Gene Symbol | Gene ID | Gene Info |
---|---|---|
Yy1
|
ENSMUSG00000021264.11 | Yy1 |
Yy2
|
ENSMUSG00000091736.2 | Yy2 |
Gene | Promoter | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Yy1 | chr12_108801515_108801666 | 4649 | 0.117113 | 0.84 | 3.7e-02 | Click! |
Yy1 | chr12_108804338_108804496 | 1822 | 0.204817 | -0.74 | 9.3e-02 | Click! |
Yy1 | chr12_108811570_108811721 | 5406 | 0.109693 | 0.66 | 1.5e-01 | Click! |
Yy1 | chr12_108793011_108793182 | 123 | 0.753513 | -0.63 | 1.8e-01 | Click! |
Yy1 | chr12_108792800_108792965 | 91 | 0.558300 | -0.62 | 1.9e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr13_91748092_91748287 | 3.55 |
Gm27656 |
predicted gene, 27656 |
3917 |
0.17 |
chr5_146901911_146902074 | 2.27 |
Gtf3a |
general transcription factor III A |
46665 |
0.09 |
chr8_70905885_70906054 | 2.18 |
Map1s |
microtubule-associated protein 1S |
13 |
0.94 |
chr2_167860160_167860340 | 2.12 |
Gm14319 |
predicted gene 14319 |
1665 |
0.34 |
chr13_95639844_95639995 | 2.10 |
Iqgap2 |
IQ motif containing GTPase activating protein 2 |
21179 |
0.13 |
chr7_18990506_18990869 | 2.09 |
Mypop |
Myb-related transcription factor, partner of profilin |
558 |
0.49 |
chr2_31517780_31518546 | 1.81 |
Ass1 |
argininosuccinate synthetase 1 |
327 |
0.88 |
chr3_94398218_94398392 | 1.79 |
Lingo4 |
leucine rich repeat and Ig domain containing 4 |
212 |
0.81 |
chr3_97645418_97646002 | 1.65 |
Prkab2 |
protein kinase, AMP-activated, beta 2 non-catalytic subunit |
12483 |
0.13 |
chr9_48738508_48738659 | 1.64 |
Zbtb16 |
zinc finger and BTB domain containing 16 |
97362 |
0.07 |
chr13_93627456_93627944 | 1.63 |
Gm15622 |
predicted gene 15622 |
2318 |
0.25 |
chr13_91747569_91747905 | 1.51 |
Gm27656 |
predicted gene, 27656 |
4369 |
0.16 |
chr9_123851836_123852151 | 1.50 |
Fyco1 |
FYVE and coiled-coil domain containing 1 |
94 |
0.96 |
chr1_21324523_21325070 | 1.48 |
Gm21909 |
predicted gene, 21909 |
8476 |
0.1 |
chr9_78192592_78192962 | 1.45 |
Gsta4 |
glutathione S-transferase, alpha 4 |
830 |
0.46 |
chr8_70717164_70717873 | 1.44 |
Gm3336 |
predicted gene 3336 |
1025 |
0.27 |
chr19_46140539_46140690 | 1.43 |
Pitx3 |
paired-like homeodomain transcription factor 3 |
369 |
0.79 |
chr2_26588564_26589214 | 1.42 |
Egfl7 |
EGF-like domain 7 |
346 |
0.71 |
chr17_27204481_27205047 | 1.42 |
Lemd2 |
LEM domain containing 2 |
295 |
0.81 |
chr1_67213641_67214357 | 1.41 |
Gm15668 |
predicted gene 15668 |
35201 |
0.17 |
chr9_74982686_74983015 | 1.41 |
Fam214a |
family with sequence similarity 214, member A |
6739 |
0.21 |
chr7_113961588_113961904 | 1.38 |
Gm45615 |
predicted gene 45615 |
125152 |
0.05 |
chr7_30955354_30955627 | 1.36 |
Usf2 |
upstream transcription factor 2 |
40 |
0.79 |
chr19_46133855_46134398 | 1.34 |
Elovl3 |
elongation of very long chain fatty acids (FEN1/Elo2, SUR4/Elo3, yeast)-like 3 |
2229 |
0.19 |
chr12_55440755_55440910 | 1.33 |
Psma6 |
proteasome subunit alpha 6 |
33449 |
0.13 |
chr17_34733622_34734232 | 1.32 |
C4b |
complement component 4B (Chido blood group) |
2172 |
0.12 |
chr14_20185275_20185426 | 1.32 |
Kcnk5 |
potassium channel, subfamily K, member 5 |
3541 |
0.16 |
chr13_45623869_45624201 | 1.31 |
Gmpr |
guanosine monophosphate reductase |
77882 |
0.1 |
chr11_65787387_65787891 | 1.30 |
Map2k4 |
mitogen-activated protein kinase kinase 4 |
646 |
0.74 |
chr1_182500736_182501185 | 1.30 |
Gm37069 |
predicted gene, 37069 |
6804 |
0.14 |
chr6_85832306_85832457 | 1.29 |
Nat8 |
N-acetyltransferase 8 (GCN5-related) |
299 |
0.79 |
chr2_118746119_118746298 | 1.28 |
Inafm2 |
InaF motif containing 2 |
450 |
0.72 |
chr16_25221689_25221840 | 1.27 |
Tprg |
transformation related protein 63 regulated |
65053 |
0.14 |
chr2_6067931_6068103 | 1.26 |
Upf2 |
UPF2 regulator of nonsense transcripts homolog (yeast) |
17590 |
0.18 |
chr18_9078096_9078247 | 1.25 |
Gm18526 |
predicted gene, 18526 |
22084 |
0.24 |
chr1_121313932_121314091 | 1.24 |
Insig2 |
insulin induced gene 2 |
1597 |
0.34 |
chr14_64695745_64695916 | 1.23 |
Kif13b |
kinesin family member 13B |
43228 |
0.13 |
chr13_4436257_4436456 | 1.22 |
Akr1c6 |
aldo-keto reductase family 1, member C6 |
210 |
0.93 |
chr4_81274252_81274490 | 1.22 |
Mpdz |
multiple PDZ domain protein |
10328 |
0.28 |
chr9_65318057_65318208 | 1.21 |
Clpx |
caseinolytic mitochondrial matrix peptidase chaperone subunit |
7980 |
0.09 |
chr4_141546149_141546719 | 1.20 |
B330016D10Rik |
RIKEN cDNA B330016D10 gene |
245 |
0.89 |
chr10_53353543_53353887 | 1.19 |
Cep85l |
centrosomal protein 85-like |
3892 |
0.15 |
chr6_124457048_124457312 | 1.19 |
Clstn3 |
calsyntenin 3 |
705 |
0.52 |
chr13_96981889_96982402 | 1.19 |
Gm48597 |
predicted gene, 48597 |
31231 |
0.12 |
chr9_106730382_106730719 | 1.18 |
Rad54l2 |
RAD54 like 2 (S. cerevisiae) |
7679 |
0.17 |
chr9_9565147_9565311 | 1.18 |
Gm47334 |
predicted gene, 47334 |
1142 |
0.57 |
chr3_52622957_52623112 | 1.18 |
Gm10293 |
predicted pseudogene 10293 |
10199 |
0.24 |
chr8_109996628_109997116 | 1.18 |
Tat |
tyrosine aminotransferase |
6366 |
0.13 |
chr9_122357685_122358080 | 1.18 |
Abhd5 |
abhydrolase domain containing 5 |
5771 |
0.15 |
chr4_125420233_125420436 | 1.16 |
Grik3 |
glutamate receptor, ionotropic, kainate 3 |
70366 |
0.1 |
chr14_121720038_121720281 | 1.16 |
Dock9 |
dedicator of cytokinesis 9 |
18702 |
0.23 |
chr19_44395706_44395857 | 1.16 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
10909 |
0.14 |
chr18_54250977_54251129 | 1.15 |
Redrum |
Redrum, erythroid developmental long intergenic non-protein coding transcript |
171242 |
0.03 |
chr17_28519046_28519420 | 1.14 |
Gm49861 |
predicted gene, 49861 |
775 |
0.35 |
chr3_51185131_51185304 | 1.14 |
Noct |
nocturnin |
39230 |
0.12 |
chr8_114108819_114109062 | 1.14 |
Nudt7 |
nudix (nucleoside diphosphate linked moiety X)-type motif 7 |
24617 |
0.25 |
chr18_9848299_9848531 | 1.14 |
Gm23637 |
predicted gene, 23637 |
21296 |
0.13 |
chr9_44096490_44096809 | 1.13 |
Usp2 |
ubiquitin specific peptidase 2 |
3975 |
0.08 |
chr14_33107131_33107302 | 1.12 |
Wdfy4 |
WD repeat and FYVE domain containing 4 |
77850 |
0.08 |
chr9_21671190_21671387 | 1.12 |
Smarca4 |
SWI/SNF related, matrix associated, actin dependent regulator of chromatin, subfamily a, member 4 |
35521 |
0.09 |
chr9_118232810_118233328 | 1.10 |
Gm17399 |
predicted gene, 17399 |
82838 |
0.08 |
chr4_115280301_115280685 | 1.10 |
Cyp4a12a |
cytochrome P450, family 4, subfamily a, polypeptide 12a |
18553 |
0.14 |
chr7_63899068_63899509 | 1.10 |
Gm27252 |
predicted gene 27252 |
1314 |
0.37 |
chr19_3562443_3562594 | 1.09 |
Ppp6r3 |
protein phosphatase 6, regulatory subunit 3 |
13178 |
0.15 |
chr13_93618635_93618791 | 1.09 |
Gm15622 |
predicted gene 15622 |
6669 |
0.17 |
chr8_35389763_35389940 | 1.09 |
Ppp1r3b |
protein phosphatase 1, regulatory subunit 3B |
13191 |
0.15 |
chr12_101954170_101954556 | 1.08 |
Atxn3 |
ataxin 3 |
3785 |
0.17 |
chr3_31970158_31970309 | 1.08 |
Gm37834 |
predicted gene, 37834 |
15469 |
0.27 |
chr2_26589721_26589923 | 1.08 |
Egfl7 |
EGF-like domain 7 |
487 |
0.54 |
chr6_129528344_129528723 | 1.08 |
Gabarapl1 |
gamma-aminobutyric acid (GABA) A receptor-associated protein-like 1 |
4627 |
0.09 |
chr11_95232020_95232325 | 1.07 |
Gm11515 |
predicted gene 11515 |
6540 |
0.15 |
chr1_127990203_127990369 | 1.06 |
Gm38248 |
predicted gene, 38248 |
5599 |
0.16 |
chr1_86522793_86522992 | 1.06 |
Ptma |
prothymosin alpha |
3834 |
0.17 |
chr15_27525366_27525772 | 1.06 |
B230362B09Rik |
RIKEN cDNA B230362B09 gene |
21657 |
0.15 |
chr5_140118402_140118733 | 1.06 |
Mad1l1 |
MAD1 mitotic arrest deficient 1-like 1 |
3101 |
0.21 |
chr11_120815283_120815743 | 1.05 |
Fasn |
fatty acid synthase |
58 |
0.94 |
chr16_91833643_91834213 | 1.05 |
Itsn1 |
intersectin 1 (SH3 domain protein 1A) |
5771 |
0.19 |
chr5_124032266_124032428 | 1.05 |
Gm34086 |
predicted gene, 34086 |
14 |
0.54 |
chr19_46138909_46139075 | 1.05 |
Pitx3 |
paired-like homeodomain transcription factor 3 |
1703 |
0.25 |
chr1_21249667_21249920 | 1.04 |
Gsta3 |
glutathione S-transferase, alpha 3 |
3728 |
0.14 |
chr7_24175162_24175313 | 1.04 |
Zfp114 |
zinc finger protein 114 |
151 |
0.92 |
chr1_80244319_80244685 | 1.04 |
Gm37932 |
predicted gene, 37932 |
11695 |
0.13 |
chr19_29370028_29370202 | 1.04 |
Cd274 |
CD274 antigen |
2660 |
0.18 |
chr4_142337823_142337991 | 1.04 |
Gm13052 |
predicted gene 13052 |
8568 |
0.28 |
chr4_117040674_117041081 | 1.03 |
Eif2b3 |
eukaryotic translation initiation factor 2B, subunit 3 |
3599 |
0.12 |
chr5_112843087_112843449 | 1.03 |
Myo18b |
myosin XVIIIb |
28318 |
0.17 |
chr2_155066050_155066313 | 1.03 |
Gm45609 |
predicted gene 45609 |
8000 |
0.14 |
chr4_8761424_8761624 | 1.02 |
Chd7 |
chromodomain helicase DNA binding protein 7 |
10086 |
0.29 |
chr14_56863632_56863793 | 1.02 |
Gm8983 |
predicted gene 8983 |
1701 |
0.22 |
chr5_125332469_125332873 | 1.02 |
Scarb1 |
scavenger receptor class B, member 1 |
4952 |
0.15 |
chr19_46056737_46057343 | 1.02 |
Pprc1 |
peroxisome proliferative activated receptor, gamma, coactivator-related 1 |
176 |
0.92 |
chr10_79555012_79555447 | 1.02 |
Mier2 |
MIER family member 2 |
30 |
0.96 |
chr8_10873138_10873312 | 1.02 |
Gm32540 |
predicted gene, 32540 |
7039 |
0.11 |
chr2_181529212_181529615 | 1.01 |
Dnajc5 |
DnaJ heat shock protein family (Hsp40) member C5 |
8466 |
0.1 |
chr2_5564343_5564554 | 1.01 |
Gm13216 |
predicted gene 13216 |
39123 |
0.19 |
chr12_83791556_83791741 | 1.00 |
Papln |
papilin, proteoglycan-like sulfated glycoprotein |
27986 |
0.1 |
chr10_81412487_81412833 | 1.00 |
Gm16104 |
predicted gene 16104 |
3085 |
0.08 |
chr2_163301297_163301733 | 1.00 |
Tox2 |
TOX high mobility group box family member 2 |
18863 |
0.19 |
chr6_137784539_137784690 | 1.00 |
Dera |
deoxyribose-phosphate aldolase (putative) |
3791 |
0.29 |
chr9_107770327_107770857 | 0.99 |
Rbm5 |
RNA binding motif protein 5 |
97 |
0.94 |
chr12_52835298_52835668 | 0.99 |
Akap6 |
A kinase (PRKA) anchor protein 6 |
39647 |
0.19 |
chr7_98351056_98351207 | 0.99 |
Tsku |
tsukushi, small leucine rich proteoglycan |
8948 |
0.17 |
chr11_67364669_67364832 | 0.99 |
Myh13 |
myosin, heavy polypeptide 13, skeletal muscle |
35 |
0.98 |
chr4_139601582_139602248 | 0.98 |
Gm21969 |
predicted gene 21969 |
1271 |
0.37 |
chr15_99033646_99034208 | 0.98 |
Tuba1c |
tubulin, alpha 1C |
3606 |
0.11 |
chr11_119950533_119950831 | 0.98 |
Baiap2 |
brain-specific angiogenesis inhibitor 1-associated protein 2 |
7210 |
0.12 |
chr2_169755530_169755681 | 0.98 |
Tshz2 |
teashirt zinc finger family member 2 |
121929 |
0.06 |
chr19_46137654_46137874 | 0.98 |
Pitx3 |
paired-like homeodomain transcription factor 3 |
475 |
0.71 |
chr17_29031946_29032467 | 0.97 |
Gm16196 |
predicted gene 16196 |
362 |
0.47 |
chr3_84285532_84285981 | 0.97 |
Trim2 |
tripartite motif-containing 2 |
14965 |
0.24 |
chr7_72298468_72299026 | 0.97 |
Mctp2 |
multiple C2 domains, transmembrane 2 |
7861 |
0.3 |
chr4_134993702_134994076 | 0.97 |
Syf2 |
SYF2 homolog, RNA splicing factor (S. cerevisiae) |
62879 |
0.09 |
chr17_79999311_79999483 | 0.97 |
Gm41625 |
predicted gene, 41625 |
17735 |
0.14 |
chr15_59751823_59751997 | 0.96 |
Gm19510 |
predicted gene, 19510 |
43049 |
0.16 |
chr9_65297702_65297853 | 0.96 |
Gm16218 |
predicted gene 16218 |
142 |
0.92 |
chr2_27210582_27210920 | 0.96 |
Sardh |
sarcosine dehydrogenase |
814 |
0.54 |
chr7_12979741_12980348 | 0.96 |
Zfp446 |
zinc finger protein 446 |
524 |
0.55 |
chr13_93628549_93628834 | 0.96 |
Gm15622 |
predicted gene 15622 |
3309 |
0.2 |
chr11_51874608_51874765 | 0.95 |
Jade2 |
jade family PHD finger 2 |
17033 |
0.15 |
chr9_121799035_121799447 | 0.95 |
Hhatl |
hedgehog acyltransferase-like |
6734 |
0.09 |
chr5_87254967_87255118 | 0.95 |
Ugt2b37 |
UDP glucuronosyltransferase 2 family, polypeptide B37 |
238 |
0.9 |
chr1_91822004_91822314 | 0.95 |
Gm29101 |
predicted gene 29101 |
356 |
0.87 |
chr4_149980056_149980645 | 0.95 |
H6pd |
hexose-6-phosphate dehydrogenase (glucose 1-dehydrogenase) |
20915 |
0.13 |
chr2_43521524_43521676 | 0.95 |
Gm13464 |
predicted gene 13464 |
2202 |
0.41 |
chr2_148037591_148038164 | 0.95 |
9030622O22Rik |
RIKEN cDNA 9030622O22 gene |
393 |
0.84 |
chr3_118644387_118644538 | 0.94 |
Dpyd |
dihydropyrimidine dehydrogenase |
82276 |
0.09 |
chr9_96478340_96478816 | 0.94 |
Rnf7 |
ring finger protein 7 |
10 |
0.97 |
chr2_31492850_31493284 | 0.94 |
Ass1 |
argininosuccinate synthetase 1 |
4705 |
0.21 |
chr17_34859202_34859695 | 0.94 |
Cfb |
complement factor B |
138 |
0.83 |
chr8_35383605_35384049 | 0.94 |
Ppp1r3b |
protein phosphatase 1, regulatory subunit 3B |
7167 |
0.17 |
chr4_155139268_155139419 | 0.94 |
Morn1 |
MORN repeat containing 1 |
28653 |
0.13 |
chr2_71498544_71498972 | 0.94 |
Gm23253 |
predicted gene, 23253 |
3487 |
0.17 |
chr4_63251381_63251799 | 0.94 |
Mir455 |
microRNA 455 |
5261 |
0.19 |
chr15_38078770_38079120 | 0.93 |
Ubr5 |
ubiquitin protein ligase E3 component n-recognin 5 |
91 |
0.59 |
chr11_32651653_32652019 | 0.93 |
Fbxw11 |
F-box and WD-40 domain protein 11 |
8932 |
0.23 |
chr17_49455547_49455883 | 0.93 |
Mocs1 |
molybdenum cofactor synthesis 1 |
3431 |
0.28 |
chr9_48724021_48724519 | 0.93 |
Zbtb16 |
zinc finger and BTB domain containing 16 |
111675 |
0.06 |
chr8_35409885_35410137 | 0.93 |
Gm45301 |
predicted gene 45301 |
505 |
0.77 |
chr7_89699637_89700074 | 0.92 |
Me3 |
malic enzyme 3, NADP(+)-dependent, mitochondrial |
36876 |
0.14 |
chr4_49441730_49441881 | 0.92 |
Acnat1 |
acyl-coenzyme A amino acid N-acyltransferase 1 |
9329 |
0.13 |
chr6_149144534_149144685 | 0.92 |
Etfbkmt |
electron transfer flavoprotein beta subunit lysine methyltransferase |
2963 |
0.18 |
chr1_183954188_183954558 | 0.92 |
Gm38108 |
predicted gene, 38108 |
25968 |
0.18 |
chr19_56397146_56397942 | 0.92 |
Casp7 |
caspase 7 |
266 |
0.91 |
chr9_44079482_44079643 | 0.91 |
Usp2 |
ubiquitin specific peptidase 2 |
5377 |
0.08 |
chr9_35267693_35268345 | 0.91 |
Rpusd4 |
RNA pseudouridylate synthase domain containing 4 |
154 |
0.57 |
chr8_3243125_3243280 | 0.91 |
Gm16180 |
predicted gene 16180 |
16502 |
0.19 |
chr17_46723600_46724031 | 0.91 |
Gnmt |
glycine N-methyltransferase |
2887 |
0.12 |
chr16_37565703_37565880 | 0.91 |
Rabl3 |
RAB, member RAS oncogene family-like 3 |
2057 |
0.25 |
chr15_3453354_3453796 | 0.91 |
Ghr |
growth hormone receptor |
18069 |
0.26 |
chr14_21088324_21088564 | 0.91 |
Adk |
adenosine kinase |
12292 |
0.21 |
chr7_143754683_143755199 | 0.90 |
Osbpl5 |
oxysterol binding protein-like 5 |
2044 |
0.2 |
chr7_63922331_63923024 | 0.90 |
Klf13 |
Kruppel-like factor 13 |
2193 |
0.22 |
chr9_48597171_48597587 | 0.90 |
Nnmt |
nicotinamide N-methyltransferase |
4 |
0.98 |
chr1_143739744_143740319 | 0.90 |
Glrx2 |
glutaredoxin 2 (thioltransferase) |
344 |
0.84 |
chr3_98685872_98686023 | 0.90 |
Gm12400 |
predicted gene 12400 |
2235 |
0.22 |
chr5_28051550_28052027 | 0.89 |
Gm26608 |
predicted gene, 26608 |
3671 |
0.2 |
chr1_74230928_74231199 | 0.89 |
Arpc2 |
actin related protein 2/3 complex, subunit 2 |
5021 |
0.11 |
chr16_94497569_94497720 | 0.89 |
Vps26c |
VPS26 endosomal protein sorting factor C |
6743 |
0.17 |
chr13_82200174_82200343 | 0.89 |
Gm48155 |
predicted gene, 48155 |
110501 |
0.07 |
chr5_36168931_36169096 | 0.89 |
Psapl1 |
prosaposin-like 1 |
35008 |
0.19 |
chr2_11448560_11448737 | 0.89 |
Gm13296 |
predicted gene 13296 |
28424 |
0.1 |
chr1_183369795_183369978 | 0.89 |
Mia3 |
melanoma inhibitory activity 3 |
333 |
0.77 |
chr17_24530793_24530944 | 0.89 |
Rab26 |
RAB26, member RAS oncogene family |
922 |
0.27 |
chr1_74740944_74741133 | 0.89 |
Cyp27a1 |
cytochrome P450, family 27, subfamily a, polypeptide 1 |
4229 |
0.14 |
chr14_8251423_8251762 | 0.89 |
Acox2 |
acyl-Coenzyme A oxidase 2, branched chain |
1930 |
0.34 |
chr3_145924039_145924997 | 0.89 |
Bcl10 |
B cell leukemia/lymphoma 10 |
161 |
0.95 |
chr17_24208221_24208612 | 0.88 |
Ntn3 |
netrin 3 |
4 |
0.86 |
chr6_72350688_72350839 | 0.88 |
Gm45051 |
predicted gene 45051 |
2305 |
0.14 |
chr3_144110073_144110233 | 0.88 |
Gm34078 |
predicted gene, 34078 |
25601 |
0.2 |
chr17_79938878_79939037 | 0.88 |
Gm6552 |
predicted gene 6552 |
4385 |
0.2 |
chr19_44399005_44399361 | 0.88 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
7507 |
0.15 |
chr9_42218132_42218473 | 0.88 |
4930546K05Rik |
RIKEN cDNA 4930546K05 gene |
9071 |
0.19 |
chr18_62068919_62069331 | 0.88 |
Gm41750 |
predicted gene, 41750 |
73493 |
0.09 |
chr9_44078514_44078710 | 0.88 |
Usp2 |
ubiquitin specific peptidase 2 |
6327 |
0.07 |
chr11_80974045_80974315 | 0.87 |
Gm11416 |
predicted gene 11416 |
72614 |
0.1 |
chr14_117945014_117945189 | 0.87 |
Mir6239 |
microRNA 6239 |
8746 |
0.26 |
chr9_61267402_61267578 | 0.87 |
B930092H01Rik |
RIKEN cDNA B930092H01 gene |
26319 |
0.18 |
chr3_129451172_129451350 | 0.87 |
Rpl7a-ps7 |
ribosomal protein L7A, pseudogene 7 |
10711 |
0.17 |
chr17_34856106_34856307 | 0.87 |
Mir6972 |
microRNA 6972 |
1426 |
0.12 |
chr2_70838613_70839186 | 0.86 |
Tlk1 |
tousled-like kinase 1 |
13171 |
0.18 |
chr7_101300105_101300356 | 0.86 |
Atg16l2 |
autophagy related 16-like 2 (S. cerevisiae) |
1797 |
0.23 |
chr1_135820666_135821286 | 0.86 |
Lad1 |
ladinin |
2378 |
0.21 |
chr18_60603835_60603987 | 0.86 |
Synpo |
synaptopodin |
3414 |
0.2 |
chr11_102755530_102755686 | 0.86 |
Adam11 |
a disintegrin and metallopeptidase domain 11 |
5831 |
0.12 |
chr1_171260026_171260323 | 0.86 |
Adamts4 |
a disintegrin-like and metallopeptidase (reprolysin type) with thrombospondin type 1 motif, 4 |
8058 |
0.07 |
chr11_58107216_58107391 | 0.86 |
Cnot8 |
CCR4-NOT transcription complex, subunit 8 |
2937 |
0.15 |
chr15_36938534_36938914 | 0.86 |
Gm34590 |
predicted gene, 34590 |
140 |
0.95 |
chr12_102271886_102272090 | 0.85 |
Rin3 |
Ras and Rab interactor 3 |
11060 |
0.21 |
chr12_70230387_70230635 | 0.85 |
Pygl |
liver glycogen phosphorylase |
977 |
0.45 |
chr7_98382870_98383037 | 0.84 |
Tsku |
tsukushi, small leucine rich proteoglycan |
21625 |
0.13 |
chr2_3749127_3749600 | 0.84 |
Gm13185 |
predicted gene 13185 |
5814 |
0.2 |
chr16_26624427_26624775 | 0.84 |
Il1rap |
interleukin 1 receptor accessory protein |
445 |
0.89 |
chr10_77586447_77586922 | 0.84 |
Pttg1ip |
pituitary tumor-transforming 1 interacting protein |
2710 |
0.15 |
chr17_28277643_28277985 | 0.84 |
Ppard |
peroxisome proliferator activator receptor delta |
5695 |
0.12 |
chr11_60199988_60200509 | 0.84 |
Mir6921 |
microRNA 6921 |
369 |
0.65 |
chr17_56099094_56099269 | 0.84 |
Hdgfl2 |
HDGF like 2 |
200 |
0.87 |
chr1_191381968_191382314 | 0.84 |
Ppp2r5a |
protein phosphatase 2, regulatory subunit B', alpha |
3185 |
0.21 |
chr2_134491717_134491883 | 0.84 |
Hao1 |
hydroxyacid oxidase 1, liver |
62507 |
0.15 |
chr8_85519627_85519778 | 0.83 |
Gpt2 |
glutamic pyruvate transaminase (alanine aminotransferase) 2 |
293 |
0.89 |
chr14_25742718_25742880 | 0.83 |
Zcchc24 |
zinc finger, CCHC domain containing 24 |
23007 |
0.12 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.8 | 5.4 | GO:0010046 | response to mycotoxin(GO:0010046) |
0.7 | 2.2 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
0.6 | 2.5 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
0.5 | 2.2 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
0.5 | 3.1 | GO:0071265 | amino acid salvage(GO:0043102) L-methionine biosynthetic process(GO:0071265) L-methionine salvage(GO:0071267) |
0.5 | 2.0 | GO:1903964 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.5 | 1.4 | GO:0042851 | L-alanine metabolic process(GO:0042851) |
0.4 | 1.8 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
0.4 | 0.9 | GO:0051594 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
0.4 | 1.3 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
0.4 | 2.6 | GO:0006642 | triglyceride mobilization(GO:0006642) |
0.4 | 1.7 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
0.4 | 0.9 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
0.4 | 1.3 | GO:0060620 | regulation of cholesterol import(GO:0060620) regulation of sterol import(GO:2000909) |
0.4 | 2.1 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
0.4 | 1.2 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
0.4 | 1.6 | GO:0072338 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
0.4 | 1.2 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
0.4 | 1.2 | GO:0000432 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) |
0.4 | 0.8 | GO:0019448 | cysteine catabolic process(GO:0009093) L-cysteine catabolic process(GO:0019448) L-cysteine metabolic process(GO:0046439) |
0.4 | 2.0 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
0.4 | 0.4 | GO:0006114 | glycerol biosynthetic process(GO:0006114) alditol biosynthetic process(GO:0019401) |
0.4 | 1.9 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
0.4 | 1.9 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
0.4 | 1.9 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
0.4 | 0.4 | GO:0007100 | mitotic centrosome separation(GO:0007100) regulation of mitotic centrosome separation(GO:0046602) centrosome separation(GO:0051299) |
0.4 | 1.5 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
0.4 | 1.4 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
0.3 | 1.0 | GO:0034727 | lysosomal microautophagy(GO:0016237) piecemeal microautophagy of nucleus(GO:0034727) late nucleophagy(GO:0044805) |
0.3 | 2.0 | GO:0006477 | protein sulfation(GO:0006477) |
0.3 | 1.0 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.3 | 4.0 | GO:0031498 | chromatin disassembly(GO:0031498) |
0.3 | 2.2 | GO:0035999 | tetrahydrofolate interconversion(GO:0035999) |
0.3 | 0.6 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
0.3 | 1.2 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.3 | 0.9 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
0.3 | 1.2 | GO:0044791 | modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) |
0.3 | 1.5 | GO:0051138 | regulation of NK T cell differentiation(GO:0051136) positive regulation of NK T cell differentiation(GO:0051138) |
0.3 | 0.9 | GO:0030397 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
0.3 | 0.3 | GO:0043201 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
0.3 | 1.2 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
0.3 | 2.0 | GO:0090209 | negative regulation of triglyceride metabolic process(GO:0090209) |
0.3 | 0.9 | GO:2001274 | negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
0.3 | 0.6 | GO:1902988 | neurofibrillary tangle assembly(GO:1902988) regulation of neurofibrillary tangle assembly(GO:1902996) |
0.3 | 1.1 | GO:2000622 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
0.3 | 0.8 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
0.3 | 0.8 | GO:0035511 | oxidative DNA demethylation(GO:0035511) |
0.3 | 0.8 | GO:0019346 | homoserine metabolic process(GO:0009092) transsulfuration(GO:0019346) |
0.3 | 0.8 | GO:0046271 | phenylpropanoid catabolic process(GO:0046271) |
0.3 | 0.8 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
0.3 | 1.1 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
0.3 | 1.0 | GO:0003383 | apical constriction(GO:0003383) |
0.3 | 0.5 | GO:0061738 | late endosomal microautophagy(GO:0061738) |
0.3 | 0.8 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
0.3 | 0.5 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
0.2 | 1.0 | GO:0070447 | positive regulation of oligodendrocyte progenitor proliferation(GO:0070447) |
0.2 | 1.2 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
0.2 | 0.7 | GO:0006015 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
0.2 | 1.2 | GO:2000074 | regulation of type B pancreatic cell development(GO:2000074) |
0.2 | 0.2 | GO:0009174 | UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
0.2 | 0.7 | GO:1900045 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
0.2 | 1.0 | GO:0002278 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil degranulation(GO:0043308) |
0.2 | 1.2 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
0.2 | 1.2 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
0.2 | 0.9 | GO:0071455 | cellular response to increased oxygen levels(GO:0036295) cellular response to hyperoxia(GO:0071455) |
0.2 | 0.9 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
