
0.0 | 0.0 | GO:0071942 | XPC complex(GO:0071942) |
0.0 | 0.0 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
0.0 | 0.3 | GO:0044295 | axonal growth cone(GO:0044295) |
0.0 | 0.1 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
0.0 | 0.1 | GO:0071986 | Ragulator complex(GO:0071986) |
0.0 | 0.0 | GO:0097648 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
0.0 | 0.1 | GO:0097208 | alveolar lamellar body(GO:0097208) |
0.0 | 0.0 | GO:0034448 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.0 | 0.3 | GO:0031672 | A band(GO:0031672) |
0.0 | 0.0 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
0.0 | 0.1 | GO:0005845 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.0 | 0.1 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.0 | 0.0 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.0 | 0.0 | GO:0097427 | microtubule bundle(GO:0097427) |
0.0 | 0.1 | GO:0042101 | T cell receptor complex(GO:0042101) |
0.0 | 0.0 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.0 | 0.1 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.0 | 1.2 | GO:0008021 | synaptic vesicle(GO:0008021) |
0.0 | 0.0 | GO:0000153 | cytoplasmic ubiquitin ligase complex(GO:0000153) |
0.0 | 0.1 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
0.0 | 0.1 | GO:0005827 | polar microtubule(GO:0005827) |
0.0 | 0.1 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.0 | 0.2 | GO:0000145 | exocyst(GO:0000145) |
0.0 | 0.0 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
0.0 | 0.2 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.0 | 0.1 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.0 | 0.0 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
0.0 | 0.1 | GO:0005766 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
0.0 | 0.0 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.0 | 0.0 | GO:1903349 | omegasome membrane(GO:1903349) |
0.0 | 0.1 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
0.0 | 0.1 | GO:0070847 | core mediator complex(GO:0070847) |
0.0 | 0.1 | GO:0016012 | dystroglycan complex(GO:0016011) sarcoglycan complex(GO:0016012) |
0.0 | 0.0 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
0.0 | 0.0 | GO:0000938 | GARP complex(GO:0000938) |
0.0 | 0.1 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
0.0 | 0.5 | GO:0000502 | proteasome complex(GO:0000502) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 1.3 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.2 | 0.7 | GO:0038181 | bile acid receptor activity(GO:0038181) |
0.2 | 0.7 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
0.2 | 0.5 | GO:0070644 | vitamin D response element binding(GO:0070644) |
0.2 | 1.8 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.2 | 0.6 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
0.2 | 0.6 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.2 | 0.5 | GO:0055100 | adiponectin binding(GO:0055100) |
0.2 | 0.5 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
0.2 | 1.0 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
0.1 | 0.4 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.1 | 0.5 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
0.1 | 0.5 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
0.1 | 0.4 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
0.1 | 0.3 | GO:0005119 | smoothened binding(GO:0005119) |
0.1 | 0.3 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.1 | 0.3 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.1 | 0.3 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
0.1 | 0.5 | GO:0042609 | CD4 receptor binding(GO:0042609) |
0.1 | 0.3 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.1 | 0.3 | GO:2001069 | glycogen binding(GO:2001069) |
0.1 | 0.3 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.1 | 0.3 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.1 | 0.2 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
0.1 | 0.2 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.1 | 0.2 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
0.1 | 0.2 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.1 | 0.3 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.1 | 0.5 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
0.1 | 0.4 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
0.1 | 1.1 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
0.1 | 0.3 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.1 | 0.2 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.1 | 0.4 | GO:0034875 | oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
0.1 | 0.1 | GO:0016532 | superoxide dismutase copper chaperone activity(GO:0016532) |
0.1 | 0.2 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
0.1 | 0.3 | GO:0070728 | leucine binding(GO:0070728) |
0.1 | 0.2 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.1 | 0.2 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
0.1 | 0.4 | GO:0034711 | inhibin binding(GO:0034711) |
0.1 | 0.2 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
0.1 | 0.8 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
0.1 | 0.2 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
0.1 | 0.2 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.1 | 0.4 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.1 | 0.2 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
0.1 | 0.3 | GO:0050051 | leukotriene-B4 20-monooxygenase activity(GO:0050051) |
0.1 | 0.2 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.1 | 0.2 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
0.1 | 0.2 | GO:0004771 | sterol esterase activity(GO:0004771) |
0.1 | 0.2 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
0.1 | 1.1 | GO:0003785 | actin monomer binding(GO:0003785) |
0.1 | 0.3 | GO:0015288 | porin activity(GO:0015288) |