0.2 | 1.4 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
0.2 | 1.4 | GO:0015871 | choline transport(GO:0015871) |
0.2 | 0.7 | GO:1901339 | regulation of store-operated calcium channel activity(GO:1901339) |
0.2 | 1.3 | GO:0097011 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) |
0.2 | 0.4 | GO:2000618 | regulation of histone H4-K16 acetylation(GO:2000618) |
0.2 | 0.6 | GO:0045897 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
0.2 | 0.6 | GO:0031999 | negative regulation of fatty acid beta-oxidation(GO:0031999) |
0.2 | 0.6 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
0.2 | 2.1 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
0.2 | 0.6 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
0.2 | 0.6 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.2 | 0.6 | GO:0030070 | insulin processing(GO:0030070) |
0.2 | 0.4 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
0.2 | 0.2 | GO:0035973 | aggrephagy(GO:0035973) |
0.2 | 0.8 | GO:1900084 | regulation of peptidyl-tyrosine autophosphorylation(GO:1900084) positive regulation of peptidyl-tyrosine autophosphorylation(GO:1900086) |
0.2 | 0.8 | GO:0018214 | protein carboxylation(GO:0018214) |
0.2 | 0.6 | GO:1903347 | negative regulation of bicellular tight junction assembly(GO:1903347) |
0.2 | 0.6 | GO:0090289 | regulation of osteoclast proliferation(GO:0090289) |
0.2 | 0.6 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
0.2 | 0.4 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
0.2 | 1.0 | GO:0032237 | activation of store-operated calcium channel activity(GO:0032237) |
0.2 | 0.8 | GO:0018243 | protein O-linked glycosylation via threonine(GO:0018243) |
0.2 | 1.8 | GO:0034375 | high-density lipoprotein particle remodeling(GO:0034375) |
0.2 | 0.8 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
0.2 | 0.6 | GO:2000645 | negative regulation of receptor catabolic process(GO:2000645) |
0.2 | 0.8 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
0.2 | 0.4 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
0.2 | 0.8 | GO:0007412 | axon target recognition(GO:0007412) |
0.2 | 1.2 | GO:0035336 | long-chain fatty-acyl-CoA metabolic process(GO:0035336) |
0.2 | 0.8 | GO:0071033 | nuclear retention of pre-mRNA at the site of transcription(GO:0071033) |
0.2 | 0.8 | GO:0002906 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
0.2 | 0.6 | GO:0007529 | establishment of synaptic specificity at neuromuscular junction(GO:0007529) |
0.2 | 0.2 | GO:0032489 | regulation of Cdc42 protein signal transduction(GO:0032489) |
0.2 | 0.8 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
0.2 | 1.3 | GO:0071501 | response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
0.2 | 1.1 | GO:0010624 | regulation of Schwann cell proliferation(GO:0010624) |
0.2 | 0.4 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
0.2 | 0.7 | GO:0070366 | regulation of hepatocyte differentiation(GO:0070366) |
0.2 | 1.8 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
0.2 | 0.9 | GO:0071476 | cellular hypotonic response(GO:0071476) |
0.2 | 0.4 | GO:1901535 | regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
0.2 | 0.2 | GO:0070672 | response to interleukin-15(GO:0070672) |
0.2 | 0.4 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
0.2 | 0.5 | GO:0035672 | oligopeptide transmembrane transport(GO:0035672) |
0.2 | 0.5 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
0.2 | 0.9 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
0.2 | 0.5 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
0.2 | 0.5 | GO:0071883 | activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) |
0.2 | 0.9 | GO:1903887 | motile primary cilium assembly(GO:1903887) |
0.2 | 0.4 | GO:0002339 | B cell selection(GO:0002339) |
0.2 | 1.1 | GO:0046069 | cGMP catabolic process(GO:0046069) |
0.2 | 0.9 | GO:1902023 | L-arginine import(GO:0043091) arginine import(GO:0090467) L-arginine transport(GO:1902023) |
0.2 | 0.2 | GO:0036258 | multivesicular body assembly(GO:0036258) |
0.2 | 1.2 | GO:0036315 | cellular response to sterol(GO:0036315) |
0.2 | 0.5 | GO:0044034 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
0.2 | 0.3 | GO:1904467 | regulation of tumor necrosis factor secretion(GO:1904467) tumor necrosis factor secretion(GO:1990774) |
0.2 | 1.5 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
0.2 | 0.3 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
0.2 | 0.5 | GO:2001168 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
0.2 | 0.7 | GO:0006787 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) |
0.2 | 1.4 | GO:0018095 | protein polyglutamylation(GO:0018095) |
0.2 | 0.5 | GO:0021898 | commitment of multipotent stem cells to neuronal lineage in forebrain(GO:0021898) |
0.2 | 0.5 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
0.2 | 0.7 | GO:0046618 | drug export(GO:0046618) |
0.2 | 0.2 | GO:1901668 | regulation of superoxide dismutase activity(GO:1901668) |
0.2 | 0.2 | GO:0019530 | taurine metabolic process(GO:0019530) |
0.2 | 0.7 | GO:1905214 | regulation of mRNA binding(GO:1902415) regulation of RNA binding(GO:1905214) |
0.2 | 0.5 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
0.2 | 0.5 | GO:0042660 | positive regulation of cell fate specification(GO:0042660) |
0.2 | 1.0 | GO:0030647 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.2 | 0.5 | GO:2000384 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
0.2 | 0.7 | GO:0034310 | primary alcohol catabolic process(GO:0034310) |
0.2 | 0.8 | GO:0009202 | deoxyribonucleoside triphosphate biosynthetic process(GO:0009202) |
0.2 | 0.2 | GO:0051665 | membrane raft localization(GO:0051665) |
0.2 | 0.5 | GO:0006393 | termination of mitochondrial transcription(GO:0006393) |
0.2 | 0.3 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) |
0.2 | 0.5 | GO:0008050 | female courtship behavior(GO:0008050) |
0.2 | 0.6 | GO:2000370 | positive regulation of clathrin-mediated endocytosis(GO:2000370) |
0.2 | 0.6 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.2 | 0.8 | GO:0032484 | Ral protein signal transduction(GO:0032484) |
0.2 | 0.3 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
0.2 | 0.5 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
0.2 | 0.5 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.2 | 0.9 | GO:0002072 | optic cup morphogenesis involved in camera-type eye development(GO:0002072) |
0.2 | 0.5 | GO:1904016 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
0.2 | 0.5 | GO:0090230 | regulation of centromere complex assembly(GO:0090230) |
0.2 | 0.3 | GO:2001027 | negative regulation of endothelial cell chemotaxis(GO:2001027) |
0.2 | 0.8 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
0.2 | 0.5 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
0.2 | 0.3 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.2 | 0.8 | GO:0045542 | positive regulation of cholesterol biosynthetic process(GO:0045542) positive regulation of cholesterol metabolic process(GO:0090205) |
0.2 | 1.1 | GO:0090308 | regulation of methylation-dependent chromatin silencing(GO:0090308) |
0.2 | 1.5 | GO:0042659 | regulation of cell fate specification(GO:0042659) |
0.2 | 1.1 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
0.2 | 0.3 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
0.2 | 0.5 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
0.2 | 0.5 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.2 | 0.9 | GO:0032960 | regulation of inositol trisphosphate biosynthetic process(GO:0032960) |
0.2 | 1.1 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
0.2 | 0.5 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
0.2 | 0.5 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
0.1 | 0.6 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
0.1 | 0.1 | GO:0045726 | positive regulation of integrin biosynthetic process(GO:0045726) |
0.1 | 0.4 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
0.1 | 0.4 | GO:0007525 | somatic muscle development(GO:0007525) |
0.1 | 0.3 | GO:1902262 | apoptotic process involved in patterning of blood vessels(GO:1902262) |
0.1 | 1.8 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
0.1 | 1.0 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
0.1 | 1.2 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
0.1 | 0.4 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
0.1 | 0.7 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
0.1 | 0.6 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
0.1 | 0.1 | GO:0006714 | sesquiterpenoid metabolic process(GO:0006714) |
0.1 | 0.4 | GO:0061010 | gall bladder development(GO:0061010) |
0.1 | 0.1 | GO:2000809 | positive regulation of synaptic vesicle clustering(GO:2000809) |
0.1 | 0.3 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
0.1 | 0.6 | GO:0060355 | positive regulation of cell adhesion molecule production(GO:0060355) |
0.1 | 0.4 | GO:0021943 | formation of radial glial scaffolds(GO:0021943) |
0.1 | 0.4 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
0.1 | 0.4 | GO:0072592 | oxygen metabolic process(GO:0072592) |
0.1 | 0.7 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.1 | 0.3 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
0.1 | 1.3 | GO:0061154 | endothelial tube morphogenesis(GO:0061154) |
0.1 | 0.7 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
0.1 | 0.6 | GO:0031585 | regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031585) |
0.1 | 0.4 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
0.1 | 0.9 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
0.1 | 0.6 | GO:0033762 | response to glucagon(GO:0033762) |
0.1 | 0.4 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
0.1 | 0.3 | GO:0046104 | thymidine metabolic process(GO:0046104) |
0.1 | 0.4 | GO:1904468 | negative regulation of tumor necrosis factor secretion(GO:1904468) |
0.1 | 0.1 | GO:0033153 | somatic diversification of T cell receptor genes(GO:0002568) somatic recombination of T cell receptor gene segments(GO:0002681) T cell receptor V(D)J recombination(GO:0033153) |
0.1 | 0.4 | GO:0042427 | serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
0.1 | 0.4 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
0.1 | 0.4 | GO:0031627 | telomeric loop formation(GO:0031627) |
0.1 | 0.8 | GO:0015074 | DNA integration(GO:0015074) |
0.1 | 0.4 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.1 | 0.3 | GO:0046066 | purine deoxyribonucleoside diphosphate metabolic process(GO:0009182) dGDP metabolic process(GO:0046066) |
0.1 | 0.5 | GO:0061724 | lipophagy(GO:0061724) |
0.1 | 1.0 | GO:0070874 | negative regulation of glycogen metabolic process(GO:0070874) |
0.1 | 0.3 | GO:0060789 | hair follicle placode formation(GO:0060789) |
0.1 | 0.7 | GO:0015867 | ATP transport(GO:0015867) |
0.1 | 0.8 | GO:1903069 | regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903069) |
0.1 | 0.3 | GO:1902683 | regulation of protein localization to synapse(GO:1902473) regulation of receptor localization to synapse(GO:1902683) |
0.1 | 0.5 | GO:0008228 | opsonization(GO:0008228) |
0.1 | 0.4 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
0.1 | 0.4 | GO:0035262 | gonad morphogenesis(GO:0035262) |
0.1 | 0.3 | GO:0021773 | striatal medium spiny neuron differentiation(GO:0021773) |
0.1 | 0.3 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
0.1 | 0.3 | GO:2000646 | positive regulation of receptor catabolic process(GO:2000646) |
0.1 | 1.1 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
0.1 | 0.5 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
0.1 | 0.3 | GO:0061511 | centriole elongation(GO:0061511) |
0.1 | 0.8 | GO:0032532 | regulation of microvillus length(GO:0032532) |
0.1 | 0.4 | GO:0032512 | regulation of protein phosphatase type 2B activity(GO:0032512) |
0.1 | 0.4 | GO:0015691 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
0.1 | 0.5 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
0.1 | 0.1 | GO:1904956 | regulation of midbrain dopaminergic neuron differentiation(GO:1904956) |
0.1 | 0.5 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
0.1 | 0.8 | GO:0010875 | positive regulation of cholesterol efflux(GO:0010875) |
0.1 | 0.4 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.1 | 0.1 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
0.1 | 0.4 | GO:0060264 | regulation of respiratory burst involved in inflammatory response(GO:0060264) |
0.1 | 0.3 | GO:0045714 | regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045714) |
0.1 | 1.2 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
0.1 | 0.4 | GO:0035356 | cellular triglyceride homeostasis(GO:0035356) |
0.1 | 0.3 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.1 | 0.4 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
0.1 | 0.6 | GO:0090166 | Golgi disassembly(GO:0090166) |
0.1 | 0.3 | GO:1903772 | regulation of viral budding via host ESCRT complex(GO:1903772) |
0.1 | 0.4 | GO:2000535 | entry of bacterium into host cell(GO:0035635) regulation of entry of bacterium into host cell(GO:2000535) |
0.1 | 0.5 | GO:1904526 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
0.1 | 0.1 | GO:0090086 | negative regulation of protein deubiquitination(GO:0090086) |
0.1 | 0.4 | GO:0018992 | germ-line sex determination(GO:0018992) |
0.1 | 0.4 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
0.1 | 1.0 | GO:1901160 | primary amino compound metabolic process(GO:1901160) |
0.1 | 0.6 | GO:0097120 | receptor localization to synapse(GO:0097120) |
0.1 | 0.8 | GO:2000288 | positive regulation of myoblast proliferation(GO:2000288) |
0.1 | 0.1 | GO:0048007 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
0.1 | 0.3 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
0.1 | 0.3 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
0.1 | 0.6 | GO:0002091 | negative regulation of receptor internalization(GO:0002091) |
0.1 | 0.5 | GO:0055091 | phospholipid homeostasis(GO:0055091) |
0.1 | 2.3 | GO:0070897 | DNA-templated transcriptional preinitiation complex assembly(GO:0070897) |
0.1 | 0.6 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
0.1 | 1.0 | GO:0006670 | sphingosine metabolic process(GO:0006670) |
0.1 | 0.4 | GO:0061072 | iris morphogenesis(GO:0061072) |
0.1 | 0.2 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
0.1 | 0.5 | GO:1901300 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
0.1 | 0.4 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
0.1 | 0.1 | GO:0090069 | regulation of ribosome biogenesis(GO:0090069) |
0.1 | 0.2 | GO:0032741 | positive regulation of interleukin-18 production(GO:0032741) |
0.1 | 0.1 | GO:0032079 | positive regulation of endodeoxyribonuclease activity(GO:0032079) |
0.1 | 0.1 | GO:0018197 | peptidyl-aspartic acid modification(GO:0018197) |
0.1 | 0.2 | GO:0042921 | glucocorticoid receptor signaling pathway(GO:0042921) |
0.1 | 0.1 | GO:0032696 | negative regulation of interleukin-13 production(GO:0032696) |
0.1 | 0.6 | GO:0090315 | negative regulation of protein targeting to membrane(GO:0090315) |
0.1 | 0.4 | GO:0034184 | positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
0.1 | 0.7 | GO:0045656 | negative regulation of monocyte differentiation(GO:0045656) |
0.1 | 0.4 | GO:0043382 | positive regulation of memory T cell differentiation(GO:0043382) |
0.1 | 0.6 | GO:0006678 | glucosylceramide metabolic process(GO:0006678) |
0.1 | 0.4 | GO:0035928 | rRNA import into mitochondrion(GO:0035928) |
0.1 | 0.5 | GO:0019243 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
0.1 | 1.8 | GO:0050435 | beta-amyloid metabolic process(GO:0050435) |
0.1 | 0.1 | GO:0045080 | positive regulation of chemokine biosynthetic process(GO:0045080) |
0.1 | 0.6 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.1 | 0.2 | GO:1901857 | positive regulation of cellular respiration(GO:1901857) |
0.1 | 1.0 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
0.1 | 1.2 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
0.1 | 0.2 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
0.1 | 0.6 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.1 | 2.7 | GO:0071542 | dopaminergic neuron differentiation(GO:0071542) |
0.1 | 0.5 | GO:1900736 | regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900736) |
0.1 | 0.2 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
0.1 | 1.0 | GO:0035095 | behavioral response to nicotine(GO:0035095) |
0.1 | 0.5 | GO:0035791 | platelet-derived growth factor receptor-beta signaling pathway(GO:0035791) |
0.1 | 0.1 | GO:0070814 | hydrogen sulfide biosynthetic process(GO:0070814) |
0.1 | 0.1 | GO:0001661 | conditioned taste aversion(GO:0001661) |
0.1 | 0.3 | GO:0072310 | glomerular visceral epithelial cell development(GO:0072015) glomerular epithelial cell development(GO:0072310) |
0.1 | 0.2 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
0.1 | 0.2 | GO:0090158 | endoplasmic reticulum membrane organization(GO:0090158) |
0.1 | 0.6 | GO:0009650 | UV protection(GO:0009650) |
0.1 | 0.5 | GO:1900364 | negative regulation of mRNA polyadenylation(GO:1900364) |
0.1 | 0.1 | GO:0070813 | hydrogen sulfide metabolic process(GO:0070813) |
0.1 | 0.2 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
0.1 | 1.1 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.1 | 0.6 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
0.1 | 0.3 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.1 | 0.5 | GO:0072675 | osteoclast fusion(GO:0072675) |
0.1 | 0.3 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
0.1 | 0.7 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
0.1 | 0.3 | GO:0048619 | embryonic hindgut morphogenesis(GO:0048619) |
0.1 | 0.4 | GO:0042518 | negative regulation of tyrosine phosphorylation of Stat3 protein(GO:0042518) |
0.1 | 0.3 | GO:0015747 | urate transport(GO:0015747) |
0.1 | 2.1 | GO:0071353 | cellular response to interleukin-4(GO:0071353) |
0.1 | 0.6 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
0.1 | 0.1 | GO:0034311 | diol metabolic process(GO:0034311) |
0.1 | 0.7 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
0.1 | 0.2 | GO:0051029 | rRNA export from nucleus(GO:0006407) rRNA transport(GO:0051029) |
0.1 | 0.2 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
0.1 | 0.5 | GO:1904424 | regulation of GTP binding(GO:1904424) |
0.1 | 0.3 | GO:0000087 | mitotic M phase(GO:0000087) |
0.1 | 0.5 | GO:1990592 | protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
0.1 | 0.3 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
0.1 | 0.9 | GO:0045722 | positive regulation of gluconeogenesis(GO:0045722) |
0.1 | 0.4 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.1 | 0.4 | GO:0043097 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
0.1 | 0.1 | GO:0032077 | positive regulation of deoxyribonuclease activity(GO:0032077) |
0.1 | 0.1 | GO:0000960 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
0.1 | 0.3 | GO:0015770 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.1 | 0.4 | GO:0061622 | glycolytic process through glucose-1-phosphate(GO:0061622) |
0.1 | 0.6 | GO:0030913 | paranodal junction assembly(GO:0030913) |
0.1 | 0.5 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
0.1 | 0.4 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
0.1 | 0.2 | GO:1903423 | positive regulation of synaptic vesicle recycling(GO:1903423) |
0.1 | 0.9 | GO:0030432 | peristalsis(GO:0030432) |
0.1 | 0.1 | GO:0032763 | regulation of mast cell cytokine production(GO:0032763) |
0.1 | 0.2 | GO:0003195 | tricuspid valve morphogenesis(GO:0003186) tricuspid valve formation(GO:0003195) |
0.1 | 0.5 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.1 | 1.0 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.1 | 0.3 | GO:0033026 | negative regulation of mast cell apoptotic process(GO:0033026) |
0.1 | 0.4 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
0.1 | 0.2 | GO:0009072 | aromatic amino acid family metabolic process(GO:0009072) |
0.1 | 0.2 | GO:1901524 | regulation of macromitophagy(GO:1901524) negative regulation of macromitophagy(GO:1901525) |
0.1 | 0.4 | GO:0002924 | negative regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002924) |
0.1 | 0.3 | GO:0035627 | ceramide transport(GO:0035627) |
0.1 | 0.3 | GO:1901679 | pyrimidine-containing compound transmembrane transport(GO:0072531) nucleotide transmembrane transport(GO:1901679) |
0.1 | 0.3 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
0.1 | 0.2 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
0.1 | 0.4 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
0.1 | 0.3 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
0.1 | 0.1 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
0.1 | 0.8 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.1 | 0.4 | GO:0055089 | fatty acid homeostasis(GO:0055089) |
0.1 | 0.4 | GO:0045341 | MHC class I biosynthetic process(GO:0045341) regulation of MHC class I biosynthetic process(GO:0045343) positive regulation of MHC class I biosynthetic process(GO:0045345) |
0.1 | 0.9 | GO:0008343 | adult feeding behavior(GO:0008343) |
0.1 | 0.5 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
0.1 | 0.5 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
0.1 | 0.2 | GO:0072205 | metanephric collecting duct development(GO:0072205) |
0.1 | 0.8 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.1 | 0.6 | GO:0046831 | regulation of RNA export from nucleus(GO:0046831) |
0.1 | 0.2 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
0.1 | 0.3 | GO:0015744 | succinate transport(GO:0015744) |
0.1 | 0.4 | GO:0061641 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
0.1 | 0.5 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
0.1 | 0.7 | GO:0006265 | DNA topological change(GO:0006265) |
0.1 | 1.9 | GO:0006730 | one-carbon metabolic process(GO:0006730) |
0.1 | 0.3 | GO:2000196 | positive regulation of female gonad development(GO:2000196) |
0.1 | 0.5 | GO:0060287 | epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
0.1 | 0.5 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
0.1 | 0.5 | GO:0045217 | cell-cell junction maintenance(GO:0045217) |
0.1 | 0.4 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
0.1 | 0.3 | GO:0002386 | immune response in mucosal-associated lymphoid tissue(GO:0002386) |
0.1 | 0.4 | GO:0010760 | negative regulation of macrophage chemotaxis(GO:0010760) |
0.1 | 0.3 | GO:0006768 | biotin metabolic process(GO:0006768) |
0.1 | 0.2 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
0.1 | 0.8 | GO:0000059 | protein import into nucleus, docking(GO:0000059) |
0.1 | 0.4 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) |
0.1 | 0.2 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
0.1 | 0.1 | GO:2000870 | regulation of progesterone secretion(GO:2000870) |
0.1 | 0.6 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) |
0.1 | 0.8 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) |
0.1 | 0.3 | GO:0006290 | pyrimidine dimer repair(GO:0006290) |
0.1 | 0.2 | GO:0061643 | chemorepulsion of axon(GO:0061643) |
0.1 | 0.5 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
0.1 | 0.2 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
0.1 | 0.3 | GO:1903332 | regulation of protein folding(GO:1903332) |
0.1 | 0.1 | GO:2001245 | regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
0.1 | 0.8 | GO:0042415 | norepinephrine metabolic process(GO:0042415) |
0.1 | 0.1 | GO:0090181 | regulation of cholesterol metabolic process(GO:0090181) |
0.1 | 0.5 | GO:0051639 | actin filament network formation(GO:0051639) |
0.1 | 0.6 | GO:0019368 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
0.1 | 0.3 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.1 | 0.8 | GO:0010225 | response to UV-C(GO:0010225) |
0.1 | 0.3 | GO:0032819 | positive regulation of natural killer cell proliferation(GO:0032819) |
0.1 | 0.4 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
0.1 | 0.3 | GO:1903912 | negative regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:1903912) |
0.1 | 0.7 | GO:0009435 | NAD biosynthetic process(GO:0009435) |
0.1 | 0.7 | GO:0042048 | olfactory behavior(GO:0042048) |
0.1 | 0.3 | GO:0050748 | negative regulation of lipoprotein metabolic process(GO:0050748) |
0.1 | 0.9 | GO:0035418 | protein localization to synapse(GO:0035418) |
0.1 | 0.7 | GO:2000310 | regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
0.1 | 0.1 | GO:0015746 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.1 | 0.2 | GO:0019086 | late viral transcription(GO:0019086) |
0.1 | 0.2 | GO:0086023 | adrenergic receptor signaling pathway involved in heart process(GO:0086023) |
0.1 | 0.3 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
0.1 | 0.2 | GO:0055009 | atrial cardiac muscle tissue development(GO:0003228) atrial cardiac muscle tissue morphogenesis(GO:0055009) |
0.1 | 0.1 | GO:0032376 | positive regulation of sterol transport(GO:0032373) positive regulation of cholesterol transport(GO:0032376) |
0.1 | 0.4 | GO:0086013 | membrane repolarization during cardiac muscle cell action potential(GO:0086013) |
0.1 | 0.2 | GO:1903011 | negative regulation of bone development(GO:1903011) |
0.1 | 0.3 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
0.1 | 0.1 | GO:0046607 | positive regulation of centrosome cycle(GO:0046607) |
0.1 | 0.1 | GO:0042773 | ATP synthesis coupled electron transport(GO:0042773) |
0.1 | 0.2 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
0.1 | 0.2 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
0.1 | 0.6 | GO:0000963 | mitochondrial RNA processing(GO:0000963) |
0.1 | 0.2 | GO:2000409 | positive regulation of T cell extravasation(GO:2000409) |
0.1 | 0.4 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.1 | 0.2 | GO:0007228 | positive regulation of hh target transcription factor activity(GO:0007228) |
0.1 | 0.8 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.1 | 0.4 | GO:0039702 | viral budding via host ESCRT complex(GO:0039702) |
0.1 | 0.3 | GO:1903797 | positive regulation of inorganic anion transmembrane transport(GO:1903797) |
0.1 | 0.3 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
0.1 | 0.1 | GO:0006067 | ethanol metabolic process(GO:0006067) ethanol oxidation(GO:0006069) |
0.1 | 0.1 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
0.1 | 0.2 | GO:0018343 | protein farnesylation(GO:0018343) |
0.1 | 0.1 | GO:0090206 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
0.1 | 0.4 | GO:1902165 | regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902165) negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902166) |
0.1 | 0.2 | GO:0072553 | terminal button organization(GO:0072553) |
0.1 | 0.5 | GO:0015884 | folic acid transport(GO:0015884) |
0.1 | 0.2 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
0.1 | 0.1 | GO:0002904 | positive regulation of B cell apoptotic process(GO:0002904) |
0.1 | 0.2 | GO:0045297 | mating plug formation(GO:0042628) single-organism reproductive behavior(GO:0044704) post-mating behavior(GO:0045297) |
0.1 | 1.6 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
0.1 | 1.5 | GO:0006783 | heme biosynthetic process(GO:0006783) |
0.1 | 0.1 | GO:0072191 | ureter smooth muscle development(GO:0072191) ureter smooth muscle cell differentiation(GO:0072193) |
0.1 | 0.1 | GO:0010519 | negative regulation of phospholipase activity(GO:0010519) |
0.1 | 0.2 | GO:0046836 | glycolipid transport(GO:0046836) |
0.1 | 0.2 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
0.1 | 0.2 | GO:0002309 | T cell proliferation involved in immune response(GO:0002309) |
0.1 | 0.1 | GO:1903147 | negative regulation of mitophagy(GO:1903147) |
0.1 | 0.2 | GO:0033578 | protein glycosylation in Golgi(GO:0033578) |
0.1 | 0.4 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
0.1 | 0.2 | GO:1902254 | negative regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902254) |
0.1 | 0.2 | GO:0042737 | drug catabolic process(GO:0042737) |
0.1 | 0.2 | GO:0090045 | positive regulation of deacetylase activity(GO:0090045) |
0.1 | 0.2 | GO:0019478 | D-amino acid catabolic process(GO:0019478) |
0.1 | 0.2 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
0.1 | 0.6 | GO:0006107 | oxaloacetate metabolic process(GO:0006107) |
0.1 | 0.2 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
0.1 | 0.4 | GO:0045906 | negative regulation of vasoconstriction(GO:0045906) |
0.1 | 0.2 | GO:0010446 | response to alkaline pH(GO:0010446) |
0.1 | 0.2 | GO:0042374 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
0.1 | 0.2 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
0.1 | 0.2 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
0.1 | 0.7 | GO:0022038 | corpus callosum development(GO:0022038) |
0.1 | 0.3 | GO:0043970 | histone H3-K9 acetylation(GO:0043970) |
0.1 | 0.1 | GO:0002634 | regulation of germinal center formation(GO:0002634) |
0.1 | 0.2 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
0.1 | 0.1 | GO:0003162 | atrioventricular node development(GO:0003162) |
0.1 | 0.5 | GO:0046116 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
0.1 | 0.2 | GO:0032201 | telomere maintenance via semi-conservative replication(GO:0032201) |
0.1 | 0.2 | GO:0032667 | interleukin-23 production(GO:0032627) regulation of interleukin-23 production(GO:0032667) |
0.1 | 0.2 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
0.1 | 0.4 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
0.1 | 0.2 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
0.1 | 0.8 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.1 | 0.5 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
0.1 | 0.2 | GO:0006534 | cysteine metabolic process(GO:0006534) |
0.1 | 0.2 | GO:0060066 | oviduct development(GO:0060066) |
0.1 | 0.2 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
0.1 | 0.3 | GO:0015722 | canalicular bile acid transport(GO:0015722) |
0.1 | 0.4 | GO:0051189 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
0.1 | 0.3 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
0.1 | 0.2 | GO:0048793 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) pronephros development(GO:0048793) |
0.1 | 0.2 | GO:1904970 | brush border assembly(GO:1904970) |
0.1 | 0.2 | GO:0032377 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
0.1 | 0.2 | GO:2001270 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
0.1 | 0.2 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
0.1 | 0.2 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
0.1 | 0.3 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
0.1 | 0.4 | GO:0045631 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
0.1 | 0.2 | GO:0006361 | transcription initiation from RNA polymerase I promoter(GO:0006361) |
0.1 | 0.2 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
0.1 | 0.4 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
0.1 | 1.4 | GO:0052696 | flavonoid biosynthetic process(GO:0009813) flavonoid glucuronidation(GO:0052696) |
0.1 | 0.1 | GO:0019585 | uronic acid metabolic process(GO:0006063) glucuronate metabolic process(GO:0019585) cellular glucuronidation(GO:0052695) |
0.1 | 0.1 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
0.1 | 0.1 | GO:0000097 | sulfur amino acid biosynthetic process(GO:0000097) |
0.1 | 0.4 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
0.1 | 0.1 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
0.1 | 0.1 | GO:0042126 | nitrate metabolic process(GO:0042126) |
0.1 | 0.1 | GO:0072319 | vesicle uncoating(GO:0072319) |
0.1 | 0.2 | GO:0002282 | microglial cell activation involved in immune response(GO:0002282) |
0.1 | 1.4 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
0.1 | 0.3 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
0.1 | 0.1 | GO:0033632 | regulation of cell-cell adhesion mediated by integrin(GO:0033632) |
0.1 | 0.9 | GO:0048490 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
0.1 | 0.4 | GO:0006707 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
0.1 | 0.1 | GO:0015780 | nucleotide-sugar transport(GO:0015780) pyrimidine nucleotide-sugar transport(GO:0015781) |
0.1 | 0.2 | GO:0060283 | negative regulation of oocyte development(GO:0060283) |
0.1 | 0.6 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
0.1 | 0.4 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
0.1 | 0.1 | GO:0045990 | carbon catabolite regulation of transcription(GO:0045990) |
0.1 | 0.3 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
0.1 | 0.2 | GO:0031296 | B cell costimulation(GO:0031296) |
0.1 | 0.3 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
0.1 | 0.3 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
0.1 | 0.3 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
0.1 | 0.3 | GO:0031642 | negative regulation of myelination(GO:0031642) |
0.1 | 0.6 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
0.1 | 0.3 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.1 | 0.8 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
0.1 | 0.5 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.1 | 0.3 | GO:0000012 | single strand break repair(GO:0000012) |
0.1 | 0.2 | GO:0072161 | mesenchymal cell differentiation involved in kidney development(GO:0072161) mesenchymal cell differentiation involved in renal system development(GO:2001012) |
0.1 | 0.3 | GO:0014072 | response to isoquinoline alkaloid(GO:0014072) response to morphine(GO:0043278) |
0.1 | 0.1 | GO:0097694 | establishment of RNA localization to telomere(GO:0097694) |
0.1 | 0.2 | GO:0032782 | bile acid secretion(GO:0032782) |
0.1 | 0.1 | GO:0051450 | myoblast proliferation(GO:0051450) |
0.1 | 0.3 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
0.1 | 0.1 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
0.1 | 0.3 | GO:0036089 | cleavage furrow formation(GO:0036089) |
0.1 | 0.3 | GO:0072488 | ammonium transmembrane transport(GO:0072488) |
0.1 | 1.1 | GO:0070884 | regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
0.1 | 0.1 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
0.1 | 0.2 | GO:0097167 | circadian regulation of translation(GO:0097167) |
0.1 | 0.4 | GO:0051382 | kinetochore assembly(GO:0051382) |
0.1 | 0.3 | GO:0090400 | stress-induced premature senescence(GO:0090400) |
0.1 | 0.1 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
0.1 | 0.1 | GO:0060336 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
0.1 | 0.1 | GO:1901970 | positive regulation of mitotic sister chromatid separation(GO:1901970) |
0.1 | 0.5 | GO:0007210 | serotonin receptor signaling pathway(GO:0007210) |
0.1 | 0.6 | GO:1990845 | diet induced thermogenesis(GO:0002024) adaptive thermogenesis(GO:1990845) |
0.1 | 0.3 | GO:0006561 | proline biosynthetic process(GO:0006561) |
0.1 | 0.3 | GO:0035641 | locomotory exploration behavior(GO:0035641) |
0.1 | 0.3 | GO:0032957 | inositol trisphosphate metabolic process(GO:0032957) |
0.1 | 0.2 | GO:0044154 | histone H3-K14 acetylation(GO:0044154) |
0.1 | 0.3 | GO:0046473 | phosphatidic acid metabolic process(GO:0046473) |
0.1 | 0.2 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
0.1 | 0.1 | GO:0048597 | post-embryonic camera-type eye morphogenesis(GO:0048597) |
0.1 | 0.2 | GO:0006570 | tyrosine metabolic process(GO:0006570) |
0.1 | 0.3 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
0.1 | 0.4 | GO:0097286 | iron ion import(GO:0097286) |
0.1 | 0.1 | GO:0070235 | regulation of activation-induced cell death of T cells(GO:0070235) |
0.1 | 0.2 | GO:1901896 | positive regulation of calcium-transporting ATPase activity(GO:1901896) |
0.1 | 0.4 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
0.1 | 0.2 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
0.1 | 0.3 | GO:0021794 | thalamus development(GO:0021794) |
0.1 | 0.3 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
0.1 | 0.1 | GO:0072695 | negative regulation of DNA recombination at telomere(GO:0048239) regulation of DNA recombination at telomere(GO:0072695) |
0.1 | 0.1 | GO:0008582 | regulation of synaptic growth at neuromuscular junction(GO:0008582) |
0.1 | 0.1 | GO:0015888 | thiamine transport(GO:0015888) |
0.1 | 0.6 | GO:0045056 | transcytosis(GO:0045056) |
0.1 | 0.2 | GO:0006562 | proline catabolic process(GO:0006562) |
0.1 | 0.2 | GO:0001302 | replicative cell aging(GO:0001302) |
0.1 | 0.1 | GO:0033030 | negative regulation of neutrophil apoptotic process(GO:0033030) |
0.1 | 0.1 | GO:0036499 | PERK-mediated unfolded protein response(GO:0036499) |
0.1 | 0.5 | GO:0008216 | spermidine metabolic process(GO:0008216) |
0.1 | 0.2 | GO:0030952 | establishment or maintenance of cytoskeleton polarity(GO:0030952) |
0.1 | 0.1 | GO:0060279 | positive regulation of ovulation(GO:0060279) |
0.1 | 0.2 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
0.1 | 0.4 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
0.1 | 0.3 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
0.1 | 0.1 | GO:0009196 | dUDP biosynthetic process(GO:0006227) pyrimidine nucleoside diphosphate biosynthetic process(GO:0009139) pyrimidine deoxyribonucleoside diphosphate metabolic process(GO:0009196) pyrimidine deoxyribonucleoside diphosphate biosynthetic process(GO:0009197) dUDP metabolic process(GO:0046077) |
0.1 | 0.2 | GO:0071830 | chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
0.1 | 0.1 | GO:0032252 | secretory granule localization(GO:0032252) |
0.1 | 0.2 | GO:0009794 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
0.1 | 0.1 | GO:1901844 | regulation of cell communication by electrical coupling involved in cardiac conduction(GO:1901844) |
0.1 | 0.1 | GO:0033023 | mast cell homeostasis(GO:0033023) mast cell apoptotic process(GO:0033024) regulation of mast cell apoptotic process(GO:0033025) |
0.1 | 1.1 | GO:0043171 | peptide catabolic process(GO:0043171) |
0.1 | 0.4 | GO:0070189 | kynurenine metabolic process(GO:0070189) |
0.1 | 0.9 | GO:0000154 | rRNA modification(GO:0000154) |
0.1 | 0.2 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
0.1 | 0.3 | GO:0010642 | negative regulation of platelet-derived growth factor receptor signaling pathway(GO:0010642) |
0.1 | 0.2 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
0.1 | 0.6 | GO:0007097 | nuclear migration(GO:0007097) |
0.1 | 0.2 | GO:0016540 | protein autoprocessing(GO:0016540) |
0.1 | 0.1 | GO:0051204 | protein insertion into mitochondrial membrane(GO:0051204) |
0.1 | 0.2 | GO:0043461 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
0.1 | 0.2 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
0.1 | 0.2 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
0.1 | 0.8 | GO:0007020 | microtubule nucleation(GO:0007020) |
0.1 | 0.5 | GO:0051654 | establishment of mitochondrion localization(GO:0051654) |
0.1 | 0.3 | GO:0035988 | chondrocyte proliferation(GO:0035988) |
0.1 | 0.1 | GO:0061009 | common bile duct development(GO:0061009) |
0.1 | 0.2 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
0.1 | 0.1 | GO:0061152 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
0.1 | 0.1 | GO:0022417 | protein maturation by protein folding(GO:0022417) |
0.1 | 0.1 | GO:2000111 | positive regulation of macrophage apoptotic process(GO:2000111) |
0.1 | 0.3 | GO:0051458 | corticotropin secretion(GO:0051458) |
0.1 | 0.4 | GO:0006750 | glutathione biosynthetic process(GO:0006750) |
0.1 | 0.1 | GO:0052428 | negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
0.1 | 2.0 | GO:0070206 | protein trimerization(GO:0070206) |
0.1 | 0.1 | GO:0021523 | somatic motor neuron differentiation(GO:0021523) |
0.1 | 0.4 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
0.1 | 0.6 | GO:0033962 | cytoplasmic mRNA processing body assembly(GO:0033962) |
0.1 | 0.2 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
0.1 | 0.6 | GO:0097237 | cellular response to toxic substance(GO:0097237) |
0.1 | 0.5 | GO:0035871 | protein K11-linked deubiquitination(GO:0035871) |
0.1 | 0.1 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
0.1 | 0.6 | GO:0032801 | receptor catabolic process(GO:0032801) |
0.1 | 0.3 | GO:0043586 | tongue development(GO:0043586) |
0.1 | 0.3 | GO:0048680 | positive regulation of axon regeneration(GO:0048680) |
0.1 | 0.1 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
0.1 | 0.5 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
0.1 | 0.6 | GO:0003334 | keratinocyte development(GO:0003334) |
0.1 | 0.7 | GO:0006465 | signal peptide processing(GO:0006465) |
0.1 | 0.4 | GO:1901984 | negative regulation of protein acetylation(GO:1901984) |
0.1 | 0.1 | GO:0051593 | response to folic acid(GO:0051593) |
0.1 | 0.1 | GO:0042996 | regulation of Golgi to plasma membrane protein transport(GO:0042996) |
0.1 | 0.8 | GO:0006805 | xenobiotic metabolic process(GO:0006805) |
0.1 | 0.2 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
0.1 | 0.4 | GO:0016074 | snoRNA metabolic process(GO:0016074) |
0.1 | 0.8 | GO:0032012 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.1 | 0.2 | GO:0090141 | positive regulation of mitochondrial fission(GO:0090141) |
0.1 | 0.7 | GO:0003301 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
0.1 | 1.1 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
0.1 | 0.1 | GO:1900106 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
0.1 | 0.2 | GO:0048318 | axial mesoderm development(GO:0048318) |
0.1 | 0.1 | GO:0051088 | PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
0.1 | 0.1 | GO:0048050 | post-embryonic eye morphogenesis(GO:0048050) |
0.1 | 0.2 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.1 | 0.3 | GO:0032466 | negative regulation of cytokinesis(GO:0032466) |
0.1 | 0.6 | GO:0006705 | mineralocorticoid biosynthetic process(GO:0006705) |
0.1 | 0.1 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
0.1 | 0.1 | GO:0002740 | negative regulation of cytokine secretion involved in immune response(GO:0002740) |
0.1 | 0.2 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
0.1 | 0.1 | GO:1901894 | regulation of calcium-transporting ATPase activity(GO:1901894) |
0.1 | 1.5 | GO:0035019 | somatic stem cell population maintenance(GO:0035019) |
0.1 | 0.2 | GO:0048207 | vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
0.1 | 0.1 | GO:0003072 | regulation of blood vessel size by renin-angiotensin(GO:0002034) renal control of peripheral vascular resistance involved in regulation of systemic arterial blood pressure(GO:0003072) |
0.1 | 0.2 | GO:0002840 | T cell mediated immune response to tumor cell(GO:0002424) regulation of T cell mediated immune response to tumor cell(GO:0002840) |
0.1 | 0.3 | GO:0006995 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
0.1 | 0.1 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
0.1 | 0.4 | GO:0006228 | UTP biosynthetic process(GO:0006228) |
0.1 | 1.0 | GO:0007094 | mitotic spindle assembly checkpoint(GO:0007094) spindle assembly checkpoint(GO:0071173) |
0.1 | 0.1 | GO:0060352 | cell adhesion molecule production(GO:0060352) |
0.1 | 1.8 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
0.1 | 0.6 | GO:1901661 | quinone metabolic process(GO:1901661) |
0.1 | 0.1 | GO:0070989 | oxidative demethylation(GO:0070989) |
0.1 | 0.1 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
0.1 | 0.1 | GO:0035330 | regulation of hippo signaling(GO:0035330) |
0.1 | 0.4 | GO:0043651 | linoleic acid metabolic process(GO:0043651) |
0.1 | 2.1 | GO:0006892 | post-Golgi vesicle-mediated transport(GO:0006892) |
0.1 | 0.1 | GO:0002739 | regulation of cytokine secretion involved in immune response(GO:0002739) |
0.1 | 0.1 | GO:0050862 | positive regulation of T cell receptor signaling pathway(GO:0050862) |
0.1 | 0.1 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
0.1 | 0.1 | GO:0008334 | histone mRNA metabolic process(GO:0008334) |
0.1 | 0.5 | GO:0060914 | heart formation(GO:0060914) |
0.1 | 0.2 | GO:0071027 | nuclear RNA surveillance(GO:0071027) nuclear mRNA surveillance(GO:0071028) |
0.1 | 0.2 | GO:0005984 | disaccharide metabolic process(GO:0005984) |
0.1 | 0.1 | GO:0060049 | regulation of protein glycosylation(GO:0060049) |
0.1 | 0.1 | GO:0036006 | response to macrophage colony-stimulating factor(GO:0036005) cellular response to macrophage colony-stimulating factor stimulus(GO:0036006) |
0.1 | 0.1 | GO:0009812 | flavonoid metabolic process(GO:0009812) |
0.1 | 0.1 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
0.1 | 0.2 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.1 | 0.2 | GO:2000010 | positive regulation of protein localization to cell surface(GO:2000010) |
0.1 | 0.1 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
0.1 | 0.5 | GO:0002115 | store-operated calcium entry(GO:0002115) |
0.1 | 0.2 | GO:0014744 | positive regulation of muscle adaptation(GO:0014744) |
0.1 | 0.1 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
0.1 | 0.2 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
0.1 | 0.2 | GO:0048478 | replication fork protection(GO:0048478) |
0.1 | 0.6 | GO:0007194 | negative regulation of adenylate cyclase activity(GO:0007194) |
0.1 | 0.1 | GO:0033121 | regulation of purine nucleotide catabolic process(GO:0033121) |
0.1 | 0.2 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
0.1 | 0.1 | GO:1904690 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
0.1 | 0.3 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
0.1 | 0.1 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
0.0 | 0.2 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
0.0 | 0.1 | GO:0045540 | regulation of cholesterol biosynthetic process(GO:0045540) |
0.0 | 0.1 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
0.0 | 1.0 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
0.0 | 0.2 | GO:1902414 | protein localization to cell junction(GO:1902414) |
0.0 | 0.2 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
0.0 | 0.1 | GO:0050975 | sensory perception of touch(GO:0050975) |
0.0 | 0.3 | GO:1900273 | positive regulation of long-term synaptic potentiation(GO:1900273) |
0.0 | 0.2 | GO:1900016 | negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
0.0 | 0.5 | GO:0014041 | regulation of neuron maturation(GO:0014041) |
0.0 | 0.1 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
0.0 | 0.2 | GO:0048733 | sebaceous gland development(GO:0048733) |
0.0 | 0.5 | GO:0017144 | drug metabolic process(GO:0017144) |
0.0 | 0.5 | GO:1901032 | negative regulation of response to reactive oxygen species(GO:1901032) |
0.0 | 0.2 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
0.0 | 0.1 | GO:1903238 | positive regulation of leukocyte tethering or rolling(GO:1903238) |
0.0 | 0.2 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
0.0 | 0.1 | GO:2000836 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
0.0 | 0.0 | GO:0023041 | neuronal signal transduction(GO:0023041) |
0.0 | 0.0 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
0.0 | 0.3 | GO:0046628 | positive regulation of insulin receptor signaling pathway(GO:0046628) |
0.0 | 0.3 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
0.0 | 0.2 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
0.0 | 1.5 | GO:0042273 | ribosomal large subunit biogenesis(GO:0042273) |
0.0 | 0.2 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.0 | 0.0 | GO:0071672 | negative regulation of smooth muscle cell chemotaxis(GO:0071672) |
0.0 | 0.1 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
0.0 | 1.9 | GO:0072332 | intrinsic apoptotic signaling pathway by p53 class mediator(GO:0072332) |
0.0 | 0.2 | GO:2000291 | regulation of myoblast proliferation(GO:2000291) |
0.0 | 0.2 | GO:0097066 | response to thyroid hormone(GO:0097066) |
0.0 | 0.2 | GO:0071921 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
0.0 | 0.1 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
0.0 | 0.0 | GO:0090114 | COPII-coated vesicle budding(GO:0090114) |
0.0 | 0.0 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
0.0 | 0.2 | GO:0035357 | peroxisome proliferator activated receptor signaling pathway(GO:0035357) |
0.0 | 0.5 | GO:0001539 | cilium or flagellum-dependent cell motility(GO:0001539) cilium-dependent cell motility(GO:0060285) |
0.0 | 0.2 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
0.0 | 0.4 | GO:0036010 | protein localization to endosome(GO:0036010) |