0.1 | 0.4 | GO:0016668 | oxidoreductase activity, acting on a sulfur group of donors, NAD(P) as acceptor(GO:0016668) |
0.1 | 0.2 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
0.1 | 0.2 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.1 | 0.3 | GO:0043910 | CTP:2,3-di-O-geranylgeranyl-sn-glycero-1-phosphate cytidyltransferase activity(GO:0043338) phospholactate guanylyltransferase activity(GO:0043814) ATP:coenzyme F420 adenylyltransferase activity(GO:0043910) UDP-N-acetylgalactosamine diphosphorylase activity(GO:0052630) |
0.1 | 0.2 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
0.1 | 0.2 | GO:0016822 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
0.1 | 1.2 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
0.1 | 0.2 | GO:0071614 | linoleic acid epoxygenase activity(GO:0071614) |
0.1 | 0.2 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
0.1 | 0.2 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.1 | 0.3 | GO:0017040 | ceramidase activity(GO:0017040) |
0.1 | 0.6 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.1 | 0.2 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
0.1 | 0.5 | GO:0002162 | dystroglycan binding(GO:0002162) |
0.1 | 0.1 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
0.0 | 0.5 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
0.0 | 1.1 | GO:0044688 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) photoreceptor cyclic-nucleotide phosphodiesterase activity(GO:0004120) 7,8-dihydro-D-neopterin 2',3'-cyclic phosphate phosphodiesterase activity(GO:0044688) inositol phosphosphingolipid phospholipase activity(GO:0052712) inositol phosphorylceramide phospholipase activity(GO:0052713) mannosyl-inositol phosphorylceramide phospholipase activity(GO:0052714) mannosyl-diinositol phosphorylceramide phospholipase activity(GO:0052715) |
0.0 | 0.1 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
0.0 | 0.3 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
0.0 | 0.2 | GO:0032564 | dATP binding(GO:0032564) |
0.0 | 0.1 | GO:1901702 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
0.0 | 0.2 | GO:0031779 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
0.0 | 0.2 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
0.0 | 0.1 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.0 | 0.1 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
0.0 | 0.1 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.0 | 0.1 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
0.0 | 0.6 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
0.0 | 0.0 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
0.0 | 0.3 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
0.0 | 0.2 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
0.0 | 0.3 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.0 | 0.2 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.0 | 1.9 | GO:0016765 | transferase activity, transferring alkyl or aryl (other than methyl) groups(GO:0016765) |
0.0 | 0.2 | GO:0008430 | selenium binding(GO:0008430) |
0.0 | 0.3 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
0.0 | 0.1 | GO:0005347 | ATP transmembrane transporter activity(GO:0005347) |
0.0 | 0.2 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
0.0 | 0.1 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
0.0 | 0.1 | GO:0071209 | U7 snRNA binding(GO:0071209) |
0.0 | 0.1 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
0.0 | 0.2 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
0.0 | 0.0 | GO:0070699 | type II activin receptor binding(GO:0070699) |
0.0 | 0.1 | GO:0016530 | metallochaperone activity(GO:0016530) |
0.0 | 0.1 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.0 | 0.3 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
0.0 | 0.3 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
0.0 | 0.1 | GO:1990239 | steroid hormone binding(GO:1990239) |
0.0 | 0.2 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
0.0 | 0.2 | GO:0004723 | calcium-dependent protein serine/threonine phosphatase activity(GO:0004723) |
0.0 | 0.6 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.0 | 0.2 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
0.0 | 0.4 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
0.0 | 0.1 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.0 | 0.7 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
0.0 | 0.2 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
0.0 | 0.1 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
0.0 | 0.3 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.0 | 0.0 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
0.0 | 0.1 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
0.0 | 0.1 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.0 | 0.2 | GO:1990405 | protein antigen binding(GO:1990405) |
0.0 | 0.2 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.0 | 0.2 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.0 | 0.2 | GO:0004064 | arylesterase activity(GO:0004064) |
0.0 | 0.2 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.0 | 0.1 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.0 | 0.3 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.0 | 0.2 | GO:0000339 | RNA cap binding(GO:0000339) |
0.0 | 0.1 | GO:0032190 | acrosin binding(GO:0032190) |
0.0 | 0.1 | GO:0034618 | arginine binding(GO:0034618) |
0.0 | 0.1 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
0.0 | 1.0 | GO:0004033 | aldo-keto reductase (NADP) activity(GO:0004033) |
0.0 | 0.2 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.0 | 0.1 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.0 | 0.1 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
0.0 | 0.1 | GO:0016453 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