0.0 | 0.0 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.0 | 0.7 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
0.0 | 0.0 | GO:0060684 | epithelial-mesenchymal cell signaling(GO:0060684) |
0.0 | 0.0 | GO:0003241 | growth involved in heart morphogenesis(GO:0003241) |
0.0 | 0.3 | GO:2000060 | positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
0.0 | 0.2 | GO:0098930 | axonal transport(GO:0098930) |
0.0 | 0.3 | GO:0071498 | cellular response to fluid shear stress(GO:0071498) |
0.0 | 0.1 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
0.0 | 0.4 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
0.0 | 0.2 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
0.0 | 0.1 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
0.0 | 0.0 | GO:0048859 | formation of anatomical boundary(GO:0048859) |
0.0 | 0.0 | GO:0030242 | pexophagy(GO:0030242) |
0.0 | 0.7 | GO:0061001 | regulation of dendritic spine morphogenesis(GO:0061001) |
0.0 | 0.5 | GO:0015693 | magnesium ion transport(GO:0015693) |
0.0 | 0.1 | GO:0085020 | protein K6-linked ubiquitination(GO:0085020) |
0.0 | 0.1 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.0 | 0.4 | GO:0051974 | negative regulation of telomerase activity(GO:0051974) |
0.0 | 0.6 | GO:0030488 | tRNA methylation(GO:0030488) |
0.0 | 0.0 | GO:0051121 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
0.0 | 0.8 | GO:0070232 | regulation of T cell apoptotic process(GO:0070232) |
0.0 | 0.6 | GO:0051452 | intracellular pH reduction(GO:0051452) |
0.0 | 0.3 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
0.0 | 0.3 | GO:0006656 | phosphatidylcholine biosynthetic process(GO:0006656) |
0.0 | 0.5 | GO:0097150 | neuronal stem cell population maintenance(GO:0097150) |
0.0 | 0.1 | GO:0014826 | vein smooth muscle contraction(GO:0014826) |
0.0 | 0.1 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
0.0 | 0.1 | GO:0072178 | nephric duct development(GO:0072176) nephric duct morphogenesis(GO:0072178) |
0.0 | 0.2 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
0.0 | 0.2 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
0.0 | 0.1 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
0.0 | 0.1 | GO:0070669 | response to interleukin-2(GO:0070669) |
0.0 | 0.1 | GO:0000820 | regulation of glutamine family amino acid metabolic process(GO:0000820) |
0.0 | 0.2 | GO:0055059 | asymmetric neuroblast division(GO:0055059) |
0.0 | 0.3 | GO:0016242 | negative regulation of macroautophagy(GO:0016242) |
0.0 | 0.1 | GO:0070535 | histone H2A K63-linked ubiquitination(GO:0070535) |
0.0 | 0.0 | GO:0030908 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
0.0 | 0.1 | GO:0006706 | steroid catabolic process(GO:0006706) |
0.0 | 0.1 | GO:0008354 | germ cell migration(GO:0008354) |
0.0 | 0.1 | GO:0048014 | Tie signaling pathway(GO:0048014) |
0.0 | 0.1 | GO:0036119 | response to platelet-derived growth factor(GO:0036119) cellular response to platelet-derived growth factor stimulus(GO:0036120) |
0.0 | 0.2 | GO:2000678 | negative regulation of transcription regulatory region DNA binding(GO:2000678) |
0.0 | 0.2 | GO:0016584 | nucleosome positioning(GO:0016584) |
0.0 | 0.2 | GO:0045793 | positive regulation of cell size(GO:0045793) |
0.0 | 0.1 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
0.0 | 0.2 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
0.0 | 0.3 | GO:0002176 | male germ cell proliferation(GO:0002176) |
0.0 | 0.1 | GO:0006878 | cellular copper ion homeostasis(GO:0006878) |
0.0 | 0.2 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
0.0 | 0.2 | GO:0033227 | dsRNA transport(GO:0033227) |
0.0 | 0.1 | GO:0060179 | male mating behavior(GO:0060179) |
0.0 | 0.2 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.0 | 0.2 | GO:0031573 | intra-S DNA damage checkpoint(GO:0031573) |
0.0 | 0.1 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
0.0 | 0.1 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
0.0 | 0.2 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.0 | 0.0 | GO:1904398 | positive regulation of neuromuscular junction development(GO:1904398) |
0.0 | 0.1 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.0 | 0.0 | GO:0006106 | fumarate metabolic process(GO:0006106) |
0.0 | 0.4 | GO:0048643 | positive regulation of skeletal muscle tissue development(GO:0048643) |
0.0 | 0.2 | GO:0006108 | malate metabolic process(GO:0006108) |
0.0 | 0.0 | GO:1902837 | amino acid import into cell(GO:1902837) |
0.0 | 0.6 | GO:0000301 | retrograde transport, vesicle recycling within Golgi(GO:0000301) |
0.0 | 0.4 | GO:0002063 | chondrocyte development(GO:0002063) |
0.0 | 0.1 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
0.0 | 0.2 | GO:0008105 | asymmetric protein localization(GO:0008105) |
0.0 | 0.1 | GO:0070309 | lens fiber cell morphogenesis(GO:0070309) |
0.0 | 0.0 | GO:0048664 | neuron fate determination(GO:0048664) |
0.0 | 0.1 | GO:0060672 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
0.0 | 0.2 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
0.0 | 0.1 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
0.0 | 0.2 | GO:0046337 | phosphatidylethanolamine metabolic process(GO:0046337) |
0.0 | 0.3 | GO:0042026 | protein refolding(GO:0042026) |
0.0 | 0.5 | GO:0006400 | tRNA modification(GO:0006400) |
0.0 | 0.6 | GO:0043029 | T cell homeostasis(GO:0043029) |
0.0 | 0.6 | GO:0006884 | cell volume homeostasis(GO:0006884) |
0.0 | 0.9 | GO:0006505 | GPI anchor metabolic process(GO:0006505) |
0.0 | 0.1 | GO:0046102 | inosine metabolic process(GO:0046102) inosine biosynthetic process(GO:0046103) |
0.0 | 0.4 | GO:0050910 | detection of mechanical stimulus involved in sensory perception of sound(GO:0050910) |
0.0 | 0.1 | GO:0002572 | pro-T cell differentiation(GO:0002572) |
0.0 | 0.4 | GO:0006471 | protein ADP-ribosylation(GO:0006471) |
0.0 | 0.2 | GO:2000042 | negative regulation of double-strand break repair via homologous recombination(GO:2000042) |
0.0 | 0.1 | GO:0046322 | negative regulation of fatty acid oxidation(GO:0046322) |
0.0 | 0.6 | GO:0043631 | mRNA polyadenylation(GO:0006378) RNA polyadenylation(GO:0043631) |
0.0 | 0.6 | GO:0031122 | cytoplasmic microtubule organization(GO:0031122) |
0.0 | 0.1 | GO:0060167 | regulation of adenosine receptor signaling pathway(GO:0060167) |
0.0 | 0.9 | GO:0034605 | cellular response to heat(GO:0034605) |
0.0 | 0.1 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
0.0 | 0.1 | GO:0060997 | dendritic spine morphogenesis(GO:0060997) |
0.0 | 0.1 | GO:0051013 | microtubule severing(GO:0051013) |
0.0 | 0.1 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
0.0 | 0.0 | GO:0060125 | negative regulation of growth hormone secretion(GO:0060125) |
0.0 | 0.3 | GO:0071674 | mononuclear cell migration(GO:0071674) |
0.0 | 0.0 | GO:0098763 | mitotic cell cycle phase(GO:0098763) |
0.0 | 0.1 | GO:0060390 | regulation of SMAD protein import into nucleus(GO:0060390) |
0.0 | 0.0 | GO:0034638 | phosphatidylcholine catabolic process(GO:0034638) |
0.0 | 0.1 | GO:0006903 | vesicle targeting(GO:0006903) |
0.0 | 0.1 | GO:0042756 | drinking behavior(GO:0042756) |
0.0 | 0.5 | GO:0060351 | cartilage development involved in endochondral bone morphogenesis(GO:0060351) |
0.0 | 0.1 | GO:0042537 | benzene-containing compound metabolic process(GO:0042537) |
0.0 | 0.1 | GO:0030920 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.0 | 0.0 | GO:0042045 | epithelial fluid transport(GO:0042045) |
0.0 | 0.1 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
0.0 | 0.2 | GO:0017121 | phospholipid scrambling(GO:0017121) |
0.0 | 0.6 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
0.0 | 0.2 | GO:0009299 | mRNA transcription(GO:0009299) |
0.0 | 0.6 | GO:0015986 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
0.0 | 0.1 | GO:0042525 | tyrosine phosphorylation of Stat6 protein(GO:0042505) regulation of tyrosine phosphorylation of Stat6 protein(GO:0042525) |
0.0 | 0.2 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.0 | 0.1 | GO:0007000 | nucleolus organization(GO:0007000) |
0.0 | 0.0 | GO:0098700 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
0.0 | 0.2 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
0.0 | 0.1 | GO:0098528 | skeletal muscle fiber differentiation(GO:0098528) |
0.0 | 0.2 | GO:0005513 | detection of calcium ion(GO:0005513) |
0.0 | 0.7 | GO:0006829 | zinc II ion transport(GO:0006829) |
0.0 | 0.1 | GO:0051934 | dopamine uptake involved in synaptic transmission(GO:0051583) catecholamine uptake involved in synaptic transmission(GO:0051934) |
0.0 | 0.0 | GO:1900221 | regulation of beta-amyloid clearance(GO:1900221) |
0.0 | 0.1 | GO:1901070 | guanosine-containing compound biosynthetic process(GO:1901070) |
0.0 | 0.2 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
0.0 | 0.0 | GO:0008292 | acetylcholine biosynthetic process(GO:0008292) acetate ester biosynthetic process(GO:1900620) |
0.0 | 0.0 | GO:0060536 | cartilage morphogenesis(GO:0060536) |
0.0 | 0.3 | GO:0006826 | iron ion transport(GO:0006826) |
0.0 | 0.1 | GO:0048333 | mesodermal cell differentiation(GO:0048333) |
0.0 | 0.1 | GO:0048102 | autophagic cell death(GO:0048102) |
0.0 | 0.1 | GO:0030259 | lipid glycosylation(GO:0030259) |
0.0 | 0.1 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.0 | 0.3 | GO:2000279 | negative regulation of DNA biosynthetic process(GO:2000279) |
0.0 | 0.0 | GO:0018342 | protein prenylation(GO:0018342) prenylation(GO:0097354) |
0.0 | 0.1 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
0.0 | 0.2 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
0.0 | 0.1 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
0.0 | 1.1 | GO:0006888 | ER to Golgi vesicle-mediated transport(GO:0006888) |
0.0 | 0.1 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
0.0 | 0.0 | GO:0031133 | regulation of axon diameter(GO:0031133) |
0.0 | 0.1 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
0.0 | 0.2 | GO:1990440 | positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
0.0 | 0.0 | GO:0090210 | regulation of establishment of blood-brain barrier(GO:0090210) |
0.0 | 0.1 | GO:1901409 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
0.0 | 0.2 | GO:0021955 | central nervous system neuron axonogenesis(GO:0021955) |
0.0 | 0.1 | GO:0031065 | positive regulation of histone deacetylation(GO:0031065) |
0.0 | 0.1 | GO:0051182 | coenzyme transport(GO:0051182) |
0.0 | 0.1 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
0.0 | 0.1 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
0.0 | 0.2 | GO:0051026 | chiasma assembly(GO:0051026) |
0.0 | 0.4 | GO:0035094 | response to nicotine(GO:0035094) |
0.0 | 0.1 | GO:0046470 | phosphatidylcholine metabolic process(GO:0046470) |
0.0 | 0.2 | GO:0006825 | copper ion transport(GO:0006825) |
0.0 | 0.0 | GO:2000041 | regulation of planar cell polarity pathway involved in axis elongation(GO:2000040) negative regulation of planar cell polarity pathway involved in axis elongation(GO:2000041) |
0.0 | 0.1 | GO:0046959 | habituation(GO:0046959) |
0.0 | 0.1 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
0.0 | 0.1 | GO:0006563 | L-serine metabolic process(GO:0006563) |
0.0 | 0.1 | GO:0046471 | phosphatidylglycerol metabolic process(GO:0046471) |
0.0 | 0.4 | GO:0016578 | histone deubiquitination(GO:0016578) |
0.0 | 0.1 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
0.0 | 0.5 | GO:0050982 | detection of mechanical stimulus(GO:0050982) |
0.0 | 0.2 | GO:0090200 | positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
0.0 | 0.0 | GO:0033088 | negative regulation of immature T cell proliferation in thymus(GO:0033088) |
0.0 | 0.1 | GO:0060766 | negative regulation of androgen receptor signaling pathway(GO:0060766) |
0.0 | 0.2 | GO:0006691 | leukotriene metabolic process(GO:0006691) |
0.0 | 0.0 | GO:0019388 | galactose catabolic process(GO:0019388) |
0.0 | 0.1 | GO:0007080 | mitotic metaphase plate congression(GO:0007080) |
0.0 | 0.1 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
0.0 | 0.2 | GO:0031116 | positive regulation of microtubule polymerization(GO:0031116) |
0.0 | 0.1 | GO:0070986 | left/right axis specification(GO:0070986) |
0.0 | 0.7 | GO:0007140 | male meiosis(GO:0007140) |
0.0 | 0.0 | GO:0071139 | resolution of recombination intermediates(GO:0071139) |
0.0 | 0.1 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
0.0 | 0.3 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
0.0 | 0.0 | GO:1902202 | regulation of hepatocyte growth factor receptor signaling pathway(GO:1902202) |
0.0 | 0.1 | GO:0018216 | peptidyl-arginine methylation(GO:0018216) |
0.0 | 0.1 | GO:0038033 | positive regulation of endothelial cell chemotaxis by VEGF-activated vascular endothelial growth factor receptor signaling pathway(GO:0038033) |
0.0 | 0.0 | GO:0007501 | mesodermal cell fate specification(GO:0007501) |
0.0 | 0.1 | GO:0010839 | negative regulation of keratinocyte proliferation(GO:0010839) |
0.0 | 0.2 | GO:0016446 | somatic hypermutation of immunoglobulin genes(GO:0016446) |
0.0 | 0.2 | GO:0002862 | negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
0.0 | 0.1 | GO:0030240 | skeletal muscle thin filament assembly(GO:0030240) |
0.0 | 0.1 | GO:0002725 | negative regulation of T cell cytokine production(GO:0002725) |
0.0 | 0.2 | GO:0050482 | arachidonic acid secretion(GO:0050482) arachidonate transport(GO:1903963) |
0.0 | 0.1 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.0 | 0.2 | GO:0042775 | mitochondrial ATP synthesis coupled electron transport(GO:0042775) |
0.0 | 0.1 | GO:0044829 | positive regulation by host of viral genome replication(GO:0044829) |
0.0 | 1.4 | GO:0035305 | negative regulation of dephosphorylation(GO:0035305) |
0.0 | 0.1 | GO:0032703 | negative regulation of interleukin-2 production(GO:0032703) |
0.0 | 0.0 | GO:1900037 | regulation of cellular response to hypoxia(GO:1900037) |
0.0 | 0.1 | GO:0090520 | sphingolipid mediated signaling pathway(GO:0090520) |
0.0 | 0.1 | GO:0051409 | response to nitrosative stress(GO:0051409) cellular response to nitrosative stress(GO:0071500) |
0.0 | 0.1 | GO:0070842 | aggresome assembly(GO:0070842) |
0.0 | 0.3 | GO:0030318 | melanocyte differentiation(GO:0030318) |
0.0 | 0.1 | GO:0000032 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) |
0.0 | 0.2 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
0.0 | 0.2 | GO:0008063 | Toll signaling pathway(GO:0008063) |
0.0 | 0.1 | GO:0061303 | cornea development in camera-type eye(GO:0061303) |
0.0 | 0.0 | GO:0072143 | mesangial cell differentiation(GO:0072007) glomerular mesangial cell differentiation(GO:0072008) kidney interstitial fibroblast differentiation(GO:0072071) renal interstitial fibroblast development(GO:0072141) mesangial cell development(GO:0072143) glomerular mesangial cell development(GO:0072144) |
0.0 | 0.1 | GO:0060340 | positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
0.0 | 0.2 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
0.0 | 0.5 | GO:0043550 | regulation of lipid kinase activity(GO:0043550) |
0.0 | 0.8 | GO:0033141 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
0.0 | 0.1 | GO:0045112 | integrin biosynthetic process(GO:0045112) |
0.0 | 0.1 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
0.0 | 0.4 | GO:1903146 | regulation of mitophagy(GO:1903146) |
0.0 | 0.1 | GO:0060770 | epithelial cell proliferation involved in prostate gland development(GO:0060767) regulation of epithelial cell proliferation involved in prostate gland development(GO:0060768) negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
0.0 | 0.1 | GO:0032196 | transposition(GO:0032196) |
0.0 | 0.4 | GO:0034394 | protein localization to cell surface(GO:0034394) |
0.0 | 0.0 | GO:0045852 | pH elevation(GO:0045852) intracellular pH elevation(GO:0051454) |
0.0 | 0.1 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
0.0 | 0.1 | GO:1903779 | regulation of cardiac conduction(GO:1903779) |
0.0 | 0.3 | GO:2001014 | regulation of skeletal muscle cell differentiation(GO:2001014) |
0.0 | 0.1 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
0.0 | 0.0 | GO:0060028 | convergent extension involved in axis elongation(GO:0060028) |
0.0 | 0.0 | GO:0002576 | platelet degranulation(GO:0002576) |
0.0 | 0.0 | GO:0001698 | gastrin-induced gastric acid secretion(GO:0001698) |
0.0 | 0.1 | GO:0003310 | pancreatic A cell differentiation(GO:0003310) |
0.0 | 0.2 | GO:0046548 | retinal rod cell development(GO:0046548) |
0.0 | 0.0 | GO:0090224 | regulation of spindle organization(GO:0090224) |
0.0 | 0.2 | GO:0060216 | definitive hemopoiesis(GO:0060216) |
0.0 | 0.0 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
0.0 | 1.0 | GO:0032543 | mitochondrial translation(GO:0032543) |
0.0 | 0.1 | GO:0060999 | positive regulation of dendritic spine development(GO:0060999) |
0.0 | 0.1 | GO:0035268 | protein mannosylation(GO:0035268) mannosylation(GO:0097502) |
0.0 | 0.0 | GO:0051775 | response to redox state(GO:0051775) |
0.0 | 0.0 | GO:0070314 | G1 to G0 transition(GO:0070314) |
0.0 | 0.1 | GO:0086045 | membrane depolarization during AV node cell action potential(GO:0086045) |
0.0 | 0.0 | GO:0010980 | regulation of vitamin D 24-hydroxylase activity(GO:0010979) positive regulation of vitamin D 24-hydroxylase activity(GO:0010980) |
0.0 | 0.1 | GO:0010544 | negative regulation of platelet activation(GO:0010544) |
0.0 | 0.0 | GO:2000053 | regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000053) |
0.0 | 0.1 | GO:2001198 | regulation of dendritic cell differentiation(GO:2001198) negative regulation of dendritic cell differentiation(GO:2001199) |
0.0 | 0.0 | GO:0002281 | macrophage activation involved in immune response(GO:0002281) |
0.0 | 0.0 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
0.0 | 0.1 | GO:0097154 | GABAergic neuron differentiation(GO:0097154) |
0.0 | 0.3 | GO:0008209 | androgen metabolic process(GO:0008209) |
0.0 | 0.0 | GO:0030656 | regulation of vitamin metabolic process(GO:0030656) |
0.0 | 0.0 | GO:0090343 | positive regulation of cell aging(GO:0090343) |
0.0 | 0.2 | GO:0098719 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
0.0 | 0.1 | GO:0045588 | positive regulation of gamma-delta T cell differentiation(GO:0045588) positive regulation of gamma-delta T cell activation(GO:0046645) |
0.0 | 0.0 | GO:0042747 | regulation of circadian sleep/wake cycle, REM sleep(GO:0042320) circadian sleep/wake cycle, REM sleep(GO:0042747) positive regulation of circadian sleep/wake cycle, REM sleep(GO:0046005) |
0.0 | 0.0 | GO:0043173 | IMP salvage(GO:0032264) nucleotide salvage(GO:0043173) |
0.0 | 0.1 | GO:0016198 | axon choice point recognition(GO:0016198) |
0.0 | 0.1 | GO:0070173 | regulation of enamel mineralization(GO:0070173) |
0.0 | 0.0 | GO:0008054 | negative regulation of cyclin-dependent protein serine/threonine kinase by cyclin degradation(GO:0008054) regulation of cyclin catabolic process(GO:2000598) negative regulation of cyclin catabolic process(GO:2000599) |
0.0 | 0.0 | GO:0032714 | negative regulation of interleukin-5 production(GO:0032714) |
0.0 | 0.0 | GO:0060405 | regulation of penile erection(GO:0060405) positive regulation of penile erection(GO:0060406) |
0.0 | 0.1 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
0.0 | 0.2 | GO:1900026 | positive regulation of substrate adhesion-dependent cell spreading(GO:1900026) |
0.0 | 0.2 | GO:0031629 | synaptic vesicle fusion to presynaptic active zone membrane(GO:0031629) vesicle fusion to plasma membrane(GO:0099500) |
0.0 | 0.2 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
0.0 | 0.3 | GO:0034340 | response to type I interferon(GO:0034340) |
0.0 | 0.1 | GO:0008088 | axo-dendritic transport(GO:0008088) |
0.0 | 0.0 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
0.0 | 0.1 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
0.0 | 0.1 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
0.0 | 0.0 | GO:0048261 | negative regulation of receptor-mediated endocytosis(GO:0048261) |
0.0 | 0.3 | GO:0021889 | olfactory bulb interneuron differentiation(GO:0021889) |
0.0 | 0.2 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) |
0.0 | 0.0 | GO:0006296 | nucleotide-excision repair, DNA incision, 5'-to lesion(GO:0006296) |
0.0 | 0.0 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
0.0 | 0.1 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
0.0 | 0.1 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
0.0 | 0.1 | GO:0006573 | valine metabolic process(GO:0006573) |
0.0 | 0.4 | GO:0006491 | N-glycan processing(GO:0006491) |
0.0 | 0.4 | GO:0050873 | brown fat cell differentiation(GO:0050873) |
0.0 | 0.1 | GO:0032506 | cytokinetic process(GO:0032506) |
0.0 | 0.1 | GO:2000463 | positive regulation of excitatory postsynaptic potential(GO:2000463) |
0.0 | 0.0 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
0.0 | 0.1 | GO:1903352 | ornithine transport(GO:0015822) L-ornithine transmembrane transport(GO:1903352) |
0.0 | 0.2 | GO:1902043 | positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
0.0 | 0.1 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
0.0 | 0.1 | GO:0019886 | antigen processing and presentation of exogenous peptide antigen via MHC class II(GO:0019886) |
0.0 | 0.1 | GO:1904406 | negative regulation of nitric oxide biosynthetic process(GO:0045019) negative regulation of nitric oxide metabolic process(GO:1904406) |
0.0 | 0.0 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.0 | 0.1 | GO:1903975 | regulation of glial cell migration(GO:1903975) |
0.0 | 0.1 | GO:0060065 | uterus development(GO:0060065) |
0.0 | 0.0 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
0.0 | 0.1 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
0.0 | 0.0 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
0.0 | 0.0 | GO:0032971 | regulation of muscle filament sliding(GO:0032971) |
0.0 | 0.0 | GO:0042701 | progesterone secretion(GO:0042701) |
0.0 | 0.1 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
0.0 | 0.1 | GO:0006862 | nucleotide transport(GO:0006862) |
0.0 | 0.0 | GO:1901977 | negative regulation of cell cycle checkpoint(GO:1901977) |
0.0 | 0.0 | GO:0090135 | actin filament branching(GO:0090135) |
0.0 | 0.1 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.0 | 0.3 | GO:0008053 | mitochondrial fusion(GO:0008053) |
0.0 | 0.0 | GO:0035993 | deltoid tuberosity development(GO:0035993) |
0.0 | 0.0 | GO:0010766 | negative regulation of sodium ion transport(GO:0010766) |
0.0 | 0.0 | GO:0030202 | heparin metabolic process(GO:0030202) |
0.0 | 0.1 | GO:0071625 | vocalization behavior(GO:0071625) |
0.0 | 0.1 | GO:0046621 | negative regulation of organ growth(GO:0046621) |
0.0 | 0.0 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
0.0 | 0.1 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.0 | 0.0 | GO:0045626 | negative regulation of T-helper 1 cell differentiation(GO:0045626) |
0.0 | 0.0 | GO:0086064 | cell communication by electrical coupling involved in cardiac conduction(GO:0086064) |
0.0 | 0.2 | GO:0007342 | fusion of sperm to egg plasma membrane(GO:0007342) |
0.0 | 0.1 | GO:0031063 | regulation of histone deacetylation(GO:0031063) |
0.0 | 0.1 | GO:0034377 | plasma lipoprotein particle assembly(GO:0034377) |
0.0 | 0.4 | GO:0061077 | chaperone-mediated protein folding(GO:0061077) |
0.0 | 0.6 | GO:0045454 | cell redox homeostasis(GO:0045454) |
0.0 | 0.0 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
0.0 | 0.0 | GO:0033574 | response to testosterone(GO:0033574) |
0.0 | 0.1 | GO:0045579 | positive regulation of B cell differentiation(GO:0045579) |
0.0 | 0.7 | GO:0051963 | regulation of synapse assembly(GO:0051963) |
0.0 | 0.0 | GO:0060988 | lipid tube assembly(GO:0060988) |
0.0 | 0.1 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
0.0 | 0.3 | GO:0016601 | Rac protein signal transduction(GO:0016601) |
0.0 | 0.1 | GO:0002803 | positive regulation of antimicrobial peptide production(GO:0002225) positive regulation of antibacterial peptide production(GO:0002803) |
0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.0 | GO:0009209 | pyrimidine ribonucleoside triphosphate biosynthetic process(GO:0009209) |
0.0 | 0.0 | GO:0060745 | mammary gland branching involved in pregnancy(GO:0060745) |
0.0 | 0.0 | GO:0051142 | regulation of NK T cell proliferation(GO:0051140) positive regulation of NK T cell proliferation(GO:0051142) |
0.0 | 0.1 | GO:1901660 | calcium ion export(GO:1901660) |
0.0 | 0.2 | GO:0061298 | retina vasculature development in camera-type eye(GO:0061298) |
0.0 | 0.0 | GO:0071025 | RNA surveillance(GO:0071025) |
0.0 | 0.1 | GO:0009950 | dorsal/ventral axis specification(GO:0009950) |
0.0 | 0.0 | GO:0016559 | peroxisome fission(GO:0016559) |
0.0 | 0.0 | GO:0070827 | chromatin maintenance(GO:0070827) |
0.0 | 0.1 | GO:0060753 | regulation of mast cell chemotaxis(GO:0060753) |
0.0 | 0.0 | GO:1904058 | positive regulation of sensory perception of pain(GO:1904058) |
0.0 | 0.1 | GO:0019227 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
0.0 | 0.5 | GO:1902476 | chloride transmembrane transport(GO:1902476) |
0.0 | 0.0 | GO:0061743 | motor learning(GO:0061743) |
0.0 | 0.0 | GO:0007096 | regulation of exit from mitosis(GO:0007096) |
0.0 | 0.0 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
0.0 | 0.0 | GO:0031284 | positive regulation of guanylate cyclase activity(GO:0031284) |
0.0 | 0.3 | GO:0045071 | negative regulation of viral genome replication(GO:0045071) |
0.0 | 0.5 | GO:1903845 | negative regulation of transforming growth factor beta receptor signaling pathway(GO:0030512) negative regulation of cellular response to transforming growth factor beta stimulus(GO:1903845) |
0.0 | 0.0 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
0.0 | 0.0 | GO:1901069 | guanosine-containing compound catabolic process(GO:1901069) |
0.0 | 0.0 | GO:0051025 | negative regulation of immunoglobulin secretion(GO:0051025) |
0.0 | 0.0 | GO:0021557 | oculomotor nerve development(GO:0021557) trochlear nerve development(GO:0021558) |
0.0 | 0.1 | GO:0043949 | regulation of cAMP-mediated signaling(GO:0043949) |
0.0 | 0.0 | GO:0051103 | DNA ligation involved in DNA repair(GO:0051103) |
0.0 | 0.0 | GO:0060431 | primary lung bud formation(GO:0060431) |
0.0 | 0.2 | GO:0051281 | positive regulation of release of sequestered calcium ion into cytosol(GO:0051281) |
0.0 | 0.0 | GO:1901419 | regulation of response to alcohol(GO:1901419) |
0.0 | 0.1 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
0.0 | 0.3 | GO:0033003 | regulation of mast cell activation(GO:0033003) |
0.0 | 0.2 | GO:0006383 | transcription from RNA polymerase III promoter(GO:0006383) |
0.0 | 0.1 | GO:0045005 | DNA-dependent DNA replication maintenance of fidelity(GO:0045005) |
0.0 | 0.0 | GO:0002361 | CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0002361) |
0.0 | 0.0 | GO:0046684 | response to pyrethroid(GO:0046684) |
0.0 | 0.0 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
0.0 | 0.1 | GO:0031954 | positive regulation of protein autophosphorylation(GO:0031954) |
0.0 | 0.1 | GO:0006661 | phosphatidylinositol biosynthetic process(GO:0006661) |
0.0 | 0.0 | GO:0072307 | metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
0.0 | 0.3 | GO:0046834 | lipid phosphorylation(GO:0046834) |
0.0 | 0.1 | GO:0031290 | retinal ganglion cell axon guidance(GO:0031290) |
0.0 | 0.0 | GO:2000474 | regulation of opioid receptor signaling pathway(GO:2000474) |
0.0 | 0.1 | GO:2000353 | positive regulation of endothelial cell apoptotic process(GO:2000353) |
0.0 | 0.0 | GO:0060510 | Type II pneumocyte differentiation(GO:0060510) |
0.0 | 0.0 | GO:0015705 | iodide transport(GO:0015705) |
0.0 | 0.1 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
0.0 | 0.1 | GO:0090190 | positive regulation of branching involved in ureteric bud morphogenesis(GO:0090190) |
0.0 | 0.0 | GO:0019068 | virion assembly(GO:0019068) |
0.0 | 0.0 | GO:0042473 | outer ear morphogenesis(GO:0042473) |
0.0 | 0.1 | GO:0006621 | protein retention in ER lumen(GO:0006621) maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
0.0 | 0.1 | GO:0046716 | muscle cell cellular homeostasis(GO:0046716) |
0.0 | 0.0 | GO:0097070 | ductus arteriosus closure(GO:0097070) |
0.0 | 0.2 | GO:0045471 | response to ethanol(GO:0045471) |
0.0 | 0.0 | GO:0040009 | regulation of growth rate(GO:0040009) |
0.0 | 0.0 | GO:0009084 | glutamine family amino acid biosynthetic process(GO:0009084) |
0.0 | 0.0 | GO:0019511 | peptidyl-proline hydroxylation(GO:0019511) |
0.0 | 0.0 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
0.0 | 0.0 | GO:0060509 | Type I pneumocyte differentiation(GO:0060509) |
0.0 | 0.0 | GO:0072182 | nephron tubule epithelial cell differentiation(GO:0072160) regulation of nephron tubule epithelial cell differentiation(GO:0072182) |
0.0 | 0.0 | GO:0003198 | epithelial to mesenchymal transition involved in endocardial cushion formation(GO:0003198) |
0.0 | 0.1 | GO:0001919 | regulation of receptor recycling(GO:0001919) |
0.0 | 0.0 | GO:0071034 | CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
0.0 | 0.0 | GO:0034374 | low-density lipoprotein particle remodeling(GO:0034374) |
0.0 | 0.0 | GO:0031448 | regulation of fast-twitch skeletal muscle fiber contraction(GO:0031446) positive regulation of fast-twitch skeletal muscle fiber contraction(GO:0031448) |
0.0 | 0.0 | GO:0042640 | anagen(GO:0042640) |
0.0 | 0.1 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.0 | 0.0 | GO:1903818 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
0.0 | 0.1 | GO:0035176 | social behavior(GO:0035176) intraspecies interaction between organisms(GO:0051703) |
0.0 | 0.0 | GO:0048642 | negative regulation of skeletal muscle tissue development(GO:0048642) |
0.0 | 0.1 | GO:0043249 | erythrocyte maturation(GO:0043249) |
0.0 | 0.1 | GO:0051923 | sulfation(GO:0051923) |
0.0 | 0.1 | GO:0032958 | inositol phosphate biosynthetic process(GO:0032958) |
0.0 | 0.0 | GO:0001714 | endodermal cell fate specification(GO:0001714) |
0.0 | 0.0 | GO:0046952 | ketone body catabolic process(GO:0046952) |
0.0 | 0.1 | GO:0007212 | dopamine receptor signaling pathway(GO:0007212) |
0.0 | 0.0 | GO:0070242 | thymocyte apoptotic process(GO:0070242) |
0.0 | 0.3 | GO:0051225 | spindle assembly(GO:0051225) |
0.0 | 0.1 | GO:0046146 | tetrahydrobiopterin metabolic process(GO:0046146) |
0.0 | 0.1 | GO:0042090 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
0.0 | 0.5 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
0.0 | 0.0 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
0.0 | 0.1 | GO:0043922 | negative regulation by host of viral transcription(GO:0043922) |
0.0 | 0.0 | GO:0019695 | choline metabolic process(GO:0019695) |
0.0 | 0.1 | GO:0000281 | mitotic cytokinesis(GO:0000281) |
0.0 | 0.1 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
0.0 | 0.0 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
0.0 | 0.0 | GO:0060033 | anatomical structure regression(GO:0060033) |
0.0 | 0.0 | GO:0043615 | astrocyte cell migration(GO:0043615) |
0.0 | 0.0 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
0.0 | 0.1 | GO:0031572 | G2 DNA damage checkpoint(GO:0031572) |
0.0 | 0.0 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
0.0 | 0.2 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
0.0 | 0.0 | GO:0045605 | negative regulation of epidermal cell differentiation(GO:0045605) |
0.0 | 0.0 | GO:0042435 | indole-containing compound biosynthetic process(GO:0042435) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 1.6 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.5 | 5.4 | GO:0070852 | cell body fiber(GO:0070852) |
0.4 | 1.1 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.3 | 1.7 | GO:0031094 | platelet dense tubular network(GO:0031094) |
0.3 | 0.3 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.3 | 1.0 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.3 | 1.3 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
0.3 | 0.9 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.3 | 1.1 | GO:0000322 | storage vacuole(GO:0000322) |
0.3 | 1.3 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
0.2 | 0.7 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
0.2 | 1.0 | GO:0071203 | WASH complex(GO:0071203) |
0.2 | 1.0 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
0.2 | 1.2 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
0.2 | 1.8 | GO:0042587 | glycogen granule(GO:0042587) |
0.2 | 0.9 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.2 | 0.2 | GO:0055087 | Ski complex(GO:0055087) |
0.2 | 0.8 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.2 | 0.8 | GO:0030127 | COPII vesicle coat(GO:0030127) |
0.2 | 0.6 | GO:0031084 | BLOC-2 complex(GO:0031084) |
0.2 | 0.8 | GO:0045298 | tubulin complex(GO:0045298) |
0.2 | 0.6 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.2 | 0.4 | GO:0071564 | npBAF complex(GO:0071564) |
0.2 | 1.1 | GO:0000347 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
0.2 | 0.9 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
0.2 | 0.5 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
0.2 | 1.6 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.2 | 0.7 | GO:0070545 | PeBoW complex(GO:0070545) |
0.2 | 0.9 | GO:0005579 | membrane attack complex(GO:0005579) |
0.2 | 0.7 | GO:0033269 | internode region of axon(GO:0033269) |
0.2 | 0.5 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.2 | 0.7 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.2 | 0.5 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
0.2 | 0.2 | GO:0070552 | BRISC complex(GO:0070552) |
0.2 | 1.3 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
0.2 | 1.1 | GO:0045180 | basal cortex(GO:0045180) |
0.2 | 0.5 | GO:0043293 | apoptosome(GO:0043293) |
0.2 | 1.1 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.2 | 0.8 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.2 | 1.1 | GO:0016342 | catenin complex(GO:0016342) |
0.2 | 0.9 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.2 | 0.6 | GO:0032021 | NELF complex(GO:0032021) |
0.1 | 0.6 | GO:0098536 | deuterosome(GO:0098536) |
0.1 | 0.7 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.1 | 0.8 | GO:0005915 | zonula adherens(GO:0005915) |
0.1 | 1.5 | GO:0031528 | microvillus membrane(GO:0031528) |
0.1 | 2.1 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
0.1 | 1.7 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.1 | 1.2 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.1 | 0.4 | GO:0032444 | activin responsive factor complex(GO:0032444) |
0.1 | 1.6 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
0.1 | 0.5 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
0.1 | 0.8 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.1 | 1.5 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
0.1 | 1.4 | GO:0035102 | PRC1 complex(GO:0035102) |
0.1 | 1.5 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
0.1 | 1.4 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
0.1 | 0.3 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
0.1 | 0.4 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
0.1 | 0.6 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.1 | 1.3 | GO:0030126 | COPI vesicle coat(GO:0030126) |
0.1 | 1.2 | GO:0000782 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
0.1 | 0.1 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
0.1 | 0.4 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
0.1 | 0.4 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.1 | 1.4 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.1 | 0.6 | GO:0033503 | HULC complex(GO:0033503) |
0.1 | 0.5 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.1 | 0.6 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.1 | 0.6 | GO:0044326 | dendritic spine neck(GO:0044326) |
0.1 | 0.9 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
0.1 | 0.3 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.1 | 0.6 | GO:0070531 | BRCA1-A complex(GO:0070531) |
0.1 | 0.3 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
0.1 | 0.5 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
0.1 | 0.4 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
0.1 | 1.5 | GO:0033391 | chromatoid body(GO:0033391) |
0.1 | 0.9 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
0.1 | 0.3 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
0.1 | 0.3 | GO:0097413 | Lewy body(GO:0097413) |
0.1 | 0.9 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
0.1 | 0.4 | GO:0030120 | vesicle coat(GO:0030120) |
0.1 | 0.9 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.1 | 0.3 | GO:0071942 | XPC complex(GO:0071942) |
0.1 | 0.7 | GO:0098827 | endoplasmic reticulum subcompartment(GO:0098827) |
0.1 | 0.7 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.1 | 0.3 | GO:0046691 | intracellular canaliculus(GO:0046691) |
0.1 | 0.3 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.1 | 1.6 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.1 | 0.3 | GO:0097441 | basilar dendrite(GO:0097441) |
0.1 | 0.4 | GO:1990696 | USH2 complex(GO:1990696) |
0.1 | 0.3 | GO:0071256 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
0.1 | 0.5 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
0.1 | 0.8 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.1 | 0.8 | GO:0043220 | Schmidt-Lanterman incisure(GO:0043220) |
0.1 | 0.3 | GO:0036449 | microtubule minus-end(GO:0036449) |
0.1 | 4.8 | GO:0005811 | lipid particle(GO:0005811) |
0.1 | 1.8 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
0.1 | 1.5 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.1 | 0.6 | GO:0071014 | post-mRNA release spliceosomal complex(GO:0071014) |
0.1 | 0.8 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.1 | 0.3 | GO:0033648 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
0.1 | 0.3 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.1 | 1.3 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
0.1 | 0.3 | GO:0071439 | clathrin complex(GO:0071439) |
0.1 | 0.3 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
0.1 | 0.3 | GO:0000836 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) |
0.1 | 0.3 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.1 | 0.8 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
0.1 | 1.1 | GO:0000421 | autophagosome membrane(GO:0000421) |
0.1 | 0.2 | GO:0042585 | germinal vesicle(GO:0042585) |
0.1 | 0.2 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
0.1 | 1.8 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
0.1 | 1.1 | GO:0097440 | apical dendrite(GO:0097440) |
0.1 | 0.2 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
0.1 | 3.6 | GO:0005778 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
0.1 | 1.4 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
0.1 | 0.3 | GO:0032133 | chromosome passenger complex(GO:0032133) |
0.1 | 0.1 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
0.1 | 0.9 | GO:0005583 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.1 | 0.4 | GO:0005827 | polar microtubule(GO:0005827) |
0.1 | 0.1 | GO:0097542 | ciliary tip(GO:0097542) |
0.1 | 0.4 | GO:0012510 | trans-Golgi network transport vesicle membrane(GO:0012510) |
0.1 | 0.3 | GO:0089701 | U2AF(GO:0089701) |
0.1 | 0.3 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
0.1 | 0.4 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
0.1 | 0.1 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.1 | 0.4 | GO:0045261 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
0.1 | 0.2 | GO:0005712 | chiasma(GO:0005712) |
0.1 | 2.5 | GO:0031672 | A band(GO:0031672) |
0.1 | 1.0 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
0.1 | 2.0 | GO:0005776 | autophagosome(GO:0005776) |
0.1 | 0.3 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
0.1 | 0.1 | GO:0097342 | ripoptosome(GO:0097342) |
0.1 | 1.0 | GO:0034451 | centriolar satellite(GO:0034451) |
0.1 | 1.3 | GO:0060170 | ciliary membrane(GO:0060170) |
0.1 | 1.2 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
0.1 | 0.4 | GO:0044666 | MLL3/4 complex(GO:0044666) |
0.1 | 0.1 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
0.1 | 1.2 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.1 | 0.1 | GO:1990423 | RZZ complex(GO:1990423) |
0.1 | 0.1 | GO:0097513 | myosin II filament(GO:0097513) |
0.1 | 1.1 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
0.1 | 0.8 | GO:0036038 | MKS complex(GO:0036038) |
0.1 | 3.1 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
0.1 | 0.2 | GO:1990130 | Iml1 complex(GO:1990130) |
0.1 | 1.2 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.1 | 0.4 | GO:0030008 | TRAPP complex(GO:0030008) |
0.1 | 0.2 | GO:0071546 | pi-body(GO:0071546) |
0.1 | 0.6 | GO:0032426 | stereocilium tip(GO:0032426) |
0.1 | 0.6 | GO:0005875 | microtubule associated complex(GO:0005875) |
0.1 | 0.7 | GO:0005640 | nuclear outer membrane(GO:0005640) |
0.1 | 0.2 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.1 | 0.4 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.1 | 0.2 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
0.1 | 0.3 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
0.1 | 0.3 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.1 | 0.1 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.1 | 0.8 | GO:0005682 | U5 snRNP(GO:0005682) |
0.1 | 0.9 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
0.1 | 0.2 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
0.1 | 0.4 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.1 | 0.2 | GO:0005726 | perichromatin fibrils(GO:0005726) |
0.1 | 0.2 | GO:0016939 | kinesin II complex(GO:0016939) |
0.1 | 0.6 | GO:0017119 | Golgi transport complex(GO:0017119) |
0.1 | 0.2 | GO:0070876 | SOSS complex(GO:0070876) |
0.1 | 0.4 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.1 | 2.2 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.1 | 0.4 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.1 | 0.4 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.1 | 0.8 | GO:0000145 | exocyst(GO:0000145) |
0.1 | 0.3 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.1 | 0.5 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
0.1 | 0.1 | GO:0001739 | sex chromatin(GO:0001739) |
0.1 | 0.1 | GO:0044327 | dendritic spine head(GO:0044327) |
0.1 | 0.7 | GO:0043196 | varicosity(GO:0043196) |
0.1 | 0.3 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
0.1 | 0.7 | GO:0035371 | microtubule plus-end(GO:0035371) |
0.1 | 0.3 | GO:0070820 | tertiary granule(GO:0070820) |
0.1 | 0.3 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.1 | 0.7 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
0.0 | 0.6 | GO:0000242 | pericentriolar material(GO:0000242) |
0.0 | 0.1 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.0 | 0.6 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.0 | 0.3 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
0.0 | 0.2 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
0.0 | 0.8 | GO:0002102 | podosome(GO:0002102) |
0.0 | 0.2 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
0.0 | 0.3 | GO:0032009 | early phagosome(GO:0032009) |
0.0 | 0.4 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.0 | 0.1 | GO:0035061 | interchromatin granule(GO:0035061) |
0.0 | 0.2 | GO:0032433 | filopodium tip(GO:0032433) |
0.0 | 0.4 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.0 | 0.0 | GO:0000125 | PCAF complex(GO:0000125) |
0.0 | 0.6 | GO:0030914 | STAGA complex(GO:0030914) |
0.0 | 0.4 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.0 | 0.1 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.0 | 0.7 | GO:0031519 | PcG protein complex(GO:0031519) |
0.0 | 1.2 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
0.0 | 0.0 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.0 | 0.4 | GO:0000124 | SAGA complex(GO:0000124) |
0.0 | 0.3 | GO:0097208 | alveolar lamellar body(GO:0097208) |
0.0 | 0.3 | GO:0031931 | TORC1 complex(GO:0031931) |
0.0 | 0.3 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.0 | 0.1 | GO:0038201 | TOR complex(GO:0038201) |
0.0 | 0.1 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
0.0 | 0.1 | GO:0044294 | dendritic growth cone(GO:0044294) |
0.0 | 0.3 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.0 | 0.2 | GO:0001652 | granular component(GO:0001652) |
0.0 | 0.2 | GO:0000938 | GARP complex(GO:0000938) |
0.0 | 0.6 | GO:0044453 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) nuclear membrane part(GO:0044453) |
0.0 | 0.3 | GO:0031083 | BLOC-1 complex(GO:0031083) |
0.0 | 1.5 | GO:0005762 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
0.0 | 0.2 | GO:0044308 | axonal spine(GO:0044308) |
0.0 | 1.5 | GO:0031201 | SNARE complex(GO:0031201) |
0.0 | 0.2 | GO:0035339 | SPOTS complex(GO:0035339) |
0.0 | 0.1 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
0.0 | 0.1 | GO:0045251 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
0.0 | 0.3 | GO:0097539 | ciliary transition fiber(GO:0097539) |
0.0 | 0.5 | GO:0010369 | chromocenter(GO:0010369) |
0.0 | 0.3 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.0 | 0.7 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.0 | 0.1 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
0.0 | 0.4 | GO:0008278 | cohesin complex(GO:0008278) |
0.0 | 0.1 | GO:0043083 | synaptic cleft(GO:0043083) |
0.0 | 0.4 | GO:0000777 | condensed chromosome kinetochore(GO:0000777) |
0.0 | 0.1 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
0.0 | 0.2 | GO:0005686 | U2 snRNP(GO:0005686) |
0.0 | 0.5 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
0.0 | 0.3 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.0 | 0.1 | GO:0005879 | axonemal microtubule(GO:0005879) |
0.0 | 0.1 | GO:0032389 | MutLalpha complex(GO:0032389) |
0.0 | 0.4 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.0 | 0.3 | GO:0031143 | pseudopodium(GO:0031143) |
0.0 | 0.1 | GO:0031211 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
0.0 | 1.5 | GO:0030964 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
0.0 | 0.2 | GO:0005796 | Golgi lumen(GO:0005796) |
0.0 | 3.0 | GO:0030176 | integral component of endoplasmic reticulum membrane(GO:0030176) |
0.0 | 0.5 | GO:0044216 | other organism(GO:0044215) other organism cell(GO:0044216) other organism part(GO:0044217) |
0.0 | 0.3 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
0.0 | 0.3 | GO:0031616 | spindle pole centrosome(GO:0031616) |
0.0 | 0.1 | GO:0008274 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
0.0 | 0.4 | GO:0016514 | SWI/SNF complex(GO:0016514) |
0.0 | 1.2 | GO:0045171 | intercellular bridge(GO:0045171) |
0.0 | 1.2 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
0.0 | 0.1 | GO:0005766 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
0.0 | 0.1 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.0 | 0.2 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.0 | 6.6 | GO:0005789 | endoplasmic reticulum membrane(GO:0005789) |
0.0 | 0.3 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
0.0 | 0.3 | GO:0097386 | glial cell projection(GO:0097386) |
0.0 | 1.4 | GO:0000922 | spindle pole(GO:0000922) |
0.0 | 1.8 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
0.0 | 1.0 | GO:0005902 | microvillus(GO:0005902) |
0.0 | 3.7 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
0.0 | 0.4 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
0.0 | 2.2 | GO:0005581 | collagen trimer(GO:0005581) |
0.0 | 0.3 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
0.0 | 0.1 | GO:0005606 | laminin-1 complex(GO:0005606) |
0.0 | 0.4 | GO:0032420 | stereocilium(GO:0032420) |
0.0 | 0.2 | GO:0035859 | Seh1-associated complex(GO:0035859) |
0.0 | 0.2 | GO:0005916 | fascia adherens(GO:0005916) |
0.0 | 1.0 | GO:0032153 | cell division site(GO:0032153) cell division site part(GO:0032155) |
0.0 | 0.6 | GO:0031941 | filamentous actin(GO:0031941) |
0.0 | 2.3 | GO:0005930 | axoneme(GO:0005930) ciliary plasm(GO:0097014) |
0.0 | 0.6 | GO:0070469 | respiratory chain(GO:0070469) |
0.0 | 0.2 | GO:0070938 | contractile ring(GO:0070938) |
0.0 | 0.2 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
0.0 | 0.5 | GO:0005719 | nuclear euchromatin(GO:0005719) |
0.0 | 0.1 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