0.0 | 0.1 | GO:0005047 | signal recognition particle binding(GO:0005047) |
0.0 | 0.1 | GO:0072341 | modified amino acid binding(GO:0072341) |
0.0 | 0.1 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
0.0 | 0.5 | GO:0043175 | RNA polymerase core enzyme binding(GO:0043175) |
0.0 | 0.1 | GO:0048019 | receptor antagonist activity(GO:0048019) |
0.0 | 0.1 | GO:0070878 | primary miRNA binding(GO:0070878) |
0.0 | 0.1 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
0.0 | 0.1 | GO:0004967 | glucagon receptor activity(GO:0004967) |
0.0 | 0.1 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
0.0 | 0.2 | GO:0004017 | adenylate kinase activity(GO:0004017) |
0.0 | 0.2 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
0.0 | 0.1 | GO:0016882 | cyclo-ligase activity(GO:0016882) |
0.0 | 0.1 | GO:0035514 | DNA demethylase activity(GO:0035514) |
0.0 | 0.2 | GO:0042910 | xenobiotic transporter activity(GO:0042910) |
0.0 | 0.1 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.0 | 0.1 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.0 | 0.3 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
0.0 | 0.3 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.0 | 0.1 | GO:0061731 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
0.0 | 0.0 | GO:0016662 | oxidoreductase activity, acting on other nitrogenous compounds as donors, cytochrome as acceptor(GO:0016662) |
0.0 | 0.3 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.0 | 0.1 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.0 | 0.2 | GO:0031419 | cobalamin binding(GO:0031419) |
0.0 | 0.5 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.0 | 0.1 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
0.0 | 0.1 | GO:0035197 | siRNA binding(GO:0035197) |
0.0 | 0.1 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.0 | 0.1 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
0.0 | 0.1 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.0 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.0 | 0.3 | GO:0016208 | AMP binding(GO:0016208) |
0.0 | 1.1 | GO:0035064 | methylated histone binding(GO:0035064) |
0.0 | 0.1 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) |
0.0 | 0.1 | GO:0050692 | DBD domain binding(GO:0050692) |
0.0 | 0.2 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
0.0 | 0.2 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
0.0 | 0.1 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
0.0 | 0.1 | GO:0003840 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
0.0 | 0.2 | GO:0035174 | histone serine kinase activity(GO:0035174) |
0.0 | 0.8 | GO:0017046 | peptide hormone binding(GO:0017046) |
0.0 | 0.1 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.0 | 0.1 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
0.0 | 0.1 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
0.0 | 1.8 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
0.0 | 0.1 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.0 | 0.3 | GO:0008413 | 8-oxo-7,8-dihydroguanosine triphosphate pyrophosphatase activity(GO:0008413) |
0.0 | 0.2 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.0 | 0.1 | GO:0016443 | bidentate ribonuclease III activity(GO:0016443) |
0.0 | 0.2 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.0 | 0.1 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
0.0 | 0.2 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
0.0 | 0.1 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.0 | 0.1 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
0.0 | 0.4 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
0.0 | 0.0 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.0 | 0.1 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.0 | 0.1 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
0.0 | 0.1 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
0.0 | 0.1 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
0.0 | 0.1 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
0.0 | 0.3 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
0.0 | 0.1 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
0.0 | 0.5 | GO:0001221 | transcription cofactor binding(GO:0001221) |
0.0 | 0.0 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.0 | 0.1 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.0 | 0.0 | GO:0051734 | polynucleotide 5'-hydroxyl-kinase activity(GO:0051731) ATP-dependent polynucleotide kinase activity(GO:0051734) |
0.0 | 0.1 | GO:0004365 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
0.0 | 0.1 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
0.0 | 0.1 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
0.0 | 0.1 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
0.0 | 0.1 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.0 | 0.1 | GO:0070137 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
0.0 | 0.1 | GO:0000146 | microfilament motor activity(GO:0000146) |
0.0 | 0.4 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
0.0 | 0.1 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
0.0 | 0.1 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.0 | 0.5 | GO:0034594 | phosphatidylinositol trisphosphate phosphatase activity(GO:0034594) |
0.0 | 0.2 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
0.0 | 0.1 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
0.0 | 0.1 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.0 | 0.1 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.0 | 0.3 | GO:0050681 | androgen receptor binding(GO:0050681) |
0.0 | 0.2 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
0.0 | 0.1 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
0.0 | 0.1 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
0.0 | 0.2 | GO:0070063 | RNA polymerase binding(GO:0070063) |
0.0 | 0.1 | GO:0061665 | SUMO ligase activity(GO:0061665) |