0.0 | 1.5 | GO:0030863 | cortical cytoskeleton(GO:0030863) |
0.0 | 2.6 | GO:0005759 | mitochondrial matrix(GO:0005759) |
0.0 | 0.8 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
0.0 | 0.3 | GO:0031045 | dense core granule(GO:0031045) |
0.0 | 0.1 | GO:0048179 | activin receptor complex(GO:0048179) |
0.0 | 1.1 | GO:0043198 | dendritic shaft(GO:0043198) |
0.0 | 0.1 | GO:0019815 | B cell receptor complex(GO:0019815) |
0.0 | 0.5 | GO:0005637 | nuclear inner membrane(GO:0005637) |
0.0 | 1.1 | GO:0005777 | peroxisome(GO:0005777) microbody(GO:0042579) |
0.0 | 0.1 | GO:0043219 | lateral loop(GO:0043219) |
0.0 | 1.1 | GO:0034707 | chloride channel complex(GO:0034707) |
0.0 | 0.3 | GO:0045259 | proton-transporting ATP synthase complex(GO:0045259) |
0.0 | 0.1 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
0.0 | 0.0 | GO:0044393 | microspike(GO:0044393) |
0.0 | 0.1 | GO:0042629 | mast cell granule(GO:0042629) |
0.0 | 1.4 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
0.0 | 0.7 | GO:0005876 | spindle microtubule(GO:0005876) |
0.0 | 0.2 | GO:0036128 | CatSper complex(GO:0036128) |
0.0 | 0.2 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.0 | 0.2 | GO:0071437 | invadopodium(GO:0071437) |
0.0 | 0.5 | GO:0005865 | striated muscle thin filament(GO:0005865) |
0.0 | 0.0 | GO:1902710 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
0.0 | 0.0 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
0.0 | 0.2 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.0 | 0.1 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.0 | 0.1 | GO:0097546 | ciliary base(GO:0097546) |
0.0 | 0.2 | GO:0048475 | membrane coat(GO:0030117) coated membrane(GO:0048475) |
0.0 | 0.6 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.0 | 0.1 | GO:0097209 | epidermal lamellar body(GO:0097209) |
0.0 | 1.8 | GO:0016607 | nuclear speck(GO:0016607) |
0.0 | 1.0 | GO:0055037 | recycling endosome(GO:0055037) |
0.0 | 0.2 | GO:0051233 | spindle midzone(GO:0051233) |
0.0 | 0.2 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
0.0 | 0.2 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.0 | 0.0 | GO:0000802 | transverse filament(GO:0000802) |
0.0 | 0.2 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
0.0 | 0.2 | GO:0032806 | carboxy-terminal domain protein kinase complex(GO:0032806) |
0.0 | 0.1 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
0.0 | 0.1 | GO:0001939 | female pronucleus(GO:0001939) |
0.0 | 0.1 | GO:0043159 | acrosomal matrix(GO:0043159) |
0.0 | 0.6 | GO:0005871 | kinesin complex(GO:0005871) |
0.0 | 0.1 | GO:0043203 | axon hillock(GO:0043203) |
0.0 | 0.7 | GO:0042641 | actomyosin(GO:0042641) |
0.0 | 0.0 | GO:0097470 | ribbon synapse(GO:0097470) |
0.0 | 0.0 | GO:1990752 | microtubule end(GO:1990752) |
0.0 | 0.2 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.0 | 0.1 | GO:0045293 | mRNA editing complex(GO:0045293) |
0.0 | 0.1 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.0 | 0.3 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
0.0 | 0.0 | GO:0035748 | myelin sheath abaxonal region(GO:0035748) |
0.0 | 0.0 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
0.0 | 0.0 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.0 | 0.1 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
0.0 | 0.1 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.0 | 0.1 | GO:0070847 | core mediator complex(GO:0070847) |
0.0 | 0.2 | GO:0044295 | axonal growth cone(GO:0044295) |
0.0 | 0.2 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.0 | 0.4 | GO:0030686 | 90S preribosome(GO:0030686) |
0.0 | 0.1 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
0.0 | 0.9 | GO:0043195 | terminal bouton(GO:0043195) |
0.0 | 0.2 | GO:0043205 | fibril(GO:0043205) |
0.0 | 0.1 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
0.0 | 0.1 | GO:0071953 | elastic fiber(GO:0071953) |
0.0 | 2.3 | GO:0005874 | microtubule(GO:0005874) |
0.0 | 0.3 | GO:0016459 | myosin complex(GO:0016459) |
0.0 | 0.1 | GO:0034719 | SMN-Sm protein complex(GO:0034719) |
0.0 | 0.0 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
0.0 | 12.0 | GO:0005739 | mitochondrion(GO:0005739) |
0.0 | 1.1 | GO:0031225 | anchored component of membrane(GO:0031225) |
0.0 | 0.1 | GO:0042588 | zymogen granule(GO:0042588) |
0.0 | 0.1 | GO:0030904 | retromer complex(GO:0030904) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.0 | 3.0 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
0.7 | 2.1 | GO:0070644 | vitamin D response element binding(GO:0070644) |
0.6 | 1.8 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
0.5 | 1.6 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.5 | 2.0 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
0.5 | 1.0 | GO:0038181 | bile acid receptor activity(GO:0038181) |
0.5 | 1.9 | GO:0047105 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
0.4 | 1.3 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.4 | 0.4 | GO:0030792 | methylarsonite methyltransferase activity(GO:0030792) |
0.4 | 1.2 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
0.4 | 1.2 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
0.4 | 1.2 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.4 | 4.9 | GO:0015643 | toxic substance binding(GO:0015643) |
0.4 | 1.1 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.4 | 2.2 | GO:0004064 | arylesterase activity(GO:0004064) |
0.4 | 1.1 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.3 | 1.0 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.3 | 2.4 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
0.3 | 2.0 | GO:0031685 | adenosine receptor binding(GO:0031685) |
0.3 | 1.0 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.3 | 1.0 | GO:0004771 | sterol esterase activity(GO:0004771) |
0.3 | 1.9 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
0.3 | 1.8 | GO:0016151 | nickel cation binding(GO:0016151) |
0.3 | 0.3 | GO:0018423 | protein C-terminal leucine carboxyl O-methyltransferase activity(GO:0018423) |
0.3 | 1.2 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.3 | 0.9 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
0.3 | 0.9 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
0.3 | 1.2 | GO:0070546 | L-phenylalanine aminotransferase activity(GO:0070546) |
0.3 | 3.9 | GO:0070402 | NADPH binding(GO:0070402) |
0.3 | 0.3 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
0.3 | 0.8 | GO:0035514 | DNA demethylase activity(GO:0035514) |
0.3 | 2.4 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.3 | 0.5 | GO:0008545 | JUN kinase kinase activity(GO:0008545) |
0.3 | 0.8 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
0.3 | 1.1 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
0.3 | 1.5 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.3 | 1.3 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
0.3 | 0.8 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
0.3 | 0.8 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
0.2 | 0.7 | GO:0016015 | morphogen activity(GO:0016015) |
0.2 | 0.7 | GO:0055100 | adiponectin binding(GO:0055100) |
0.2 | 1.9 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
0.2 | 0.7 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.2 | 0.7 | GO:0016822 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
0.2 | 1.4 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
0.2 | 0.7 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.2 | 2.9 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
0.2 | 0.4 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
0.2 | 0.7 | GO:0005347 | ATP transmembrane transporter activity(GO:0005347) |
0.2 | 0.7 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
0.2 | 0.9 | GO:0050815 | phosphoserine binding(GO:0050815) |
0.2 | 0.9 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.2 | 1.3 | GO:0035473 | lipase binding(GO:0035473) |
0.2 | 0.8 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
0.2 | 0.8 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.2 | 0.6 | GO:0050692 | DBD domain binding(GO:0050692) |
0.2 | 1.0 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
0.2 | 0.2 | GO:0046921 | alpha-(1->6)-fucosyltransferase activity(GO:0046921) |
0.2 | 1.0 | GO:0004396 | glucokinase activity(GO:0004340) hexokinase activity(GO:0004396) |
0.2 | 1.4 | GO:0001849 | complement component C1q binding(GO:0001849) |
0.2 | 1.9 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
0.2 | 2.1 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.2 | 1.5 | GO:0016662 | oxidoreductase activity, acting on other nitrogenous compounds as donors, cytochrome as acceptor(GO:0016662) |
0.2 | 0.6 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
0.2 | 0.9 | GO:0004331 | fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
0.2 | 0.9 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
0.2 | 0.4 | GO:0032551 | UTP binding(GO:0002134) pyrimidine ribonucleoside binding(GO:0032551) |
0.2 | 0.7 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.2 | 0.9 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
0.2 | 0.9 | GO:0017040 | ceramidase activity(GO:0017040) |
0.2 | 0.5 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.2 | 0.5 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
0.2 | 0.5 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
0.2 | 1.4 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.2 | 0.5 | GO:0030911 | TPR domain binding(GO:0030911) |
0.2 | 0.5 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
0.2 | 0.3 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.2 | 0.5 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.2 | 1.5 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.2 | 0.7 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
0.2 | 0.5 | GO:0019862 | IgA binding(GO:0019862) |
0.2 | 1.7 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.2 | 0.5 | GO:0019959 | interleukin-8 binding(GO:0019959) |
0.2 | 0.8 | GO:0070191 | methionine-R-sulfoxide reductase activity(GO:0070191) |
0.2 | 0.5 | GO:0005119 | smoothened binding(GO:0005119) |
0.2 | 1.0 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
0.2 | 0.6 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
0.2 | 1.3 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.2 | 0.2 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.2 | 0.8 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.2 | 0.5 | GO:0008142 | oxysterol binding(GO:0008142) |
0.2 | 0.8 | GO:0046790 | virion binding(GO:0046790) |
0.2 | 0.6 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
0.2 | 0.5 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.1 | 0.9 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
0.1 | 0.1 | GO:0000009 | alpha-1,6-mannosyltransferase activity(GO:0000009) |
0.1 | 0.1 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
0.1 | 0.4 | GO:0004104 | cholinesterase activity(GO:0004104) |
0.1 | 0.6 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
0.1 | 0.6 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
0.1 | 1.4 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
0.1 | 0.4 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
0.1 | 0.4 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
0.1 | 0.6 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.1 | 1.1 | GO:0035174 | histone serine kinase activity(GO:0035174) |
0.1 | 0.5 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
0.1 | 0.4 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
0.1 | 0.7 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
0.1 | 0.4 | GO:0071253 | connexin binding(GO:0071253) |
0.1 | 0.4 | GO:0018593 | fluorene oxygenase activity(GO:0018585) mono-butyltin dioxygenase activity(GO:0018586) tri-n-butyltin dioxygenase activity(GO:0018588) di-n-butyltin dioxygenase activity(GO:0018589) methylsilanetriol hydroxylase activity(GO:0018590) methyl tertiary butyl ether 3-monooxygenase activity(GO:0018591) 4-nitrocatechol 4-monooxygenase activity(GO:0018592) 4-chlorophenoxyacetate monooxygenase activity(GO:0018593) tert-butanol 2-monooxygenase activity(GO:0018594) alpha-pinene monooxygenase activity(GO:0018595) dimethylsilanediol hydroxylase activity(GO:0018596) ammonia monooxygenase activity(GO:0018597) hydroxymethylsilanetriol oxidase activity(GO:0018598) 2-hydroxyisobutyrate 3-monooxygenase activity(GO:0018599) alpha-pinene dehydrogenase activity(GO:0018600) bisphenol A hydroxylase B activity(GO:0034559) 2,2-bis(4-hydroxyphenyl)-1-propanol hydroxylase activity(GO:0034562) 9-fluorenone-3,4-dioxygenase activity(GO:0034786) anthracene 9,10-dioxygenase activity(GO:0034816) 2-(methylthio)benzothiazole monooxygenase activity(GO:0034857) 2-hydroxybenzothiazole monooxygenase activity(GO:0034858) benzothiazole monooxygenase activity(GO:0034859) 2,6-dihydroxybenzothiazole monooxygenase activity(GO:0034862) pinacolone 5-monooxygenase activity(GO:0034870) thioacetamide S-oxygenase activity(GO:0034873) thioacetamide S-oxide S-oxygenase activity(GO:0034874) endosulfan monooxygenase I activity(GO:0034888) N-nitrodimethylamine hydroxylase activity(GO:0034893) 4-(1-ethyl-1,4-dimethyl-pentyl)phenol monoxygenase activity(GO:0034897) endosulfan ether monooxygenase activity(GO:0034903) pyrene 4,5-monooxygenase activity(GO:0034925) pyrene 1,2-monooxygenase activity(GO:0034927) 1-hydroxypyrene 6,7-monooxygenase activity(GO:0034928) 1-hydroxypyrene 7,8-monooxygenase activity(GO:0034929) phenylboronic acid monooxygenase activity(GO:0034950) spheroidene monooxygenase activity(GO:0043823) |
0.1 | 0.3 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
0.1 | 0.3 | GO:0070905 | serine binding(GO:0070905) |
0.1 | 0.4 | GO:0070137 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
0.1 | 0.4 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.1 | 0.4 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
0.1 | 0.9 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.1 | 2.5 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
0.1 | 0.5 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
0.1 | 0.5 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.1 | 0.1 | GO:0043495 | protein anchor(GO:0043495) |
0.1 | 0.4 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
0.1 | 0.4 | GO:0004359 | glutaminase activity(GO:0004359) |
0.1 | 0.5 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.1 | 1.5 | GO:0005542 | folic acid binding(GO:0005542) |
0.1 | 0.4 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
0.1 | 0.8 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
0.1 | 0.4 | GO:0009041 | uridylate kinase activity(GO:0009041) |
0.1 | 0.5 | GO:0050897 | cobalt ion binding(GO:0050897) |
0.1 | 1.6 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.1 | 0.9 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
0.1 | 0.5 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
0.1 | 0.4 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
0.1 | 0.7 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.1 | 0.7 | GO:0043047 | single-stranded telomeric DNA binding(GO:0043047) |
0.1 | 1.4 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
0.1 | 0.6 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.1 | 0.3 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
0.1 | 0.6 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.1 | 0.6 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
0.1 | 0.3 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
0.1 | 0.2 | GO:0001226 | RNA polymerase II transcription corepressor binding(GO:0001226) |
0.1 | 0.2 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
0.1 | 2.9 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
0.1 | 0.7 | GO:0030957 | Tat protein binding(GO:0030957) |
0.1 | 1.4 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.1 | 0.2 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
0.1 | 0.4 | GO:0061665 | SUMO ligase activity(GO:0061665) |
0.1 | 0.3 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
0.1 | 0.4 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.1 | 0.2 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.1 | 0.5 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.1 | 0.4 | GO:0070052 | collagen V binding(GO:0070052) |
0.1 | 0.4 | GO:0008934 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
0.1 | 0.5 | GO:0032453 | histone demethylase activity (H3-K4 specific)(GO:0032453) |
0.1 | 0.9 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
0.1 | 3.2 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
0.1 | 0.3 | GO:0008515 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
0.1 | 0.3 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.1 | 0.4 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
0.1 | 3.2 | GO:0080032 | prenylcysteine methylesterase activity(GO:0010296) 1-oxa-2-oxocycloheptane lactonase activity(GO:0018731) sulfolactone hydrolase activity(GO:0018732) butyrolactone hydrolase activity(GO:0018734) endosulfan lactone lactonase activity(GO:0034892) L-ascorbate 6-phosphate lactonase activity(GO:0035460) Ser-tRNA(Thr) hydrolase activity(GO:0043905) Ala-tRNA(Pro) hydrolase activity(GO:0043906) Cys-tRNA(Pro) hydrolase activity(GO:0043907) Ser(Gly)-tRNA(Ala) hydrolase activity(GO:0043908) all-trans-retinyl-palmitate hydrolase, all-trans-retinol forming activity(GO:0047376) mannosyl-oligosaccharide 1,6-alpha-mannosidase activity(GO:0052767) mannosyl-oligosaccharide 1,3-alpha-mannosidase activity(GO:0052768) methyl indole-3-acetate esterase activity(GO:0080030) methyl salicylate esterase activity(GO:0080031) methyl jasmonate esterase activity(GO:0080032) |
0.1 | 1.6 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
0.1 | 3.2 | GO:0042169 | SH2 domain binding(GO:0042169) |
0.1 | 0.3 | GO:0004849 | uridine kinase activity(GO:0004849) |
0.1 | 0.9 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
0.1 | 0.2 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
0.1 | 0.2 | GO:0032190 | acrosin binding(GO:0032190) |
0.1 | 0.2 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
0.1 | 3.1 | GO:0051059 | NF-kappaB binding(GO:0051059) |
0.1 | 0.1 | GO:0032405 | MutLalpha complex binding(GO:0032405) |
0.1 | 1.7 | GO:0004889 | acetylcholine-activated cation-selective channel activity(GO:0004889) |
0.1 | 0.4 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
0.1 | 0.3 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.1 | 0.4 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.1 | 0.3 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
0.1 | 0.4 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
0.1 | 0.5 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
0.1 | 0.4 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
0.1 | 0.6 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.1 | 0.5 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.1 | 0.7 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.1 | 0.4 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.1 | 0.7 | GO:0002162 | dystroglycan binding(GO:0002162) |
0.1 | 1.5 | GO:0005112 | Notch binding(GO:0005112) |
0.1 | 0.7 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
0.1 | 0.5 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.1 | 1.0 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
0.1 | 0.4 | GO:0031781 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
0.1 | 0.6 | GO:0035197 | siRNA binding(GO:0035197) |
0.1 | 1.6 | GO:0052890 | oxidoreductase activity, acting on the CH-CH group of donors, with a flavin as acceptor(GO:0052890) |
0.1 | 0.3 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
0.1 | 0.4 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
0.1 | 3.4 | GO:0030170 | pyridoxal phosphate binding(GO:0030170) |
0.1 | 0.6 | GO:0102337 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
0.1 | 0.7 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.1 | 0.5 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.1 | 0.3 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.1 | 0.3 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
0.1 | 0.1 | GO:0032564 | dATP binding(GO:0032564) |
0.1 | 0.8 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.1 | 0.1 | GO:0015142 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.1 | 0.2 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.1 | 0.3 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
0.1 | 0.8 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
0.1 | 0.2 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
0.1 | 1.7 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.1 | 0.3 | GO:0000182 | rDNA binding(GO:0000182) |
0.1 | 0.4 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
0.1 | 0.5 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
0.1 | 0.3 | GO:0071614 | linoleic acid epoxygenase activity(GO:0071614) |
0.1 | 0.9 | GO:0070411 | I-SMAD binding(GO:0070411) |
0.1 | 0.3 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.1 | 0.3 | GO:0052851 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
0.1 | 0.3 | GO:0019002 | GMP binding(GO:0019002) |
0.1 | 0.5 | GO:0003910 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
0.1 | 0.2 | GO:0008409 | 5'-3' exonuclease activity(GO:0008409) |
0.1 | 0.3 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
0.1 | 0.4 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.1 | 1.5 | GO:0005527 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
0.1 | 1.4 | GO:0004532 | exoribonuclease activity(GO:0004532) |
0.1 | 0.2 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
0.1 | 0.2 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
0.1 | 0.4 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) |
0.1 | 1.3 | GO:0008308 | voltage-gated anion channel activity(GO:0008308) |
0.1 | 1.3 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.1 | 0.3 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.1 | 0.3 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.1 | 0.4 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
0.1 | 0.2 | GO:0019767 | IgE receptor activity(GO:0019767) |
0.1 | 0.6 | GO:0005338 | nucleotide-sugar transmembrane transporter activity(GO:0005338) |
0.1 | 0.2 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
0.1 | 0.6 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.1 | 0.2 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
0.1 | 1.7 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.1 | 1.0 | GO:0043295 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
0.1 | 0.5 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
0.1 | 1.2 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
0.1 | 0.1 | GO:0030984 | kininogen binding(GO:0030984) |
0.1 | 0.2 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
0.1 | 0.2 | GO:0031013 | troponin I binding(GO:0031013) |
0.1 | 0.4 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
0.1 | 0.3 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
0.1 | 0.2 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
0.1 | 0.9 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
0.1 | 0.4 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
0.1 | 0.2 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
0.1 | 1.0 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
0.1 | 0.1 | GO:0019187 | beta-1,4-mannosyltransferase activity(GO:0019187) |
0.1 | 0.4 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.1 | 0.2 | GO:0043891 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
0.1 | 0.2 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
0.1 | 0.2 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.1 | 0.1 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
0.1 | 0.4 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.1 | 0.1 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
0.1 | 0.5 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
0.1 | 0.6 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
0.1 | 0.3 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
0.1 | 0.4 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.1 | 0.5 | GO:0008430 | selenium binding(GO:0008430) |