0.0 | 0.3 | GO:0015026 | coreceptor activity(GO:0015026) |
0.0 | 0.7 | GO:0000049 | tRNA binding(GO:0000049) |
0.0 | 0.2 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
0.0 | 0.1 | GO:0000832 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
0.0 | 0.1 | GO:0019215 | intermediate filament binding(GO:0019215) |
0.0 | 0.1 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.0 | 0.1 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.0 | 0.1 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
0.0 | 0.3 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.0 | 0.1 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
0.0 | 0.1 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.0 | 0.1 | GO:0031078 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
0.0 | 0.2 | GO:0022884 | macromolecule transmembrane transporter activity(GO:0022884) |
0.0 | 0.3 | GO:0001848 | complement binding(GO:0001848) |
0.0 | 0.5 | GO:0004693 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
0.0 | 0.1 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
0.0 | 0.1 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.0 | 0.1 | GO:0050897 | cobalt ion binding(GO:0050897) |
0.0 | 0.3 | GO:0005527 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
0.0 | 0.1 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.0 | 0.0 | GO:0004676 | 3-phosphoinositide-dependent protein kinase activity(GO:0004676) |
0.0 | 0.1 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.0 | 0.0 | GO:0016934 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
0.0 | 0.0 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
0.0 | 0.3 | GO:0030552 | cAMP binding(GO:0030552) |
0.0 | 0.1 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.0 | 0.0 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.0 | 0.2 | GO:0005123 | death receptor binding(GO:0005123) |
0.0 | 0.0 | GO:0004376 | glycolipid mannosyltransferase activity(GO:0004376) |
0.0 | 0.1 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
0.0 | 0.1 | GO:0052851 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
0.0 | 0.3 | GO:0003756 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
0.0 | 0.3 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
0.0 | 0.1 | GO:0018585 | fluorene oxygenase activity(GO:0018585) |
0.0 | 0.1 | GO:1990254 | keratin filament binding(GO:1990254) |
0.0 | 0.1 | GO:0004030 | aldehyde dehydrogenase [NAD(P)+] activity(GO:0004030) |
0.0 | 0.0 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
0.0 | 0.1 | GO:0004556 | alpha-amylase activity(GO:0004556) |
0.0 | 0.0 | GO:0046921 | alpha-(1->6)-fucosyltransferase activity(GO:0046921) |
0.0 | 0.1 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.0 | 0.1 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
0.0 | 0.3 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
0.0 | 0.1 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
0.0 | 0.1 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
0.0 | 0.1 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
0.0 | 0.0 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.0 | 0.3 | GO:0045309 | protein phosphorylated amino acid binding(GO:0045309) |
0.0 | 0.1 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
0.0 | 0.1 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.0 | 0.0 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.0 | 0.1 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
0.0 | 0.3 | GO:0046875 | ephrin receptor binding(GO:0046875) |
0.0 | 0.1 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.0 | 0.0 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
0.0 | 0.1 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
0.0 | 0.1 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
0.0 | 0.0 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.0 | 0.0 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
0.0 | 0.3 | GO:0016667 | oxidoreductase activity, acting on a sulfur group of donors(GO:0016667) |
0.0 | 0.3 | GO:0070330 | aromatase activity(GO:0070330) |
0.0 | 0.1 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.0 | 0.6 | GO:0030276 | clathrin binding(GO:0030276) |
0.0 | 0.0 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.0 | 0.1 | GO:0031685 | adenosine receptor binding(GO:0031685) |
0.0 | 0.0 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
0.0 | 0.3 | GO:0051721 | protein phosphatase 2A binding(GO:0051721) |
0.0 | 0.1 | GO:0005499 | vitamin D binding(GO:0005499) |
0.0 | 0.1 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.0 | 0.1 | GO:0102336 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
0.0 | 0.1 | GO:0005522 | profilin binding(GO:0005522) |
0.0 | 0.1 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
0.0 | 0.1 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.0 | 0.9 | GO:0016597 | amino acid binding(GO:0016597) |
0.0 | 0.1 | GO:0046790 | virion binding(GO:0046790) |
0.0 | 0.0 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
0.0 | 0.0 | GO:0015157 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
0.0 | 0.2 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
0.0 | 0.0 | GO:0016712 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced flavin or flavoprotein as one donor, and incorporation of one atom of oxygen(GO:0016712) |
0.0 | 0.1 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.0 | 0.0 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
0.0 | 0.4 | GO:0070888 | E-box binding(GO:0070888) |
0.0 | 0.0 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
0.0 | 0.1 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.0 | 0.2 | GO:0031369 | translation initiation factor binding(GO:0031369) |
0.0 | 0.0 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
0.0 | 0.1 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