0.1 | 1.1 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.1 | 1.1 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.1 | 0.4 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
0.1 | 0.1 | GO:0015141 | succinate transmembrane transporter activity(GO:0015141) |
0.1 | 0.2 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
0.1 | 0.1 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
0.1 | 0.3 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.1 | 1.0 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
0.1 | 0.6 | GO:0001223 | transcription coactivator binding(GO:0001223) |
0.1 | 0.3 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.1 | 0.7 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.1 | 0.2 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
0.1 | 0.4 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
0.1 | 0.1 | GO:0097016 | L27 domain binding(GO:0097016) |
0.1 | 1.6 | GO:0016702 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of two atoms of oxygen(GO:0016702) |
0.1 | 0.3 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
0.1 | 0.3 | GO:0003696 | satellite DNA binding(GO:0003696) |
0.1 | 0.3 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
0.1 | 0.5 | GO:0031078 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
0.1 | 0.1 | GO:0004705 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
0.1 | 0.5 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.1 | 0.3 | GO:0070513 | death domain binding(GO:0070513) |
0.1 | 0.3 | GO:0070728 | leucine binding(GO:0070728) |
0.1 | 0.7 | GO:0034946 | 2-oxoglutaryl-CoA thioesterase activity(GO:0034843) 2,4,4-trimethyl-3-oxopentanoyl-CoA thioesterase activity(GO:0034869) 3-isopropylbut-3-enoyl-CoA thioesterase activity(GO:0034946) glutaryl-CoA hydrolase activity(GO:0044466) |
0.1 | 0.3 | GO:0031404 | chloride ion binding(GO:0031404) |
0.1 | 0.5 | GO:0015321 | sodium-dependent phosphate transmembrane transporter activity(GO:0015321) |
0.1 | 0.2 | GO:0051430 | corticotropin-releasing hormone receptor 1 binding(GO:0051430) |
0.1 | 0.1 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
0.1 | 0.2 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
0.1 | 0.1 | GO:0055103 | ligase regulator activity(GO:0055103) ubiquitin-protein transferase regulator activity(GO:0055106) |
0.1 | 0.4 | GO:0008097 | 5S rRNA binding(GO:0008097) |
0.1 | 0.6 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.1 | 0.5 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.1 | 0.2 | GO:0019961 | interferon binding(GO:0019961) |
0.1 | 0.4 | GO:0016408 | C-acyltransferase activity(GO:0016408) |
0.1 | 0.2 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
0.1 | 0.4 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
0.1 | 1.0 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
0.1 | 1.5 | GO:0004177 | aminopeptidase activity(GO:0004177) |
0.1 | 1.2 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
0.1 | 0.3 | GO:0000339 | RNA cap binding(GO:0000339) |
0.1 | 0.2 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
0.1 | 0.6 | GO:0071814 | lipoprotein particle binding(GO:0071813) protein-lipid complex binding(GO:0071814) |
0.1 | 0.1 | GO:0070878 | primary miRNA binding(GO:0070878) |
0.1 | 0.2 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
0.1 | 0.2 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.1 | 0.8 | GO:0043274 | phospholipase binding(GO:0043274) |
0.1 | 0.7 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
0.1 | 0.1 | GO:0016289 | CoA hydrolase activity(GO:0016289) |
0.1 | 0.4 | GO:0001640 | adenylate cyclase inhibiting G-protein coupled glutamate receptor activity(GO:0001640) |
0.1 | 0.2 | GO:0015205 | purine nucleobase transmembrane transporter activity(GO:0005345) pyrimidine nucleobase transmembrane transporter activity(GO:0005350) nucleobase transmembrane transporter activity(GO:0015205) |
0.1 | 0.6 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.1 | 0.2 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
0.1 | 0.2 | GO:0035877 | death effector domain binding(GO:0035877) |
0.1 | 0.4 | GO:0048156 | tau protein binding(GO:0048156) |
0.1 | 0.1 | GO:0001016 | RNA polymerase III regulatory region DNA binding(GO:0001016) |
0.1 | 0.4 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.1 | 0.5 | GO:0005523 | tropomyosin binding(GO:0005523) |
0.1 | 0.8 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
0.1 | 1.4 | GO:0042056 | chemoattractant activity(GO:0042056) |
0.1 | 0.1 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.1 | 0.2 | GO:0004969 | histamine receptor activity(GO:0004969) |
0.1 | 0.2 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
0.1 | 0.3 | GO:0098634 | protein binding involved in cell-matrix adhesion(GO:0098634) |
0.1 | 0.2 | GO:0031705 | bombesin receptor binding(GO:0031705) |
0.1 | 0.1 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
0.1 | 1.9 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
0.1 | 0.6 | GO:0070182 | DNA polymerase binding(GO:0070182) |
0.1 | 0.2 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
0.1 | 5.3 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
0.1 | 0.1 | GO:0000405 | bubble DNA binding(GO:0000405) |
0.1 | 0.3 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
0.1 | 0.1 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
0.1 | 0.1 | GO:0016420 | S-malonyltransferase activity(GO:0016419) malonyltransferase activity(GO:0016420) |
0.1 | 0.2 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
0.1 | 0.1 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
0.1 | 0.5 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
0.1 | 0.3 | GO:0034185 | apolipoprotein binding(GO:0034185) |
0.1 | 0.7 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.1 | 0.2 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
0.1 | 1.1 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.1 | 0.2 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
0.1 | 0.4 | GO:0042171 | lysophosphatidic acid acyltransferase activity(GO:0042171) |
0.1 | 0.4 | GO:0017166 | vinculin binding(GO:0017166) |
0.1 | 0.3 | GO:0016681 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.1 | 0.3 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
0.1 | 0.1 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
0.1 | 0.2 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
0.1 | 0.2 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
0.1 | 0.4 | GO:0034062 | RNA polymerase activity(GO:0034062) |
0.1 | 0.1 | GO:0098748 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
0.1 | 0.4 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
0.1 | 0.1 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
0.1 | 0.4 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
0.1 | 0.3 | GO:0005113 | patched binding(GO:0005113) |
0.1 | 0.4 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
0.1 | 0.1 | GO:0042054 | histone methyltransferase activity(GO:0042054) |
0.1 | 0.2 | GO:0004096 | catalase activity(GO:0004096) |
0.1 | 0.3 | GO:0050051 | leukotriene-B4 20-monooxygenase activity(GO:0050051) |
0.1 | 0.4 | GO:0044548 | S100 protein binding(GO:0044548) |
0.1 | 0.2 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.1 | 0.4 | GO:0030492 | hemoglobin binding(GO:0030492) |
0.1 | 0.2 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
0.1 | 0.8 | GO:0008200 | ion channel inhibitor activity(GO:0008200) |
0.1 | 1.6 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.1 | 1.3 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.0 | 0.1 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
0.0 | 0.1 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
0.0 | 1.6 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
0.0 | 0.1 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
0.0 | 0.5 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
0.0 | 0.5 | GO:0005351 | sugar:proton symporter activity(GO:0005351) |
0.0 | 0.9 | GO:0004364 | glutathione transferase activity(GO:0004364) |
0.0 | 0.5 | GO:0005451 | monovalent cation:proton antiporter activity(GO:0005451) |
0.0 | 0.2 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.0 | 0.6 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
0.0 | 0.7 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
0.0 | 0.1 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
0.0 | 1.9 | GO:0048306 | calcium-dependent protein binding(GO:0048306) |
0.0 | 0.1 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
0.0 | 0.1 | GO:0051380 | beta-adrenergic receptor activity(GO:0004939) epinephrine binding(GO:0051379) norepinephrine binding(GO:0051380) |
0.0 | 0.5 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
0.0 | 0.1 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
0.0 | 0.1 | GO:0004936 | alpha-adrenergic receptor activity(GO:0004936) alpha2-adrenergic receptor activity(GO:0004938) |
0.0 | 0.6 | GO:0003756 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
0.0 | 0.1 | GO:0004967 | glucagon receptor activity(GO:0004967) |
0.0 | 0.2 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
0.0 | 0.1 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
0.0 | 0.7 | GO:0071949 | FAD binding(GO:0071949) |
0.0 | 0.0 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
0.0 | 0.2 | GO:0016782 | transferase activity, transferring sulfur-containing groups(GO:0016782) |
0.0 | 0.2 | GO:0016997 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
0.0 | 0.2 | GO:0002054 | nucleobase binding(GO:0002054) |
0.0 | 0.4 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.0 | 0.5 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
0.0 | 0.2 | GO:0070492 | oligosaccharide binding(GO:0070492) |
0.0 | 0.0 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
0.0 | 0.2 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
0.0 | 0.1 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
0.0 | 0.3 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
0.0 | 0.3 | GO:0005123 | death receptor binding(GO:0005123) |
0.0 | 0.9 | GO:0015002 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.0 | 0.3 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.0 | 0.2 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
0.0 | 0.1 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
0.0 | 0.1 | GO:0034191 | apolipoprotein A-I receptor binding(GO:0034191) |
0.0 | 0.2 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.0 | 0.1 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
0.0 | 0.6 | GO:0030332 | cyclin binding(GO:0030332) |
0.0 | 0.1 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.0 | 0.1 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
0.0 | 0.2 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
0.0 | 0.1 | GO:0042289 | MHC class II protein binding(GO:0042289) |
0.0 | 0.0 | GO:0031748 | D1 dopamine receptor binding(GO:0031748) |
0.0 | 0.1 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.0 | 1.0 | GO:0016751 | S-succinyltransferase activity(GO:0016751) |
0.0 | 0.7 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
0.0 | 0.8 | GO:0017147 | Wnt-protein binding(GO:0017147) |
0.0 | 1.4 | GO:0005109 | frizzled binding(GO:0005109) |
0.0 | 0.5 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
0.0 | 0.1 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.0 | 0.0 | GO:2001070 | starch binding(GO:2001070) |
0.0 | 0.7 | GO:0003785 | actin monomer binding(GO:0003785) |
0.0 | 0.1 | GO:0050681 | androgen receptor binding(GO:0050681) |
0.0 | 0.1 | GO:0034618 | arginine binding(GO:0034618) |
0.0 | 0.3 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
0.0 | 0.5 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.0 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.0 | 0.3 | GO:0031996 | thioesterase binding(GO:0031996) |
0.0 | 0.5 | GO:0070628 | proteasome binding(GO:0070628) |
0.0 | 0.1 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
0.0 | 0.1 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
0.0 | 0.0 | GO:0008517 | folic acid transporter activity(GO:0008517) |
0.0 | 0.8 | GO:0019894 | kinesin binding(GO:0019894) |
0.0 | 2.3 | GO:0003777 | microtubule motor activity(GO:0003777) |
0.0 | 0.8 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.0 | 1.6 | GO:0017022 | myosin binding(GO:0017022) |
0.0 | 0.1 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
0.0 | 0.1 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
0.0 | 0.1 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
0.0 | 0.1 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
0.0 | 0.1 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.0 | 0.8 | GO:0048487 | beta-tubulin binding(GO:0048487) |
0.0 | 1.5 | GO:0019003 | GDP binding(GO:0019003) |
0.0 | 0.0 | GO:0009378 | four-way junction helicase activity(GO:0009378) |
0.0 | 0.1 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.0 | 0.1 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.0 | 0.1 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
0.0 | 0.8 | GO:0019239 | deaminase activity(GO:0019239) |
0.0 | 0.8 | GO:0001540 | beta-amyloid binding(GO:0001540) |
0.0 | 0.2 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.0 | 0.5 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
0.0 | 0.9 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
0.0 | 2.8 | GO:0008175 | tRNA methyltransferase activity(GO:0008175) |
0.0 | 0.8 | GO:0019707 | protein-cysteine S-acyltransferase activity(GO:0019707) |
0.0 | 0.1 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
0.0 | 0.2 | GO:0008483 | transaminase activity(GO:0008483) |
0.0 | 0.1 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
0.0 | 0.1 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
0.0 | 0.3 | GO:0016595 | glutamate binding(GO:0016595) |
0.0 | 0.1 | GO:0018685 | alkane 1-monooxygenase activity(GO:0018685) |
0.0 | 0.1 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
0.0 | 0.2 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.0 | 1.7 | GO:0043130 | ubiquitin binding(GO:0043130) |
0.0 | 0.3 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.0 | 0.3 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
0.0 | 0.1 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
0.0 | 0.1 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
0.0 | 0.0 | GO:0070699 | type II activin receptor binding(GO:0070699) |
0.0 | 0.3 | GO:0051378 | serotonin binding(GO:0051378) |
0.0 | 0.3 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
0.0 | 1.0 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
0.0 | 0.1 | GO:0001134 | transcription factor activity, transcription factor recruiting(GO:0001134) |
0.0 | 0.1 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
0.0 | 0.1 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.0 | 0.1 | GO:0034809 | enoyl-[acyl-carrier-protein] reductase activity(GO:0016631) 2,3-dihydroxy-2,3-dihydro-phenylpropionate dehydrogenase activity(GO:0018498) cis-2,3-dihydrodiol DDT dehydrogenase activity(GO:0018499) trans-9R,10R-dihydrodiolphenanthrene dehydrogenase activity(GO:0018500) cis-chlorobenzene dihydrodiol dehydrogenase activity(GO:0018501) 2,5-dichloro-2,5-cyclohexadiene-1,4-diol dehydrogenase activity(GO:0018502) trans-1,2-dihydrodiolphenanthrene dehydrogenase activity(GO:0018503) 3,4-dihydroxy-3,4-dihydrofluorene dehydrogenase activity(GO:0034790) benzo(a)pyrene-trans-11,12-dihydrodiol dehydrogenase activity(GO:0034805) benzo(a)pyrene-cis-4,5-dihydrodiol dehydrogenase activity(GO:0034809) citronellyl-CoA dehydrogenase activity(GO:0034824) menthone dehydrogenase activity(GO:0034838) phthalate 3,4-cis-dihydrodiol dehydrogenase activity(GO:0034912) cinnamate reductase activity(GO:0043786) NADPH-dependent curcumin reductase activity(GO:0052849) NADPH-dependent dihydrocurcumin reductase activity(GO:0052850) |
0.0 | 0.2 | GO:0042162 | telomeric DNA binding(GO:0042162) |
0.0 | 0.1 | GO:0036374 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
0.0 | 0.4 | GO:0043733 | alkylbase DNA N-glycosylase activity(GO:0003905) DNA-3-methylbase glycosylase activity(GO:0043733) |
0.0 | 2.2 | GO:0004725 | protein tyrosine phosphatase activity(GO:0004725) |
0.0 | 0.7 | GO:0043621 | protein self-association(GO:0043621) |
0.0 | 0.1 | GO:0016443 | bidentate ribonuclease III activity(GO:0016443) |
0.0 | 0.4 | GO:0004467 | long-chain fatty acid-CoA ligase activity(GO:0004467) |
0.0 | 0.1 | GO:0033265 | choline binding(GO:0033265) |
0.0 | 0.1 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
0.0 | 1.2 | GO:0008146 | sulfotransferase activity(GO:0008146) |
0.0 | 0.1 | GO:0043842 | Kdo transferase activity(GO:0043842) |
0.0 | 0.1 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
0.0 | 0.1 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.0 | 0.3 | GO:0051400 | BH domain binding(GO:0051400) |
0.0 | 0.1 | GO:0003964 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
0.0 | 0.1 | GO:0052723 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
0.0 | 0.1 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
0.0 | 0.1 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
0.0 | 0.1 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
0.0 | 0.1 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
0.0 | 0.2 | GO:0031432 | titin binding(GO:0031432) |
0.0 | 0.2 | GO:0044390 | ubiquitin conjugating enzyme binding(GO:0031624) ubiquitin-like protein conjugating enzyme binding(GO:0044390) |
0.0 | 0.3 | GO:0070990 | snRNP binding(GO:0070990) |
0.0 | 0.5 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
0.0 | 0.0 | GO:0032357 | oxidized DNA binding(GO:0032356) oxidized purine DNA binding(GO:0032357) |
0.0 | 0.2 | GO:0004952 | dopamine neurotransmitter receptor activity(GO:0004952) |
0.0 | 0.0 | GO:0097001 | ceramide binding(GO:0097001) |
0.0 | 0.2 | GO:0036222 | dITP diphosphatase activity(GO:0035870) XTP diphosphatase activity(GO:0036222) |
0.0 | 0.0 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) |
0.0 | 1.1 | GO:0008013 | beta-catenin binding(GO:0008013) |
0.0 | 0.2 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
0.0 | 0.2 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.0 | 0.1 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.0 | 0.0 | GO:0008187 | poly-pyrimidine tract binding(GO:0008187) |
0.0 | 0.1 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
0.0 | 0.1 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
0.0 | 1.0 | GO:0004197 | cysteine-type endopeptidase activity(GO:0004197) |
0.0 | 0.3 | GO:0008408 | 3'-5' exonuclease activity(GO:0008408) |
0.0 | 0.1 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
0.0 | 0.5 | GO:0015459 | potassium channel regulator activity(GO:0015459) |
0.0 | 0.1 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
0.0 | 0.1 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.0 | 0.8 | GO:0003774 | motor activity(GO:0003774) |
0.0 | 0.1 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.0 | 0.3 | GO:0016667 | oxidoreductase activity, acting on a sulfur group of donors(GO:0016667) |
0.0 | 0.0 | GO:0017153 | sodium:dicarboxylate symporter activity(GO:0017153) |
0.0 | 0.8 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
0.0 | 0.0 | GO:0030580 | C-methyltransferase activity(GO:0008169) 2-polyprenyl-6-methoxy-1,4-benzoquinone methyltransferase activity(GO:0008425) quinone cofactor methyltransferase activity(GO:0030580) |
0.0 | 0.1 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
0.0 | 0.1 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
0.0 | 0.3 | GO:0005546 | phosphatidylinositol-4,5-bisphosphate binding(GO:0005546) |
0.0 | 0.8 | GO:0008170 | N-methyltransferase activity(GO:0008170) |
0.0 | 0.0 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
0.0 | 0.3 | GO:0008378 | galactosyltransferase activity(GO:0008378) |
0.0 | 0.0 | GO:0016413 | O-acetyltransferase activity(GO:0016413) |
0.0 | 0.1 | GO:0033677 | DNA/RNA helicase activity(GO:0033677) |
0.0 | 0.1 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
0.0 | 0.2 | GO:0046977 | TAP binding(GO:0046977) |
0.0 | 0.1 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.0 | 1.2 | GO:0000149 | SNARE binding(GO:0000149) |
0.0 | 0.3 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.0 | 0.0 | GO:0098988 | G-protein coupled glutamate receptor activity(GO:0098988) |
0.0 | 1.7 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
0.0 | 0.2 | GO:0019843 | rRNA binding(GO:0019843) |
0.0 | 0.0 | GO:0001846 | opsonin binding(GO:0001846) |
0.0 | 0.0 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
0.0 | 0.5 | GO:0070063 | RNA polymerase binding(GO:0070063) |
0.0 | 0.1 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
0.0 | 0.2 | GO:0035198 | miRNA binding(GO:0035198) |
0.0 | 0.3 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
0.0 | 0.0 | GO:0051425 | PTB domain binding(GO:0051425) |
0.0 | 0.0 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
0.0 | 4.6 | GO:0005525 | GTP binding(GO:0005525) |
0.0 | 0.5 | GO:0016765 | transferase activity, transferring alkyl or aryl (other than methyl) groups(GO:0016765) |
0.0 | 0.2 | GO:0015166 | polyol transmembrane transporter activity(GO:0015166) |
0.0 | 0.2 | GO:0019789 | SUMO transferase activity(GO:0019789) |
0.0 | 0.0 | GO:0035240 | dopamine binding(GO:0035240) |
0.0 | 0.1 | GO:0015215 | nucleotide transmembrane transporter activity(GO:0015215) |
0.0 | 0.2 | GO:0043142 | single-stranded DNA-dependent ATPase activity(GO:0043142) |
0.0 | 1.3 | GO:0008234 | cysteine-type peptidase activity(GO:0008234) |
0.0 | 0.3 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.0 | 0.0 | GO:0031720 | haptoglobin binding(GO:0031720) |
0.0 | 0.1 | GO:0031628 | opioid receptor binding(GO:0031628) |
0.0 | 0.8 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
0.0 | 0.1 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.0 | 0.1 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
0.0 | 0.1 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
0.0 | 0.0 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.0 | 0.7 | GO:0002039 | p53 binding(GO:0002039) |
0.0 | 0.0 | GO:0051723 | protein methylesterase activity(GO:0051723) |
0.0 | 2.0 | GO:0008022 | protein C-terminus binding(GO:0008022) |
0.0 | 0.0 | GO:0016248 | channel inhibitor activity(GO:0016248) |
0.0 | 0.1 | GO:0031434 | mitogen-activated protein kinase kinase binding(GO:0031434) |
0.0 | 0.1 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.0 | 0.0 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
0.0 | 0.1 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
0.0 | 0.1 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
0.0 | 0.1 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
0.0 | 0.1 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
0.0 | 0.1 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
0.0 | 0.1 | GO:0034584 | piRNA binding(GO:0034584) |
0.0 | 3.1 | GO:0016881 | acid-amino acid ligase activity(GO:0016881) |
0.0 | 0.0 | GO:0036033 | mediator complex binding(GO:0036033) |
0.0 | 0.3 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
0.0 | 0.1 | GO:0034841 | acyl-CoA ligase activity(GO:0003996) succinate-CoA ligase activity(GO:0004774) 3-oxo-2-(2'-pentenyl)cyclopentane-1-octanoic acid CoA ligase activity(GO:0010435) 3-isopropenyl-6-oxoheptanoyl-CoA synthetase activity(GO:0018854) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA synthetase activity(GO:0018855) benzoyl acetate-CoA ligase activity(GO:0018856) 2,4-dichlorobenzoate-CoA ligase activity(GO:0018857) pivalate-CoA ligase activity(GO:0034783) cyclopropanecarboxylate-CoA ligase activity(GO:0034793) adipate-CoA ligase activity(GO:0034796) citronellyl-CoA ligase activity(GO:0034823) mentha-1,3-dione-CoA ligase activity(GO:0034841) thiophene-2-carboxylate-CoA ligase activity(GO:0034842) 2,4,4-trimethylpentanoate-CoA ligase activity(GO:0034865) cis-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034942) trans-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034943) branched-chain acyl-CoA synthetase (ADP-forming) activity(GO:0043759) aryl-CoA synthetase (ADP-forming) activity(GO:0043762) 3-hydroxypropionyl-CoA synthetase activity(GO:0043955) perillic acid:CoA ligase (ADP-forming) activity(GO:0052685) perillic acid:CoA ligase (AMP-forming) activity(GO:0052686) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (ADP-forming) activity(GO:0052687) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (AMP-forming) activity(GO:0052688) pristanate-CoA ligase activity(GO:0070251) malonyl-CoA synthetase activity(GO:0090409) |
0.0 | 0.1 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.0 | 0.1 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
0.0 | 0.0 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
0.0 | 0.0 | GO:0004645 | phosphorylase activity(GO:0004645) |
0.0 | 0.0 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.0 | 0.1 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
0.0 | 1.1 | GO:0061630 | ubiquitin protein ligase activity(GO:0061630) |
0.0 | 0.1 | GO:0004931 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.0 | 0.0 | GO:0038064 | collagen receptor activity(GO:0038064) |
0.0 | 0.1 | GO:0008494 | translation activator activity(GO:0008494) |
0.0 | 0.1 | GO:0017160 | Ral GTPase binding(GO:0017160) |
0.0 | 0.2 | GO:0003924 | GTPase activity(GO:0003924) |
0.0 | 0.1 | GO:0005522 | profilin binding(GO:0005522) |
0.0 | 0.1 | GO:0035671 | enone reductase activity(GO:0035671) |
0.0 | 0.0 | GO:0005534 | galactose binding(GO:0005534) |
0.0 | 0.1 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
0.0 | 0.0 | GO:0004376 | glycolipid mannosyltransferase activity(GO:0004376) |
0.0 | 0.1 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
0.0 | 0.1 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
0.0 | 0.1 | GO:0031210 | phosphatidylcholine binding(GO:0031210) |
0.0 | 0.1 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
0.0 | 0.2 | GO:0030276 | clathrin binding(GO:0030276) |
0.0 | 0.0 | GO:0043199 | sulfate binding(GO:0043199) |
0.0 | 0.0 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.0 | 0.1 | GO:0051393 | alpha-actinin binding(GO:0051393) |
0.0 | 0.0 | GO:0072341 | modified amino acid binding(GO:0072341) |
0.0 | 0.2 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
0.0 | 0.1 | GO:0042015 | interleukin-20 binding(GO:0042015) |
0.0 | 0.0 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
0.0 | 0.2 | GO:0005248 | voltage-gated sodium channel activity(GO:0005248) voltage-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1905030) |
0.0 | 3.5 | GO:0004674 | protein serine/threonine kinase activity(GO:0004674) |
0.0 | 0.1 | GO:0016891 | endoribonuclease activity, producing 5'-phosphomonoesters(GO:0016891) |
0.0 | 0.3 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
0.0 | 0.4 | GO:0043022 | ribosome binding(GO:0043022) |
0.0 | 0.1 | GO:0051861 | glycolipid binding(GO:0051861) |
0.0 | 0.0 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
0.0 | 0.0 | GO:0008474 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
0.0 | 0.0 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.0 | 0.2 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.0 | 0.0 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
0.0 | 0.0 | GO:0050543 | icosatetraenoic acid binding(GO:0050543) oleic acid binding(GO:0070538) |
0.0 | 0.0 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
0.0 | 1.2 | GO:0005244 | voltage-gated ion channel activity(GO:0005244) voltage-gated channel activity(GO:0022832) |
0.0 | 0.0 | GO:0017070 | U6 snRNA binding(GO:0017070) |
0.0 | 8.4 | GO:0044822 | poly(A) RNA binding(GO:0044822) |
0.0 | 0.0 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
0.0 | 0.3 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
0.0 | 0.0 | GO:0030572 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) |
0.0 | 0.3 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
0.0 | 0.1 | GO:0001848 | complement binding(GO:0001848) |
0.0 | 0.0 | GO:0048185 | activin binding(GO:0048185) |
0.0 | 0.2 | GO:0005186 | pheromone activity(GO:0005186) |
0.0 | 0.1 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.0 | 0.0 | GO:0004407 | histone deacetylase activity(GO:0004407) |
0.0 | 1.1 | GO:0004842 | ubiquitin-protein transferase activity(GO:0004842) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 0.5 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
0.3 | 0.3 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.2 | 3.4 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.2 | 5.0 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.2 | 0.4 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.2 | 0.2 | PID ERBB4 PATHWAY | ErbB4 signaling events |
0.1 | 1.0 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
0.1 | 0.9 | PID ARF6 PATHWAY | Arf6 signaling events |
0.1 | 1.1 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
0.1 | 1.1 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.1 | 3.5 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.1 | 3.4 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
0.1 | 1.0 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.1 | 0.5 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
0.1 | 4.3 | PID LKB1 PATHWAY | LKB1 signaling events |
0.1 | 0.5 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.1 | 5.9 | PID P73PATHWAY | p73 transcription factor network |
0.1 | 0.3 | PID S1P S1P4 PATHWAY | S1P4 pathway |
0.1 | 0.8 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
0.1 | 0.6 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
0.1 | 0.8 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
0.1 | 3.5 | SIG CHEMOTAXIS | Genes related to chemotaxis |
0.1 | 0.9 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.1 | 1.8 | PID AURORA A PATHWAY | Aurora A signaling |
0.1 | 0.9 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
0.1 | 0.8 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
0.1 | 0.2 | ST G ALPHA I PATHWAY | G alpha i Pathway |
0.1 | 0.1 | PID CD40 PATHWAY | CD40/CD40L signaling |
0.1 | 1.6 | PID ALK1 PATHWAY | ALK1 signaling events |
0.1 | 2.9 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
0.1 | 0.5 | PID IFNG PATHWAY | IFN-gamma pathway |
0.1 | 2.1 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
0.1 | 1.0 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
0.1 | 0.5 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.1 | 1.0 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.1 | 0.6 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
0.1 | 3.8 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
0.1 | 0.6 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
0.1 | 1.4 | PID BARD1 PATHWAY | BARD1 signaling events |
0.1 | 0.8 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.1 | 0.3 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.1 | 0.2 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.1 | 1.3 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.0 | 1.2 | PID AURORA B PATHWAY | Aurora B signaling |
0.0 | 1.4 | PID CDC42 PATHWAY | CDC42 signaling events |
0.0 | 0.6 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.0 | 1.2 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
0.0 | 1.2 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
0.0 | 0.6 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.0 | 0.3 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.0 | 0.0 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
0.0 | 0.4 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.0 | 0.6 | PID ATM PATHWAY | ATM pathway |
0.0 | 0.5 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
0.0 | 0.2 | PID IL1 PATHWAY | IL1-mediated signaling events |
0.0 | 1.2 | NABA COLLAGENS | Genes encoding collagen proteins |
0.0 | 0.5 | PID MYC PATHWAY | C-MYC pathway |
0.0 | 0.3 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.0 | 0.1 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
0.0 | 0.6 | ST INTEGRIN SIGNALING PATHWAY | Integrin Signaling Pathway |
0.0 | 0.8 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.0 | 0.2 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.0 | 0.0 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
0.0 | 0.4 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
0.0 | 0.8 | PID P53 REGULATION PATHWAY | p53 pathway |
0.0 | 0.3 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
0.0 | 0.6 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.0 | 0.1 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.0 | 0.3 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
0.0 | 1.6 | WNT SIGNALING | Genes related to Wnt-mediated signal transduction |
0.0 | 0.2 | PID IL27 PATHWAY | IL27-mediated signaling events |
0.0 | 0.4 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.0 | 0.1 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.0 | 0.2 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.0 | 0.3 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.0 | 0.2 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
0.0 | 0.4 | PID ARF 3PATHWAY | Arf1 pathway |
0.0 | 0.4 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
0.0 | 0.0 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
0.0 | 0.2 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
0.0 | 0.4 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
0.0 | 0.7 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
0.0 | 0.5 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
0.0 | 0.3 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
0.0 | 0.1 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.0 | 0.1 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
0.0 | 0.2 | PID ATR PATHWAY | ATR signaling pathway |
0.0 | 0.4 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.0 | 0.3 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
0.0 | 0.4 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
0.0 | 0.0 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
0.0 | 0.4 | PID BCR 5PATHWAY | BCR signaling pathway |
0.0 | 0.2 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.0 | 0.4 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.0 | 0.0 | PID S1P S1P3 PATHWAY | S1P3 pathway |
0.0 | 0.2 | PID RAC1 PATHWAY | RAC1 signaling pathway |
0.0 | 0.3 | PID MTOR 4PATHWAY | mTOR signaling pathway |
0.0 | 0.3 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
0.0 | 0.0 | PID IL23 PATHWAY | IL23-mediated signaling events |
0.0 | 0.1 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.0 | 0.2 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
0.0 | 0.1 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.0 | 0.4 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
0.0 | 0.1 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 0.5 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
0.2 | 4.9 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.2 | 2.1 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.2 | 3.8 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS | Genes involved in Synthesis of bile acids and bile salts |
0.2 | 1.2 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
0.2 | 0.4 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
0.2 | 0.2 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.2 | 3.3 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
0.2 | 1.7 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.2 | 2.4 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.2 | 0.2 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
0.2 | 2.5 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
0.2 | 1.6 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
0.2 | 0.2 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
0.2 | 1.4 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.2 | 2.4 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
0.1 | 1.5 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
0.1 | 1.0 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
0.1 | 2.3 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.1 | 0.1 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.1 | 0.4 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
0.1 | 1.1 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.1 | 2.3 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.1 | 0.4 | REACTOME INHIBITION OF THE PROTEOLYTIC ACTIVITY OF APC C REQUIRED FOR THE ONSET OF ANAPHASE BY MITOTIC SPINDLE CHECKPOINT COMPONENTS | Genes involved in Inhibition of the proteolytic activity of APC/C required for the onset of anaphase by mitotic spindle checkpoint components |
0.1 | 1.4 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.1 | 1.2 | REACTOME ACTIVATION OF IRF3 IRF7 MEDIATED BY TBK1 IKK EPSILON | Genes involved in Activation of IRF3/IRF7 mediated by TBK1/IKK epsilon |
0.1 | 1.9 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.1 | 1.9 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
0.1 | 1.3 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.1 | 0.2 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
0.1 | 0.3 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
0.1 | 1.1 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.1 | 0.4 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
0.1 | 1.9 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
0.1 | 0.3 | REACTOME ACTIVATION OF KAINATE RECEPTORS UPON GLUTAMATE BINDING | Genes involved in Activation of Kainate Receptors upon glutamate binding |
0.1 | 0.3 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.1 | 2.0 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
0.1 | 0.7 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
0.1 | 2.5 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.1 | 1.3 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.1 | 0.3 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
0.1 | 1.1 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.1 | 0.3 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.1 | 0.2 | REACTOME NRIF SIGNALS CELL DEATH FROM THE NUCLEUS | Genes involved in NRIF signals cell death from the nucleus |
0.1 | 2.9 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
0.1 | 0.4 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
0.1 | 13.5 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
0.1 | 0.7 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
0.1 | 1.3 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
0.1 | 1.5 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
0.1 | 1.1 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.1 | 0.4 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
0.1 | 0.9 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.1 | 0.8 | REACTOME N GLYCAN TRIMMING IN THE ER AND CALNEXIN CALRETICULIN CYCLE | Genes involved in N-glycan trimming in the ER and Calnexin/Calreticulin cycle |
0.1 | 0.7 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.1 | 0.3 | REACTOME BILE ACID AND BILE SALT METABOLISM | Genes involved in Bile acid and bile salt metabolism |
0.1 | 0.3 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
0.1 | 0.7 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
0.1 | 0.9 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
0.1 | 1.0 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
0.1 | 0.9 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
0.1 | 2.2 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
0.1 | 0.5 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
0.1 | 0.5 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.1 | 0.6 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
0.1 | 0.9 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
0.1 | 1.5 | REACTOME KINESINS | Genes involved in Kinesins |
0.1 | 0.9 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.1 | 0.8 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.1 | 0.5 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
0.1 | 1.0 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
0.1 | 0.2 | REACTOME LATE PHASE OF HIV LIFE CYCLE | Genes involved in Late Phase of HIV Life Cycle |
0.1 | 0.9 | REACTOME AUTODEGRADATION OF CDH1 BY CDH1 APC C | Genes involved in Autodegradation of Cdh1 by Cdh1:APC/C |
0.1 | 0.1 | REACTOME ADP SIGNALLING THROUGH P2RY1 | Genes involved in ADP signalling through P2Y purinoceptor 1 |
0.1 | 0.8 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
0.1 | 0.3 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
0.1 | 0.7 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
0.1 | 2.0 | REACTOME MRNA 3 END PROCESSING | Genes involved in mRNA 3'-end processing |
0.1 | 0.4 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
0.1 | 0.8 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.1 | 1.4 | REACTOME PHASE II CONJUGATION | Genes involved in Phase II conjugation |
0.1 | 1.0 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
0.1 | 0.6 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.1 | 0.1 | REACTOME TRANSPORT OF MATURE TRANSCRIPT TO CYTOPLASM | Genes involved in Transport of Mature Transcript to Cytoplasm |
0.1 | 0.8 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.1 | 1.2 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
0.1 | 1.5 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
0.1 | 0.3 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
0.1 | 0.6 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
0.1 | 0.3 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
0.1 | 3.2 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
0.1 | 0.3 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
0.1 | 0.3 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
0.1 | 1.2 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
0.1 | 0.4 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
0.0 | 1.8 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
0.0 | 0.4 | REACTOME LIPOPROTEIN METABOLISM | Genes involved in Lipoprotein metabolism |
0.0 | 0.1 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
0.0 | 0.5 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.0 | 0.5 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
0.0 | 0.8 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
0.0 | 0.5 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.0 | 0.0 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF CAMKII | Genes involved in CREB phosphorylation through the activation of CaMKII |
0.0 | 0.8 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
0.0 | 0.5 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
0.0 | 0.2 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
0.0 | 0.4 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
0.0 | 0.3 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.0 | 1.1 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
0.0 | 0.4 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
0.0 | 0.4 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
0.0 | 0.6 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
0.0 | 0.0 | REACTOME CYCLIN E ASSOCIATED EVENTS DURING G1 S TRANSITION | Genes involved in Cyclin E associated events during G1/S transition |
0.0 | 1.2 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
0.0 | 0.8 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
0.0 | 0.2 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.0 | 0.3 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
0.0 | 0.5 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
0.0 | 0.4 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.0 | 0.6 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
0.0 | 0.7 | REACTOME APOPTOTIC CLEAVAGE OF CELLULAR PROTEINS | Genes involved in Apoptotic cleavage of cellular proteins |
0.0 | 0.7 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.0 | 0.5 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
0.0 | 0.4 | REACTOME RNA POL III CHAIN ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
0.0 | 0.4 | REACTOME NUCLEAR EVENTS KINASE AND TRANSCRIPTION FACTOR ACTIVATION | Genes involved in Nuclear Events (kinase and transcription factor activation) |
0.0 | 0.5 | REACTOME DEADENYLATION DEPENDENT MRNA DECAY | Genes involved in Deadenylation-dependent mRNA decay |
0.0 | 0.3 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
0.0 | 0.3 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
0.0 | 2.5 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
0.0 | 1.3 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.0 | 0.3 | REACTOME CD28 DEPENDENT PI3K AKT SIGNALING | Genes involved in CD28 dependent PI3K/Akt signaling |
0.0 | 0.3 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.0 | 0.2 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
0.0 | 0.2 | REACTOME PROTEIN FOLDING | Genes involved in Protein folding |
0.0 | 0.3 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
0.0 | 0.2 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
0.0 | 0.1 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.0 | 0.3 | REACTOME TGF BETA RECEPTOR SIGNALING ACTIVATES SMADS | Genes involved in TGF-beta receptor signaling activates SMADs |
0.0 | 1.0 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
0.0 | 0.3 | REACTOME LIPID DIGESTION MOBILIZATION AND TRANSPORT | Genes involved in Lipid digestion, mobilization, and transport |
0.0 | 0.3 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
0.0 | 0.5 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
0.0 | 3.1 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
0.0 | 0.8 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.0 | 0.1 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
0.0 | 1.2 | REACTOME MITOTIC G2 G2 M PHASES | Genes involved in Mitotic G2-G2/M phases |
0.0 | 0.1 | REACTOME REGULATION OF WATER BALANCE BY RENAL AQUAPORINS | Genes involved in Regulation of Water Balance by Renal Aquaporins |
0.0 | 0.3 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.0 | 0.1 | REACTOME TAK1 ACTIVATES NFKB BY PHOSPHORYLATION AND ACTIVATION OF IKKS COMPLEX | Genes involved in TAK1 activates NFkB by phosphorylation and activation of IKKs complex |
0.0 | 0.8 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
0.0 | 0.1 | REACTOME GRB2 SOS PROVIDES LINKAGE TO MAPK SIGNALING FOR INTERGRINS | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
0.0 | 1.3 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
0.0 | 0.0 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
0.0 | 0.2 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
0.0 | 0.3 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
0.0 | 0.2 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
0.0 | 0.3 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
0.0 | 1.8 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
0.0 | 0.0 | REACTOME NEUROTRANSMITTER RECEPTOR BINDING AND DOWNSTREAM TRANSMISSION IN THE POSTSYNAPTIC CELL | Genes involved in Neurotransmitter Receptor Binding And Downstream Transmission In The Postsynaptic Cell |
0.0 | 0.1 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
0.0 | 0.2 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
0.0 | 0.3 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
0.0 | 0.0 | REACTOME BOTULINUM NEUROTOXICITY | Genes involved in Botulinum neurotoxicity |
0.0 | 0.7 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.0 | 0.0 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
0.0 | 0.7 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
0.0 | 0.0 | REACTOME NEF MEDIATES DOWN MODULATION OF CELL SURFACE RECEPTORS BY RECRUITING THEM TO CLATHRIN ADAPTERS | Genes involved in Nef-mediates down modulation of cell surface receptors by recruiting them to clathrin adapters |
0.0 | 0.1 | REACTOME MAPK TARGETS NUCLEAR EVENTS MEDIATED BY MAP KINASES | Genes involved in MAPK targets/ Nuclear events mediated by MAP kinases |
0.0 | 0.3 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.0 | 0.4 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
0.0 | 0.1 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
0.0 | 0.1 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
0.0 | 0.1 | REACTOME MRNA PROCESSING | Genes involved in mRNA Processing |
0.0 | 1.6 | REACTOME PEPTIDE LIGAND BINDING RECEPTORS | Genes involved in Peptide ligand-binding receptors |