0.0 | 0.1 | GO:0017070 | U6 snRNA binding(GO:0017070) |
0.0 | 0.1 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
0.0 | 0.0 | GO:0034452 | dynactin binding(GO:0034452) |
0.0 | 0.1 | GO:0008097 | 5S rRNA binding(GO:0008097) |
0.0 | 0.2 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.0 | 0.1 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
0.0 | 0.0 | GO:0016015 | morphogen activity(GO:0016015) |
0.0 | 0.1 | GO:0008329 | signaling pattern recognition receptor activity(GO:0008329) pattern recognition receptor activity(GO:0038187) |
0.0 | 0.2 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
0.0 | 0.0 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
0.0 | 0.1 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.0 | 0.0 | GO:0004115 | 3',5'-cyclic-AMP phosphodiesterase activity(GO:0004115) |
0.0 | 0.3 | GO:0015485 | cholesterol binding(GO:0015485) |
0.0 | 0.1 | GO:0019825 | oxygen binding(GO:0019825) |
0.0 | 0.4 | GO:0034212 | peptide N-acetyltransferase activity(GO:0034212) |
0.0 | 0.2 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
0.0 | 0.4 | GO:0005160 | transforming growth factor beta receptor binding(GO:0005160) |
0.0 | 0.1 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
0.0 | 0.1 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.0 | 0.1 | GO:0048038 | quinone binding(GO:0048038) |
0.0 | 0.0 | GO:0019158 | fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
0.0 | 0.2 | GO:0008137 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 0.1 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.1 | 0.8 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.1 | 1.2 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
0.0 | 1.2 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.0 | 0.2 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
0.0 | 2.0 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
0.0 | 0.3 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
0.0 | 1.6 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.0 | 0.1 | PID IFNG PATHWAY | IFN-gamma pathway |
0.0 | 0.4 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
0.0 | 1.1 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.0 | 0.6 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.0 | 0.8 | PID ALK1 PATHWAY | ALK1 signaling events |
0.0 | 0.8 | PID IGF1 PATHWAY | IGF1 pathway |
0.0 | 0.2 | PID S1P S1P4 PATHWAY | S1P4 pathway |
0.0 | 0.4 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.0 | 0.2 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.0 | 0.2 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.0 | 0.9 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.0 | 0.4 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.0 | 0.1 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
0.0 | 0.0 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.0 | 0.6 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.0 | 0.7 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
0.0 | 0.1 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.0 | 0.5 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.0 | 0.2 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
0.0 | 0.4 | ST ADRENERGIC | Adrenergic Pathway |
0.0 | 0.3 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.0 | 0.4 | PID ARF6 PATHWAY | Arf6 signaling events |
0.0 | 0.7 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
0.0 | 0.6 | PID AURORA B PATHWAY | Aurora B signaling |
0.0 | 0.3 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.0 | 0.3 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
0.0 | 0.4 | PID BMP PATHWAY | BMP receptor signaling |
0.0 | 0.1 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
0.0 | 0.3 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
0.0 | 0.1 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.0 | 0.1 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.0 | 0.2 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
0.0 | 0.9 | WNT SIGNALING | Genes related to Wnt-mediated signal transduction |
0.0 | 0.3 | PID RAS PATHWAY | Regulation of Ras family activation |
0.0 | 0.6 | PID CMYB PATHWAY | C-MYB transcription factor network |
0.0 | 0.0 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
0.0 | 0.2 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
0.0 | 0.4 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
0.0 | 0.0 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
0.0 | 0.3 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
0.0 | 0.1 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
0.0 | 0.0 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
0.0 | 0.1 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.0 | 0.3 | PID ATR PATHWAY | ATR signaling pathway |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 0.5 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
0.1 | 1.5 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
0.1 | 0.8 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
0.1 | 1.1 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
0.1 | 0.6 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.1 | 0.4 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
0.1 | 1.0 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.1 | 0.1 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
0.1 | 2.0 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
0.1 | 0.6 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.0 | 0.0 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
0.0 | 0.4 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
0.0 | 1.0 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.0 | 0.2 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.0 | 0.3 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.0 | 0.7 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.0 | 0.4 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.0 | 0.3 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.0 | 0.1 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
0.0 | 0.1 | REACTOME NRIF SIGNALS CELL DEATH FROM THE NUCLEUS | Genes involved in NRIF signals cell death from the nucleus |
0.0 | 0.7 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
0.0 | 0.3 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.0 | 0.6 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
0.0 | 0.3 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.0 | 0.1 | REACTOME SHC RELATED EVENTS | Genes involved in SHC-related events |
0.0 | 0.4 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
0.0 | 0.1 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
0.0 | 0.7 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.0 | 0.1 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
0.0 | 0.2 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.0 | 0.3 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.0 | 0.5 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.0 | 0.5 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
0.0 | 0.5 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
0.0 | 0.1 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
0.0 | 0.4 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
0.0 | 0.5 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.0 | 0.4 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
0.0 | 0.0 | REACTOME PKB MEDIATED EVENTS | Genes involved in PKB-mediated events |
0.0 | 0.2 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
0.0 | 0.2 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.0 | 0.0 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
0.0 | 0.1 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
0.0 | 0.6 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
0.0 | 0.3 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
0.0 | 0.1 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
0.0 | 0.0 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
0.0 | 0.2 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.0 | 0.2 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
0.0 | 0.2 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
0.0 | 0.0 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
0.0 | 0.1 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
0.0 | 0.1 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
0.0 | 0.1 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
0.0 | 0.2 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
0.0 | 0.3 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.0 | 0.2 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
0.0 | 0.3 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
0.0 | 0.2 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.0 | 0.2 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.0 | 0.3 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
0.0 | 0.0 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
0.0 | 0.2 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.0 | 0.4 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
0.0 | 0.0 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.0 | 0.0 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
0.0 | 0.6 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
0.0 | 0.4 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
0.0 | 0.2 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.0 | 0.0 | REACTOME GRB2 SOS PROVIDES LINKAGE TO MAPK SIGNALING FOR INTERGRINS | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
0.0 | 0.1 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
0.0 | 0.2 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
0.0 | 0.2 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
0.0 | 0.3 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.0 | 0.2 | REACTOME SEMA4D IN SEMAPHORIN SIGNALING | Genes involved in Sema4D in semaphorin signaling |
0.0 | 0.1 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
0.0 | 0.1 | REACTOME SHC MEDIATED CASCADE | Genes involved in SHC-mediated cascade |
0.0 | 0.1 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.0 | 0.6 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
0.0 | 0.1 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
0.0 | 0.3 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.0 | 1.4 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
0.0 | 0.2 | REACTOME G1 PHASE | Genes involved in G1 Phase |
0.0 | 0.1 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
0.0 | 0.1 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
0.0 | 0.1 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
0.0 | 0.1 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.0 | 0.2 | REACTOME DOUBLE STRAND BREAK REPAIR | Genes involved in Double-Strand Break Repair |
0.0 | 0.0 | REACTOME CD28 CO STIMULATION | Genes involved in CD28 co-stimulation |
0.0 | 0.2 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.0 | 0.1 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
0.0 | 0.0 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
0.0 | 0.1 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
0.0 | 0.1 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
0.0 | 0.1 | REACTOME SIGNALING BY FGFR1 MUTANTS | Genes involved in Signaling by FGFR1 mutants |
0.0 | 0.1 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
0.0 | 0.1 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
0.0 | 0.0 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.0 | 0.1 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.0 | 0.2 | REACTOME ACTIVATION OF KAINATE RECEPTORS UPON GLUTAMATE BINDING | Genes involved in Activation of Kainate Receptors upon glutamate binding |